merge of '5fdf69ca60d1683cdd9f4c2595134bed26394834'

and '6b61c50f4cf888bea302ac8fcf5dbb573b443251'

--HG--
extra : convert_revision : b1dd3b94e60a07a176dba2b035ac79968595990a

CHANGES

@@ -1,3 +1,85 @@
+0.49 - Tues 13 June 2003
+
+- Return immediately for "sleep 10 & echo foo", rather than waiting
+  for the sleep to return (pointed out by Rob Landley)
+
+- Added -P pidfile argument to the server (from Swen Schillig)
+
+- Compile fixes, make sure that all variable definitions are at the start
+  of a scope.
+
+- Use $HOME in preference to that from /etc/passwd, so that it
+  dbclient can still work on systems with a broken setup.
+
+- Add -N dbclient option for "no command"
+
+- Add -f dbclient option for "background after auth"
+
+- Try to finally fix ss_family compilation problems
+
+0.48.1 - Sat 11 March 2006
+
+- Compile fix for scp
+
+0.48 - Thurs 9 March 2006
+
+- Check that the circular buffer is properly empty before
+  closing a channel, which could cause truncated transfers
+  (thanks to Tomas Vanek for helping track it down)
+
+- Implement per-IP pre-authentication connection limits 
+  (after some poking from Pablo Fernandez)
+
+- Exit gracefully if trying to connect to as SSH v1 server 
+  (reported by Rushi Lala)
+
+- Only read /dev/random once at startup when in non-inetd mode
+
+- Allow ctrl-c to close a dbclient password prompt (may
+  still have to press enter on some platforms)
+
+- Merged in uClinux patch for inetd mode
+
+- Updated to scp from OpenSSH 4.3p2 - fixes a security issue
+  where use of system() could cause users to execute arbitrary
+  code through malformed filenames, ref CVE-2006-0225
+
+0.47 - Thurs Dec 8 2005
+
+- SECURITY: fix for buffer allocation error in server code, could potentially
+  allow authenticated users to gain elevated privileges. All multi-user systems
+  running the server should upgrade (or apply the patch available on the
+  Dropbear webpage).
+
+- Fix channel handling code so that redirecting to /dev/null doesn't use
+  100% CPU.
+
+- Turn on zlib compression for dbclient.
+
+- Set "low delay" TOS bit, can significantly improve interactivity
+  over some links.
+
+- Added client keyboard-interactive mode support, allows operation with
+  newer OpenSSH servers in default config.
+
+- Log when pubkey auth fails because of bad ~/.ssh/authorized_keys permissions
+
+- Improve logging of assertions
+
+- Added aes-256 cipher and sha1-96 hmac.
+
+- Fix twofish so that it actually works.
+
+- Improve PAM prompt comparison.
+
+- Added -g (dbclient) and -a (dropbear server) options to allow
+  connections to listening forwarded ports from remote machines.
+
+- Various other minor fixes
+
+- Compile fixes for glibc 2.1 (ss_family vs __ss_family) and NetBSD
+  (netinet/in_systm.h needs to be included).
+
 0.46 - Sat July 9 2005
 
 - Fix long-standing bug which caused connections to be closed if an ssh-agent

LICENSE

@@ -8,7 +8,7 @@ The majority of code is written by Matt Johnston, under the license below.
 Portions of the client-mode work are (c) 2004 Mihnea Stoenescu, under the
 same license:
 
-Copyright (c) 2002-2004 Matt Johnston
+Copyright (c) 2002-2006 Matt Johnston
 Portions copyright (c) 2004 Mihnea Stoenescu
 All rights reserved.
 

Makefile.in

@@ -64,12 +64,12 @@ bindir=${exec_prefix}/bin
 sbindir=${exec_prefix}/sbin
 
 CC=@CC@
-LD=@LD@
 AR=@AR@
 RANLIB=@RANLIB@
 STRIP=@STRIP@
 INSTALL=@INSTALL@
-CFLAGS=-I. -I$(srcdir)/libtomcrypt/src/headers/ @CFLAGS@
+CPPFLAGS=@CPPFLAGS@
+CFLAGS=-I. -I$(srcdir) -I$(srcdir)/libtomcrypt/src/headers/ $(CPPFLAGS) @CFLAGS@
 LIBS=$(LTC) $(LTM) @LIBS@
 LDFLAGS=@LDFLAGS@
 
@@ -155,11 +155,11 @@ dropbearconvert: $(dropbearconvertobjs)
 
 dropbear dbclient dropbearkey dropbearconvert: $(HEADERS)  $(LTC) $(LTM) \
 													Makefile
-	$(LD) $(LDFLAGS) -o $@$(EXEEXT) $($@objs) $(LIBS)
+	$(CC) $(LDFLAGS) -o $@$(EXEEXT) $($@objs) $(LIBS)
 
 # scp doesn't use the libs so is special.
 scp: $(SCPOBJS)  $(HEADERS) Makefile
-	$(LD) $(LDFLAGS) -o $@$(EXEEXT) $(SCPOBJS)
+	$(CC) $(LDFLAGS) -o $@$(EXEEXT) $(SCPOBJS)
 
 
 # multi-binary compilation.
@@ -172,7 +172,7 @@ endif
 dropbearmulti: multilink 
 
 multibinary: $(HEADERS) $(MULTIOBJS) $(LTC) $(LTM) Makefile
-	$(LD) $(LDFLAGS) -o dropbearmulti$(EXEEXT) $(MULTIOBJS) $(LIBS)
+	$(CC) $(LDFLAGS) -o dropbearmulti$(EXEEXT) $(MULTIOBJS) $(LIBS)
 
 multilink: multibinary $(addprefix link, $(PROGRAMS))
 
@@ -186,6 +186,8 @@ $(LTC): options.h
 $(LTM): options.h
 	cd libtommath && $(MAKE)
 
+.PHONY : clean sizes thisclean distclean tidy ltc-clean ltm-clean
+
 ltc-clean:
 	cd libtomcrypt && $(MAKE) clean
 

README

@@ -25,7 +25,7 @@ the key entries in that file. They should be of the form:
 ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAIEAwVa6M6cGVmUcLl2cFzkxEoJd06Ub4bVDsYrWvXhvUV+ZAM9uGuewZBDoAqNKJxoIn0Hyd0Nk/yU99UVv6NWV/5YSHtnf35LKds56j7cuzoQpFIdjNwdxAN0PCET/MG8qyskG/2IE2DPNIaJ3Wy+Ws4IZEgdJgPlTYUBWWtCWOGc= someone@hostname
 
 You must make sure that ~/.ssh, and the key file, are only writable by the
-user.
+user. Beware of editors that split the key into multiple lines.
 
 NOTE: Dropbear ignores authorized_keys options such as those described in the
 OpenSSH sshd manpage, and will not allow a login for these keys. 

TODO

@@ -6,8 +6,6 @@ Things which might need doing:
 
 - Make options.h generated from configure perhaps?
 
-- Improved queueing of unauthed connections
-
 - handle /etc/environment in AIX
 
 - check that there aren't timing issues with valid/invalid user authentication
@@ -15,7 +13,6 @@ Things which might need doing:
 
 - Binding to different interfaces
 
-- check PRNG
 - CTR mode
 - SSH_MSG_IGNORE sending to improve CBC security
 - DH Group Exchange possibly, or just add group14 (whatever it's called today)

auth.h

@@ -52,6 +52,7 @@ void cli_pubkeyfail();
 void cli_auth_password();
 int cli_auth_pubkey();
 void cli_auth_interactive();
+char* getpass_or_cancel(char* prompt);
 
 
 #define MAX_USERNAME_LEN 25 /* arbitrary for the moment */

cli-auth.c

@@ -236,8 +236,8 @@ void recv_msg_userauth_success() {
 
 void cli_auth_try() {
 
-	TRACE(("enter cli_auth_try"))
 	int finished = 0;
+	TRACE(("enter cli_auth_try"))
 
 	CHECKCLEARTOWRITE();
 	
@@ -278,3 +278,18 @@ void cli_auth_try() {
 
 	TRACE(("leave cli_auth_try"))
 }
+
+/* A helper for getpass() that exits if the user cancels. The returned
+ * password is statically allocated by getpass() */
+char* getpass_or_cancel(char* prompt)
+{
+	char* password = NULL;
+
+	password = getpass(prompt);
+
+	/* 0x03 is a ctrl-c character in the buffer. */
+	if (password == NULL || strchr(password, '\3') != NULL) {
+		dropbear_close("Interrupted.");
+	}
+	return password;
+}

cli-authinteract.c

@@ -99,13 +99,14 @@ void recv_msg_userauth_info_request() {
 	if (strlen(name) > 0) {
 		cleantext(name);
 		fprintf(stderr, "%s", name);
-		m_free(name);
 	}
+	m_free(name);
+
 	if (strlen(instruction) > 0) {
 		cleantext(instruction);
 		fprintf(stderr, "%s", instruction);
-		m_free(instruction);
 	}
+	m_free(instruction);
 
 	for (i = 0; i < num_prompts; i++) {
 		unsigned int response_len = 0;
@@ -115,7 +116,7 @@ void recv_msg_userauth_info_request() {
 		echo = buf_getbool(ses.payload);
 
 		if (!echo) {
-			unsigned char* p = getpass(prompt);
+			unsigned char* p = getpass_or_cancel(prompt);
 			response = m_strdup(p);
 			m_burn(p, strlen(p));
 		} else {

cli-authpasswd.c

@@ -116,19 +116,19 @@ static char *gui_getpass(const char *prompt) {
 void cli_auth_password() {
 
 	char* password = NULL;
+	char prompt[80];
 
 	TRACE(("enter cli_auth_password"))
 	CHECKCLEARTOWRITE();
 
+	snprintf(prompt, sizeof(prompt), "%s@%s's password: ", 
+				cli_opts.username, cli_opts.remotehost);
 #ifdef ENABLE_CLI_ASKPASS_HELPER
 	if (want_askpass())
-		password = gui_getpass("Password: ");
+		password = gui_getpass(prompt);
 	else
 #endif
-		password = getpass("Password: ");
-
-	if (password == NULL)
-		return 0;
+		password = getpass_or_cancel(prompt);
 
 	buf_putbyte(ses.writepayload, SSH_MSG_USERAUTH_REQUEST);
 

cli-authpubkey.c

@@ -112,6 +112,7 @@ void recv_msg_userauth_pk_ok() {
 		/* Success */
 		break;
 	}
+	buf_free(keybuf);
 
 	if (keyitem != NULL) {
 		TRACE(("matching key"))

cli-chansession.c

@@ -162,8 +162,6 @@ void cli_tty_cleanup() {
 
 static void put_termcodes() {
 
-	TRACE(("enter put_termcodes"))
-
 	struct termios tio;
 	unsigned int sshcode;
 	const struct TermCode *termcode;
@@ -172,6 +170,8 @@ static void put_termcodes() {
 
 	unsigned int bufpos1, bufpos2;
 
+	TRACE(("enter put_termcodes"))
+
 	if (tcgetattr(STDIN_FILENO, &tio) == -1) {
 		dropbear_log(LOG_WARNING, "Failed reading termmodes");
 		buf_putint(ses.writepayload, 1); /* Just the terminator */

cli-kex.c

@@ -122,6 +122,7 @@ static void ask_to_confirm(unsigned char* keyblob, unsigned int keybloblen) {
 	fprintf(stderr, "\nHost '%s' is not in the trusted hosts file.\n(fingerprint %s)\nDo you want to continue connecting? (y/n)\n", 
 			cli_opts.remotehost, 
 			fp);
+	m_free(fp);
 
 	tty = fopen(_PATH_TTY, "r");
 	if (tty) {
@@ -132,7 +133,6 @@ static void ask_to_confirm(unsigned char* keyblob, unsigned int keybloblen) {
 	}
 
 	if (response == 'y') {
-		m_free(fp);
 		return;
 	}
 
@@ -145,49 +145,59 @@ static void checkhostkey(unsigned char* keyblob, unsigned int keybloblen) {
 	FILE *hostsfile = NULL;
 	int readonly = 0;
 	struct passwd *pw = NULL;
+	char * homedir = NULL;
 	unsigned int hostlen, algolen;
 	unsigned long len;
 	const char *algoname = NULL;
 	buffer * line = NULL;
 	int ret;
 	
-	pw = getpwuid(getuid());
+	homedir = getenv("HOME");
 
-	if (pw == NULL) {
-		dropbear_exit("Failed to get homedir");
-	}
-
-	len = strlen(pw->pw_dir);
-	filename = m_malloc(len + 18); /* "/.ssh/known_hosts" and null-terminator*/
-
-	snprintf(filename, len+18, "%s/.ssh", pw->pw_dir);
-	/* Check that ~/.ssh exists - easiest way is just to mkdir */
-	if (mkdir(filename, S_IRWXU) != 0) {
-		if (errno != EEXIST) {
-			dropbear_log(LOG_INFO, "Warning: failed creating ~/.ssh: %s",
-					strerror(errno));
-			TRACE(("mkdir didn't work: %s", strerror(errno)))
-			ask_to_confirm(keyblob, keybloblen);
-			goto out; /* only get here on success */
+	if (!homedir) {
+		pw = getpwuid(getuid());
+		if (pw) {
+			homedir = pw->pw_dir;
 		}
+		pw = NULL;
 	}
 
-	snprintf(filename, len+18, "%s/.ssh/known_hosts", pw->pw_dir);
-	hostsfile = fopen(filename, "a+");
-	
-	if (hostsfile != NULL) {
-		fseek(hostsfile, 0, SEEK_SET);
-	} else {
-		/* We mightn't have been able to open it if it was read-only */
-		if (errno == EACCES || errno == EROFS) {
-				TRACE(("trying readonly: %s", strerror(errno)))
-				readonly = 1;
-				hostsfile = fopen(filename, "r");
+	if (homedir) {
+
+		len = strlen(homedir);
+		filename = m_malloc(len + 18); /* "/.ssh/known_hosts" and null-terminator*/
+
+		snprintf(filename, len+18, "%s/.ssh", homedir);
+		/* Check that ~/.ssh exists - easiest way is just to mkdir */
+		if (mkdir(filename, S_IRWXU) != 0) {
+			if (errno != EEXIST) {
+				dropbear_log(LOG_INFO, "Warning: failed creating %s/.ssh: %s",
+						homedir, strerror(errno));
+				TRACE(("mkdir didn't work: %s", strerror(errno)))
+				ask_to_confirm(keyblob, keybloblen);
+				goto out; /* only get here on success */
+			}
+		}
+
+		snprintf(filename, len+18, "%s/.ssh/known_hosts", homedir);
+		hostsfile = fopen(filename, "a+");
+		
+		if (hostsfile != NULL) {
+			fseek(hostsfile, 0, SEEK_SET);
+		} else {
+			/* We mightn't have been able to open it if it was read-only */
+			if (errno == EACCES || errno == EROFS) {
+					TRACE(("trying readonly: %s", strerror(errno)))
+					readonly = 1;
+					hostsfile = fopen(filename, "r");
+			}
 		}
 	}
 
 	if (hostsfile == NULL) {
 		TRACE(("hostsfile didn't open: %s", strerror(errno)))
+		dropbear_log(LOG_WARNING, "Failed to open %s/.ssh/known_hosts",
+				homedir);
 		ask_to_confirm(keyblob, keybloblen);
 		goto out; /* We only get here on success */
 	}

cli-runopts.c

@@ -44,12 +44,14 @@ static void addforward(char* str, struct TCPFwdList** fwdlist);
 static void printhelp() {
 
 	fprintf(stderr, "Dropbear client v%s\n"
-					"Usage: %s [options] [user@]host\n"
+					"Usage: %s [options] [user@]host [command]\n"
 					"Options are:\n"
 					"-p <remoteport>\n"
 					"-l <username>\n"
 					"-t    Allocate a pty\n"
 					"-T    Don't allocate a pty\n"
+					"-N    Don't run a remote command\n"
+					"-f    Run in background after auth\n"
 #ifdef ENABLE_CLI_PUBKEY_AUTH
 					"-i <identityfile>   (multiple allowed)\n"
 #endif
@@ -88,6 +90,8 @@ void cli_getopts(int argc, char ** argv) {
 	cli_opts.remoteport = NULL;
 	cli_opts.username = NULL;
 	cli_opts.cmd = NULL;
+	cli_opts.no_cmd = 0;
+	cli_opts.backgrounded = 0;
 	cli_opts.wantpty = 9; /* 9 means "it hasn't been touched", gets set later */
 #ifdef ENABLE_CLI_PUBKEY_AUTH
 	cli_opts.privkeys = NULL;
@@ -163,6 +167,12 @@ void cli_getopts(int argc, char ** argv) {
 				case 'T': /* don't want a pty */
 					cli_opts.wantpty = 0;
 					break;
+				case 'N':
+					cli_opts.no_cmd = 1;
+					break;
+				case 'f':
+					cli_opts.backgrounded = 1;
+					break;
 #ifdef ENABLE_CLI_LOCALTCPFWD
 				case 'L':
 					nextislocal = 1;
@@ -269,6 +279,11 @@ void cli_getopts(int argc, char ** argv) {
 			cli_opts.wantpty = 0;
 		}
 	}
+
+	if (cli_opts.backgrounded && cli_opts.cmd == NULL
+			&& cli_opts.no_cmd == 0) {
+		dropbear_exit("command required for -f");
+	}
 }
 
 #ifdef ENABLE_CLI_PUBKEY_AUTH

cli-service.c

@@ -82,6 +82,4 @@ void recv_msg_service_accept() {
 	}
 
 	dropbear_exit("unrecognised service accept");
-	/* m_free(servicename); not reached */
-
 }

cli-session.c

@@ -76,12 +76,14 @@ static const struct ChanType *cli_chantypes[] = {
 
 void cli_session(int sock, char* remotehost) {
 
+	seedrandom();
+
 	crypto_init();
+
 	common_session_init(sock, remotehost);
 
 	chaninitialise(cli_chantypes);
 
-
 	/* Set up cli_ses vars */
 	cli_session_init();
 
@@ -91,12 +93,8 @@ void cli_session(int sock, char* remotehost) {
 	/* Exchange identification */
 	session_identification();
 
-	seedrandom();
-
 	send_msg_kexinit();
 
-	/* XXX here we do stuff differently */
-
 	session_loop(cli_sessionloop);
 
 	/* Not reached */
@@ -214,19 +212,38 @@ static void cli_sessionloop() {
 			*/
 
 		case USERAUTH_SUCCESS_RCVD:
+
+			if (cli_opts.backgrounded) {
+				int devnull;
+				// keeping stdin open steals input from the terminal and
+				// is confusing, though stdout/stderr could be useful.
+				devnull = open(_PATH_DEVNULL, O_RDONLY);
+				if (devnull < 0) {
+					dropbear_exit("opening /dev/null: %d %s",
+							errno, strerror(errno));
+				}
+				dup2(devnull, STDIN_FILENO);
+				if (daemon(0, 1) < 0) {
+					dropbear_exit("Backgrounding failed: %d %s", 
+							errno, strerror(errno));
+				}
+			}
+			
 #ifdef ENABLE_CLI_LOCALTCPFWD
 			setup_localtcp();
 #endif
 #ifdef ENABLE_CLI_REMOTETCPFWD
 			setup_remotetcp();
 #endif
-			cli_send_chansess_request();
-			TRACE(("leave cli_sessionloop: cli_send_chansess_request"))
+			if (!cli_opts.no_cmd) {
+				cli_send_chansess_request();
+			}
+			TRACE(("leave cli_sessionloop: running"))
 			cli_ses.state = SESSION_RUNNING;
 			return;
 
 		case SESSION_RUNNING:
-			if (ses.chancount < 1) {
+			if (ses.chancount < 1 && !cli_opts.no_cmd) {
 				cli_finished();
 			}
 

common-channel.c

@@ -181,7 +181,6 @@ void channelio(fd_set *readfds, fd_set *writefds) {
 
 	struct Channel *channel;
 	unsigned int i;
-	int ret;
 
 	/* iterate through all the possible channels */
 	for (i = 0; i < ses.chansize; i++) {
@@ -237,7 +236,7 @@ static void checkclose(struct Channel *channel) {
 	TRACE(("checkclose: writefd %d, readfd %d, errfd %d, sentclosed %d, recvclosed %d",
 				channel->writefd, channel->readfd,
 				channel->errfd, channel->sentclosed, channel->recvclosed))
-	TRACE(("writebuf %d extrabuf %s extrabuf %d",
+	TRACE(("writebuf size %d extrabuf ptr 0x%x extrabuf size %d",
 				cbuf_getused(channel->writebuf),
 				channel->writebuf,
 				channel->writebuf ? 0 : cbuf_getused(channel->extrabuf)))
@@ -377,7 +376,7 @@ static void writechannel(struct Channel* channel, int fd, circbuffer *cbuf) {
 	cbuf_incrread(cbuf, len);
 	channel->recvdonelen += len;
 
-	if (fd == channel->writefd && len == maxlen && channel->recveof) { 
+	if (fd == channel->writefd && cbuf_getused(cbuf) == 0 && channel->recveof) { 
 		/* Check if we're closing up */
 		closewritefd(channel);
 		TRACE(("leave writechannel: recveof set"))

common-kex.c

@@ -262,6 +262,7 @@ void gen_new_keys() {
 	hash_state hs;
 	unsigned int C2S_keysize, S2C_keysize;
 	char mactransletter, macrecvletter; /* Client or server specific */
+	int recv_cipher = 0, trans_cipher = 0;
 
 	TRACE(("enter gen_new_keys"))
 	/* the dh_K and hash are the start of all hashes, we make use of that */
@@ -298,17 +299,20 @@ void gen_new_keys() {
 	hashkeys(C2S_key, C2S_keysize, &hs, 'C');
 	hashkeys(S2C_key, S2C_keysize, &hs, 'D');
 
-	if (cbc_start(
-		find_cipher(ses.newkeys->recv_algo_crypt->cipherdesc->name),
-			recv_IV, recv_key, 
+	recv_cipher = find_cipher(ses.newkeys->recv_algo_crypt->cipherdesc->name);
+	if (recv_cipher < 0)
+	    dropbear_exit("crypto error");
+		
+	if (cbc_start(recv_cipher, recv_IV, recv_key, 
 			ses.newkeys->recv_algo_crypt->keysize, 0, 
 			&ses.newkeys->recv_symmetric_struct) != CRYPT_OK) {
 		dropbear_exit("crypto error");
 	}
-
-	if (cbc_start(
-		find_cipher(ses.newkeys->trans_algo_crypt->cipherdesc->name),
-			trans_IV, trans_key, 
+	trans_cipher = find_cipher(ses.newkeys->trans_algo_crypt->cipherdesc->name);
+	if (trans_cipher < 0)
+	    dropbear_exit("crypto error");
+		
+	if (cbc_start(trans_cipher, trans_IV, trans_key, 
 			ses.newkeys->trans_algo_crypt->keysize, 0, 
 			&ses.newkeys->trans_symmetric_struct) != CRYPT_OK) {
 		dropbear_exit("crypto error");
@@ -517,7 +521,7 @@ void kexdh_comb_key(mp_int *dh_pub_us, mp_int *dh_priv, mp_int *dh_pub_them,
 	hash_state hs;
 
 	/* read the prime and generator*/
-	mp_init(&dh_p);
+	m_mp_init(&dh_p);
 	bytes_to_mp(&dh_p, dh_p_val, DH_P_LEN);
 
 	/* Check that dh_pub_them (dh_e or dh_f) is in the range [1, p-1] */

common-session.c

@@ -229,13 +229,11 @@ void session_identification() {
 	/* write our version string, this blocks */
 	if (atomicio(write, ses.sock, LOCAL_IDENT "\r\n",
 				strlen(LOCAL_IDENT "\r\n")) == DROPBEAR_FAILURE) {
-		dropbear_exit("Error writing ident string");
+		ses.remoteclosed();
 	}
 
-	/* We allow up to 9 lines before the actual version string, to
-	 * account for wrappers/cruft etc. According to the spec only the client
-	 * needs to handle this, but no harm in letting the server handle it too */
-	for (i = 0; i < 10; i++) {
+    /* If they send more than 50 lines, something is wrong */
+	for (i = 0; i < 50; i++) {
 		len = ident_readln(ses.sock, linebuf, sizeof(linebuf));
 
 		if (len < 0 && errno != EINTR) {
@@ -252,13 +250,19 @@ void session_identification() {
 
 	if (!done) {
 		TRACE(("err: %s for '%s'\n", strerror(errno), linebuf))
-		dropbear_exit("Failed to get remote version");
+		ses.remoteclosed();
 	} else {
 		/* linebuf is already null terminated */
 		ses.remoteident = m_malloc(len);
 		memcpy(ses.remoteident, linebuf, len);
 	}
 
+    /* Shall assume that 2.x will be backwards compatible. */
+    if (strncmp(ses.remoteident, "SSH-2.", 6) != 0
+            && strncmp(ses.remoteident, "SSH-1.99-", 9) != 0) {
+        dropbear_exit("Incompatible remote version '%s'", ses.remoteident);
+    }
+
 	TRACE(("remoteident: %s", ses.remoteident))
 
 }

config.sub

@@ -1,9 +1,10 @@
 #! /bin/sh
 # Configuration validation subroutine script.
 #   Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999,
-#   2000, 2001, 2002, 2003 Free Software Foundation, Inc.
+#   2000, 2001, 2002, 2003, 2004, 2005, 2006 Free Software Foundation,
+#   Inc.
 
-timestamp='2003-05-09'
+timestamp='2007-01-18'
 
 # This file is (in principle) common to ALL GNU software.
 # The presence of a machine in this file suggests that SOME GNU software
@@ -21,14 +22,15 @@ timestamp='2003-05-09'
 #
 # You should have received a copy of the GNU General Public License
 # along with this program; if not, write to the Free Software
-# Foundation, Inc., 59 Temple Place - Suite 330,
-# Boston, MA 02111-1307, USA.
-
+# Foundation, Inc., 51 Franklin Street - Fifth Floor, Boston, MA
+# 02110-1301, USA.
+#
 # As a special exception to the GNU General Public License, if you
 # distribute this file as part of a program that contains a
 # configuration script generated by Autoconf, you may include it under
 # the same distribution terms that you use for the rest of that program.
 
+
 # Please send patches to <config-patches@gnu.org>.  Submit a context
 # diff and a properly formatted ChangeLog entry.
 #
@@ -70,7 +72,7 @@ Report bugs and patches to <config-patches@gnu.org>."
 version="\
 GNU config.sub ($timestamp)
 
-Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001
+Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, 2005
 Free Software Foundation, Inc.
 
 This is free software; see the source for copying conditions.  There is NO
@@ -83,11 +85,11 @@ Try \`$me --help' for more information."
 while test $# -gt 0 ; do
   case $1 in
     --time-stamp | --time* | -t )
-       echo "$timestamp" ; exit 0 ;;
+       echo "$timestamp" ; exit ;;
     --version | -v )
-       echo "$version" ; exit 0 ;;
+       echo "$version" ; exit ;;
     --help | --h* | -h )
-       echo "$usage"; exit 0 ;;
+       echo "$usage"; exit ;;
     -- )     # Stop option processing
        shift; break ;;
     - )	# Use stdin as input.
@@ -99,7 +101,7 @@ while test $# -gt 0 ; do
     *local*)
        # First pass through any local machine types.
        echo $1
-       exit 0;;
+       exit ;;
 
     * )
        break ;;
@@ -118,7 +120,9 @@ esac
 # Here we must recognize all the valid KERNEL-OS combinations.
 maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
 case $maybe_os in
-  nto-qnx* | linux-gnu* | freebsd*-gnu* | netbsd*-gnu* | storm-chaos* | os2-emx* | rtmk-nova*)
+  nto-qnx* | linux-gnu* | linux-dietlibc | linux-newlib* | linux-uclibc* | \
+  uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | knetbsd*-gnu* | netbsd*-gnu* | \
+  storm-chaos* | os2-emx* | rtmk-nova*)
     os=-$maybe_os
     basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
     ;;
@@ -144,7 +148,7 @@ case $os in
 	-convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
 	-c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
 	-harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
-	-apple | -axis)
+	-apple | -axis | -knuth | -cray)
 		os=
 		basic_machine=$1
 		;;
@@ -169,6 +173,10 @@ case $os in
 	-hiux*)
 		os=-hiuxwe2
 		;;
+	-sco6)
+		os=-sco5v6
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
 	-sco5)
 		os=-sco3.2v5
 		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
@@ -185,6 +193,10 @@ case $os in
 		# Don't forget version if it is 3.2v4 or newer.
 		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
 		;;
+	-sco5v6*)
+		# Don't forget version if it is 3.2v4 or newer.
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
 	-sco*)
 		os=-sco3.2v2
 		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
@@ -228,14 +240,17 @@ case $basic_machine in
 	| a29k \
 	| alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \
 	| alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \
-	| arc | arm | arm[bl]e | arme[lb] | armv[2345] | armv[345][lb] | avr \
-	| clipper \
+	| am33_2.0 \
+	| arc | arm | arm[bl]e | arme[lb] | armv[2345] | armv[345][lb] | avr | avr32 \
+	| bfin \
+	| c4x | clipper \
 	| d10v | d30v | dlx | dsp16xx \
-	| fr30 | frv \
+	| fido | fr30 | frv \
 	| h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \
 	| i370 | i860 | i960 | ia64 \
-	| ip2k \
-	| m32r | m68000 | m68k | m88k | mcore \
+	| ip2k | iq2000 \
+	| m32c | m32r | m32rle | m68000 | m68k | m88k \
+	| maxq | mb | microblaze | mcore | mep \
 	| mips | mipsbe | mipseb | mipsel | mipsle \
 	| mips16 \
 	| mips64 | mips64el \
@@ -244,27 +259,33 @@ case $basic_machine in
 	| mips64vr4100 | mips64vr4100el \
 	| mips64vr4300 | mips64vr4300el \
 	| mips64vr5000 | mips64vr5000el \
+	| mips64vr5900 | mips64vr5900el \
 	| mipsisa32 | mipsisa32el \
 	| mipsisa32r2 | mipsisa32r2el \
 	| mipsisa64 | mipsisa64el \
+	| mipsisa64r2 | mipsisa64r2el \
 	| mipsisa64sb1 | mipsisa64sb1el \
 	| mipsisa64sr71k | mipsisa64sr71kel \
 	| mipstx39 | mipstx39el \
 	| mn10200 | mn10300 \
+	| mt \
 	| msp430 \
+	| nios | nios2 \
 	| ns16k | ns32k \
-	| openrisc | or32 \
+	| or32 \
 	| pdp10 | pdp11 | pj | pjl \
 	| powerpc | powerpc64 | powerpc64le | powerpcle | ppcbe \
 	| pyramid \
-	| sh | sh[1234] | sh[23]e | sh[34]eb | shbe | shle | sh[1234]le | sh3ele \
+	| score \
+	| sh | sh[1234] | sh[24]a | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \
 	| sh64 | sh64le \
-	| sparc | sparc64 | sparc86x | sparclet | sparclite | sparcv9 | sparcv9b \
-	| strongarm \
-	| tahoe | thumb | tic80 | tron \
+	| sparc | sparc64 | sparc64b | sparc64v | sparc86x | sparclet | sparclite \
+	| sparcv8 | sparcv9 | sparcv9b | sparcv9v \
+	| spu | strongarm \
+	| tahoe | thumb | tic4x | tic80 | tron \
 	| v850 | v850e \
 	| we32k \
-	| x86 | xscale | xstormy16 | xtensa \
+	| x86 | xc16x | xscale | xscalee[bl] | xstormy16 | xtensa \
 	| z8k)
 		basic_machine=$basic_machine-unknown
 		;;
@@ -275,6 +296,9 @@ case $basic_machine in
 		;;
 	m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k)
 		;;
+	ms1)
+		basic_machine=mt-unknown
+		;;
 
 	# We use `pc' rather than `unknown'
 	# because (1) that's what they normally are, and
@@ -294,20 +318,20 @@ case $basic_machine in
 	| alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \
 	| alphapca5[67]-* | alpha64pca5[67]-* | arc-* \
 	| arm-*  | armbe-* | armle-* | armeb-* | armv*-* \
-	| avr-* \
-	| bs2000-* \
+	| avr-* | avr32-* \
+	| bfin-* | bs2000-* \
 	| c[123]* | c30-* | [cjt]90-* | c4x-* | c54x-* | c55x-* | c6x-* \
-	| clipper-* | cydra-* \
+	| clipper-* | craynv-* | cydra-* \
 	| d10v-* | d30v-* | dlx-* \
 	| elxsi-* \
-	| f30[01]-* | f700-* | fr30-* | frv-* | fx80-* \
+	| f30[01]-* | f700-* | fido-* | fr30-* | frv-* | fx80-* \
 	| h8300-* | h8500-* \
 	| hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \
 	| i*86-* | i860-* | i960-* | ia64-* \
-	| ip2k-* \
-	| m32r-* \
+	| ip2k-* | iq2000-* \
+	| m32c-* | m32r-* | m32rle-* \
 	| m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \
-	| m88110-* | m88k-* | mcore-* \
+	| m88110-* | m88k-* | maxq-* | mcore-* \
 	| mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \
 	| mips16-* \
 	| mips64-* | mips64el-* \
@@ -316,30 +340,36 @@ case $basic_machine in
 	| mips64vr4100-* | mips64vr4100el-* \
 	| mips64vr4300-* | mips64vr4300el-* \
 	| mips64vr5000-* | mips64vr5000el-* \
+	| mips64vr5900-* | mips64vr5900el-* \
 	| mipsisa32-* | mipsisa32el-* \
 	| mipsisa32r2-* | mipsisa32r2el-* \
 	| mipsisa64-* | mipsisa64el-* \
+	| mipsisa64r2-* | mipsisa64r2el-* \
 	| mipsisa64sb1-* | mipsisa64sb1el-* \
 	| mipsisa64sr71k-* | mipsisa64sr71kel-* \
 	| mipstx39-* | mipstx39el-* \
+	| mmix-* \
+	| mt-* \
 	| msp430-* \
-	| none-* | np1-* | nv1-* | ns16k-* | ns32k-* \
+	| nios-* | nios2-* \
+	| none-* | np1-* | ns16k-* | ns32k-* \
 	| orion-* \
 	| pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \
 	| powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* | ppcbe-* \
 	| pyramid-* \
 	| romp-* | rs6000-* \
-	| sh-* | sh[1234]-* | sh[23]e-* | sh[34]eb-* | shbe-* \
+	| sh-* | sh[1234]-* | sh[24]a-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \
 	| shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \
-	| sparc-* | sparc64-* | sparc86x-* | sparclet-* | sparclite-* \
-	| sparcv9-* | sparcv9b-* | strongarm-* | sv1-* | sx?-* \
+	| sparc-* | sparc64-* | sparc64b-* | sparc64v-* | sparc86x-* | sparclet-* \
+	| sparclite-* \
+	| sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | strongarm-* | sv1-* | sx?-* \
 	| tahoe-* | thumb-* \
 	| tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* \
 	| tron-* \
 	| v850-* | v850e-* | vax-* \
 	| we32k-* \
-	| x86-* | x86_64-* | xps100-* | xscale-* | xstormy16-* \
-	| xtensa-* \
+	| x86-* | x86_64-* | xc16x-* | xps100-* | xscale-* | xscalee[bl]-* \
+	| xstormy16-* | xtensa-* \
 	| ymp-* \
 	| z8k-*)
 		;;
@@ -359,6 +389,9 @@ case $basic_machine in
 		basic_machine=a29k-amd
 		os=-udi
 		;;
+    	abacus)
+		basic_machine=abacus-unknown
+		;;
 	adobe68k)
 		basic_machine=m68010-adobe
 		os=-scout
@@ -376,6 +409,9 @@ case $basic_machine in
 	amd64)
 		basic_machine=x86_64-pc
 		;;
+	amd64-*)
+		basic_machine=x86_64-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
 	amdahl)
 		basic_machine=580-amdahl
 		os=-sysv
@@ -435,12 +471,27 @@ case $basic_machine in
 		basic_machine=j90-cray
 		os=-unicos
 		;;
+	craynv)
+		basic_machine=craynv-cray
+		os=-unicosmp
+		;;
+	cr16c)
+		basic_machine=cr16c-unknown
+		os=-elf
+		;;
 	crds | unos)
 		basic_machine=m68k-crds
 		;;
+	crisv32 | crisv32-* | etraxfs*)
+		basic_machine=crisv32-axis
+		;;
 	cris | cris-* | etrax*)
 		basic_machine=cris-axis
 		;;
+	crx)
+		basic_machine=crx-unknown
+		os=-elf
+		;;
 	da30 | da30-*)
 		basic_machine=m68k-da30
 		;;
@@ -463,6 +514,10 @@ case $basic_machine in
 		basic_machine=m88k-motorola
 		os=-sysv3
 		;;
+	djgpp)
+		basic_machine=i586-pc
+		os=-msdosdjgpp
+		;;
 	dpx20 | dpx20-*)
 		basic_machine=rs6000-bull
 		os=-bosx
@@ -641,10 +696,6 @@ case $basic_machine in
 	mips3*)
 		basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
 		;;
-	mmix*)
-		basic_machine=mmix-knuth
-		os=-mmixware
-		;;
 	monitor)
 		basic_machine=m68k-rom68k
 		os=-coff
@@ -657,6 +708,9 @@ case $basic_machine in
 		basic_machine=i386-pc
 		os=-msdos
 		;;
+	ms1-*)
+		basic_machine=`echo $basic_machine | sed -e 's/ms1-/mt-/'`
+		;;
 	mvs)
 		basic_machine=i370-ibm
 		os=-mvs
@@ -725,10 +779,6 @@ case $basic_machine in
 	np1)
 		basic_machine=np1-gould
 		;;
-	nv1)
-		basic_machine=nv1-cray
-		os=-unicosmp
-		;;
 	nsr-tandem)
 		basic_machine=nsr-tandem
 		;;
@@ -736,9 +786,12 @@ case $basic_machine in
 		basic_machine=hppa1.1-oki
 		os=-proelf
 		;;
-	or32 | or32-*)
+	openrisc | openrisc-*)
 		basic_machine=or32-unknown
-		os=-coff
+		;;
+	os400)
+		basic_machine=powerpc-ibm
+		os=-os400
 		;;
 	OSE68000 | ose68000)
 		basic_machine=m68000-ericsson
@@ -765,24 +818,36 @@ case $basic_machine in
 	pc532 | pc532-*)
 		basic_machine=ns32k-pc532
 		;;
+	pc98)
+		basic_machine=i386-pc
+		;;
+	pc98-*)
+		basic_machine=i386-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
 	pentium | p5 | k5 | k6 | nexgen | viac3)
 		basic_machine=i586-pc
 		;;
 	pentiumpro | p6 | 6x86 | athlon | athlon_*)
 		basic_machine=i686-pc
 		;;
-	pentiumii | pentium2)
+	pentiumii | pentium2 | pentiumiii | pentium3)
 		basic_machine=i686-pc
 		;;
+	pentium4)
+		basic_machine=i786-pc
+		;;
 	pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*)
 		basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
 		;;
 	pentiumpro-* | p6-* | 6x86-* | athlon-*)
 		basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
 		;;
-	pentiumii-* | pentium2-*)
+	pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*)
 		basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
 		;;
+	pentium4-*)
+		basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
 	pn)
 		basic_machine=pn-gould
 		;;
@@ -815,6 +880,10 @@ case $basic_machine in
 		basic_machine=i586-unknown
 		os=-pw32
 		;;
+	rdos)
+		basic_machine=i386-pc
+		os=-rdos
+		;;
 	rom68k)
 		basic_machine=m68k-rom68k
 		os=-coff
@@ -841,6 +910,14 @@ case $basic_machine in
 	sb1el)
 		basic_machine=mipsisa64sb1el-unknown
 		;;
+	sde)
+		basic_machine=mipsisa32-sde
+		os=-elf
+		;;
+	sei)
+		basic_machine=mips-sei
+		os=-seiux
+		;;
 	sequent)
 		basic_machine=i386-sequent
 		;;
@@ -848,6 +925,12 @@ case $basic_machine in
 		basic_machine=sh-hitachi
 		os=-hms
 		;;
+	sh5el)
+		basic_machine=sh5le-unknown
+		;;
+	sh64)
+		basic_machine=sh64-unknown
+		;;
 	sparclite-wrs | simso-wrs)
 		basic_machine=sparclite-wrs
 		os=-vxworks
@@ -922,10 +1005,6 @@ case $basic_machine in
 		basic_machine=t90-cray
 		os=-unicos
 		;;
-        tic4x | c4x*)
-		basic_machine=tic4x-unknown
-		os=-coff
-		;;
 	tic54x | c54x*)
 		basic_machine=tic54x-unknown
 		os=-coff
@@ -951,6 +1030,10 @@ case $basic_machine in
 	tower | tower-32)
 		basic_machine=m68k-ncr
 		;;
+	tpf)
+		basic_machine=s390x-ibm
+		os=-tpf
+		;;
 	udi29k)
 		basic_machine=a29k-amd
 		os=-udi
@@ -994,6 +1077,10 @@ case $basic_machine in
 		basic_machine=hppa1.1-winbond
 		os=-proelf
 		;;
+	xbox)
+		basic_machine=i686-pc
+		os=-mingw32
+		;;
 	xps | xps100)
 		basic_machine=xps100-honeywell
 		;;
@@ -1024,6 +1111,9 @@ case $basic_machine in
 	romp)
 		basic_machine=romp-ibm
 		;;
+	mmix)
+		basic_machine=mmix-knuth
+		;;
 	rs6000)
 		basic_machine=rs6000-ibm
 		;;
@@ -1040,13 +1130,10 @@ case $basic_machine in
 	we32k)
 		basic_machine=we32k-att
 		;;
-	sh3 | sh4 | sh[34]eb | sh[1234]le | sh[23]ele)
+	sh[1234] | sh[24]a | sh[34]eb | sh[1234]le | sh[23]ele)
 		basic_machine=sh-unknown
 		;;
-	sh64)
-		basic_machine=sh64-unknown
-		;;
-	sparc | sparcv9 | sparcv9b)
+	sparc | sparcv8 | sparcv9 | sparcv9b | sparcv9v)
 		basic_machine=sparc-sun
 		;;
 	cydra)
@@ -1119,19 +1206,23 @@ case $os in
 	      | -aos* \
 	      | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
 	      | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
-	      | -hiux* | -386bsd* | -netbsd* | -openbsd* | -freebsd* | -riscix* \
-	      | -lynxos* | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
+	      | -hiux* | -386bsd* | -knetbsd* | -mirbsd* | -netbsd* \
+	      | -openbsd* | -solidbsd* \
+	      | -ekkobsd* | -kfreebsd* | -freebsd* | -riscix* | -lynxos* \
+	      | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
 	      | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
 	      | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
 	      | -chorusos* | -chorusrdb* \
 	      | -cygwin* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
-	      | -mingw32* | -linux-gnu* | -uxpv* | -beos* | -mpeix* | -udk* \
+	      | -mingw32* | -linux-gnu* | -linux-newlib* | -linux-uclibc* \
+	      | -uxpv* | -beos* | -mpeix* | -udk* \
 	      | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \
 	      | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \
 	      | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \
 	      | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \
 	      | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \
-	      | -powermax* | -dnix*)
+	      | -powermax* | -dnix* | -nx6 | -nx7 | -sei* | -dragonfly* \
+	      | -skyos* | -haiku* | -rdos* | -toppers* | -drops*)
 	# Remember, each alternative MUST END IN *, to match a version number.
 		;;
 	-qnx*)
@@ -1149,12 +1240,15 @@ case $os in
 		os=`echo $os | sed -e 's|nto|nto-qnx|'`
 		;;
 	-sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \
-	      | -windows* | -osx | -abug | -netware* | -os9* | -beos* \
+	      | -windows* | -osx | -abug | -netware* | -os9* | -beos* | -haiku* \
 	      | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*)
 		;;
 	-mac*)
 		os=`echo $os | sed -e 's|mac|macos|'`
 		;;
+	-linux-dietlibc)
+		os=-linux-dietlibc
+		;;
 	-linux*)
 		os=`echo $os | sed -e 's|linux|linux-gnu|'`
 		;;
@@ -1167,6 +1261,9 @@ case $os in
 	-opened*)
 		os=-openedition
 		;;
+        -os400*)
+		os=-os400
+		;;
 	-wince*)
 		os=-wince
 		;;
@@ -1188,6 +1285,9 @@ case $os in
 	-atheos*)
 		os=-atheos
 		;;
+	-syllable*)
+		os=-syllable
+		;;
 	-386bsd)
 		os=-bsd
 		;;
@@ -1210,6 +1310,9 @@ case $os in
 	-sinix*)
 		os=-sysv4
 		;;
+        -tpf*)
+		os=-tpf
+		;;
 	-triton*)
 		os=-sysv3
 		;;
@@ -1246,6 +1349,9 @@ case $os in
 	-kaos*)
 		os=-kaos
 		;;
+	-zvmoe)
+		os=-zvmoe
+		;;
 	-none)
 		;;
 	*)
@@ -1268,6 +1374,12 @@ else
 # system, and we'll never get to this point.
 
 case $basic_machine in
+        score-*)
+		os=-elf
+		;;
+        spu-*)
+		os=-elf
+		;;
 	*-acorn)
 		os=-riscix1.2
 		;;
@@ -1277,6 +1389,9 @@ case $basic_machine in
 	arm*-semi)
 		os=-aout
 		;;
+        c4x-* | tic4x-*)
+        	os=-coff
+		;;
 	# This must come before the *-dec entry.
 	pdp10-*)
 		os=-tops20
@@ -1302,6 +1417,9 @@ case $basic_machine in
 	m68*-cisco)
 		os=-aout
 		;;
+        mep-*)
+		os=-elf
+		;;
 	mips*-cisco)
 		os=-elf
 		;;
@@ -1320,9 +1438,15 @@ case $basic_machine in
 	*-be)
 		os=-beos
 		;;
+	*-haiku)
+		os=-haiku
+		;;
 	*-ibm)
 		os=-aix
 		;;
+    	*-knuth)
+		os=-mmixware
+		;;
 	*-wec)
 		os=-proelf
 		;;
@@ -1455,9 +1579,15 @@ case $basic_machine in
 			-mvs* | -opened*)
 				vendor=ibm
 				;;
+			-os400*)
+				vendor=ibm
+				;;
 			-ptx*)
 				vendor=sequent
 				;;
+			-tpf*)
+				vendor=ibm
+				;;
 			-vxsim* | -vxworks* | -windiss*)
 				vendor=wrs
 				;;
@@ -1482,7 +1612,7 @@ case $basic_machine in
 esac
 
 echo $basic_machine$os
-exit 0
+exit
 
 # Local variables:
 # eval: (add-hook 'write-file-hooks 'time-stamp)

configure.in

@@ -19,10 +19,13 @@ fi
 AC_SUBST(LD)	
 
 if test -z "$OLDCFLAGS" && test "$GCC" = "yes"; then
-	AC_MSG_RESULT(No \$CFLAGS set... using "-Os -W -Wall" for GCC)
+	AC_MSG_NOTICE(No \$CFLAGS set... using "-Os -W -Wall" for GCC)
 	CFLAGS="-Os -W -Wall"
 fi
 
+# large file support is useful for scp
+AC_SYS_LARGEFILE
+
 # Host specific options
 # this isn't a definitive list of hosts, they are just added as required
 AC_CANONICAL_HOST
@@ -75,7 +78,7 @@ dnl Can't use login() or logout() with uclibc
 AC_CHECK_DECL(__UCLIBC__, 
 	[
 	no_loginfunc_check=1
-	AC_MSG_RESULT(Using uClibc - login() and logout() probably don't work, so we won't use them.)
+	AC_MSG_NOTICE([Using uClibc - login() and logout() probably don't work, so we won't use them.])
 	],,,)
 
 # Checks for libraries.
@@ -104,16 +107,16 @@ AC_ARG_ENABLE(zlib,
 	[
 		if test "x$enableval" = "xno"; then
 			AC_DEFINE(DISABLE_ZLIB,, Use zlib)
-			AC_MSG_RESULT(Disabling zlib)
+			AC_MSG_NOTICE(Disabling zlib)
 		else
 			AC_CHECK_LIB(z, deflate, , AC_MSG_ERROR([*** zlib missing - install first or check config.log ***]))
-			AC_MSG_RESULT(Enabling zlib)
+			AC_MSG_NOTICE(Enabling zlib)
 		fi
 	],
 	[
 		# if not disabled, check for zlib
 		AC_CHECK_LIB(z, deflate, , AC_MSG_ERROR([*** zlib missing - install first or check config.log ***]))
-		AC_MSG_RESULT(Enabling zlib)
+		AC_MSG_NOTICE(Enabling zlib)
 	]
 )
 
@@ -141,16 +144,16 @@ AC_ARG_ENABLE(pam,
 	[
 		if test "x$enableval" = "xyes"; then
 			AC_CHECK_LIB(pam, pam_authenticate, , AC_MSG_ERROR([*** PAM missing - install first or check config.log ***]))
-			AC_MSG_RESULT(Enabling PAM)
+			AC_MSG_NOTICE(Enabling PAM)
 		else
 			AC_DEFINE(DISABLE_PAM,, Use PAM)
-			AC_MSG_RESULT(Disabling PAM)
+			AC_MSG_NOTICE(Disabling PAM)
 		fi
 	],
 	[
 		# disable it by default
 		AC_DEFINE(DISABLE_PAM,, Use PAM)
-		AC_MSG_RESULT(Disabling PAM)
+		AC_MSG_NOTICE(Disabling PAM)
 	]
 )
 
@@ -158,14 +161,14 @@ AC_ARG_ENABLE(openpty,
 	[  --disable-openpty       Don't use openpty, use alternative method],
 	[
 		if test "x$enableval" = "xno"; then
-			AC_MSG_RESULT(Not using openpty)
+			AC_MSG_NOTICE(Not using openpty)
 		else
-			AC_MSG_RESULT(Using openpty if available)
+			AC_MSG_NOTICE(Using openpty if available)
 			AC_SEARCH_LIBS(openpty, util, [AC_DEFINE(HAVE_OPENPTY,,Have openpty() function)])
 		fi
 	],
 	[
-		AC_MSG_RESULT(Using openpty if available)
+		AC_MSG_NOTICE(Using openpty if available)
 		AC_SEARCH_LIBS(openpty, util, [AC_DEFINE(HAVE_OPENPTY)])
 	]
 )
@@ -176,13 +179,13 @@ AC_ARG_ENABLE(syslog,
 	[
 		if test "x$enableval" = "xno"; then
 			AC_DEFINE(DISABLE_SYSLOG,, Using syslog)
-			AC_MSG_RESULT(Disabling syslog)
+			AC_MSG_NOTICE(Disabling syslog)
 		else
-			AC_MSG_RESULT(Enabling syslog)
+			AC_MSG_NOTICE(Enabling syslog)
 		fi
 	],
 	[
-		AC_MSG_RESULT(Enabling syslog)
+		AC_MSG_NOTICE(Enabling syslog)
 	]
 )
 
@@ -190,15 +193,15 @@ AC_ARG_ENABLE(shadow,
 	[  --disable-shadow        Don't use shadow passwords (if available)],
 	[
 		if test "x$enableval" = "xno"; then
-			AC_MSG_RESULT(Not using shadow passwords)
+			AC_MSG_NOTICE(Not using shadow passwords)
 		else
 			AC_CHECK_HEADERS([shadow.h])
-			AC_MSG_RESULT(Using shadow passwords if available)
+			AC_MSG_NOTICE(Using shadow passwords if available)
 		fi
 	],
 	[
 		AC_CHECK_HEADERS([shadow.h])
-		AC_MSG_RESULT(Using shadow passwords if available)
+		AC_MSG_NOTICE(Using shadow passwords if available)
 	]
 )
 			
@@ -341,11 +344,17 @@ AC_CHECK_MEMBERS([struct utmp.ut_host, struct utmp.ut_pid, struct utmp.ut_type,
 
 AC_CHECK_MEMBERS([struct utmpx.ut_host, struct utmpx.ut_syslen, struct utmpx.ut_type, struct utmpx.ut_id, struct utmpx.ut_addr, struct utmpx.ut_addr_v6, struct utmpx.ut_time, struct utmpx.ut_tv],,,[
 #include <sys/types.h>
+#include <sys/socket.h>
 #if HAVE_UTMPX_H
 #include <utmpx.h>
 #endif
 ])
 
+AC_CHECK_MEMBERS([struct sockaddr_storage.ss_family],,,[
+#include <sys/types.h>
+#include <sys/socket.h>
+])
+
 AC_CHECK_FUNCS(endutent getutent getutid getutline pututline setutent)
 AC_CHECK_FUNCS(utmpname)
 AC_CHECK_FUNCS(endutxent getutxent getutxid getutxline pututxline )
@@ -378,7 +387,7 @@ AC_ARG_ENABLE(wtmpx,
 AC_ARG_ENABLE(loginfunc,
 	[  --disable-loginfunc     Disable use of login() etc. [no]],
 	[ no_loginfunc_check=1
-	AC_MSG_RESULT(Not using login() etc) ]
+	AC_MSG_NOTICE(Not using login() etc) ]
 )
 AC_ARG_ENABLE(pututline,
 	[  --disable-pututline     Disable use of pututline() etc. ([uw]tmp) [no]],
@@ -595,7 +604,7 @@ if test -z "$no_ptmx_check" ; then
 	if test x"$cross_compiling" = x"no" ; then
 		AC_CHECK_FILE("/dev/ptmx", AC_DEFINE(USE_DEV_PTMX,,Use /dev/ptmx))
 	else
-		AC_MSG_RESULT(Not checking for /dev/ptmx, we're cross-compiling)
+		AC_MSG_NOTICE(Not checking for /dev/ptmx, we're cross-compiling)
 	fi
 fi
 
@@ -603,14 +612,57 @@ if test -z "$no_ptc_check" ; then
 	if test x"$cross_compiling" = x"no" ; then
 		AC_CHECK_FILE("/dev/ptc", AC_DEFINE(HAVE_DEV_PTS_AND_PTC,,Use /dev/ptc & /dev/pts))
 	else
-		AC_MSG_RESULT(Not checking for /dev/ptc & /dev/pts\, we're cross-compiling)
+		AC_MSG_NOTICE(Not checking for /dev/ptc & /dev/pts\, we're cross-compiling)
 	fi
 fi
 
 AC_EXEEXT
+
+# XXX there must be a nicer way to do this
+AS_MKDIR_P(libtomcrypt/src/ciphers/aes)
+AS_MKDIR_P(libtomcrypt/src/ciphers/safer)
+AS_MKDIR_P(libtomcrypt/src/ciphers/twofish)
+AS_MKDIR_P(libtomcrypt/src/encauth/ccm)
+AS_MKDIR_P(libtomcrypt/src/encauth/eax)
+AS_MKDIR_P(libtomcrypt/src/encauth/gcm)
+AS_MKDIR_P(libtomcrypt/src/encauth/ocb)
+AS_MKDIR_P(libtomcrypt/src/hashes)
+AS_MKDIR_P(libtomcrypt/src/hashes/chc)
+AS_MKDIR_P(libtomcrypt/src/hashes/helper)
+AS_MKDIR_P(libtomcrypt/src/hashes/sha2)
+AS_MKDIR_P(libtomcrypt/src/hashes/whirl)
+AS_MKDIR_P(libtomcrypt/src/mac/hmac)
+AS_MKDIR_P(libtomcrypt/src/mac/omac)
+AS_MKDIR_P(libtomcrypt/src/mac/pelican)
+AS_MKDIR_P(libtomcrypt/src/mac/pmac)
+AS_MKDIR_P(libtomcrypt/src/misc/base64)
+AS_MKDIR_P(libtomcrypt/src/misc/crypt)
+AS_MKDIR_P(libtomcrypt/src/misc/mpi)
+AS_MKDIR_P(libtomcrypt/src/misc/pkcs5)
+AS_MKDIR_P(libtomcrypt/src/modes/cbc)
+AS_MKDIR_P(libtomcrypt/src/modes/cfb)
+AS_MKDIR_P(libtomcrypt/src/modes/ctr)
+AS_MKDIR_P(libtomcrypt/src/modes/ecb)
+AS_MKDIR_P(libtomcrypt/src/modes/ofb)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/bit)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/choice)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/ia5)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/integer)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/object_identifier)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/octet)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/printable_string)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/sequence)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/short_integer)
+AS_MKDIR_P(libtomcrypt/src/pk/asn1/der/utctime)
+AS_MKDIR_P(libtomcrypt/src/pk/dh)
+AS_MKDIR_P(libtomcrypt/src/pk/dsa)
+AS_MKDIR_P(libtomcrypt/src/pk/ecc)
+AS_MKDIR_P(libtomcrypt/src/pk/pkcs1)
+AS_MKDIR_P(libtomcrypt/src/pk/rsa)
+AS_MKDIR_P(libtomcrypt/src/prng)
 AC_CONFIG_HEADER(config.h)
 AC_OUTPUT(Makefile)
 AC_OUTPUT(libtomcrypt/Makefile)
 AC_OUTPUT(libtommath/Makefile)
-AC_MSG_RESULT()
-AC_MSG_RESULT(Now edit options.h to choose features.)
+AC_MSG_NOTICE()
+AC_MSG_NOTICE(Now edit options.h to choose features.)

dbclient.1

@@ -29,24 +29,23 @@ Read the identity from file
 .I idfile
 (multiple allowed).
 .TP
-.B \-L \fIlocalport\fR:\fIremotehost\fR:\fIremoteport\fR
+.B \-L \fIlistenport\fR:\fIhost\fR:\fIport\fR
 Local port forwarding.
 Forward the port
-.I localport
-on the local host to port
-.I remoteport
-on the remote host
-.IR remotehost .
+.I listenport
+on the local host through the SSH connection to port
+.I port
+on the host
+.IR host .
 .TP
-.B \-R \fIlocalport\fR:\fIremotehost\fR:\fIremoteport\fR
+.B \-R \fIlistenport\fR:\fIhost\fR:\fIport\fR
 Remote port forwarding.
 Forward the port
-.I remoteport
-on the remote host
-.I remotehost
-to port
-.I localport
-on the local host.
+.I listenport
+on the remote host through the SSH connection to port
+.I port
+on the host
+.IR host .
 .TP
 .B \-l \fIuser
 Username.
@@ -60,6 +59,13 @@ Allocate a pty.
 .B \-T
 Don't allocate a pty.
 .TP
+.B \-N
+Don't request a remote shell or run any commands. Any command arguments are ignored.
+.TP
+.B \-f
+Fork into the background after authentication. A command argument (or -N) is required.
+This is useful when using password authentication.
+.TP
 .B \-g
 Allow non-local hosts to connect to forwarded ports. Applies to -L and -R
 forwarded ports, though remote connections to -R forwarded ports may be limited

dbutil.c

@@ -400,7 +400,10 @@ unsigned char * getaddrstring(struct sockaddr_storage* addr, int withport) {
 
 	len = sizeof(struct sockaddr_storage);
 	/* Some platforms such as Solaris 8 require that len is the length
-	 * of the specific structure. */
+	 * of the specific structure. Some older linux systems (glibc 2.1.3
+	 * such as debian potato) have sockaddr_storage.__ss_family instead
+	 * but we'll ignore them */
+#ifdef HAVE_STRUCT_SOCKADDR_STORAGE_SS_FAMILY
 	if (addr->ss_family == AF_INET) {
 		len = sizeof(struct sockaddr_in);
 	}
@@ -408,6 +411,7 @@ unsigned char * getaddrstring(struct sockaddr_storage* addr, int withport) {
 	if (addr->ss_family == AF_INET6) {
 		len = sizeof(struct sockaddr_in6);
 	}
+#endif
 #endif
 
 	ret = getnameinfo((struct sockaddr*)addr, len, hbuf, sizeof(hbuf), 
@@ -448,6 +452,7 @@ char* getaddrhostname(struct sockaddr_storage * addr) {
 	len = sizeof(struct sockaddr_storage);
 	/* Some platforms such as Solaris 8 require that len is the length
 	 * of the specific structure. */
+#ifdef HAVE_STRUCT_SOCKADDR_STORAGE_SS_FAMILY
 	if (addr->ss_family == AF_INET) {
 		len = sizeof(struct sockaddr_in);
 	}
@@ -456,6 +461,7 @@ char* getaddrhostname(struct sockaddr_storage * addr) {
 		len = sizeof(struct sockaddr_in6);
 	}
 #endif
+#endif
 
 
 	ret = getnameinfo((struct sockaddr*)addr, len, hbuf, sizeof(hbuf),
@@ -521,26 +527,36 @@ char * stripcontrol(const char * text) {
  * Returns DROPBEAR_SUCCESS or DROPBEAR_FAILURE */
 int buf_readfile(buffer* buf, const char* filename) {
 
-	int fd;
+	int fd = -1;
 	int len;
 	int maxlen;
+	int ret = DROPBEAR_FAILURE;
 
 	fd = open(filename, O_RDONLY);
 
 	if (fd < 0) {
-		close(fd);
-		return DROPBEAR_FAILURE;
+		goto out;
 	}
 	
 	do {
 		maxlen = buf->size - buf->pos;
-		len = read(fd, buf_getwriteptr(buf, maxlen),
-				maxlen);
+		len = read(fd, buf_getwriteptr(buf, maxlen), maxlen);
+		if (len < 0) {
+			if (errno == EINTR || errno == EAGAIN) {
+				continue;
+			}
+			goto out;
+		}
 		buf_incrwritepos(buf, len);
 	} while (len < maxlen && len > 0);
 
-	close(fd);
-	return DROPBEAR_SUCCESS;
+	ret = DROPBEAR_SUCCESS;
+
+out:
+	if (fd >= 0) {
+		m_close(fd);
+	}
+	return ret;
 }
 
 /* get a line from the file into buffer in the style expected for an
@@ -588,20 +604,17 @@ out:
 }	
 #endif
 
-/* loop until the socket is closed (in case of EINTR) or
- * we get and error.
- * Returns DROPBEAR_SUCCESS or DROPBEAR_FAILURE */
-int m_close(int fd) {
+/* make sure that the socket closes */
+void m_close(int fd) {
 
 	int val;
 	do {
 		val = close(fd);
 	} while (val < 0 && errno == EINTR);
 
-	if (val == 0 || errno == EBADF) {
-		return DROPBEAR_SUCCESS;
-	} else {
-		return DROPBEAR_FAILURE;
+	if (val < 0 && errno != EBADF) {
+		/* Linux says EIO can happen */
+		dropbear_exit("Error closing fd %d, %s", fd, strerror(errno));
 	}
 }
 	

dbutil.h

@@ -55,7 +55,7 @@ char* getaddrhostname(struct sockaddr_storage * addr);
 int buf_readfile(buffer* buf, const char* filename);
 int buf_getline(buffer * line, FILE * authfile);
 
-int m_close(int fd);
+void m_close(int fd);
 void * m_malloc(size_t size);
 void * m_strdup(const char * str);
 void * m_realloc(void* ptr, size_t size);

debian/changelog

@@ -1,6 +1,56 @@
-dropbear (0.46-0.1) unstable; urgency=medium
+dropbear (0.49-0.1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Matt Johnston <matt@ucc.asn.au>  Tues, 13 June 2005 19:20:21 +0800
+
+dropbear (0.48.1-1) unstable; urgency=medium
+
+  * new upstream point release.
+    * Compile fix for scp
+  * debian/diff/dbclient.1.diff: new: document -R option to dbclient
+    accurately (thx Markus Schaber; closes: #351882).
+  * debian/dropbear.README.Debian: document a workaround for systems with
+    possibly blocking /dev/random device (closes: #355414)..
+
+ -- Gerrit Pape <pape@smarden.org>  Sun, 16 Apr 2006 16:16:40 +0000
+
+dropbear (0.48-1) unstable; urgency=medium
+
+  * New upstream release.
+  * SECURITY: Improve handling of denial of service attempts from a single
+    IP.
+
+  * debian/implicit: update to revision 1.11.
+  * new upstream release updates to scp from OpenSSH 4.3p2 - fixes a
+    security issue where use of system() could cause users to execute
+    arbitrary code through malformed filenames; CVE-2006-0225 (see also
+    #349645); the scp binary is not provided by this package though.
+
+ -- Gerrit Pape <pape@smarden.org>  Fri, 10 Mar 2006 22:00:32 +0000
+
+dropbear (0.47-1) unstable; urgency=high
+
+  * New upstream release.
+  * SECURITY: Fix incorrect buffer sizing; CVE-2005-4178.
+
+ -- Matt Johnston <matt@ucc.asn.au>  Thu, 8 Dec 2005 19:20:21 +0800
+
+dropbear (0.46-2) unstable; urgency=low
+
+  * debian/control: Standards-Version: 3.6.2.1; update descriptions to
+    mention included server and client (thx Tino Keitel).
+  * debian/dropbear.init: allow '/etc/init.d/dropbear stop' even though
+    'NO_START is not set to zero.' (closes: #336723).
+
+ -- Gerrit Pape <pape@smarden.org>  Tue,  6 Dec 2005 13:30:49 +0000
+
+dropbear (0.46-1) unstable; urgency=medium
 
   * New upstream release, various fixes.
+  * debian/diff/dbclient-usage-typo.diff, debian/diff/manpages.diff: remove;
+    obsolete.
+  * debian/dbclient.1: move to ./dbclient.1.
 
  -- Matt Johnston <matt@ucc.asn.au>  Fri, 8 July 2005 21:32:55 +0800
 

debian/control

@@ -3,16 +3,16 @@ Section: net
 Priority: optional
 Maintainer: Gerrit Pape <pape@smarden.org>
 Build-Depends: libz-dev
-Standards-Version: 3.6.1.0
+Standards-Version: 3.6.2.1
 
 Package: dropbear
 Architecture: any
 Depends: ${shlibs:Depends}
 Suggests: ssh, runit
-Description: lightweight SSH2 server
- dropbear is a SSH 2 server designed to be small enough to be used in small
- memory environments, while still being functional and secure enough for
- general use.
+Description: lightweight SSH2 server and client
+ dropbear is a SSH 2 server and client designed to be small enough to
+ be used in small memory environments, while still being functional and
+ secure enough for general use.
  .
  It implements most required features of the SSH 2 protocol, and other
  features such as X11 and authentication agent forwarding.

debian/dropbear.README.Debian

@@ -39,3 +39,14 @@ by following these steps:
 See the Dropbear homepage for more information:
   http://matt.ucc.asn.au/dropbear/dropbear.html
 
+
+Entropy from /dev/random
+------------------------
+
+The dropbear binary package is configured at compile time to read
+entropy from /dev/random. If /dev/random on a system blocks when
+reading data from it, client logins may be delayed until the client
+times out. The dropbear server writes a notice to the logs when it
+sees /dev/random blocking.  A workaround for such systems is to
+re-compile the package with DROPBEAR_RANDOM_DEV set to /dev/urandom
+in options.h.

debian/dropbear.init

@@ -16,7 +16,6 @@ set -e
 
 cancel() { echo "$1" >&2; exit 0; };
 test ! -r /etc/default/dropbear || . /etc/default/dropbear
-test "$NO_START" = "0" || cancel 'NO_START is not set to zero.'
 test -x "$DAEMON" || cancel "$DAEMON does not exist or is not executable."
 test ! -h /var/service/dropbear || \
   cancel '/var/service/dropbear exists, service is controlled through runit.'
@@ -30,6 +29,7 @@ test -n "$DROPBEAR_DSSKEY" || \
 
 case "$1" in
   start)
+	test "$NO_START" = "0" || cancel 'NO_START is not set to zero.'
 	echo -n "Starting $DESC: "
 	start-stop-daemon --start --quiet --pidfile /var/run/"$NAME".pid \
 	  --exec "$DAEMON" -- -d "$DROPBEAR_DSSKEY" -r "$DROPBEAR_RSAKEY" \
@@ -42,6 +42,7 @@ case "$1" in
 	echo "$NAME."
 	;;
   restart|force-reload)
+	test "$NO_START" = "0" || cancel 'NO_START is not set to zero.'
 	echo -n "Restarting $DESC: "
 	start-stop-daemon --stop --quiet --oknodo --pidfile /var/run/"$NAME".pid
 	sleep 1

debian/implicit

@@ -1,4 +1,4 @@
-# $Id: implicit,v 1.10 2004/07/03 15:20:00 pape Exp $
+# $Id: implicit,v 1.11 2005/11/29 21:57:55 pape Exp $
 
 .PHONY: deb-checkdir deb-checkuid
 
@@ -38,6 +38,14 @@ deb-checkuid:
 	@gzip -9 debian/$*/usr/share/doc/$*/changelog*
 %.deb-docs-docs:
 	@for i in `cat debian/$*.docs 2>/dev/null || :`; do \
+	  if test -d $$i; then \
+	    sh -cx "install -d -m0755 debian/$*/usr/share/doc/$*/$${i##*/}" && \
+	    for j in $$i/*; do \
+	      sh -cx "install -m0644 $$j \
+	        debian/$*/usr/share/doc/$*/$${i##*/}/" || exit 1; \
+	    done || exit 1; \
+	    continue; \
+	  fi; \
 	  sh -cx "install -m0644 $$i debian/$*/usr/share/doc/$*/" || exit 1; \
 	done
 	@test ! -r debian/$*.README.Debian || \

debug.h

@@ -44,8 +44,10 @@
 /* All functions writing to the cleartext payload buffer call
  * CHECKCLEARTOWRITE() before writing. This is only really useful if you're
  * attempting to track down a problem */
-#define CHECKCLEARTOWRITE() assert(ses.writepayload->len == 0 && \
-		ses.writepayload->pos == 0)
+/*#define CHECKCLEARTOWRITE() assert(ses.writepayload->len == 0 && \
+		ses.writepayload->pos == 0)*/
+
+#define CHECKCLEARTOWRITE()
 
 /* Define this, compile with -pg and set GMON_OUT_PREFIX=gmon to get gmon
  * output when Dropbear forks. This will allow it gprof to be used.

dropbear.8

@@ -72,6 +72,10 @@ Use this option to run
 under TCP/IP servers like inetd, tcpsvd, or tcpserver.
 In program mode the \-F option is implied, and \-p options are ignored.
 .TP
+.B \-P \fIpidfile
+Specify a pidfile to create when running as a daemon. If not specified, the 
+default is /var/run/dropbear.pid
+.TP
 .B \-a
 Allow remote hosts to connect to forwarded ports.
 .SH AUTHOR

dropbearkey.c

@@ -283,8 +283,10 @@ out:
 	buf_burn(buf);
 	buf_free(buf);
 	buf = NULL;
-	sign_key_free(key);
-	key = NULL;
+	if (key) {
+		sign_key_free(key);
+		key = NULL;
+	}
 	exit(err);
 }
 
@@ -297,6 +299,9 @@ static void printpubkey(sign_key * key, int keytype) {
 	const char * typestring = NULL;
 	char *fp = NULL;
 	int len;
+	struct passwd * pw = NULL;
+	char * username = NULL;
+	char hostname[100];
 
 	buf = buf_new(MAX_PUBKEY_SIZE);
 	buf_put_pub_key(buf, key, keytype);
@@ -315,8 +320,18 @@ static void printpubkey(sign_key * key, int keytype) {
 
 	fp = sign_key_fingerprint(buf_getptr(buf, len), len);
 
-	printf("Public key portion is:\n%s %s\nFingerprint: %s\n",
-			typestring, base64key, fp);
+	/* a user@host comment is informative */
+	username = "";
+	pw = getpwuid(getuid());
+	if (pw) {
+		username = pw->pw_name;
+	}
+
+	gethostname(hostname, sizeof(hostname));
+	hostname[sizeof(hostname)-1] = '\0';
+
+	printf("Public key portion is:\n%s %s %s@%s\nFingerprint: %s\n",
+			typestring, base64key, username, hostname, fp);
 
 	m_free(fp);
 	buf_free(buf);

dss.c

@@ -90,6 +90,9 @@ int buf_get_dss_priv_key(buffer* buf, dss_key *key) {
 	key->x = m_malloc(sizeof(mp_int));
 	m_mp_init(key->x);
 	ret = buf_getmpint(buf, key->x);
+	if (ret == DROPBEAR_FAILURE) {
+		m_free(key->x);
+	}
 
 	return ret;
 }
@@ -338,7 +341,9 @@ void buf_put_dss_sign(buffer* buf, dss_key *key, const unsigned char* data,
 	/* generate k */
 	m_mp_init(&dss_protok);
 	bytes_to_mp(&dss_protok, proto_k, SHA512_HASH_SIZE);
-	mp_mod(&dss_protok, key->q, &dss_k);
+	if (mp_mod(&dss_protok, key->q, &dss_k) != MP_OKAY) {
+		dropbear_exit("dss error");
+	}
 	mp_clear(&dss_protok);
 	m_burn(proto_k, SHA512_HASH_SIZE);
 #else /* DSS_PROTOK not defined*/

includes.h

@@ -72,12 +72,12 @@
 #include <lastlog.h>
 #endif
 
-#include <arpa/inet.h>
-
 #ifdef HAVE_NETINET_IN_H
 #include <netinet/in.h>
 #endif
 
+#include <arpa/inet.h>
+
 /* netbsd 1.6 needs this to be included before netinet/ip.h for some
  * undocumented reason */
 #ifdef HAVE_NETINET_IN_SYSTM_H

keyimport.c

@@ -361,7 +361,7 @@ struct openssh_key {
 static struct openssh_key *load_openssh_key(const char *filename)
 {
 	struct openssh_key *ret;
-	FILE *fp;
+	FILE *fp = NULL;
 	char buffer[256];
 	char *errmsg = NULL, *p = NULL;
 	int headers_done;
@@ -482,6 +482,9 @@ static struct openssh_key *load_openssh_key(const char *filename)
 		memset(&ret, 0, sizeof(ret));
 		m_free(ret);
 	}
+	if (fp) {
+		fclose(fp);
+	}
 	if (errmsg) {
 		fprintf(stderr, "Error: %s\n", errmsg);
 	}
@@ -926,40 +929,6 @@ static int openssh_write(const char *filename, sign_key *key,
 	if (passphrase) {
 		fprintf(stderr, "Encrypted keys aren't supported currently\n");
 		goto error;
-#if 0
-		/*
-		 * Invent an iv. Then derive encryption key from passphrase
-		 * and iv/salt:
-		 * 
-		 *  - let block A equal MD5(passphrase || iv)
-		 *  - let block B equal MD5(A || passphrase || iv)
-		 *  - block C would be MD5(B || passphrase || iv) and so on
-		 *  - encryption key is the first N bytes of A || B
-		 */
-		struct MD5Context md5c;
-		unsigned char keybuf[32];
-
-		for (i = 0; i < 8; i++) iv[i] = random_byte();
-
-		MD5Init(&md5c);
-		MD5Update(&md5c, (unsigned char *)passphrase, strlen(passphrase));
-		MD5Update(&md5c, iv, 8);
-		MD5Final(keybuf, &md5c);
-
-		MD5Init(&md5c);
-		MD5Update(&md5c, keybuf, 16);
-		MD5Update(&md5c, (unsigned char *)passphrase, strlen(passphrase));
-		MD5Update(&md5c, iv, 8);
-		MD5Final(keybuf+16, &md5c);
-
-		/*
-		 * Now encrypt the key blob.
-		 */
-		des3_encrypt_pubkey_ossh(keybuf, iv, outblob, outlen);
-
-		memset(&md5c, 0, sizeof(md5c));
-		memset(keybuf, 0, sizeof(keybuf));
-#endif
 	}
 
 	/*
@@ -976,12 +945,6 @@ static int openssh_write(const char *filename, sign_key *key,
 		goto error;
 	}
 	fputs(header, fp);
-	if (passphrase) {
-		fprintf(fp, "Proc-Type: 4,ENCRYPTED\nDEK-Info: DES-EDE3-CBC,");
-		for (i = 0; i < 8; i++)
-			fprintf(fp, "%02X", iv[i]);
-		fprintf(fp, "\n\n");
-	}
 	base64_encode_fp(fp, outblob, outlen, 64);
 	fputs(footer, fp);
 	fclose(fp);

libtomcrypt/LICENSE

@@ -0,0 +1,5 @@
+LibTomCrypt is public domain.  As should all quality software be.
+
+Tom St Denis
+
+

libtomcrypt/Makefile.in

@@ -0,0 +1,317 @@
+# MAKEFILE for linux GCC
+#
+# Tom St Denis
+# Modified by Clay Culver
+
+# The version
+VERSION=1.16
+
+VPATH=@srcdir@
+srcdir=@srcdir@
+
+# Compiler and Linker Names
+#CC=gcc
+#LD=ld
+
+# Archiver [makes .a files]
+#AR=ar
+#ARFLAGS=r
+
+# Compilation flags. Note the += does not write over the user's CFLAGS!
+# The rest of the flags come from the parent Dropbear makefile
+CFLAGS += -c -I$(srcdir)/src/headers/ -I$(srcdir)/../
+
+# additional warnings (newer GCC 3.4 and higher)
+ifdef GCC_34
+CFLAGS += -Wsystem-headers -Wdeclaration-after-statement -Wbad-function-cast -Wcast-align -Wstrict-prototypes -Wmissing-prototypes \
+		  -Wmissing-declarations -Wpointer-arith 
+endif
+
+ifndef IGNORE_SPEED
+
+# optimize for SPEED
+#CFLAGS += -O3 -funroll-loops
+
+# add -fomit-frame-pointer.  hinders debugging!
+#CFLAGS += -fomit-frame-pointer
+
+# optimize for SIZE
+#CFLAGS += -Os -DLTC_SMALL_CODE
+
+endif
+
+# older GCCs can't handle the "rotate with immediate" ROLc/RORc/etc macros
+# define this to help
+#CFLAGS += -DLTC_NO_ROLC
+
+# compile for DEBUGING (required for ccmalloc checking!!!)
+#CFLAGS += -g3 -DLTC_NO_ASM
+
+#Output filenames for various targets.
+ifndef LIBNAME
+   LIBNAME=libtomcrypt.a
+endif
+ifndef LIBTEST
+   LIBTEST=libtomcrypt_prof.a
+endif
+LIBTEST_S=$(LIBTEST)
+
+HASH=hashsum
+CRYPT=encrypt
+SMALL=small
+PROF=x86_prof
+TV=tv_gen
+MULTI=multi
+TIMING=timing
+TEST=test
+
+#LIBPATH-The directory for libtomcrypt to be installed to.
+#INCPATH-The directory to install the header files for libtomcrypt.
+#DATAPATH-The directory to install the pdf docs.
+ifndef DESTDIR
+   DESTDIR=
+endif
+
+ifndef LIBPATH
+   LIBPATH=/usr/lib
+endif
+ifndef INCPATH
+   INCPATH=/usr/include
+endif
+ifndef DATAPATH
+   DATAPATH=/usr/share/doc/libtomcrypt/pdf
+endif
+
+#Who do we install as?
+ifdef INSTALL_USER
+USER=$(INSTALL_USER)
+else
+USER=root
+endif
+
+ifdef INSTALL_GROUP
+GROUP=$(INSTALL_GROUP)
+else
+GROUP=wheel
+endif
+
+#List of objects to compile.
+#START_INS
+OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
+src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
+src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
+src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
+src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
+src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
+src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
+src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
+src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
+src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
+src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
+src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
+src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
+src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
+src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
+src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
+src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
+src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
+src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
+src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
+src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
+src/mac/pelican/pelican.o src/mac/pelican/pelican_memory.o src/mac/pelican/pelican_test.o \
+src/mac/pmac/pmac_done.o src/mac/pmac/pmac_file.o src/mac/pmac/pmac_init.o src/mac/pmac/pmac_memory.o \
+src/mac/pmac/pmac_memory_multi.o src/mac/pmac/pmac_ntz.o src/mac/pmac/pmac_process.o \
+src/mac/pmac/pmac_shift_xor.o src/mac/pmac/pmac_test.o src/mac/xcbc/xcbc_done.o \
+src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
+src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
+src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
+src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
+src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
+src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
+src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
+src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
+src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
+src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
+src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
+src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
+src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
+src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
+src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
+src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
+src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
+src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
+src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
+src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
+src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
+src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
+src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
+src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
+src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
+src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
+src/modes/ofb/ofb_start.o 
+
+HEADERS=src/headers/tomcrypt_cfg.h src/headers/tomcrypt_mac.h src/headers/tomcrypt_macros.h \
+src/headers/tomcrypt_custom.h src/headers/tomcrypt_argchk.h src/headers/tomcrypt_cipher.h \
+src/headers/tomcrypt_pk.h src/headers/tomcrypt_hash.h src/headers/tomcrypt_math.h \
+src/headers/tomcrypt_misc.h src/headers/tomcrypt.h src/headers/tomcrypt_pkcs.h \
+src/headers/tomcrypt_prng.h testprof/tomcrypt_test.h
+
+#END_INS
+
+TESTOBJECTS=demos/test.o
+HASHOBJECTS=demos/hashsum.o
+CRYPTOBJECTS=demos/encrypt.o
+SMALLOBJECTS=demos/small.o
+TVS=demos/tv_gen.o
+MULTIS=demos/multi.o
+TIMINGS=demos/timing.o
+TESTS=demos/test.o
+
+#Files left over from making the crypt.pdf.
+LEFTOVERS=*.dvi *.log *.aux *.toc *.idx *.ilg *.ind *.out
+
+#Compressed filenames
+COMPRESSED=crypt-$(VERSION).tar.bz2 crypt-$(VERSION).zip
+
+#The default rule for make builds the libtomcrypt library.
+default:library
+
+#ciphers come in two flavours... enc+dec and enc 
+src/ciphers/aes/aes_enc.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+	$(CC) $(CFLAGS) -DENCRYPT_ONLY -c $< -o src/ciphers/aes/aes_enc.o
+
+#These are the rules to make certain object files.
+src/ciphers/aes/aes.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+src/ciphers/twofish/twofish.o: src/ciphers/twofish/twofish.c src/ciphers/twofish/twofish_tab.c
+src/hashes/whirl/whirl.o: src/hashes/whirl/whirl.c src/hashes/whirl/whirltab.c
+src/hashes/sha2/sha512.o: src/hashes/sha2/sha512.c src/hashes/sha2/sha384.c
+src/hashes/sha2/sha256.o: src/hashes/sha2/sha256.c src/hashes/sha2/sha224.c
+
+#This rule makes the libtomcrypt library.
+library: $(LIBNAME)
+
+testprof/$(LIBTEST): 
+	cd testprof ; CFLAGS="$(CFLAGS)" LIBTEST_S=$(LIBTEST_S) $(MAKE) 
+
+$(LIBNAME): $(OBJECTS)
+	$(AR) $(ARFLAGS) $@ $(OBJECTS) 
+	$(RANLIB) $@
+
+#This rule makes the hash program included with libtomcrypt
+hashsum: library $(HASHOBJECTS)
+	$(CC) $(HASHOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(HASH) $(WARN)
+
+#makes the crypt program
+crypt: library $(CRYPTOBJECTS)
+	$(CC) $(CRYPTOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(CRYPT) $(WARN)
+
+#makes the small program
+small: library $(SMALLOBJECTS)
+	$(CC) $(SMALLOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(SMALL) $(WARN)
+	
+tv_gen: library $(TVS)
+	$(CC) $(LDFLAGS) $(TVS) $(LIBNAME) $(EXTRALIBS) -o $(TV)
+
+multi: library $(MULTIS)
+	$(CC) $(MULTIS) $(LIBNAME) $(EXTRALIBS) -o $(MULTI)
+
+timing: library testprof/$(LIBTEST) $(TIMINGS)
+	$(CC) $(LDFLAGS) $(TIMINGS) testprof/$(LIBTEST) $(LIBNAME) $(EXTRALIBS) -o $(TIMING)
+
+test: library testprof/$(LIBTEST) $(TESTS)
+	$(CC) $(LDFLAGS) $(TESTS) testprof/$(LIBTEST) $(LIBNAME) $(EXTRALIBS) -o $(TEST)
+
+#This rule installs the library and the header files. This must be run
+#as root in order to have a high enough permission to write to the correct
+#directories and to set the owner and group to root.
+ifndef NODOCS
+install: library docs
+else
+install: library
+endif
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(DATAPATH)
+	install -g $(GROUP) -o $(USER) $(LIBNAME) $(DESTDIR)$(LIBPATH)
+	install -g $(GROUP) -o $(USER) $(HEADERS) $(DESTDIR)$(INCPATH)
+ifndef NODOCS
+	install -g $(GROUP) -o $(USER) doc/crypt.pdf $(DESTDIR)$(DATAPATH)
+endif
+
+install_test: testprof/$(LIBTEST)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
+	install -g $(GROUP) -o $(USER) testprof/$(LIBTEST) $(DESTDIR)$(LIBPATH)
+
+profile:
+	CFLAGS="$(CFLAGS) -fprofile-generate" $(MAKE) timing EXTRALIBS="$(EXTRALIBS) -lgcov"
+	./timing
+	rm -f timing `find . -type f | grep [.][ao] | xargs`
+	CFLAGS="$(CFLAGS) -fprofile-use" $(MAKE) timing EXTRALIBS="$(EXTRALIBS) -lgcov"
+
+
+#This rule cleans the source tree of all compiled code, not including the pdf
+#documentation.
+clean:
+	-rm -f $(OBJECTS)
+	-rm -f libtomcrypt.a
+
+#build the doxy files (requires Doxygen, tetex and patience)
+doxy:
+	doxygen
+	cd doc/doxygen/latex ; ${MAKE} ; mv -f refman.pdf ../../.
+	echo The huge doxygen PDF should be available as doc/refman.pdf
+	
+#This builds the crypt.pdf file. Note that the rm -f *.pdf has been removed
+#from the clean command! This is because most people would like to keep the
+#nice pre-compiled crypt.pdf that comes with libtomcrypt! We only need to
+#delete it if we are rebuilding it.
+docs: crypt.tex
+	rm -f doc/crypt.pdf $(LEFTOVERS)
+	echo "hello" > crypt.ind
+	latex crypt > /dev/null
+	latex crypt > /dev/null
+	makeindex crypt.idx > /dev/null
+	perl fixupind.pl
+	latex crypt > /dev/null
+	dvipdf crypt
+	mv -ivf crypt.pdf doc/crypt.pdf
+	rm -f $(LEFTOVERS)
+
+docdvi: crypt.tex
+	echo hello > crypt.ind
+	latex crypt > /dev/null
+	latex crypt > /dev/null
+	makeindex crypt.idx
+	perl fixupind.pl
+	latex crypt > /dev/null
+	latex crypt > /dev/null
+
+#zipup the project (take that!)
+no_oops: clean
+	cd .. ; cvs commit 
+	echo Scanning for scratch/dirty files
+	find . -type f | grep -v CVS | xargs -n 1 bash mess.sh
+
+zipup: no_oops docs
+	cd .. ; rm -rf crypt* libtomcrypt-$(VERSION) ; mkdir libtomcrypt-$(VERSION) ; \
+	cp -R ./libtomcrypt/* ./libtomcrypt-$(VERSION)/ ; \
+	cd libtomcrypt-$(VERSION) ; rm -rf `find . -type d | grep CVS | xargs` ; cd .. ; \
+	tar -cjvf crypt-$(VERSION).tar.bz2 libtomcrypt-$(VERSION) ; \
+	zip -9r crypt-$(VERSION).zip libtomcrypt-$(VERSION) ; \
+	gpg -b -a crypt-$(VERSION).tar.bz2 ; gpg -b -a crypt-$(VERSION).zip ; \
+	mv -fv crypt* ~ ; rm -rf libtomcrypt-$(VERSION)
+
+
+# $Source: /cvs/libtom/libtomcrypt/makefile,v $ 
+# $Revision: 1.145 $ 
+# $Date: 2006/12/02 19:23:21 $ 

libtomcrypt/README

@@ -0,0 +1,3 @@
+See doc/crypt.pdf
+
+

libtomcrypt/TODO

@@ -0,0 +1,11 @@
+stopped at ch12
+-- needs examples for ecc/dsa!!! (and for asn.1)
+
+must have for v1.16
+- document PK build flags
+- document makefile flags [INSTALL_* for instance]
+- prepare manual for printing (both soft and hard cover)
+
+Nice to have [in order of precedence]
+- add X9.63 IES
+- add CPP macros like OpenSSL has for ASN1 (e.g. encode/decode functions, etc) shameless ripoff :-)

libtomcrypt/build.sh

@@ -0,0 +1,20 @@
+#!/bin/bash
+echo "$1 ($2, $3)..."
+make clean 1>/dev/null 2>/dev/null
+echo -n "building..."
+CFLAGS="$2 $CFLAGS $4" EXTRALIBS="$5" make -j4 -f $3 test tv_gen 1>gcc_1.txt 2>gcc_2.txt || (echo "build $1 failed see gcc_2.txt for more information" && cat gcc_2.txt && exit 1)
+echo -n "testing..."
+if [ -a test ] && [ -f test ] && [ -x test ]; then
+   ((./test >test_std.txt 2>test_err.txt && ./tv_gen > tv.txt) && echo "$1 test passed." && echo "y" > testok.txt) || (echo "$1 test failed" && cat test_err.txt && exit 1)
+   if find *_tv.txt -type f 1>/dev/null 2>/dev/null ; then
+      for f in *_tv.txt; do if (diff --ignore-case $f notes/$f) then true; else (echo "tv_gen $f failed" && rm -f testok.txt && exit 1); fi; done
+   fi
+fi
+if [ -a testok.txt ] && [ -f testok.txt ]; then
+   exit 0
+fi
+exit 1
+
+# $Source: /cvs/libtom/libtomcrypt/build.sh,v $   
+# $Revision: 1.9 $   
+# $Date: 2006/03/18 14:10:55 $ 

libtomcrypt/crypt.lof

@@ -0,0 +1,24 @@
+\addvspace {10\p@ }
+\addvspace {10\p@ }
+\contentsline {figure}{\numberline {2.1}{\ignorespaces Load And Store Macros}}{9}{figure.2.1}
+\contentsline {figure}{\numberline {2.2}{\ignorespaces Rotate Macros}}{9}{figure.2.2}
+\addvspace {10\p@ }
+\contentsline {figure}{\numberline {3.1}{\ignorespaces Built--In Software Ciphers}}{19}{figure.3.1}
+\contentsline {figure}{\numberline {3.2}{\ignorespaces Twofish Build Options}}{21}{figure.3.2}
+\addvspace {10\p@ }
+\contentsline {figure}{\numberline {4.1}{\ignorespaces Built--In Software Hashes}}{57}{figure.4.1}
+\addvspace {10\p@ }
+\addvspace {10\p@ }
+\contentsline {figure}{\numberline {6.1}{\ignorespaces List of Provided PRNGs}}{82}{figure.6.1}
+\addvspace {10\p@ }
+\addvspace {10\p@ }
+\addvspace {10\p@ }
+\contentsline {figure}{\numberline {9.1}{\ignorespaces DSA Key Sizes}}{119}{figure.9.1}
+\addvspace {10\p@ }
+\contentsline {figure}{\numberline {10.1}{\ignorespaces List of ASN.1 Supported Types}}{127}{figure.10.1}
+\addvspace {10\p@ }
+\addvspace {10\p@ }
+\contentsline {figure}{\numberline {12.1}{\ignorespaces RSA/DH Key Strength}}{149}{figure.12.1}
+\contentsline {figure}{\numberline {12.2}{\ignorespaces ECC Key Strength}}{149}{figure.12.2}
+\addvspace {10\p@ }
+\addvspace {10\p@ }

libtomcrypt/demos/encrypt.c

@@ -0,0 +1,241 @@
+/* encrypt V1.1 Fri Oct 18 04:28:03 NZDT 2002 */
+/* File de/encryption, using libtomcrypt */
+/* Written by Daniel Richards <kyhwana@world-net.co.nz> */
+/* Help from Tom St Denis with various bits */
+/* This code is public domain, no rights reserved. */
+/* Encrypts by default, -d flag enables decryption */
+/* ie: ./encrypt blowfish story.txt story.ct */
+/* ./encrypt -d blowfish story.ct story.pt */
+
+#include <tomcrypt.h>
+
+int errno;
+
+int usage(char *name) 
+{
+   int x;
+
+   printf("Usage: %s [-d](ecrypt) cipher infile outfile\nCiphers:\n", name);
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      printf("%s\n",cipher_descriptor[x].name);
+   }
+   exit(1);
+}
+
+void register_algs(void)
+{
+   int x;
+   
+#ifdef RIJNDAEL
+  register_cipher (&aes_desc);
+#endif
+#ifdef BLOWFISH
+  register_cipher (&blowfish_desc);
+#endif
+#ifdef XTEA
+  register_cipher (&xtea_desc);
+#endif
+#ifdef RC5
+  register_cipher (&rc5_desc);
+#endif
+#ifdef RC6
+  register_cipher (&rc6_desc);
+#endif
+#ifdef SAFERP
+  register_cipher (&saferp_desc);
+#endif
+#ifdef TWOFISH
+  register_cipher (&twofish_desc);
+#endif
+#ifdef SAFER
+  register_cipher (&safer_k64_desc);
+  register_cipher (&safer_sk64_desc);
+  register_cipher (&safer_k128_desc);
+  register_cipher (&safer_sk128_desc);
+#endif
+#ifdef RC2
+  register_cipher (&rc2_desc);
+#endif
+#ifdef DES
+  register_cipher (&des_desc);
+  register_cipher (&des3_desc);
+#endif
+#ifdef CAST5
+  register_cipher (&cast5_desc);
+#endif
+#ifdef NOEKEON
+  register_cipher (&noekeon_desc);
+#endif
+#ifdef SKIPJACK
+  register_cipher (&skipjack_desc);
+#endif
+#ifdef KHAZAD
+  register_cipher (&khazad_desc);
+#endif
+#ifdef ANUBIS
+  register_cipher (&anubis_desc);
+#endif
+
+   if (register_hash(&sha256_desc) == -1) {
+      printf("Error registering SHA256\n");
+      exit(-1);
+   } 
+
+   if (register_prng(&yarrow_desc) == -1) {
+      printf("Error registering yarrow PRNG\n");
+      exit(-1);
+   }
+
+   if (register_prng(&sprng_desc) == -1) {
+      printf("Error registering sprng PRNG\n");
+      exit(-1);
+   }
+}
+
+int main(int argc, char *argv[]) 
+{
+   unsigned char plaintext[512],ciphertext[512];
+   unsigned char tmpkey[512], key[MAXBLOCKSIZE], IV[MAXBLOCKSIZE];
+   unsigned char inbuf[512]; /* i/o block size */
+   unsigned long outlen, y, ivsize, x, decrypt;
+   symmetric_CTR ctr;
+   int cipher_idx, hash_idx, ks;
+   char *infile, *outfile, *cipher;
+   prng_state prng;
+   FILE *fdin, *fdout;
+
+   /* register algs, so they can be printed */
+   register_algs();
+
+   if (argc < 4) {
+      return usage(argv[0]);
+   }
+
+   if (!strcmp(argv[1], "-d")) {
+      decrypt = 1;
+      cipher  = argv[2];
+      infile  = argv[3];
+      outfile = argv[4];
+   } else {
+      decrypt = 0;
+      cipher  = argv[1];
+      infile  = argv[2];
+      outfile = argv[3];
+   }   
+
+   /* file handles setup */
+   fdin = fopen(infile,"rb");
+   if (fdin == NULL) {
+      perror("Can't open input for reading");
+      exit(-1);
+   }
+
+   fdout = fopen(outfile,"wb");
+   if (fdout == NULL) { 
+      perror("Can't open output for writing");
+      exit(-1);
+   }
+ 
+   cipher_idx = find_cipher(cipher);
+   if (cipher_idx == -1) {
+      printf("Invalid cipher entered on command line.\n");
+      exit(-1);
+   }
+
+   hash_idx = find_hash("sha256");
+   if (hash_idx == -1) {
+      printf("SHA256 not found...?\n");
+      exit(-1);
+   }
+
+   ivsize = cipher_descriptor[cipher_idx].block_length;
+   ks = hash_descriptor[hash_idx].hashsize;
+   if (cipher_descriptor[cipher_idx].keysize(&ks) != CRYPT_OK) { 
+      printf("Invalid keysize???\n");
+      exit(-1);
+   }
+
+   printf("\nEnter key: ");
+   fgets((char *)tmpkey,sizeof(tmpkey), stdin);
+   outlen = sizeof(key);
+   if ((errno = hash_memory(hash_idx,tmpkey,strlen((char *)tmpkey),key,&outlen)) != CRYPT_OK) {
+      printf("Error hashing key: %s\n", error_to_string(errno));
+      exit(-1);
+   }
+   
+   if (decrypt) {
+      /* Need to read in IV */
+      if (fread(IV,1,ivsize,fdin) != ivsize) {
+         printf("Error reading IV from input.\n");
+         exit(-1);
+      }
+   
+      if ((errno = ctr_start(cipher_idx,IV,key,ks,0,CTR_COUNTER_LITTLE_ENDIAN,&ctr)) != CRYPT_OK) {
+         printf("ctr_start error: %s\n",error_to_string(errno));
+         exit(-1);
+      }
+
+      /* IV done */
+      do {
+         y = fread(inbuf,1,sizeof(inbuf),fdin);
+
+         if ((errno = ctr_decrypt(inbuf,plaintext,y,&ctr)) != CRYPT_OK) {
+            printf("ctr_decrypt error: %s\n", error_to_string(errno));
+            exit(-1);
+         }
+
+         if (fwrite(plaintext,1,y,fdout) != y) {
+            printf("Error writing to file.\n");
+            exit(-1);
+         }
+      } while (y == sizeof(inbuf));
+      fclose(fdin);
+      fclose(fdout);
+
+   } else {  /* encrypt */
+      /* Setup yarrow for random bytes for IV */
+      
+      if ((errno = rng_make_prng(128, find_prng("yarrow"), &prng, NULL)) != CRYPT_OK) {
+         printf("Error setting up PRNG, %s\n", error_to_string(errno));
+      }      
+
+      /* You can use rng_get_bytes on platforms that support it */
+      /* x = rng_get_bytes(IV,ivsize,NULL);*/
+      x = yarrow_read(IV,ivsize,&prng);
+      if (x != ivsize) {
+         printf("Error reading PRNG for IV required.\n");
+         exit(-1);
+      }
+   
+      if (fwrite(IV,1,ivsize,fdout) != ivsize) {
+         printf("Error writing IV to output.\n");
+         exit(-1);
+      }
+
+      if ((errno = ctr_start(cipher_idx,IV,key,ks,0,CTR_COUNTER_LITTLE_ENDIAN,&ctr)) != CRYPT_OK) {
+         printf("ctr_start error: %s\n",error_to_string(errno));
+         exit(-1);
+      }
+
+      do {
+         y = fread(inbuf,1,sizeof(inbuf),fdin);
+
+         if ((errno = ctr_encrypt(inbuf,ciphertext,y,&ctr)) != CRYPT_OK) {
+            printf("ctr_encrypt error: %s\n", error_to_string(errno));
+            exit(-1);
+         }
+
+         if (fwrite(ciphertext,1,y,fdout) != y) {
+            printf("Error writing to output.\n");
+            exit(-1);
+         }
+      } while (y == sizeof(inbuf));   
+      fclose(fdout);
+      fclose(fdin);
+   }
+   return 0;
+}
+
+/* $Source: /cvs/libtom/libtomcrypt/demos/encrypt.c,v $ */
+/* $Revision: 1.3 $ */
+/* $Date: 2005/08/04 20:43:50 $ */

libtomcrypt/demos/hashsum.c

@@ -0,0 +1,119 @@
+/*
+ * Written by Daniel Richards <kyhwana@world-net.co.nz> 6/7/2002
+ * hash.c: This app uses libtomcrypt to hash either stdin or a file
+ * This file is Public Domain. No rights are reserved.
+ * Compile with 'gcc hashsum.c -o hashsum -ltomcrypt'
+ * This example isn't really big enough to warrent splitting into
+ * more functions ;)
+*/
+
+#include <tomcrypt.h>
+
+int errno;
+
+void register_algs();
+
+int main(int argc, char **argv)
+{
+   int idx, x, z;
+   unsigned long w;
+   unsigned char hash_buffer[MAXBLOCKSIZE];
+   hash_state md;
+
+   /* You need to register algorithms before using them */
+   register_algs();
+   if (argc < 2) {
+      printf("usage: ./hash algorithm file [file ...]\n");
+      printf("Algorithms:\n");
+      for (x = 0; hash_descriptor[x].name != NULL; x++) {
+         printf(" %s (%d)\n", hash_descriptor[x].name, hash_descriptor[x].ID);
+      }
+      exit(EXIT_SUCCESS);
+   }
+
+   idx = find_hash(argv[1]);
+   if (idx == -1) {
+      fprintf(stderr, "\nInvalid hash specified on command line.\n");
+      return -1;
+   }
+
+   if (argc == 2) {
+      hash_descriptor[idx].init(&md);
+      do {
+         x = fread(hash_buffer, 1, sizeof(hash_buffer), stdin);
+         hash_descriptor[idx].process(&md, hash_buffer, x);
+      } while (x == sizeof(hash_buffer));
+      hash_descriptor[idx].done(&md, hash_buffer);
+      for (x = 0; x < (int)hash_descriptor[idx].hashsize; x++) {
+          printf("%02x",hash_buffer[x]);
+      }
+      printf("  (stdin)\n");
+   } else {
+      for (z = 2; z < argc; z++) {
+         w = sizeof(hash_buffer);
+         if ((errno = hash_file(idx,argv[z],hash_buffer,&w)) != CRYPT_OK) {
+            printf("File hash error: %s\n", error_to_string(errno));
+         } else {
+             for (x = 0; x < (int)hash_descriptor[idx].hashsize; x++) {
+                 printf("%02x",hash_buffer[x]);
+             }
+             printf("  %s\n", argv[z]);
+         }
+      }
+   }
+   return EXIT_SUCCESS;
+}
+
+void register_algs(void)
+{
+  int err;
+
+#ifdef TIGER
+  register_hash (&tiger_desc);
+#endif
+#ifdef MD2
+  register_hash (&md2_desc);
+#endif
+#ifdef MD4
+  register_hash (&md4_desc);
+#endif
+#ifdef MD5
+  register_hash (&md5_desc);
+#endif
+#ifdef SHA1
+  register_hash (&sha1_desc);
+#endif
+#ifdef SHA224
+  register_hash (&sha224_desc);
+#endif
+#ifdef SHA256
+  register_hash (&sha256_desc);
+#endif
+#ifdef SHA384
+  register_hash (&sha384_desc);
+#endif
+#ifdef SHA512
+  register_hash (&sha512_desc);
+#endif
+#ifdef RIPEMD128
+  register_hash (&rmd128_desc);
+#endif
+#ifdef RIPEMD160
+  register_hash (&rmd160_desc);
+#endif
+#ifdef WHIRLPOOL
+  register_hash (&whirlpool_desc);
+#endif
+#ifdef CHC_HASH
+  register_hash(&chc_desc);
+  if ((err = chc_register(register_cipher(&aes_enc_desc))) != CRYPT_OK) {
+     printf("chc_register error: %s\n", error_to_string(err));
+     exit(EXIT_FAILURE);
+  }
+#endif
+
+}
+
+/* $Source: /cvs/libtom/libtomcrypt/demos/hashsum.c,v $ */
+/* $Revision: 1.2 $ */
+/* $Date: 2005/05/05 14:35:56 $ */

libtomcrypt/demos/multi.c

@@ -0,0 +1,110 @@
+/* test the multi helpers... */
+#include <tomcrypt.h>
+
+int main(void)
+{
+   unsigned char key[16], buf[2][MAXBLOCKSIZE];
+   unsigned long len, len2;
+
+
+/* register algos */
+   register_hash(&sha256_desc);
+   register_cipher(&aes_desc);
+
+/* HASH testing */
+   len = sizeof(buf[0]);
+   hash_memory(find_hash("sha256"), (unsigned char*)"hello", 5, buf[0], &len);
+   len2 = sizeof(buf[0]);
+   hash_memory_multi(find_hash("sha256"), buf[1], &len2, (unsigned char*)"hello", 5, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   hash_memory_multi(find_hash("sha256"), buf[1], &len2, (unsigned char*)"he", 2UL, "llo", 3UL, NULL, 0);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   hash_memory_multi(find_hash("sha256"), buf[1], &len2, (unsigned char*)"h", 1UL, "e", 1UL, "l", 1UL, "l", 1UL, "o", 1UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+
+/* HMAC */
+   len = sizeof(buf[0]);
+   hmac_memory(find_hash("sha256"), key, 16, (unsigned char*)"hello", 5, buf[0], &len);
+   len2 = sizeof(buf[0]);
+   hmac_memory_multi(find_hash("sha256"), key, 16, buf[1], &len2, (unsigned char*)"hello", 5UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   hmac_memory_multi(find_hash("sha256"), key, 16, buf[1], &len2, (unsigned char*)"he", 2UL, "llo", 3UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   hmac_memory_multi(find_hash("sha256"), key, 16, buf[1], &len2, (unsigned char*)"h", 1UL, "e", 1UL, "l", 1UL, "l", 1UL, "o", 1UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+
+/* OMAC */
+   len = sizeof(buf[0]);
+   omac_memory(find_cipher("aes"), key, 16, (unsigned char*)"hello", 5, buf[0], &len);
+   len2 = sizeof(buf[0]);
+   omac_memory_multi(find_cipher("aes"), key, 16, buf[1], &len2, (unsigned char*)"hello", 5UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   omac_memory_multi(find_cipher("aes"), key, 16, buf[1], &len2, (unsigned char*)"he", 2UL, "llo", 3UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   omac_memory_multi(find_cipher("aes"), key, 16, buf[1], &len2, (unsigned char*)"h", 1UL, "e", 1UL, "l", 1UL, "l", 1UL, "o", 1UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+
+/* PMAC */
+   len = sizeof(buf[0]);
+   pmac_memory(find_cipher("aes"), key, 16, (unsigned char*)"hello", 5, buf[0], &len);
+   len2 = sizeof(buf[0]);
+   pmac_memory_multi(find_cipher("aes"), key, 16, buf[1], &len2, (unsigned char*)"hello", 5, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   pmac_memory_multi(find_cipher("aes"), key, 16, buf[1], &len2, (unsigned char*)"he", 2UL, "llo", 3UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+   len2 = sizeof(buf[0]);
+   pmac_memory_multi(find_cipher("aes"), key, 16, buf[1], &len2, (unsigned char*)"h", 1UL, "e", 1UL, "l", 1UL, "l", 1UL, "o", 1UL, NULL);
+   if (len != len2 || memcmp(buf[0], buf[1], len)) {
+      printf("Failed: %d %lu %lu\n", __LINE__, len, len2);
+      return EXIT_FAILURE;
+   }
+
+
+   printf("All passed\n");
+   return EXIT_SUCCESS;
+}
+
+
+/* $Source: /cvs/libtom/libtomcrypt/demos/multi.c,v $ */
+/* $Revision: 1.3 $ */
+/* $Date: 2006/06/07 22:25:09 $ */

libtomcrypt/demos/small.c

@@ -0,0 +1,14 @@
+/* small demo app that just includes a cipher/hash/prng */
+#include <tomcrypt.h>
+
+int main(void)
+{
+   register_cipher(&rijndael_enc_desc);
+   register_prng(&yarrow_desc);
+   register_hash(&sha256_desc);
+   return 0;
+}
+
+/* $Source: /cvs/libtom/libtomcrypt/demos/small.c,v $ */
+/* $Revision: 1.3 $ */
+/* $Date: 2006/06/07 22:25:09 $ */

libtomcrypt/demos/test.c

@@ -0,0 +1,36 @@
+#include <tomcrypt_test.h>
+
+int main(void)
+{
+   int x;
+   reg_algs();
+
+#ifdef USE_LTM
+   ltc_mp = ltm_desc;
+#elif defined(USE_TFM)
+   ltc_mp = tfm_desc;
+#elif defined(USE_GMP)
+   ltc_mp = gmp_desc;
+#else
+   extern ltc_math_descriptor EXT_MATH_LIB;
+   ltc_mp = EXT_MATH_LIB;
+#endif
+
+   printf("build == \n%s\n", crypt_build_settings);
+   printf("\nstore_test...."); fflush(stdout); x = store_test();       printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\ncipher_test..."); fflush(stdout); x = cipher_hash_test(); printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\nmodes_test...."); fflush(stdout); x = modes_test();       printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\nder_test......"); fflush(stdout); x = der_tests();        printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\nmac_test......"); fflush(stdout); x = mac_test();         printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\npkcs_1_test..."); fflush(stdout); x = pkcs_1_test();      printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\nrsa_test......"); fflush(stdout); x = rsa_test();         printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\necc_test......"); fflush(stdout); x = ecc_tests();        printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE); 
+   printf("\ndsa_test......"); fflush(stdout); x = dsa_test();         printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\nkatja_test...."); fflush(stdout); x = katja_test();       printf(x ? "failed" : "passed");if (x) exit(EXIT_FAILURE);
+   printf("\n");
+   return EXIT_SUCCESS;
+}
+
+/* $Source: /cvs/libtom/libtomcrypt/demos/test.c,v $ */
+/* $Revision: 1.28 $ */
+/* $Date: 2006/05/25 10:50:08 $ */

libtomcrypt/demos/timing.c

@@ -0,0 +1,42 @@
+#include <tomcrypt_test.h>
+
+int main(void)
+{
+
+init_timer();
+reg_algs();
+
+#ifdef USE_LTM
+   ltc_mp = ltm_desc;
+#elif defined(USE_TFM)
+   ltc_mp = tfm_desc;
+#elif defined(USE_GMP)
+   ltc_mp = gmp_desc;
+#else
+   extern ltc_math_descriptor EXT_MATH_LIB;
+   ltc_mp = EXT_MATH_LIB;
+#endif
+
+time_keysched();
+time_cipher();
+time_cipher2();
+time_cipher3();
+time_cipher4();
+time_hash();
+time_macs();
+time_encmacs();
+time_prng();
+time_mult();
+time_sqr();
+time_rsa();
+time_ecc();
+#ifdef USE_LTM
+time_katja();
+#endif
+return EXIT_SUCCESS;
+
+}
+
+/* $Source: /cvs/libtom/libtomcrypt/demos/timing.c,v $ */
+/* $Revision: 1.61 $ */
+/* $Date: 2006/12/03 03:08:35 $ */

libtomcrypt/demos/tv_gen.c

@@ -0,0 +1,786 @@
+#include <tomcrypt.h>
+
+void reg_algs(void)
+{
+  int err;
+
+#ifdef RIJNDAEL
+  register_cipher (&aes_desc);
+#endif
+#ifdef BLOWFISH
+  register_cipher (&blowfish_desc);
+#endif
+#ifdef XTEA
+  register_cipher (&xtea_desc);
+#endif
+#ifdef RC5
+  register_cipher (&rc5_desc);
+#endif
+#ifdef RC6
+  register_cipher (&rc6_desc);
+#endif
+#ifdef SAFERP
+  register_cipher (&saferp_desc);
+#endif
+#ifdef TWOFISH
+  register_cipher (&twofish_desc);
+#endif
+#ifdef SAFER
+  register_cipher (&safer_k64_desc);
+  register_cipher (&safer_sk64_desc);
+  register_cipher (&safer_k128_desc);
+  register_cipher (&safer_sk128_desc);
+#endif
+#ifdef RC2
+  register_cipher (&rc2_desc);
+#endif
+#ifdef DES
+  register_cipher (&des_desc);
+  register_cipher (&des3_desc);
+#endif
+#ifdef CAST5
+  register_cipher (&cast5_desc);
+#endif
+#ifdef NOEKEON
+  register_cipher (&noekeon_desc);
+#endif
+#ifdef SKIPJACK
+  register_cipher (&skipjack_desc);
+#endif
+#ifdef ANUBIS
+  register_cipher (&anubis_desc);
+#endif
+#ifdef KHAZAD
+  register_cipher (&khazad_desc);
+#endif
+
+#ifdef TIGER
+  register_hash (&tiger_desc);
+#endif
+#ifdef MD2
+  register_hash (&md2_desc);
+#endif
+#ifdef MD4
+  register_hash (&md4_desc);
+#endif
+#ifdef MD5
+  register_hash (&md5_desc);
+#endif
+#ifdef SHA1
+  register_hash (&sha1_desc);
+#endif
+#ifdef SHA224
+  register_hash (&sha224_desc);
+#endif
+#ifdef SHA256
+  register_hash (&sha256_desc);
+#endif
+#ifdef SHA384
+  register_hash (&sha384_desc);
+#endif
+#ifdef SHA512
+  register_hash (&sha512_desc);
+#endif
+#ifdef RIPEMD128
+  register_hash (&rmd128_desc);
+#endif
+#ifdef RIPEMD160
+  register_hash (&rmd160_desc);
+#endif
+#ifdef WHIRLPOOL
+  register_hash (&whirlpool_desc);
+#endif
+#ifdef CHC_HASH
+  register_hash(&chc_desc);
+  if ((err = chc_register(register_cipher(&aes_desc))) != CRYPT_OK) {
+     printf("chc_register error: %s\n", error_to_string(err));
+     exit(EXIT_FAILURE);
+  }
+#endif
+
+#ifdef USE_LTM
+   ltc_mp = ltm_desc;
+#elif defined(USE_TFM)
+   ltc_mp = tfm_desc;
+#elif defined(USE_GMP)
+   ltc_mp = gmp_desc;
+#else
+   extern ltc_math_descriptor EXT_MATH_LIB;
+   ltc_mp = EXT_MATH_LIB;
+#endif
+
+
+}
+
+void hash_gen(void)
+{
+   unsigned char md[MAXBLOCKSIZE], *buf;
+   unsigned long outlen, x, y, z;
+   FILE *out;
+   int   err;
+   
+   out = fopen("hash_tv.txt", "w");
+   if (out == NULL) {
+      perror("can't open hash_tv");
+   }
+   
+   fprintf(out, "Hash Test Vectors:\n\nThese are the hashes of nn bytes '00 01 02 03 .. (nn-1)'\n\n");
+   for (x = 0; hash_descriptor[x].name != NULL; x++) {
+      buf = XMALLOC(2 * hash_descriptor[x].blocksize + 1);
+      if (buf == NULL) {
+         perror("can't alloc mem");
+         exit(EXIT_FAILURE);
+      }
+      fprintf(out, "Hash: %s\n", hash_descriptor[x].name);
+      for (y = 0; y <= (hash_descriptor[x].blocksize * 2); y++) {
+         for (z = 0; z < y; z++) {
+            buf[z] = (unsigned char)(z & 255);
+         }
+         outlen = sizeof(md);
+         if ((err = hash_memory(x, buf, y, md, &outlen)) != CRYPT_OK) {
+            printf("hash_memory error: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3lu: ", y);
+         for (z = 0; z < outlen; z++) {
+            fprintf(out, "%02X", md[z]);
+         }
+         fprintf(out, "\n");
+      }
+      fprintf(out, "\n");
+      XFREE(buf);
+   }
+   fclose(out);
+}
+
+void cipher_gen(void)
+{
+   unsigned char *key, pt[MAXBLOCKSIZE];
+   unsigned long x, y, z, w;
+   int err, kl, lastkl;
+   FILE *out;
+   symmetric_key skey;
+   
+   out = fopen("cipher_tv.txt", "w");
+   
+   fprintf(out, 
+"Cipher Test Vectors\n\nThese are test encryptions with key of nn bytes '00 01 02 03 .. (nn-1)' and original PT of the same style.\n"
+"The output of step N is used as the key and plaintext for step N+1 (key bytes repeated as required to fill the key)\n\n");
+                   
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      fprintf(out, "Cipher: %s\n", cipher_descriptor[x].name);
+      
+      /* three modes, smallest, medium, large keys */
+      lastkl = 10000;
+      for (y = 0; y < 3; y++) {
+         switch (y) {
+            case 0: kl = cipher_descriptor[x].min_key_length; break;
+            case 1: kl = (cipher_descriptor[x].min_key_length + cipher_descriptor[x].max_key_length)/2; break;
+            case 2: kl = cipher_descriptor[x].max_key_length; break;
+         }
+         if ((err = cipher_descriptor[x].keysize(&kl)) != CRYPT_OK) {
+            printf("keysize error: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         if (kl == lastkl) break;
+         lastkl = kl;
+         fprintf(out, "Key Size: %d bytes\n", kl);
+
+         key = XMALLOC(kl);
+         if (key == NULL) {
+            perror("can't malloc memory");
+            exit(EXIT_FAILURE);
+         }
+
+         for (z = 0; (int)z < kl; z++) {
+             key[z] = (unsigned char)z;
+         }
+         if ((err = cipher_descriptor[x].setup(key, kl, 0, &skey)) != CRYPT_OK) {
+            printf("setup error: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         
+         for (z = 0; (int)z < cipher_descriptor[x].block_length; z++) {
+            pt[z] = (unsigned char)z;
+         }
+         for (w = 0; w < 50; w++) {
+             cipher_descriptor[x].ecb_encrypt(pt, pt, &skey);
+             fprintf(out, "%2lu: ", w);
+             for (z = 0; (int)z < cipher_descriptor[x].block_length; z++) {
+                fprintf(out, "%02X", pt[z]);
+             }
+             fprintf(out, "\n");
+
+             /* reschedule a new key */
+             for (z = 0; z < (unsigned long)kl; z++) {
+                 key[z] = pt[z % cipher_descriptor[x].block_length];
+             }
+             if ((err = cipher_descriptor[x].setup(key, kl, 0, &skey)) != CRYPT_OK) {
+                printf("cipher setup2 error: %s\n", error_to_string(err));
+                exit(EXIT_FAILURE);
+             }
+         }
+         fprintf(out, "\n");
+         XFREE(key);
+     }
+     fprintf(out, "\n");
+  }
+  fclose(out);
+}  
+
+void hmac_gen(void)
+{
+   unsigned char key[MAXBLOCKSIZE], output[MAXBLOCKSIZE], *input;
+   int x, y, z, err;
+   FILE *out;
+   unsigned long len;
+  
+   out = fopen("hmac_tv.txt", "w");
+
+   fprintf(out, 
+"HMAC Tests.  In these tests messages of N bytes long (00,01,02,...,NN-1) are HMACed.  The initial key is\n"
+"of the same format (the same length as the HASH output size).  The HMAC key in step N+1 is the HMAC output of\n"
+"step N.\n\n");
+
+   for (x = 0; hash_descriptor[x].name != NULL; x++) {
+      fprintf(out, "HMAC-%s\n", hash_descriptor[x].name);
+      
+      /* initial key */
+      for (y = 0; y < (int)hash_descriptor[x].hashsize; y++) {
+          key[y] = (y&255);
+      }
+
+      input = XMALLOC(hash_descriptor[x].blocksize * 2 + 1);
+      if (input == NULL) {
+         perror("Can't malloc memory");
+         exit(EXIT_FAILURE);
+      }
+      
+      for (y = 0; y <= (int)(hash_descriptor[x].blocksize * 2); y++) {
+         for (z = 0; z < y; z++) {
+            input[z] = (unsigned char)(z & 255);
+         }
+         len = sizeof(output);
+         if ((err = hmac_memory(x, key, hash_descriptor[x].hashsize, input, y, output, &len)) != CRYPT_OK) {
+            printf("Error hmacing: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3d: ", y);
+         for (z = 0; z <(int) len; z++) {
+            fprintf(out, "%02X", output[z]);
+         }
+         fprintf(out, "\n");
+
+         /* forward the key */
+         memcpy(key, output, hash_descriptor[x].hashsize);
+      }
+      XFREE(input);
+      fprintf(out, "\n");
+   }
+   fclose(out);
+}
+   
+void omac_gen(void)
+{
+   unsigned char key[MAXBLOCKSIZE], output[MAXBLOCKSIZE], input[MAXBLOCKSIZE*2+2];
+   int err, x, y, z, kl;
+   FILE *out;
+   unsigned long len;
+  
+   out = fopen("omac_tv.txt", "w");
+
+   fprintf(out, 
+"OMAC Tests.  In these tests messages of N bytes long (00,01,02,...,NN-1) are OMAC'ed.  The initial key is\n"
+"of the same format (length specified per cipher).  The OMAC key in step N+1 is the OMAC output of\n"
+"step N (repeated as required to fill the array).\n\n");
+
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      kl = cipher_descriptor[x].block_length;
+
+      /* skip ciphers which do not have 64 or 128 bit block sizes */
+      if (kl != 8 && kl != 16) continue;
+
+      if (cipher_descriptor[x].keysize(&kl) != CRYPT_OK) {
+         kl = cipher_descriptor[x].max_key_length;
+      }
+      fprintf(out, "OMAC-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
+      
+      /* initial key/block */
+      for (y = 0; y < kl; y++) {
+          key[y] = (y & 255);
+      }
+      
+      for (y = 0; y <= (int)(cipher_descriptor[x].block_length*2); y++) {
+         for (z = 0; z < y; z++) {
+            input[z] = (unsigned char)(z & 255);
+         }
+         len = sizeof(output);
+         if ((err = omac_memory(x, key, kl, input, y, output, &len)) != CRYPT_OK) {
+            printf("Error omacing: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3d: ", y);
+         for (z = 0; z <(int)len; z++) {
+            fprintf(out, "%02X", output[z]);
+         }
+         fprintf(out, "\n");
+
+         /* forward the key */
+         for (z = 0; z < kl; z++) {
+             key[z] = output[z % len];
+         }
+      }
+      fprintf(out, "\n");
+   }
+   fclose(out);
+}
+
+void pmac_gen(void)
+{
+   unsigned char key[MAXBLOCKSIZE], output[MAXBLOCKSIZE], input[MAXBLOCKSIZE*2+2];
+   int err, x, y, z, kl;
+   FILE *out;
+   unsigned long len;
+  
+   out = fopen("pmac_tv.txt", "w");
+
+   fprintf(out, 
+"PMAC Tests.  In these tests messages of N bytes long (00,01,02,...,NN-1) are OMAC'ed.  The initial key is\n"
+"of the same format (length specified per cipher).  The OMAC key in step N+1 is the OMAC output of\n"
+"step N (repeated as required to fill the array).\n\n");
+
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      kl = cipher_descriptor[x].block_length;
+
+      /* skip ciphers which do not have 64 or 128 bit block sizes */
+      if (kl != 8 && kl != 16) continue;
+
+      if (cipher_descriptor[x].keysize(&kl) != CRYPT_OK) {
+         kl = cipher_descriptor[x].max_key_length;
+      }
+      fprintf(out, "PMAC-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
+      
+      /* initial key/block */
+      for (y = 0; y < kl; y++) {
+          key[y] = (y & 255);
+      }
+      
+      for (y = 0; y <= (int)(cipher_descriptor[x].block_length*2); y++) {
+         for (z = 0; z < y; z++) {
+            input[z] = (unsigned char)(z & 255);
+         }
+         len = sizeof(output);
+         if ((err = pmac_memory(x, key, kl, input, y, output, &len)) != CRYPT_OK) {
+            printf("Error omacing: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3d: ", y);
+         for (z = 0; z <(int)len; z++) {
+            fprintf(out, "%02X", output[z]);
+         }
+         fprintf(out, "\n");
+
+         /* forward the key */
+         for (z = 0; z < kl; z++) {
+             key[z] = output[z % len];
+         }
+      }
+      fprintf(out, "\n");
+   }
+   fclose(out);
+}
+
+void eax_gen(void)
+{
+   int err, kl, x, y1, z;
+   FILE *out;
+   unsigned char key[MAXBLOCKSIZE], nonce[MAXBLOCKSIZE*2], header[MAXBLOCKSIZE*2], 
+                 plaintext[MAXBLOCKSIZE*2], tag[MAXBLOCKSIZE];
+   unsigned long len;
+
+   out = fopen("eax_tv.txt", "w");
+   fprintf(out, "EAX Test Vectors.  Uses the 00010203...NN-1 pattern for header/nonce/plaintext/key.  The outputs\n"
+                "are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous\n"
+                "step repeated sufficiently.\n\n");
+
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      kl = cipher_descriptor[x].block_length;
+
+      /* skip ciphers which do not have 64 or 128 bit block sizes */
+      if (kl != 8 && kl != 16) continue;
+
+      if (cipher_descriptor[x].keysize(&kl) != CRYPT_OK) {
+         kl = cipher_descriptor[x].max_key_length;
+      }
+      fprintf(out, "EAX-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
+
+      /* the key */
+      for (z = 0; z < kl; z++) {
+          key[z] = (z & 255);
+      }
+      
+      for (y1 = 0; y1 <= (int)(cipher_descriptor[x].block_length*2); y1++){
+         for (z = 0; z < y1; z++) {
+            plaintext[z] = (unsigned char)(z & 255);
+            nonce[z]     = (unsigned char)(z & 255);
+            header[z]    = (unsigned char)(z & 255);
+         }
+         len = sizeof(tag);
+         if ((err = eax_encrypt_authenticate_memory(x, key, kl, nonce, y1, header, y1, plaintext, y1, plaintext, tag, &len)) != CRYPT_OK) {
+            printf("Error EAX'ing: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3d: ", y1);
+         for (z = 0; z < y1; z++) {
+            fprintf(out, "%02X", plaintext[z]);
+         }
+         fprintf(out, ", ");
+         for (z = 0; z <(int)len; z++) {
+            fprintf(out, "%02X", tag[z]);
+         }
+         fprintf(out, "\n");
+
+         /* forward the key */
+         for (z = 0; z < kl; z++) {
+             key[z] = tag[z % len];
+         }
+      }
+      fprintf(out, "\n");
+   }
+   fclose(out);
+}
+
+void ocb_gen(void)
+{
+   int err, kl, x, y1, z;
+   FILE *out;
+   unsigned char key[MAXBLOCKSIZE], nonce[MAXBLOCKSIZE*2], 
+                 plaintext[MAXBLOCKSIZE*2], tag[MAXBLOCKSIZE];
+   unsigned long len;
+
+   out = fopen("ocb_tv.txt", "w");
+   fprintf(out, "OCB Test Vectors.  Uses the 00010203...NN-1 pattern for nonce/plaintext/key.  The outputs\n"
+                "are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous\n"
+                "step repeated sufficiently.  The nonce is fixed throughout.\n\n");
+
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      kl = cipher_descriptor[x].block_length;
+
+      /* skip ciphers which do not have 64 or 128 bit block sizes */
+      if (kl != 8 && kl != 16) continue;
+
+      if (cipher_descriptor[x].keysize(&kl) != CRYPT_OK) {
+         kl = cipher_descriptor[x].max_key_length;
+      }
+      fprintf(out, "OCB-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
+
+      /* the key */
+      for (z = 0; z < kl; z++) {
+          key[z] = (z & 255);
+      }
+
+      /* fixed nonce */
+      for (z = 0; z < cipher_descriptor[x].block_length; z++) {
+          nonce[z] = z;
+      }
+      
+      for (y1 = 0; y1 <= (int)(cipher_descriptor[x].block_length*2); y1++){
+         for (z = 0; z < y1; z++) {
+            plaintext[z] = (unsigned char)(z & 255);
+         }
+         len = sizeof(tag);
+         if ((err = ocb_encrypt_authenticate_memory(x, key, kl, nonce, plaintext, y1, plaintext, tag, &len)) != CRYPT_OK) {
+            printf("Error OCB'ing: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3d: ", y1);
+         for (z = 0; z < y1; z++) {
+            fprintf(out, "%02X", plaintext[z]);
+         }
+         fprintf(out, ", ");
+         for (z = 0; z <(int)len; z++) {
+            fprintf(out, "%02X", tag[z]);
+         }
+         fprintf(out, "\n");
+
+         /* forward the key */
+         for (z = 0; z < kl; z++) {
+             key[z] = tag[z % len];
+         }
+      }
+      fprintf(out, "\n");
+   }
+   fclose(out);
+}
+
+
+void ccm_gen(void)
+{
+   int err, kl, x, y1, z;
+   FILE *out;
+   unsigned char key[MAXBLOCKSIZE], nonce[MAXBLOCKSIZE*2], 
+                 plaintext[MAXBLOCKSIZE*2], tag[MAXBLOCKSIZE];
+   unsigned long len;
+
+   out = fopen("ccm_tv.txt", "w");
+   fprintf(out, "CCM Test Vectors.  Uses the 00010203...NN-1 pattern for nonce/header/plaintext/key.  The outputs\n"
+                "are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous\n"
+                "step repeated sufficiently.  The nonce is fixed throughout at 13 bytes 000102...\n\n");
+
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      kl = cipher_descriptor[x].block_length;
+
+      /* skip ciphers which do not have 128 bit block sizes */
+      if (kl != 16) continue;
+
+      if (cipher_descriptor[x].keysize(&kl) != CRYPT_OK) {
+         kl = cipher_descriptor[x].max_key_length;
+      }
+      fprintf(out, "CCM-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
+
+      /* the key */
+      for (z = 0; z < kl; z++) {
+          key[z] = (z & 255);
+      }
+
+      /* fixed nonce */
+      for (z = 0; z < cipher_descriptor[x].block_length; z++) {
+          nonce[z] = z;
+      }
+      
+      for (y1 = 0; y1 <= (int)(cipher_descriptor[x].block_length*2); y1++){
+         for (z = 0; z < y1; z++) {
+            plaintext[z] = (unsigned char)(z & 255);
+         }
+         len = sizeof(tag);
+         if ((err = ccm_memory(x, key, kl, NULL, nonce, 13, plaintext, y1, plaintext, y1, plaintext, tag, &len, CCM_ENCRYPT)) != CRYPT_OK) {
+            printf("Error CCM'ing: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3d: ", y1);
+         for (z = 0; z < y1; z++) {
+            fprintf(out, "%02X", plaintext[z]);
+         }
+         fprintf(out, ", ");
+         for (z = 0; z <(int)len; z++) {
+            fprintf(out, "%02X", tag[z]);
+         }
+         fprintf(out, "\n");
+
+         /* forward the key */
+         for (z = 0; z < kl; z++) {
+             key[z] = tag[z % len];
+         }
+      }
+      fprintf(out, "\n");
+   }
+   fclose(out);
+}
+
+void gcm_gen(void)
+{
+   int err, kl, x, y1, z;
+   FILE *out;
+   unsigned char key[MAXBLOCKSIZE], plaintext[MAXBLOCKSIZE*2], tag[MAXBLOCKSIZE];
+   unsigned long len;
+
+   out = fopen("gcm_tv.txt", "w");
+   fprintf(out, "GCM Test Vectors.  Uses the 00010203...NN-1 pattern for nonce/header/plaintext/key.  The outputs\n"
+                "are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous\n"
+                "step repeated sufficiently.  The nonce is fixed throughout at 13 bytes 000102...\n\n");
+
+   for (x = 0; cipher_descriptor[x].name != NULL; x++) {
+      kl = cipher_descriptor[x].block_length;
+
+      /* skip ciphers which do not have 128 bit block sizes */
+      if (kl != 16) continue;
+
+      if (cipher_descriptor[x].keysize(&kl) != CRYPT_OK) {
+         kl = cipher_descriptor[x].max_key_length;
+      }
+      fprintf(out, "GCM-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
+
+      /* the key */
+      for (z = 0; z < kl; z++) {
+          key[z] = (z & 255);
+      }
+     
+      for (y1 = 0; y1 <= (int)(cipher_descriptor[x].block_length*2); y1++){
+         for (z = 0; z < y1; z++) {
+            plaintext[z] = (unsigned char)(z & 255);
+         }
+         len = sizeof(tag);
+         if ((err = gcm_memory(x, key, kl, plaintext, y1, plaintext, y1, plaintext, y1, plaintext, tag, &len, GCM_ENCRYPT)) != CRYPT_OK) {
+            printf("Error GCM'ing: %s\n", error_to_string(err));
+            exit(EXIT_FAILURE);
+         }
+         fprintf(out, "%3d: ", y1);
+         for (z = 0; z < y1; z++) {
+            fprintf(out, "%02X", plaintext[z]);
+         }
+         fprintf(out, ", ");
+         for (z = 0; z <(int)len; z++) {
+            fprintf(out, "%02X", tag[z]);
+         }
+         fprintf(out, "\n");
+
+         /* forward the key */
+         for (z = 0; z < kl; z++) {
+             key[z] = tag[z % len];
+         }
+      }
+      fprintf(out, "\n");
+   }
+   fclose(out);
+}
+
+void base64_gen(void)
+{
+   FILE *out;
+   unsigned char dst[256], src[32];
+   unsigned long x, y, len;
+   
+   out = fopen("base64_tv.txt", "w");
+   fprintf(out, "Base64 vectors.  These are the base64 encodings of the strings 00,01,02...NN-1\n\n");
+   for (x = 0; x <= 32; x++) {
+       for (y = 0; y < x; y++) {
+           src[y] = y;
+       }
+       len = sizeof(dst);
+       base64_encode(src, x, dst, &len);
+       fprintf(out, "%2lu: %s\n", x, dst);
+   }
+   fclose(out);
+}
+
+void math_gen(void)
+{
+}
+
+void ecc_gen(void)
+{
+   FILE         *out;
+   unsigned char str[512];
+   void          *k, *order, *modulus;
+   ecc_point    *G, *R;
+   int           x;
+
+   out = fopen("ecc_tv.txt", "w");
+   fprintf(out, "ecc vectors.  These are for kG for k=1,3,9,27,...,3**n until k > order of the curve outputs are <k,x,y> triplets\n\n");
+   G = ltc_ecc_new_point();
+   R = ltc_ecc_new_point();
+   mp_init(&k);
+   mp_init(&order);
+   mp_init(&modulus);
+
+   for (x = 0; ltc_ecc_sets[x].size != 0; x++) {
+        fprintf(out, "ECC-%d\n", ltc_ecc_sets[x].size*8);
+        mp_set(k, 1);
+
+        mp_read_radix(order,   (char *)ltc_ecc_sets[x].order, 16);
+        mp_read_radix(modulus, (char *)ltc_ecc_sets[x].prime, 16);
+        mp_read_radix(G->x,    (char *)ltc_ecc_sets[x].Gx,    16);
+        mp_read_radix(G->y,    (char *)ltc_ecc_sets[x].Gy,    16);
+        mp_set(G->z, 1);  
+
+        while (mp_cmp(k, order) == LTC_MP_LT) {
+            ltc_mp.ecc_ptmul(k, G, R, modulus, 1);
+            mp_tohex(k,    (char*)str); fprintf(out, "%s, ", (char*)str);
+            mp_tohex(R->x, (char*)str); fprintf(out, "%s, ", (char*)str);
+            mp_tohex(R->y, (char*)str); fprintf(out, "%s\n", (char*)str);
+            mp_mul_d(k, 3, k);
+        }
+   }
+   mp_clear_multi(k, order, modulus, NULL);
+   ltc_ecc_del_point(G);
+   ltc_ecc_del_point(R);
+   fclose(out);
+}
+
+void lrw_gen(void)
+{
+   FILE *out;
+   unsigned char tweak[16], key[16], iv[16], buf[1024];
+   int x, y, err;
+   symmetric_LRW lrw;
+   
+   /* initialize default key and tweak */
+   for (x = 0; x < 16; x++) {
+      tweak[x] = key[x] = iv[x] = x;
+   }
+
+   out = fopen("lrw_tv.txt", "w");
+   for (x = 16; x < (int)(sizeof(buf)); x += 16) {
+       if ((err = lrw_start(find_cipher("aes"), iv, key, 16, tweak, 0, &lrw)) != CRYPT_OK) {
+          fprintf(stderr, "Error starting LRW-AES: %s\n", error_to_string(err));
+          exit(EXIT_FAILURE);
+       }
+
+       /* encrypt incremental */
+       for (y = 0; y < x; y++) {
+           buf[y] = y & 255;
+       }
+
+       if ((err = lrw_encrypt(buf, buf, x, &lrw)) != CRYPT_OK) {
+          fprintf(stderr, "Error encrypting with LRW-AES: %s\n", error_to_string(err));
+          exit(EXIT_FAILURE);
+       }
+
+       /* display it */
+       fprintf(out, "%d:", x);
+       for (y = 0; y < x; y++) {
+          fprintf(out, "%02x", buf[y]);
+       }
+       fprintf(out, "\n");
+
+       /* reset IV */
+       if ((err = lrw_setiv(iv, 16, &lrw)) != CRYPT_OK) {
+          fprintf(stderr, "Error setting IV: %s\n", error_to_string(err));
+          exit(EXIT_FAILURE);
+       }
+
+       /* copy new tweak, iv and key */
+       for (y = 0; y < 16; y++) {
+          key[y]   = buf[y];
+          iv[y]    = buf[(y+16)%x];
+          tweak[y] = buf[(y+32)%x];
+       }
+
+       if ((err = lrw_decrypt(buf, buf, x, &lrw)) != CRYPT_OK) {
+          fprintf(stderr, "Error decrypting with LRW-AES: %s\n", error_to_string(err));
+          exit(EXIT_FAILURE);
+       }
+
+       /* display it */
+       fprintf(out, "%d:", x);
+       for (y = 0; y < x; y++) {
+          fprintf(out, "%02x", buf[y]);
+       }
+       fprintf(out, "\n");
+       lrw_done(&lrw);
+   }
+   fclose(out);
+}      
+
+int main(void)
+{
+   reg_algs();
+   printf("Generating hash   vectors..."); fflush(stdout); hash_gen();   printf("done\n");
+   printf("Generating cipher vectors..."); fflush(stdout); cipher_gen(); printf("done\n");
+   printf("Generating HMAC   vectors..."); fflush(stdout); hmac_gen();   printf("done\n");
+   printf("Generating OMAC   vectors..."); fflush(stdout); omac_gen();   printf("done\n");
+   printf("Generating PMAC   vectors..."); fflush(stdout); pmac_gen();   printf("done\n");
+   printf("Generating EAX    vectors..."); fflush(stdout); eax_gen();    printf("done\n");
+   printf("Generating OCB    vectors..."); fflush(stdout); ocb_gen();    printf("done\n");
+   printf("Generating CCM    vectors..."); fflush(stdout); ccm_gen();    printf("done\n");
+   printf("Generating GCM    vectors..."); fflush(stdout); gcm_gen();    printf("done\n");
+   printf("Generating BASE64 vectors..."); fflush(stdout); base64_gen(); printf("done\n");
+   printf("Generating MATH   vectors..."); fflush(stdout); math_gen();   printf("done\n");
+   printf("Generating ECC    vectors..."); fflush(stdout); ecc_gen();    printf("done\n");
+   printf("Generating LRW    vectors..."); fflush(stdout); lrw_gen();    printf("done\n");
+   return 0;
+}
+
+/* $Source: /cvs/libtom/libtomcrypt/demos/tv_gen.c,v $ */
+/* $Revision: 1.15 $ */
+/* $Date: 2006/06/09 22:10:27 $ */

libtomcrypt/doc/footer.html

@@ -0,0 +1,10 @@
+<hr width="80%">
+Code by <a href="http://www.libtomcrypt.com/">Tom</a><br>
+Docs using <img src="doxygen.png" alt="doxygen" align="middle" border=0>
+<a href="http://jlcooke.ca/tom/hidden_image.png">
+
+<!--
+/* $Source: /cvs/libtom/libtomcrypt/doc/footer.html,v $ */
+/* $Revision: 1.4 $ */
+/* $Date: 2006/03/31 14:15:34 $ */
+-->

libtomcrypt/doc/header.html

@@ -0,0 +1,12 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
+<html><head><meta http-equiv="Content-Type" content="text/html;charset=iso-8859-1">
+<title>LibTomCrypt: Main Page</title>
+<link href="doxygen.css" rel="stylesheet" type="text/css">
+</head><body>
+<!-- Generated by Doxygen 1.3.8 -->
+
+<!--
+/* $Source: /cvs/libtom/libtomcrypt/doc/header.html,v $ */
+/* $Revision: 1.3 $ */
+/* $Date: 2005/05/07 10:09:20 $ */
+-->

libtomcrypt/filter.pl

@@ -0,0 +1,30 @@
+#!/usr/bin/perl
+
+# we want to filter every between START_INS and END_INS out and then insert crap from another file (this is fun)
+
+$dst = shift;
+$ins = shift;
+
+open(SRC,"<$dst");
+open(INS,"<$ins");
+open(TMP,">tmp.delme");
+
+$l = 0;
+while (<SRC>) {
+   if ($_ =~ /START_INS/) {
+      print TMP $_;
+      $l = 1;
+      while (<INS>) {
+         print TMP $_;
+      }
+      close INS;
+   } elsif ($_ =~ /END_INS/) {
+      print TMP $_;
+      $l = 0;
+   } elsif ($l == 0) {
+      print TMP $_;
+   }
+}
+
+close TMP;
+close SRC;

libtomcrypt/fixupind.pl

@@ -0,0 +1,11 @@
+open(IN,"<crypt.ind");
+open(OUT,">crypt.ind.tmp");
+$a = <IN>;
+print OUT  "$a\n\\addcontentsline{toc}{chapter}{Index}\n";
+while (<IN>) {
+   print OUT $_;
+}
+close OUT;
+close IN;
+system("mv -f crypt.ind.tmp crypt.ind");
+

libtomcrypt/genlist.sh

@@ -0,0 +1,10 @@
+#!/bin/bash
+# aes_tab.o is a pseudo object as it's made from aes.o and MPI is optional
+export a=`echo -n "src/ciphers/aes/aes_enc.o " ; find . -type f | sort | grep "[.]/src" | grep "[.]c" | grep -v "sha224" | grep -v "sha384" | grep -v "aes_tab" | grep -v "twofish_tab" | grep -v "whirltab" | grep -v "dh_sys" | grep -v "ecc_sys" | grep -v "mpi[.]c" | grep -v "sober128tab" | sed -e 'sE\./EE' | sed -e 's/\.c/\.o/' | xargs`
+perl ./parsenames.pl OBJECTS "$a"
+export a=`find . -type f | grep [.]/src | grep [.]h | sed -e 'se\./ee' | xargs`
+perl ./parsenames.pl HEADERS "$a"
+
+# $Source: /cvs/libtom/libtomcrypt/genlist.sh,v $   
+# $Revision: 1.4 $   
+# $Date: 2005/07/17 23:15:12 $ 

libtomcrypt/makefile.icc

@@ -0,0 +1,292 @@
+# MAKEFILE for linux ICC (Intel C compiler)
+#
+# Tested with ICC v8....
+#
+# Be aware that ICC isn't quite as stable as GCC and several optimization switches
+# seem to break the code (that GCC and MSVC compile just fine).  In particular
+# "-ip" and "-x*" seem to break the code (ROL/ROR macro problems).  As the makefile 
+# is shipped the code will build and execute properly.
+#
+# Also note that ICC often makes code that is slower than GCC.  This is probably due to 
+# a mix of not being able to use "-ip" and just having fewer optimization algos than GCC.
+#
+# Tom St Denis
+
+# Compiler and Linker Names
+CC=icc
+
+#LD=ld
+
+# Archiver [makes .a files]
+#AR=ar
+#ARFLAGS=r
+
+# Compilation flags. Note the += does not write over the user's CFLAGS!
+CFLAGS += -c -Isrc/headers/ -Itestprof/ -DINTEL_CC -DLTC_SOURCE
+
+#ICC v9 doesn't support LTC_FAST for things like Pelican MAC
+#Despite the fact I can't see what's wrong with my code
+#Oh well
+CFLAGS += -DLTC_NO_FAST
+
+#The default rule for make builds the libtomcrypt library.
+default:library
+
+# optimize for SPEED
+#
+# -mcpu= can be pentium, pentiumpro (covers PII through PIII) or pentium4
+# -ax?	specifies make code specifically for ? but compatible with IA-32
+# -x?	   specifies compile solely for ? [not specifically IA-32 compatible]
+#
+# where ? is 
+#	K - PIII
+#	W - first P4 [Williamette]
+#	N - P4 Northwood
+#	P - P4 Prescott
+#	B - Blend of P4 and PM [mobile]
+#
+# Default to just generic max opts
+ifdef LTC_SMALL
+CFLAGS += -O2 -xP -ip
+endif
+
+ifndef IGNORE_SPEED
+CFLAGS += -O3 -xP -ip 
+endif
+
+# want to see stuff?
+#CFLAGS += -opt_report
+
+#These flags control how the library gets built.
+
+#Output filenames for various targets.
+ifndef LIBNAME
+   LIBNAME=libtomcrypt.a
+endif
+ifndef LIBTEST
+   LIBTEST=libtomcrypt_prof.a
+   LIBTEST_S=$(LIBTEST)
+endif
+HASH=hashsum
+CRYPT=encrypt
+SMALL=small
+PROF=x86_prof
+TV=tv_gen
+MULTI=multi
+TIMING=timing
+TEST=test
+
+#LIBPATH-The directory for libtomcrypt to be installed to.
+#INCPATH-The directory to install the header files for libtomcrypt.
+#DATAPATH-The directory to install the pdf docs.
+ifndef DESTDIR
+   DESTDIR=
+endif
+ifndef LIBPATH
+   LIBPATH=/usr/lib
+endif
+ifndef INCPATH
+   INCPATH=/usr/include
+endif
+ifndef DATAPATH
+   DATAPATH=/usr/share/doc/libtomcrypt/pdf
+endif
+
+#List of objects to compile.
+#START_INS
+OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
+src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
+src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
+src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
+src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
+src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
+src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
+src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
+src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
+src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
+src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
+src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
+src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
+src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
+src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
+src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
+src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
+src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
+src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
+src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
+src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
+src/mac/pelican/pelican.o src/mac/pelican/pelican_memory.o src/mac/pelican/pelican_test.o \
+src/mac/pmac/pmac_done.o src/mac/pmac/pmac_file.o src/mac/pmac/pmac_init.o src/mac/pmac/pmac_memory.o \
+src/mac/pmac/pmac_memory_multi.o src/mac/pmac/pmac_ntz.o src/mac/pmac/pmac_process.o \
+src/mac/pmac/pmac_shift_xor.o src/mac/pmac/pmac_test.o src/mac/xcbc/xcbc_done.o \
+src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
+src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
+src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
+src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
+src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
+src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
+src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
+src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
+src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
+src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
+src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
+src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
+src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
+src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
+src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
+src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
+src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
+src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
+src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
+src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
+src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
+src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
+src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
+src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
+src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
+src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
+src/modes/ofb/ofb_start.o src/pk/asn1/der/bit/der_decode_bit_string.o \
+src/pk/asn1/der/bit/der_encode_bit_string.o src/pk/asn1/der/bit/der_length_bit_string.o \
+src/pk/asn1/der/boolean/der_decode_boolean.o src/pk/asn1/der/boolean/der_encode_boolean.o \
+src/pk/asn1/der/boolean/der_length_boolean.o src/pk/asn1/der/choice/der_decode_choice.o \
+src/pk/asn1/der/ia5/der_decode_ia5_string.o src/pk/asn1/der/ia5/der_encode_ia5_string.o \
+src/pk/asn1/der/ia5/der_length_ia5_string.o src/pk/asn1/der/integer/der_decode_integer.o \
+src/pk/asn1/der/integer/der_encode_integer.o src/pk/asn1/der/integer/der_length_integer.o \
+src/pk/asn1/der/object_identifier/der_decode_object_identifier.o \
+src/pk/asn1/der/object_identifier/der_encode_object_identifier.o \
+src/pk/asn1/der/object_identifier/der_length_object_identifier.o \
+src/pk/asn1/der/octet/der_decode_octet_string.o src/pk/asn1/der/octet/der_encode_octet_string.o \
+src/pk/asn1/der/octet/der_length_octet_string.o \
+src/pk/asn1/der/printable_string/der_decode_printable_string.o \
+src/pk/asn1/der/printable_string/der_encode_printable_string.o \
+src/pk/asn1/der/printable_string/der_length_printable_string.o \
+src/pk/asn1/der/sequence/der_decode_sequence_ex.o \
+src/pk/asn1/der/sequence/der_decode_sequence_flexi.o \
+src/pk/asn1/der/sequence/der_decode_sequence_multi.o \
+src/pk/asn1/der/sequence/der_encode_sequence_ex.o \
+src/pk/asn1/der/sequence/der_encode_sequence_multi.o src/pk/asn1/der/sequence/der_length_sequence.o \
+src/pk/asn1/der/sequence/der_sequence_free.o src/pk/asn1/der/set/der_encode_set.o \
+src/pk/asn1/der/set/der_encode_setof.o src/pk/asn1/der/short_integer/der_decode_short_integer.o \
+src/pk/asn1/der/short_integer/der_encode_short_integer.o \
+src/pk/asn1/der/short_integer/der_length_short_integer.o src/pk/asn1/der/utctime/der_decode_utctime.o \
+src/pk/asn1/der/utctime/der_encode_utctime.o src/pk/asn1/der/utctime/der_length_utctime.o \
+src/pk/asn1/der/utf8/der_decode_utf8_string.o src/pk/asn1/der/utf8/der_encode_utf8_string.o \
+src/pk/asn1/der/utf8/der_length_utf8_string.o src/pk/dsa/dsa_decrypt_key.o \
+src/pk/dsa/dsa_encrypt_key.o src/pk/dsa/dsa_export.o src/pk/dsa/dsa_free.o src/pk/dsa/dsa_import.o \
+src/pk/dsa/dsa_make_key.o src/pk/dsa/dsa_shared_secret.o src/pk/dsa/dsa_sign_hash.o \
+src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc.o \
+src/pk/ecc/ecc_ansi_x963_export.o src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc_decrypt_key.o \
+src/pk/ecc/ecc_encrypt_key.o src/pk/ecc/ecc_export.o src/pk/ecc/ecc_free.o src/pk/ecc/ecc_get_size.o \
+src/pk/ecc/ecc_import.o src/pk/ecc/ecc_make_key.o src/pk/ecc/ecc_shared_secret.o \
+src/pk/ecc/ecc_sign_hash.o src/pk/ecc/ecc_sizes.o src/pk/ecc/ecc_test.o src/pk/ecc/ecc_verify_hash.o \
+src/pk/ecc/ltc_ecc_is_valid_idx.o src/pk/ecc/ltc_ecc_map.o src/pk/ecc/ltc_ecc_mul2add.o \
+src/pk/ecc/ltc_ecc_mulmod.o src/pk/ecc/ltc_ecc_mulmod_timing.o src/pk/ecc/ltc_ecc_points.o \
+src/pk/ecc/ltc_ecc_projective_add_point.o src/pk/ecc/ltc_ecc_projective_dbl_point.o \
+src/pk/katja/katja_decrypt_key.o src/pk/katja/katja_encrypt_key.o src/pk/katja/katja_export.o \
+src/pk/katja/katja_exptmod.o src/pk/katja/katja_free.o src/pk/katja/katja_import.o \
+src/pk/katja/katja_make_key.o src/pk/pkcs1/pkcs_1_i2osp.o src/pk/pkcs1/pkcs_1_mgf1.o \
+src/pk/pkcs1/pkcs_1_oaep_decode.o src/pk/pkcs1/pkcs_1_oaep_encode.o src/pk/pkcs1/pkcs_1_os2ip.o \
+src/pk/pkcs1/pkcs_1_pss_decode.o src/pk/pkcs1/pkcs_1_pss_encode.o src/pk/pkcs1/pkcs_1_v1_5_decode.o \
+src/pk/pkcs1/pkcs_1_v1_5_encode.o src/pk/rsa/rsa_decrypt_key.o src/pk/rsa/rsa_encrypt_key.o \
+src/pk/rsa/rsa_export.o src/pk/rsa/rsa_exptmod.o src/pk/rsa/rsa_free.o src/pk/rsa/rsa_import.o \
+src/pk/rsa/rsa_make_key.o src/pk/rsa/rsa_sign_hash.o src/pk/rsa/rsa_verify_hash.o src/prngs/fortuna.o \
+src/prngs/rc4.o src/prngs/rng_get_bytes.o src/prngs/rng_make_prng.o src/prngs/sober128.o \
+src/prngs/sprng.o src/prngs/yarrow.o 
+
+HEADERS=src/headers/tomcrypt_cfg.h src/headers/tomcrypt_mac.h src/headers/tomcrypt_macros.h \
+src/headers/tomcrypt_custom.h src/headers/tomcrypt_argchk.h src/headers/tomcrypt_cipher.h \
+src/headers/tomcrypt_pk.h src/headers/tomcrypt_hash.h src/headers/tomcrypt_math.h \
+src/headers/tomcrypt_misc.h src/headers/tomcrypt.h src/headers/tomcrypt_pkcs.h \
+src/headers/tomcrypt_prng.h testprof/tomcrypt_test.h
+
+#END_INS
+
+#Who do we install as?
+ifdef INSTALL_USER
+USER=$(INSTALL_USER)
+else
+USER=root
+endif
+
+ifdef INSTALL_GROUP
+GROUP=$(INSTALL_GROUP)
+else
+GROUP=wheel
+endif
+
+#ciphers come in two flavours... enc+dec and enc 
+aes_enc.o: aes.c aes_tab.c
+	$(CC) $(CFLAGS) -DENCRYPT_ONLY -c aes.c -o aes_enc.o
+
+HASHOBJECTS=demos/hashsum.o
+CRYPTOBJECTS=demos/encrypt.o
+SMALLOBJECTS=demos/small.o
+TVS=demos/tv_gen.o
+TIMINGS=demos/timing.o
+TESTS=demos/test.o
+
+#ciphers come in two flavours... enc+dec and enc 
+src/ciphers/aes/aes_enc.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+	$(CC) $(CFLAGS) -DENCRYPT_ONLY -c src/ciphers/aes/aes.c -o src/ciphers/aes/aes_enc.o
+
+#These are the rules to make certain object files.
+src/ciphers/aes/aes.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+src/ciphers/twofish/twofish.o: src/ciphers/twofish/twofish.c src/ciphers/twofish/twofish_tab.c
+src/hashes/whirl/whirl.o: src/hashes/whirl/whirl.c src/hashes/whirl/whirltab.c
+src/hashes/sha2/sha512.o: src/hashes/sha2/sha512.c src/hashes/sha2/sha384.c
+src/hashes/sha2/sha256.o: src/hashes/sha2/sha256.c src/hashes/sha2/sha224.c
+
+#This rule makes the libtomcrypt library.
+library: $(LIBNAME)
+
+testprof/$(LIBTEST):
+	cd testprof ; LIBTEST_S=$(LIBTEST) CFLAGS="$(CFLAGS)" make -f makefile.icc
+
+$(LIBNAME): $(OBJECTS)
+	$(AR) $(ARFLAGS) $@ $(OBJECTS)
+	ranlib $@
+
+#This rule makes the hash program included with libtomcrypt
+hashsum: library $(HASHOBJECTS)
+	$(CC) $(HASHOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(HASH) $(WARN)
+
+#makes the crypt program
+crypt: library $(CRYPTOBJECTS)
+	$(CC) $(CRYPTOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(CRYPT) $(WARN)
+
+#makes the small program
+small: library $(SMALLOBJECTS)
+	$(CC) $(SMALLOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(SMALL) $(WARN)
+	
+tv_gen: library $(TVS)
+	$(CC) $(TVS) $(LIBNAME) $(EXTRALIBS) -o $(TV)
+
+timing: library $(TIMINGS) testprof/$(LIBTEST)
+	$(CC) $(TIMINGS) testprof/$(LIBTEST) $(LIBNAME) $(EXTRALIBS) -o $(TIMING)
+
+test: library $(TESTS) testprof/$(LIBTEST)
+	$(CC) $(TESTS) testprof/$(LIBTEST) $(LIBNAME) $(EXTRALIBS) -o $(TEST)
+  
+#This rule installs the library and the header files. This must be run
+#as root in order to have a high enough permission to write to the correct
+#directories and to set the owner and group to root.
+install: library
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
+	install -g $(GROUP) -o $(USER) $(LIBNAME) $(DESTDIR)$(LIBPATH)
+	install -g $(GROUP) -o $(USER) $(LIBTEST) $(DESTDIR)$(LIBPATH)
+	install -g $(GROUP) -o $(USER) $(HEADERS) $(DESTDIR)$(INCPATH)
+
+# $Source: /cvs/libtom/libtomcrypt/makefile.icc,v $   
+# $Revision: 1.73 $   
+# $Date: 2006/12/02 19:23:21 $ 
+

libtomcrypt/makefile.msvc

@@ -0,0 +1,149 @@
+#MSVC Makefile [tested with MSVC 6.00 with SP5]
+#
+#Tom St Denis
+CFLAGS = /Isrc/headers/ /Itestprof/ /Ox /DWIN32 /DLTC_SOURCE /W3 /Fo$@ $(CF)
+
+#START_INS
+OBJECTS=src/ciphers/aes/aes_enc.obj src/ciphers/aes/aes.obj src/ciphers/anubis.obj src/ciphers/blowfish.obj \
+src/ciphers/cast5.obj src/ciphers/des.obj src/ciphers/kasumi.obj src/ciphers/khazad.obj src/ciphers/kseed.obj \
+src/ciphers/noekeon.obj src/ciphers/rc2.obj src/ciphers/rc5.obj src/ciphers/rc6.obj src/ciphers/safer/safer.obj \
+src/ciphers/safer/safer_tab.obj src/ciphers/safer/saferp.obj src/ciphers/skipjack.obj \
+src/ciphers/twofish/twofish.obj src/ciphers/xtea.obj src/encauth/ccm/ccm_memory.obj \
+src/encauth/ccm/ccm_test.obj src/encauth/eax/eax_addheader.obj src/encauth/eax/eax_decrypt.obj \
+src/encauth/eax/eax_decrypt_verify_memory.obj src/encauth/eax/eax_done.obj src/encauth/eax/eax_encrypt.obj \
+src/encauth/eax/eax_encrypt_authenticate_memory.obj src/encauth/eax/eax_init.obj \
+src/encauth/eax/eax_test.obj src/encauth/gcm/gcm_add_aad.obj src/encauth/gcm/gcm_add_iv.obj \
+src/encauth/gcm/gcm_done.obj src/encauth/gcm/gcm_gf_mult.obj src/encauth/gcm/gcm_init.obj \
+src/encauth/gcm/gcm_memory.obj src/encauth/gcm/gcm_mult_h.obj src/encauth/gcm/gcm_process.obj \
+src/encauth/gcm/gcm_reset.obj src/encauth/gcm/gcm_test.obj src/encauth/ocb/ocb_decrypt.obj \
+src/encauth/ocb/ocb_decrypt_verify_memory.obj src/encauth/ocb/ocb_done_decrypt.obj \
+src/encauth/ocb/ocb_done_encrypt.obj src/encauth/ocb/ocb_encrypt.obj \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.obj src/encauth/ocb/ocb_init.obj src/encauth/ocb/ocb_ntz.obj \
+src/encauth/ocb/ocb_shift_xor.obj src/encauth/ocb/ocb_test.obj src/encauth/ocb/s_ocb_done.obj \
+src/hashes/chc/chc.obj src/hashes/helper/hash_file.obj src/hashes/helper/hash_filehandle.obj \
+src/hashes/helper/hash_memory.obj src/hashes/helper/hash_memory_multi.obj src/hashes/md2.obj src/hashes/md4.obj \
+src/hashes/md5.obj src/hashes/rmd128.obj src/hashes/rmd160.obj src/hashes/rmd256.obj src/hashes/rmd320.obj \
+src/hashes/sha1.obj src/hashes/sha2/sha256.obj src/hashes/sha2/sha512.obj src/hashes/tiger.obj \
+src/hashes/whirl/whirl.obj src/mac/f9/f9_done.obj src/mac/f9/f9_file.obj src/mac/f9/f9_init.obj \
+src/mac/f9/f9_memory.obj src/mac/f9/f9_memory_multi.obj src/mac/f9/f9_process.obj src/mac/f9/f9_test.obj \
+src/mac/hmac/hmac_done.obj src/mac/hmac/hmac_file.obj src/mac/hmac/hmac_init.obj src/mac/hmac/hmac_memory.obj \
+src/mac/hmac/hmac_memory_multi.obj src/mac/hmac/hmac_process.obj src/mac/hmac/hmac_test.obj \
+src/mac/omac/omac_done.obj src/mac/omac/omac_file.obj src/mac/omac/omac_init.obj src/mac/omac/omac_memory.obj \
+src/mac/omac/omac_memory_multi.obj src/mac/omac/omac_process.obj src/mac/omac/omac_test.obj \
+src/mac/pelican/pelican.obj src/mac/pelican/pelican_memory.obj src/mac/pelican/pelican_test.obj \
+src/mac/pmac/pmac_done.obj src/mac/pmac/pmac_file.obj src/mac/pmac/pmac_init.obj src/mac/pmac/pmac_memory.obj \
+src/mac/pmac/pmac_memory_multi.obj src/mac/pmac/pmac_ntz.obj src/mac/pmac/pmac_process.obj \
+src/mac/pmac/pmac_shift_xor.obj src/mac/pmac/pmac_test.obj src/mac/xcbc/xcbc_done.obj \
+src/mac/xcbc/xcbc_file.obj src/mac/xcbc/xcbc_init.obj src/mac/xcbc/xcbc_memory.obj \
+src/mac/xcbc/xcbc_memory_multi.obj src/mac/xcbc/xcbc_process.obj src/mac/xcbc/xcbc_test.obj \
+src/math/fp/ltc_ecc_fp_mulmod.obj src/math/gmp_desc.obj src/math/ltm_desc.obj src/math/multi.obj \
+src/math/rand_prime.obj src/math/tfm_desc.obj src/misc/base64/base64_decode.obj \
+src/misc/base64/base64_encode.obj src/misc/burn_stack.obj src/misc/crypt/crypt.obj \
+src/misc/crypt/crypt_argchk.obj src/misc/crypt/crypt_cipher_descriptor.obj \
+src/misc/crypt/crypt_cipher_is_valid.obj src/misc/crypt/crypt_find_cipher.obj \
+src/misc/crypt/crypt_find_cipher_any.obj src/misc/crypt/crypt_find_cipher_id.obj \
+src/misc/crypt/crypt_find_hash.obj src/misc/crypt/crypt_find_hash_any.obj \
+src/misc/crypt/crypt_find_hash_id.obj src/misc/crypt/crypt_find_hash_oid.obj \
+src/misc/crypt/crypt_find_prng.obj src/misc/crypt/crypt_fsa.obj src/misc/crypt/crypt_hash_descriptor.obj \
+src/misc/crypt/crypt_hash_is_valid.obj src/misc/crypt/crypt_ltc_mp_descriptor.obj \
+src/misc/crypt/crypt_prng_descriptor.obj src/misc/crypt/crypt_prng_is_valid.obj \
+src/misc/crypt/crypt_register_cipher.obj src/misc/crypt/crypt_register_hash.obj \
+src/misc/crypt/crypt_register_prng.obj src/misc/crypt/crypt_unregister_cipher.obj \
+src/misc/crypt/crypt_unregister_hash.obj src/misc/crypt/crypt_unregister_prng.obj \
+src/misc/error_to_string.obj src/misc/pkcs5/pkcs_5_1.obj src/misc/pkcs5/pkcs_5_2.obj src/misc/zeromem.obj \
+src/modes/cbc/cbc_decrypt.obj src/modes/cbc/cbc_done.obj src/modes/cbc/cbc_encrypt.obj \
+src/modes/cbc/cbc_getiv.obj src/modes/cbc/cbc_setiv.obj src/modes/cbc/cbc_start.obj \
+src/modes/cfb/cfb_decrypt.obj src/modes/cfb/cfb_done.obj src/modes/cfb/cfb_encrypt.obj \
+src/modes/cfb/cfb_getiv.obj src/modes/cfb/cfb_setiv.obj src/modes/cfb/cfb_start.obj \
+src/modes/ctr/ctr_decrypt.obj src/modes/ctr/ctr_done.obj src/modes/ctr/ctr_encrypt.obj \
+src/modes/ctr/ctr_getiv.obj src/modes/ctr/ctr_setiv.obj src/modes/ctr/ctr_start.obj src/modes/ctr/ctr_test.obj \
+src/modes/ecb/ecb_decrypt.obj src/modes/ecb/ecb_done.obj src/modes/ecb/ecb_encrypt.obj \
+src/modes/ecb/ecb_start.obj src/modes/f8/f8_decrypt.obj src/modes/f8/f8_done.obj src/modes/f8/f8_encrypt.obj \
+src/modes/f8/f8_getiv.obj src/modes/f8/f8_setiv.obj src/modes/f8/f8_start.obj src/modes/f8/f8_test_mode.obj \
+src/modes/lrw/lrw_decrypt.obj src/modes/lrw/lrw_done.obj src/modes/lrw/lrw_encrypt.obj \
+src/modes/lrw/lrw_getiv.obj src/modes/lrw/lrw_process.obj src/modes/lrw/lrw_setiv.obj \
+src/modes/lrw/lrw_start.obj src/modes/lrw/lrw_test.obj src/modes/ofb/ofb_decrypt.obj src/modes/ofb/ofb_done.obj \
+src/modes/ofb/ofb_encrypt.obj src/modes/ofb/ofb_getiv.obj src/modes/ofb/ofb_setiv.obj \
+src/modes/ofb/ofb_start.obj src/pk/asn1/der/bit/der_decode_bit_string.obj \
+src/pk/asn1/der/bit/der_encode_bit_string.obj src/pk/asn1/der/bit/der_length_bit_string.obj \
+src/pk/asn1/der/boolean/der_decode_boolean.obj src/pk/asn1/der/boolean/der_encode_boolean.obj \
+src/pk/asn1/der/boolean/der_length_boolean.obj src/pk/asn1/der/choice/der_decode_choice.obj \
+src/pk/asn1/der/ia5/der_decode_ia5_string.obj src/pk/asn1/der/ia5/der_encode_ia5_string.obj \
+src/pk/asn1/der/ia5/der_length_ia5_string.obj src/pk/asn1/der/integer/der_decode_integer.obj \
+src/pk/asn1/der/integer/der_encode_integer.obj src/pk/asn1/der/integer/der_length_integer.obj \
+src/pk/asn1/der/object_identifier/der_decode_object_identifier.obj \
+src/pk/asn1/der/object_identifier/der_encode_object_identifier.obj \
+src/pk/asn1/der/object_identifier/der_length_object_identifier.obj \
+src/pk/asn1/der/octet/der_decode_octet_string.obj src/pk/asn1/der/octet/der_encode_octet_string.obj \
+src/pk/asn1/der/octet/der_length_octet_string.obj \
+src/pk/asn1/der/printable_string/der_decode_printable_string.obj \
+src/pk/asn1/der/printable_string/der_encode_printable_string.obj \
+src/pk/asn1/der/printable_string/der_length_printable_string.obj \
+src/pk/asn1/der/sequence/der_decode_sequence_ex.obj \
+src/pk/asn1/der/sequence/der_decode_sequence_flexi.obj \
+src/pk/asn1/der/sequence/der_decode_sequence_multi.obj \
+src/pk/asn1/der/sequence/der_encode_sequence_ex.obj \
+src/pk/asn1/der/sequence/der_encode_sequence_multi.obj src/pk/asn1/der/sequence/der_length_sequence.obj \
+src/pk/asn1/der/sequence/der_sequence_free.obj src/pk/asn1/der/set/der_encode_set.obj \
+src/pk/asn1/der/set/der_encode_setof.obj src/pk/asn1/der/short_integer/der_decode_short_integer.obj \
+src/pk/asn1/der/short_integer/der_encode_short_integer.obj \
+src/pk/asn1/der/short_integer/der_length_short_integer.obj src/pk/asn1/der/utctime/der_decode_utctime.obj \
+src/pk/asn1/der/utctime/der_encode_utctime.obj src/pk/asn1/der/utctime/der_length_utctime.obj \
+src/pk/asn1/der/utf8/der_decode_utf8_string.obj src/pk/asn1/der/utf8/der_encode_utf8_string.obj \
+src/pk/asn1/der/utf8/der_length_utf8_string.obj src/pk/dsa/dsa_decrypt_key.obj \
+src/pk/dsa/dsa_encrypt_key.obj src/pk/dsa/dsa_export.obj src/pk/dsa/dsa_free.obj src/pk/dsa/dsa_import.obj \
+src/pk/dsa/dsa_make_key.obj src/pk/dsa/dsa_shared_secret.obj src/pk/dsa/dsa_sign_hash.obj \
+src/pk/dsa/dsa_verify_hash.obj src/pk/dsa/dsa_verify_key.obj src/pk/ecc/ecc.obj \
+src/pk/ecc/ecc_ansi_x963_export.obj src/pk/ecc/ecc_ansi_x963_import.obj src/pk/ecc/ecc_decrypt_key.obj \
+src/pk/ecc/ecc_encrypt_key.obj src/pk/ecc/ecc_export.obj src/pk/ecc/ecc_free.obj src/pk/ecc/ecc_get_size.obj \
+src/pk/ecc/ecc_import.obj src/pk/ecc/ecc_make_key.obj src/pk/ecc/ecc_shared_secret.obj \
+src/pk/ecc/ecc_sign_hash.obj src/pk/ecc/ecc_sizes.obj src/pk/ecc/ecc_test.obj src/pk/ecc/ecc_verify_hash.obj \
+src/pk/ecc/ltc_ecc_is_valid_idx.obj src/pk/ecc/ltc_ecc_map.obj src/pk/ecc/ltc_ecc_mul2add.obj \
+src/pk/ecc/ltc_ecc_mulmod.obj src/pk/ecc/ltc_ecc_mulmod_timing.obj src/pk/ecc/ltc_ecc_points.obj \
+src/pk/ecc/ltc_ecc_projective_add_point.obj src/pk/ecc/ltc_ecc_projective_dbl_point.obj \
+src/pk/katja/katja_decrypt_key.obj src/pk/katja/katja_encrypt_key.obj src/pk/katja/katja_export.obj \
+src/pk/katja/katja_exptmod.obj src/pk/katja/katja_free.obj src/pk/katja/katja_import.obj \
+src/pk/katja/katja_make_key.obj src/pk/pkcs1/pkcs_1_i2osp.obj src/pk/pkcs1/pkcs_1_mgf1.obj \
+src/pk/pkcs1/pkcs_1_oaep_decode.obj src/pk/pkcs1/pkcs_1_oaep_encode.obj src/pk/pkcs1/pkcs_1_os2ip.obj \
+src/pk/pkcs1/pkcs_1_pss_decode.obj src/pk/pkcs1/pkcs_1_pss_encode.obj src/pk/pkcs1/pkcs_1_v1_5_decode.obj \
+src/pk/pkcs1/pkcs_1_v1_5_encode.obj src/pk/rsa/rsa_decrypt_key.obj src/pk/rsa/rsa_encrypt_key.obj \
+src/pk/rsa/rsa_export.obj src/pk/rsa/rsa_exptmod.obj src/pk/rsa/rsa_free.obj src/pk/rsa/rsa_import.obj \
+src/pk/rsa/rsa_make_key.obj src/pk/rsa/rsa_sign_hash.obj src/pk/rsa/rsa_verify_hash.obj src/prngs/fortuna.obj \
+src/prngs/rc4.obj src/prngs/rng_get_bytes.obj src/prngs/rng_make_prng.obj src/prngs/sober128.obj \
+src/prngs/sprng.obj src/prngs/yarrow.obj 
+
+HEADERS=src/headers/tomcrypt_cfg.h src/headers/tomcrypt_mac.h src/headers/tomcrypt_macros.h \
+src/headers/tomcrypt_custom.h src/headers/tomcrypt_argchk.h src/headers/tomcrypt_cipher.h \
+src/headers/tomcrypt_pk.h src/headers/tomcrypt_hash.h src/headers/tomcrypt_math.h \
+src/headers/tomcrypt_misc.h src/headers/tomcrypt.h src/headers/tomcrypt_pkcs.h \
+src/headers/tomcrypt_prng.h testprof/tomcrypt_test.h
+
+#END_INS
+
+default: library
+
+#ciphers come in two flavours... enc+dec and enc
+src/ciphers/aes/aes_enc.obj: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+	$(CC) $(CFLAGS) /DENCRYPT_ONLY /c src/ciphers/aes/aes.c /Fosrc/ciphers/aes/aes_enc.obj
+
+library: $(OBJECTS)
+	lib /out:tomcrypt.lib $(OBJECTS)
+	cd testprof 
+	nmake -f makefile.msvc
+	cd ..
+	
+tv_gen: demos/tv_gen.c library
+	cl $(CFLAGS) demos/tv_gen.c tomcrypt.lib advapi32.lib $(EXTRALIBS)
+
+hashsum: demos/hashsum.c library
+	cl $(CFLAGS) demos/hashsum.c tomcrypt.lib advapi32.lib $(EXTRALIBS)
+
+test: demos/test.c library
+	cl $(CFLAGS) demos/test.c testprof/tomcrypt_prof.lib tomcrypt.lib advapi32.lib $(EXTRALIBS)
+
+timing: demos/timing.c library
+	cl $(CFLAGS) demos/timing.c testprof/tomcrypt_prof.lib tomcrypt.lib advapi32.lib $(EXTRALIBS)
+
+# $Source: /cvs/libtom/libtomcrypt/makefile.msvc,v $   
+# $Revision: 1.51 $   
+# $Date: 2006/12/02 19:23:21 $ 

libtomcrypt/makefile.shared

@@ -0,0 +1,279 @@
+# MAKEFILE for linux GCC
+#
+# This makefile produces a shared object and requires libtool to be installed.
+#
+# Thanks to Zed Shaw for helping debug this on BSD/OSX.  
+# Tom St Denis
+
+# The version
+VERSION=0:116
+
+# Compiler and Linker Names
+CC=libtool --mode=compile --tag=CC gcc 
+
+# ranlib tools
+ifndef RANLIB
+   RANLIB=ranlib
+endif
+
+# Compilation flags. Note the += does not write over the user's CFLAGS!
+CFLAGS += -c -I./src/headers/ -Wall -Wsign-compare -W -Wshadow -DLTC_SOURCE
+
+# additional warnings (newer GCC 3.4 and higher)
+ifdef GCC_34
+CFLAGS += -Wsystem-headers -Wdeclaration-after-statement -Wbad-function-cast -Wcast-align -Wstrict-prototypes -Wmissing-prototypes \
+			 -Wmissing-declarations -Wpointer-arith 
+endif
+
+
+ifndef IGNORE_SPEED
+
+# optimize for SPEED
+CFLAGS += -O3 -funroll-loops
+
+# add -fomit-frame-pointer.  hinders debugging!
+CFLAGS += -fomit-frame-pointer
+
+# optimize for SIZE
+#CFLAGS += -Os -DLTC_SMALL_CODE
+
+endif
+
+# compile for DEBUGING (required for ccmalloc checking!!!)
+#CFLAGS += -g3
+
+# older GCCs can't handle the "rotate with immediate" ROLc/RORc/etc macros
+# define this to help
+#CFLAGS += -DLTC_NO_ROLC
+
+#Output filenames for various targets.
+ifndef LIBTEST_S
+   LIBTEST_S=libtomcrypt_prof.a
+endif
+ifndef LIBTEST
+   LIBTEST=libtomcrypt_prof.la
+endif
+ifndef LIBNAME
+   LIBNAME=libtomcrypt.la
+endif
+ifndef LIBNAME_S
+   LIBNAME_S=libtomcrypt.a
+endif
+
+HASH=hashsum
+CRYPT=encrypt
+SMALL=small
+PROF=x86_prof
+TV=tv_gen
+TEST=test
+TIMING=timing
+
+#LIBPATH-The directory for libtomcrypt to be installed to.
+#INCPATH-The directory to install the header files for libtomcrypt.
+#DATAPATH-The directory to install the pdf docs.
+ifndef DESTDIR
+   DESTDIR=
+endif
+ifndef LIBPATH
+   LIBPATH=/usr/lib
+endif
+ifndef INCPATH
+   INCPATH=/usr/include
+endif
+ifndef DATAPATH
+   DATAPATH=/usr/share/doc/libtomcrypt/pdf
+endif
+
+#Who do we install as?
+ifdef INSTALL_USER
+USER=$(INSTALL_USER)
+else
+USER=root
+endif
+
+ifdef INSTALL_GROUP
+GROUP=$(INSTALL_GROUP)   
+else
+GROUP=wheel  
+endif
+
+#List of objects to compile.
+#START_INS
+OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
+src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
+src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
+src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
+src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
+src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
+src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
+src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
+src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
+src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
+src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
+src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
+src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
+src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
+src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
+src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
+src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
+src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
+src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
+src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
+src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
+src/mac/pelican/pelican.o src/mac/pelican/pelican_memory.o src/mac/pelican/pelican_test.o \
+src/mac/pmac/pmac_done.o src/mac/pmac/pmac_file.o src/mac/pmac/pmac_init.o src/mac/pmac/pmac_memory.o \
+src/mac/pmac/pmac_memory_multi.o src/mac/pmac/pmac_ntz.o src/mac/pmac/pmac_process.o \
+src/mac/pmac/pmac_shift_xor.o src/mac/pmac/pmac_test.o src/mac/xcbc/xcbc_done.o \
+src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
+src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
+src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
+src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
+src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
+src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
+src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
+src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
+src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
+src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
+src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
+src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
+src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
+src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
+src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
+src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
+src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
+src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
+src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
+src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
+src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
+src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
+src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
+src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
+src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
+src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
+src/modes/ofb/ofb_start.o src/pk/asn1/der/bit/der_decode_bit_string.o \
+src/pk/asn1/der/bit/der_encode_bit_string.o src/pk/asn1/der/bit/der_length_bit_string.o \
+src/pk/asn1/der/boolean/der_decode_boolean.o src/pk/asn1/der/boolean/der_encode_boolean.o \
+src/pk/asn1/der/boolean/der_length_boolean.o src/pk/asn1/der/choice/der_decode_choice.o \
+src/pk/asn1/der/ia5/der_decode_ia5_string.o src/pk/asn1/der/ia5/der_encode_ia5_string.o \
+src/pk/asn1/der/ia5/der_length_ia5_string.o src/pk/asn1/der/integer/der_decode_integer.o \
+src/pk/asn1/der/integer/der_encode_integer.o src/pk/asn1/der/integer/der_length_integer.o \
+src/pk/asn1/der/object_identifier/der_decode_object_identifier.o \
+src/pk/asn1/der/object_identifier/der_encode_object_identifier.o \
+src/pk/asn1/der/object_identifier/der_length_object_identifier.o \
+src/pk/asn1/der/octet/der_decode_octet_string.o src/pk/asn1/der/octet/der_encode_octet_string.o \
+src/pk/asn1/der/octet/der_length_octet_string.o \
+src/pk/asn1/der/printable_string/der_decode_printable_string.o \
+src/pk/asn1/der/printable_string/der_encode_printable_string.o \
+src/pk/asn1/der/printable_string/der_length_printable_string.o \
+src/pk/asn1/der/sequence/der_decode_sequence_ex.o \
+src/pk/asn1/der/sequence/der_decode_sequence_flexi.o \
+src/pk/asn1/der/sequence/der_decode_sequence_multi.o \
+src/pk/asn1/der/sequence/der_encode_sequence_ex.o \
+src/pk/asn1/der/sequence/der_encode_sequence_multi.o src/pk/asn1/der/sequence/der_length_sequence.o \
+src/pk/asn1/der/sequence/der_sequence_free.o src/pk/asn1/der/set/der_encode_set.o \
+src/pk/asn1/der/set/der_encode_setof.o src/pk/asn1/der/short_integer/der_decode_short_integer.o \
+src/pk/asn1/der/short_integer/der_encode_short_integer.o \
+src/pk/asn1/der/short_integer/der_length_short_integer.o src/pk/asn1/der/utctime/der_decode_utctime.o \
+src/pk/asn1/der/utctime/der_encode_utctime.o src/pk/asn1/der/utctime/der_length_utctime.o \
+src/pk/asn1/der/utf8/der_decode_utf8_string.o src/pk/asn1/der/utf8/der_encode_utf8_string.o \
+src/pk/asn1/der/utf8/der_length_utf8_string.o src/pk/dsa/dsa_decrypt_key.o \
+src/pk/dsa/dsa_encrypt_key.o src/pk/dsa/dsa_export.o src/pk/dsa/dsa_free.o src/pk/dsa/dsa_import.o \
+src/pk/dsa/dsa_make_key.o src/pk/dsa/dsa_shared_secret.o src/pk/dsa/dsa_sign_hash.o \
+src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc.o \
+src/pk/ecc/ecc_ansi_x963_export.o src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc_decrypt_key.o \
+src/pk/ecc/ecc_encrypt_key.o src/pk/ecc/ecc_export.o src/pk/ecc/ecc_free.o src/pk/ecc/ecc_get_size.o \
+src/pk/ecc/ecc_import.o src/pk/ecc/ecc_make_key.o src/pk/ecc/ecc_shared_secret.o \
+src/pk/ecc/ecc_sign_hash.o src/pk/ecc/ecc_sizes.o src/pk/ecc/ecc_test.o src/pk/ecc/ecc_verify_hash.o \
+src/pk/ecc/ltc_ecc_is_valid_idx.o src/pk/ecc/ltc_ecc_map.o src/pk/ecc/ltc_ecc_mul2add.o \
+src/pk/ecc/ltc_ecc_mulmod.o src/pk/ecc/ltc_ecc_mulmod_timing.o src/pk/ecc/ltc_ecc_points.o \
+src/pk/ecc/ltc_ecc_projective_add_point.o src/pk/ecc/ltc_ecc_projective_dbl_point.o \
+src/pk/katja/katja_decrypt_key.o src/pk/katja/katja_encrypt_key.o src/pk/katja/katja_export.o \
+src/pk/katja/katja_exptmod.o src/pk/katja/katja_free.o src/pk/katja/katja_import.o \
+src/pk/katja/katja_make_key.o src/pk/pkcs1/pkcs_1_i2osp.o src/pk/pkcs1/pkcs_1_mgf1.o \
+src/pk/pkcs1/pkcs_1_oaep_decode.o src/pk/pkcs1/pkcs_1_oaep_encode.o src/pk/pkcs1/pkcs_1_os2ip.o \
+src/pk/pkcs1/pkcs_1_pss_decode.o src/pk/pkcs1/pkcs_1_pss_encode.o src/pk/pkcs1/pkcs_1_v1_5_decode.o \
+src/pk/pkcs1/pkcs_1_v1_5_encode.o src/pk/rsa/rsa_decrypt_key.o src/pk/rsa/rsa_encrypt_key.o \
+src/pk/rsa/rsa_export.o src/pk/rsa/rsa_exptmod.o src/pk/rsa/rsa_free.o src/pk/rsa/rsa_import.o \
+src/pk/rsa/rsa_make_key.o src/pk/rsa/rsa_sign_hash.o src/pk/rsa/rsa_verify_hash.o src/prngs/fortuna.o \
+src/prngs/rc4.o src/prngs/rng_get_bytes.o src/prngs/rng_make_prng.o src/prngs/sober128.o \
+src/prngs/sprng.o src/prngs/yarrow.o 
+
+HEADERS=src/headers/tomcrypt_cfg.h src/headers/tomcrypt_mac.h src/headers/tomcrypt_macros.h \
+src/headers/tomcrypt_custom.h src/headers/tomcrypt_argchk.h src/headers/tomcrypt_cipher.h \
+src/headers/tomcrypt_pk.h src/headers/tomcrypt_hash.h src/headers/tomcrypt_math.h \
+src/headers/tomcrypt_misc.h src/headers/tomcrypt.h src/headers/tomcrypt_pkcs.h \
+src/headers/tomcrypt_prng.h testprof/tomcrypt_test.h
+
+#END_INS
+
+TESTOBJECTS=demos/test.o
+HASHOBJECTS=demos/hashsum.o
+CRYPTOBJECTS=demos/encrypt.o
+SMALLOBJECTS=demos/small.o
+TVS=demos/tv_gen.o
+TESTS=demos/test.o
+TIMINGS=demos/timing.o
+
+#The default rule for make builds the libtomcrypt library.
+default:library
+
+#ciphers come in two flavours... enc+dec and enc 
+src/ciphers/aes/aes_enc.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+	$(CC) $(CFLAGS) -DENCRYPT_ONLY -c src/ciphers/aes/aes.c -o src/ciphers/aes/aes_enc.o
+
+#These are the rules to make certain object files.
+src/ciphers/aes/aes.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+src/ciphers/twofish/twofish.o: src/ciphers/twofish/twofish.c src/ciphers/twofish/twofish_tab.c
+src/hashes/whirl/whirl.o: src/hashes/whirl/whirl.c src/hashes/whirl/whirltab.c
+src/hashes/sha2/sha512.o: src/hashes/sha2/sha512.c src/hashes/sha2/sha384.c
+src/hashes/sha2/sha256.o: src/hashes/sha2/sha256.c src/hashes/sha2/sha224.c
+
+#This rule makes the libtomcrypt library.
+library: $(LIBNAME)
+
+testprof/$(LIBTEST):
+	cd testprof ; CFLAGS="$(CFLAGS)" GROUP=$(GROUP) USER=$(USER) VERSION=$(VERSION) LIBPATH=$(LIBPATH) LIBTEST=$(LIBTEST) LIBTEST_S=$(LIBTEST_S) make -f makefile.shared
+
+objs: $(OBJECTS)
+
+$(LIBNAME): $(OBJECTS) testprof/$(LIBTEST)
+	libtool --silent --mode=link gcc $(CFLAGS) `find . -type f | grep "[.]lo" | grep "src/" | xargs` $(EXTRALIBS) -o $(LIBNAME) -rpath $(LIBPATH) -version-info $(VERSION)
+
+install: $(LIBNAME)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
+	cd testprof ; CFLAGS="$(CFLAGS)" GROUP=$(GROUP) USER=$(USER) VERSION=$(VERSION) LIBPATH=$(LIBPATH) LIBTEST=$(LIBTEST) LIBTEST_S=$(LIBTEST_S) DESTDIR=$(DESTDIR) make -f makefile.shared install
+	libtool --silent --mode=install install -c libtomcrypt.la $(DESTDIR)$(LIBPATH)/libtomcrypt.la
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
+	install -g $(GROUP) -o $(USER) $(HEADERS) $(DESTDIR)$(INCPATH)
+
+#This rule makes the hash program included with libtomcrypt
+hashsum: library
+	gcc $(CFLAGS) demos/hashsum.c -o hashsum.o
+	gcc -o hashsum hashsum.o -ltomcrypt $(EXTRALIBS)
+
+#makes the crypt program
+crypt: library 
+	gcc $(CFLAGS) demos/encrypt.c -o encrypt.o
+	gcc -o crypt encrypt.o -ltomcrypt $(EXTRALIBS)
+
+tv_gen: library $(TVS)
+	gcc -o tv_gen $(TVS) -ltomcrypt $(EXTRALIBS)
+
+test: library testprof/$(LIBTEST) $(TESTS)
+	gcc -o $(TEST) $(TESTS) -ltomcrypt_prof -ltomcrypt $(EXTRALIBS)
+
+timing: library testprof/$(LIBTEST) $(TIMINGS)
+	gcc -o $(TIMING) $(TIMINGS) -ltomcrypt_prof -ltomcrypt $(EXTRALIBS)
+
+# $Source: /cvs/libtom/libtomcrypt/makefile.shared,v $   
+# $Revision: 1.76 $   
+# $Date: 2006/12/02 19:23:21 $ 

libtomcrypt/makefile.unix

@@ -0,0 +1,239 @@
+# MAKEFILE for bsd make
+#
+# Tom St Denis
+
+# Compiler and Linker Names
+CC=cc
+LD=ld
+
+# Archiver [makes .a files]
+AR=ar
+ARFLAGS=r
+
+# Compilation flags. Note the += does not write over the user's CFLAGS!
+CFLAGS = -c -I./testprof/ -I./src/headers/ -DLTC_SOURCE -O2 ${CFLAGS_OPTS} -o $@
+
+LIBNAME=libtomcrypt.a
+LIBTEST=libtomcrypt_prof.a
+LIBTEST_S=$(LIBTEST)
+
+HASH=hashsum
+CRYPT=encrypt
+SMALL=small
+PROF=x86_prof
+TV=tv_gen
+MULTI=multi
+TIMING=timing
+TEST=test
+
+#LIBPATH-The directory for libtomcrypt to be installed to.
+#INCPATH-The directory to install the header files for libtomcrypt.
+#DATAPATH-The directory to install the pdf docs.
+LIBPATH=/usr/local/lib
+INCPATH=/usr/local/include
+DATAPATH=/usr/local/share/doc/libtomcrypt/pdf
+
+#Who do we install as?
+USER=root
+
+GROUP=wheel
+
+#List of objects to compile.
+#START_INS
+OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
+src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
+src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
+src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
+src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
+src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
+src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
+src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
+src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
+src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
+src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
+src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
+src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
+src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
+src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
+src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
+src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
+src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
+src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
+src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
+src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
+src/mac/pelican/pelican.o src/mac/pelican/pelican_memory.o src/mac/pelican/pelican_test.o \
+src/mac/pmac/pmac_done.o src/mac/pmac/pmac_file.o src/mac/pmac/pmac_init.o src/mac/pmac/pmac_memory.o \
+src/mac/pmac/pmac_memory_multi.o src/mac/pmac/pmac_ntz.o src/mac/pmac/pmac_process.o \
+src/mac/pmac/pmac_shift_xor.o src/mac/pmac/pmac_test.o src/mac/xcbc/xcbc_done.o \
+src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
+src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
+src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
+src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
+src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
+src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
+src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
+src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
+src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
+src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
+src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
+src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
+src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
+src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
+src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
+src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
+src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
+src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
+src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
+src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
+src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
+src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
+src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
+src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
+src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
+src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
+src/modes/ofb/ofb_start.o src/pk/asn1/der/bit/der_decode_bit_string.o \
+src/pk/asn1/der/bit/der_encode_bit_string.o src/pk/asn1/der/bit/der_length_bit_string.o \
+src/pk/asn1/der/boolean/der_decode_boolean.o src/pk/asn1/der/boolean/der_encode_boolean.o \
+src/pk/asn1/der/boolean/der_length_boolean.o src/pk/asn1/der/choice/der_decode_choice.o \
+src/pk/asn1/der/ia5/der_decode_ia5_string.o src/pk/asn1/der/ia5/der_encode_ia5_string.o \
+src/pk/asn1/der/ia5/der_length_ia5_string.o src/pk/asn1/der/integer/der_decode_integer.o \
+src/pk/asn1/der/integer/der_encode_integer.o src/pk/asn1/der/integer/der_length_integer.o \
+src/pk/asn1/der/object_identifier/der_decode_object_identifier.o \
+src/pk/asn1/der/object_identifier/der_encode_object_identifier.o \
+src/pk/asn1/der/object_identifier/der_length_object_identifier.o \
+src/pk/asn1/der/octet/der_decode_octet_string.o src/pk/asn1/der/octet/der_encode_octet_string.o \
+src/pk/asn1/der/octet/der_length_octet_string.o \
+src/pk/asn1/der/printable_string/der_decode_printable_string.o \
+src/pk/asn1/der/printable_string/der_encode_printable_string.o \
+src/pk/asn1/der/printable_string/der_length_printable_string.o \
+src/pk/asn1/der/sequence/der_decode_sequence_ex.o \
+src/pk/asn1/der/sequence/der_decode_sequence_flexi.o \
+src/pk/asn1/der/sequence/der_decode_sequence_multi.o \
+src/pk/asn1/der/sequence/der_encode_sequence_ex.o \
+src/pk/asn1/der/sequence/der_encode_sequence_multi.o src/pk/asn1/der/sequence/der_length_sequence.o \
+src/pk/asn1/der/sequence/der_sequence_free.o src/pk/asn1/der/set/der_encode_set.o \
+src/pk/asn1/der/set/der_encode_setof.o src/pk/asn1/der/short_integer/der_decode_short_integer.o \
+src/pk/asn1/der/short_integer/der_encode_short_integer.o \
+src/pk/asn1/der/short_integer/der_length_short_integer.o src/pk/asn1/der/utctime/der_decode_utctime.o \
+src/pk/asn1/der/utctime/der_encode_utctime.o src/pk/asn1/der/utctime/der_length_utctime.o \
+src/pk/asn1/der/utf8/der_decode_utf8_string.o src/pk/asn1/der/utf8/der_encode_utf8_string.o \
+src/pk/asn1/der/utf8/der_length_utf8_string.o src/pk/dsa/dsa_decrypt_key.o \
+src/pk/dsa/dsa_encrypt_key.o src/pk/dsa/dsa_export.o src/pk/dsa/dsa_free.o src/pk/dsa/dsa_import.o \
+src/pk/dsa/dsa_make_key.o src/pk/dsa/dsa_shared_secret.o src/pk/dsa/dsa_sign_hash.o \
+src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc.o \
+src/pk/ecc/ecc_ansi_x963_export.o src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc_decrypt_key.o \
+src/pk/ecc/ecc_encrypt_key.o src/pk/ecc/ecc_export.o src/pk/ecc/ecc_free.o src/pk/ecc/ecc_get_size.o \
+src/pk/ecc/ecc_import.o src/pk/ecc/ecc_make_key.o src/pk/ecc/ecc_shared_secret.o \
+src/pk/ecc/ecc_sign_hash.o src/pk/ecc/ecc_sizes.o src/pk/ecc/ecc_test.o src/pk/ecc/ecc_verify_hash.o \
+src/pk/ecc/ltc_ecc_is_valid_idx.o src/pk/ecc/ltc_ecc_map.o src/pk/ecc/ltc_ecc_mul2add.o \
+src/pk/ecc/ltc_ecc_mulmod.o src/pk/ecc/ltc_ecc_mulmod_timing.o src/pk/ecc/ltc_ecc_points.o \
+src/pk/ecc/ltc_ecc_projective_add_point.o src/pk/ecc/ltc_ecc_projective_dbl_point.o \
+src/pk/katja/katja_decrypt_key.o src/pk/katja/katja_encrypt_key.o src/pk/katja/katja_export.o \
+src/pk/katja/katja_exptmod.o src/pk/katja/katja_free.o src/pk/katja/katja_import.o \
+src/pk/katja/katja_make_key.o src/pk/pkcs1/pkcs_1_i2osp.o src/pk/pkcs1/pkcs_1_mgf1.o \
+src/pk/pkcs1/pkcs_1_oaep_decode.o src/pk/pkcs1/pkcs_1_oaep_encode.o src/pk/pkcs1/pkcs_1_os2ip.o \
+src/pk/pkcs1/pkcs_1_pss_decode.o src/pk/pkcs1/pkcs_1_pss_encode.o src/pk/pkcs1/pkcs_1_v1_5_decode.o \
+src/pk/pkcs1/pkcs_1_v1_5_encode.o src/pk/rsa/rsa_decrypt_key.o src/pk/rsa/rsa_encrypt_key.o \
+src/pk/rsa/rsa_export.o src/pk/rsa/rsa_exptmod.o src/pk/rsa/rsa_free.o src/pk/rsa/rsa_import.o \
+src/pk/rsa/rsa_make_key.o src/pk/rsa/rsa_sign_hash.o src/pk/rsa/rsa_verify_hash.o src/prngs/fortuna.o \
+src/prngs/rc4.o src/prngs/rng_get_bytes.o src/prngs/rng_make_prng.o src/prngs/sober128.o \
+src/prngs/sprng.o src/prngs/yarrow.o 
+
+HEADERS=src/headers/tomcrypt_cfg.h src/headers/tomcrypt_mac.h src/headers/tomcrypt_macros.h \
+src/headers/tomcrypt_custom.h src/headers/tomcrypt_argchk.h src/headers/tomcrypt_cipher.h \
+src/headers/tomcrypt_pk.h src/headers/tomcrypt_hash.h src/headers/tomcrypt_math.h \
+src/headers/tomcrypt_misc.h src/headers/tomcrypt.h src/headers/tomcrypt_pkcs.h \
+src/headers/tomcrypt_prng.h testprof/tomcrypt_test.h
+
+#END_INS
+
+TESTOBJECTS=demos/test.o
+HASHOBJECTS=demos/hashsum.o
+CRYPTOBJECTS=demos/encrypt.o
+SMALLOBJECTS=demos/small.o
+TVS=demos/tv_gen.o
+MULTIS=demos/multi.o
+TIMINGS=demos/timing.o
+TESTS=demos/test.o
+
+#Files left over from making the crypt.pdf.
+LEFTOVERS=*.dvi *.log *.aux *.toc *.idx *.ilg *.ind *.out
+
+#Compressed filenames
+COMPRESSED=crypt-$(VERSION).tar.bz2 crypt-$(VERSION).zip
+
+#The default rule for make builds the libtomcrypt library.
+default:library
+
+#ciphers come in two flavours... enc+dec and enc 
+src/ciphers/aes/aes_enc.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+	$(CC) $(CFLAGS) -DENCRYPT_ONLY -c src/ciphers/aes/aes.c -o src/ciphers/aes/aes_enc.o
+
+#These are the rules to make certain object files.
+src/ciphers/aes/aes.o: src/ciphers/aes/aes.c src/ciphers/aes/aes_tab.c
+src/ciphers/twofish/twofish.o: src/ciphers/twofish/twofish.c src/ciphers/twofish/twofish_tab.c
+src/hashes/whirl/whirl.o: src/hashes/whirl/whirl.c src/hashes/whirl/whirltab.c
+src/hashes/sha2/sha512.o: src/hashes/sha2/sha512.c src/hashes/sha2/sha384.c
+src/hashes/sha2/sha256.o: src/hashes/sha2/sha256.c src/hashes/sha2/sha224.c
+
+#This rule makes the libtomcrypt library.
+library: $(LIBNAME)
+
+testprof/$(LIBTEST): 
+	cd testprof ; CFLAGS="$(CFLAGS)" LIBTEST_S=$(LIBTEST_S) $(MAKE) 
+
+$(LIBNAME): $(OBJECTS)
+	$(AR) $(ARFLAGS) $@ $(OBJECTS)
+	$(RANLIB) $@
+
+#This rule makes the hash program included with libtomcrypt
+hashsum: library $(HASHOBJECTS)
+	$(CC) $(HASHOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(HASH) $(WARN)
+
+#makes the crypt program
+crypt: library $(CRYPTOBJECTS)
+	$(CC) $(CRYPTOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(CRYPT) $(WARN)
+
+#makes the small program
+small: library $(SMALLOBJECTS)
+	$(CC) $(SMALLOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(SMALL) $(WARN)
+	
+tv_gen: library $(TVS)
+	$(CC) $(LDFLAGS) $(TVS) $(LIBNAME) $(EXTRALIBS) -o $(TV)
+
+multi: library $(MULTIS)
+	$(CC) $(MULTIS) $(LIBNAME) $(EXTRALIBS) -o $(MULTI)
+
+timing: library testprof/$(LIBTEST) $(TIMINGS)
+	$(CC) $(LDFLAGS) $(TIMINGS) testprof/$(LIBTEST) $(LIBNAME) $(EXTRALIBS) -o $(TIMING)
+
+test: library testprof/$(LIBTEST) $(TESTS)
+	$(CC) $(LDFLAGS) $(TESTS) testprof/$(LIBTEST) $(LIBNAME) $(EXTRALIBS) -o $(TEST)
+
+#This rule installs the library and the header files. This must be run
+#as root in order to have a high enough permission to write to the correct
+#directories and to set the owner and group to root.
+install: library
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(DATAPATH)
+	install -g $(GROUP) -o $(USER) $(LIBNAME) $(DESTDIR)$(LIBPATH)
+	install -g $(GROUP) -o $(USER) $(HEADERS) $(DESTDIR)$(INCPATH)
+
+install_test: testprof/$(LIBTEST)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
+	install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
+	install -g $(GROUP) -o $(USER) testprof/$(LIBTEST) $(DESTDIR)$(LIBPATH)
+
+# $Source: /cvs/libtom/libtomcrypt/makefile.unix,v $ 
+# $Revision: 1.4 $ 
+# $Date: 2006/12/02 19:23:21 $ 

libtomcrypt/mess.sh

@@ -0,0 +1,4 @@
+#!/bin/bash
+if cvs log $1 >/dev/null 2>/dev/null; then exit 0; else echo "$1 shouldn't be here, removed"; rm -f $1 ; fi
+
+

libtomcrypt/notes/base64_tv.txt

@@ -0,0 +1,35 @@
+Base64 vectors.  These are the base64 encodings of the strings 00,01,02...NN-1
+
+ 0: 
+ 1: AA==
+ 2: AAE=
+ 3: AAEC
+ 4: AAECAw==
+ 5: AAECAwQ=
+ 6: AAECAwQF
+ 7: AAECAwQFBg==
+ 8: AAECAwQFBgc=
+ 9: AAECAwQFBgcI
+10: AAECAwQFBgcICQ==
+11: AAECAwQFBgcICQo=
+12: AAECAwQFBgcICQoL
+13: AAECAwQFBgcICQoLDA==
+14: AAECAwQFBgcICQoLDA0=
+15: AAECAwQFBgcICQoLDA0O
+16: AAECAwQFBgcICQoLDA0ODw==
+17: AAECAwQFBgcICQoLDA0ODxA=
+18: AAECAwQFBgcICQoLDA0ODxAR
+19: AAECAwQFBgcICQoLDA0ODxAREg==
+20: AAECAwQFBgcICQoLDA0ODxAREhM=
+21: AAECAwQFBgcICQoLDA0ODxAREhMU
+22: AAECAwQFBgcICQoLDA0ODxAREhMUFQ==
+23: AAECAwQFBgcICQoLDA0ODxAREhMUFRY=
+24: AAECAwQFBgcICQoLDA0ODxAREhMUFRYX
+25: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGA==
+26: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBk=
+27: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBka
+28: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGw==
+29: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxw=
+30: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwd
+31: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHg==
+32: AAECAwQFBgcICQoLDA0ODxAREhMUFRYXGBkaGxwdHh8=

libtomcrypt/notes/ccm_tv.txt

@@ -0,0 +1,214 @@
+CCM Test Vectors.  Uses the 00010203...NN-1 pattern for nonce/header/plaintext/key.  The outputs
+are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous
+step repeated sufficiently.  The nonce is fixed throughout at 13 bytes 000102...
+
+CCM-aes (16 byte key)
+  0: , 54C92FE45510D6B3B0D46EAC2FEE8E63
+  1: DA, 7A8984228DCF944903936CA9D7709ACF
+  2: B95E, 1056DE0CBBEEA760ED2053FFEB554EA6
+  3: 58FF3B, A42DE1A812D29BBC6C1C5AC808565437
+  4: 9D6E6FB6, 5E8E0422792999381ED669CE17601D34
+  5: 40D49E851D, B076B4ED79BF0155B39A743550593944
+  6: 015356B9A6E1, 8D62CEFC451CAE4A21C1C579C6CAA128
+  7: A2CF0A77AE0DE2, 97B9D201740FA59E863513EDACC59FFB
+  8: A44C68E52F95B48B, A461B79D4D9B8ADF6C6618E6ECDC059A
+  9: F56B8AD68AA31F22B9, C5C7D2E6FE34D94CE72B86DA55679080
+ 10: 5C17EEBF4E348CBE3278, 29FAE7B470CB652C501343FE23B25894
+ 11: 1EE960BFAE360302D834E3, 8F8F475EB9BAB29CE14A9CF42C30B148
+ 12: EFF6BA1F2B1389237C6C045E, C895302DD8E75096951EF5CA63BFDD67
+ 13: 5A1179A4047334CCD9162F36EB, 110987D37F45422625DEA402BD7580EB
+ 14: F26E2C27E7D287B182FA42879978, 530FDE90C13A01EBCA86449073A3B035
+ 15: 77BFE79B4BC87116EC5232606E890F, 280994EB0E16C7CF10F31BB60DBF52C8
+ 16: 9926A4CE1AD70B89CC0050A58B958742, A635B4272EBFA1F83DAE270452D877E7
+ 17: BAAF99CAE4753E3304D6F8F9C0CD366C68, A6F606AACD0B87923B43C3EB61AC3965
+ 18: F72453C6765352A31494FA02B388E407B1FB, 0A446D28B7C5845C3621B4D3A0FA98DB
+ 19: A7372589A86B2E137F124A96618095EB5E1435, 3C59A6A858947FEBFD32441E37309F1A
+ 20: 5683E13A4E82A1AB8B3DC2051B6DBF2E1F2BB417, 459D1B0D2CF2C30B5ED5C237D07DFC19
+ 21: 33594C4B84536C23DA5AB2117E9267258CCE5DEC3B, 6E4BB70A72343E142AC4E31CE0FE6A77
+ 22: 332EDC9A3BDB90DBCCF317AC55BE5855CA9BCA2A73C4, 9FB310E5FFF5C754EE1E5FFF865F1656
+ 23: 734618677055469335FFD574B008F2C68B78633F79010E, FAD31386E42BB4EA76A643A9004A8CB4
+ 24: BA6F6ABA2AF35895F7F966D71F4E91A0BDD1DD551826F861, 25A3EC1C91C26283BAA5975390285AB2
+ 25: FF519213E858E36AC8D92450F81CA46C8CA8AB129A997EBB36, 0D4AB2B7A5EB02242C01A81CEBF5D84E
+ 26: B1F80058C3B4316EA86E9A898CD0B9C0366DFCB2AEC0799312D5, 0F4FF2759EDDF6349F4E23F284FAAD2E
+ 27: 00BDC15012F8183112D5C3A135DC60DC9C764A04BD39A8E041F1D9, 0C68BC9E6A6BF1B01743F3183C9B7C80
+ 28: 3022FD12969D925365C553D98D59E5D1EC494540909D1FA794F41E18, 05E61844943E78DB9BD417DDDE9C98B2
+ 29: 4F4A4554BFED6BAA09E3D8843C4EA3807B8762799C1D21289A46575389, 3A59A6DC9230020FE061466A92BBCAFD
+ 30: 6AE735EB15D9B39C8AD0E54F45307AAD97DB9F8A2A66BDC9BABCCFBD54A3, 0BDB365E493A9E160EEFD7DE24101870
+ 31: 4AF19F00EAE55FED2304B94FBCA29383042F2BE711041323C1D9F14BA63383, 94561581E496553D068052BA698683D2
+ 32: C2438BC46A92A465E0DB41E638CC6C8E0029C4DA842CA4140D73F90985EABA9C, 0F5A69F52AA8D8508D09E642511E54E5
+
+CCM-rc6 (16 byte key)
+  0: , D01FACF2BB577BFA6194800E53FB4A00
+  1: 65, 92E48F7300FA2697E9E0FF80DD187237
+  2: AF5C, 332863BC515649D5BCAB6A2FE5F5250D
+  3: E7C89D, 49A641F027C65A15100009D99E79CF3F
+  4: ACB36D46, 53DE328A8B4B14CAD363BED53DACE8A1
+  5: C3ADAE6CCF, F713F5079BD77046F95D8685CDF522DC
+  6: 5A8CABC912DA, FB97B059D2BE1273497FA8D2739A1505
+  7: 27F101DD6D0894, 266ACEF34476A0E64410D209219335D0
+  8: 66164DA09BE2F46D, EFC64C01890A5B562AF39ADFC48E1CA9
+  9: 1B0018895394753995, FA894E1C882D96E35A4C238708931F3D
+ 10: D346062826187BAEFC3B, A036AE1D3C02E2AD23541DE095AC7B84
+ 11: EFB375BA1138339FA1B504, CDD4232FF4664D59D5AC6BE32CBE1B35
+ 12: AFCF494078D7D7E6D9803FD5, 07E06ED923F76150BE82C1DDCB62C4DD
+ 13: 75DF2EC91379408DA426A444E4, 440ACDF2A6567FA3A5009DDFE502A1A1
+ 14: 3B36B62B01E324E702694305DD29, 4093598607DCD9993845D1837D211FE2
+ 15: 7DF6595C9711B164C99CB246B4D57E, F364993B2C187058F466B62D11E0F94D
+ 16: D317EE9EE1746D1B89A4CC52D88F0819, 41856B0B229D38344FA718E04CA57A8B
+ 17: 85252277A97CA7553007995BD5A0DCD372, BDEEAB636BD1ACC8D5A23F658150FA30
+ 18: 36FF305AC6EF662C155A1C15A6C195D3EC88, 9AC48EF07A510E308E06E79C0C80C3A0
+ 19: 51645A614313E978F6DCE7BBDDEDC33E3284AB, E9F7723E763AD50161C0671C4034FD0A
+ 20: 3CB9E6D0730FE05F903D338708AD8E34BFBB3285, 8A12185DAD518049F0FAC945A8FB305A
+ 21: 276E37D246C40ABF32DC83007B95390EE801CDA6E3, 73FA1D310D031E0A0A3A1421661B4697
+ 22: 4444BB070EDFBD1AC59D0BF70D66F48F0830069F3562, 9DCB6A99CBCCE3C8AEF29F06AF5057FB
+ 23: D16BA084CF82EDD2E43349311140BF3A2E37DE40544BF3, CB93C5AD60C700D4EA653136101AACCC
+ 24: 3FBAEBB36E2B74014043BA7D72F899B0D8DED883F592D778, 54DEA31D7EEA863A06A16D6C9B25DC13
+ 25: 3614B5428B790793F31E23670A38A070B65DB8E51C61FEA9C9, A91B750FD7ABFF18376C982DFA0C8872
+ 26: AC15FD90A4C254BA1406BE7DBA5694BB2625F634C69F45CCCD04, E6F97BCC8526BE3C04BA139EB50E65DF
+ 27: B506E83557E48553BD8557411D2C17D64005E734BA5A5FF1CF98B1, 6FA001758A19F783A71C97AF1AA61F94
+ 28: F07721663400838947EA1B9404D9683556F2D911429A9F59E3F5AD31, 376A1165A30C919E96C3706A4AB5DB37
+ 29: 98B5EB8FE0005E515A585D8F44D838FA590054EA5201CD444366B6F71E, D8C58448F601F2C05F24ED2CC349C78B
+ 30: E36E2FC225767CC1E2C388BEBC2C81C340FEF5B504575D5FA49682E1C214, CFED56F38CA4F84E6E1E16CEF50A6154
+ 31: 7A9FDD8E481B822B3D282AAF726944101ED61DAE73782DE055D7D305E36B27, 328B10841E977041CBD13C39CD70F03F
+ 32: 48AE8B5FA027930A7BCEC27468D795D0D8E6099C5F0558361B3AD20C1ECFF89F, B180AA9353E9EB6A22710A4DE872FACB
+
+CCM-safer+ (16 byte key)
+  0: , E106F41D61402E532662213EBA471BFF
+  1: 05, 1749600C7045647DCB3293C0724E7A21
+  2: 2355, 80DD597665723F4AEFFF760C5C6C5EE2
+  3: 5F4CD8, 59AE54E63A8CF4DBAD050B42CE922013
+  4: 75F63A43, C31B6BD3125C036C99507DDEE0197201
+  5: 51D4D87B8D, 0F3872088CDEB0E958C35F343677AC24
+  6: 8CF6D81A274C, C8E688954E72A052B5F8D1CA46FB44B0
+  7: 5EB8283B299AB1, 5977CB96C8D439DE3A86AE0452A2EE34
+  8: 829B1A4EA8643EAA, 1E892D3DFB73A469035CA81DD7F937D1
+  9: 0FEEF9504CF0F4E282, EDCBED7C61E8E2D24392B4145218F0AB
+ 10: DEF7679D3073D461A94C, D7ABAE561901CBB30FD7D9467C088B3B
+ 11: 625FD679C7354A74D62893, 450E3954857640DDF4C7A95A6E202A1E
+ 12: 3C9E76E4E2D4D95FEABD5C90, CD4467F695B7ED8973AEED5A822B347A
+ 13: B1B6294ECEAE6AEE4853731CA9, 6042302DAE598822BE8554BE038119CF
+ 14: 204BF480582D4BA408BAD23CEB52, 4D6B87334E1BFB9BA2D42B89B24165B2
+ 15: 277591770E3E2DB97A3011D9616991, 75D0A4B9937748EAE7794056F7A8A7FE
+ 16: 5669F75D0C908BFF7B82095231B86DAA, 3E816776A73FB89276534A3646C0F8FB
+ 17: 37E621EF5A043A83FC98A65329891BC031, 159A823EA61B3A47B42EFCF12F304725
+ 18: 18AC6ECF3F478A0797BF813C871235A9D309, 9B415B1B3A933B22C9027E2D72764956
+ 19: 671484C7587DAAB885C7F2FAF030081B452CC6, 574A63D113A5ECEC877D5A368A3160AA
+ 20: D7AB0F7D46B7ED976C8F6E7D0C6AABE3CAAA5A6E, 266C7A025C4EDF657DD42EB82BB6616A
+ 21: D60E4CFC6500E237276A69F35AE4BBAE17371392EF, 6ED2A1673F8B4DB795547D9D93D76D8B
+ 22: FAC6E21979D8D9896C790CB883C29F84D6820AE4FD4B, 1C7B6D73200E3C2DC5C701152F38EE8E
+ 23: 39240DC2B544CA8BEBBB4EA499FD48A5EE707198AE8AC8, E7FFD169552665ADE7B9C0DFFDD04EBD
+ 24: 6BE2C24172CAA192D55CC3E640E34675DD7F441CE5DB0FC0, 760CA976355281F76E49A2856A4EC7A0
+ 25: 0E20427218D6447D6E23FA4832CB8D2A172B23FDC542B41524, 27D0F37E109252FF5E6F6F703CA784F5
+ 26: 0AF75BD89028A5691B8B7993B9CE4FD24334A312DE28212C8B2C, AFE4C6B193B0F1796FC9E6C23292C060
+ 27: 6830D8E2E6DEC1476796DA44C982D36409E268F966283A66E801ED, 9E2C92D5B30EB0943E17869ED4C789EC
+ 28: 75ED280BEECD7768F7E032071F0E06D9D6BF1C9FF8E5DEB536DCD4BA, BF0DD11D633DBA5DCD25F4172765570B
+ 29: DF1FAECC1DB24718236B18B90B354F405FD5DE1257EC43F811F4A43DCD, 48D182E572E794350BBDA91FD76B86BC
+ 30: 176681E38ACACCD3C625F554C1F7A2D7C2C474C9444EAC8929B8C36EC05E, 080E109FFC5D247F1007217DD642BBA3
+ 31: 8A8172C21D88A1FDD43089C545C308507617F7BDB02C47CF2719F1484407E2, 1A0D10B0AF5BE21BF19D570D3FDA5BCE
+ 32: 0A93CAE2B95517773A4009FD3438231A207B9D46AABAE83FC4E1057EA4E2D6B4, 717AEF2F55DC8669F7E2D0298F8A7BE9
+
+CCM-twofish (16 byte key)
+  0: , 33B3DF1B59C84DD3C15E4FEB66173303
+  1: BF, 92DCEBF1C11DD0B028DEC944A555E4C6
+  2: 8A4F, A859C7F76291326D821BB3C7519657C0
+  3: BAE755, 14D7C2EFBCA1063460FEFCEBAE3AD79A
+  4: 25695BC6, 9358BC434B14B59ED17F9C0D3F51DCB1
+  5: 1D9FC70ECE, 2A86578FA3A8C702E2E6723DB9A9893F
+  6: AC39F1DF3661, 3F9C71EE0506FD2BAFFEE7200D22CD92
+  7: D330A915EED9D0, 22DC25EDF5ACDEF8358BE2A3082112BC
+  8: EF913ADAE6380507, E87D72BB6395EEEF2AD4F546B4033DE8
+  9: 5EC16994E762BCE467, D7700F7BF4FE026A2076F161C3383A0A
+ 10: 7EEB4910B7C2B540B490, 40C88A977E1DCDDABD749ABC9A0C60F8
+ 11: E5DD32FF54D39451CC2AF8, 541B1558B5AFF6E9EFBEE496D60AD65C
+ 12: 242C2900F859966B6627FF5C, 1CED148098350F3A5D1B5634180817A3
+ 13: EEF025B9E4EB867B127EBD19D4, AD0179A07AD1418C25F40E123C2BEF47
+ 14: C5E812B0AE37098686E2C4452C12, 02FC88AAA62E34742BB8577A651E922B
+ 15: 7BCAB32D1A871A62F9C781AFCAC60C, 2CD1C11EE197D9E130359F76E7F49251
+ 16: 1E82D8B8EED9A730D1670F0DCFF17B60, B7730261560EA6CF715FF7006D5FEFE2
+ 17: 0E1966992E360DC81312B28ECA6865B811, 10C40ACD169CB0F2A6FFC99F9A5516EA
+ 18: 5F5418C1322BF7EB828CF27C1F72086515BE, 90F8ED0447171A10476DED39F7518075
+ 19: 6C552506FA167FB8AA12E9F416930031487D4E, C992009F83F31A7BF922BFAE68C4134B
+ 20: 38429D966676406B17638DB7F9F7205250408BB2, 3385A50E9789D2C63835A80EFE9CFAE4
+ 21: 56EF426315EF96BE4C60B49F41C9BDDE2E0CDB3C22, 2D51D5B4F5B04BEF3BC1A7CF1AEA70E9
+ 22: 314B075C097EE531ECCE6AD7CEF22A72AAFCEFB02029, FB7A7D84D23FF524D060871D90FAC106
+ 23: 61CCCF7E2A9B3E46CD0A94D7F4A7617BB0DBA2D989907A, B3F4D46094732F3EDD81E0755F0C52EB
+ 24: 7A812A3BCED4E0A72FB81218BD5A4E33D69CA18834FFAE61, 487F80588B41F4E1198124708987667D
+ 25: DBFAB77EF07AA4C9ED2B05500BDFA00FE3F19F15F97A74880A, 84504D9EECBC6CE11B18BD105DE55E2C
+ 26: E676D4739B01B5101E36BF8D9F4FAE8F767C028E83A6D5B39664, 3141A05669807BCA30F0934F599FD077
+ 27: D8FEBD069D87C1EE504CB8F72ADFF2166B14BA40B17B4DAA439668, 1D99A301943041C2F7A71432DA736FE0
+ 28: D98E2A1CFFAB28341F92C41971A21AD0FDDE733EA25F2607967CD0C3, 42E05A53BF4F1A6C5B7F84742ECE031B
+ 29: 13FA412B484945C1FE8291A7EB8F8FB78D2DC2C72C5132386EA82BF4A6, A1A8E8B026DD116B0F9C73EB14C1C7CD
+ 30: 10ABD2DC25C8BA594FBFA9312E69C1A2DBF326475AF2080E55E3611FBC0E, 49DF8A5171DAC3FB684BA2CF7FBB3D3B
+ 31: F401D2123619B81F54F307B783362CC40FB4FB2433CF51F5543A147BCD1FE5, ACBB670CB3722059B4B9FBEE67703E98
+ 32: 839A9BFA1D3CA37924BC6648DED2291FC61736A3638906D9C5DA28A66AA684AC, CD07B83C8E0C3E6FB4115A149BDF6FDA
+
+CCM-noekeon (16 byte key)
+  0: , FF73C6775C61DB36D9B5EEC812091FF7
+  1: 5F, 7D2AEA62A5202E3C4FBE05F33EBE4CC5
+  2: 0EA5, 312ED15FDDAB6EEEAC6AF9BE9CE698FA
+  3: 968F95, FA1AD58B85B93B5A4B5096C881F773C3
+  4: 9A8F4069, 8911063ADDF79E27D9DCEFF3F440E6D7
+  5: A5C0376E27, 9553F44B0BA8039527F8E05CD70AD8B0
+  6: 5B097736F3DA, 405B7EC685FC94903B36AC8E700558B8
+  7: 616810AE303B2C, 64C95A2DF5263F7BE6D1F9F3CF88EADE
+  8: C8D69A2E1170532C, 073A7E426266237FD73D8109F55AE5D3
+  9: 3E42CDB7DA4A72F2E0, 48675EA4302CA6BFE5992DE96CE43BB3
+ 10: 88532CC1F3E321F66D64, 528B3516C6D9A4B5390DD32C2A2E6C19
+ 11: 9216A8FC9A961E7F602F7D, B03047186B783844F5B6757057576B38
+ 12: 89B0858D4FDE6795EDE19CCC, F4530A2DCA823307AEDE5AF34E5C4191
+ 13: A676E20BB0A5E84FD0B9149BF7, 11B823B315DA93B0E15780851526D4BD
+ 14: 903AD5C108C43A80436FE2117EF0, EB1C79C7DF20CE2967A99783EA8D6EF8
+ 15: 81774C36F46F67159B7FFC24C080D7, 2E9E4812D9A92977EC34922782B6420D
+ 16: 63FD1C3F692D64B2DA3982FCD474A5D4, 04171AE84857713A9BABBD4564875D33
+ 17: B1BF6AD99F83C9173C6C021ACA74C5431C, 38D17D4F6AA3C24B8F3B465EAACE0A1E
+ 18: 0948D1ED59F07DE44A96A76E05B0B6F7C309, 1848D886FCFF35E85B0DC3CBE5BEE7FA
+ 19: 3458E5911222F9C555A1054C7D9748876DA39A, 584AFAE72FB6065A74BE016CF39D2E86
+ 20: 641F3867185D0605E9D666AB605187E75A1299EF, 6F9332E6FB5EA0CE811E3345593CD163
+ 21: 0676622D07733EF31A765AAB1E713FCE329277FB16, 88547474050FFC986930CC04BA8A03F0
+ 22: 79861EC2FD2BCC5C12B69F30A1575FC66AC1405281BB, FC68EEAC8F39ED69D312AEABF8000084
+ 23: CB2731835A576F7F8F2C2786D786FB6186E2F85D89DA3B, 3ED9E95BC51CF6368E6EF63667B35BD8
+ 24: 3CB1C02FADB6DD5483BC5D3C03D944102CFCEDF82B913402, 1C3F60C989A6FBF41A7AF4F29115C334
+ 25: E69FAEA5E3D0B76EF9E70F99C5918D934D0E9836F248DB9EEE, 7F1916B2CF7C9A5E3F5581D365ADBD31
+ 26: 36779AD755A9DF2DC3C5824DC2F7DD4FFE038628A4E1A1C33AE7, 2BDED3703468D267F8AB7EC0AF8F1E65
+ 27: E9D325646A41EE5AA7DABCDE98DE83440A7DC02714BA0AEE017E22, 972F4D7832F3371C60DCD04A6DEDEA15
+ 28: 0FAAE3F6028A28A80BBFE71FA7AA9042E538B41A0D514D6EB4EE6029, F7B3925495E260249ACC6E1CBE956BC5
+ 29: A9CC39EFFEE354C0E0579256AA85CBAA7B10E670DD3828A7A05DA0F49D, 28D9D20187AFE70AD9DD16759F0EFEB5
+ 30: 032F4BBB4EBF2E65758C541FDAFF2107DDBED399739849F8EBB41AF9711F, A3436981ED637CE5EEE01B380C46ACAD
+ 31: 7B321ED831CE96A603668E3E74BBC7453749A03D04A1B38E95966E6CC488F0, 88D1DADF2C1EE0BA579D0A8A90C1E62A
+ 32: D862B0BD0E2178AE05AEFB14F34C791547C5956F1F3B5BD525926578DE383A94, BF32CFE059F27222DC55D3E7CE7C5F10
+
+CCM-anubis (16 byte key)
+  0: , C85F41475E06F25682F855C3D45A6523
+  1: 25, 437BD73ECB8CFFAD9B2876F08D4BDA36
+  2: 5ADC, 5C762058A5EF71278B69F567F18CBE51
+  3: 95E541, DF099E8218AEDE8087791B38298334E9
+  4: 2DAA84E4, 7437094198E4AD2647C2618248769A26
+  5: B9641C5855, 91B02EC44D22460BFF22BB40C799E20C
+  6: 102012BCEFA5, E60488DA65D683182F0EFDF9DA52A78C
+  7: 8F14972CA4F8EA, C26B51F20ACDEC7DCA911500CF1241ED
+  8: ED2714B652972256, 8BA29459D5D370FC608EE362B55B7633
+  9: BF58A269A4F59CE0A4, D69080820F836E5B5CA8F393E61ED009
+ 10: 44AF1F715ADAF26C6EF0, FEFBC7DB75ECDDBA4A13CBF9A57873D8
+ 11: 77CDE1B951F0803893642D, FBF8B80B061703504D8D3A7718366B6E
+ 12: DE599BAAC9D3EFD9FCD47E44, F636EC35D172D661F01746FF86688B95
+ 13: A792B8359050C4866572977415, AE67D4EED92E63A14003FBC936EEF43E
+ 14: 62D5A7A4DFB78A175831627987CB, 25F7B440DBE9902C28B28E50BF02C516
+ 15: B6F289459F924C76586F4EEA0C1CAA, 54266B4424C3AF6E81F6CC4F2437F54E
+ 16: 884B7DF3395F063DCA26BDF9F2FEF4EA, E3C2BFA1964EFDF78FDB9559C8031C50
+ 17: 774962377B8731F2F301B930487518801F, F35B54264711D843D23636BA6CFA3E4C
+ 18: E9C8D1164F2B196C7305406179B232E45F1F, 2A13E034A136EBC0ED3361737EAD214C
+ 19: D3DCD242C952C5589E00B65CD826CA87691B8F, 9D624D482042798DB896B55D801EAD98
+ 20: 57065B2655D4799C0478FE7E8463A2215E758875, C8FB052F14F9DF6731A9C8B566E71D53
+ 21: FF736FDBD23593D9BC9A0D8CA7D819F550EF969322, 5CC3023029790BFD43204B27D52D7D7E
+ 22: C562B7387B8F1D3DBA22DD1636C9C4AB443F2FF15F70, 195C928EAF88BB4ACBA8A01B4EBAEE6E
+ 23: D0AC6EA8A804DC261304D4821E6AD7FCC2F0DC1A299B9A, 34FE2034CCF09A98DD50581DA8BCBE39
+ 24: B65933A7D7C8EF19C1BDEAABE2B4CE5E821459D953565EF8, 42B20EF142EB228803D6AF47C6482BEB
+ 25: F1F4FCE842EFEF563F6F047956E6706DC9B178D00D82776D74, 3ECE3050D8C80319821D5F57A7CA7066
+ 26: 4A3F10F4E34210A5CA1B81AD4269CBC3FD68AC662BF0E9DC9935, 0BC0724AA9A194D8C75EE6FC8E7F28F1
+ 27: 077F3C055303FD669BC1A370B18AA7F31D3C8CBFF5A69381404FBB, 872C7946401BE70E677B79EA13FB0F58
+ 28: FD39D32B27FE5BB8E6512C642D490E0AD0866E386580AE115C85ED2B, EE81712EA57DD54DDEE98EAB3285E6EE
+ 29: B45ED179290A6064188AFF6B722B37F8C3E984EC37AB5F47B353229B12, 186B3AD0C9F60D57E84992CBB2B0F71B
+ 30: 83FF1FD179D518A414148C15BE566BE4CC3DBE9FF5319A651E862811F152, 4B2942C66565EB9139A83C2EFD549D55
+ 31: B8176469E6A0D5797ED6421A871FEECDE48ACF011E394981C43AC917E8FFD5, E9B01383DB1A32E6126BD802A6C6F47E
+ 32: AB6A0AA29B687D05735167D78DB697BA2478BD14ECD059AE9D1239E7F2AB48FD, A560A30FD87CF28BA66F5B2638567E4B
+

libtomcrypt/notes/eax_tv.txt

@@ -0,0 +1,461 @@
+EAX Test Vectors.  Uses the 00010203...NN-1 pattern for header/nonce/plaintext/key.  The outputs
+are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous
+step repeated sufficiently.
+
+EAX-aes (16 byte key)
+  0: , 9AD07E7DBFF301F505DE596B9615DFFF
+  1: 47, 57C4AC75A42D05260AFA093ACD4499ED
+  2: C4E2, 26C5AB00325306772E6F6E4C8093F3D2
+  3: 16177B, 852260F91F27898D4FC176E311F6E1D1
+  4: F09F68BE, 700766CA231643B5D60C3B91B1B700C1
+  5: 8472705EDF, AC4C3359326EEA4CF71FC03E0E0292F2
+  6: 14C25EB5FD0D, 8DBD749CA79CCF11C1B370F8C975858C
+  7: F6A37F60670A85, AFBD1D5921557187504ADE61014C9622
+  8: 1AACFEAE8FBAD833, 82F477325D6F76BB81940AE25F9801C2
+  9: 069414324EC293697C, B980E21C09CA129B69E9032D980A9DC5
+ 10: D8174DE9A2FC92B7DA9C, 1E42CC58BA2C8BFD83806444EA29DB61
+ 11: 2C087DEA30F8B7EE510990, 83DB400A080C4D43CAA6EC3F1085A923
+ 12: F36B93C272A703D3422C6A11, 1370C3AF2F3392916364BBBCC2C62EC1
+ 13: A0F33477BAE2E28E6747AA3193, B626DC719528CAC65DB0EF94E35422CE
+ 14: FCF5193506052E8BFA095C1A5205, F5BD02E0B3C91CC7D6FAAA8A9A76CE6A
+ 15: 3797D7F8599B8EEAB39C56241880DC, 0B70003E77146B903F06EF294FECD517
+ 16: C4BAD0E0356FFD369110C048D45D81BE, DE7C2B1D83BE2CC8EA402ABE1038BB79
+ 17: AF5C358BD31CDCAC2F0EA5252F1C3BE1E4, 2D700986F93B22DFE6695C2A243B4E42
+ 18: 7DEF9056FBDAF491D7206B26B19DEF617AA1, E71A7D00BE972D85C77931D7591B2151
+ 19: 6E9B2C0A90BF9D38A6EA3B5D2B9B2D97F938EB, 5B483D7F15C39602C2918181E57DA341
+ 20: 7C5F68DEE9BBA3B04F11D5FC7C9C7FE6E8B5025C, 0AE6A12D37A9C10BB1A494E16705DC05
+ 21: AF0A886BF673BC72045FC074F06A0176C96105E2E6, 06B2DC9A2868C23F86D710E01E37E07B
+ 22: 5F228A986DFE4301EDBAF07A02E114F1B30932995CD1, 74EBF68627C78B1FD024A59B56B2A8FA
+ 23: 911322F60555118CBECD8DD82F186AC19514316E8D48BA, B6A8BAF2F175CD0C71B63B1EF37E185E
+ 24: E7F52730CFB808EFDB376A5D5DF31A7EF8292DC5FC37E9BC, BA2AD158A2D2E5CE01296402B592E1DB
+ 25: B3F8D7CA47D8D86E94D670AFBAFA3B8D9E186C97DC029D4705, 709D2D2B9975D4729C19D4EAC430E65E
+ 26: 7178FEC027AFADDC2C03518E75CF34D207CAC2EB1537A0DBA520, A315F034CE5E66601444402520F55DE2
+ 27: FC230B2B8522F53459D0B968421469BBA7E683ACB0190393B2870F, 48679A78E470E175CF3D3E9B46CEDFCE
+ 28: 35A641127C78C721ECDC50866C21637FDC9515E41CE60F09015EA713, 0062987222F6412B7AAF8A9ABF6FBF98
+ 29: 3D42D6C113421743C08A6F682CFA0E517D5531BB66241C02EC4DCC26F7, B1AAFE11FA2D6E0C870177DDD7F98FF0
+ 30: DAD065B4669B7C59C8392D8E7BD7E64BC01CEFFF27E335B25A328D356F0E, 8973B9B9ECF26DAB58CCF0787EE928E5
+ 31: EBE626F9E241FD233D9781C359430C982667AA26921B62E98FAEC502C01B0B, 2AC0D7052A2CDCCE8E26FEA7595198AA
+ 32: 64D842B66796A797C2B4C6905742FDF2148FFC445E192F9E03B53810C082F788, 9778B345EC12D222DCC6DBABD2651750
+
+EAX-blowfish (8 byte key)
+  0: , D8C4C23A6AC0B7B7
+  1: 2A, 5E0E4BDDB60772FB
+  2: 7695, 7581B16CCC9C45F1
+  3: EB14C8, 6223A121CFA216C7
+  4: 5A5C809C, 4A47658796337D6A
+  5: 8BC2041181, E1FBA8DBA00571FC
+  6: 89C666F015FA, 2B4A76A0E699FCFE
+  7: 86C1FA92484AF6, 31B3B738A261D6F5
+  8: D1F401C145C9328B, 4C4A045EB489F59C
+  9: 70C9C7753698324A73, AB298B5B20567EB4
+ 10: A50D9D88DC101B6DC8D2, 529DFCBFD13B8E6C
+ 11: 7CC2885C2BE79C44F28FF2, 566255022B40C81C
+ 12: 6902D58347C29250EE07981C, 34619AF18E14C690
+ 13: AB6C3C4AD3EC45143392B642DA, E6D2DD323DA175BB
+ 14: 7065B28BA8AB67B2FB7B6D5E3FAF, AEDCAA54F4B0772F
+ 15: CBBA14A74AD4ADC0EF036EDAE42D51, F2BFFA4D81BAC034
+ 16: 60A315193F58144F5701D547C79FEEED, 912FDBDB05467DF5
+
+EAX-xtea (16 byte key)
+  0: , 86881D824E3BC561
+  1: EE, 4C3505F04611D9C2
+  2: 80C8, 6A3428BEEAD60738
+  3: BF88E7, 04F1E99E9F5906C2
+  4: E06574B7, 33B0153AAEF9776F
+  5: 42D950AF63, 4A0F415640322FDF
+  6: C30F6AD46EC9, 9646FE909D2B95CB
+  7: A0049FCA856A14, A0257289C6BBF278
+  8: 2814B0C1358440E0, C4B0A2354925E887
+  9: BF4F062B52C1E489CF, B56442A3CA57A041
+ 10: 63DF433956831B8780FC, ADF9ED0B46DCA19E
+ 11: C317FD079817F50E0E8A16, 2EA0EC993FC603AE
+ 12: 2BD12FDDD81EB11660346D2A, FBC6F69125BBA88D
+ 13: 85D356536FE2843C6BBE60EDBC, BB2FEFD04F230E79
+ 14: 22493009DB01B4746F4927A8C4FB, 64CC08471D93C9AC
+ 15: C0F3C0DB08DC93FBA725D1E02DE084, 77B762213DDCCFFE
+ 16: 568B66D3112556BD98FF9339E9C002E5, C8355F508219FE0C
+
+EAX-rc5 (8 byte key)
+  0: , 169C7954341EF44D
+  1: 22, DABFDA9A0B0BA067
+  2: 2E54, 6A3D6D9AA5877C5A
+  3: 2A6ECF, 2A34A3AF5DE8919E
+  4: 9CC5F84F, D3F673EDAF75E3B5
+  5: FF5611756C, CC647FAAC8D49BF1
+  6: 74C939BEB31C, C335999CCFE8F5FA
+  7: 7976B6F7709B5F, 2A7969C5FD063A88
+  8: 421EEC5022276174, 2C9BFB1EAC3C54A2
+  9: 6A4761CD266B1C0ECB, 3EA3CCEBC85FAC4E
+ 10: 7C09201098E764239A2E, 8043ABA9BF4D5AEE
+ 11: 8CE26277562F646DE33C88, D72AED48895E3B40
+ 12: 52150F44D37D121560DA87F6, 58E865E22B485906
+ 13: BA0A73B45F93ECFBFC3AB3D8D0, 683D52FA47FB1A52
+ 14: 96546CBE01054AD24CC95DB54724, D80D0D530E5D1DDE
+ 15: 61E654BB18CD26FC36C09F874DC2C7, C65884CB9D9FEC1E
+ 16: 1D77B8BF02CDEAB4A707C07628826D5B, F18D1730C3D64701
+
+EAX-rc6 (16 byte key)
+  0: , 1DF8B0B92A3F0C951C425AF4830E63FD
+  1: 1A, 8A2959EBBE90180999994DEB7036DB85
+  2: 435D, 7EF00CB57DB7B4155DB530D75CE6B025
+  3: 08A6CF, 2ED6AF0F2D5BAB05F623D389480A01F2
+  4: A86E54D3, FC69547C8BD922A5BF2F7B26C4D20F98
+  5: ED0822E439, 0007A3C6DEFC6C912C0E5B853B520368
+  6: 7BEFC7FD4054, D32C43A4D1086D57C5BCFAEE04EBC600
+  7: 5235E58E79287C, A27E9C781327C0FC7C55410EB0C828A9
+  8: CEB5EE99BE521F4D, 547F46383987F2A3582A81A3BCF9B280
+  9: 0358B063D5F99C3770, C0A73730512CDA6AD49599775D59EDA1
+ 10: 434B9AEE07DFADD0A332, 499BD88881E558E09A8E822BE27D2496
+ 11: D47849E650F350BB622D74, 638E37A84E7FAAF8F5D77F1B061773DC
+ 12: 814592F568284085E79A024B, 9EB1405E8422FE50BC0D88D837A2C650
+ 13: 6F2B55EC91B591082053AF692E, C48F91EF01AA43A1EE3B36D233DDD48B
+ 14: 506CBDD2901838EE2F178B6953DA, 03778957F536509BFCA577B23A18F726
+ 15: 446EE435D3D1848B51BB8C5F7BE4A1, 1129EAEAADE534940546D43242A4C839
+ 16: FB9D2B150C42465B1685D8F069CC06DB, 41E2940F5DC63CB4E2FBEC25ED8A31E6
+ 17: 9684F683260107BE8FEBBEE1D3EEDAA7BD, BAE7C116F7FF96631F4ACEE95C65CEF3
+ 18: 5082B1FE48CD3AB58F63C2DCFDD4069AC736, 19AC7B8EE315CBB7131A283851B32266
+ 19: 8C72AE495B6F003A3C784D144E84E88885F78E, FA4CEC023740A8D670E351FBCF62C1CB
+ 20: 815D6361C7AE34C9D796ADF9C71ABC46AEF88BC9, 9A1F7288C61A6623B9A82748137ED7CC
+ 21: 904A853E2E96BD2B85AAB3F5DFB900E9B3642EE667, 9AA90DBDD461CAD20495DCFBCB513DD2
+ 22: 79D738A462F727B3D3C529ED999B6FDCCD991D1C5A4D, BF0987BEDDE650D73CAE7D380FED3431
+ 23: B2DEFDB7D503A84E83155A04B8DE8C8DBB68C2FC475007, B7CE900CF43CD518024123C76F6DA328
+ 24: 9E723E15439E12F6C46DF8A309AE1E97B6FD18436259CFB0, DF8B6E1E23512CC4CF5FF531A1908F69
+ 25: A7F0AD03CEBCC9202718AA164886E1026975306A664C5AC7A9, 4A771BF8B9A4325705C85E5499FD98E9
+ 26: A53A92AD1C6835F28E04EF591E783D36F3D76E489B31B87BEB7A, AA263B52A6E6A043DE4D7029D4DC73F5
+ 27: 79BE3C38291A7F77E932C8A9DEAC08DE6442EA9B3895B101A14E7B, 33B84DE06342E675E019CD0237292ED0
+ 28: FA108123C5A69571CFDFE8C3D00535121FDE3096DDC0D700F8F26A5A, 764025D7CA1A3F2C54D28956423B0C77
+ 29: 36EC2D67FD977BD2B73DB6D8EB756B3EADA13690E1B6DFC12A4781B34B, 4BC6B38DE3B02283D92F4DF19A5C48C5
+ 30: 96D3243C945905C9732B5927E46F00886D511463B38C86002FC26B65AB8C, 5B5511CDEC35687AB8425AB22D58B4F1
+ 31: 9CF83B87BEA3374AF7722E999863E3DABB858B0383383EAC7757F5B80FD44B, 1E0CBC961940FDA93B73A92DACFD67F3
+ 32: CE3BC3C9FA5EF4AFE5272B3EDD24B1B003FED2C2E501528CFF44D3FABFF52CB4, DC94FDDC78AAB2B7CAA1E1EF149AC355
+
+EAX-safer+ (16 byte key)
+  0: , B120C7B37450C46189712E4DFD1F0C44
+  1: CA, 82BA1869C5FF1EF2A4F6ADC1E7DC1F1D
+  2: DD20, 6BD5601B16C9943A84AC1F99A176E6D1
+  3: C1C09F, 0911DC63AA414C004E2BD825BECDC93B
+  4: 27E43F59, BD858F084B082F76814DC385E1FB20D1
+  5: 2A9A92F246, 5ADC4A32491934AC0BD00FCE686B26F1
+  6: 52C78C0CD6F4, F35886F46C03EDCA10B3D01CF07B1E0A
+  7: 23E0D3CED3795F, FE33D96FC98B78A30C0A412C60E93992
+  8: CD3FC9961559F239, 9982364A61609FC41068260267231EE9
+  9: 6EA46CB7AD7505C1BC, BB15053EF0F78B9091B3064118F3E9BF
+ 10: 05D9BA230A56CCA0703A, 1338E68E3DC992B6EB2685C668E75869
+ 11: 7AAD6049DFDCA6771AE42B, 35267E431051E1812495615324C4CBE6
+ 12: 8695091532B83B23C296F620, 7B2EEA861E9A91E6B6A911E10FC3FDD1
+ 13: D909DA4BC7372ACAEA78E6A0EE, EA6C1CD16180DF0B07F4E204A4B4FACB
+ 14: 7DEC8443600D0563AEFE87A2064F, DA454728069B3B409889664783588189
+ 15: C042FE656742CD2FE5D9C212D18C6C, 5929E4AECC2CA047BAE948E7023FE4D0
+ 16: 0B84D3CF59EEF7319633F4A397D47CF8, 31F892FFDB7535DF5D9143456E404163
+ 17: 8C9E57AAFA7969B142742B63AB73286600, C418231C44F96660DDBA8C26B3BB3681
+ 18: E9EED66D370A3A6A39C7E0E570D96F807EAC, A4AFE8D1D3C31B956A3BDBD043E7A665
+ 19: 1A5D47992DA5597D1449B4C8DD47B7404C7657, F3ECEE5182014FC3365FDBC4C33CC06A
+ 20: E7C7945FD1AFD3F5DCE666D8A5A2E8A3C11A7A5F, 86D78B2FBA7597B8806BED505B52BDF6
+ 21: 9E2165B47B29CBC4ACD50660E011D691F061209969, E9B1E860BD02085177E1A94E1EE6F3F0
+ 22: 48EA2945C8DD3FE09407BAC8973A861DB15B788C8FFD, 502926712EDB1B3DD13806052C6C75D7
+ 23: F37D46B35B60819EA52B00457D79155C04B55972D0DFA9, BB2B7D210BF0570F422640BF81F39B9E
+ 24: 12E85C0C78227205CC682360C79E35BF58EC6551CF8FE2D0, 042990D7A58D458C570A15DD375DB4E7
+ 25: 4F6C15109DE980DD14A7F4C27F48671E4787C53A564232F427, B097A5990D8067DD89C21473150C070F
+ 26: AAC472E49DB101B564A8A01E2C80C0C6AE9065D332C2DE79FAB6, ACDD587A7DB86542E195DF73AF1C1CBC
+ 27: B9912CE18019C31692A1F7E11D9CCB20297ACCB9DC62C47C01D2C2, B0ACBF028CA5B15E0035D2EB8CA916BE
+ 28: B4F2B1FE14A1ECDC9C8EA1A0120395E6ED1E69D3FC85DD0F3F90F350, 9A561EBC769369B95B9CB74FC6AC27D3
+ 29: 3FE397C8AD02689B7437A37861F0907AF1F6014A293B46419348771C5A, 6B7BEB9BD5018FECD71BE5081C7C2544
+ 30: 5019089142199F7207E1B7731B8B247A18A685B231499DF12A73F5D67D37, 307E93446777005BA1B088F178A0DB6E
+ 31: EAE8F9F02F8DB3D70B78B08CFB0949D99F1A86C958A8E3823736BCEAB86BE1, 6C94F48591C18BF9C450515B73379973
+ 32: B9C795F7A87305B4AD36DBA10B3B1C70B329D29E49C8C6A932D96A74334AEE4A, D18E6E233FEFD6E5C7148BDC1504299C
+
+EAX-twofish (16 byte key)
+  0: , DB0C02CB069E3773296D3BD4A87A381B
+  1: 99, 7D21D19E9C440F68E99F1F2EA2668694
+  2: 0696, EA590EC417C88E23FD23917F9ECFB0C6
+  3: B9B082, 82D4C9B68DDB02C906496413E13A2D68
+  4: D6B29D74, 5BCE5CA4F662E883BF7FCAAE5FB2CE01
+  5: A59C9CB009, CBFB04226D1029A7EC9D64A48A6729BE
+  6: F4924FE3E355, 3D85B3900DECA0528C815F1447A1F209
+  7: 679C88D52FB519, 931C7A863C3701D8015FDBD8696C6C30
+  8: 26DA41C0D115375E, 7627E23E791A4DCB0FA5ED71B1ED2288
+  9: 8FEC6EB7016AD2B178, F65ED0286A724F0CB2EA317D5022B0D8
+ 10: B5F22415B1334133C531, 87C4F3A8991BBB85984BC4D3305A5CF1
+ 11: 23E1D0ED2E820AFE7DA2FE, 100499F1093FAB2ECF73B643594E98E3
+ 12: 79519ABA91F46B8DAD6D5335, FBDCD1FCDB20AB99135F28A714C6992F
+ 13: 5968D0B4198A0AAD3D0395018F, 781F22E2DA98F83398FCF911B2010057
+ 14: 4E55B14432B601E3EF2EF567CB15, 8BF6E53D7657E56EA3DA1BFD9C9EC06E
+ 15: 6ED89651CE19B3DD1EE5C8780B5015, 131CFD657D32D4E1B35140ADDCA0E13A
+ 16: 2295A968B4D072D12757756247554850, F35FAC95C2AA4155450EAAA6E2E789B5
+ 17: F9B2AA2AA502EA79BBA0C5EAD932B8E1EE, 0ED81AA40B9BF39A9AAEDDDB7A04BEA6
+ 18: 385055F1C1C26C0472A504B4CD225DCA55FE, 24831680B56368231AC54227D737F582
+ 19: 771529585C741A3F8B1C973709892F255A99EE, 2A132B4BF96FD5109DB04459103F5E84
+ 20: E7A2197D9FAA8AB8B303B5EC71AE34AD5EC5DD66, CCAB6518371EC8E0A9E9EE4F7CA5878B
+ 21: 279E54F755EAC6B57375B9EC4406E43DB3139D740C, 7B6F26F2C0ECC9F2DF4EDD7513E6E0B7
+ 22: 27816AA94CBA2BF98E49E595AF5B3FAD12BF1D6F1AC6, D04876C5492D275F15C834E3CF794F0E
+ 23: B5658DC148855F68B282211D879F688F3C142FE555CF81, 4539CDA8A65DB9047AAD76B421B81120
+ 24: 72F0BD4F939C2C9B4FA734DCB0AE4FB9BD342BC8459ED2FE, CEA8469BC0457EBF3418C1114288C904
+ 25: 70568245E6E6BD5D11AD0C74030D7AE08BA05057DEA0FBF4AD, 71554FDE6B87477A51EE4499D78783D2
+ 26: 8702D35BE07D7ADF70684046CC6C72FBBBF821E0BBCCBC973601, 33CC6FBFDA15E306919E0C3BB2E22BB6
+ 27: 0BA23F4A6174165D4A8BA80B7C875340B0F8B2A6967D34E106BC22, 00E6679496714236EECEC84B9AF3072E
+ 28: B9E25ABA84C6BD95B5149E7616FE2E1D6FAACEAAD77A636C60279176, 8D8AD0B9D4C709E1DA370EE01611482A
+ 29: 74759711F6D542581F9F83498FB616638D092732BA07109BF4B5BE045C, 71A40DC777BD09F75362F7B20E0B7576
+ 30: ADBF7E98926484BA2C7F6CD7CD9734FC19265F68AF3BFCAEB025F6296E37, 8DF15B5F69B67F7DABE44E3666B55047
+ 31: 2DC26D449379997D110309B2A0DC2760FCE8CADB4B14ED580F86C70F69C9BA, EFCB60EB2B25737E256BC76700B198EF
+ 32: 2B1890EB9FC0B8293E45D42D2126F4072754AA54E220C853C5F20FBA86BE0795, 1A1B15BBC287372FB9AF035FB124B6A1
+
+EAX-safer-k64 (8 byte key)
+  0: , 9065118C8F6F7842
+  1: A1, 1926B3F5112C33BA
+  2: 2E9A, 5FA6078A0AA7B7C8
+  3: 56FCE2, 984E385F9441FEC8
+  4: C33ACE8A, 24AC1CBBCCD0D00A
+  5: 24307E196B, DD2D52EFCA571B68
+  6: 31471EAA5155, EB41C2B36FAAA774
+  7: 03D397F6CFFF62, 7DFBC8485C8B169B
+  8: 8FA39E282C21B5B2, 2C7EC769966B36D7
+  9: FEA5402D9A8BE34946, A058E165B5FFB556
+ 10: 6CDEF76554CA845193F0, FED516001FFE039A
+ 11: DC50D19E98463543D94820, 8F9CCF32394498A1
+ 12: 42D8DC34F1974FB4EB2535D7, 77F648526BCBB5AF
+ 13: B75F1299EF6211A6318F6A8EAA, C5086AEA1BE7640B
+ 14: 1E28D68373330829DD1FFC5D083E, 33EDA06A7B5929A2
+ 15: 85529CF87C4706751B0D47CC89CEA6, D031905D6141CBED
+ 16: FE5CB61BAF93B30ED3C296EE85F51864, CC484888F0ABD922
+
+EAX-safer-sk64 (8 byte key)
+  0: , 5254AB3079CDCB78
+  1: 75, 798DCF14FEF8F4D1
+  2: 0300, D5FCA75DAC97849C
+  3: 520F98, 10E357957CE20898
+  4: 80E2764D, 5C7F46656C6A46EA
+  5: C48960CDAA, 3CCF44BD41F01CA8
+  6: E0E60BD9AA2C, EBB493983FCEE79D
+  7: D13D8804906A1B, 6EDDCA919978F0B6
+  8: B7AE14C37A343BFB, 2369E38A9B686747
+  9: 5DE326BBCC7D0D35E9, 041E5EE8568E941C
+ 10: 13494F5B0635BA3D6E53, EAEEA8AFA55141DD
+ 11: A9BB35B14C831FDA0D83F7, 4002A696F1363987
+ 12: E242043A1C355409819FABFC, 63A085B8886C5FDC
+ 13: 204598B889272C6FE694BDBB4D, 194A1530138EFECE
+ 14: EE3F39E0823A82615679C664DEBF, 1EFF8134C8BEFB3A
+ 15: 8579D87FD3B5E2780BC229665F1D1B, A832CD3E1C1C2289
+ 16: 74D7290D72DA67C4A9EAD434AE3A0A85, 96BAA615A5253CB5
+
+EAX-safer-k128 (16 byte key)
+  0: , 7E32E3F943777EE7
+  1: D1, BA00336F561731A7
+  2: F6D7, 8E3862846CD1F482
+  3: 5323B5, BD1B8C27B061969B
+  4: A3EC3416, 170BBB9CE17D1D62
+  5: 0C74D66716, 7BD024B890C5CE01
+  6: 6158A630EB37, B5C5BD0652ACB712
+  7: 17F2D0E019947D, F9FF81E2638EC21C
+  8: 68E135CC154509C8, AA9EAEF8426886AA
+  9: EDB1ABE0B486749C21, 355C99E4651C0400
+ 10: DB0C30E9367A72E8F5B2, 631B5671B8A1DB9A
+ 11: D4E5453D9A4C9DB5170FCE, 75A2DF0042E14D82
+ 12: 3F429CC9A550CBDA44107AA7, 2C2977EA13FEBD45
+ 13: A7CA22A97C2361171B415E7083, BFE81185F31727A8
+ 14: 170F79D8B0E3F77299C44208C5B1, D5ED9F9459DF9C22
+ 15: 2E24312D2AE5D5F09D5410900A4BBA, 2FC865CA96EA5A7E
+ 16: 8F3C49A316BA27067FF2C6D99EC8C846, 9D840F40CDB62E4B
+
+EAX-safer-sk128 (16 byte key)
+  0: , 22D90A75BBA5F298
+  1: 3F, 98C31AB2DE61DE82
+  2: 584D, F4701D4A1A09928C
+  3: B9DEAD, 6E221A98505153DA
+  4: 06D4A6EB, 0E57C51B96BA13B6
+  5: 7B58B441CA, E28CCF271F5D0A29
+  6: 7950E0D1EC24, 2ACDDE6E38180C07
+  7: 65A4F4E098D7C6, 7DC1C9E9602BACF2
+  8: FEBE4E72BAA0848F, C4607EA3F138BAD9
+  9: 9B7BD6D6D655985AA3, 8B2C58A9530EA6AC
+ 10: 60C92F925D1478470203, 51E6F5F6DC996F84
+ 11: 7B40769370E651F64AA654, 74F1F8A8D3F4B9AF
+ 12: 7215832C2FB9C54DF7A9C686, 9BF9AEF14F9151D1
+ 13: AD0F9C79008572AB8AE2466EFF, F375D0583D921B69
+ 14: C05076E2C330A0D25D7CEC80597F, 843C12F84B00A8E0
+ 15: D18F0563AB0278140B0CD9A9B07B34, 262B1688E16A171E
+ 16: 650747091F5C532EE37D2D78EE1EC605, 1BAC36144F9A0E8D
+
+EAX-rc2 (8 byte key)
+  0: , D6CC8632EEE0F46B
+  1: 4C, EA19572CB8970CB4
+  2: 5537, 3EDD3253F6D0C1A8
+  3: 206FA6, 20FA88F03F240D31
+  4: 17EE8B40, 702E8194F1FCBFDE
+  5: 2A89287136, 31C5534786E15FB3
+  6: 3A6AEDC7066B, 3C663A4081E1D243
+  7: 8BC5203947A644, 6AAC806C92BFBD6E
+  8: 2E0274BBE14D21A3, CEB0E0CB73C3664C
+  9: 9C4B292B0CF17E3A29, F23CD535559023EC
+ 10: 8E322734308F85662877, 46363D7EFC322821
+ 11: C413C405767FF5F98E3667, E7BA35D8F3678E7E
+ 12: D77806B7A218098B1569EADC, BA67C306E5C0181B
+ 13: 4BE5EF74F9E9799A4D636FEA9F, 4C511C44ADBA4030
+ 14: 7E19969170C2C8D8AEBA8C7FBC2C, 54CC6D466A2DF6DA
+ 15: 2EF1CEDC1DD3403CF440FC5561BE33, 61C6FB277E93701F
+ 16: DE052719153EBACE9D7B19F52AC4282F, 4AC2A96F2FA8634C
+
+EAX-des (8 byte key)
+  0: , 44048B7F240B6F5F
+  1: 0A, 37009B7D4E09953A
+  2: 03BA, BFD2FD7758961728
+  3: 37EE10, 16A6AF96DE888A19
+  4: 07F44290, 100CA84AA0EDAA1D
+  5: 389EF0023B, 9614FB800A533268
+  6: 3F4DBA8AA01C, EFA6B55B7ED5E40F
+  7: 8C7B837896EAE7, C113CE8F664CE3D4
+  8: 7011D993D8EDB0C7, B4C370A919F60497
+  9: 0DEB30A31351B13D7B, 00ABC82DC5F3A1AF
+ 10: 8D3897B2CBE323D6EE1C, 7A2D15627CA1441B
+ 11: DBC002C817DEBFB419F94B, D8EB87F86D6ACDEF
+ 12: 17048E2976FA85AA849E9A80, 229FCD1C9D1E3B9C
+ 13: 30B989EF646544885A478AC198, C1B7EB4F799105C8
+ 14: 5C2E12A7F118A08D6FD585F9C839, C358679FEE6FE7D7
+ 15: 8D1A1E888BBB8648E638C4E74E11B8, 685E006C441448B8
+ 16: 93AE906B8BE4EAC8ED6D8F48F04A7AFF, 71DD7AF752FE28FB
+
+EAX-3des (24 byte key)
+  0: , 8914311BB990B725
+  1: D8, 2094EDC5D03E54B1
+  2: FEE5, 781CFB0EBE3895CA
+  3: DECF5E, 59918E8A5C4B459B
+  4: BD583AAD, 2013BEEBEEA795A1
+  5: 2BC01C6C78, 0B1134DBBEAB5D3F
+  6: 4D5EAF01A895, AB4D17516ECBA50A
+  7: AF229F90614480, D3113C0A9D133CD4
+  8: BCA6F375DF4568E0, 8E9EAEC8E77786BC
+  9: 575F34219E6DD8DB4C, B40C75139E5D1860
+ 10: A199B8AC433B615EC96F, 774AF803698ADE3D
+ 11: 718A2975DD9A872A68AE10, 3B9460F849CBA7FB
+ 12: AB38E148180F6E2FFBB96F91, E3EE3B8FC50DADBC
+ 13: EB10E0233507459D4A6C29EE80, 8D90B46BB1EAB27E
+ 14: EB48559C320DFB056C37458E19B5, 9315F0C4AF8500EB
+ 15: 9E8C73EADA105749B5D8D97392EDC3, 2E749EE66C1E6A16
+ 16: 600FA4149AF252C87B828C780AEFF8BC, 33D7D11DCDC19936
+
+EAX-cast5 (8 byte key)
+  0: , 382FB8F7E9F69FDC
+  1: 99, 20DA959849B3F7AB
+  2: C54B, D05547C6AFA3484A
+  3: 579836, AAA92B2321FC50C5
+  4: FEB7AE55, 639EDF01C4FB965D
+  5: EA8A6023FA, 01274B3ED5CE102C
+  6: B7C4E995121F, 712BFE27CAFF6DDE
+  7: F44236660B0004, FAC51D1DF8EC7093
+  8: 01CD7E3D0BF29E8A, 049C47A45D868D0B
+  9: DAB170493DFD6E0365, 6F3AEDD9A3ECF4FD
+ 10: 82C9EEC4803D9CD11FA8, 32683C0A9128C6EA
+ 11: 324AC59E87B244ECE0F32F, F6B095AAB49353CF
+ 12: DBDDAB11D02C9CA5843C406E, EA728FC46DDD3B04
+ 13: D67376C2A4AD92E7DD80E39303, CAF72B7E7C237EB3
+ 14: F2B9BBEF08036C2982C6DDD06918, 70A29D780C22752C
+ 15: 96E3D9141F8EBF520540C2BC9A9C23, CEFC86A1CD48203D
+ 16: 70CABBA983179106AE7FCD5F1F31D5C3, BF7F9168F4F82F56
+
+EAX-noekeon (16 byte key)
+  0: , 556805EEA595CFB9A30FAD196103D7FD
+  1: F5, 0A7DAEDFB656526CEF4DDBA8087A227A
+  2: 7B8C, 249895D79962D5B4D18FE07366281B72
+  3: ACFF15, DCC489D24832EB106F576AE6B6EB957A
+  4: 08ADE7DB, 0D3215999E9960EDAB29B78744C7F139
+  5: 66139213F6, 505E1E7141D043E903C26EE0959EEECD
+  6: 078B79F880A8, 35B7EB326A55E50332866EEDB682EC20
+  7: 2809E34D9667D4, FFDEC555F68524A09A6ABACA372077D9
+  8: 93D267DE1EC635D3, 4FF3561990A56E4B374618722EF850FF
+  9: F377A4D93FF32F4A51, 91D4070423A90FC54D305169C03F49ED
+ 10: 6244B717E082993EB7A1, 2E3A8A354AFA9473667ED7FDD46BE9FC
+ 11: E917559625D25E6E5F2EDA, 19295C37A70314CC9A1D11FDE8D23C92
+ 12: 1E6DF2EE112A893AB14DFA92, 12C4A89D4CD65F8116A03A135AFD3701
+ 13: 47B18CD762E011770E203CF605, 434909A97E118B20D3AEDC79AFE33A9E
+ 14: 72D9A1A7DA6F33D5E0B927F9F32C, 779C23714FCAA2B2321EC7FB5B03E222
+ 15: DA8B830FFCB3DB274807F780D33240, EDC2F1C8A401F328A53392597730B007
+ 16: B53DD2BB840AD933D36A7B5FFDCCFBBB, 4EC0E6D1F916BF633869239B672B37A1
+ 17: 42936BB9A936C30408660855F4F47F3314, F0DAA6DDA15585E1697ABBB4790B15B5
+ 18: 00372E47F5BA016F1B2A1E680B76AB02052A, CDBF3D241BF7FF96D3DFBEDDB872E901
+ 19: 8AA236B0C8BEF6F67A97C2DF90628F6E5838FF, 731DCD61F7F26004C03519F9500EA824
+ 20: 55338647812FC9D86CBDDCED7120268A4D43F8BA, 0E61B3C835CAD95FD49FEF002C014E72
+ 21: 435820B28E52154B47A04D5E635D8FE37FA47FC985, F6A96DCE4917E8D7C610923627E80970
+ 22: 0D30C15B6FEB4A48B14DD15D41A4B25D442AA677B25C, 28E15CCB74AE992C68BDDC8D87802050
+ 23: D9D701F9AD6B0E13D2CDDA15A5194E7CE8BD2C02137391, 2DB9A15884E9C996C3D6B5BDA44B9598
+ 24: E2390AC5CE10CCFBC72106A52C7F180CB477E3C193CBACA8, 22D3F7DCD6947EA4E78DF57A8E1A9A59
+ 25: ADEFB7D9500658D34996AF6BE6336CD78891064EA1DB8E9785, F239D67D039A15C620A7CD4BE4796B3F
+ 26: 89964C90ABF54A6DF9F13C3681E70C702D80A17BE79F8160F30E, 6336F729ECE1ED7368669D75B7E2DCBA
+ 27: 576B2813CECDA4F905BD5D58349EF070FF41B7EB6BB2B01B061B0B, 125324CBF2ACF1011A44A99A11EC8AFC
+ 28: 430B957481748519A60494F0B5F698F34B1A8235B00AC0D1F0A4442E, 1E80A7FCEBBB8E1E12D6831906154485
+ 29: E781BFE5FCDE0BFC056CC86C4A0B9DD3B815BE8CA678204CF47289B5B5, 190D5AAA9EC1CB4CC86FACE53BF1201B
+ 30: 78BFAC07A9B7B2AE9329BF9F9BF18A1A49DD9587001EFCA00E9AD9752764, 4FB5ECBEEB0995C150EBC66508FA19C1
+ 31: 7D6C20694109DE21F7955855A8FF832347518DD496C2A114DF142C68ACDEAA, B25D4BB34056DC091A7A3950D46C32EC
+ 32: 3E1E4395DEC1AFEA9212B95F37E679B6E2D14DF23C5DE49018C2C8038CC4AD45, 9A6DE7BD41A21918AD504490EF4E581D
+
+EAX-skipjack (10 byte key)
+  0: , 85F74B6AFFB10ACD
+  1: 3F, 604DF8BDD98A0B3F
+  2: EA87, 792374FE07588BF9
+  3: 0169CA, 489AB8AF69DA3306
+  4: A7AC3EB1, 428DAF508E24B583
+  5: AA9028D5B3, C0A44EDA71FB2C86
+  6: DA97BA88A061, DA2EC34077F42585
+  7: 7E25FAA41CEBC8, 36D4987551E06D5B
+  8: F662DA6C9001CBFE, B7DEF76680C316A9
+  9: 6D3F73EC716E1DA897, 5F0F83BAE4D3513B
+ 10: 2A300F585BEE9C889743, F4756C24DEB72A9C
+ 11: 80518B010DD77C82D19106, 50FF5CAA365F4A70
+ 12: 6E579A2173C861B6F37B4CD3, 81E3E5ABBA8F0292
+ 13: 5B04829880A72C38871C7021F3, 6B26F463708A3294
+ 14: 934177878E9A9A9FB4DEB3895922, EBC1C32F0A2A3E96
+ 15: 07AF486D1C458AAB2DBF13C3243FAD, 87288E41A9E64089
+ 16: 84059283DF9A2A8563E7AF69235F26DF, 351652A0DBCE9D6E
+
+EAX-anubis (16 byte key)
+  0: , 8E20F19D9BA22ABA09FB86FDE6B9EF38
+  1: 3B, F4201E546A9160F989191942EC8FD1D3
+  2: 9F38, 4E3CEAE3E1CB954E021A10E814B71732
+  3: 4F4769, 3E8F35A6A5B11200E9F1AA38590066CD
+  4: AB41F5FC, EC4C97A8892AAF5433106D4AC8A49843
+  5: 414F95D61B, BF831E34D1E3FECB973A8C730ECA2E6D
+  6: 4798322F06D1, 005BBC30BFEDBE6463536C4F80D1A071
+  7: F256B6CD1BF4F5, 468A28F0661884B846B191B530C8D064
+  8: 90906F27A633ADDE, 6D9200A37A7F6A456CB103673184C2E5
+  9: 16CD3C17C9B4EAB135, 6D716E23D7B35109F55B036EDFA7742E
+ 10: 7AD1C22F1F06298DFB25, B076990F8193543C8F3185D3792BCE56
+ 11: 0476F2ABCD057FE6FEE39D, BB2876DB18C00038FADBBD9B264ACC3C
+ 12: B69EDE336407DBC2EE735857, AB63E5906116A8BE22C52B5DA31B1839
+ 13: C3864C1354065A56470669E602, C72BFD3A0BC73BFF051C9AB2F0DFED93
+ 14: 296D8F183A59020D33890420DD7B, C9D90B9EB42C32EDCF6223587D1598A6
+ 15: 256ED8E9D982616680559979BDF2E9, 179FE4E7BA7E966050D35900317E9916
+ 16: D4ED8F30FF9C0470D75B3B16750A3AE4, 5D50F05BB270A292DFF9F67A3BA84675
+ 17: 40CDEB6388274143CA3C4F6020BD9A4875, B27C7DFB1BFBB3FCCEE0171852C7924E
+ 18: 54EF262EC1801D505C7629D038654EBA0594, 9D2060FCD0A2C577511C7752ADE60BBE
+ 19: F39EE54A37F16DD38B624D7AB8F0D9CBD4B981, BC056C7D2C09D813703CDD63C1C69F44
+ 20: F4E7AD474FCA153ABD670E43081ED09EB2C4CC1A, F244BD4D630272F0D98FCA04226C04F1
+ 21: 039ECC36A0A16273E7246CA1FF19D213AC87B53F29, 3056DB6916C925DF220B6C9980EE141A
+ 22: 7DE1DCDEF01447CA2FE83375A48DD84E4A7CB7C01992, 79AFEA4816EAF8DAC8A5E93960F1594F
+ 23: A886C4B914BF0983003272F226F9B2197EF2DC05ACDDE0, B59D85A0FDA5FA4422F7203C055B97A9
+ 24: 00B3E1E91448E250AAFB695C0643A6577AB453EFECFABF53, 4A7EFF1CBC1AB535122A017203616D85
+ 25: 85E972E774D66D0531E40B8FE9E264A77B50FA883AB0943080, B18E164BF89B7E7AB0DC256DFEC7C72F
+ 26: 004849E39334969B392CB0CF3FDEFB3D792DCBBC15F8328C7EDC, 3C51295711F5F878DE8F0B2B5A26A227
+ 27: A0BAD6C2264AB1578993BA49E59D4598822FFED20A57D88F756FF1, 2EB9D525697A419A10DB2A84AEEA5FBC
+ 28: C34DD806EAB5AD823D78BCA78A7709A705FC94ECC521A367D76C9588, 3C57580C7903039D645C06DBAF07B477
+ 29: C447EC77512938CF7862388C32AF22ACE6B5E4CBAA998BE4F5CBC4D215, 43425D09B7ACFD90371C08953946A955
+ 30: 2C16993AAE624CBA4CDAF34FE3D368559E6BE548292B281439866375013B, 3B7360C3FA8FB1C15D19F567153CB46C
+ 31: 538E5DFAF14854A786851E4165F2E01CDDA963E318FCE4FB58E31A6B5CFC33, 2F8EA13B7A6873FE556CA535ABA0968B
+ 32: 5E29CDB7D9695A110043E9C260104BDF020A3A2A139D4112E918AB584BDD7EDA, 9133213AA7BCF062D2BD37F866683D3F
+
+EAX-khazad (16 byte key)
+  0: , 75968E54452F6781
+  1: 95, ADAF5949F09B5A22
+  2: 6B8F, A06B201947424A11
+  3: 5BE668, 3251416625DF347A
+  4: 5A92E82B, 33E25772427D9786
+  5: 62F9F2ABCC, DE714F5F5D17D6D0
+  6: 0E3CD825BD8D, A7991C8CB8975ED9
+  7: 4AD0D999503AAD, 53A827D7886F7227
+  8: BB08E6FAED1DAEE8, 91A118749B7AB9F3
+  9: 16E30CB12E20D18495, F8F8B8C1280158F9
+ 10: 616DBCC6346959D89E4A, 506BF35A70297D53
+ 11: F86B022D4B28FDB1F0B7D3, EA42220C805FD759
+ 12: 9B8A3D9CDBADD9BBCCCD2B28, BB478D3CE9A229C9
+ 13: CDC4AB4EF2D5B46E87827241F0, 658EDB9497A91823
+ 14: 1A113D96B21B4AEBDB13E34C381A, 63AD0C4084AC84B0
+ 15: 14DA751E5AF7E01F35B3CE74EE1ACF, 3C76AB64E1724DCE
+ 16: A13BBC7E408D2C550634CBC64690B8FE, 3D4BBC0C76536730
+

libtomcrypt/notes/etc/saferp_optimizer.c

@@ -0,0 +1,177 @@
+/* emits an optimized version of SAFER+ ... only does encrypt so far... */
+
+#include <stdio.h>
+#include <string.h>
+
+/* This is the "Armenian" Shuffle.  It takes the input from b and stores it in b2 */
+#define SHUF\
+    b2[0] = b[8]; b2[1] = b[11]; b2[2] = b[12]; b2[3] = b[15];   \
+    b2[4] = b[2]; b2[5] = b[1]; b2[6] = b[6]; b2[7] = b[5];      \
+    b2[8] = b[10]; b2[9] = b[9]; b2[10] = b[14]; b2[11] = b[13]; \
+    b2[12] = b[0]; b2[13] = b[7]; b2[14] = b[4]; b2[15] = b[3]; memcpy(b, b2, sizeof(b));
+
+/* This is the inverse shuffle.  It takes from b and gives to b2 */
+#define iSHUF(b, b2)                                               \
+    b2[0] = b[12]; b2[1] = b[5]; b2[2] = b[4]; b2[3] = b[15];      \
+    b2[4] = b[14]; b2[5] = b[7]; b2[6] = b[6]; b2[7] = b[13];      \
+    b2[8] = b[0]; b2[9] = b[9]; b2[10] = b[8]; b2[11] = b[1];      \
+    b2[12] = b[2]; b2[13] = b[11]; b2[14] = b[10]; b2[15] = b[3]; memcpy(b, b2, sizeof(b));
+    
+#define ROUND(b, i)                                                                        \
+    b[0]  = (safer_ebox[(b[0] ^ skey->saferp.K[i][0]) & 255] + skey->saferp.K[i+1][0]) & 255;    \
+    b[1]  = safer_lbox[(b[1] + skey->saferp.K[i][1]) & 255] ^ skey->saferp.K[i+1][1];            \
+    b[2]  = safer_lbox[(b[2] + skey->saferp.K[i][2]) & 255] ^ skey->saferp.K[i+1][2];            \
+    b[3]  = (safer_ebox[(b[3] ^ skey->saferp.K[i][3]) & 255] + skey->saferp.K[i+1][3]) & 255;    \
+    b[4]  = (safer_ebox[(b[4] ^ skey->saferp.K[i][4]) & 255] + skey->saferp.K[i+1][4]) & 255;    \
+    b[5]  = safer_lbox[(b[5] + skey->saferp.K[i][5]) & 255] ^ skey->saferp.K[i+1][5];            \
+    b[6]  = safer_lbox[(b[6] + skey->saferp.K[i][6]) & 255] ^ skey->saferp.K[i+1][6];            \
+    b[7]  = (safer_ebox[(b[7] ^ skey->saferp.K[i][7]) & 255] + skey->saferp.K[i+1][7]) & 255;    \
+    b[8]  = (safer_ebox[(b[8] ^ skey->saferp.K[i][8]) & 255] + skey->saferp.K[i+1][8]) & 255;    \
+    b[9]  = safer_lbox[(b[9] + skey->saferp.K[i][9]) & 255] ^ skey->saferp.K[i+1][9];            \
+    b[10] = safer_lbox[(b[10] + skey->saferp.K[i][10]) & 255] ^ skey->saferp.K[i+1][10];         \
+    b[11] = (safer_ebox[(b[11] ^ skey->saferp.K[i][11]) & 255] + skey->saferp.K[i+1][11]) & 255; \
+    b[12] = (safer_ebox[(b[12] ^ skey->saferp.K[i][12]) & 255] + skey->saferp.K[i+1][12]) & 255; \
+    b[13] = safer_lbox[(b[13] + skey->saferp.K[i][13]) & 255] ^ skey->saferp.K[i+1][13];         \
+    b[14] = safer_lbox[(b[14] + skey->saferp.K[i][14]) & 255] ^ skey->saferp.K[i+1][14];         \
+    b[15] = (safer_ebox[(b[15] ^ skey->saferp.K[i][15]) & 255] + skey->saferp.K[i+1][15]) & 255;        
+
+int main(void)
+{
+   int b[16], b2[16], x, y, z;
+   
+/* -- ENCRYPT ---  */
+   for (x = 0; x < 16; x++) b[x] = x;
+   /* emit encrypt preabmle  */
+printf(
+"void saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)\n"
+"{\n"
+"   int x;\n"
+"   unsigned char b[16];\n"
+"\n"
+"   LTC_ARGCHK(pt   != NULL);\n"
+"   LTC_ARGCHK(ct   != NULL);\n"
+"   LTC_ARGCHK(skey != NULL);\n"
+"\n"
+"   /* do eight rounds */\n"
+"   for (x = 0; x < 16; x++) {\n"
+"       b[x] = pt[x];\n"
+"   }\n");   
+
+   /* do 8 rounds of ROUND; LT; */
+   for (x = 0; x < 8; x++) {
+       /* ROUND(..., x*2) */
+       for (y = 0; y < 16; y++) {
+printf("b[%d] = (safer_%cbox[(b[%d] %c skey->saferp.K[%d][%d]) & 255] %c skey->saferp.K[%d][%d]) & 255;\n",
+          b[y], "elle"[y&3], b[y], "^++^"[y&3],      x*2, y, "+^^+"[y&3], x*2+1, y);
+       }
+       
+       /* LT */
+       for (y = 0; y < 4; y++) {
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[0], b[0], b[1], b[0], b[1]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[2], b[2], b[3], b[3], b[2]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[4], b[4], b[5], b[5], b[4]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[6], b[6], b[7], b[7], b[6]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[8], b[8], b[9], b[9], b[8]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[10], b[10], b[11], b[11], b[10]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[12], b[12], b[13], b[13], b[12]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[14], b[14], b[15], b[15], b[14]);
+      if (y < 3) {
+         SHUF;
+      }         
+      }   
+  }
+  
+printf(
+"   if (skey->saferp.rounds <= 8) {\n");
+/* finish */
+   for (x = 0; x < 16; x++) {
+   printf(
+"      ct[%d] = (b[%d] %c skey->saferp.K[skey->saferp.rounds*2][%d]) & 255;\n",
+       x, b[x], "^++^"[x&3], x);
+   }   
+   printf("      return;\n   }\n");
+  
+  /* 192-bit keys */
+printf(  
+"   /* 192-bit key? */\n"
+"   if (skey->saferp.rounds > 8) {\n");
+  
+   /* do 4 rounds of ROUND; LT; */
+   for (x = 8; x < 12; x++) {
+       /* ROUND(..., x*2) */
+       for (y = 0; y < 16; y++) {
+printf("b[%d] = (safer_%cbox[(b[%d] %c skey->saferp.K[%d][%d]) & 255] %c skey->saferp.K[%d][%d]) & 255;\n",
+          b[y], "elle"[y&3], b[y], "^++^"[y&3],      x*2, y, "+^^+"[y&3], x*2+1, y);
+       }
+       
+       /* LT */
+       for (y = 0; y < 4; y++) {
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[0], b[0], b[1], b[0], b[1]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[2], b[2], b[3], b[3], b[2]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[4], b[4], b[5], b[5], b[4]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[6], b[6], b[7], b[7], b[6]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[8], b[8], b[9], b[9], b[8]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[10], b[10], b[11], b[11], b[10]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[12], b[12], b[13], b[13], b[12]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[14], b[14], b[15], b[15], b[14]);
+      if (y < 3) {
+         SHUF;
+      }         
+      }   
+  }
+printf("}\n");
+  
+printf(
+"   if (skey->saferp.rounds <= 12) {\n");
+/* finish */
+   for (x = 0; x < 16; x++) {
+   printf(
+"      ct[%d] = (b[%d] %c skey->saferp.K[skey->saferp.rounds*2][%d]) & 255;\n",
+       x, b[x], "^++^"[x&3], x);
+   }   
+   printf("      return;\n   }\n");
+
+  /* 256-bit keys */
+printf(  
+"   /* 256-bit key? */\n"
+"   if (skey->saferp.rounds > 12) {\n");
+  
+   /* do 4 rounds of ROUND; LT; */
+   for (x = 12; x < 16; x++) {
+       /* ROUND(..., x*2) */
+       for (y = 0; y < 16; y++) {
+printf("b[%d] = (safer_%cbox[(b[%d] %c skey->saferp.K[%d][%d]) & 255] %c skey->saferp.K[%d][%d]) & 255;\n",
+          b[y], "elle"[y&3], b[y], "^++^"[y&3],      x*2, y, "+^^+"[y&3], x*2+1, y);
+       }
+       
+       /* LT */
+       for (y = 0; y < 4; y++) {
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[0], b[0], b[1], b[0], b[1]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[2], b[2], b[3], b[3], b[2]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[4], b[4], b[5], b[5], b[4]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[6], b[6], b[7], b[7], b[6]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[8], b[8], b[9], b[9], b[8]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[10], b[10], b[11], b[11], b[10]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[12], b[12], b[13], b[13], b[12]);
+printf("   b[%d]  = (b[%d] + (b[%d] = (b[%d] + b[%d]) & 255)) & 255;\n", b[14], b[14], b[15], b[15], b[14]);
+      if (y < 3) {
+         SHUF;
+      }         
+      }   
+  }
+/* finish */
+   for (x = 0; x < 16; x++) {
+   printf(
+"      ct[%d] = (b[%d] %c skey->saferp.K[skey->saferp.rounds*2][%d]) & 255;\n",
+       x, b[x], "^++^"[x&3], x);
+   }   
+   printf("   return;\n");
+printf("   }\n}\n\n");
+
+   return 0;
+}
+
+
+/* $Source: /cvs/libtom/libtomcrypt/notes/etc/saferp_optimizer.c,v $ */
+/* $Revision: 1.2 $ */
+/* $Date: 2005/05/05 14:35:58 $ */

libtomcrypt/notes/etc/whirlgen.c

@@ -0,0 +1,95 @@
+#include <stdio.h>
+
+unsigned E[16] =  { 1, 0xb, 9, 0xc, 0xd, 6, 0xf, 3, 0xe, 8, 7, 4, 0xa, 2, 5, 0 };
+unsigned Ei[16];
+unsigned R[16] =  { 7, 0xc, 0xb, 0xd, 0xe, 4, 9, 0xf, 6, 3, 8, 0xa, 2, 5, 1, 0 };
+unsigned cir[8][8] = { 
+ {1, 1, 4, 1, 8, 5, 2, 9 },
+}; 
+
+
+unsigned gf_mul(unsigned a, unsigned b)
+{
+   unsigned r;
+   
+   r = 0;
+   while (a) {
+      if (a & 1) r ^= b;
+      a >>= 1;
+      b = (b << 1) ^ (b & 0x80 ? 0x11d : 0x00);
+   }
+   return r;
+}
+
+unsigned sbox(unsigned x)
+{
+   unsigned a, b, w;
+   
+   a = x >> 4;
+   b = x & 15;
+   
+   a = E[a]; b = Ei[b];
+   w = a ^ b; w = R[w];
+   a = E[a ^ w]; b = Ei[b ^ w];
+   
+   
+   return (a << 4) | b;
+}
+
+int main(void)
+{
+   unsigned x, y;
+   
+   for (x = 0; x < 16; x++) Ei[E[x]] = x;
+   
+//   for (x = 0; x < 16; x++) printf("%2x ", sbox(x));
+   for (y = 1; y < 8; y++) {
+      for (x = 0; x < 8; x++) {
+          cir[y][x] = cir[y-1][(x-1)&7];
+      }
+   }
+
+/*   
+   printf("\n");
+   for (y = 0; y < 8; y++) {
+       for (x = 0; x < 8; x++) printf("%2d ", cir[y][x]);
+       printf("\n");
+   }
+*/
+
+   for (y = 0; y < 8; y++) {
+       printf("static const ulong64 sbox%d[] = {\n", y);
+       for (x = 0; x < 256; ) {
+           printf("CONST64(0x%02x%02x%02x%02x%02x%02x%02x%02x)",
+              gf_mul(sbox(x), cir[y][0]),
+              gf_mul(sbox(x), cir[y][1]),
+              gf_mul(sbox(x), cir[y][2]),
+              gf_mul(sbox(x), cir[y][3]),
+              gf_mul(sbox(x), cir[y][4]),
+              gf_mul(sbox(x), cir[y][5]),
+              gf_mul(sbox(x), cir[y][6]),
+              gf_mul(sbox(x), cir[y][7]));
+           if (x < 255) printf(", ");
+           if (!(++x & 3)) printf("\n");
+       }
+       printf("};\n\n");
+  }
+  
+  printf("static const ulong64 cont[] = {\n");
+  for (y = 0; y <= 10; y++) {
+      printf("CONST64(0x");
+      for (x = 0; x < 8; x++) {
+         printf("%02x", sbox((8*y + x)&255));
+      }
+      printf("),\n");
+  }
+  printf("};\n\n");
+  return 0;
+   
+}
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/notes/etc/whirlgen.c,v $ */
+/* $Revision: 1.2 $ */
+/* $Date: 2005/05/05 14:35:58 $ */

libtomcrypt/notes/etc/whirltest.c

@@ -0,0 +1,19 @@
+#include <stdio.h>
+
+int main(void)
+{
+   char buf[4096];
+   int x;
+   
+   while (fgets(buf, sizeof(buf)-2, stdin) != NULL) {
+        for (x = 0; x < 128; ) {
+            printf("0x%c%c, ", buf[x], buf[x+1]);
+            if (!((x += 2) & 31)) printf("\n");
+        }
+   }
+}
+
+
+/* $Source: /cvs/libtom/libtomcrypt/notes/etc/whirltest.c,v $ */
+/* $Revision: 1.2 $ */
+/* $Date: 2005/05/05 14:35:58 $ */

libtomcrypt/notes/gcm_tv.txt

@@ -0,0 +1,214 @@
+GCM Test Vectors.  Uses the 00010203...NN-1 pattern for nonce/header/plaintext/key.  The outputs
+are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous
+step repeated sufficiently.  The nonce is fixed throughout at 13 bytes 000102...
+
+GCM-aes (16 byte key)
+  0: , C6A13B37878F5B826F4F8162A1C8D879
+  1: F1, 397F649A20F3F89A00F45BF230F26B61
+  2: D6B8, 1653F67C9C716D0FC59F3B14154DECBF
+  3: 673456, E82EFC79B30CA5235E2DC8BE4C14265D
+  4: 26DD7C26, B8D1F4DB845F7D7079DEB8920949C14D
+  5: DA62AD1487, 828A42329320764E5FB74D44A6108F4B
+  6: FB79F7D51742, 865415BD049E86F3DA2E0B6E25E1A50C
+  7: 9D96D1034166BF, 50669247A5B338E183DE5139831CD6A4
+  8: B466050E1330B20A, CB264FA7853A1FFE86E1A07CFA7C7319
+  9: CF16F0B3D9FC6183DF, 647DD6E1F40F385E1DFE6676FB036242
+ 10: 14D90928C7236050096F, 930CAAA5536406218885475CA823A973
+ 11: 4F2322D66A7079BD7DF519, 3B3931D47413042FAF1313F1041509A3
+ 12: F1497906F1D8F4F9E47E4BE9, 469FB0D62828427C2E9BA04041A1424F
+ 13: 2FAFA2A3EEA4C000702E58D1D4, C9A484FC4ED8644A06060DAE2C3D1568
+ 14: 5D707F8ACF319413D220AA2FC2B2, 0EE9AAF5B1CF622ECF6C4F5E5FF4656A
+ 15: 2C19DBF966D24B2713F82B69934060, 8676246A2F7795ABD435B3C6B4EA6E7A
+ 16: B3FED6C2315CE6D98729DBE69270A11E, B8AC739AD154744A33E906C34D91BD4B
+ 17: B2BC44CE088BC3F654B9703D9C691F17B3, BAD8314A171BC0119942136C5876AACC
+ 18: C6E958E3E9AC836C9626BD66478974D26B0C, 4E6D61833E9DB839117B665A96DC686C
+ 19: D40FADD078B474EBCE130FB44DDB4824077988, F43E3CD978A6E328AF039CC70E291E1C
+ 20: E177B3DF83A117E55F255A6C2CD78AFDAFDA307F, EEF1ABAAB9CBE0EE317CC79E7E5E24B8
+ 21: DBB4569B3E305E4525F1F7B3D2AFEF226F397E661D, 65ACFB70132EEE1D47319A550A506DB5
+ 22: AC2CAF77718DE59131A6B745DE9F3A9897B17580EC71, D8DB9006A9597F640F2594340D69E551
+ 23: 8F62022F72A0D769D2D095A55E28832950870B2B44B0BE, A7E196F869071B7BB713E8A2D15627E9
+ 24: 37F5640F820384B35F13F8C8C7DC31BDE1E4F29DCFBDA321, D5765C39DBCA72AC89100CCB8864E1DB
+ 25: 25059BFC302D0F8DD41BB22CF2391D456630C06F1DAF4DFA86, DC2FFD153C788C28D251B78AB8B7388C
+ 26: 151F158CC4BA9393FDB153C4C72911C120BAB519FAF64719133D, C61915006038BF15DED603832FD179DE
+ 27: F5DCF4231482F72D02F8B9BE0A41113D35AEA1CD85021CEC978D9C, 9CBD02C557180FBD0868C87A0BEA25AE
+ 28: 5D88B5554A2ED73054226473676FAA7159CE12B5357D635DDED35B5A, 5AD11CD6B14C59E64B5B26DFBD00FB5C
+ 29: 5696C7066EA09A30FC8BCBAD96D48A5E5FBCC8756B770F0A89B8711911, B9EA5F3BEF0599D385A9ACEBE4064498
+ 30: 1240FED47B305AC1883F8CF137D58E79052B4E686DCA1423A6A2BECBD5F5, 036A5EA5F4F2D0BF397E8896EB7AB03D
+ 31: AD9517BF392C1EB56D78EDE1C41F3C73B72304DA47F400C390C86B37A50C2A, EB3E026D518EED47F6C927525746AC54
+ 32: 2AE1CEED83C6490A7E5752E91532406EAC6FF4B11AA770EFFF1B255FDB77C528, 74BFBC7F120B58FA2B5E988A41EAF7AC
+
+GCM-rc6 (16 byte key)
+  0: , D595FEDAB06C62D8C5290E76ED84601D
+  1: 4D, 47A6EDEF8286F9C144B7B51C9BCCCACF
+  2: 0085, 9788DDF89843EC51120B132EB0D0F833
+  3: 463701, 673CB8D248E6BECD5A6A7B0B08465EF6
+  4: F5B3222C, 1C424282D7FB427E55285E20FC2ABFF9
+  5: 3A4A8361B2, BD40E631B054F280C7973E5AB3F06B42
+  6: A475866BF2C5, 2067F42FAAA6274270CF9E65D833FDED
+  7: 689D0D407172C8, 3BCCFFC64E56D5B753352E1DDD5CCAA3
+  8: D9CE4B051202A1D3, 79B0CCDA3D0B9C9BCF640BC9E6D9CE0D
+  9: 0317D68BE098D276B7, AF35043DB6213DC5D4F3DFB8E29EE537
+ 10: 154CEF0C6F37AA0A73C4, 61E598A8C6D17B639F9E27AF55DD00F3
+ 11: C3DB1B2B6CCC9170B9C05F, 966871DDD6E110711FB9DD733B6B2B3A
+ 12: E4F22383C75BC0FB0E59C5E8, 971536AF878F4EED68F59046C928EAC8
+ 13: 2FBFB99AABC6209FB8664916DD, 68D0BF2144AD1ADECC4074DAE58540C2
+ 14: 5FEEDFD09BF89719A34CDCCD2AAA, 64DEB7D5E6891103AA54C0EB366715D0
+ 15: E063A076E0C770FB010D26C3AC3EB5, 0CA321B2A7448FEEF84D4E0AD5BA2DA4
+ 16: AFB0DB9959F0906BD346C2D81DC5412C, 425627895E2C4C9546D3227975585459
+ 17: 79179C0D4D6C5E0741DD4CA1E8CF28C75C, D0188A344A1CEE52272FE6368DB0FB75
+ 18: 8A75521139B0DE3C08C9EAEB77D8018A39FE, 47FCC200D8A384320D2F1A5E803A9991
+ 19: 0399381D0A975AE3980A9FB75B991C055AF367, 034915370AF94B96A8A4E50FF9B134CC
+ 20: 8C189094DB13FBE62EA5C4A53C29A428ED587BA2, 99C58F838423033298897841ED526347
+ 21: D91F5144B525AF5D47EF4D5F0AF9915447A55927F9, F6750BF7E089515D35B47BC1C65E2E3A
+ 22: A4E26B554AA277057A5FE3FA08A6138CEEC6D69BB1D8, 7BBEBF52D8251108C7AA1025E213EC44
+ 23: 5C1A8C3A46FCA90D73675706313CADFBB90A535A4B3D5A, E35244A2633478BBDAFCC81161F28B80
+ 24: D69F7264FC594057B89181B83582D799AE54E9EE4FE8AD48, D4B29E5C25F9477D9345526DBDE9372A
+ 25: AFD322D0AC4AF38D5B9CBE0DFE85618C001A7A77CD8FFFCB3E, AD06BB9C59D23D258D6A2AEDD946AA20
+ 26: 179CA8395CD8E75B4E5EA07D25C8036AF08B1A1C330492523D36, E3704C4341A834C087500E332B7DEAE9
+ 27: B9178EF7774684F43F1FCE99A4319B5A4D167B0A848551F562CD7C, 5D5082FB02B9B494D5883DF49DB3B84B
+ 28: 830FCD15A09EC61245D7DA258E308E76D3B542F2345DBFC11AE983A3, F50C3332F8D91911BDACCFE228565E5C
+ 29: 179619B8C7EE9B3121405BBED2AC102A027E6C97EAEDB5ECFEB13792EF, 859EBA3BADCE6E5AB271A261B26DE28C
+ 30: 14264C7E0A154119BF24B7FCF434E81440D42D54738F0BAE55836849AB85, 0B6C9B9CADB1B6EC71CEA090C8C72834
+ 31: 0D7A316F8B873F62CF26CFC569179AB11CBF09D3467936A85ADC265B2C9A8F, 866AE7C51EC2D9DEB32748A1C8B61143
+ 32: F8FD1F967CD3632805AD7FA8ECB40F530927DD5C49D31FDBAE49738E2315905D, 9CB1CB84A727C9F42555EB566E0A1DEE
+
+GCM-safer+ (16 byte key)
+  0: , F769B436C7FB7C0C822E24BB2B2555D3
+  1: CA, B156298625F5634FA012B23044437807
+  2: 4960, A64C73E890F3D77B2C3B3C76C2D913C6
+  3: DBBB8D, 686651A017F89A22F9FE96533C85C52C
+  4: 150AD99A, 177F7DE9E897DACCAB7EACEE3CDE7601
+  5: 077055065F, 48B4309C76CAC37BDF11842311BA6CD3
+  6: B2F8CE062C06, ED04DF96C06959524956E8AC5C338457
+  7: DCE718211410D8, 3F8D8180BDEAC2F018EA81615177CC8F
+  8: 0F71E2772402AC83, 2130481B2CA7B4B4C8F3EE73B3B3C28F
+  9: B69030734E5ADF753C, 8CC4B62BFBC3EA56CCDBF0ED318C784D
+ 10: 6B8A91ABC1BF2F2D0176, 86EAAD80D148A48086987A40A5631DEF
+ 11: 44AD00799EC8E62E34D6A1, 016830D58F06F75E54531B45D9E785F9
+ 12: 0C4B9381D78E0F0A78B3CEAA, 4A79C58DAB131A22F172F9177DC4158B
+ 13: 2C56D4625876524B4D8D5F079B, 7B407F704225B25F1F136C984E564147
+ 14: 36424D69BACC56407D345B3D7B4D, EB126C255A2DCFD32F69DD5CB61876C7
+ 15: FDD3E091C0420D1A4D4A848757FCC2, D319C5C07134D67BA42A4BF312CD874D
+ 16: EFAF6F117EA9A4B4B83052BBF5A07DB9, BB09D473FE82257146E7ABC2EFF6F631
+ 17: 19B71383C414BAC3EF252FFF09F5ACD777, 526DC9AE6895ED33A34A9A4ADB07E1B6
+ 18: 9AB6DFDB930D26E00B3D98DD5AD014E08756, D70B95B20C106A5A03F9B803D2CAC3A0
+ 19: EEB3C236C3031DE4C3F94BD746677AE84B271D, 9483BBCBBFDBA1CC5F6392DABA2ACC19
+ 20: 3A0EBC7536F8717E8FDAFEDAC39E8F1F43C0627A, 3DA7DC2475466CEDF01EB543870A74FA
+ 21: 79D28D2F149E1D97E910342DF383FCEECF5AFD4C6A, 2364F33BCF6F07E381F7E26DAF802D83
+ 22: F1D7C319BAFB740332CA19AB0C9B71728D3AE69BFAC2, 3D4AEE9780A5C98CBC69606CDDDB31F8
+ 23: 1A0D80381A186673FB7B52C40AB6C46A11AB0889333C20, AF5C17E3D0D9724EDC1FC438A16B4EBB
+ 24: 5E503440B22DD6AE6401BA4355C8791BACC598C9E0F1412E, 156D8221BD61F5C108FC18FB2F50D159
+ 25: 7784EFDC6F0FC56FCADAFF17BB52DEB35B64FA19C3F391BDFD, A291E8238EF158A2379692077F70E8D0
+ 26: 184B6E18032D1A70CE5027912E447C357C72EEF7B20EF0FB256C, 0FA0138FB9480E0C4C237BF5D6099777
+ 27: 7AC8FCB64F35B71C5ED0CCD776B1FF76CE352EB57244085ED34FE8, D995B3C1350CC777878108640C1CADAE
+ 28: 86C7A01FB2262A8E37FF38CC99BF3EFAEB8B36166D24913BDD3B91DA, 25EC6D9F69168C5FA32C39631B606B55
+ 29: 91F5D3E3FE0B1976E2915B8DA3E785F4D55768FD727AEF19FA1552F506, AF902DED55E386F0FC4210C97DB9446E
+ 30: 7ABF5BD9CB2EFF8382C6D2B28C1B0B25540E434123AC252046BDDA74DA32, 713259EDDA9B1B63EB68E0283D0259DB
+ 31: 5634B23ACEF2874BE0591BE3268C4538698FF2D93D59B39BC86D0137DACBAD, C4054796AFD335B43C60E7E634122BAF
+ 32: F26C68C36B1E56449595EA4E162391E0C6A306592949F69797B6C2327E533ADB, 7B392AF776A94983078814B6B8428BFE
+
+GCM-twofish (16 byte key)
+  0: , 6275E8CA35B36C108AD6D5F84F0CC5A3
+  1: 38, A714210792F9ED12A28F25CAE3B3BC5E
+  2: 8E2F, 6357C1F125723F2244DAF344CDFCD47B
+  3: 900A4C, ED4E0B318346D5B9B646441E946204E9
+  4: 087EAFF8, B871ED95C873F1EFA24EF8B6915F447D
+  5: 63FC9EFBD4, 650D0ED98CBECA07040AB97B97129360
+  6: B6081E94AA19, 6A3BDA8030C5A79B6B9087555A1DA67B
+  7: E10A7B9CBB20C2, 59EB55DFD0A37C55A869834E597373AF
+  8: 94E947FEE05780EE, 354918527F855264E37DB6892E868050
+  9: 9A80C567AA50220862, 814EE57CC9D51D7D900AB4840C4B072F
+ 10: A8741BE1E42BE207C416, 2B28AFD8ABE20664D8BAD7535F82F11A
+ 11: 6AB7E3C68B6682023E8190, 5E48B67541FE83969952394F84D29E93
+ 12: 4F66FB634EB258CEE2955D84, F2632C2135B6E1144673B0EF73499818
+ 13: B29042F3877C2F5E694953C5F6, 03268A30499D57A06AA873EF00160C3C
+ 14: DCC7B5D9F58C88F54A9611389B8D, 5515426FF7CF2EEA91BE2B3752371CE0
+ 15: B665488BCD75FC02A0DF7994B7CF98, B721531E2A317C254FA2ED306ADCF96C
+ 16: 9535DC8A72645E34F948B71A5159AA9B, 5CEED93DE128044F0471C65AA8F21D29
+ 17: 5CBFC61A23D28562FCA929375E5B585327, 3AA842B21631968D1B58B72FEE090EE1
+ 18: 2AC3F780B956A933C0B8565EE527173B8CC8, 16EC4B6D8E2CF3CD0D16E7A5F401C78E
+ 19: 5067FD65870A4EBF6C7FA811A15270E7F8F17D, 9A7563BEDADFA6B6E48F5C13FCEAED6E
+ 20: E3A65A188077E5DC171CFF30BE8B27F10F015166, BD5B3D84D0C1DD51A3909F849141B57F
+ 21: 88D0A65C105823E68BE3987CB205AE0C1A27588FCD, B280221AD0BD83E1D6B37F331F326AB5
+ 22: 7C56D987FEF6807EEFAFD4C7EB9D72AA0E037979D91E, 686E1268A8DC9CD0192A383EA6C2D975
+ 23: B23CCD0A076CB122750B634B9E6551E0585EDEA18C3245, 6DF30A7F0728E2D549AA411AE375E569
+ 24: 767BC3AF206E67C9E27A4D7E814F3B3A65D27BB70BA9DD4D, AB2B16C031FB2C8E85B3B2B38A5CBA4E
+ 25: 9ABF34ABD43705D62F377449461C5DC239A2A86E5A98AFB159, 3DEDEDA85E6BFB53C6F18726CD561604
+ 26: FE756344C05CB12AA0673F1C2069A86556E583FF4B7313A0D395, 21CB0E0BABC3C7E547F5CB207295C0EE
+ 27: B70F16AD19A6B0AF6D8DBF4E98D7D5ADB944D91BD889D9390C3E21, 2AE67812A22C1C785D3BFC184A1C74EA
+ 28: A6389032AA9D08BDBAAA5E230E5130665FB4F0CB868F3F20C4C5438B, ECA054EFA3F39400A587839C4F0605C7
+ 29: A55A41315EAF3A67A0FD0E14C6E04D03A5E38D0F756719F4A0800B290A, 7A5277809D4B65E663603099B4DFFBD8
+ 30: E739633579AA6201A024B9873F28412BB08B08B8616D611BC9D07979BD3A, 390038A93AFD326C5CC1525A24CA91AD
+ 31: ED3266F8B0DAA7C3DB7814427E8139831CFC0EDE668F0DA83FF7090154410D, DE440EC2C6080048BFF3C5455E1BB33F
+ 32: 4D0F751B55DA3A2E0B28DE59E9680669FCB5984E9C0DB942DBAACDDEF0879731, 62F96CFE31D3D6AAA0B9F5130ED1B21B
+
+GCM-noekeon (16 byte key)
+  0: , EB5A8E30D5C16311864E2D8D32859ACB
+  1: 88, EAB88DE1EB7BC784A706B2D7946798D7
+  2: BA1F, DC3CEC6AA324AC7D053EFF7A99AD3069
+  3: 9A1457, 4AB65831DE378DFF71C20249C7BEC05E
+  4: 2F9496D6, 800745CF95EAE3A698EDF9EC949D92B7
+  5: 84153177A2, F6A05B654435ABDF5F696C0E0588CB5C
+  6: F80B7865C766, 2334D0061FD488D15A6AC8E44EA1F4B9
+  7: 872EA486B4EA9D, 3A49671DE347F675AD7904DDF4255F3D
+  8: A4EE5750507FC831, 956D09F7C5FE812C6FB982E1DDBE864A
+  9: B5874AC964FBFC1A97, 90FBC75F45BFF58B3A1100393955D0C2
+ 10: 92FF5FCF1EC675E02E71, 983C96A7BD4A0DB5D3B877911CE8A6B3
+ 11: F7BCA69A9C7033D84A2BA0, D4ECE5BB9FFCBB331A646D9CE8078634
+ 12: 5E1041B4554C8CDD14AAF16D, 1EF777F307CB96788B9120FFF8A8BC2F
+ 13: 7BB7289FCAD209D7992EB7AEDC, E8AEFB830DBAED2B4A790FFEF940A20B
+ 14: 12776A7C937A648F0A8628AD8C5C, F070283852AC030819EA67BF82C719AA
+ 15: 7293476D9E935EAE9DEB66F697F662, D6322603671153A1EC1453CDA5978E15
+ 16: DC12A86C85E7358919BABB15A3BF5FD7, BBBFA467EBA8124DFEC82DB0137D56B9
+ 17: 0CC1DAD00A987F9C57E3660D9417F226E5, BB8AF5A0B5BC79BD11C5D41CA80CDE2C
+ 18: D0049115D6EB5495FB391CDC494022AEAA48, 682FF357B2BC059765C29AE6CA668D0C
+ 19: 48FC54A401B4C06CE8567AD298B672191C7E84, 493A4AF4C2A8828FED8442C4EFF877F6
+ 20: 90779795821CB1B7DBD97028E29DC1CE7D0CFAE0, E126F485F73B6F7B3894B4CF7E1C5DDE
+ 21: 8CA5C246C8B7C04BD7171CAE2D1A892D66302433F8, 5D73149A3635A86B3C34DEA5B95CCBCB
+ 22: DF082B665F7A952B2604C04554B81393FCC7C0B816C8, D3569ED7D431176B286EF22414E4CBA8
+ 23: 761908530C9069E189649ED24B6A68A89B067C31E9868C, A258BCD83D3FBC7AE2AEF7516025AB36
+ 24: 717048F5A31F3C89D3704F90069AC5D5174118770C65BDA1, 067EBF18F7E3DF4EA13F9ABAC682C2A2
+ 25: 08C6FCC5D3099347C3FEBA3858A6C22C51298CB591DDB77827, B57BFBA40BE99DF5031918A1A4E2CA80
+ 26: 2CC53EF7EB954234E64CD4D60FB1D7157A489ABABC10900FFCDB, 236E769611D16EB7F463B7578770F886
+ 27: 2556B46F2E831223D632F2691329A874F517687AF81B8322AC55D7, E213A90DBC31DC261A45A9AE41CFEEC3
+ 28: 71241792728594D69791B80AD6DBC6417D1D14D222DF5E6F834B82C8, 601F97617708B1945BCDA8A82496EFB1
+ 29: 5003DC2EAAA23F9E2221CCBB9E20116692CCC99B3CFBD0DDD3A8491E7C, 3743155B792012845550205C8949B73E
+ 30: D0589675357E850333F854FBA160688F06D122DEC00CC2620DA0B2770765, 20E085752FC4D37791C22501ED1DB6AD
+ 31: 645B46D2D114EE7329F14AC1D94E6817EB385EB80C61F014F90530749079EC, 8A18DE86F9555A1070D0BFEDAC15B14F
+ 32: 068389206D37BF5A41C58075FC98901C3B42E6F2F13C09F4E92524021BB1C1C8, 370B86914D63CFEE8303D538A6BEA0E7
+
+GCM-anubis (16 byte key)
+  0: , A0061C2F3B2295BFA33BC74C037EA8DA
+  1: ED, 9E5648DCE40DE37B56C557D26CB18D83
+  2: 6719, A6605253C59A101FF85C5102CE92BE45
+  3: B8873D, 13F3E3ED3646BB296EE4ED5D6379A21B
+  4: 5AA6E2CB, 1812E8385D15B5BAE043E4E860BEF490
+  5: 4F6F4CD8E9, 8A80BC5E08929C42A5A74C5D9ACC0C6D
+  6: 2F0D8B483CE4, 316F588F78FC6A9196C97CE59B9B63B6
+  7: 82D885FDE1F948, 7160BF556614511F53738A92B5277056
+  8: E4931462AD41B6DC, 7CE24C4D6B499975FCB72B5E2275ED56
+  9: 503AA70BE698BC5B41, 10EA0C61FDBA8FF7B4E9927BCCEFD911
+ 10: 6B2D213D14B5D25EBE36, DC3222AED12EE26D3D14E2E733EDB2A7
+ 11: 7D8B0BC1B7443E7267371E, FCACFC73E391865BE86E041F51C45E81
+ 12: 9EF3BF8609E133BEB10565AF, D84326D4CAC9D5B74FCFD8CBAFE79E77
+ 13: 59AE7B1FDE1178CEE7F63C4894, E1BCFCDCA86CAB9C684F7D21962D580D
+ 14: 564E7B8BAC5582A3BF1178916569, 54804D8DF4D7577EF65C15487695F840
+ 15: 758A6DC437C8821274B0F16F911BAA, 19DD27500915F425F34F67CC2374DC36
+ 16: 0468C94A88A27AEEE2B3A973065E53CC, C743996C6F49363B2F4613F24703EF7E
+ 17: 3B0CABA5EEE44B7BFF0D726ECED54763FF, 14D9D09815BCD91DCCE2F5AE1A9929CF
+ 18: 5B945D83B98C43B0248F9BC0479E332869AB, 67A275F0313D4245B1965411CFCC8F17
+ 19: 97332441CA96DE8553A3C6D898FC6D90C86DBF, 73150EC3D6327E3FC8015A6192652D3B
+ 20: B9A1778FAF9767160D0D87816ECE1B99AA727087, 0C173D3C4078392CE377313C48D2BAE8
+ 21: 5882B73911C7D26EFDCCA3AED2EDC8A8BFFE75B1F8, 8F8C535639A0B59537E590C7FC9D2E53
+ 22: 70AEBED8CCFFF6E5CF06F3E841D12387EF8D6C7B4BDE, 4B00C27FCA9BEB82331CC8EB13DCC580
+ 23: 345CCB52BC20DC5F1BF5EEDF5D72A6C48F402557FFD342, 1A790A39573B853DBB8E2E73B7331014
+ 24: 0637C78A817E91D63CE18CEAF8D65C6107283A90C5A97842, 52786CB81724E12C76A0D23D4680E36B
+ 25: 59526D1E86A473DFB720FF25E97D6571077845F73C5E8322F1, 369FBA7823FC83D727FFD25D10130987
+ 26: 2933BB4E7603C313B62332827601F8189E14C1F08EA547E15AB5, 204520E365DAFF6551B01562A4CEFDFB
+ 27: A4098CF2A48A1DC2BCCE65CCE8DF825AF51E7E5F94B6186FF85D77, 9833EBB9A1D5CD0356E023E2C3761C2B
+ 28: 26557B942FD6913D806672EB01526DBD5D6F532F78AB6759DE3415C5, EDAACDD101BC40EE6530D8B5DC031F31
+ 29: DB92C3D77DF0C8F4C98845AA9AD43FB800192E57A53E083862B7E3FAF0, 628DEB1E345303A40700289052080FF8
+ 30: FC57BFAC2C77781723C2B721886D44ED67A52D9AD827874BC4EEC0A97281, 9A222DBC47B4AB4E520D3CC5850D4DEF
+ 31: 72DFB9E91A78EAFE758B4542206A4A957B4523A58428398C11BCF2AEAE1938, 307D0B876130E82804C1167E03B69B2F
+ 32: 7275C6EBDC2680DFCB73326A987D2FBCE83E40A9AEFE6351CFDA7251A6FE10A6, 895E6EEAA9BD88594903325A063CA45F
+

libtomcrypt/notes/lrw_tv.txt

@@ -0,0 +1,126 @@
+16:931b40b97cd1d1338d4a4abdf96d1f45
+16:000102030405060708090a0b0c0d0e0f
+32:85e82fe5e8b426cf04bd96d9aed318fb5dae89a1dfb854a09f556b61c5ac918b
+32:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f
+48:dd7aad6c6d10176e25eb97e165ba612a2b6275d97667102f20af20ec2630c7ccb4f5772a3e009948f1ea91f3bbaf7e04
+48:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f
+64:338509ed021eecd249cb15cdd440a84ff9d6704b99e8e52e9d057f152b742a5e3b9c314574026c76fc887fb404a12d669eea9460c1fa08e1867c2c0274408b9e
+64:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f
+80:8a9cbff36874de7da3e20e9a26691eef944ff78a72341515ae20c2199688ff92f039a19dc6d517e017ef36647834debee90bf80ba20a7caf24964bcb0bb3a621f8203ce5428461d3ee72ead7aeb201a9
+80:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f
+96:06eb66a88b9667296b8644cda3464a27e3e2d8b6b3d0a9ffbebfd48f3967952ce161d8867900b0a7a44638a6e41b9a9dc53bf183a85a4ee33bb6f6c2d64b8cb54bfbb8625ff5cd3965aa08b460737b575da0b8f4123751cf8f0ae801c5856712
+96:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f
+112:7af5a2b1381a8bc5aa2bdd4370b88d680c34ba9332d1d9f6e203c4d9fdbf5ece39fe5afb5871490a180c4b102665823dabe1079656f24969bf84267d3264f92cbbc610f26203536d387333938d1a52f4076df1aa0a114f3b0182da12c3a5d87bdc8eff54f80b0d56f7044ba372ee6366
+112:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f
+128:814fe82674b98d54671869e3fd705f76e353761bf61cfc635fbb23037d8a0e0dfc13c6c0e34f8c79d4444ac314d4918773265b3fb5866a997e270d5ea8891f0217ec6749df281d790dfbbec8adc504404cc0a6f11e91d0ee6c19abdc67b0c22ea4d9fa218320a694dca53cf522c761e426e0cd57e49b73a5d765cb4bc571e888
+128:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f
+144:9fab9584b0dd87df42f07513edad3b5e3a35b8871323eed63a48ded1efe4308a9883579f3a7ab830277bda59b1f1c2614a2cabe11cdd87689c0bae80ebad02b76d9300703d0268e0eb052d9956c5648912843b16be988134cfaf65fa87013ab960b190afea879897f1fdd00b360b6bfc6cc3531285682894b707af5914d2d1a136407f869ae6672e096ad7e95f380d53
+144:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f
+160:95aa16e637f1449d9012237f5fd95a57c5a9e203ca0a9393975e5991cc568f7ad2af3266ab605915af277f4395aa312586fb28a18f22d1644963233e1121472980229a3941c2f24758a51c48aa22b61fa4310ed2e6175a71bd4058cdb070f2b8289a46a39636dbe259eeff3c87f96fc8d46961aac54d7a8491b5d713e6cc0d6551b9e90911947d9fd15051badf67420188c450f9916c2edae245f1f6a67e4f5c
+160:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9f
+176:5cb782dd9e2391ab54378121d0766afe6d35ecef7a2cbd85ab04ea82b06b56ddabd311917093ff16bc1857480f84049d89ec6694414617b1cf3a11778c1ccbf22b81be5f07ed6f978df5089e54561fec53de95205ffa7d573092688fce92cae228f342f77c50df87404d502a9b274bbf3cfcaf4e94a1e8401630e18b79d048a5f3901abe82493d911d385890405bcaf4d5981def670955e95c546da8939aa68aefda56b37abd3bdcd466605f9bcc5931
+176:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeaf
+192:e9a7781c750910f265e72edf0659d76a0db2dab863f43ca313b9e67e8f9f97a1ad8ced641c6d8d889ed2d38caa7887ec2eb9242093b39d4633702731b96e11da52b1a9a584d2367e6a0e759baf902eb908b4432ffecd367ff1fde454d4af844e9a10cb260ae222446c179dcc82b5f767b941f75196e8c4b210315d01b006fa6b5f1faf931549044b17b33f567b729ddea115c7b11c90982e1480101e98aab23da6533b40777971b4afc3815d063ef175419dd72bddcdc6bb187b3512c3bff56e
+192:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebf
+208:8fd33ac16f8d9bd2ab24d1d26b267f67222b9309d697502bd001bb48b8c3206bd5c98cc1cff788633cda4edb5aaed2055435c2c092a7c655455d1d01a6d7a449df870dd559e9bae1e0fb0d6e5a98679402c288b87cbda569c3503b4aa9403f80c835c995e3b47e33c1c5b8321e8db1b72955ccbdf640c78aac376ec449396b163b8d16b51b0749fab6ba71d0b563fef6e94702f35ff2ed180f0de1f86679d8f2a26b2b9d8adffc7ad11c5944118e30025c9be26431f130aa2bc238e4b0104ddf9f82630ab7eea590bd7eabb2da745ffa
+208:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecf
+224:ac2daa6b330224b6f146ad67edebacd98cd2269d0cb313fde49d85ad60f9b21c9926d411fd435be8bd073d294e905acfccea2708f98e05cc9ded3c77e684b671bdc59deff3b43fb931381b12133ce386a0314a939d6c4855bbb7765adf955f4e587bebaf6d3b8cf547b2feda60c326e3409833665f61d91a2451ca2693bad6779094e010a3804993d6078c1ac3c2d26d589a8b3376dd06241b3139d2ae603ae5c4829c297f09a5c535c37998f571b0e96855e7a708d7b2ac42659050547c7bd447bbebad92e98b203ce6e83bab8e94f232417152ac6bfe8f9982012c8f83c674
+224:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedf
+240:5c4d34448cf5b5b385a8aa9e504d724e6e689a35ff36143c20fa16df16f74347df6b65ef354c094732fe1b31e454e319a7be20dc6df4b900dd6527feb5b7c81a7a40df73d513cd40a5e1acfda4ba9e4fed784bb26b2719899c60a54bd8c772f17c95e6100c6def216c9c612a10db62a576cf45392c68736466305f6cb86f218f57b033c3773d0cdd9827f822cd480b60f94d32b28f536e6f0464e63e84294f0c3ab088dbf0efcf95b020f4c2ddc72c5823c2182025cfda510e1a944ac9316f0ceaba7dbd116cef95e051ca9143eebd575ce53c26cab9aa897167d500fcbe229560a85c98e83385ca6befa90726e768b4
+240:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeef
+256:46d31a1a6fccbff0435e1811a4851746df2af5772dd0408fbca2b3603cc4f92f778dec8f14daaa6f081500de55d036b3680a8a9b6c50bc20eebf09e35036bdef9b3751167e807cd1aa70385ea9f4be42ef4de6211079eb0cd6c3810404a60f09dd4e98cccb09c356e6b4c4cc1da036bc82023b075011cad2d01bf95fc45829c7af484f92562c2579bd3b4dba3967d5c6bfdb3e2236c2b43655e6393cdce8a2cca0affb8e45e8545aaf04049c2789108ac5bc6bceba18bcb9d4944ed81a64ab43e28e28207268464b99dad7328db0059defa25a722cbfaf89e93a20768bbce91b64f395a379ba5580a2ca4ab2d978c6ed3aedc9f53896bdc28aa5f1300473a3df
+256:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff
+272:96a46190ac8c56cb272488d1db3a6153a4be7a298f200eecd42b0657e7110e879ddaf12a782d3f946a283f23fd5fd98ddce5874ea645e6581284d94c5437a4737921fd1504fded721d9a12c9bac8d8feda0b1a32a5a04e3602dd3befaebb161af6df1590d280ce09fd99e551ab39351dff8cd85dc084920a21f49e726bafdfc75e1cd2c42fc8789edf52adcb8b8f87b0b7c89c7e80fb8a14807c96912fa125395d71f631cc3181cccbf435da014e47c4dd25640cf7953787c3fa2e9de4a867d61cc398724a94b584ed336715ec92a562215bf36c193cf2356973e60b858d3f97a944d12a40173218f0bd2e565833581e51bee580e3b3430b3d41d6d6788b73ebb45a22a548456f393f24999c40136688
+272:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f
+288:4ea9644990536525105792b735e1a9adaabf7542f8d30f41553f756b33fa90051352939fe2693be9e5e482f9a2fd0ea00ec85abb01a56780b61609ac1364b22b2a1f7b061317995c1d2a8bdd280a7735d1191aa6c546516713577093f17b5696c9f2a2b94b766b5a9d2551891a5c17530bf953aa1dbec6a9560054534163c26973399b128156af6a257e0c591b279ff376d0e2464b06a464bc5e5f3d4ca309ddb9fc96d8c59efe0027389e25aca9106b4a6c0e8e3726e26470f0aa59ecbb1022953312bf5a09db75728ce455f63bd328437622bc61dc5f703e7e0d49a27ccc1fa25439848a1349c7790d1920f465151318c3d27855bd953231981eb903bde19906667d26900e2c233330fa0b6c157db37d5b7c76fdfa7a7e1606045e9a18a0b9
+288:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f
+304:53ef1d7350ca9c52f3d53b1f3097919a4e49bc48d2e63c571abac2f19f16084b16308dd8cf96f374fafbd1ac7b3f9cf3b9c62af25563ff09f419c94f0530d43ddda8396d99010c861c92d59b3d03bb8423eea55044053b06be07fdab392cff5f85be8119ce3e3783cd03923d28bd6cbecd5620fc2465a9f2b1a0850e4a6f35c1893819b689387e5bd2449aaf8b1497a598a48595030a00b92ce357509f259690823c0d1b710edb36cae8b7653afc183f54b1955a56db65929df6b29880e99eb68581f1e41141ee697c1fa565f0d674a2b9f1e88c3f370d1d5c564547370e73e2f475f52eda167bccbcc19405e1cdd24c13ac25bcfa3f7dd65e233e059b18fb420bdb52969816548bca83ae9d392b8ba1eece0faea2a4d965e46e38c3acdb00466892c1be69ed0e73ad80beee0cbe6d2b
+304:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f
+320:577d305d82d993adb3fbf1e91bbfcd6d9fd9b7872420dc418825ff0bc791b12dcc5fb56f0a4396131f989cebb7b07b67f6365bf120b15cdf7c856e4ffdecff571bc8b04a10328811401ced98c14b92d667d89ef0f413d2472d039931c33570bef3db3485b4f018bdc771ecad8cdca1ace0ec948591e98ce1e037d33ce00326452fddfc70a340c73b0886b43dd0e9203c11c025af0aa2ef3e3538893d6716574f242657cf1bfdf6d8ca3fabb982866d04554d74a9495f178b5bb68d2c2d026b82a1d65a2a63a5527710c305d6b54e830baa18f692dc0f29815b7eeb717c08d49b696af80db2c05481aa077e52420cbd1ec47c99aa82a0bb730a85bff1a8000c1735af09ac45ad3d0088eaf52f5d42ba1337dfe3ae956d6d7899ac949028ec0f5884ae58d949099505dc9576d204702d9b25a172f81a041fea4e8744605ff0dcb5
+320:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f
+336:cf3c36fbf2b8d72b6e9e8e9ec871117b2d4dc814e3204a5aa223136f8fb8218245dcf03cd81de80a4d35fc5d0a4f8a31a2872d3c1acdab0846c89bbc8db6f31436741f6e3f21cc1f783bf4eeea9b29415eab9c1d6ed94dbd391a13ba98a851ee0646a378a8d1b25d56de83049fa5ffb33ed2c5f60c6588eaf8e6b374c43cf1aac153dd63951aab2ef10923889af3192bf2adf9eaad048eb8ee3f81916eb589974b5152226c5d1e6f516a82e8acfccbb46ab14d5b901a4b9ad23c3310b0a2d30f0d88d0852e67fd7391c64b9e57800d62d81695d9450e135c9d193fc0efcc8f774e0fab020dff5d0a28390dd4d629f5492a544fcf04811f2b0e3a64d33c5eabc43a22a97c698390d53789935aab90808b091211609a5834ee60da7af6cce5cfe9dcdb438b9e8bf60706696d0a95c5e6bfd25921dee98c47de5d7e4cf5101fc994b062fd2dd01a176358113bafa404bbc8
+336:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f
+352:7dfc531b8d9b4f8a084ef0f6bca81ccedb88d13f899c64ddae54611d76a0f77ca27d3745860c79bc944eb854738a1c5a1d23491d19a20f7fef3ac6391798360eb210874cec1cedeef549726e533b223a3f3b14d4bdad059920910279ceb49e70c87a84f1901125327a9929f238f5361099425afa5d826c82253d94d83cd291947a7d54dde88aac734d1df8de1f125fa02b6b0983cd8674bf529c97929b56a5ba681c7279461575a7568c7b9518d95e6ea8faa6ab6b4dca7874dda2c8d2cc72577dd67744873da145bce25593511d0bc3d67bf5cb61f9ac53e04701a1a448e80d692fb46651e45b65dae90994c91b83ba4c1ec9f7945187b9e7c31e870401f5ec8322d0a686fc2f9559279de992171957719004de602a7da9ab63a902fad8313b60fd883781aeb1c8d5b99c73e417c821f75859bbaafad40ab85098dae356c996f4274b198536262b2d26b22216e79ff3fc707fd197e1f39bdfb9acb6214d9196
+352:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f
+368:100e6e817ed865757039f75eb6d15c16c5478784eb9dc70f60e3b900f60fa925404e09e2cfc0450bc89bce115fef62de782a2d7725970e7fe8226122c1ff9ccf142275d4f37d011ca3aad5700e2e8a8d27c7553e59f8173c8117d813e4d237bf906e3499306fd5bee0fbae137a372807caae0619caee51039049a09066b62953fc5bf1213dac7da86b4418cf3bbfe046c1b9fedb6045ccbf25617ea52e2b6fe2cf9a52ed371f864197fbb3ccd27ff2d0e2e7285e29b21632111d2ebea0c8f1a216779aaef98346b84f54fafe46ee3128020434d0fb1291e07c53bdb236e3f476199647bd7366a72dcdb5484e2439257ddc5b2d77b3c033e068c32288d94a72f2c6562c7e1727e4f60fa41a75f5561c4c15d5997db99471ff68b085b39d5107003927dce0060b1926ed8e9144a6ba6d907ecf037f8006936ba536513fb8122b82214162b7735a16f72ffc4773c32c9d694827c3c2ecddf742766d2b742ffba674a04c3700ea52988f6e265925cdcf4ef5
+368:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f
+384:0e2a132eca216076665bab6f3d1f222a9b502a4830e7a67be3330fb4a4cbc1f2ba2c3891ffd67cca8514739848cd90354e99e489235f380b3727e74467b5579ab2c3661054eac7f9413fe1f5f9b8b54f25b9eec5f693025d300bc70c607f074b640764d91230a6a9753bc403a17009e201cb96b57020b527d48943436e4fb717a5c5ab027e239cb508115244f1ba975861c0beebbfa6a7ff1e47ae135eb2cefdd8976c48ad71ff19549164d22df54044abb8cf86c7281035c00f471514762b6224b2c06cd496e149fe43262c554ba04735df40ae8946a59d87d7bfc4573e5a1cc4bee53a4d33d301503955e405c47cce974a8844ad1990c568dd07dcc1a240dd1dba5f4ce864321967870acf941535926e5d3b511a97924350c9019313a56816a1abc5c51aa96bbfdd2c7837a43320ba964d047fe5d2db2800471679663dbc8afd4fb8ca4d39c5735281b9a668b9dcc46c4f45881a2c9f841dc52f354d706cd32ef5dcb4a9f2cb5c1c7b4fc9e2b56e14fe10a8492f7137e580b6f117d1cae58c
+384:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f
+400:0195b4bd24e6a6295a3a6ea05ee7717ec07eb6eab50bbac751f66f6a79fc564f7aa1bce8b62b87dc25e7b45d52ff34f4f9d30afd0eb33eedac4eb19241fd80dc05ed8265974d1ed3df48c2e027b77866dbc235536b48ab50f628635a95c4430f8c237d647fd588e0318a5370ee6342eb802c6e584983ec6aace4f486aa05e4ae68da28307cd64f1b9572ba59c0c59ecd198dcae3d6d36e09c80d10c877a88b8779b934c6e39dfe0123c922be796a5d962586b54f6e9fbb467f72534be73c4374a7ec7c34cc1eb3e3934505d9edde91c210697b2e550569bf6a3e1adfc2db5d364336c19ac4dc17e3270601ac88f996a5efbcb2d241a1c7acc8ab4a354533f912c9e51ba898bd41f43486290fa32b36a760de5df0c25d5914f3d56004920c6dc2e1724a95eab88f61cfd154dd47fc8b62702e7780522938fb9c035b494a0ace5a21c09f0cd465a834a61c4c979b093a5d780141cca82324f3dde77f45efbe46d3772831cfa93869d144740bc4d0948bd60df373ea24e4be876b6dc8a338e1853cce36b9415ee9aa9077c4cf9b2d482f70
+400:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f
+416:5c3985f375cf6cca081dfc118d4460208446d21d3f3d100e883222cabddda538115ccfc37f68739fb6a1649c55fd36412579ad1c66908b87f252cde8ab32386ef68c6205c8994bb7d0f9e0fa5e1e6d8aef7064b0432b1a03b3dd4fea645aea15216c03f58658df21ca8792fd2253a2a889d1b223efbd60e10890676291fedbdc91aff403cb98fcd96de1d1481bb8103f157780ca09ab5490c79fc9c60fe91d5325103441b986af5e9a0e323bdc98150e45a2e7cd20997c58a561c8698a64e7734ada60ad1669160f92c07e56360113adf699c25990d0172cf67fa8e0e4a3687ac23801badd498c7a1a411ffb1f96bdfa5de99d5a4d6faa8feff99f624c396029c5605927ae0b7315dda77d092d6e37ff885669e7e60a823fd06a457785be0a151786fb0a7a3a8b67a4cf47788ff8768e24b38df7338c87c2fe3919e74e923cc8a4a3ab7a21db18ff4672a25d3652be23b4ef02e958a77d7df0254d7d54f6ce0f3a4572ef675782d0a9083c6549304cb302a03b5692137a2fd65f0b5a21eeae19c6535836844445afbbe2a236ec3fe26b7d7615a4171a6900620376bf27db1479
+416:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9f
+432:de81559812d2938cba8075ee1cfb7313173305486f59e53abc00efa276653d6cf200828615a9f51a045ee94017723aa431e0d4252205f8b45afce15d3654fc638bc32744488e97f4f7b9958694d40403bec42a1ca97011cc166580737b6fdd71843b8e9e876793858d5b7a06da8cd7bcaad4ab2db8a5635f3643263c9881a9157e1ad82c2832e5894630dd36cb9c65dd7faf147b57e230b5b94417aa962a3f63bf1594a99adbbedb9c03bb9d1a728614032946ad9743c514948b3e01ba8099954dd5e3a0c157eee3e0038c8254fbedb10c685d89cb0555ea7d3f7bd5bce22431bb274ca8421af1fd9842cc9d8094f2289b6e0f4eaa183f316a203b1aa4e6f8008d8576b5936f715ccc584e4ccf1ae81ba5954ee4f5d78ed17135cb13af0484f3664a6f9639a7440ceffd5ea60cc5f391b7cd7201b0059e3391eab6cee0e9ae0ab7c4b7e6480ce7f315b84d8321ec4d1a33cce3ff8dfcf9b1299cbbfee9a5874ce5a1c1dd89710a3119c1d73bd9795d85ff3a01d88066a7b2377738a2247f3cc02072f0f3ea2e3adf463c157e9d662167422db3824df31c592891474fd4d0268e0c64ee9117f6fa02acbbec532d4f9801
+432:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeaf
+448:957c2adc952b9187cc7da773714fcb6fe574a07684c3d5d1e2d633354cfe248406b95f0e9714f276f156d97014cfb35991c359e07464b55ebf67f745168b386bda72f0c2df5a7f830a5e4629303443181cd43cd8d30a415cbce0f503d10a0f63a34eaa3a7ae962111caff5fc33d012549eac997290ee78f4c9cf95c148138b60734cef0612983eb27a160bcf5434bb1e3e6a6c100dd55dff25b04d738bfcedb84ae2a168f3be9711bf74c0c61925b61b321f90bed4018f0798b6aeb99975d26244606e1b5632ad1c1019d0ed0f254273cb6a48494b92e516dd1c90b6e48b407179fb20426ee46a8a0771f1bd67b153bd7625e76ebe052d33137ed1cb8b0574eb7c93176d6ad88c5e4bc47c8c9ef4bd54a46fa8ff32ed284339982a1aafe3752648c55f01f5ea80c419aee39b0590de39f0e34f382e3463bad7b42aa17b5eeb2e5a4ca06e9dc3c254cceb5567acc56fd6848d5d6b259e79452423d1a541c6cbaff928039186f51bf1800d859ed932977df30fe28e00117c1e6e8e77a0bf7ca69e264fcc96c1f75ca677554e9aefd06ce97ce5f0edacd50ef8af9653ec3650dc78693a483cb9686015565ea96fd0c36c13d51af320fb8ca900802ae94fdbcd560e
+448:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebf
+464:1b30a6f0f8275f186d7dc2686794411242cd55389a35c2a8f0d276138b9c1bbd2e12c152def0bcbdc323bd3e3b43fab29cbb67f5ffdf7450acbd8c4844e17b196d68f0ca6c0075bf06b1561432435687a998658d62d2f9945ab9d2a2b9cfd7d4f67bbf4c536ea589faa7a438e3cb0c006a2bbf2f90c139793c6cb41be18b4948841a2d31cff96b25ad0f1377563a4acb28f64efa006834c3335e604d94873e7b8eab583f87c5f4e096bb27f1c1af45eb906953acfd7558c978032624355fb2421a636ac6433e7459b61b0706dac2f4bbcaf18727dea1f6100d34eeed31d2ea2672f9dfc853e408736b1cc03a6485496b6cfccc6f3481b2cd05f5569bb36456970d0289aee8c0442cb85b0659efe9872d5e7eee0218d9da684ed0f11c489b49f5b974d1a397bb31e15a9556dc1447018a4cb40f1e13db643a8769e4be78e22f354390563a7a7334445adc5e70ad26623d248721a0e3b8354e526f573f8a292e7d568e63fa38b48e0a4ce7431e890ed19b3f824cedc84a050d4d2a7818ee26b8ea804700ac840eb4bd3a4c1cc9655380d13a86a69f03f642e7b2337d21116aa7510761704098bde0cd6136cf47858a26e4a11649920fc2cb21a51f2f9330095d9de06b5d72b93a67a59ae3fbaa4652b82c
+464:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecf
+480:8140b529f455d70afc9ee6018a2e59a1ae060ccc18908f3b0ee9e8efcbd3f0124123252c5a62401b3c30ae2843f4565f19d6f4af186dc35ce11fc8d0d23bde67ac133dea138a5c27712381f148f1756228e0ae06a0795e8fa3e8437f87a6f34db3edd5a679d8b93442e9129ccb3bbd2e79d4e01d57caeeb085b5cf24200150bfa76047b850e96818faabd768ac5e2dfe210846008bd76d956352bcc5600fa77c044ec582c17b8bacbef9075e9f99a2f58fbf8f102825786b6785428f4ac15756c7190ba822ce5c0c571940bf77a22474f8eb6692469a3faf69694301d5c14d92d9995d20afe38b9e58aa6c0bb59dfabdb2aebb0e7b11bd2eba1cfa05ded46cf1dd1cb174dc76ff6784d06f6062fb58a7760284e051cc1ce1144643d902881f1a435130d3a5d7b2442fc03db9896d6d552afc14be38263c63b24659fff6e115b795aa1e1d6415e67637b0bc095de9dc4d464b9cc00dc47cbb55b3b73f3ac03a8ab933be81986e9739c79169e51bb90b1664320193df2368697afc9e02b9d9ca09d7e8710535f512c17ff24e3bfafec233f799999d8be0bc8f460fea79d8459ba17d4efef64cfd90624864fb5b220bc3b77d21a3db10fb626cd8539245398b008c93205254a60c73f9c19f0ed4f4152311ab1743762d859b29af7807fafa815fe9
+480:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedf
+496:569e7fa1c3fb86f2f88b26de0fbbe7332900ef284696d3b04800b0d81d09eaffece090063c472a180f237b2d4e51b2be3f29c361fad95789ef5f1fbb07059133ed74c3cc544032021d98894be3202af6c77e43f55755afe31ac5b9e5d73d1aa8ad059a4efb9fa10f76d88ad0bd792c96f804254566d4c86949027fff96a5d05c673eecb52436737d329298922ebd45d77789104c6b0885e742e45c4d2fd283768377c09a9925b3984828d1a4fc9bc2bc256b28a2aff31a1ead319897441fccc4b8f3f2c82e5c64cd82111de146cdf7652a8147076d828f1c50b67e2d060deecb9bd2b84a8ba13f0a65fea79a0f47af74d3f03207a191e3a5c9087994846cf176063c196b77271c7e8560ab28084fd1e394d9c43b07deab40c48c05eecfc5ba42ec6d36724eb30ffa5e9904318c1242b0b113cf0c7a168da9197abc2a083f371c526b4afdfe1f1424b290fb2bccf48a426c8f321663c767e3708f37fda56968f0b5e787b67d366828a3cc16266268d92c8afdced356463dcaff0ef568c87653a308c12b69649235f7b2eb391f6c54df1e96451419bf412d2ca0f6d34ec92e04b7bc618ccbff4433e687dd147c5b3fdcf4705078adf5d7e370ee992e021329bed281d0c086930a3661541d67d4af188d882ddd020cdb7bd0c65743ff41b6fc7fd75237e02e7d6dd8083afb544080620c41
+496:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeef
+512:9821b3449869f2cb0ef0a24ecbff9b33a73b3cd54bde63d343c426a36c68d1d166c13d02ca4d65cf78e953361a4d2a4035fcade9f3d35d0ae1cff5b85f1fe5c9f3a9db9dab6c10b8ee7542944c84815ca990bf4bcd7062a8013bf852ff3b781f60e29eb9196f31b0e9cd566b7c906b8d930c4d4f410793c1fdf7c8c8ed913469c2506ccfa1c029f383a9eee5a95f18ffeb1f25084c62d6c9fab1d67213efc1ff08f2a33a20eabb520d6997803ffe382ec2f1879465c8b166b045e8ef6fc27c8182d8969419291fa5641afb45ba1600f512a612e7dfca4f71cd63c5fae50a53fb305650e3805428bfb6689813e342425ac6d5d13c9575b629b9430cbb21bfc41c026fa3f8fcd9677bf9bb7cc14c447706a455e2d5fc90a80ee635fbaa589e2f50d35d1a1d5ded77bd970a1fe32f92fccae831c8e540c5cfbad2162dd0683160f0d614fef933207b4ecb51465ec0063ab31243c9a23a07cf0952b81eb02e628b9e53ed0c27d720f65be8f38b960c0286b8dc58aa11905f3d3c694d364ac0997e6b2e3886a1a11b357ef0b75cadbf77acf015b4cf6bce508f4c27f01048d2f4d811e39ee8501d4fb6d69fbb6159a6ba56629e54e798e872be33c191750168af7a47dfefd989c65f6b2ef8064aef83e2e902f68aa9e10a7d6ac4a2680dd0913aad62b5dbbe2f51b46bf64c950caee3b66f6e7857a64d9ccd4518d955f24a23819615
+512:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff
+528:f02604963d9dc47382d2b835494b8591deeee437c38d4d23e643ef3d3d3d3d87a6ac3475667a749ee84cac055aa47b531eb22d58cfdcdb395fccd9e34e88ec8dd6d4bdff940e321899b700572badb5e44675f7b425a9c1c1969df684a25ee0974c8a9d5e801b5cd70976a6c5af27937c784f4f8d1c86ae1c265c5cb38ea1ee18bca93ff6019f1927ebe203514bf20548c7efc13cd91fc292e2c9ab9fc014d8371d85a2efae108b2afb8bbafab75e7361c99925a19d83f3d7fa51c0274a7a9796aee7451e783976e679db97baadc4aecbc9d120e01719592e007195dcb7b42439c5403ccdde0ed0ad21a7c5a2798919abe81ff72a2baa033002fe25070e14f3417e7076847e90d21ca9a7fa82b45f62d2340bc2aa729616c83bbbf2a6505f860ceca837c479eead3b18f50f88a63f9582e517b4bf51703e42c3f473f901702d3eb4dc25097169a2fa95729f295200e13d05567e5132268b3939250b8bec170a90bf842c8f2b680fb7dd6bb63bcc1ade151944030c0a58b278d700e3460e9d9a7453f0698de6fe4b3104f048d0d3c2bfd6d71c86d8460b95568df8a493f6e77e1d64b158329bec6ec126a24a1d3cec3beb2749c0d2f2d1c9d03708d0f0a4faf81ab0cc31e31dadba6e7f453f35978d49bd026c145188b042da98795d884256fb7b25f5d6e8ef42c927bb39c921d1e634bc94539076986afc5973e98bbd0e466b2b7e4cfc7831fb0d4da70ab31dd9e1584d
+528:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f
+544:ab5530701149690a9f3157b9718fb392d2d2c38e57b588c652a9af8580750ef2da9ac7f28442a1a3acc2ddc06e0cca15a6ad8c5a253c0cbb307e7d89ecd6a9d5e72c76f2589e11706713bd0cc4bf524fb5ef3c410eb88e52ec0e52d822f6fe14d744a09ec110171af24ce27a8f116688092d7a7123c2ae144fef01f277876e85bf0bf774350c92c7bfee5977d71f52a0d395003adecddcd92ce6e3a6c73b07786db829396479b10b92938c7b788b897695f74b61bec738526c02865b15ddb8d6a927840fabac0fc2ccbca815ab58689eb73adfb08d6148d9a98e8a5388aa6502458ebf02592178527681a12afacb0e0e1b861347dca374eb38f31d86761b5d933f182cfb3aa48cdcf17f08cb9563ab8928e6472fdf43143454f66b626d4e69b1ea0698a4571387e99fd4ee16faf826c3a5c1110522236345948c594c20e3a61e530dee291b79b7cd0e2b0fe7d0180ba1162bc4b3b1b3280dca81fd5a9ca8a227f77cef89896e5c664a75b787f45e9693147776ca8ec8ed99ced39920b813ae9e1e93214d8cfe5c168ec5f07fca092f6368fd952d0d48a49600fc0b3905486140be1fdbf142d0cc8da446d2ed4b1b42f09f09d3cccb95b50ebbfeff60a1f5bc44a9161ec3bebb94504b70fef1c36035a89a866fb96b12f122d2e5ee5fe85b371223f95664b7737784c0cecea980fa711cc263446be48c07e6da223c4ec856004f99b0b195180187aa73ad3318b7b23c9002590d6b42fc57e9b0891e70406387ed
+544:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f
+560:dee4d7750f0870bcd16faff4d65a5593f5d86f32a6ad7a519d6b2333e522dccadfab7890d02a6499d6487302aeddf9c52c929486ffb44b9ea9409a940d4486a379b0ed04e00421f6e43e7393f75963e68422ebcb2b87eca211f671dd713d59a6034576a4feb356eff67f33081f7889c684f971a22be68adaceb35d24d1947d7f5a5c03f66f3152dc3bd70f59e172879f50da9038a115986ada1277014958b2b19d8a158c097c3212eab6c6c0e97948ae15f146a245bda2495a5a860da0dea32b7794f77aa4bc91268076649255fb138a4ed831e659a1ab9761e37bc13839d1f419d7cecbb12bfa67c53fde957ef5f5cdf43157517f8021e89eb46df4762cdb992a9285c36b6361561dc469c2e9b5bbf79fdc8779627971e6d6a74e40fb1961933f182a1b270910d7604a680d5bfc2e5f66b6e4098a0b13d4c9b923bb56713012bb63b7a5cd1f9f1a7b42a4e28278e5766a3e484da08a7538fb1b27a15f7eefdb5fe28cf6297d81ce7c464b6f7373783c7d344334beed713e325e1429bd7bfdd1610efa551f0c16a6eee5b787f973a0110754bb681de8d17830996e993a360e1585b12ea8720fdb3227f193a1963f0afa7d59e303c27c70d37392fcdaefd5b85d52c2bbb7f19b3146c2165e35bda3b6c23f16e469281e10bd351a533edc370388a07e63f02b07db8569b8760b7c091529907893133685aec1cabbb8e06752f90490ed49fe4cf5d580c0007ea7e902a71923029237fbcf965859abb2d14f6c89548017eeed6d0d5614d131b6512c74b407
+560:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f
+576:a1d36653fed5f5d40d1dd0873a07b82e673c63f30f6d7c895ec6eec7fb1e9fce1f3ecc41032c94b3fefa4fe98f66baa353939c796be30cc1668d195eaf5c8556c1a00c4dc0d6ab65919a1d72950231c8969c5b02b7f22b70cc03fceaa39a5adca0c9ba1cfd9bfbbef5d4dbe74d3596659658cc5aa1709e4d60469600324514517e90d203aa7eb44612e58870e3acec3b8c969f47f90c2142128a2a47ac3d3247c67fcb051c82f3bcfc98dc5fdf5bef407e369d02f23d690f62cc5e41aeb2298bf2c971a66744bdaeb9832650edc25d09fbd1314a5d84477d7e552b81b3c5731b420eab4d679bb84e765ffc5bf9b4d19df96b22342ec09d808d509fe8c4d0d40c3ab9b1d40040b4443555d9ce9aa04e216567f05ee286c811c9daa6c1dab198bce81e03d171305f1423626132210f0143a514daa926edbfce9a234b3100590196c424fffe738d0137fba0532a7b9b4dc162b9b406fa06840e49b0b9cad3ef7d71aa767b8b2fbf9780f1369d6c5b34361f403a3516ceb2fa0a89bf1821574439dcf42fb1328415e363d9a306a3f720e23eb5041199edcfa10b865a9f5a32009906512202bb4ed532616b956d0308a0d713c6adf20dc03da7c9b29c9d409b2fbe3c7f30376bace8a3156fcb384a62b93c50561776fc6cf16ded8e968b27391af2b767ac890b57fdbb7d3a3fcdee5467badc7c0d8ce59a17129a3672c37259874b85202902b11a3261ce7a16b3f830d36a173a8dd3623db5f45c233c6456b8a2d0fdadb16356e5c37afeb7f473cb4a55f39b9ffb0e4fd96952b75edb5c7f4648250e
+576:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f
+592:4231efb1fe07daf9ef1a69137769cce0731aac9aef27cfae5b60094e8e8550cc5b83c31efee907f5aa9fc51fbffe785d7d70ed0b93e918b4d771c7b22dd72b3d78e7eedaba9689eafd5d440897a339a2fd814651166f74636518affd53d96ce9b6b2727cf3b87c1a7e5ad7cf839b244bb2561fb3955d848131efa937cc8f61fa8820496b779498ecb3a3ea1cb573d55c11bcfe1f21ca95110012be5f35ee2d224cc284062b27b5ef85abe933f8bc5f1acb40b2f42b24db4dddaaae33b67653145a2c20ec0b308cb7f2e1a4110033776cdca32115a2022b3427d73d1e3895c9b6f337c6ba7efffc63bfde50b2c43cb6741650a4ec6a742019c65581a6d45f8d62f62d3da161211e414eb6af9894383615b4df3d1ac5d5d878ba72087ae03530013b21d56130782acfe0a9605466085a8c8b8db96827ea4039a77b1d7b95aca25167d37e6d6ca8880da08588ec7c613f06d24f69c3e8bc1f0b9b8bf589b7010671a9737f57eb59e76523b9df0a94edbb85a5ad91a7bc58ac0df86e6fa68b36eac485b497a170bfdd798e1032376906d0b77dfe9335fe47ae4142dfe9da9b3d946af220715dfa7adcb0c7789e4566fb9acad513c054d859ef309cec2a196a5407902ae929aab826cdd056f70a8957e7e001a63522e579986f542297fe07226c946e832554cb4d8a0f579891abd54b7ed12247ed880574eb62f823b42cca3418fd03b9efbd6e490e92dcca2409c1e5530b9a02529fef02114f96bc0ee7739507b22e48510221e218c0bad525dec6a2da81b834134ebf0bbad4638d6e3d781db3335883256d1964bcfd37391e84d128c5c7fd
+592:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f
+608:7cff31eeaa23800d7147e8746ad4e2b2e041a68804786f51539d19c040c4529d2c8f3a9eb917505eaf9fa09c8ae6e0d8d8f5c341e4f35f0b0f9b4ad99d7996c140abe8adcb81b6c96459f62b7e24e580614f6320b9d9a2f791b7c2aa9de02f0450819411e80cd62d67ab56f207441f823e8a40bb89f41fbbe95e26359f738ec2c7e418acd5c054c18631d573aec346915979d8eda7ef287b96053e6b9ad1ea683624fd02b3ae6ecf0db342a7e5c46b4b39f5fb16a52237689977c1f2d310fa7e940b9a7c6e20beb9e7a8c0727f0c7461dcb6fee73b4444822776345d7db060c7ff761e2246250b2d7a48e4ebd1f084fae6906c3120f59b740ac6bfda70ac6e1168d4572ca2912f6891d33a128e439bda816691e519bef01660a80df5d6e7108b7789950ee523b9b2ac8d998dcd276ad09c479265fc9679008174cac18ab8ba38f0ea3384f3e623daf1fa7081d042203a4777e5a245540bfb1cda88445f056d4668256e719352a4cd9d02cc3f0a3bf24153aeca33ed0df4ba73d5453a40e79a4a1ff462b6c9b3f3a129be2d27f1ee31b5675ad4d9c1a4567c57d039badc19676a6a029881c6c30616a8d32b6af83c6a3fa412a6a383af1f6cd38366c1475670dc15a9406a22e33ca2e149bb7141b8e39f1e437a13cb0ea27a9f73f7f01a02ceb8ef6a70de8a33e68c6f5495058a0b5af933bbcda9451e93f6e8877938ec67728d48fce408e803351928ea05f2d0d53ead088eaa84c2ec158ac9c036ba602399d542b687e8e0c80f7ea642b09abb61798e54c54886c88eeca627a8012254bdecd763c906e4dc7c31249830278dc4ac6a08cb22eb2aca2cc1bd54da06376e741149
+608:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f
+624:d49acd3a39ebf5002de6a7e435cddbc5df1ee700d41c4f8ae145882f005aa149edbb81506056755bc660208b79ce20927d17f8246689174e22c9e5dc225d86924de4ab1073d6f9762931ecf002c9149d05c715b05d7b56dd0c2d715aef361084073d55b126a9e34390f49cf66fa1deabe9c1191478659be5509462b2bf5c0c6490c4a97aa9343403b5056de209afe24ad277e68bfe19c11e4b99d70bd7f1f0abcdd80ec552392b4e5b385c25e9703c992a340927fe1271dcae11fc44a1060b77bbb42fe8fbe92cee73fb6231e0c66747c5dcd0e407958707745d7a969605c5308ca858641863c8546039bbf78e54178dc3445285f6c4cfa1264ec44e76946b16c7d1fb40370bb7681cc5bd08f1f325517c076b83a0fbc9dd82cc6b4a5fe145df1d206934333f04940bf403f6a0ae6bf2dacd9d240f73d20ae6aa24bf6b8ae918bdaff2615eb6fe2de197420e085ded829a2bcd194043d2c7f4da31acb04a84123ee75cdb611618667b6adcc3677f0c5203cfb9b18d6994e1a3b05b01f97471c374facd2a380c8770f1baeb09a0d9b45ab4e32ded8ae5292c307a8f83352757dbb797c8a7dbac6d2f2c54bf86055e08cc59db82c083d2a4ee16c57127d335dc07a895ceeccc8a8c268873cad5b3b3f9318e5e1b46f1e603596abed2332e79cc8d9835e0d67b9bc9c3192671a812bb80d3d09a95110dd4191bbf76c0eb6665326c753dfa9047dedfb91bf6258e575c0305a46b8f27847f74020fd5cb6306b32f526286d2f69d3c1f7c77071ce622b809ff9706eec156ac3c6b31dc3fc112c6fbfee7e40a86a1bb634dd2f62cf3e7b9885fe6a24db8204e1424bcb996f53ca5a5fb823263e564cc08d0194ef39500c81568
+624:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f
+640:34aa7620dd642155a71ef5f64dbb6e226780c86774d9892d7cfc2f11876d05a4e51cf71d01479119ee35ba690debba287a0a8a2a5f984eacf6623db41cc5f8f8028cabbb1377d010effcb8cdfad1a9f583e2b8357760ebe68e4d8727844ff55277713d27e1c98290b4d83cdf71a577de138daec9dbe03fa7637e5a42c39fce6540f921c2248c28cea6787f23fc8046fb6efd9b3a1ffc3fc335f130bc0b4cca337dcd8ba050d8d87bc8da7c0e286503526e46385c85a6c8bd36ea803f3bff5d37dc29dd39429a84c6f35e83a3192db15a3bece1fa7648002ebf8feb5a158859831f10946c94a834ebe3922a71bb424e681a18fbd7feb27cbf889443f6ad1a94a0e48ef3ce6378f123acd41abf79621663a75e5f14dacd0e590fd9cb9f50daff9f9f109959474c9841d9fbfc538947dc98221df050732084f672daf8ae517fc9b59617c5667c946f3837a21a1c60707c8f086d27e856df624bd7972aa9149d2d588dcf4cdb66b78b257387d28985e9e518631aa1b4c9e272eec70ee9b2b58e98983aa14461bb6a468c6976620ff76855570ac7a7894199de1240ebabc8d5dd6aa261bfe09d8bf711f2175977d241e5a32bb99f4486a7e023e5c587eb952ae908bf48125a74ed8a675e801151bef8b226d10cd1cb0981697b67fda8064385b3867232071123128619c05f64fdab86fa6903c2651674fc225855317f7bc47a0018db70dad91b08164bef0a2de82e62d6592b42d8e303aea2974ddacec20efa9cebf99ed23a93582388bb75ea7bb93d2447079b8968644747ab32b3ac10f6445d585eb3011e1dc12fa65863e616c0e44fb36a978852a10e913aba4239ce369ea1358f32130aac17be13af5ccb31e404fbb916a2ca902b6c84c2b7b369747454db4844
+640:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f
+656:f7ed0e6e0ef7d5fa1d23f895db539ad14e024902f30d899dd592a64a4a044b191f545c72734b2ecc70a1a752d7e55acb2f28503e3e9e06569faeb1bec2b6e7f4b9064aeaef41bcfa097ba3cc416505dee7e2840128cb1abef3e4106be9add513c3d22646211de6dd6fa7c7e2a40a2ac70b3724d1e5875c59ad004d82c2d3fda06d9f5dada4345d2f945f0a7c3036ba290b4dfed691688140b9af1b82274ba844a3d03b86556b67babd856e6c812a4c2521ce629596f28267e7d3cb7fe30bd1d693927b4c85fd50445a1c4753ecce75035996f38684685211e5b43ea5d32e54c5db286a70c573681d386480a499488502be1f51bf205ab3ffbc61a86765835d748e6e2a81410389ec98eeeb2bcb2c16cd9d3514e542021ed1bd9a41b3775cee0af410c6e3a29db39ab9a8913d7b72ceedee6f06bcd17178974d93a037ff303ac8a58b50787067ace9ed15d12417964230712cf154d881968ace0cec64721370864714739670441fc421185c2fa57a2a0bf9bc43a1e4cb78c0964ae06789af36cca8f7f85364c6d4be28fd7f275050b0e3b88b3a46739cb5ab2bd6d301c03dfae838b3137d085ff8bcdc593b8f790d6c3b56c8c4901ab23e5fe4f5fbe9b6cceb4beb06e8bdf1d6e8df98b6e4b3c96f2555431f1e634e8b7cd7919d489188c792b89b538e4fd8334fa28bd45bfcfa9dd9796ce0849f99b4c1c915f73ec0e0d59859f3100892f9c9f5793e5d0e908546eaaeb8bf4a8629386b1b28eb94d4b03dedff7b101a22f219a989285cd657fcfd3b5eeea8151e31ab11e38bad33bc40e519a8450b5929779aa90fb0c28ffd45df929c962faa2a342c5d6c7170af7213019e92d84758e41a4545dced705a21b6c857e4a2aa6176e21933626f363ac758b566278016e7088741cb3776ebe0530e26fda6
+656:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f
+672:c324cc370a3ac69bcd8312a091b00dea07de0b5f3d4335ef68b596926fad005df403820803a80934f87d0ae02bc5ef9c25caf162d5b0638d0ce61b79bc0e0105d3c2df29015dee30fa123be4c5ca9e4ed4f9388bab22e2b7602a7a76206a311d5bb1f609ef60b777227326efe17a648f3b6febe3c64e8160070d5b8f5f81a5820af7b69486051e65779481e7edd4a0326b72d9292bfa5c553384f66c18ac573e848e1e69d9288cb52ab7bba98cadc6be8a71f5cb6ef23baafca64e91e0b451f2fb32479653a4f54e790dd7ba625713a2d3fc8d0c54d2dada99bd4e78e819ea0dab2586fad553dc4d87e8f45c85d1efb0f9d7a8da57184a2daaaad2d174c912e79997269f5e5a1a9c10f644e2280956f4836e8feea9b39557f7a928bbc6641fc61b613afefe04d35feb60fe33d03ed772fda778fa8c6fbc568a3ce516d1d7a731bb4cd3428caaeb2fb72fbd3e320b868dffc0794a0749c7ff42699c07dbc576d6e52105ceb16478683818e6207bbd02b268c45496e7841df2bb49faca2e45aa6cc5f50e8c845fe19faf6e4d79ca84d1437529be69ab32ee97c21e0002426098b9ab6c043f3fca03379d3d047701c43127ffc5d49543435c3c21fc9bcf798dde20b764040061f89293d9f2cf793e6e2afe443b423168a8fa9bc0484bdec7949e6a4be68a7f1afe8e6256b55a49827f18054a3c09dd3bc8c7676e86b1786e04d279ee61faa805d9e574e17d8a0d366f127784cad553fd038e237f6c5e8fb2c94817bb76cf954eb5195ede1ff597690239be6e0f6ceac8107ac4b5c843e4c2edadc7754a55ec64a59c7d88122a8a353bf8b75c56ed1aecb6d3454bc352088ce570bd066afd2402e8da33d4ec1d670a06030165fbd1f25407eee55b554848d0923f77b9a263af75f83b5bf702dc733686d9cdcd977da36d321844ec1e5fbd38c3db11
+672:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9f
+688:d4f095f98c6f6d5e536668ef67014b1cfaae8410377f67505c1fbac8f1d5a9b08e117348803c9dc1a06faa05527d6c9962611aa80a027ba9ab90f4bda65f4ca70dfc0008b18229b4c7e5b8970feac4f5f0b2012f7acde2dd835dcc94175ed97ca691f66ba1e86e86db2e1b546d24b44166061327e5e872829e1693671c42fead9921bfc9a10eb16dac02ab725ed48b34c153716c897ba91e1d55d53e6954bdcb2653f49a5bdd6f25b2ba109ee0f9ccffdde38e7bb5b6bb23ee4aa062e3148ff5e11fca8a484be29849aafc41dd8d23c6d051f58a998717a96c32aef897f80f5143a8d9140965544926540f6a9f33762a97ace2a127839c193aa643d9e7277854f362e4149b39688af16767f20cb3340df8a61a1c850d1c79d5408762985341fa62f2863ff650cbf1676f6e247987e317691dc8b77647db6d26e9ddd53923508343f1404e16e2e13da4dc1bf51c9c2ad2e604d6843f2a506ab32dc893c9f6e392917d04b4b3f18e7cd0e60d170987a2a479570bdfc4a933579a19daea628e3966df59285775da8ed1ef1c60888c7f65f8ccaa21fe4196d638ff5ab9e0948b2b7d6ecbe98f38a22bf9cfac14d5a277c16b6c4b43999c092d0fcd0b6f4d4bd0b7cbe05d03ddac0e2e8cc70d8627a97e2ffe0f7d7d5e82a1a59fa190bf798531de3c130a92cfe737f3d41ae67ff9040ea86bae64f0035765577326e595d08fa90b6490a8960cf636be26f21cf15f9628554e0c55132274a7acf6cb738ad535e872e591daa602b17c64f296950b2f6978f5edb11063d5d838418e6aa960fd09f713426ac4d522fc3ebe1a440c04de7398e9d787a5209d5720e17946543a0251921d1e61cd51a1b71d83cd40a4b190ff58668a90d264576ee675110e17aadb765d4e8bdea5d6f8bb87d558ceaec33f81facfe0b2cc78b37335b91aa6cb7f4d749302df73ee9e01a936c78b2b1a8a3d2e949b48
+688:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeaf
+704:52aa88885c8189072ed6fba7972b92b32544c1ffae641cd7704987d5661338d5a86f45540abd8fa9b36df2a74ac0e7fde18a9b863e689ac6c50ec81cdea4ff74ebba9b4a5bf401479e3c7b4c444616f1b385e0b335c26b9ec89ef10fa2f5e6e7b13c7c4ef9b88bb9ba10a8715886d6b0e598dd5a2e8b5ab98f6f5a6855bda241beeb0fbf53869254a39c250395b75ee8c6cde6e911f9d110c19759ee93e90f741b4620b008c9c54cbaf10d9cd39855f6493a612e9fdaf8709552c4f36eae6831edba0bbdec5cde5193e0ca24c7afdcd66ec6d3d94ff2fb1d0a9b71da4f0d6638fa924f780b3cd6c271685d23d6018bd7e87a565ac9cfda02c5d0fda60b2c076ffae6aa94f73a58526c6b7e1c08384cb0aa660c6a8b939f7d7ac7ca57b7c18b9be7e496fa0b94771a8918a57a3fa5dc03ca5b3f47b8cd99ce97d9d01c27cd97050602238ec7fac872c1e9b280dd551ae59734ee935f4c1257e067f5de2b6f2ff532cb5f45e228a6a961d2107835874aa307d7d9e495eefc7cc1039745a478a61eff60083689828f225304bc3a22524a6ff3849ef260c84458884c9b011b5660988de0e8ef47ced9cb5ce31b684c22156ca0ec1c60c2b09d487e5672e5a7ba98a1a4c8d0390420190bf2a3d4d5191f164b248297bec98e656742770849e9abc22156a8a214c464ebcdcc0db0a6b77ad29987b6ffa23cf1281a5316c2db1e8a712ace87d6023f1252ccdda51722dbd47b758dd12c44c4c356cd005d42e1a7f1bbfa5b4b57a0fedbbdce6e0ce0fc69d92417aecb8e7d7c593a1d1e74e58273072da7e4bce4f4bd94a03f1dd87d3a7089079ae6caa80a835109d984b19aa30f3e50db4fc91ea93182418ab500a44f521f8ebf7e202388da49472e7442fa407bc6604b8c0954a40f9c543a55a436a2eac98dd454755137602021130a9e13cc5107a9f23fbf9d1d1448a60d09fbaeb7472ff3d227df70964cbbf9bb0a35780cf7917e54
+704:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebf
+720:17d8ac181eb03a99368dc6cb4a8e3b6ed3b8ebfa2ac6e0f988243b96066031261827c3964295c33a20e45ec4529509e8dfb754c69e5988e7b67a737365980184e935fc8fe51b8e5b9514e2b61283872320e75a43aaf92bb9ac44dc0774068d3be4a1497616d5867321e03ad9e440545b82a48bf5a185701f9683ce291757e398e9f4dec98182493d977dbf57529c88e6c88ba9c92cd6c5af668d9d37c99d85cd11e58dcd6b159dcd1c699c302df95fc9e60b651bed0e571ee6db8e711d0bc7c69e52706be5a181fe213b28c70d2ec92d45056e29ff2314367c1695737e73e75b7be408cb3287cdca8b592f83fb03870ea88343331c3b02f0d91552d673d41c2957be143bd9dae64eed6c71ac8d4a8f627112720b1c5b95c2555bcc4fe8727fdb650f3db80a9c18bb8fdf885efa2cfeb4b56a1f1e78bc670c44fbcf49f84daaa1b9b1c943de2068364674b51a389dced863c8b4950bbf1e706b9d5132319697da0f5714e0380d8d7411e650df78f2e875c2178105f86dd0b7ff49f98bc61115e6231f01954c3c73957d8f26469b9b12232aeec1a592fb1fee638e02c1ac8c795a986734e896e79ebb510d9956e6fdc2421dd304c7fa11db82dc05f053d7fb0b9b77c368379245c2ebc3ff9573548985eead364f65d7737c84444b020b6875b0c845caf9e521500143f732cf13dd493a7fcad33299cec6ef50a088a1ba6aa42b9fa1bcbae6068debf5a0751785ff646bf79454242f784b70b6b36f8c7fa12469faea65dcf2fb8ab7548893c725c139514c0a317dcc6aa76241cb76230e9daeba2853d3aeebd02901038c53c08769abf5d3738750c6f2854071713ea513838d4efdea23f13ce194ab3e3adcb5e66504714ca084198c4fac1ed59e0e112030142aae46f89772a2440555990d659bac5c05c4bd6f7be52de389cb581f7a381759749e103fc184ef880bf6d170beeb5c931ac02ecfa92321013da446d89d6ab564da6d7865cda50677ce5d352ca93bdf702736
+720:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecf
+736:7d25eb22236666c1574748f0fd631c8694d573df66e16bde87491efaba83b36d389ff10fedf3a8fe4689d57826f47c5e0eb47119f8f6e61c589602762a6c3a7c3be980b9a271f721483ada30887e5dd6d75d906511b6cf422d41aa7adf1d1254fe299aa5faa1be4b95e63f235e26fe10dcb60a189ae415016c5484989a7d32f51494d9ac28c81822eb2760ea734da2320f083d3c2a708b4a68569073b11e634977b2aaa053b08c4ef1c11bf92d4cd9dac7ecd913bdc4ce70a5c9f0d559cfd98cca12c43c8102a9c89349702c173defef8222b486c2fb63e2b0ea9b1a103550cad8719883f349c9b21c135df1cb84d3f5ece4f153dbb661abaed30574c53eb7922a72737a92d4baba008bdf983a56bd58789242f4176e3c65031dc2a418b32a7ff53f4557cda34583b70710c6feec420938087728f9692c21edf00c6a8cb6487d8f51dede758835cb716b383dbe90fdd90478687b1da45905f0ce5f0cc2765c0737da9810c7ebc698bd2f00d0e905fd86bdf9bac5ac7ce4af90cf87242356fdbf3ba0cf19e82daf21d2261363e8b30187edd9b1339f8f48afc8880f71c06bd59ff7906e2847c5129ac20d2e68622b34eb29657fe949ab4953232efac5eb83efc010aada059a5073d8dad10037fd586ac93dc5417c916073765d7e1eacb3dd076f22809d06dd6b0c90bd776015a8d769ee82e9963c6153030a845131c9ce8f8642dee4fc878c7d727ab3982c8c3394482124a32ff12684991fb2114f7256eb3421273129905abc87de9b27a34009440f8d4537c8e6df11209b7289b84ace6f5d63677fda318c8f55f6535c270bc0a39b9a1d05f459db316415021cd90a476e10a342499b88181c2e5985902f761654380c59cafa90c0ca056c058daada2de18fe6860a4a5bd860bb50b348418f668266d73551d38c771266edf1466dd52989f3551f45e3075d9bbb8c95d8c8bd0f062534bca370c0ddafeb08c51781126b785a176e9410b054f66b584c4da0777970a141598adb1826d6f5038da6f25f013fbfa7
+736:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedf
+752:0c2ace6d4227b0314c8c9b39c2090541759f40f9d5d0523b25f081436b9982bd8b2fd7db50b6e6e8cf5ed828854f549c6d6f7b768372e73dbf7c834759b0f01d3a1ecfbb6d19b3ace85cb643e7d69a9af7d591608f266cb347298eb3756da5b92188c6d9e1dab31cee666b5dd06b3077a21bbd14479a35701bb5a21f80417a49cf36333b4da1a7a1871424cf6c3b90a0530c9746d75977b585d6a621d08161a3695e56b569184f8bc7b26519505422f220a4f2e20d5b5dafbe24a0811b675d0d5c85e2180ba194490f9ac758006f23886abce9e06d42b8b7519eb2c77f2a0545fd7b36ff0f15544b15ce100ac7a96ccda5b0a9d7b657f93407c86a9c58e08aa9ad13fec40601d9f7c79225ef8b8b4029f4d470d606b3e30acd463dcdb45c50a8b1dca6063d56fdbd05326a75e6a16e8b6fb41c3030b8b0e613694e8b877662a3361c95f0534599fbfc9a623fae8a119e98cb8068a911cca7c4edc105d65b5395d9ec3b75cf73fa4b371e3319f241f060b84c9760403395913abdd74bb75fbe4693232a853ace148248f218e5e0c175ba82196fd26f4c478014ec08e5bc47b599b6f42483668925d7e45eeb59026a2589d76dd2a6bdc23c292162355938f4f7440ff5eba65c946adb900f1dde05a85b0d82a84a2ae9585695cbcce85a88d99c5f4fff8e153d947b973766c9120b5d1fe2d6e3ea9fad4cd732e3aa869d0a721c188fdead76d98d37a4696bd968e23f069506c525f46362acd222e845cf4c0665e6369c4ca0822eb89d3711b070172485d8447d203f80cc82a174945c094f5e9659fc7e3069c8848efebef09dd3495b06d10a659abbb363b78a79bd8bc2de1beecee979d2b3b504a054c66a98393ab0549311337fc121f3728e6e8821be49820755ff578b3763643dd7f3b54b4ba694609017849c0bda642a49e4a85b8eed67cd9daff10c980869d8e1edf95476e79c5475110d16cad3c271b42d4809c658c2a0cbbc5394fc83dc416d255f814301b8711b91605e73b744db9edcb87fc6b14cca8ffe14d00719b00c4f8f53b4e825acd6b9
+752:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeef
+768:a96c69c3bf2a4bfe67bc553c6028bb5f42ee4178f87aee7535aada824b72716a40af3bb5bf039f6cee5e4524c424b15dccd1ae02981ab382a6070fc739d8fd5666e097ddf40b0142a9ffcf069445cf50db8c08087d5a78421f526922e7e79bc2a149e585075720c51be341d083e9dcd51aaa6aeb69fb08346e58269cd895ac0bc2fb3291f74a6d71155150b5bbcee52ada0d08fe6e4afd2d7e5bc7c4e18846edf2be939bc46815b68ced4532136bffdd890a83393f75653bd983f1ce52ab699b75d0b7c3293e398c38048e778f42aa988b51fba10b6aa379cc1abd12291eb11a910f927d13b7a74b725c27db8c9f4499f3d3b0d25f2d8738280b73ebb29790ada6e95ff7933a189e34532e3124027e9fccabf23ec6469b425c62ba4e0cd68177c555af0e49bc3d48f4b8c43328b57bdd47cc2c1a87df7764e25d49395c6f353a66b42f41e3bd1bc9f6ba84724990d1978b34d740e0bb84a8dd46edb245259cea37aa1f46cb8fe54802b65c98986fe9dc61a03aec493ecc2b263682d585cbf4162d6a9a7da7660fbe37a2e89cf1d4dac38211cf3cdc0554676e18c1a43e93e90c969da7c1e5265238d55c9cbb1563b07a77535ae14b895c5b020f3bdd7cbea272f79e5a42e23025cb25aef30a7e0cd43d01d93f6dae36c5ccc52d16e9abbbb65928e0eb97d83c184a8e181c9d8430f3d198dc024d757ebca4dd2f011863af893d4b25a434e304f6db5b5d46e193fd83404bd97216c314b9cdf59b68eb3272789472f0e0f077e98fcf53a9979fd08ae339598d57a0e59c0bfb7c6898c042634ee7e32f889eb07f5b17b568c007ba55d05cb33f554bec6f7dfdf165f49b659d3e3af859fcb3024f6610b5db6b176f250e838fe4ba8c21cc5ea2472851853702cba5ba99b17df0a47ae3fa0ecb36099c22df6782f8d45d910ebb2aa701c60af0d55da51659da3bd6054afe5413036532741aeb808932d10a4e5af32ee9b28b6c39a5c91371a58de8c4220f8c65b0458e764dea847b07be78c41610e02588f604733701255b26a5e9ca572c16f32bb92115c078bd76cf270aca1a56b283fb9a67f2f8
+768:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff
+784:21278770ac93e98b0d7a4a5a2fc7014e8cebba97b575c45dc3beb9edd7e8a07448639bc285c9e7a98014d2b40c2cd33ac6f14d18ad1ffa5d12dae454527ca8d4a832e27e0c94d6b870f77e3c11cf54bcd8a8e49a2edc6ce8e19bea61c7bb5ef4f75342d3f2dc5e694df575ca778c0246da3669553eb58c7da006e4faa9f58d530da166a051cc4bb1ca70092bc58a07fc0cf668558e28471f6f83bb2667e6b131a4ec76c291a027b7a563dcb373ae1de152c17865e254699f5a88662621cbbfae892309cc2f06eca8c2a6275c7a65277b63266b36a8eaeb31a3b76e0cac01b155eb0e7998c30f3c7cb9556cdf1496108fbc6592c2ef7a3bd57a559ce9d9f8dd30e39e223a8090919c302a6d703600ec053f505178e83af97259a5eff1b222ceacc74ba6ac3e46097bb62cdf8ced6b027c68e60f76c222a6957284912ebcbbdb74585c03e8867bea69de6bdd68566873e743eae0857448b03b191890e791529e4e2149f88130ab912bbeba27ecd75ae44d6554e33bcca80e9161b285329694dd246d0b146d8a8918ef68ba5dd49aea22adea00b4dd0167b9a4a4b5f18fa684bec7c7f628ea7832ee6fea16b20ac303fec7a8df1bb39dd8448d192c19e686f90fbc7493898a801f0f231603592caa5fc5e562b737f82b89de49ee5f2cf7ec5be61ad8b145da0f9dd2fa0e6bc6a0dc17613c48f5e1ca260d35fb9c807e244dda3372d61f0f5988b4f2cdf703fe507cd932ea0d0833481d2bca2dfdbad4ab50efd08e2e63a29eaf1e4155d6bc80f1a665c4237cf40d331ac1d52f29667c9581d5a66b7b6c629956553aed47dde70ef3492be6b4a9728f57469db1d3e830a6719533d757f69b6f400c7f6636ee699f0dc06273d70b40335792aabdf8101952f9eaccd40ded5cb911bd3e55d698b7ae4937a619dbb67c7b02fdf67a97253d0e0e3ab0a9e24bde2046ba82a69b7e1bf32bab2fbbbc2b02680e1c2b08c1099b661f5bdb2ebc58fd39e82c5d4ba199efcd73f8a1843fea9c84c083aee456aa811c9d6072aac9868d61f3bccc40c7b1a3aa470296c4ee7525ff29854484a05485c327186394dcab0a9b6fea8a00bdfc5ad667b85c66
+784:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f
+800:09a0113a78cf09a4a7e8ca519b63004d62f50d84c9570e7431e4a9dc1e7f9b2943374fc3a83961efd9b43c6967d9d3655dad2a1edc70b948c3ff10621aa60d6739da0bb75d434f46e251963be90121c802eb02b78560a0fa57eb0f8b7592caf2a91928c874573da9b859c85c3b82b93bd427a2e1a98ea8fd5337da73f456041a01f824bc3d1042f3dcf73f9c8809aedfabcc982087efa1953bc95d3b33a4627695839badb2ef5b70353e1ec2992b07089c747dd4614de1b1f273e8a22a5002b87d7dd2b92f7c9c5fa3b2c33e4e027e6bd93ca5072de8f918bd49ef3a8191030e83f104ddbdcc0e4f98783397c4e1d2c6fe009c4f2b0042e1c16dbdbb35f689dff9e793496ac33f6c96f70740a2bdb18688fd9b9b2865cbd4344c2a54ddc033a83ef3d134d5c8ee785f9697dbe28de6fa034caff78919b32af62e7cae90cb5b709e07a6ca844959fd5e015daed3d8cee560c1dc95dd5a4e1b30c03569fe3d9262078cbc48c294ac0603325bde7cbb9def6a4d828eaaf68059eaa27b50edfe83545fc7d2e008c046b912719fc7d72622fd73b0744ea4e023206f54797e7b36bee14a4f669226349d6cc2b5550f4543bbbe76e43b1746f52cec2cd735723538a34c9ab54db2edd22e6b163a4c5dbe7cea900b6f1cdb8be7ff25d3f18f2eec7929a4dd3d475d6e526c8644430106d02ffeb300d4dbb19f1f806c750f1838663ba70def27ed20f16515308ce942fa1ad2e8516f5df37751339f6a9a5835e8e848c257d25f806c5d5e0562ef2c96a541a8cda5950d107c23fbfd6947d68256fcba0098591b6b57418919c23d0ba37b2368669fe2701c4d58b629be2661b5f27d2b3de75fbd274c2d626350ee6da7861e5d033fd1905da0c1c72ddfebe92af2e6a6c7881f6a98c4b62057478d4173c6ac8d31a50ef01fed21177bea97cbf382bfd0ad1e5fb5b4a931f62dd2948c3a2b94ea5b4ff55e80187ad453c5b8c430494651f09acb764b8c44d47305ee22dc1289377481cdfd2a8664cc764b0982ac2923a485db4e8f7ad35cd08820f5bf854dc5089a077aa92a2f175c3f1771b14102c52bb2720619ffa98ebd94ff15ed62b8d24f9e02dd8b8f454e0d8c74f133df512cdbbae7
+800:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f
+816:3563439e39e10a74a84b204c7e3aa88695514c2c2b4575058999b0b2acf7221ebc0efafca23fee6dfec9640a6711d1c5fc903c99df596f43c8ddb919116c3a301a8f526d87b94b41c674093527db68aeb63d1705015d4c5f14099e258791ceea5bbd1369ae632cfa42f5c6d85520a5b8e3bf9691ac41bbb7569d44ab7af84eff60f633fc2be1601778ddb4f8481f940ddd8432d1aa898d2841aeea92dd4ae3b83a2e736454a8e779ee7b27778fc80b35a2c23d87e4b9e3db21cd549fb46fd8d37a883d4d210cc4336dd2aba0501db3c7ec53c5fce208b67b236ce3a446c036872ffe4251d455a444c00c62672b100de3e40118115b82ad2c516c30e49ebf2c3e8b16e1ed575e1c6c200c95a1482d89f769f14a2ad11877cadb3cd8d8ac0e26de638295a4d19d900d0ec6f24d97035e61dc8f4a5026269e205ba1b3bde1c431d56de4dfe0dcb979018ebb0e075fc712bf0114e3788a7cdc7ba93ade53a0e08dee265ae8ed1d6345cc2d5fa931c53e14dfcf3bc61c4803b3e86b702cda53efe0f6f0c9c2e1dc6e754736a276dabd46217b98ba1063a7b041d8d2685d9b36fdb441d3a23c60af648ad504e8c00301eda5b65696cde206d549fcd9822745aab3079d116905652052993e28b89e01a53db7ad3ab4756b33a024930a2b8e4fd39dfff919e8a3ff69d1f09453e0e9662b9a86e9956b65cc1e0ad33ebfddf19d13cc9e2aaf8e6d2c416975ab56f6b2e38c3bc00b31643e9062dd18a39888ebacc284ae73b6b9aac6e6b41e4fc4aa2f0a3c8a5c89e40278ec0649187e8a27b6240f8b68b67c84dc085cbdeaaa0e98b18c97785e8924d6b15899496c1079368dfce78b4e1321cb5b223ebf963231dda79a9c3b2c6f4c84c8b8f6420f474eeac754eaddd8c2b403b5ec2ba9bf133da6319e2a9a33813b94db2d4dadce0c2843a32ea06f75fa9e73752c179d8014def50b102e2018f3e46d00373660a2beb7abbc1c73d352d8e163a0f6cfdbbbeb82634bea3992efc2bc402a8383df91f7fb2ff0b7e5b87ba90ae76f920c7028cbd77fbfbcb6feb1cbb8656e0271223034edcc711a37a5e3d0ea3fb4383a5c2654bac15ce4fd97caa0552673a7b7409ed209ea47e13995467573dd8da2245a5d53223cbf3a1645a0de
+816:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f
+832:5d06971e1b3999c61b8c2ad2f6c69cdc1c07f5dc736daa78838c68127564bc8925ba600e892c04045667448c9be6101dbcc99b28d8fd809d31c2c0f2a0ce9ee430754588703eb7ed65dfd24f316710267885dd6cbace7d6636d3ac7e4d654b7fba954f2b4dc5164f21e6ccc3cffb9f430e3b673a7c64088adc8e841ee3d1d83b475808992588660e8756f438065f9a93b3de2e3ee0a5229df17c830d4c1a1e3d72e829eb8d77fca6b4cabdf16d0dd00862a08d899062b9e201b38dc0f755f08658a85ad83cd5dcfb289cd2ed3e2c5e4f2fc1097d5748e6e5be88df37f58696d69673408b21b8ee1fabbc63332053c206e54209aeff02bf2c7aa39634791c5d44b9ef2fe117dc9835dd0fef1e18dddfb03ba8f1819983fc7bbd9176e663bfe291c0b655b64d6d520901806a44c670e16bdb551bde314212ea306f440cc3c1ae5fe18dff4d58c595fbcf2abee582344f334eaf7c0d06faa39c6ff9219677675c857254644060f3117cdc9e9574c4af13d2b91103f92fe8aa66874680be0e31f52f7df722523068e5120c6061b50a84599c29fa33403c1853e393b7f971cd94633b9808e9b2b487d2f818dab80399d74dc40d6a5a9f9f0ae86e6b3a404010755b6d91b283bf96eddaac4f6cd918d37e13813b1b9d5fc56d9f6c6b704e845e443f2c7ff15197bf3ad8780a53a45dfd434cec61d6fdb148d3001f6d4d1da11b2440cda7cfc4ecb8a4dda37647b638eed69d15292d4af489bc7207fc562627a2bc47f30a1723a19b956a6747bbe5fef13fb83980730599adf1c8c79f3eb8f8bd16f8872e3d011d24967d5b4df53058bf6d850ea352823cad19a0b1e60c0c2430b899530a593d02721b1015cd334356291ac48bb34b840c8eb2eaa8490e31f0fbb40c405cad0a4a7abb1969a4781d45b39ddf470719909cf853ce0854e4ea742bee2434c49c82cbec4f4ffd6d417751acf04c7aa3cf806a33dbfdbd4b622945eb65eaa698e2ed6e648e068bb6ee917d72f7e1f0c50a96b9f139925ecacf07d5823772f79ef5a0bbe3ea5030b48a6d45a96cce9112ca45632c58629dc7765402d180b7ad3b88e72e59398e0256ed406b5ae58fb91d7263064b78667e37f1bae38d4565d90005d29c2dda4d8421f46671a83e6d457f4843b1c3a40468fb92271f1b085629
+832:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f
+848:7425c506e34c1f7f41351e6a836d712e308fee8e9b07b0ea43fe7c91aff8b9d2ff367a0e7427d06ca131e396ad7d8bee4d92849deb3fbed9d3b4c69553a85b537b10f671fb5bb18e2c0b81cf3d8c42511db6f70cf8339462d19e0f17872ba0264ebf4ca34e87ab2e633e63f88f8fc69be8bed9638f5e8a33b4ff4b50408c5b640505069e862d3f43ef3ed5fc691b9e2076c378c32a3d92668d169aa44be6ad4259601528fbcea5fa5d48fba49f830f6084481b920e9b9c60bfb1d36c92f8bfba1cd03f75d77c1e20af32457d64a148bd0509fc25b9e50739183346a1e7012d9dec8e9f7f83a48a745e483889c20fc88974cb2cfea5a271a3a48155e23d2f27ff0b9cf92df0bfe67af2e0948355206f2a28b6e984a211d6e2d9d4b4dc1dbecceb26cfb8d61bdd439fa7908c8377e75e3ef38caae86b49978d287463d139459da625f80e5f90b4b210095b29ef9eb54744f9c0e1b409d3105b5583c0774af8a1a496559527b0d6181fb539a1ea5799e5e7b36264024983803fa1c22d5f9fb69ddaabe3b86b67f1a1e28ac4f54bce5095c62c34cf44eb9b4c7dace34efbf79bc064fae5cac01a3f2ff0f175aa44b0207b29e4404f058b633f994d6fa2d87302b0454deed9305b9c6a5dca4413deed61b3d0c13c23b69c291a5197842dce0b787361440b9b8f687284cc923fd3c50c1be290927386b757f9aaeb318a878296c95a243affecf5387b6d2bcf7f68f407dcb2b775262acc0460e516d84f3a46fac4f3a2b6f413d57a9e865a01d9cfb1395742d05cd9932169de4ca1d242e6a1cf5c6b230031ceb0a1bfc09fd3520528f11109bed15ff9fb011b13d956b34c06e7ce5f28693f8a4ab93df6f11e6945b56d32bea6ab4754be8c951abf74833c91e362b50efd26a0787b09c5ccd9386d79c7c2c6eb2da20e873108c16a7658f8b765fcdb6480071a0b8624fb0ca5ee081bc2407586aa6bf5b285da6c10070a068e1daed4502fade3ee5aef733fff590d906cb0aee09061fc8033dfbb6f8e52d98223320c17ae6ac86e1ebfac3beb758b80d0818a02d335544c372f70fb7a602668ab163ec0b9ec5d00cf637ed1aa4e6d8e76668d7ca75a418a71f57c90679af483758cbf5940272a901eaf1ca9aa7335c6ccc1399c8d7f829eb7bc9011c9bc71920d5d80efbea91a2f8d94b3389478a81293e7193b
+848:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f
+864:764b92fd61e99249b6fb085b02c3b204dca2858aac1b419d9ae16dc7e927aa5ba4971a1a4ebbc54236a86f4372043162ddc4b9c35f4ee43a1cba3f090470e80f5dd1aaad578c518da3fa5fec78d464e74b2acde84e5641b1074868356cf1afed14271eaf705ebdb94234e4c9b00b4f88fcb409b2066ec82f954def23a153b95231d03bb4a1c8fde19187b997555026e19542427f757fd7283716bc0e8d0a4e78c8861e7f49733e89d28179508bb5bf1d03d8ccec34225fe5bf26803456f5210b4a009570d5683a83c0f8ff480b4a4f454edcc2cce8abc112fda27595eba8f3a101597dd2c2d53b073816aff654c35de769b6396429bb9a1b4395d08229968e57666832356f43d61b9132d752e9839659d286dd75667eb320e90b0e6352e0834fb7b18c658ca5472ac0909e018f7f4953affd3529154ad883d2e91d56c41ef85ab7a49a49aac116d0051d8e0f4e091ad6f5ac4273e5e56d8dcb3ee0e6e759eb2a7f54d71f20b7d0250056c6eb02b8a05d812f449cf47ed191196156b2e061098205a9eab3fe510c3691b439835dbb62705553f0edd6fe643fb54a273ab3b7bcb37b9a46a6d5b508f0a42679cf11ed4057c87928018d72222b14a38a1d1e1744eb79ba7d7271403b1fe3ee39d76d94665a313f5932795cf66fa08a5b0e61cd6b32648c628ec0ef0079ca74cb84ba96627e349892636f0783976d16e1aeaa21bd20b8b0c642fc73caa1e5d92fa1b412f94ed3e08e21755d608f5e62e38726785daf73306c082a5ac13690a82465babdf8f154f0096736780136856c86c5c63d95172dbac86476275387658e28f612acbf0ac9d44dbb015d339cc05517f5a0c0bc7c7e7748b91df87b6f8d48b8a8921a7d8737da324767390846b70ef4f5aa81a1df8e16c1effbfd8610fd5f815ae42aae521181b716f42a24e601ebb9b95358a77a80ed2e7da8b54ab9359f9f15c9628eec00b38cc2134a671f11ae7bc96da59da73ef278338716dd85a67bbb507b0600f26186dec8c6ab4e5a68b31c0d0501c69a4964644dc0e4f611b603b4accc295c7be7d6372871a5bcc5be78e6f53689c50a20f0cc1b4cade5c3c3f465337fe7ca320eab9f2e6b4fb81897f2fbdd79f2af5641c41f8efb1c6bd7829c2959946a7671ad4e62916378ee220c9356d54205d88d0f32f128bb80824f2f88506c590eb4faf8fcc9cf28afbd391ecce6bc538a5b66
+864:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f
+880:29c2f3b2c6bdd1209c76fb6b483a0fea5b269ddce36ca90008cf2cc52cc1e3b382f3fe445523997c1318f50014ce000de365dbaab930c4a8ad0743ba4f8c9fb4540c5ba1296cff579a64b964efd3f62e481944a5c475af35c51394383c80fd5cf37eb969e97f53afcdb4a2914473523a61e8239fd8e441cbb028c23b9a837fd05824972fd9e2cf92876d2dc93641e3500f52be33ca5f646c8013c04a256a71bbb4ca3e4c8ffba6113e34ff2423ee5c623902b47f2a1d8f51bf5f0b33d3c8d948859c9a0787101e126dc8e5e2b5bab6f125605f7b1a3ed85e1484bb6380bb01b44d3b18db78d904fb9f239222926893314d85591c5970f2c287dc78827c3895385c306a6dfe05000f7f01bcabc0e7ea14edf019f20c01f3732e4bebef395834d069582f685157f93e7924fcb0fa4898662fd67144f5b5bd07f8ae60d820a4305151a29e9306762914b579a52ea1b8d6b06e50e039a6b2148dd063c3781db0ce2c0e46f054f41329b57c07e5f571356a29587905be947cea7cb38a1a190a2cdf443514e09fb429a5e8c56a8774ec2344edfebc4aa4088725e7083b9d0908f5b0fbb71876dfd8fa69a0c1ea5cac706c6063c7ec9a2ce986e8ebe5f3cfab9a7bc636666b627d5338d48bae45016c6c98748f852554fff47b0b46f4d2951df9422f839ada5b10aa5c471f359ae1e462a839bad79af26322893533ba119fe5fad16d2cabbbc07210d2cb6eab815a4a74e8aa60332da45a8eeb37916365cf4435aa5b5df3686b299c846bd33412b7f8535e470074a9440702d9f98bf9dfcbaec7c356d8c61077235dfdb66e3493724e93be78c5c114c9e7996733f1c6c618d960b779263c1473b7c0eb6831bdbccccae88a287ab9096f5003a28f9d9026366554177954ab34ac940e33d14e2c61c74628fd617dbb4bd037c5763edfc5243f1c7cd98bed9718e8560c1ede47c5b3201fc47a2ed5507697633fe34bfcb9e40827989378a85f3e4c476f2b1c210cd0940703637ab728614e98f603a46cf5e830ac644c848a5e233349c5d5178c67f51261d1d7ca4aa36e293ef771b61bb81303b4546f1d6c7b84d9e1d47121990c3a7b819d53195b7ece7bc6bb517948cc44778200a7a53b083b1de133e8fbf1e51da9cf49cfbd04773654149bdbd679ed72acab26f301d895b1bd8c045fec96768ba49021fe380ec68ad1d143f26b8d2e873fc8295bba799c953d8b9e0857df2fea790f0d753432
+880:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f
+896:b3807844dbb30365e6f40f56e7b1f075d50762f12c64d7a7afdaa7da9b9eb80e90bd263a5977f9ce2fc761627fe447780f59fd6f452c0688f5ace451c9d583111523558b007e17db611961a6956e7d778c74384f427eb54ac2321041e1baa70119c81978a751392b4f49704f14c9fdd7f423b7c0c9b6f8e89c25999d7ef008f5397968e26a769bc172b50974f6988d6d92cf783634c79cf804d59c8e9225a17e7c6fe42179f52239ccb1b865c8d4ed5ec8bd7bd63f8cc1a05d6d652f26841937f794b2c0c8c4903e0b8935b1868363798da983541807debf9996bb6cd5f61974e06953c3b72ec70c6b5c69181e2745033b3d7aabf40d84845aa6a33bdedcd6383f7a19506e65ca18a38777768b1e229a13da5c054a585d1ed83d7a7839b780db663b634132d90fd1c3941f095282c760b21889438acb47ae02b9c2f3058f13186b16cf9c374545c804807ce2ddf590e038633619b50bf2b78a55f6c08483563d267ae84924f8b1b6a94572e782c4f86605446d0650556ec5ffcdcb92b33a9c983b2e4360f9887db8312ff2eface3fd92a2b8bf034bc720ec832252a5eb9d81732ca31a926955ba01e2f28699913a4961a26aceee382e3ca742f1b9fe3f53f71ff12f3bf12d9ee7e0f0de6ee089568da0511562813edaef60f429beb76626814d40854dc91fdf6c27831407113074c1661feed01c7a222c2c468c6f4207f625d0a09e5a4ad07f12388cfce72c4b05ba1d6c07c3c60c7c744509777b7e6feb085a33bad2df5538b4683976d3208be57c217eb5de4a5b5844e4ee877381ebf08f975b47ed1d17ba2c541146802658a14641376c13459764e018d7e6320f52c6cd2c7804d78d1b74e860e134b36628b423bc0ab8e45b7db1cd1f4609ab93878c05ea070cf2d5998cdbb8dbd87f1226b24029b53471f68439601e04b658f4269ffe58b070251b2864298adfc6be0a3df6d1c94ad25ac27aefa0cedd1473e9a3808877e1fa65f6411f82c67f42c94c655f3e2e9215ccb082d171feccc6ea0688d29051d6a80ebd36382131933d5d9f9538c35a489446fc8bb2748dfaf232d51bd4986c3dd5df2427696fde8761c695c12d0d291099e38c7abf0cf2e25fd9523f8dd0ef226d23cf69f23db15e46bbc30cc652ab7140f3ed4caf39d26df35d6628cd39bfd4493d535533a61bfe210dc929e8a6f50db5f0222355ed2ba3f6e945ec86c740648bcef4c9576c327f9cb3ca52612c5b72d8f4b152805e6cbf83593153ea0f0b
+896:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f
+912:b690948e6fbb6d5065e1f143bd8413a18f1762ae4301c9467f31bb75fc73cad9ef44a6f5d22d9813d068b555bb4949faa007568c86f63663a14df9d36c40e329435ac5baa656796e9b92ba26247a266a9d6cef4618ec1fafb730fdb5e417503a1bd061ccda2f93bcab6c8d0b1e11d9f29781c2ae361774b82b0b097be4a6c0494dfdee31d97591c22422a09418082d1c3689fd8b72828ea1730531665ca7264e75aed3b4f22845cb813bc525d877dfe616278e2041505c8bcc0b3d52bc8ef7335ef655733f263413f5493cd65d233c3f0e276881dcb13b27760b2694375502d9de447501dcbdb380e8fb3d554fa2cc771a38ef927cfd4cc3879e497e86006f4aa3b0e9ba3de6844cbdb0e63e04d83bb124ccbeb91aabb4c6df567ff4c4302a9e8ed13c5932e1c8ab03d3d0d6c6e4715a641e82d15f08de55a818b82c437ac039616499da2c3afc9c50e85e7af23801516961d2f4460ff425b10228c42594e78e05a68f238be3957d15e2ba3a227499ff30564f7c2a11ba00fe05505d0664462e301738f37b59bbb43bf44e3afc41e789211b97005898f8edb18231afc26ef98965df9e38a2306c14b82bd995184bcc1078b36cdcba476980a50252447a4f2a5925e311a2f21067b80b35031d677bf3560d5d5435c1131d0eb9863eedc06095c0ae8a4e6b13e9fefad3a9c9b35bd6adbc4db04ada77e3af55181cb17aff5aef861bd05d7ead1f42554a5bac36cd5b2b89cc10cf2b09072d13e517411235ff0a348894df3dc8d37a1828a5ff5dd31c9d04205ba0cb98a51394359e202dbdfda332185ccced81f451e7a7b79576be0bd5ab571c82c5763fca0ca66527dd9f524c85dd06f522d85de846c111ece570d1072dece75853d72d8d2b76677b53877b9586473795ce9d7b59e612023fd08a163d2897b35480b4f3e2d4daa092daf321031878e5432197133ae6a763e336e570f6e0428ea6a2501aee160b3b9ea2e0caa101927b93edc6dcf92cc38c4688989ede312fba3ae35ccb8056eef57668dd46f2f0ed9ba2d35ad450caa945baf34b8f254a3e0afbc3bdd37869f13745622f30c35f380d62990bb5c40a0dcbf6e13ec0cfb569c2581ee68e16d1cdcadf77a15d166c59b7f154aaaea4bd4287c31f2683013facb53bfc69998d5d35a58c4cd90a3aa3a049e06cc63a6d7181a2c38817be9c4721e346667557bd8d076c1224392d039ae243724dc495fe2ec3f2be06107bb91475f23bdd70b91f86c5f42711509222f29783ff066ea43cfb2933ff327ba83918
+912:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f
+928:bc5df364add8c8b84b3cd442f0cc09d2ac092ab25a81c6c57a5a13f62d9fea43c0fbf314d71e05c4eb01158aea19309efb4a5f32de5f311db43f568b6ec9d54383738ce402eb66a16129c4ab14f01ba81bba99ceae83b1e126f89125dbca89be178c23a5a1a8cdb287369321b95986aeec02c74a63fc32d7364e2e49382d440156be2428a3082c14dd482374a8ede2b3756a49725ae7e3148e8cdff15e8f2c8287d3fd7933e88b1c2439c6b8a0147d14c4bcf39a718ce38f2d42108282fe6ff236957fe5396362eb0e0dfd53e25d7b38e14de45ff451f1b56ec05e5d1a74d3aef5f2c0acd4662b5010af266fd653f3d99ea6e0a538655f1709e221392a7c450cdda6adebbd0f13fd3eb85520a7b8b5ed07926a09b763c6075fe6343d2fda48805d9345a3bff442b607e7d1417ef044d82f32e4fc2f8370fc36eee84854c63d4b4869a5b14874f03bad28b1fd9228f2eb648ae562763582dfe198d1a817ba42e2d9e7785cd54cc934045ac9985c9ae3d5b54dc61ffe99646a7f041a5a424ef909d68b1d8c042952f70533d8ae85e677d20554566dff1097d70780da80f5e6061ca27cfed9365c51a2db775be2e145fef14b2cf9bf671110be653f0781ee8d2b77f40e7d52f6928aa6e3f6dbb4462b0707afb354b2d88f1f6e0a9a687c63e2b0275e9309930956e310e37935c8b142af786bfaef99ef4786b0347c2238d8c468a77724b963b9bd04b85766bf358b44835a765ef105a4f71352f00d53aead6b98799c36dba4f73f6ffff880ffeabbb4c7bc97b61d3c8cdb757459f70a800e68980f120c1c5e9c4fd87d6b8d797bf3474744e42d5075a903d7ec24841b6d317d0e266e96b7fe40c1c65e90b65ae6476fbf4db5afa20d930ea00a5ff117766f300497b64edff10fbfcdb2a5b389c6ad4f1a4dc7338b6aab66f3b1c914b64c980572fb858eeb2364001271f7b3d9230faef634455753123766f14bcd0567905a121009dfdd6648b37a4012c5c534fa097f9e5e043a4dc18e924131cba32cbe91beeee1dbe8be95a91e3dbcb3eacdac1c6ae914cf50df6913f8dec3b17b6536df1fcf276b241f8e3ca34ee37f9182ec7beb3965f809780226c19da869a42aeb0ca0f75d6c8e61cc5241b48d1d0896db21ff6dc242604ecb003d6dfd3d04ff9b3ef1262c5c8a39ee525e642577019d69c5c2d0be5872b85fdab68769bc55658a553d1448918124284ee1a32961f0c6e4ef97ad1c19a5f7e75e254f837560b3c25c31c774248d1e48a5f7effcf96abf9774dcec13e732bfbe0a812ce2a4a9b4a08bf80fc0
+928:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9f
+944:62e7a2ef1ec0ee486b1de8c2d10232ebc0615252f48dc33b7700b64c262849098660a89d87747d7970a029c15fbfc980dc2f780ccf1f3c35283ecdc690412debb3466da444dcc5658b025bbc34fdee1bdd6058064b42ae92fa228f576337e2cb01bd062e5f8a353b027881e5b95aa153128a3a3092a4dcaa6395c59cadfcfc44fcb368c1809cd8f18817c8920e02f18ca7bdd9bd441f4d7a5ba3e3801ca1ab16b16742a77d459055b7fc755e74e525e8d21a1bdc6105c726d5aec9595cbc3b2ec95643739c49678e177165c15a5f7252020e48225bd5b61c0a3021e4811ee6d14a5a3cba357f429d5593a55a58e6b13cb105c9434049b1e86432926efddecfca063e1502ecf33915e00e7e4a03dddfd64ddeec5aeb18a4c6dd054495fe05e0bf83d4d8fddbaf11799fff54fdafd5562d0f0abf1f3bfd67813425b9568c05cb70bae4c1bbd888d3d5d79322127deae89003f857b66d2e623eaa7ca28e75012c669d28a438f1b47d71dc03539f273969017f033cb4037bed293e227fc3d745b26727bffdb313713ad08de751bd9135e8f2e463a1d8b8b8b2ffdb023cc5af4497b0e8dfd19ecb29684a15e5167d9bbc0bcf674a0c9bb454c6e31c81605776af4b640ff35d7a011ed5658df6b7157acd8f87fa505195b5524f3283f4c4e8bffeb7af66cdc233f1af1d9b81c63601eb5863de6d2d7ca892207c20ae6078dd347f9c1464d92f39f55b7a62caa2913bea8e8893f76e92fc1408b4f76412ff5baf04d62766282c23588eae49908c856ed4eece4ede57dca9e745cf4838fd3c7aef6a857a9d9826db5b571928ca1d614467225deb510f4aa24955a00755c64e49d3183715a34f7ab2069e6fa864e5cefcc706633d4543d448ec7a18779cda8e6116bdd4120c0a1f653161adba4c1abca388ae6f40c96d853793e5aef469ca3c57f57f19c09f2eecad6ac0bb687fbb0c71a932fdd80483b85759ba661d3a9747c5131cdfcd7c1b46ab719a0fd2f0a7c1b41fa043177d5187f1cfe9f870a36d7e71f080a286aec0a2c6771e629944551f3692fe91beb59c3fff95470dc42ad077260f0f20912c394e2e04baac2363d3e056d589d763b5963642decd3ff5e345377574e24b87405ca7179e2d6a278089cf89dfe726a3639e4820ba48cf264717343dfa7e0b82a3928fcca98f3e1129837f2bfbd732664583354e71ac115009f3e8a9499694af02edef9d25c95291f206bd931a5d43227e1d0fa1de8ce06f88fc33e70ecbe1b17c5b43a716211f6a26b1fb28a431f3c2ed6b106ada51add23e4eb690a23a91d2db355c880c441390d06a9de6022e499c
+944:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeaf
+960:b8616d0a83c9aae9f1ac8ba538c43eae3f5861843787aec8b1189d7c32e072d79fe1f08fe0291740ef058d53e52c08f41cfca7b8d8eed4404a24dab6816003828c083f57152cbcefa411d213211e828efef1669cbec96fbff2f691ae78aebb5ddccf87684cf08d1c243ea7b3c6bac1b11ebe02ff7e1c342e825670ae7b88bcf31c3850f94dc540e6bb9be4ed8fd08113799c539eb97c1342a23448cea9d81a188974d47b6bca7c37dd19b413746f7feb2e49e1f7a61a3e6516b4bd49a2b02a73c27bbcd95b262e57986905eea78a7579b0a01a98269264a5fd2f1297cff5d109c4014c07bb3a98de6ba4490dbaf81ed8c62a6942d7295815f97fac618b3533e8c3d1ffb7f047004ad18cf0278d3d0cc046f67e64914eae29589381ab9b14781c4cf801579d01c5d5472816a6826982d5a626ca4d4404a10bb882b34083b4d2a1be756ded346c2300705c27d517cd2bb607a7e2c2f1b209a3c0ae4dffff1de98f7e64848ad865354919ec5efa517cab15b5f109d2264fe98b019b01665d5e4a73e98afa189699cece78b2ec97925ce99e2a2e195858f7487a199d55eb8ff9a69b11cf958b5d522a23c0bd30e6092e191ca4ae702d21ca3fb0823c57de653a93d7942c7731ae7a530c74fcc18f064f53fa507cc13608625d723ce39bf937a969c68f20c4b8aaba3869e12dfe4fe887d7cdec7d0c6efa9bfa11a949ceea5e16c353ea4f3c834161d3cf991a73d750e32ea75cbf15674a488028c4967569534cf17f587b5cde13d0e39614c46150d48572522fbd1dc4f4e7671b40b9a9c2bffa40084791211dd9e4fda25aa547ca27d6f68569e1cee1333b6fa3ebf7937aa6765a3421a3bfafbb605f95eb5bac77df9530a6a75f87c8463ef1733167316b4339ab8e41d3fd7dd518ae7c28c043fa802924b854ad01e6b2e7166e3f1966bd352943a794b6f4752beb8122103913a0f1a88d2f3cd8a210a54a81b991b3f566b912fc03d133c4fc55537bd0c9095678f7558b400500060f01c179bb9e998361a6c4c140be88070bdad79d40984579cf663db9e5de3d29274f1897d4d576ac3b593343e6d618e0747664429e7c087ce1eeac4e5aab827e24f21ec8a1bea9c0da9c41859ad2b09e9cfbdb88f426c66bb5dcfac33aae44976b8c567fecd0ec0549612d74f1932a571649198c736a602abf02bdf48bdd1fb7677e9aba0dab07b8afa973e1bd50eb9977f6d4779c24ae085ece616dcac3a0c8d6923aed9dc256e48a08dd33369e6bb9d619a3410ca5766b6cacb1cce1fe5dd2119beca4af02889721b0e28b3ce2c14a746a84155cd66408bcdc9d62fc7999eed86d1138aa4bdb5e8639ac2492
+960:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebf
+976:fe8a924f6b473e4252e8306238646b383cb6cc6adeb6c472314b1c21b0d651e2864e875d4f5c47b9c8b74493b153f6795fd0265e9022f93ed363e9e4439e233f4298d859620eb269663a3094ef87a65b8568e8f646bb7a94a9bfb666c416486492bc14783cc1d32a6def86aacd4fb3e808785f796cdb3c67333d14dc611b043ad8d5dbd9ebad1b18f3f243bc67d4578077872de81f660d01a9a0d289d24d224ee33852ba898da68b74612f7140d3151f6d1dcc4304b1677a46f623589d3a1ccf61434dfc23d0fc2e31cb118ba4d02550b0057a261e736d8cdfac1f33373d2ee932bb6c07d3420f5c1791faab4e61ae17f857d716b93ff583883a834e6d878db98fb9f2abd0b1641a8f3904406d536c480f1c6be78083b745f1d8cb103700911a4c8d5b9b8f5a1dc5dcf5cbb021ed9f035ffba62f2bb1ea524e4fd999aa226980633853ff20b4b7094f3e8fe5913b7bd36259bb531ec1a4a41336a855cd8d8712480b380af3e66f8eae13b964fca9b1e1593ecb904cd6b8e1daff2296c268954bb6baf1211e35280c3d0115374055e0dda8a48486f45d1236c04d3e3d24f4aed948bd5467df2468929840ba0af1487e96f8883846fb02a6a20cdb3ffdd280a534c0f4d88743694b8abd71b24ad4dcb7ca7563f01971815b785b4d29c91994776b8a4fac9da0f9fc76488d8016bcb77d927125bd86f2127b85dbae52b0712358908a75f545c83ef81ce34a5f931504ab75b0d1aa12814f176ecec759e9cc8e21b2e92a3e2e6fcca56f8e0c6423e1a93e4c856316d7a6a2cb9ac4400538cecaa9ac7868ce99de9a50dc7b5bb7707c959ab0291708e83395bd142225261ea222b9ef58614f5208848dee2c97baa86ab3e390658803e0483968d6f2a067fbaeba311983066b9032f99cdbfb4d767729bf7d9148345724462fb868297e6b325f289f00bc151110f89d5ea758e9484eb26ba3eaeab7156308740ac499414b5d75d07fdec78843ba261a8c58d03609668fbf55d4ad2eed5b0ea4eca805d633541bcd6e93020003c6ad2cf360b03c71c32673cb34130f7634f8eaa459fa8bcb56f4476738b49aa9c7569672f0a7e58874e8d2b78373150faea04648c08873afd27530b04f9882f9921306fddea77a186605390f40de81efe5cdb48d6a25efbac6f6badfe7e2a7eea7d204151febdad5687c228f22ca4fed8b456cd5a7eeadb750ff29cff75016d8e5a439b735aa9586244300f6f78164b10f27cf311e46ce86e4a387ccf72e277ec6eff71ea62e783bbdf20a4f234d54c0e3d8c24d1fc3c9f27bb5c160d92cfd4b5e789a0f54335f7b16b7226877ff142e7a396f087422c41ea1424c7b89f7b05ac5f16b15ebf37ae8718b511b72
+976:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecf
+992:af755a7fd216598bcfec0d1398921f87ad8f9a4aa4418a5bfccf00bc9a710a0669ea2cb17cae99ad9a87b731236847bd642a3598c7e590e0135d0aae144d288fa1426ab6c50bbe70a27b72c793dcfddd118373e22ae8f680b0e8b10a3cda8a334a0faa389f56b7807c05d6cefa9560b0467c1ad10d29f83a5c07d6c69e8917a4aa4520cf42c7156ccf114781ee80bf2f1558fd9efdc9f9ef369b219ca8106408d24b6bbf851816e8e0c989615fb2d4c0854072ab3758ffa22c69185d5ff6920cb62fbf786b054353940081a55fd81979b73f5808a9cd29b8d3e4c75a622561375e95d50c2ffd61bc967b1295c70d8c8163c80cea6d6982f9a72db09495414a99247b24bbb64511ddaddb8fae455816d7c12880442001e8d0588180ed69a9a84e975b93659389c986653e8bbee4332b748ee40d8e1b556d05da8a3aa1348972036fb2657f29d044ca0ed4d8ea4030a1b23d0e973958806d8dc806430deabb64d5bd75dbcf2641a6d2ce92f297a8598c7aab436c1485074f244b609aca470151e8f3d54102f0d4290ba5b7722758a363c873fbc88e43afb2437f79ebd38990f72238bb865261bd434f9da58c0a54048494f0746b9690a69510361a02d934b14ff0589353828d375741236f1b45497d8afc1b479779e4f724edae20e2609764fb9613305d370f16afe452be289f595941981b451b4180c7b4b65843c2d99a75e4332f1ab83f8ef22827f94c6ecff6b3ec136033d4839e3518e1f76d734910556bccc0394bf619e209d92275862ebcc19d8be4a68ba52b6ef05db9ce497853bdb31764a351d2d6b91e0f1680b84d154e7f3404b97a0e9643188e27268e73f0740e9ac3c4461c9be061970a7b4a77db5bab38450b4fd0af274fa8c4283b2e95776c63d023991c8b02da1aff122eb9e661bcb1239d67e516500ce626e2000ef9767e75843c5e90679beee9aac3328defc89dcc5da2b7dbb76ab1dd6d84ac22f7e05d9e515b827824482c115d7180cc1b9378fe0eafbe34b545fa52b3fb9a9bdce1e41a80b2f911747f6bdb279b140cf12507fd33ef9eadcafc7ea5dc107a3ff6745a30c12d8ded824580aaa274e49495f017435979940c3a0035be77f29e099f44e1ee82b00a13729b2b90addc549d6799c388630ce7c42691b888380ccdf5cf7a701ccdc3f3422a677dc7f7891140c7fbb5093626349066a7720a4c696ec590fb74a5ca7f6b6774811af33eed78198d5b8de2371a9aa768b789cc0ca1c381cf4b70104204fba70b140a87e6093f15b02625c7b90ac215c3b318c2efc85c5e9baa06b52e426e2d3207b638f28af2814d8bc6dd29204e1d45823e6bca114acc39bae9293bb4b292bdddc457502b6dca9a7a80ba45f528a2234a166924d62b09cbbab14f
+992:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedf
+1008:425b0a3543b047574d63f3513c2fc330437067ea9e14c24487e0fed0a5e5ca8c1e92d8c5015e4d25fb6bb9e7a16b6f0fd54782f84499ea944ef01b05053c004c730c5e229523bd7e017dabb49487f4aa6d93e580d7d5d6f05316f39a2f3fbaed95b615a83b39a4106dbf127e9d1a134cd65780cd9507723e876ff82a63d96c16a50ec0412f977b038e0efae2fcc1203da3ea4feb029a5be2bfd502e58d1f753fefd49bd3c67ed0d79d99618efbafadef0b47327803ea099247f8fb17f7ac8cc7ca37a32f5d1ee27f637db36d3c171af5549f554b4b9422f8bfad644ef9dbd47fc868ce4ba9342888ebc8c69728902565f1b520528fc73dc2bcd7d516d0a4ff9eee95069f487c810efc38bda54933f41ef69b3a39f28a19afaf758a5abf173f7544dea90596ac9eaf6194f26f444ad6f0feaf9c6cf1827a35eab9e4a44f7bcfa085dafd83f5a2ff66b73f58e7415d906312749427ac5625bc70f7b58dc78f2b0153c83f2d2503d670b9da82df1ae7ff567f80464f1a7a7ffc2e69ccbd507fdce91714691582800a07694969536d86f1acaa4bf4517fcfb631f08732a9234e17154ad807d0308aca397fdb648dc49164cfaec222f6a911c4deefa790738aaa7a5c94f1668441c20bfbf7e1a72f9f45b7e62e87214194c9b4e9a4e68702f91d797076c9268dff2fb1bd84b4bfab3af92bc7fbf21610be8819bdee42cb40515676c4d82561a41d930b34790a6f744d05c599256bbc94adeca9be462ee24fce633eac239ff0d1423a51c475f4a51ca51c570293988113c64b921b7496e5a9f0013578bb206819574ee4fc80067ce33df536a8a7fb6b54b16b719c547257cfabeed00c18eb120e019c09e7d275feae4076a1957035e05f9649dd93bec3e56a9aabdaebbe9bc53af637004f35f029e75b44a40989885c7913574fbe040ba059524044f00da3f29d0f6eab71b8508c5693a8401fd0bd0d4312d018b9b26cd2633ee477585affb5a2be73f156285bd93905a227f6794138e18ecc0fedc9814ba806c0bb2087653e02295aa13807908d968d6966c7ec21c936c877b8ba6a76f2dc367dd1b538c0045d211ea81d286a8afa147eabea42802fe01891012a1766551abcdbffdab8191b630c6a98ba91cd9dee647091838cf31454fa7c877418fb10b19ef905408c47ba1115394fbd5af5ce362b1f888124043a5fd3fc78a041fd7240396d61d2fe3fceea37488065b23d9b7745cc46b1769aad936ded16a4fb73b982d24959ea0ec38f6d0673b1e4272f0da01512cca7d2e14bf2481c5fcb37cbae35a95fa417b18b1173413a0d6ca1e548bcdc09b070656b98b0d6a05fac98c986ccad9c6bbd17881412adcef7d041550c753f26320a6e296ac0059ba1b91015bce4a73a7749a3dc02efab9668503d20f492d78be481
+1008:000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeeff0f1f2f3f4f5f6f7f8f9fafbfcfdfeff000102030405060708090a0b0c0d0e0f101112131415161718191a1b1c1d1e1f202122232425262728292a2b2c2d2e2f303132333435363738393a3b3c3d3e3f404142434445464748494a4b4c4d4e4f505152535455565758595a5b5c5d5e5f606162636465666768696a6b6c6d6e6f707172737475767778797a7b7c7d7e7f808182838485868788898a8b8c8d8e8f909192939495969798999a9b9c9d9e9fa0a1a2a3a4a5a6a7a8a9aaabacadaeafb0b1b2b3b4b5b6b7b8b9babbbcbdbebfc0c1c2c3c4c5c6c7c8c9cacbcccdcecfd0d1d2d3d4d5d6d7d8d9dadbdcdddedfe0e1e2e3e4e5e6e7e8e9eaebecedeeef

libtomcrypt/notes/ocb_tv.txt

@@ -0,0 +1,461 @@
+OCB Test Vectors.  Uses the 00010203...NN-1 pattern for nonce/plaintext/key.  The outputs
+are of the form ciphertext,tag for a given NN.  The key for step N>1 is the tag of the previous
+step repeated sufficiently.  The nonce is fixed throughout.
+
+OCB-aes (16 byte key)
+  0: , 04ADA45E947BC5B6E00F4C8B8053902D
+  1: 07, 987354C062CD6251CAA6D93280EFE9BE
+  2: 1CB7, B9F1620EA8374E1C2D05110878D93069
+  3: B98C59, 3793FB737C2DFB29E73DD1AD8B8F71C7
+  4: 8978F240, 5E25316ED13D3300F2EC12D718A0BA8E
+  5: CB4D261594, EDA252A1A5C7D0A4AB4620F771446DD3
+  6: 30D6B6688D59, 684037DE07832C6FC38CA42BDF2A7D53
+  7: D0583F9741BFA4, 3DF53DFF73431C0245982F4EEEAD432F
+  8: EE3B9596CBEFF520, D283D1B9D990739EA05F4BAE2E96BE4E
+  9: 6570FC25E6103AC125, 90D3F1FA6595B775749FAE7B00A8E5B1
+ 10: F56750C98C370DFDC4A0, 19389A6875FAB432B72D64BCDD6BD26C
+ 11: 3344AE6D9528603CC1E4E1, 87AB6FBC7F919125A7DB0D17D19056B8
+ 12: F3D9D816A727D3E67330C779, 07AC0F3841DFCFEC58A5AAC22270538C
+ 13: 976651E63ABC3B276799BC1FE4, EE603A8C66099AD6FF8667B3F34ABF29
+ 14: A48E3ABC31336C6B717A96170A9B, A9D1B973D84D3125F5F9D7923BA0A8FF
+ 15: F60E9B2A911FAFB0080FAA3ECDEE42, 4902F8AEB7685F7B255ECC45B5B7D3D4
+ 16: 0855DE488940144AF18C65A9966DDB66, A66B3E7A75D394273AC196FFD062F9DD
+ 17: 172DC1740F75AB2A27B2B80895961A69AB, D6986BB95F7E4137430CAC67F773623B
+ 18: A414234DCCC61B65A79B7C618A6B91ACA410, 6CE32E55E158BC3E51E94116A615F3A2
+ 19: 16A1B16BC0F63D63179901F1CBC772D612C102, 54007EF9822E0E4A4F953838577C76FA
+ 20: 539788EBF85C15B3A638017B4054D71315BFF25F, 9B2511322E16CECD53E3241F3D51EB97
+ 21: 7E74595A3DCFE1EA2C91B67738765463D50A22924A, AC9C9B526251C16F112E769F9FBE74E4
+ 22: A2B61792102B2E44F1DC0E48B40472CE883730504FEB, 76452A49C2524404C8A4B098D6390F98
+ 23: F58174BC06A022AB7D81991E9346F5E4B0AEC535D93473, 47F96374BC094BB2C1A5D1D291806912
+ 24: A3A7713895D178A85D9092EA6138323DC2FF9090D7F01AC5, 3814208FA7009A2934F9A172D029667D
+ 25: 385525DAF9949DCDEB22F7518AF96438E40F7D94933706A9F2, 1249F3DF50084A6D1A76AA350FD85B0B
+ 26: 6838E207D98A5BF8D8E41454CF51663D8F8B76FD26092D45D1D9, 301723D0F49BF8CF37828340B894689C
+ 27: 736413C025A549CB2550E93139DFD5DC3CE241C296C9FE641FF520, BE07259963F251743A85DF51EB1B47FB
+ 28: 7F2CD26367A885BD9E2B515D4E871272AC1BEA1C650B530E5616B2D3, EEB37E8451597E5A53CB49072EDA9346
+ 29: 68F23DCDEF223B60B46E3D724A93BEEF8B110D4394C990AC3D0E34E1B6, 9A60344982F852EFE02CBE9CBBAB60F1
+ 30: 66C5DE3EB27139983D48BED81D0E5FCE6BA1AB402C357062FE989D31C69C, BAFA0A7997A529039F0CE8528E670415
+ 31: D3B9009C1A930EE288C61B0B15C7E92CB73484C345594DC5A3F377147981DB, 1EDAACF7F1F3AC7EA613F94DA4DEF930
+ 32: F7818DF15FE6FBC42A28FDE1D55A2C07EC8D82AA0E7A680DBD3CF26C13448F9B, 67FEB344108008A88067E92B210766D5
+
+OCB-blowfish (8 byte key)
+  0: , 07B7752047F9E0AE
+  1: CE, 7D69017C42B06204
+  2: 1D6F, 4DFD4BD58439062F
+  3: 30A011, DB49D988798F8842
+  4: B71C8951, AA3261584B0C20FD
+  5: 06F89957DA, 88BFA80D36427F64
+  6: 45BC4CE5FABD, 4CAF71136ED166A7
+  7: A7405F124D0296, 5D8993CE64FFF0E7
+  8: ECABEFD9E6574E4D, B69349673CF86E41
+  9: F7D26A7E82A34ACC71, AFFDEE843ABEA68A
+ 10: E225C5F0FA1D649F81A3, 03AC1D5DF1323EF8
+ 11: 58722FBFB86C2697061217, CE731D80E6355710
+ 12: E577EB8FA70225C5A18D31DC, 2F08B140F0D3A255
+ 13: 92154A94CD7D42EBADB6CFEE14, DC949170E84D3CA2
+ 14: 5A3C08744FD85CA262D51AC6CD25, E83CE45547403BAD
+ 15: 8B2E4980ABA10A20573A402D89AD12, E3D978611DD831D0
+ 16: 3EDC4A0FA95BD8F944BCE4F252B6470C, 87B54BBEA86A5B5C
+
+OCB-xtea (16 byte key)
+  0: , 56722ECFE6ED1300
+  1: CA, DF53479333DB86AA
+  2: 9529, D0B5A859106FCC9B
+  3: DDBAB2, 3B31FFDA57CF51C8
+  4: 22EB7DD4, 2BB34D04FFF810CB
+  5: 108693761A, 7AFF6F52574A019A
+  6: 391FB7C61E76, 616C5E66297F2CCE
+  7: 3E22E4A4A0BD13, E84C385ABE25C8D8
+  8: 94FA11D5243EE34F, 8F017DE96049D0F9
+  9: DADB6B5D27049240A7, CA69E14047C6BBA7
+ 10: F79C8EA83C69DE914DAC, 1EF042DA68106C64
+ 11: C5B6E04AB8B9491E6A99F8, 143515779A55C972
+ 12: 33F493AB7AE62DADA38C5B24, 531BF7799A778620
+ 13: 6DAA66BF02E66DF8C0B6C1CC24, 6CDF72786C5EC761
+ 14: 4940E22F083A0F3EC01B3D468928, 185EE9CD2D7521AB
+ 15: 5D100BF55708147A9537C7DB6E42A6, 78984C682124E904
+ 16: 744033532DDB372BA4AFADEA1959251E, 438EB9F6B939844C
+
+OCB-rc5 (8 byte key)
+  0: , E7462C3C0C95A73E
+  1: C5, 83CB00E780937259
+  2: 1533, 022FF70566E0BA87
+  3: 57543B, AC4EF15FC83BDF2D
+  4: 01E4474B, BD817C06AC2141E0
+  5: 4CD7E850EE, 7BB6B3BDA5373422
+  6: 489C0CD1502A, 23DD4406F87EB164
+  7: 0CBAAE08E07EFF, 92569C958B722413
+  8: 073612F283F8A6E4, 1DD978D01CE8D1DF
+  9: CDE676B1A3AC98B00E, C033F099E2620668
+ 10: AD3BC88EEEDA40A83685, 36DA44E13C0C8A4D
+ 11: CA60E8B918F73E99986021, 45634CA0E43E4B13
+ 12: 3B3CF82157ECEACAD8658EF5, E681F57616146CC7
+ 13: EBC1A7068346EC1B7EB815A7DC, 2C806D2A909CCAF1
+ 14: 97CDB3EF8276F1E7D6B6677DA2DB, 53F00B9A2E43DE08
+ 15: 44169B3EDAD9506C51A6DA055EF9C2, 5BB6DD996130896B
+ 16: 35EC29065B1FC640015B0F779E7A358A, 867EBD0E86823F09
+
+OCB-rc6 (16 byte key)
+  0: , 27B9E3F544B8F567EEBF98ED5FD55C76
+  1: 92, 219FD2D74D7E3F21AA6C2A507C0A546B
+  2: BECF, 96A656A16FB3C4579E6955D592AECAE1
+  3: 4DDE09, 7D1882879B5D6FD8C151502BD8AB220A
+  4: 0D6B4FCC, E01FBD1ECA2A6A8DC6697A06AB12BDB0
+  5: E5E19C973B, E5A86AADF2F333D5DEDCE410688CC6A4
+  6: 90BA7D2A6965, 80523A2CAB2A7BB2E90B121DE80F46A9
+  7: 6FE258148EC8D0, B7254B11276A77C5F99FE5EC91D81F57
+  8: D887080095DF8817, F3FB938068A01EF89DE0F1226C544362
+  9: D9823313289D597614, A547764EF20BD4B4B303882B64FAF2C5
+ 10: FF68942112CF01701E86, 94F3860D4438428EE296CEACB3EB67F5
+ 11: FFD390D3E0B64F64D3192F, 99D2E424C67EBACCD4E2EB9A0CDB8CDD
+ 12: 3162235748BDDECC84FC8C94, BDD400A58AF59100A731DD5B4386444E
+ 13: D2A0EC8B1F20672289F7236C56, B245CF42644BDAC5F077143AF2A57BA7
+ 14: 830929B2850E22F6C1BA2027248C, B6B522F7D6BA3CFFA92D093B383542FE
+ 15: 2A5FCCCCF43F845AA77750D3BC6B1E, 53A0A0882C7844636900509921661FCA
+ 16: 8480234796F9EAC313140CE014B0265C, 0656CA8D851B53FD5C1AAC303B264E43
+ 17: F011A67C22F16A42CEA5E493CB766964AA, 830B8158B7A96224A53FB7F3A08CD128
+ 18: F76274A730A608C2AB37497A049C3699882E, 4DC4DD4DF39D0E68D6169F9DC7F4A6D5
+ 19: 7B38DD237DE552A72E4369A81C30AFEA5E5063, 01A62CBD30153702A5B29FB2A1683899
+ 20: 58EB866F1FCB060ACC821D776AAC4AD9E87C326A, 25AFB8FC48605E1396EA8471F55C1294
+ 21: A25F2C0FAD66B3580627498EC66C994B49C5445911, 0182A951D9A3DA53675612DE8EED1FB9
+ 22: 8813977F092F07F251A1497C898967F3F98F5CB878CB, 80BC353E310880A83DD4DE4FE96AB6F0
+ 23: 52DC8B76F5A6F78D51FB7DB51048E2663563335EC876A5, DC3689AA079C04C19D83646B272F9DEC
+ 24: 965437D3FDF91784B63C73C8CD001BD9372167963DF36B89, 9FF84E2845E3C1E3E6711D1646B18F21
+ 25: ADD40F674BD56FFC8F9B4047FAAD2471F0A48F4544C894F806, 9D684F74F9734F1C497E33D96A27E00C
+ 26: 7B049B688839BC62785082397DEC7AA94B837D094AECA4B14571, EE711DF1C15B5C9E36B6E38B6F7152D2
+ 27: DD4681F9C498A3CF69A9AC876E02BD9CDC4FB1F6798F772013B62D, C5A50676EFAA2A56CBDBE55CFED3050D
+ 28: 471B5E89A1337E75E88AFBAACA1C011790F1657425483229E55C34EE, 20F73F2AC452FFEA423BE2EBDF33CFA1
+ 29: 71812C83DE34DB329C8DCD98890AFB1F7719E890DAE5CEB7AC9668CAD0, 6FAA03E10C6FB67D425C683C6D85FD76
+ 30: 4BC2DB33786CFD29B5CA5B804454169906138E90E29E7BE9197971027AF7, 75053C433EF5572A70C58EEC96F56C53
+ 31: 5E3A0AB41264AB65365458ED3B7E6A25827E50075A9E347F1622ED0723E229, C8F1ECD19AD5FC970CF0D31BF46B0F2B
+ 32: 2E48DEE4B379CD59F5367D17DC397C1BFD53B8C4CE46A8202518614076174EB6, EFCE758ECCB6BE875D16B7E03A498D31
+
+OCB-safer+ (16 byte key)
+  0: , 88618DEF98FE588E23107E9A5D89C26B
+  1: 39, 2B01B202E751F957E331ECD1CEDE3456
+  2: 13CB, 17071E5AFD5D8CE953A73F49412BE8C4
+  3: DC4428, 4B0B1881C2540FF92E7DE63C479A7750
+  4: 120382B0, 0BB11D57B5BD9D846CF31033CD4CCB92
+  5: 97F332F95B, 335E0424D0A820F60DBB968B8B5AA057
+  6: 3C7AAE72037B, C8034C2C76C1CCD7C1B3F36DD8907E1D
+  7: 8A99E4A1B89B6D, 06A8165DFADF1EA5ABD89E574422DF7F
+  8: 676587065F0342B8, 93ADE63994DF2189079234DC204BF92B
+  9: 8EC394CBC6877B245A, 1A89F0AB0B44BC708EBD9DE489E2EEB8
+ 10: 5FB5366E5CAE4DB72411, 5CA5881A5805D53ACA4904A5EEC01550
+ 11: 72A1994028F09ED6A4E45C, 0FFC0052996CE45DF4A28F7A6E9CFEA6
+ 12: 1D5EF20F52A9B72386D1A601, A697DF1179628DE1120D5E8D9F39DA6E
+ 13: 79BD002AA59D74F125AD9E32DE, 2F02CB6F70BF57BBA0DF100DE503F633
+ 14: 442C6F9016DF4C090056258756A9, 58C6FD3180B9B74459D70B5684BE3F4C
+ 15: 4FC5543D9A892B44ED04EE8B25E232, B8B858B3D3EB4B26E867E429F88A56B4
+ 16: F06E7503167C2210AB332259BAFD6AB4, 73CE2589D1DF34CA3DC2B14CC9FA6276
+ 17: BCCC260BD4823B64090FB33E6816F9C330, 81ABBDC83B2544907840FEB5AF4479EC
+ 18: 450C1105B76F960D1A5F33D7F9D37DAE20C3, C41DDC8980E88E3986D9C84857BBE1E7
+ 19: C9F36EF3A990E0554EDB59E6788F8E9BF1DBC7, 90DD543E148D9A0B79A8B376C5509E09
+ 20: 3666FEEA98A4FC434EDB7517E7FCEE2320C69BCB, 99F11B360DDB3A15C42110831CCBF21C
+ 21: 126F39C19D1E0B87F1180F6589A75712B66209E2CE, B4D268FB8EF5C048CA9A35337D57828A
+ 22: C1B6D14EE8B6D0A653BFCC295D5F94E6BCA09E181D8A, 4B4883B614D5CC412B53ED4203EA93B7
+ 23: D1F2A10F1A9DAB738C61CD0EF66FE5F6D1DA95DC671128, 3F1EFDA55EFEF1A0B24708E132BC4D25
+ 24: 9D457216C584F43DBA1DD55C54822A8B6A86D22DBFFA14D4, 53402970B128E98A5F0D62476A38F959
+ 25: 012828614B5D67C9A1EE24A1EBCD322FE9C8BE0C3F20A53714, 2BFF288D90DBDC638084F80F3F7AADF3
+ 26: B1904AECF599F6C74557475E409E75E646271DEDEC7A830260DB, BF119BDBDA27773E038B7067D2B0EECD
+ 27: ED831771C4346FC19435354AE29F7A9436D6E8D4D42CFF26207DBD, C3F029FC8AE690E84FBD0EF806B801F3
+ 28: E051B958601223FECEADF932A277BCF18C25025AE4DA791155B85035, EB75E56BE7856F1B5ED3D125C092D38A
+ 29: AB3449537C5E22125BC32D483F74C3A3DBDBD5232839A85D300F65B4FD, 851B0FBABD080F783BDE4F47ADCD6D76
+ 30: 4E68550837130652795A8C9D68530717D2B0AA5A17F3AEF92FFB502E46AC, 10E222706527A64E757EDE4B9EFC09DD
+ 31: C2D7033DA7A1857D79497EA6C64779EB969046CCEE6C74E6592FEE6E7C94C4, 2015674ECA80AC9B67AE854E18A7D56E
+ 32: 2F3F0374DDC24AE21F02D4DA74D46C71F0CD2269A68F32F7FAA0BAB64AA8E9BC, 737C8BA1677A8CE97D42FBB07530EE99
+
+OCB-twofish (16 byte key)
+  0: , 2CD8EF22E5457C7FE4016B0FB82FD204
+  1: 64, EB7BB60E4932C0E97A7A5906BD044ACF
+  2: 3A59, E3D2024241666369BB542ED096F20C71
+  3: 67C038, 7E6F1EB3F2088F6416BB675DCAC0D484
+  4: BB36BF02, BDEEEF07EBB7A50A5201C8A2D72C0036
+  5: 6F06C0E293, C63557681D84ACCFFBFEE87D82EF1D3C
+  6: 2015F94CC5AA, EF1DEAD4134D2A1A47A20F26FAA3554D
+  7: A5F8CDD07964B0, 672B74D88C8AA7567C6AC4A896E0F6D1
+  8: 5EFC9D8C3B9E7F3F, DB9160C53AD429D4C22BC0E2E6C509C5
+  9: B62CB80F75594BC54F, 20020A798FF59F0472E750C796B5CC94
+ 10: 970983B0F889760EEEF0, 360AE43CEBCC27755548D4984CEEA10C
+ 11: 75C3A8CCB30A94CD57D1F8, 79820F3B1625E216B5BC1D1A22B198F9
+ 12: 033DA41CCBFE3C6897230FCE, CFE3EDD11627270CD63916508B058B7A
+ 13: 15358032F30043A66F49D3F76A, 98B8056A7991D5EF498E7C09DAC7B25D
+ 14: 71FBA7D6C2C8DC4A0E2773766F26, 22BA0ECEF19532554335D8F1A1C7DEFC
+ 15: BD761CD92C6F9FB651B38555CDFDC7, 8E3C7E1D8C4702B85C6FCD04184739E4
+ 16: EB6D310E2B7F84C24872EC48BFAA6BD7, 12DE548D982A122716CEDF5B5D2176D9
+ 17: 8DDF6CE25A67B409D3FB42A25C3AA7A842, 3E9FA2C6C65341A8E1101C15E1BBD936
+ 18: 5563DFC29B750FBC647E427C5480B65846DB, 90881C6820901BD41F7B3C2DF529B8A9
+ 19: 93343C1E9624321C2A0A155BA8B4E66FD92BE2, 71A641DDCD49825E10880D54BEF30E91
+ 20: C256BCA0CF0ACCEEC1AA4B9372AF27D2C3C65AFC, 91D45C4DA49BBAD1809A11F4041C7D09
+ 21: 3DE69FDB72C93518A3E317F7B26C425EE3DD42DA7E, 85E37B3E8EC3AF476DB7819D739D07D5
+ 22: 676AC7885C7C8FBE9862242FCCC46C181440EE49AE59, BCDB42B53AC4FDDF9C3BF8849AB96EEC
+ 23: D71B98B88F46CC47D90BB931564CDF0157F0ABCB5E6954, 289CD5799D9E49F36D70F67726A59610
+ 24: 669C16DB9DC175200C08476832155DAA52F1F8969DF3B79A, 835B210EBBE5C9D34C2E052E1843C1F8
+ 25: 2F39346E14A34BBED0491929CD9F1FB3CEC412C25AB703372A, DC4B42E8BA676BA100B87BEE328C5229
+ 26: 1FD0F8BD0AC95E91881635EB0CF0E4FB099CBB214CE556422E2D, 898CEB3CA8FCA565CE5B01EF932FD391
+ 27: 7FBD32B3D88B7E002BA6055585B5D0E1CC648315A81CFECA363CC8, 804820B1E3813D244164F778B9C2A8C8
+ 28: 877A5F336A1D33AB94751A33E285C21666F0D8F103AC1187FC205372, AF9F0AC165EAFCEE8C2A831608F166B4
+ 29: ECCA297705B0395E71B9E4263343D486B29207DA188C2F1BA626EDBF46, A05DC873406B236E4DDBC038DC4D2627
+ 30: FF3BD8D4E1108E98FBAE2E28BC12819CD7956BC491C0B3A291FBEE739599, 68DFE58473BA2818A23095D1D6EC065C
+ 31: F175230606040ADACEBAFE4D58BBD140B2D45E8BF7E5C904510B58E4B53D3F, DAF579E1A12481D39F4DCFB7C28794B1
+ 32: 261388D491EF1CB92C261FD9B91CAD5B95440DE0A747144EB8697699F600801D, 749056EBEAF4F20CD8746AA8C8846C47
+
+OCB-safer-k64 (8 byte key)
+  0: , 0EDD2A1AB692AA7A
+  1: 3E, 306F814F3C2C109E
+  2: 0593, 063D19B734C34715
+  3: CA72C6, DF6DAAFAD91BE697
+  4: 08924AEE, 15095FA49E789483
+  5: 359908A6CD, 16CB7F0741BA4091
+  6: 97F3BD820CF4, A59DB15B67B95EE8
+  7: 0A267201AC039E, B4FFC31DBCD8284A
+  8: 9F6ACD9705C9ECC5, 6B41A938F0B1CAEB
+  9: F355D5A937DD1582C2, 9D1F932E521CB955
+ 10: ED39758CAF89E7932E48, 398EF517015F118F
+ 11: D8ACF19363A0E0ADC9321B, F98B2A30217766AA
+ 12: F8F54A8202B0F281ED610F33, 36EF7FA4A20E04B7
+ 13: 0F8677DF64B5982DB6E2299140, 4DED2DA806834C81
+ 14: 0C357A9DC321C93B3872881503B0, 7814D1C0C6A8900A
+ 15: 10B6B1A261C3015A18110AD200A7B6, 9A814D6D2BAD850C
+ 16: AA9EA9D1BA7818C0D2EBF23781A5467D, 236A24FC98826702
+
+OCB-safer-sk64 (8 byte key)
+  0: , 76F16BDCE55B3E23
+  1: 63, F34B0B471F6F8F75
+  2: 8651, D7EFE17943D35193
+  3: D45504, 263224E50E7E9E75
+  4: 57B414C3, A553D6CABCA0F285
+  5: 4976E3B303, AC5E9969F739EBD9
+  6: F10AB8EB94E0, 8301FFE68848D46D
+  7: 6E954593AC427D, C1CF93BBC0F92644
+  8: F48F44441B898C0F, 698FFAED1A95E8E4
+  9: 1DC60156D62782E3D0, 6AFF0DCC65D4C933
+ 10: 71920ADC8997CB8B3A72, 1C101C6A27CFBBBD
+ 11: 890ED7492ED914AC20391B, F66DCD6205D945C6
+ 12: 1B9FAB84A8748BAC187C7393, B450757FCAFAAD52
+ 13: B4C89E1BB280DBC265E43ACE15, AE6BB3D2E6A371FF
+ 14: 24B0C28944BDF22048E2E86644F5, 84E93E2191CEF17A
+ 15: 8F2D5694D55EE235168AAA735943AF, 514252AEF2F2A2D9
+ 16: 568B7E31FFDA726718E40397CFC8DCC6, 3C80BA7FCA9E419E
+
+OCB-safer-k128 (16 byte key)
+  0: , 4919F68F6BC44ABC
+  1: 65, C6785F7BE4DE54D3
+  2: E1B0, C197C93B63F58355
+  3: BB7247, DFE092EF8184443B
+  4: 38C2D022, 943FD999227C5596
+  5: D71E4FD0ED, 51040FE9A01EA901
+  6: C4B211EADC2A, 329429BE3366F22F
+  7: 426DEB3FC3A4BC, CF1C976F6A19CE88
+  8: A6F813C09CE84800, 98D9FF427B3BD571
+  9: 4D1A9948FD157814B4, 5A389FAEEB85B8C6
+ 10: EC3EA142C3F07F5A9EEB, 31E26E13F032A48F
+ 11: A75FB14365D1533CD3FBE7, 8EF01ACC568C0591
+ 12: 891582B5853DD546FF3EA071, E013CFFE43219C21
+ 13: 54CA848C49DCDEE076780F21F4, 298EFC7B4D6B6CFE
+ 14: EA7611C69A60F1A2EF71D6A7762D, 7D9AA51CFCEC8101
+ 15: B2D1A211BC524B965A084BB4B21710, 7B2AC0EEB5216892
+ 16: 5E81F1BFA270E804A488C9BFAB75811D, A67F627CE1E37851
+
+OCB-safer-sk128 (16 byte key)
+  0: , E523C6DBB3CA178D
+  1: 5E, B1CB7EBE5780DF98
+  2: F4D8, 8036235F2BE7A817
+  3: 4FE268, 123320394EAC24F6
+  4: A5BA02B4, B8276B5E027D45DA
+  5: 1571859CCC, 29406C5F2DF2CFC4
+  6: CA1E47447B95, 5D4FAF8FD5341791
+  7: 8710DB37022D96, E10040FEA9AEA9C2
+  8: 205990DC9A34DA3C, AE25CB49AA7A697B
+  9: 757AFCB3191DC811C3, AA8CADA8638D6118
+ 10: 6994F8C153522361BB92, 1BCEE09E928EB18B
+ 11: A86FA0CDD051BB60AF5AA8, 50A38F8E9889354D
+ 12: 8D3FD3EB7FF2269AACFD24BA, CB51CF84CEFC45F0
+ 13: 03D2A313925D9490FC5547F95F, A1FF9D72E11C420B
+ 14: D77C0F0F600FE92F14F479FA457C, 1EBE1B4B9685EDFA
+ 15: 0CAF0A8BEB864E26058C7DF8EBA0EB, 1B153DDAE807561F
+ 16: 113D12716DFE0596A2F30C875EC6BA0E, C61F5AC0245154A6
+
+OCB-rc2 (8 byte key)
+  0: , 1A073F25FF5690BE
+  1: F4, 3D3221E92E40F634
+  2: 2C76, C22C20B7231A0DB9
+  3: C647CB, 3E6348D996399629
+  4: 2021891A, 8EF76B24E9D55FDA
+  5: 1966CBCBBF, 310D24024D573E8D
+  6: 42C15AC9AAF0, 217E83C0CDE4F077
+  7: AB70F3F73DF0B6, 16AB2679D96A591B
+  8: B7C7DD845D7E76DD, F33065EA531545CA
+  9: 468CC16A37CF63EA73, 88879733F70AE3D3
+ 10: 4F769E25A7346E22A932, 26E1A92FEDEE0597
+ 11: 304A8B53B1CD24C6C27C17, 48B46E9F091B0B2E
+ 12: 4E3DF867FEFF0B8E06D5FA70, 53BB48BFB8AB4750
+ 13: 2BAB3F0A8C38A3BD3C49DBBA5A, 52303CADCBB6D312
+ 14: 3D04A29924589AAEF93A29003EE7, 120EF9364B83748F
+ 15: 486127A80E4EC599C461451CF1D79B, 2245D51599CAD629
+ 16: AF8FB3FD2DB343F1AFF564FCBEA58785, 805BF441E660B0B0
+
+OCB-des (8 byte key)
+  0: , 8A65BD7DE54082AD
+  1: A8, 3A83897CC8EC7CF6
+  2: 9256, DC66C39C7DD87D93
+  3: C145A0, 45967F3764F62F48
+  4: CD314BAB, EF38B0213259C3D4
+  5: 7074014741, 6748F4BAF06DD7BD
+  6: 9A874CAE01F1, E382DB7235624104
+  7: DFA0D86DC4CA84, 627ABB432E50455E
+  8: 685C2B2CBDD8D144, D166082E085063BA
+  9: 53515DAAC7F7B8CE1D, 6680B6C26E1B0994
+ 10: 2B3967812BF4155A8D36, AFED7F38AFEFC543
+ 11: F4E5AC3CC5913B8A7F35FB, 6181DD3C46A6C24F
+ 12: F3EC89AD4235287D53715A81, 12CC354833FE5BD8
+ 13: 66D554AC2CA85C079F051B8459, 097F31088CFBA239
+ 14: 8746061C26D72771A7586949A3E4, 6CEF3565D0E45C6B
+ 15: FB3BCC650B29F418930A467EA4FB73, 64D12723E100F08B
+ 16: DE1C27E9B3C391AF5DF403291F2C084A, 6BADE4638AE46BE2
+
+OCB-3des (24 byte key)
+  0: , 9CB7074F93CD37DD
+  1: 4D, 51541A838A154E0B
+  2: 5C77, 60E86F2F1F4C6F96
+  3: B3D2F0, 7D74A9E6A061457D
+  4: B3556075, EAF7A89A07453460
+  5: 1B61CE7230, F90D18620E1AB877
+  6: 3987FEC8D0D7, B5EF04DEE2E528F9
+  7: EBD0A7EBEEFF3B, A72CA24DD77A5DDA
+  8: 429FB38DDABF76D4, D0578484C37227C8
+  9: F8DF28BF5C4CD28B1B, 5E7C4DC8E694E3B4
+ 10: 2BF436BBE063F7E830C2, 8D919637C973C71B
+ 11: ED21656C8878319F1B7D29, 8813280C1277DF26
+ 12: F45F90980D38EDF5D0FEC926, F9619341E273A31F
+ 13: 52F2D3CACC294B141B35D73BBF, 7BBC3F1A0D38F61F
+ 14: 2E6DA0FB55962F79B8E890E8DD8D, 8060799DCAB802E4
+ 15: D6F9A6B2420174C499F9FE91178784, D3AAF969ED2F7215
+ 16: 4F1CF285B8748C4F8F4D201C06B343CA, 203A2692C077F1B5
+
+OCB-cast5 (8 byte key)
+  0: , 77E8002236021687
+  1: 52, D57DF1037B6A799D
+  2: 31C9, 7E781759B057D695
+  3: 5C8324, 56965D6CB2C97C0C
+  4: 17D99099, 7C52B5D09475F5D3
+  5: 400082C475, 3CA5CDB9B4A0FAE9
+  6: 4DF0E4000C24, DCFEE2C3384F9731
+  7: 10004C3CE32255, 0A6832F985F61658
+  8: FFA6EA76B346893C, 6202693B153254D6
+  9: E96378C94D246AB51C, 5B259FEB715B9159
+ 10: A9BED2D59A92D3D9418A, 1E7E066C098A023D
+ 11: 4EF144B7D4622BAD4DC840, 5DAB2C1D0DF56B08
+ 12: 6DBCDF56E57CE47DD3D0CF44, 2A24F2A224368F55
+ 13: 43241A0AD933635D7C8EAD47DC, 86B4B5AC22177F19
+ 14: 920D6BDBE073F3C75052420C883D, 10943DBB23BD894D
+ 15: B2C75DF024269833B039CAB19EC865, 84B7DBB425E45855
+ 16: 6A9424B6A873BB7155C01DC87E23EC52, 82C5047655952B01
+
+OCB-noekeon (16 byte key)
+  0: , 72751E743D0B7A07EFB23444F1492DDC
+  1: 61, 41BDE9478A47B2B612A23752B5A42915
+  2: F4EB, 90EF542D89F867CDFB1A0807F8AA3CC6
+  3: F5A59B, 1BED873B613096546D4C201347CC3858
+  4: F454610B, FB4035F28AA75221F599668ABBE21782
+  5: 382FC932F1, B40270E2084E8DCEB14C6603D080D7C2
+  6: 18F921441119, 47F1F889B307298150750E81E94AB360
+  7: EF01C70C9D1810, AE0439DBB3825F27CF846B43E4C3AA80
+  8: 89863EDCAD471C3A, F4E8AF73BFC4CB79AECBBB3774DAF8C2
+  9: A6F494092E066A70F6, F73D3B04752B7D913420C17E656C7F86
+ 10: 342459682E0A8D53AF4F, 61E7CF14E9878E0726C64B1E8CA08BFF
+ 11: 65E520D5A99825DE2441D1, 7A2AA740D786EB7015C61B31959E55D9
+ 12: 2F96D0BB72E37DA202410302, 1A313242527FB522289094B9AFDB5F7B
+ 13: 3E8F8A1FCEE3F866EC29128BA0, B8065DA2DABF04129E5AE28ECC11A15B
+ 14: C2C15976D3C2499ACB9454878131, 372CAD486E104098EB1AA78A2922A1BE
+ 15: 1F12CADABAEE80E448B7EDCB42F8FE, 86A38DE5363787F55B16462C684E08DC
+ 16: 3B9ABB3304E75BF5B63E7F5B5A3F3980, 1FBD6B93E457B9779E2D12D78301EFA9
+ 17: DC0CD805E43675A4317452E378AD48AC4C, 40AE4AFA4B3E580EFDB4AD0AF5BC4E4A
+ 18: E9DD52EA7264C6C7BBA39B761B6E87B65687, 4061DD65D5E7FFFE8D3D4261494D4F8C
+ 19: 80A9735CA1175072823828123413CCE772D521, D3378A12E79C49A37378DF527A460AB2
+ 20: 09AD495AFFBF7CB8841262E7E5E8952878D4391A, C25D7A98C6F260B5FBCA3B8B5F7F33C1
+ 21: 3925615707CC40C351D4A49794778545BC1F683175, 97622437A7208383A4A8D276D5551876
+ 22: 5BB0D41ECD7BD2CF0B12A933255D95A3FE35E4C896BB, 4B8AD84EEA3156765A46AC19C68B6F88
+ 23: 1EE71FE23CBFD5683AB1B391FC12B4E5952E4E6AA3D189, B0FD75996F28E071EB6C86BD7102BAA5
+ 24: 0AA3D8C98AADEEE1867B13B017DD263BD16E960DA64FD071, 5204780963A62C2F4F7B3555BFF73836
+ 25: 3A88B6F2AE321B226DA90B98E04A6A1589411BEDBE994632D5, 5638AF04EACF1EB986AC0702B4373A22
+ 26: C2731661AC634A4DC0345F040DA7AEE507A3B9D019B5958543BA, 4C67D3FE37ABEE928B3BB812E7346823
+ 27: D3E7651AA6DA035D05D599EFB806E8FD45177224593B5974758419, 5814E84258E1B9BD56A188AAE6F25138
+ 28: 17818E7102B8C123230C5D64F18BE94C3159B85C8F7B64A7D4712CDA, FAA905B587A93DCF600BA8589A985432
+ 29: BCA4335C6C29D978032C216114D39C01C6F161BF69D5A1CE55FBA8C575, BE24424A162E43A19755E2EFD274DBED
+ 30: 24C33CEE022F8A633DE9DFD009F535B52BCF64F390D2375E5BED65B70D08, 138F21D54B6B7E34628397DCDE0D33BF
+ 31: 838FE950C8165ADBBD6B61E9732F9A727CA7AE74376981382F0C531C331915, 0742E769CCBA2D1CAC7CAD4E0F012810
+ 32: 57CD778DAD477271794FBF763662D97F8A10B17D70A69FDCB974FFE67E558519, 942C7D1C200C3845748F8131DF71AE26
+
+OCB-skipjack (10 byte key)
+  0: , 90EAAB5131AEB43B
+  1: 2F, 6274B82063314006
+  2: DAF6, 6A6BCCE84FD4EF02
+  3: 5C2A88, C83D54C562A62852
+  4: B6E8FB5E, C44459EF41C8F296
+  5: 6C0888C119, 269DD7657BD0225F
+  6: 1FD9AD7ECCC3, 3CA090F46B107839
+  7: 1EDBFF8AE458A3, 440380BF9745132B
+  8: 04DBECC1F31F9F96, 2653620A4877B0E6
+  9: 908AE5648AF988A896, 00180FF33C1DD249
+ 10: 53E63E0C297C1FC7859B, 36616209504C4230
+ 11: 407BE16144187B4BEBD3A3, 4754B7DD4DB2927B
+ 12: 9961D87CFEDDF9CC22F2C806, 5947FC41E6B9CEC9
+ 13: 9F5254962E4D210ED8AC301252, 97A392BEAF9B3B04
+ 14: 379FDA76ECCFDAAC10F67FBF624C, 1D895ABD932BD5EC
+ 15: 1D5A7AD556FF3078284BB21A536DAA, 01FAE2F4936ED9D2
+ 16: 4B8B71396924880CB33EA6EC6593F969, A0F4B1BE3B9B4CCE
+
+OCB-anubis (16 byte key)
+  0: , D22ACF880B297DB0513DFAF0D2DF57D9
+  1: 59, 210A179469D6568AB9470C760415574E
+  2: AFA5, 1223F9CD160ABE2F257164C6E5533C87
+  3: 969BEC, A57EC767543CA2ADBA4F5A7423ECA78A
+  4: CF8B31F1, 13B5BF9CD87CE15CE696F3AF1B082650
+  5: 9B22DF3852, 4937FDDA0AFDDA04CCD53CCBB0A82745
+  6: E11719B2F0F8, 6847931DBF0223F5CEF66AE3F4DFCF9B
+  7: 5A85E0F6DD2266, A1A0AF45A68A681CC396615FE1E1DFB5
+  8: 7F2DFCC65ED86976, 13614A3C6E0E08611D8DF8EE5B7D788F
+  9: 1DAF10DFA3F1D53E50, 673632B6DD553BAE90E9E6CC8CDE0FA5
+ 10: AF74FD9671F9C0A9879C, B8B4DD448FE967207227B84E42126D90
+ 11: 49421CED1167A882E26297, 21C8951A1761E4BD13BC85CBD14D30BD
+ 12: BC0BC779B83F07D30CB340DA, FAABD25E14FFD8D468AD6616021F604C
+ 13: 843D7E00F94E61AE950B9AA191, 08933ED5FBDCAF72F788393CD5422D0F
+ 14: 296F15C383C511C36258F528E331, 8BFFADF5655C1864057D69A6706D1739
+ 15: E31D2E80B2DBA4FBFAF52DB0513838, C4CD36821EC631CCBF1F258EE9931288
+ 16: 87F319FE9A48E2D087EDF95563896EE5, 517960488E5A118D150A1573E76C290A
+ 17: 9632B7DC1740BBE0A7AEEFD0F535B5AE8A, 0C24D0950873621D319A928862D3A6AC
+ 18: 359431ED4B3AC537238CAC2F86126972D403, 4A0CED2F4BFA3355C17D6C5DF9FABFAA
+ 19: E15B50172EE8DA9C552D448A5A48BEEAA2F11D, 8166B2A2D3A0745D1055F9F503FD6C03
+ 20: 75842DDC0D5E3BD80225E4BFBD1298421244D7EF, BB957BB2582B67B63978BCFD7A949EDD
+ 21: 3DD69162716D5F3E096E614991CAD7ED8E01F926B8, 40A954F31F5B0A2C5DD220ACED8D2B3E
+ 22: 8A49AC14F59593D5399A10F9346E2FD36F47F64ED419, 4324D408CE7F86370495AF14FBD1A859
+ 23: 6AA8FA353BCAAB4262211D75F13D27BE173526B8BC3CFC, BA3A27D79EC8ECBC5A78CB9FD095B766
+ 24: B918192BB72CFEF980298EEE570460356A4BA1755576FEAA, EB341ECE0A070E769F498600EE4EBF77
+ 25: BEFAE0B77E42A2FD18958D9E43202E8A338562AFF8317461B0, 444C1D6BDC026A01012BB2CEEAD89C2C
+ 26: 07E86D49CFFE6FB08FDF44584033AF321447003D8AD3862C00C9, DA9355A79B224EF662DA65F19BE494A7
+ 27: 911BB223AC6F6E54082FBFEDEC300D73FCAF715CCA35949212B372, 3496160A46A21DCDB5A4C179F159D860
+ 28: ABB563FC803715F59AA35460E98470E2E94E4270455ACEBF4297641B, 899CFE1946A060DE620879B8A7464718
+ 29: 47D98E83B5849CDE19B14ABCF9EA6CA9684AB49A3AB36BD14F328D808C, 6D76CD5EFF6D4AD3B67A56DF1EB42E05
+ 30: C8BF0B71A95884FFB93D64C57E327A4754EC5A1EE26632CF8E0B6B26CBDE, 2B3BE785263B1A400E5893273AFD09AE
+ 31: 9804D668CF2D75CA58C9671F65630E33909269B9511AF9119BE88EBB35F00C, 3DDA028B1A2339CA817DC8D9371E0FF8
+ 32: F6E038A82A09BCD20BAAC7926B2296B78F9CBA9DD12C497C47EA08DBCD8CEA3A, A203FC1E68E21A52E72224891AC10EE2
+
+OCB-khazad (16 byte key)
+  0: , BDEDFF7AA0070063
+  1: 00, 67E951582D66ED93
+  2: 5FED, 09DC8AEAD70673DE
+  3: 26A7CC, CE1436CE1E37D4B0
+  4: 3D2BD063, 574C24395F31511A
+  5: 597F1AFCB1, 6FBBE820C6F26CDB
+  6: 202DAE442DF6, 58CA6E5706C9852D
+  7: 7C20EDA18E9444, AABF0DA252A1BAAD
+  8: DEC02BF76DFD5B77, A0A97446B80EACB6
+  9: 5D7A42F73843F9200E, A1DD603372D124CB
+ 10: 0D4710E454C19B68369E, CC78E9D7EAA6A39F
+ 11: 126694191BF09A29DCF40E, 76C9B84FA3E8913F
+ 12: A94EBB86BD325B4FA1942FA5, 613DE312DB1666F7
+ 13: 4F9462386469EA0EFDC1BFAFE9, 5247244FD4BBAA6F
+ 14: 4EB794DFCF3823BDC38FA5EF3B23, 0C12017B5E058398
+ 15: D870479780CC5B3B13A7A39029A56F, 003D3FCD31D497B5
+ 16: A47BF1218AC86A60F6002CE004AF5E50, B4EC27091D5DCD58
+

libtomcrypt/notes/omac_tv.txt

@@ -0,0 +1,461 @@
+OMAC Tests.  In these tests messages of N bytes long (00,01,02,...,NN-1) are OMAC'ed.  The initial key is
+of the same format (length specified per cipher).  The OMAC key in step N+1 is the OMAC output of
+step N (repeated as required to fill the array).
+
+OMAC-aes (16 byte key)
+  0: 97DD6E5A882CBD564C39AE7D1C5A31AA
+  1: F69346EEB9A76553172FC20E9DB18C63
+  2: 996B17202E2EDEBD63F414DD5E84F3AF
+  3: D00D7DA967A2873589A7496503B3DBAB
+  4: B43C24C0A82DAA12D328395C2ABD7CAE
+  5: 9B902B6663B5FEDC6F9DCE74B35B91F2
+  6: 06A9678C65D7CE225E082ECA31788335
+  7: 7D67866CDB313DF65DED113DB02D6362
+  8: 259E28CF3E578AC47A21A77BA9EA8261
+  9: 32F23C8F93EA301C6D3FE0840CA8DB4B
+ 10: C2B06388AD6F8C43D19FE4F6A8ED21AE
+ 11: FA8622485DB2F62F84FF46E532A1A141
+ 12: F312D9B2E6272578F406B66C79F30A0E
+ 13: 7A5DE06B2BFB75ADA665E96F680AC098
+ 14: C3B00380F0BD8E2F5C9DD9945E0F36EE
+ 15: DDD87974A5FB2E7A4514241E94526B5B
+ 16: AD24FC47A0FEA84C54696DE997A94F4B
+ 17: 7538713D8AA2AE3726307EFF087BBF5E
+ 18: 7619A52B4C34A98440812F5F28F8DC4F
+ 19: 7E797B8846554888622CC5E400B2FA44
+ 20: 61E8DD3E09145F5657DB4B8F7BD2D7D8
+ 21: FDAE2A3FE60DDF1871C2613A293AB6F1
+ 22: A186D6EFD10DFFD2C088480B0A784185
+ 23: 3119D337865618CDA55C06FB992427CF
+ 24: 413E3EAD7E3F169A37C49F9CA92E235E
+ 25: 37A55AF22373B9A1E2F8368B2FB992CA
+ 26: 4941F604C40EEEE1A16CFE073C12D1FE
+ 27: 3E8F4A0876BF12A2DCA87157F15DC884
+ 28: 5DFAE292D8EEB13D8FE5725E5D169742
+ 29: 59160455E0C0B35D950BA67C77F9FB05
+ 30: 5AC0D736A06A7DD146B137ADEE78EE06
+ 31: 0CA1178F28B953045EE76E2E760036CA
+ 32: 025616215F870D1EF838AD1D2AE0C649
+
+OMAC-blowfish (8 byte key)
+  0: 2CFB5DE451FFE8CC
+  1: A5AC339DB44D020C
+  2: A3CE0CF62249444D
+  3: 3076B7129CE3F6A1
+  4: 9E091A637DDF70E3
+  5: 275199AB20A5F09C
+  6: CDEDA8D16A401E62
+  7: FC980516CF5C9E30
+  8: 659D0B31D21B622B
+  9: 8306847B5E72E018
+ 10: 7AD029BBF1D2919F
+ 11: 133181425C6808C9
+ 12: FC5AC60E367F413A
+ 13: E0DF8BCCF0AD01D9
+ 14: AC5015398FA64A85
+ 15: 1F068F22AFFECEE1
+ 16: 8E6831D5370678EF
+
+OMAC-xtea (16 byte key)
+  0: 4A0B6160602E6C69
+  1: 1B797D5E14237F21
+  2: 938300C83B99D0AC
+  3: F989B99B3DE563C6
+  4: F65DEA2A6AD45D1E
+  5: 1DB329F0239E162E
+  6: C0C148C4EE8B4E1F
+  7: D82B387D5DFFE1FB
+  8: 1D027A4493898DF2
+  9: 196369F6B0AF971A
+ 10: 2A37A2655191D10A
+ 11: BD514BE32718EB4A
+ 12: B4DBC978F8EE74ED
+ 13: 8ACCAD35C3D436AE
+ 14: 73ABDC1956630C9B
+ 15: 73410D3D169373CE
+ 16: 23D797B3C7919374
+
+OMAC-rc5 (8 byte key)
+  0: E374E40562C3CB23
+  1: B46D83F69233E236
+  2: 7CB72B1D335F04B0
+  3: 94457CBC97B31328
+  4: 543D0EDFCDCD7C76
+  5: 5164EFA8412EAA5D
+  6: 13CA0717EF95F9A7
+  7: 2AA49A7AA7719700
+  8: C9E7C56125C3D90F
+  9: 2BE3E15FE58648AA
+ 10: 77D0B90372D6D0FD
+ 11: 17408F62ECD62F57
+ 12: 7864EFFA59DC059B
+ 13: 3212E76E25E5DEA8
+ 14: E2424C083CDE5A6A
+ 15: DE86FFDBDA65D138
+ 16: 85482C24D61B8950
+
+OMAC-rc6 (16 byte key)
+  0: E103BD8BA47B7C1C010E1561712E6722
+  1: E51AEECFED3AF40443B3A1C011407736
+  2: FA6506C5ABE03381B045D28D1D828966
+  3: FAC4237FFE7772E2299D3D983BB130DD
+  4: 3A7E24D41121A5D4F96FCECF0C2A4A10
+  5: AA44291E5500C1C8E1A14CB56E4F979A
+  6: 4B8FDA6DA6B3266E39111F403C31754E
+  7: 4DF5F1A1C8EBC7F56D0D12EEB63FF585
+  8: 46A6DDE419355EDE14D31045FCA1BA35
+  9: 71756D4D3DF59578B7F93FD4B5C08187
+ 10: ADA292A19F8636A03A8BC58C26D65B0D
+ 11: 703190DAF17F8D08A67A11FDF0C2A622
+ 12: D2B94CAD1AFC5CD012575964D1425BE6
+ 13: 45FD0069FCA6F72E23E4DB41AA543091
+ 14: 36F652600F5C9F226721400A7199E2BA
+ 15: E8CC6389ECF8EF1DBB90A0FD051B7570
+ 16: 8125446B975DBDA742A903340D6B96C7
+ 17: 00B55E4399EB930E592F507F896BF3DC
+ 18: 33E58F42A47C9543A851D6CA9324FEE0
+ 19: 9F28FDEA3EC7F515128F5D0C0EB684C5
+ 20: AC1DAF6C01AA28BCC0A819189FA949D7
+ 21: D0532B5F54A179444D052A4D2AD6E4F9
+ 22: 58B80A66549404C7B9F64D5AE3F798AB
+ 23: D0D6D586477F92311DDF667E0749D338
+ 24: 0DFC0FAA67FF114398CE94D0688AE146
+ 25: E163B8C00CF5CC9FA23ACACD62B53D64
+ 26: ACE9270456AF9BD388BA72E98825CFE8
+ 27: 4302EED9BAA19C7A296585E23A066A44
+ 28: B3EEABEFAB25C7478419265564715387
+ 29: 9F0630ADE9C74AB2981D63F3B69E85BF
+ 30: 1215A9446A275CCE2714F94F3C213BB7
+ 31: AF43D7F748DE0E3458DB970BAC37E98D
+ 32: BF871AC9E892CE0DCD7C8C7ADDD854C6
+
+OMAC-safer+ (16 byte key)
+  0: A2C8C7FEA5529D01C3FF4E9359EF74F4
+  1: EAB87021118FF24FE79B69ABCCB14A8F
+  2: 789566F467BAA68F4CC3C4B61901D6D4
+  3: 369F41EEAF7D628F9E0D77BE43BFC1D2
+  4: DC46A20E1F36F45006ED5B43BEC20DA6
+  5: 8F150CE34F57BBA2E6CE3431B78E4ACD
+  6: 61CD154478BE20F33B26CD8FC58091A5
+  7: 4E6DAA575CF28F1F48B256262B7D558C
+  8: D21FA4F1859571DB91E92767C5487AA2
+  9: E3D009DC7E71FBBB030B8FF0B544A2C9
+ 10: 094C236EA48ABF7DBAE5A88AA3DE07D7
+ 11: 00C401996F8224359566660AC1CEDAA1
+ 12: D580EC60F712558D875F01643D96653F
+ 13: 8482298027C7B4D5969787A1DB1B1F2F
+ 14: AB726AE3DA95CB242E63EF876A4BC446
+ 15: D668ED4919003F5E45590663FAED41DA
+ 16: E4CFFD7E0E7B176867C386001849FD6F
+ 17: 37B3C6DEFC5573879006D15F982A397C
+ 18: 0AB8847EE6A41A0E960080EF0D1BF1C5
+ 19: 2C94FCA2A685F276A65ED286AE12FD9F
+ 20: 23383032032D7B5165A31ECA156DBD23
+ 21: E1EECFB3D671DF694FFB05AE4305AD4C
+ 22: A0F6CA99B96CD1EDD04C52828C8A4D74
+ 23: 12D6B7053417AF3E407EFD6EE1CC38FE
+ 24: A566D1C39AE7A1A0A77D5A1F56C5FAAB
+ 25: 81C9FAECEAEA326140AFCD569668F669
+ 26: 6A00BF1D0DC893868378E4347CB4A1B9
+ 27: 98842956DBE7AFB1BF49C46497BD54C7
+ 28: 88EFCD5A1644B75BB0B3F5DD338849CE
+ 29: 77EC62C278C61163B1BEC595A11F047A
+ 30: 147424E817DC69413CC657E0CB292F7F
+ 31: A2946CBB910743EF62D8A3C7391B9B9B
+ 32: 00EEDA55520B8A5B88B76487E80EB6E1
+
+OMAC-twofish (16 byte key)
+  0: 0158EB365FCCFDD94EBA6BE42B6659C4
+  1: 17DA580917D147D10CB73DB6800B0E59
+  2: 3F185CC15EF3328D3E075665308C07C8
+  3: 5712A97ACC9D08FE9D2087D0CA16B0AD
+  4: 90425A8CC1C026DDD896FC2131AF654B
+  5: 30A43D4FEAE71F5396308C16DA081B4A
+  6: 6839FEF605704D49F1A379A9E9595E6F
+  7: 56A8F06DFEE543971B351B07430E2026
+  8: 36DD0E4B55C5314F9F2753D7EB6F0849
+  9: 8E319249A3CD456460F410F518F8CEDB
+ 10: 463978BE2A063C22E71DC71520723517
+ 11: 1B735E45FD3DF636E0A6104D4A2E9CB8
+ 12: 628A82213148AD9791153D5AAFBDDFDC
+ 13: 21AFDF08A36ADB6659B656C8EA0800E5
+ 14: E5C3E58803DDBE174E0D4C2B8171AEF0
+ 15: FC6981F2B4359BA05988D61822C0FA88
+ 16: 7B03498FAFB04A6542248852225F9DAE
+ 17: 9B173E91E59A940186E57BB867B8307B
+ 18: 470BF2EE614C8423AA3FDF323F1C103E
+ 19: 6E664AFDFD8306547BBEDA036D267B79
+ 20: F61AEC1144C3DD646169E16073700AC6
+ 21: AE503B139707AFA494F7F2DE933EE81A
+ 22: A0A8BDD4ED0DCAE4A8E1DCEE56368FF0
+ 23: 460B8207930DA434AE6AFECC305D9A26
+ 24: 7F03F8C7BA5365CC65F7864A42693BC8
+ 25: 31448849D6190484192F29A221700011
+ 26: BDA941019C75551D858F70FB1362EB23
+ 27: 2880CB3E62447AE8EACA76C17971BB18
+ 28: FC8D710FA3990B56357E61C2A302EB84
+ 29: 793CD15348D7DFF301C47BC6E6235E22
+ 30: 6FB0CE69A15A3B6A933324A480077D35
+ 31: C24FCA5DD4AE0DF2BFF17364D17D6743
+ 32: DC6738080478AF9AF7CA833295031E06
+
+OMAC-safer-k64 (8 byte key)
+  0: 726FE2DD40A43924
+  1: 2A138B65EB352621
+  2: 9588A1B53E29616C
+  3: C025DEFDE1A59850
+  4: 73D062F1B6D8E003
+  5: 944598A2FC8A2D76
+  6: B176C25D8CAFFC98
+  7: 14F05014DE6A090A
+  8: A7B9847B2CE22D0F
+  9: FCD71310CBAA3A62
+ 10: BFF00CE5D4A20331
+ 11: BEE12A2171333ED5
+ 12: 333FD849BEB4A64A
+ 13: D048EC7E93B90435
+ 14: F04960356689CFEF
+ 15: 9E63D9744BF1B61A
+ 16: 7C744982F32F8889
+
+OMAC-safer-sk64 (8 byte key)
+  0: E96711BA37D53743
+  1: 7DCFF26A03509FE1
+  2: 0A20EF19C8EE9BF2
+  3: FE2883748A6963CF
+  4: 557060195B820A18
+  5: 771A7931FBBE5C0F
+  6: 6BDBCE5F96CF91D8
+  7: F3B924CCE8724595
+  8: EC7191286D83C2C3
+  9: 94F55B19BB7A8AC1
+ 10: 2189F4F2B06A8CA4
+ 11: 99853DAEBCA33A46
+ 12: 66EAC37A033802D7
+ 13: 845D7AA866F8A8AD
+ 14: 33A874DFECAC22AC
+ 15: 63DD9F7A7F3683DF
+ 16: EAC277D951676C44
+
+OMAC-safer-k128 (16 byte key)
+  0: 8037B89AF193F129
+  1: FF2314E87BA6AFE1
+  2: C3243DF896B61D85
+  3: 0F61C715CE821AB8
+  4: EBFDC6A9CFD2F5A4
+  5: AB6497D7AF2C7FFF
+  6: C920CEEB7C1819C2
+  7: 3E186951B545A7E5
+  8: 5EA36A93C94AF4AC
+  9: 6A2C59FAE33709BE
+ 10: BF1BAFAF9FC39C19
+ 11: 69EB6EF046677B7C
+ 12: CDDCEE6B20453094
+ 13: A3833BD3FED6895C
+ 14: B6C05E51F01E049B
+ 15: 90A2D0EAB739D39B
+ 16: 07BF607A161D0A66
+
+OMAC-safer-sk128 (16 byte key)
+  0: 5E8B137A3946A557
+  1: 0228FA66B13F3C7E
+  2: A6F9BBAFF050DCDD
+  3: F75880F684A796CE
+  4: E0AEFB8E32040EBD
+  5: 9F65D658B86D310F
+  6: 3FA52804FB46CCAA
+  7: 2F6D12D199FCD2FB
+  8: CB56AF60AFB4D2BB
+  9: 8E6F0FF6FDD262FD
+ 10: 490245BE3CCCEDE2
+ 11: EFD319AE46C73005
+ 12: 43E00E545C848995
+ 13: 10444B41ECA15EBE
+ 14: 521775C389D5BE71
+ 15: 9B683EF8B097FEBA
+ 16: 3C5D746EED09530A
+
+OMAC-rc2 (8 byte key)
+  0: F001FE9BBC3A97B0
+  1: 8F8DC9C952897FBD
+  2: EC82EAD195AAC38C
+  3: 53DD52269B19E9A4
+  4: 9B86F64BF72A0647
+  5: 664A88A29F2898C6
+  6: AFEC3F71C1415666
+  7: 9BA1F2C1A2E765F9
+  8: 402A12120908B436
+  9: 03ECCD4C6AF44144
+ 10: E8CA3529B5D9D6FC
+ 11: 951EE10779CC585D
+ 12: B9083CA88E7E819B
+ 13: AFFB9E884DACC5B7
+ 14: E942E8BC241343D6
+ 15: 9B190489091344FB
+ 16: 9330A9E05554A15A
+
+OMAC-des (8 byte key)
+  0: C9085E99D74DF01D
+  1: FAC84F0EFBEF8630
+  2: C37C5FECE671CF16
+  3: 45B2CBEE8701A5B1
+  4: 53665E1F024EB001
+  5: 357123CEDFC9FF61
+  6: BD2CFD33FB1F832B
+  7: 1AAA9D8C9120BDBF
+  8: EB9F589AE9D4E78F
+  9: C8F9D2ACE691922D
+ 10: 81ED6F3611DDC0FD
+ 11: 2965ABEAC46839EE
+ 12: 2208B1E095F7AE2E
+ 13: C0414FE41800113E
+ 14: 653A24119CF43D97
+ 15: 7FB7CE0862958B37
+ 16: 55097816B10C549B
+
+OMAC-3des (24 byte key)
+  0: 7F07A9EA8ECEDF9E
+  1: 4E2A652EB5FBF5F8
+  2: 4F84E3779ACCB9F5
+  3: 7134AB3463115DC6
+  4: 82327BE8EA2D7E0B
+  5: 24950B9C14D87CD9
+  6: B25A097BB7E0E18A
+  7: ED51BAE55ED925E7
+  8: 56B79E7644556975
+  9: A65BD98E4D4E31E2
+ 10: 11145BB51514482D
+ 11: 397486787E676BA6
+ 12: BD1F6DEBAF6D9AEF
+ 13: 5CC3921F7DB815CF
+ 14: B0C0E60DA5F727F3
+ 15: F8637AEEFF10F470
+ 16: 0EA19531D42706EA
+
+OMAC-cast5 (8 byte key)
+  0: 7413DCDB9F0C3100
+  1: 423799EDF1472B79
+  2: 03856F0CB4F11606
+  3: F152AE6360813DE0
+  4: 853998BD980AD146
+  5: AE6C3D667DB8B414
+  6: B5A4986A34BDE20F
+  7: E5ABE5B979798942
+  8: BEE8DFED4555F405
+  9: 6B5339E952AF61BE
+ 10: 5E867CF34D9C1149
+ 11: F9C55CB3BC655E08
+ 12: EA09A2929AC7D915
+ 13: CE8EB0E4370E1933
+ 14: 749A424B2AA91B98
+ 15: 8DDA93C2B814D5D1
+ 16: E8B0B219D4CB699B
+
+OMAC-noekeon (16 byte key)
+  0: EC61647B281C47C1B43F9815064BF953
+  1: B100B1B6CD96DCED8F47A77E70670A92
+  2: A96CDE3C48831A6B0A5ADFECA6399BDB
+  3: 14E75E7CAD840208834918B29A5D4430
+  4: 9577083713AE6E44EEC987C77C93C072
+  5: 2A738C02841E461238C02F5CFC8E66A6
+  6: A901327E451BE0D2D9DEC83DEEA9A022
+  7: 5ED7EE1BE04A64A689D15F6970A821A6
+  8: BA053E24FCFD02C731A8CFCA19EE66A0
+  9: 57139CA8C91072555B29F85A19E2C84D
+ 10: 4585EAC7EFB84869FD96EE7A5FDD350B
+ 11: 62AF6C415CA73E54E82EA306254C1BDE
+ 12: 75304F9724BD364F84371EE154F5210E
+ 13: 7FE5DBCEE826760434745D417453182B
+ 14: EC98DA2A580E9131218D1CDE835423D4
+ 15: 631BD9EAFD1AE445F2C1C35E2B4416ED
+ 16: CA2D902A1D83388FE35BAB7C29F359BA
+ 17: 0DBF0AF7FCBEEE21FB6159C0A2FFCD4C
+ 18: BD7CD2C49241032DA33B1975EE2EE982
+ 19: B30B090EE8626D77D310EDB957552D46
+ 20: 64F608AC5707C381AC6878AA38345144
+ 21: 28513CA7795B23A02B37DC3732413D23
+ 22: 9F440700094517847E9E013C8915C433
+ 23: 8CA483F313D20BFE7E0C089DAA4145BD
+ 24: FA44872743E20E5E0A069B3C4578DB50
+ 25: F6DE8FFBECD52CC1F213CD9E406DF3BC
+ 26: B9702B7E846735A3DCC0724255F88FEC
+ 27: A1DDAFED2B1732C7BA89C2F194AF039E
+ 28: 2549C5F0E30F8F4002431D2C098805B8
+ 29: 52E3836181BF5C9B09A507D5330CD14F
+ 30: 01C55DCBCCFD9D7A4D27BDE2A89AA8EF
+ 31: 3CF721A0CF006702CDA91F2FF3E4D5E3
+ 32: 6D264B9065BE98C170E68E9D2A4DE86E
+
+OMAC-skipjack (10 byte key)
+  0: 84EDFA769040603C
+  1: 7DA58A4CBD642627
+  2: 118F60115CFC8229
+  3: A7F7346D34DB2F0E
+  4: 35615CCD526CD57F
+  5: DE471601A3660844
+  6: 15FCCE6D6D883D1F
+  7: C6F694861233151B
+  8: 3B762B397F16E807
+  9: 976C6AB59FB3AB12
+ 10: 6810791F2C595961
+ 11: 7FA3478286917F17
+ 12: 73DEE44A51C6B610
+ 13: 89EE8B253B1ACE81
+ 14: CDF2586A56C8A0B5
+ 15: ED91F98DA98F42C4
+ 16: D8D0FA5CE96B08BF
+
+OMAC-anubis (16 byte key)
+  0: E672617CAA1E641C0E7B4B4CC4787455
+  1: C0C16E8FD63907C08A8ABBB7B73376D3
+  2: 23F97CED54939361830396224A7BDD91
+  3: 7FD87DEA9F05E07212DDF61292D9E13D
+  4: 929A11A4D0991A6446B1051926A6048D
+  5: 4EB74F1CC0150D86126BC6FE1FC8253D
+  6: 33C2C3C072D05BB6D54F87579C23B116
+  7: DE350181C9E90A79879813A609BE77E2
+  8: DB519EB9EF0E154D9D248734FD3D3724
+  9: 4F7F2E6D3FC72BA94FE24EC0ABBF4E66
+ 10: D646389DBCEEDD59EBB6E8F09C422930
+ 11: 8547658AE1CE6A8B8D010A1E1FEA7AF4
+ 12: C9BE2B7F3630EFDFBD3AEA6A108C86EA
+ 13: 290417C57096B8B9A1BA3C20FD91285B
+ 14: 9AF60E99692C5F911CBF969A6E11DC14
+ 15: CDA433BE58C98E49EBA8A7108E50DE2B
+ 16: 7430D0EE631A4659351B8A4489A78D46
+ 17: DCC74C0FD0415768FE00225CA14B7DC2
+ 18: 0CF2432B1B465F2A8C5FACAAF2FEF619
+ 19: DA020680C64E93AE5FCA3D71466D01C1
+ 20: B9C33A86E6ED9FCCDCD973382DD1B6A3
+ 21: 6631236B9F2F810DD4D97E6046F41AF2
+ 22: 0312C322F4D634CF4FBC0C2624E3E9F2
+ 23: 111E3E9F8FBDC1E4364622723F1CB524
+ 24: 6D2608D7AAF243D5219E14513895BFF6
+ 25: 683BD01B43CBC0430A007ACBAB357DC9
+ 26: 01B8FC65C56B0F1A5BFEBEDCCF6748D9
+ 27: 4D6298D63A80D55491697A6DD8E3694C
+ 28: 6F0205E4E083CAB00747D723300510DF
+ 29: 5183BAEEF05E9402A935EB9AFF0AA2A9
+ 30: 1E673BFAD4944643A740C59D96A5925C
+ 31: 940FB4000E34EEE78E8DB402E4A76502
+ 32: 87B0C48F3D155AD85D0502D94A4572DE
+
+OMAC-khazad (16 byte key)
+  0: 4EBEFA460499424F
+  1: 97AEEAD51E541D16
+  2: 29A35212910C9595
+  3: ABD1577D622074EA
+  4: 70A537DE14DD765C
+  5: 240A19016DE99C51
+  6: 4D42C10A9F803177
+  7: F464BC3E0DB5A909
+  8: 1C65A01A7C08DAC7
+  9: E49A1428C230C209
+ 10: 16DD0FEB7A6505B8
+ 11: 2DDDB3E35A05C220
+ 12: EC88910C799AC6CC
+ 13: B2A65C9EF39BEC8A
+ 14: F0D2366BA91DFFD5
+ 15: BCAB623CAB7AAA23
+ 16: 9BCEAB857596E478
+

libtomcrypt/notes/pmac_tv.txt

@@ -0,0 +1,461 @@
+PMAC Tests.  In these tests messages of N bytes long (00,01,02,...,NN-1) are OMAC'ed.  The initial key is
+of the same format (length specified per cipher).  The OMAC key in step N+1 is the OMAC output of
+step N (repeated as required to fill the array).
+
+PMAC-aes (16 byte key)
+  0: 4399572CD6EA5341B8D35876A7098AF7
+  1: 580F7AA4AA45857C79BA2FB892228893
+  2: 24D2D1DBABDB25F9F2D391BB61F4204A
+  3: 083BF95E310B42A89751BC8E65ABA8B5
+  4: 69BEB9268CD7FD3D7AB820BD7E226955
+  5: FD71B0E647ADB4BB3F587E82B8B3401A
+  6: 07EA46271081840737CEB1AC9E5E22E3
+  7: FFA12AD9A9FDB5EE126084F82B381B10
+  8: 8A11AF301AAFEAC8A75984ED16BB3292
+  9: 368BDC3F4220E89B54C5F9D09FFB8F34
+ 10: 8B6DBFF776FD526147D1C4655626374F
+ 11: C538C09FC10DF38217CD8E799D8D1DC9
+ 12: FC1264A2051DEF73339432EA39443CFD
+ 13: 8AF37ED2FB2E8E30E9C4B75C1F1363E1
+ 14: 4295541FC62F6774068B8194CC9D9A46
+ 15: CFAF4D8EA09BB342F07131344DB0AA52
+ 16: B6CBD6E95959B2A8E22DE07E38B64D8D
+ 17: 3124E42DE3273B0F4806FB72A50F3E54
+ 18: 252D49403509B618AB3A6A1D99F9E9FA
+ 19: 9CDA75594CB696EB19C022DDA7324C10
+ 20: 33BB8AE43B7BC179E85F157FA19607D0
+ 21: 12FE91BCF2F2875379DC671C6F1B403E
+ 22: 416A3E519D1E406C92F8BB0DDBBBB6BF
+ 23: 6F98DCCD5A8D60DEAF612ACCEDD7E465
+ 24: FFCE7604609B2C3C050921854C638B7E
+ 25: DD2BB10AA07A5EC8D326BB7BF8D407F4
+ 26: 468BFE669FCDF354E4F9768FE1EAF8F6
+ 27: 01724D2F2C61EB4F380852218212E892
+ 28: 2D90EC658F57138505598C659C539A3E
+ 29: 6301EAA0E1500FFEB86752744EFFF23D
+ 30: 3CCB177486377616056D835F6F857F7C
+ 31: BFB3C7755C1F4543B516EB8610CB219F
+ 32: D5C505847D7CFFD8CED848F6CB613105
+
+PMAC-blowfish (8 byte key)
+  0: 3B7E4EFE92FA46AF
+  1: 746840017C38C892
+  2: 3B6A92C731465B64
+  3: D89D3B05143B6704
+  4: 43F70D54B808B7CE
+  5: 84E4063AB32F046C
+  6: A7E78CD5CCD23805
+  7: A78FB083475FEF10
+  8: D4F6C26B5386BA25
+  9: 184768A079853C90
+ 10: 0702E6C8140C5D3B
+ 11: 786D94565AA0DF4B
+ 12: F6D36D3A2F4FB2C1
+ 13: 7BB3A0592E02B391
+ 14: 5B575C77A470946B
+ 15: 686DAD633B5A8CC3
+ 16: BDFE0C7F0254BAD5
+
+PMAC-xtea (16 byte key)
+  0: A7EF6BB667216DDA
+  1: B039E53812C4ABDC
+  2: 87D2F8EA5FB6864D
+  3: F85E3F4C1D9F5EFC
+  4: 4EB749D982FB5FE2
+  5: 0BFA0F172027441A
+  6: FF82D01F36A6EC91
+  7: 3BC2AA2028EBBD7A
+  8: 15AA03A97A971E2A
+  9: C974691F5D66B835
+ 10: 4FC7AA8F399A79ED
+ 11: 2633DA9E94673BAE
+ 12: 82A9FD48C5B60902
+ 13: 31BF6DA9EE0CE7E4
+ 14: 26B2538601B7620E
+ 15: D103F3C0B4579BE5
+ 16: 031346BA20CD87BC
+
+PMAC-rc5 (8 byte key)
+  0: C6B48F8DEC631F7C
+  1: F7AA62C39972C358
+  2: 0E26EC105D99F417
+  3: 7D3C942798F20B8C
+  4: 415CDA53E1DE3888
+  5: A314BA5BCA9A67AC
+  6: 02A5D00A3E371326
+  7: E210F0A597A639E5
+  8: D4A15EED872B78A2
+  9: AC5F99886123F7DC
+ 10: 69AEB2478B58FFDF
+ 11: 8AB167DFC9EF7854
+ 12: 945786A136B98E07
+ 13: F3822AB46627CAB5
+ 14: 23833793C3A83DA9
+ 15: 70E6AB9E6734E5A6
+ 16: 0705C312A4BB6EDE
+
+PMAC-rc6 (16 byte key)
+  0: C7715A17012401DE248DC944DEEBD551
+  1: 5B804C6CCDF97BB28811C9ED24FE6157
+  2: 7528378C052F4346253CB0DFA3D251C7
+  3: 6DA86EE0B28606861B1A954D7429A93C
+  4: B4DFF84C25937FB50EE79D4037323160
+  5: A60FD9BE5E1FF67EC9734776C8781096
+  6: 81D3F8EDC0A197DD3739EAE648F38580
+  7: 8BAF47F02120E898916D678DBD0C1641
+  8: 7A9EEC96F10B7CF557B61EF35BB55B08
+  9: B88C11221014F8AE048E56C427DF4A46
+ 10: 4BBA8EED89F357861A265006816D9B04
+ 11: 8497C1D55010A65ED8C3688B75A7CABF
+ 12: 95E1720C06A373CAD1A22F432F26BCCA
+ 13: A175FB732692831E96AFB587BC49E18C
+ 14: 54EBC04FCFD90302907BF77C4D8AC77C
+ 15: EA9F13EE5548CDF771C354527CDDA09B
+ 16: 4EDBCFD0E2E6B321530EB31B3E8C2FE4
+ 17: F412304C1A5B9005CC3B7900A597DFB5
+ 18: 3B9247C12BB25DF048BF5541E91E1A78
+ 19: 39626488635D0A6224CD23C13B25AE8E
+ 20: 40305F5C2FCEF34E764E33EF635A3DC5
+ 21: F84499804086033E85633A1EF9908617
+ 22: C4D263CDC7E0969B8AC6FA9AD9D65CB8
+ 23: 6137DC840E61EA6A288D017EFB9646FC
+ 24: 8619960428EB29B1D5390F40173C152F
+ 25: F0464509D0FBDBECEC9DFC57A820016D
+ 26: 630EED23E87059051E564194831BAEF6
+ 27: 4B792B412458DC9411F281D5DD3A8DF6
+ 28: F2349FA4418BC89853706B35A9F887BA
+ 29: FEAC41D48AEAB0955745DC2BE1E024D5
+ 30: A67A135B4E6043CB7C9CAFBFA25D1828
+ 31: EC12C9574BDE5B0001EE3895B53716E2
+ 32: 44903C5737EE6B08FD7D7A3937CC840D
+
+PMAC-safer+ (16 byte key)
+  0: E8603C78F9324E9D294DA13C1C6E6E9B
+  1: 3F1178DFC2A10567D4BCC817D35D1E16
+  2: 27FE01F90E09237B4B888746199908EE
+  3: 4F5172E3D8A58CD775CD480D85E70835
+  4: 74BED75EFAAB3E8AA0027D6730318521
+  5: 54B003AB0BE29B7C69F7C7494E4E9623
+  6: 8A2DAD967747AEA24670141B52494E2F
+  7: 69EB054A24EE814E1FB7E78395339781
+  8: E59C2D16B76B700DC62093F0A7F716CC
+  9: AB227D6303007FD2001D0B6A9E2BFEB7
+ 10: AE107117D9457A1166C6DFD27A819B44
+ 11: F84DE551B480CED350458851BAE20541
+ 12: B0EB5103E7559B967D06A081665421E0
+ 13: CDB14F3AD1170CE8C6091947BE89DE7B
+ 14: 24FA2F476407094152D528FCF124E438
+ 15: 440144B31EC09BD8791BFE02E24EA170
+ 16: 697D268A46E8B33CEC0BAB8CAF43F52D
+ 17: 587CBDE7608449BD162184020FBFCC8D
+ 18: 3EA999C2169CC65735737F50FCD7956B
+ 19: C6D692698CD8BEEBF2387C6A35A261B0
+ 20: 46DAB3AD3C4E2EF712FAC38F846C63E1
+ 21: 7261E68B530D10DDC9AD4C9AB5D95693
+ 22: 4D0BA5773E988C2B7B2302BBA0A9D368
+ 23: 8617154626362736698613151D1FD03A
+ 24: 23CF25F68B281E21777DC409FE3B774A
+ 25: CA626956C97DC4207D968A8CC85940B8
+ 26: 24C39BE160BDBB753513F949C238014E
+ 27: 83CD65C010FB69A77EEDEA022A650530
+ 28: 1A72DC8438B927464125C0DFEACDE75D
+ 29: 546054936A2CB5BFBB5E25FFD07C9B51
+ 30: 0EB81A268F1BB91997CB9809D7F9F2AD
+ 31: 7D08B4DE960CADC483D55745BB4B2C17
+ 32: FD45061D378A31D0186598B088F6261B
+
+PMAC-twofish (16 byte key)
+  0: D2D40F078CEDC1A330279CB71B0FF12B
+  1: D1C1E80FD5F38212C3527DA3797DA71D
+  2: 071118A5A87F637D627E27CB581AD58C
+  3: C8CFA166A9B300F720590382CE503B94
+  4: 3965342C5A6AC5F7B0A40DC3B89ED4EB
+  5: 6830AB8969796682C3705E368B2BDF74
+  6: FF4DCC4D16B71AFEEA405D0097AD6B89
+  7: ADB77760B079C010889F79AA02190D70
+  8: 5F2FCD6AA2A22CEECAA4671EE0403B88
+  9: 70DD6D396330904A0A03E19046F4C0BF
+ 10: 8A2C9D88FA0303123275C704445A7F47
+ 11: BA0B2F6D029DCD72566821AB884A8427
+ 12: C8DF45FF13D7A2E4CFE1546279172300
+ 13: 512659AD40DC2B9D31D299A1B00B3DAD
+ 14: A8A0E99D2E231180949FC4DFB4B79ED4
+ 15: CA161AFB2BC7D891AAE268D167897EF2
+ 16: D6C19BBDFFC5822663B604B1F836D8BD
+ 17: 4BF115F409A41A26E89C8D758BBF5F68
+ 18: 02E3196D888D5A8DE818DBCBAD6E6DC7
+ 19: 995C9DD698EC711A73BD41CAAE8EB633
+ 20: A031857FADC8C8AFEABF14EF663A712D
+ 21: 124695C9A8132618B10E9800A4EFACC5
+ 22: 997E5E41798648B8CE0C398EF9135A2C
+ 23: 42C92154B71FB4E133F8F5B2A2007AB2
+ 24: 945DC568188D036AC91051A11AC92BBF
+ 25: D5A860CC4C3087E9F4988B25D1F7FAAE
+ 26: 6CD6ABF8EDF3102659AFFBE476E2CBE8
+ 27: 45ECD0C37091414E28153AA5AFA3E0B2
+ 28: CBA6FE296DDE36FE689C65667F67A038
+ 29: C4022281633F2FC438625540B2EE4EB8
+ 30: 864E27045F9CC79B5377FDF80A6199CF
+ 31: 0D06F2FAEC5AA404A4087AAEBC4DBB36
+ 32: 0F396FE9E3D9D74D17EB7A0BF603AB51
+
+PMAC-safer-k64 (8 byte key)
+  0: 2E49792C78C1DA52
+  1: 7A5136F4FE617C57
+  2: 6FC8575F6F3D78EC
+  3: 7C0373CAEAAA640B
+  4: 9D469E7FF6C35D31
+  5: 7755D62DD7D88112
+  6: ADD9E7855A958C9F
+  7: 752D29BA8150F18E
+  8: 0954649A99596104
+  9: 05D4D75A9FAE233D
+ 10: 1AADAFD7B4B250DA
+ 11: E7A8F31ED74DA32B
+ 12: 1A74DF61BDB9DF94
+ 13: C38A67B1955C4E0D
+ 14: EBADAA44746ADF16
+ 15: C0BFBB092CE81D8E
+ 16: 984975657F3FF2B0
+
+PMAC-safer-sk64 (8 byte key)
+  0: E8917E1629E7403E
+  1: AE8061A5E412A647
+  2: C969771CE5A9B0C6
+  3: 78159C01D0A3A5CB
+  4: 1DD4382A8FC81921
+  5: 4086880FD863C048
+  6: A520B45600A3FA1D
+  7: 0F0AB5118D7506C4
+  8: 22E315F2DD03BCC6
+  9: 5ECB5561EE372016
+ 10: 446A9B2BCB367AD6
+ 11: B2107FE2EB411AE9
+ 12: 5A539B62FB5893DF
+ 13: F44EE1EB3278C2BA
+ 14: 293FEA56D1F6EA81
+ 15: F38F614D2B5F81C4
+ 16: AB23F7F8F4C12A7E
+
+PMAC-safer-k128 (16 byte key)
+  0: 7E0BDE11EC82FDE6
+  1: 8942FB017A135520
+  2: 0B073E6D0F037A02
+  3: DBF88439D671ED4F
+  4: B89427ED1121069A
+  5: AA8573DAC66D2315
+  6: 12DA3144BEF13FF2
+  7: EF80413CBA281B3A
+  8: DFA7114D8505EEBD
+  9: AE53607F3E6F4A54
+ 10: 3F2C9395CFB9F78F
+ 11: 67EB7C5F02760AED
+ 12: 3EF4CBB4AB5B8D1F
+ 13: 83B63AFA78795A92
+ 14: 5DE400951766992A
+ 15: AA8791A45237CF83
+ 16: 7743B18704B037CF
+
+PMAC-safer-sk128 (16 byte key)
+  0: 8F1597FFCF6FB7C1
+  1: AFF8BD8FF9F3888A
+  2: 65F89D82869D8B42
+  3: CBE1F06476B2D5BD
+  4: 4878D47FDFECE23E
+  5: 4751A9E6D61AB2A2
+  6: 003AC162AED4DED8
+  7: 1F617A5555092C22
+  8: 088EE0C35B607153
+  9: F840B485086F9908
+ 10: BA99E0FB5D7D0976
+ 11: F04AF6DC4BAF6887
+ 12: 5DBBE40AF2F67E4E
+ 13: 7F52A93E87E29C9D
+ 14: 7B26A14A4BD5B709
+ 15: C34F26E08C64F26B
+ 16: 291A41D479EC1D2A
+
+PMAC-rc2 (8 byte key)
+  0: E5AF80FAC4580444
+  1: 6A15D6211EB4FF99
+  2: DDB95E9486C4B034
+  3: 9764761DC2AAD5C0
+  4: 1B1CD2E799D44B4F
+  5: 4F80FE32256CF2EC
+  6: 7B70CF31C81CD384
+  7: 9BC10DD9332CF3BB
+  8: 628189801879FDD8
+  9: 5FC17C555E2AE28B
+ 10: E20E68327ABEAC32
+ 11: 5D375CA59E7E2A7C
+ 12: A9F4CFC684113161
+ 13: 3A0E069940DDD13C
+ 14: EAC25B6351941674
+ 15: CB8B5CF885D838CF
+ 16: DCBCDDFC06D3DB9A
+
+PMAC-des (8 byte key)
+  0: 086A2A7CFC08E28E
+  1: F66A1FB75AF18EC9
+  2: B58561DE2BEB96DF
+  3: 9C50856F571B3167
+  4: 6CC645BF3FB00754
+  5: 0E4BEE62B2972C5A
+  6: D2215E451649F11F
+  7: E83DDC61D12F3995
+  8: 155B20BDA899D2CF
+  9: 2567071973052B1D
+ 10: DB9C20237A2D8575
+ 11: DAF4041E5674A48C
+ 12: 552DB7A627E8ECC4
+ 13: 1E8B7F823488DEC0
+ 14: 84AA15713793B25D
+ 15: FCE22E6CAD528B49
+ 16: 993884FB9B3FB620
+
+PMAC-3des (24 byte key)
+  0: E42CCBC9C9457DF6
+  1: FE766F7930557708
+  2: B9011E8AF7CD1E16
+  3: 5AE38B037BEA850B
+  4: A6B2C586E1875116
+  5: BF8BA4F1D53A4473
+  6: 3EB4A079E4E39AD5
+  7: 80293018AC36EDBF
+  8: CC3F5F62C2CEE93C
+  9: EE6AA24CE39BE821
+ 10: 487A6EAF915966EA
+ 11: D94AD6393DF44F00
+ 12: F4BFCCC818B4E20D
+ 13: 2BE9BC57412591AA
+ 14: 7F7CC8D87F2CDAB7
+ 15: B13BFD07E7A202CB
+ 16: 58A6931335B4B2C2
+
+PMAC-cast5 (8 byte key)
+  0: 0654F2F4BC1F7470
+  1: 3F725B162A1C8E6B
+  2: BCFBDC680A20F379
+  3: 027922705BCACDEE
+  4: 44E2F4BE59774BA4
+  5: 3ABD1AFC8EE291F7
+  6: D96347E717921E96
+  7: 96257299FCE55BC6
+  8: C2C1DA176EE98170
+  9: FD415C122E604589
+ 10: DCBCA228D45AEDA4
+ 11: 7801FBCFAAB9DF75
+ 12: D38CB38574474B7F
+ 13: F5C5A23FF3E80F37
+ 14: 83FA4DAD55D092F5
+ 15: BDC0A27EE0CB1657
+ 16: 87D907CACA80A138
+
+PMAC-noekeon (16 byte key)
+  0: A1E4C84B5958726557DF0855B37AA551
+  1: 5DE20299CA919D3365B493D3D4895F92
+  2: AF7E70C336571A857F62A18649EDB197
+  3: C5F55CFE1AA119C352B64252AD246CBD
+  4: FEF68A0CE08E8BA315B73B62F861824F
+  5: 8321C2958DE4903DC12C42A8845ECC20
+  6: 370466D1324AECF1F5B42E0E01381613
+  7: 5CB900190F5CACBACFE5EAB0CC289D87
+  8: A13C043E6CAAA1E34601A93C497446A4
+  9: 865E11622A4CC8A9E1408E00F56C4543
+ 10: 9DC42C26868374649BD17D69D025CA1B
+ 11: 37D33C11B433C91DA09925CA9E86757A
+ 12: 1373D769C270E7137C953AC0F8F37941
+ 13: 7E81DEC583348B1E2F6267ECF82CB994
+ 14: 505B6329338556518FF364CAA730F5E8
+ 15: 0C085AEEB315968B0BDE904E8BBC6FD0
+ 16: 5FED63259364BE7E5133FF0507DD2D4C
+ 17: F7EE5C80A99AAEADB49E7CC69BFFF679
+ 18: 4388FA5E763A641130940EB705BEFD08
+ 19: 1BC31CA79EBE1674CEBE01BC9988267B
+ 20: BE88961637EFFE2D6905D104FEDD51A4
+ 21: 9C341004FB22AFCC496094E3207CA761
+ 22: B9DAA3620E38FFC7C5D5E7D2D8FE3DE4
+ 23: A38D2E571F037061B4400F1131FDBDEA
+ 24: 61DB71AE77A6EB47F2E9E14E8CBF2F4B
+ 25: 9903A072274CC048EF2C51493266D9ED
+ 26: 1EBEA421DD08859C17DDF39B20A82102
+ 27: F425858618E1A86F4912E4714EFB9E75
+ 28: 3B3D4EA07F7FE6DDFDD02D624ACDFC9F
+ 29: CEEE256591D701514EB17DF73B08A970
+ 30: 5CC56D5D46120C530A23B6C511C685FC
+ 31: 68E484CE18BE28EADD0BBF23291B8237
+ 32: ABD58A9CDF8AA68168A1A402074CF520
+
+PMAC-skipjack (10 byte key)
+  0: 9CD94B75BC43B647
+  1: B069ACB82B12BC7B
+  2: 6DD40E71EB03E311
+  3: 74CBED61D77DBA7D
+  4: DD1B7E0D181537FE
+  5: ACB5B96FA0AD1786
+  6: B34E01EB2567D381
+  7: 9623DAADE57B9549
+  8: 8BA384BABB798344
+  9: B147AA9D5C5C67CF
+ 10: 0033C520F4C67523
+ 11: 42DAC184BEABC3E5
+ 12: 428029311004AEBB
+ 13: AC2BB1C0F0ED649B
+ 14: F7CAA9A3BF749C1A
+ 15: 2C5BD475AAC44C77
+ 16: FEB892DA66D31A84
+
+PMAC-anubis (16 byte key)
+  0: DF33EE541FFEE6A97FE3A1F72F7A38FC
+  1: 0AB28675AC3923C6DD9F5A8E1E2928D0
+  2: 2DABF75D6403E1E1CFAB3E6869FB1088
+  3: 95835D49E09740180B79E394FC2AA744
+  4: F364D6DC2C2078A519E5BAEFE858AFCA
+  5: DA4C66A4805FC91FABAECC0D3AEAD850
+  6: 487660FADCAC7B326C492AA051A1DF49
+  7: BF07835AA1A548FA7312509AF35CE3F3
+  8: 3CE8A8B1F324A700923AC0B830D53D99
+  9: 3C54D99AACFAB26E34FC1B0B6BB9EB22
+ 10: 0A559F9D107ED76FD19227FDD0752B8A
+ 11: BFD9E74ADC40B9C7446FDD09558FA584
+ 12: F1130F663BC0FA3B1066129E0D1910E9
+ 13: 535EAD786F0D211DE7AA78F3CB480803
+ 14: CDF5855F00A4C310D95B26751B01A28B
+ 15: EF6686E999D5A9C35A96D25BB9DBBF57
+ 16: E795733AA0AAF16D8F7AB1A8E9C55E54
+ 17: E03CA85727D5CF06F56BB6465BB3E5C5
+ 18: 6EDDDB6D2292EFF584E382E1BACD1A49
+ 19: 7B7FE0D8821836C1AA95578071FF2FD2
+ 20: 5F8CC568338400746B61A9286B7CF262
+ 21: 32DEE5A11E9EDB04BDF911837CE0FA4D
+ 22: F1A99914F13B17ABF383F36157FEB170
+ 23: 99F541647F382390043CAE5332E3114D
+ 24: 34C5EBB85693A1979F8CFDF8B431A5BB
+ 25: 1BA7266568F1E7B4A77A869D3021AC0F
+ 26: 0FC675C99C24E859F8CE714E86BF5289
+ 27: CBFAB21F5ABC47356A43BED806D873C0
+ 28: 9659AB1A4D334B622629721F98EECE3A
+ 29: 644C8BEE41F03BDE7652B03CAEA31E37
+ 30: 5B3447AFAD934B4D1E4910A8DFD588E7
+ 31: BFF403342E8D50D0447627AEA2F56B23
+ 32: 19F468F0FB05184D00FABD40A18DB7B2
+
+PMAC-khazad (16 byte key)
+  0: F40CEF2E392BEAEB
+  1: C6E086BD1CFA0992
+  2: 513F2851583AD69A
+  3: 07279D57695D78FF
+  4: 051E94FE4CC847B6
+  5: 5E9AAA5989D5C951
+  6: 310D5D740143369A
+  7: 9BB1EA8ECD4AF34B
+  8: CF886800AF0526C8
+  9: 0B03E2C94729E643
+ 10: 42815B308A900EC7
+ 11: 9A38A58C438D26DD
+ 12: 044BFF68FD2BFF76
+ 13: 7F5ABBDC29852729
+ 14: F81A7D6F7B788A5D
+ 15: 93098DA8A180AA35
+ 16: BACE2F4DA8A89E32
+

libtomcrypt/notes/tech0001.txt

@@ -0,0 +1,73 @@
+Tech Note 0001
+How to Gather Entropy on Embedded Systems
+Tom St Denis
+
+Introduction
+------------
+
+This tech note explains a relatively simple way to gather entropy for a PRNG (Yarrow in this case) in embedded systems
+where there are few sources of entropy or physical sources.
+
+When trying to setup a secure random number generator a fresh source of random data (entropy) is required to ensure the
+deterministic state of the PRNG is not known or predetermined with respect to an attacker.
+
+At the very least the system requires one timer and one source of un-timed interrupts.  by "un-timed" I mean interrupts
+that do not occur at regular intervals [e.g. joypad/keypad input, network packets, etc...].
+
+First we shall begin by taking an overview of how the Yarrow PRNG works within libtomcrypt.  At the heart of all
+PRNGs is the "prng_state" data type.  This is a union of structures that hold the PRNG state for the various prngs.  The 
+first thing we require is a state... 
+
+   prng_state myPrng;
+
+Next we must initialize the state once to get the ball rolling
+
+   if (yarrow_start(&myPrng) != CRYPT_OK) {
+      // error should never happen!
+   }
+
+At this point the PRNG is ready to accept fresh entropy which is added with
+
+   int yarrow_add_entropy(const unsigned char *buf, unsigned long len, prng_state *prng)
+
+This function is **NOT** thread safe which will come under consideration later.  To add entropy to our PRNG we must 
+call this function with fresh data as its sampled.  Lets say we have a timer counter called "uTimer" which is a 32-bit 
+long and say a 32-bit joyPad state called "uPad".  An example interrupt handler would look like
+
+   void joypad_interrupt(...) {
+       unsigned char buf[8];
+
+       STORE32L(uTimer, buf);
+       STORE32L(uPad, buf+4)
+       if (yarrow_add_entropy(buf, 8, &myPrng) != CRYPT_OK) {
+          // this should never occur either unless you didn't call yarrow_start
+       }
+ 
+       // handle interrupt
+   }
+
+In this snippet the timer count and state of the joypad are added together into the entropy pool.  The timer is important
+because with respect to the joypad it is a good source of entropy (on its own its not).  For example, the probability of
+the user pushing the up arrow is fairly high, but at a specific time is not.
+
+This method doesn't gather alot of entropy and has to be used to for quite a while.  One way to speed it up is to tap
+multiple sources.  If you have a network adapter and other sources of events (keyboard, mouse, etc...) trapping their
+data is ideal as well.  Its important to gather the timer along with the event data.
+
+As mentioned the "yarrow_add_entropy()" function is not thread safe.  If your system allows interrupt handlers to be 
+interrupted themselves then you could have trouble.  One simple way is to detect when an interrupt is in progress and
+simply not add entropy during the call (jump over the yarrow_add_entropy() call)
+
+Once you feel that there has been enough entropy added to the pool then within a single thread you can call
+
+    int yarrow_ready(prng_state *prng)
+
+Now the PRNG is ready to read via the 
+
+    unsigned long yarrow_read(unsigned char *buf, unsigned long len, prng_state *prng)
+
+It is a very good idea that once you call the yarrow_ready() function that you stop harvesting entropy in your interrupt
+functions.  This will free up alot of CPU time.  Also one more final note.  The yarrow_read() function is not thread
+safe either.  This means if you have multiple threads or processes that read from it you will have to add your own semaphores
+around calls to it.
+

libtomcrypt/notes/tech0002.txt

@@ -0,0 +1,52 @@
+Tech Note 0002
+How to avoid non-intrusive timing attacks with online computations
+Tom St Denis
+
+Introduction
+------------
+
+A timing attack is when an attacker can observe a side channel of the device (in this case time).  In this tech note
+we consider only non-intrusive timing attacks with respect to online computations.  That is an attacker can
+determine when a computation (such as a public key encryption) begins and ends but cannot observe the device 
+directly.  This is specifically important for applications which transmit data via a public network.
+
+Consider a Diffie-Hellman encryption which requires the sender to make up a public key "y = g^x mod p".  Libtomcrypt
+uses the MPI bignum library to perform the operation.  The time it takes to compute y is controlled by the number
+of 1 bits in the exponent 'x'.  To a large extent there will be the same number of squaring operations.  "1" bits in
+the exponent require the sender to perform a multiplication.  This means to a certain extent an attacker can 
+determine not only the magnitude of 'x' but the number of one bits.  With this information the attacker cannot directly
+learn the key used.  However, good cryptography mandates the close scrutiny of any practical side channel.
+
+Similar logic applies to the other various routines.  Fortunately for this case there is a simple solution.  First, 
+determine the maximum time the particular operation can require.  For instance, on an Athlon 1.53Ghz XP processor a
+DH-768 encryption requires roughly 50 milliseconds.  Take that time and round it up.  Now place a delay after the call.
+
+For example, 
+
+void demo(void) {
+   clock_t t1;
+
+   // get initial clock
+   t1 = clock();
+   
+   // some PK function
+   
+   // now delay 
+   while (clock() < (t1 + 100));
+   
+   // transmit data...
+   
+}
+
+This code has the effect of taking at least 100 ms always.  In effect someone analyzing the traffic will see that the
+operations always take a fixed amount of time.  Since no two platforms are the same this type of fix has not been 
+incorporated into libtomcrypt (nor is it desired for many platforms).  This requires on the developers part to profile
+the code to determine the delays required.
+
+Note that this "quick" fix has no effect against an intrusive attacker.  For example, power consumption will drop
+significantly in the loop after the operation.  However, this type of fix is more important to secure the user of the 
+application/device.  For example, a user placing an order online won't try to cheat themselves by cracking open their
+device and performing side-channel cryptanalysis.  An attacker over a network might try to use the timing information
+against the user.
+
+

libtomcrypt/notes/tech0003.txt

@@ -0,0 +1,52 @@
+Tech Note 0003
+Minimizing Memory Usage
+Tom St Denis
+
+Introduction
+------------
+
+For the most part the library can get by with around 20KB of stack and about 32KB of heap even if you use the
+public key functions.  If all you plan on using are the hashes and ciphers than only about 1KB of stack is required
+and no heap.
+
+To save space all of the symmetric key scheduled keys are stored in a union called "symmetric_key".  This means the 
+size of a symmetric_key is the size of the largest scheduled key.  By removing the ciphers you don't use from
+the build you can minimize the size of this structure.  For instance, by removing both Twofish and Blowfish the
+size reduces to 768 bytes from the 4,256 bytes it would have been (on a 32-bit platform).  Or if you remove
+Blowfish and use Twofish with TWOFISH_SMALL defined its still 768 bytes.  Even at its largest the structure is only 
+4KB which is normally not a problem for any platform.  
+
+
+Cipher Name | Size of scheduled key (bytes) |
+------------+-------------------------------|
+Twofish     | 4,256                         |
+Blowfish    | 4,168                         |
+3DES        | 768                           |
+SAFER+      | 532                           |
+Serpent     | 528                           |
+Rijndael    | 516                           |
+XTEA        | 256                           |
+RC2         | 256                           |
+DES         | 256                           |
+SAFER [#]   | 217                           |
+RC5         | 204                           |
+Twofish [*] | 193                           |
+RC6         | 176                           |
+CAST5       | 132                           |
+Noekeon     | 32                            |
+Skipjack    | 10                            |
+------------+-------------------------------/
+Memory used per cipher on a 32-bit platform.
+
+[*] For Twofish with TWOFISH_SMALL defined
+[#] For all 64-bit SAFER ciphers.
+
+Noekeon is a fairly fast cipher and uses very little memory.  Ideally in low-ram platforms all other ciphers should be
+left undefined and Noekeon should remain.  While Noekeon is generally considered a secure block cipher (it is insecure
+as a hash) CAST5 is perhaps a "runner-up" choice.  CAST5 has been around longer (it is also known as CAST-128) and is 
+fairly fast as well.
+
+You can easily accomplish this via the "config.pl" script. Simply answer "n" to all of the ciphers except the one you want
+and then rebuild the library.  [or you can hand edit mycrypt_custom.h]
+
+

libtomcrypt/notes/tech0004.txt

@@ -0,0 +1,91 @@
+Tech Note 0004
+Using Yarrow, Fortuna and SOBER-128
+Tom St Denis
+
+Introduction
+------------
+
+This tech note explains how to use three of the more useful pseudo random number generators and their 
+own little "issues".  While all of the PRNGs have the same API and are roughly used in the same 
+manner their effectiveness really depends on the user knowing how they work.
+
+
+Yarrow
+------
+
+Yarrow is by far the simplest of the PRNGs.  It gathers bits of entropy by hashing the pool state
+plus the additional bits storing the message digest back in the pool.  E.g.
+
+pool = hash(pool || newbits)
+
+Simply dump bits into the PRNG via yarrow_add_entropy() and call yarrow_ready() when you want to 
+put them to use.  This PRNG while simple is not entirely safe.  An attacker who learns the state
+of the pool and can control future events can control the PRNG.  This requires an active attacker but 
+isn't entire impossible.
+
+The pool is then used as a key for a cipher that is used in CTR mode.  
+
+Yarrow is mostly meant for short-term programs [e.g. like file utils].  This particular implementation
+is not meant for long-term usage.
+
+Fortuna
+-------
+
+Fortuna was designed by Niels Fergusson and Bruce Schneier [Bruce is also the guy who invented Yarrow].  It
+operates on a more defensive level than Yarrow.  Instead of 1 entropy pool it has 32 and the new entropy 
+is spread [round robin] in all of the pools. 
+
+That is, each call to fortuna_add_entropy() puts the bits in the next [in the sequenece] pool of entropy.  
+Effective bits are added to the pool by sending them through a hash [but not terminating the hash].  
+
+Here's the main catch though.  When the PRNG must be reseeded [so that you can extract bits from it] only
+certain pools are used.  More precisely the i'th pool is used every 2**i'th reseeding.  For example, pool[0]
+is always used.  pool[1] is used every second reseeding, pool[2] every fourth.
+
+The pools are hashed together along with the current key and the result is the new key for a cipher which
+operates in CTR mode [more about that in a sec].
+
+Now this may seem odd at first however there is a good reason behind it.  An attacker who learns pool[0] won't
+strictly know the other pools.  So the recovery rate of is not 0.  In fact pool[0] can be completely 
+compromised and the PRNG will still eventually recover.  The value FORTUNA_WD is the "WatchDog" counter.
+Every FORTUNA_WD calls to fortuna_read will invoke the reseed operation.  By default this is set to 10 which 
+means after 10 calls the PRNG will reseed itself.  
+
+The pools are combined with the running cipher key [256 bits] so that a cipher in CTR mode can produce 
+the stream.  Unlike Yarrow the cipher is re-keyed after every call to fortuna_read() [so one big call 
+would be faster than many smaller calls].  This prevents too much data being encrypted under the same
+key [and mitigates a flaw in CTR mode that the same block can't be emitted twice under the same key].
+
+Fortuna is really meant for a kernel-level PRNG.  The more sources [and often] you feed into it the 
+healthier it will be.  It's also meant to be used for long term purposes.  Since it can recover from
+compromises it is harder to control it.  
+
+SOBER-128
+------
+
+SOBER-128 is actually a stream cipher but like most ciphers can easily be modelled in the context of a PRNG.
+This PRNG is extremely fast [4 cycles/byte on a P4] and was designed by a well known cryptographer [Greg Rose].
+
+SOBER-128 doesn't really "act" like the other two PRNGs.  It's meant to be seeded once and then read as 
+required.  In such a sense it isn't a "system PRNG" but useful short term purposes.  In particular
+the sober128_read() function actually XORs against the input buffer you specify.  This allows the 
+read() function to be used as an "encrypt" function as well.  
+
+You can only key SOBER-128 once [by calling sober128_add_entropy()].  Once it it is keyed subsequent
+calls to add_entropy() will be considered a "re-IV" operation.  Changing the IV allows you to use same
+initial key and not produce the same output stream.  It also lets you differentiate packets.  E.g. each
+packet has it's own IV.
+
+All inputs to sober128_add_entropy() must have a length that is a multiple of four.
+
+Overall
+-------
+
+Since SOBER-128 is *much* faster than the other two PRNGs a good setup would be to use Fortuna as your 
+system-wide PRNG and use SOBER-128 [key'ed from Fortuna] for encrypting streams or as a PRNG for 
+simulations.
+
+Yarrow is still a good candidate but only for "short lived" programs.  However, since Fortuna is faster
+[by about 10 cycles/byte on a P4] I'd use Fortuna anyways...
+
+Tom

libtomcrypt/notes/tech0005.txt

@@ -0,0 +1,20 @@
+Tech Note 0005
+Minimizing Code Space
+Tom St Denis
+
+Introduction
+------------
+
+Tweaking...
+
+You can disable whole classes of algorithms on the command line with the LTC_NO_* defines.  From there you can manually turn on what you want to enable.  
+
+The following build with GCC 3.4.4 on an AMD64 box gets you AES, CTR mode, SHA-256, HMAC, Yarrow, full RSA PKCS #1, PKCS #5 and ASN.1 DER in 
+roughly 40KB of code (49KB on the ARMv4) (both excluding the math library).
+
+CFLAGS="-DLTC_NO_CIPHERS -DLTC_NO_HASHES -DLTC_NO_PRNGS -DLTC_NO_MACS -DLTC_NO_MODES -DLTC_NO_PK -DRIJNDAEL -DLTC_CTR_MODE -DSHA256 \
+-DLTC_HMAC -DYARROW -DMRSA -DMPI -DTFM_DESC -DARGTYPE=3 -Os -DLTC_SMALL_CODE -fomit-frame-pointer" make IGNORE_SPEED=1
+
+Obviously this won't get you performance but if you need to pack a crypto lib in a device with limited means it's more than enough...
+
+Neato eh?

libtomcrypt/notes/tech0006.txt

@@ -0,0 +1,91 @@
+Tech Note 0006
+PK Standards Compliance
+Tom St Denis
+
+RSA
+----
+
+PKCS #1 compliance.
+
+Key Format:  RSAPublicKey and RSAPrivateKey as per PKCS #1 v2.1
+Encryption:  OAEP as per PKCS #1
+Signature :  PSS  as per PKCS #1
+
+DSA
+----
+
+The NIST DSA algorithm
+
+Key Format:  HomeBrew [see below]
+Signature :  ANSI X9.62 format [see below].
+
+Keys are stored as 
+
+DSAPublicKey ::= SEQUENCE {
+    publicFlags    BIT STRING(1), -- must be 0
+    g              INTEGER      , -- base generator, check that g^q mod p == 1
+                                  -- and that 1 < g < p - 1
+    p              INTEGER      , -- prime modulus 
+    q              INTEGER      , -- order of sub-group (must be prime)
+    y              INTEGER      , -- public key, specifically, g^x mod p, 
+                                  -- check that y^q mod p == 1
+                                  -- and that 1 < y < p - 1
+}
+
+DSAPrivateKey ::= SEQUENCE {
+    publicFlags    BIT STRING(1), -- must be 1
+    g              INTEGER      , -- base generator, check that g^q mod p == 1
+                                  -- and that 1 < g < p - 1
+    p              INTEGER      , -- prime modulus 
+    q              INTEGER      , -- order of sub-group (must be prime)
+    y              INTEGER      , -- public key, specifically, g^x mod p, 
+                                  -- check that y^q mod p == 1
+                                  -- and that 1 < y < p - 1
+    x              INTEGER        -- private key
+}
+
+Signatures are stored as 
+
+DSASignature ::= SEQUENCE {
+    r, s           INTEGER        -- signature parameters
+}
+
+ECC
+----
+
+The ANSI X9.62 and X9.63 algorithms [partial].  Supports all NIST GF(p) curves.
+
+Key Format   :  Homebrew [see below, only GF(p) NIST curves supported]
+Signature    :  X9.62 compliant
+Encryption   :  Homebrew [based on X9.63, differs in that the public point is stored as an ECCPublicKey]
+Shared Secret:  X9.63 compliant
+
+ECCPublicKey ::= SEQUENCE {
+    flags       BIT STRING(1), -- public/private flag (always zero), 
+    keySize     INTEGER,       -- Curve size (in bits) divided by eight 
+                               -- and rounded down, e.g. 521 => 65
+    pubkey.x    INTEGER,       -- The X co-ordinate of the public key point
+    pubkey.y    INTEGER,       -- The Y co-ordinate of the public key point
+}
+
+ECCPrivateKey ::= SEQUENCE {
+    flags       BIT STRING(1), -- public/private flag (always one), 
+    keySize     INTEGER,       -- Curve size (in bits) divided by eight 
+                               -- and rounded down, e.g. 521 => 65
+    pubkey.x    INTEGER,       -- The X co-ordinate of the public key point
+    pubkey.y    INTEGER,       -- The Y co-ordinate of the public key point
+    secret.k    INTEGER,       -- The secret key scalar
+}
+
+The encryption works by finding the X9.63 shared secret and hashing it.  The hash is then simply XOR'ed against the message [which must be at most the size
+of the hash digest].  The format of the encrypted text is as follows
+
+ECCEncrypted ::= SEQUENCE {
+    hashOID     OBJECT IDENTIFIER,   -- The OID of the hash used
+    pubkey      OCTET STRING     ,   -- Encapsulation of a random ECCPublicKey
+    skey        OCTET STRING         -- The encrypted text (which the hash was XOR'ed against)
+}
+
+% $Source: /cvs/libtom/libtomcrypt/notes/tech0006.txt,v $   
+% $Revision: 1.2 $   
+% $Date: 2005/06/18 02:26:27 $ 

libtomcrypt/notes/tech0007.txt

@@ -0,0 +1,5 @@
+Tech Note #7
+Quick building for testing with LTM
+
+EXTRALIBS=-ltommath CFLAGS="-g3 -DLTC_NO_ASM -DUSE_LTM -DLTM_DESC" make -j3 IGNORE_SPEED=1 test
+

libtomcrypt/parsenames.pl

@@ -0,0 +1,26 @@
+#!/usr/bin/perl
+#
+# Splits the list of files and outputs for makefile type files 
+# wrapped at 80 chars 
+# 
+# Tom St Denis
+@a = split(" ", $ARGV[1]);
+$b = "$ARGV[0]=";
+$len = length($b);
+print $b;
+foreach my $obj (@a) {
+   $len = $len + length($obj);
+   $obj =~ s/\*/\$/;
+   if ($len > 100) {
+      printf "\\\n";
+      $len = length($obj);
+   }
+   print "$obj ";
+}
+if ($ARGV[0] eq "HEADERS") { print "testprof/tomcrypt_test.h"; }
+
+print "\n\n";
+
+# $Source: /cvs/libtom/libtomcrypt/parsenames.pl,v $   
+# $Revision: 1.3 $   
+# $Date: 2005/05/05 14:49:27 $ 

libtomcrypt/run.sh

@@ -0,0 +1,35 @@
+#!/bin/bash
+bash build.sh " $1" "$2 -O2" "$3 IGNORE_SPEED=1" "$4" "$5"
+if [ -a testok.txt ] && [ -f testok.txt ]; then
+   echo
+else
+	echo
+	echo "Test failed"
+	exit 1
+fi
+
+rm -f testok.txt
+bash build.sh " $1" "$2 -Os" " $3 IGNORE_SPEED=1 LTC_SMALL=1" "$4" "$5"
+if [ -a testok.txt ] && [ -f testok.txt ]; then
+   echo
+else
+	echo
+	echo "Test failed"
+	exit 1
+fi
+
+rm -f testok.txt
+bash build.sh " $1" " $2" " $3 " "$4" "$5"
+if [ -a testok.txt ] && [ -f testok.txt ]; then
+   echo
+else
+	echo
+	echo "Test failed"
+	exit 1
+fi
+
+exit 0
+
+# $Source: /cvs/libtom/libtomcrypt/run.sh,v $   
+# $Revision: 1.15 $   
+# $Date: 2005/07/23 14:18:31 $ 

libtomcrypt/src/ciphers/aes/aes.c

@@ -0,0 +1,762 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+
+/* AES implementation by Tom St Denis
+ *
+ * Derived from the Public Domain source code by
+ 
+---  
+  * rijndael-alg-fst.c
+  *
+  * @version 3.0 (December 2000)
+  *
+  * Optimised ANSI C code for the Rijndael cipher (now AES)
+  *
+  * @author Vincent Rijmen <vincent.rijmen@esat.kuleuven.ac.be>
+  * @author Antoon Bosselaers <antoon.bosselaers@esat.kuleuven.ac.be>
+  * @author Paulo Barreto <paulo.barreto@terra.com.br>
+---
+ */
+/**
+  @file aes.c
+  Implementation of AES
+*/   
+
+#include "tomcrypt.h"
+
+#ifdef RIJNDAEL
+
+#ifndef ENCRYPT_ONLY 
+
+#define SETUP    rijndael_setup
+#define ECB_ENC  rijndael_ecb_encrypt
+#define ECB_DEC  rijndael_ecb_decrypt
+#define ECB_DONE rijndael_done
+#define ECB_TEST rijndael_test
+#define ECB_KS   rijndael_keysize
+
+#if 0
+const struct ltc_cipher_descriptor rijndael_desc =
+{
+    "rijndael",
+    6,
+    16, 32, 16, 10,
+    SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+#endif
+
+const struct ltc_cipher_descriptor aes_desc =
+{
+    "aes",
+    6,
+    16, 32, 16, 10,
+    SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+#else
+
+#define SETUP    rijndael_enc_setup
+#define ECB_ENC  rijndael_enc_ecb_encrypt
+#define ECB_KS   rijndael_enc_keysize
+#define ECB_DONE rijndael_enc_done
+
+const struct ltc_cipher_descriptor rijndael_enc_desc =
+{
+    "rijndael",
+    6,
+    16, 32, 16, 10,
+    SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+const struct ltc_cipher_descriptor aes_enc_desc =
+{
+    "aes",
+    6,
+    16, 32, 16, 10,
+    SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+#endif
+
+#include "aes_tab.c"
+
+static ulong32 setup_mix(ulong32 temp)
+{
+   return (Te4_3[byte(temp, 2)]) ^
+          (Te4_2[byte(temp, 1)]) ^
+          (Te4_1[byte(temp, 0)]) ^
+          (Te4_0[byte(temp, 3)]);
+}
+
+#ifndef ENCRYPT_ONLY
+#ifdef LTC_SMALL_CODE
+static ulong32 setup_mix2(ulong32 temp)
+{
+   return Td0(255 & Te4[byte(temp, 3)]) ^
+          Td1(255 & Te4[byte(temp, 2)]) ^
+          Td2(255 & Te4[byte(temp, 1)]) ^
+          Td3(255 & Te4[byte(temp, 0)]);
+}
+#endif
+#endif
+
+ /**
+    Initialize the AES (Rijndael) block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+    int i, j;
+    ulong32 temp, *rk;
+#ifndef ENCRYPT_ONLY
+    ulong32 *rrk;
+#endif    
+    LTC_ARGCHK(key  != NULL);
+    LTC_ARGCHK(skey != NULL);
+  
+    if (keylen != 16 && keylen != 24 && keylen != 32) {
+       return CRYPT_INVALID_KEYSIZE;
+    }
+    
+    if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) {
+       return CRYPT_INVALID_ROUNDS;
+    }
+    
+    skey->rijndael.Nr = 10 + ((keylen/8)-2)*2;
+        
+    /* setup the forward key */
+    i                 = 0;
+    rk                = skey->rijndael.eK;
+    LOAD32H(rk[0], key     );
+    LOAD32H(rk[1], key +  4);
+    LOAD32H(rk[2], key +  8);
+    LOAD32H(rk[3], key + 12);
+    if (keylen == 16) {
+        j = 44;
+        for (;;) {
+            temp  = rk[3];
+            rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i];
+            rk[5] = rk[1] ^ rk[4];
+            rk[6] = rk[2] ^ rk[5];
+            rk[7] = rk[3] ^ rk[6];
+            if (++i == 10) {
+               break;
+            }
+            rk += 4;
+        }
+    } else if (keylen == 24) {
+        j = 52;   
+        LOAD32H(rk[4], key + 16);
+        LOAD32H(rk[5], key + 20);
+        for (;;) {
+        #ifdef _MSC_VER
+            temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; 
+        #else
+            temp = rk[5];
+        #endif
+            rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i];
+            rk[ 7] = rk[ 1] ^ rk[ 6];
+            rk[ 8] = rk[ 2] ^ rk[ 7];
+            rk[ 9] = rk[ 3] ^ rk[ 8];
+            if (++i == 8) {
+                break;
+            }
+            rk[10] = rk[ 4] ^ rk[ 9];
+            rk[11] = rk[ 5] ^ rk[10];
+            rk += 6;
+        }
+    } else if (keylen == 32) {
+        j = 60;
+        LOAD32H(rk[4], key + 16);
+        LOAD32H(rk[5], key + 20);
+        LOAD32H(rk[6], key + 24);
+        LOAD32H(rk[7], key + 28);
+        for (;;) {
+        #ifdef _MSC_VER
+            temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; 
+        #else
+            temp = rk[7];
+        #endif
+            rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i];
+            rk[ 9] = rk[ 1] ^ rk[ 8];
+            rk[10] = rk[ 2] ^ rk[ 9];
+            rk[11] = rk[ 3] ^ rk[10];
+            if (++i == 7) {
+                break;
+            }
+            temp = rk[11];
+            rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8));
+            rk[13] = rk[ 5] ^ rk[12];
+            rk[14] = rk[ 6] ^ rk[13];
+            rk[15] = rk[ 7] ^ rk[14];
+            rk += 8;
+        }
+    } else {
+       /* this can't happen */
+       return CRYPT_ERROR;
+    }
+
+#ifndef ENCRYPT_ONLY    
+    /* setup the inverse key now */
+    rk   = skey->rijndael.dK;
+    rrk  = skey->rijndael.eK + j - 4; 
+    
+    /* apply the inverse MixColumn transform to all round keys but the first and the last: */
+    /* copy first */
+    *rk++ = *rrk++;
+    *rk++ = *rrk++;
+    *rk++ = *rrk++;
+    *rk   = *rrk;
+    rk -= 3; rrk -= 3;
+    
+    for (i = 1; i < skey->rijndael.Nr; i++) {
+        rrk -= 4;
+        rk  += 4;
+    #ifdef LTC_SMALL_CODE        
+        temp = rrk[0];
+        rk[0] = setup_mix2(temp);
+        temp = rrk[1];
+        rk[1] = setup_mix2(temp);
+        temp = rrk[2];
+        rk[2] = setup_mix2(temp);
+        temp = rrk[3];
+        rk[3] = setup_mix2(temp);
+     #else
+        temp = rrk[0];
+        rk[0] =
+            Tks0[byte(temp, 3)] ^
+            Tks1[byte(temp, 2)] ^
+            Tks2[byte(temp, 1)] ^
+            Tks3[byte(temp, 0)];
+        temp = rrk[1];
+        rk[1] =
+            Tks0[byte(temp, 3)] ^
+            Tks1[byte(temp, 2)] ^
+            Tks2[byte(temp, 1)] ^
+            Tks3[byte(temp, 0)];
+        temp = rrk[2];
+        rk[2] =
+            Tks0[byte(temp, 3)] ^
+            Tks1[byte(temp, 2)] ^
+            Tks2[byte(temp, 1)] ^
+            Tks3[byte(temp, 0)];
+        temp = rrk[3];
+        rk[3] =
+            Tks0[byte(temp, 3)] ^
+            Tks1[byte(temp, 2)] ^
+            Tks2[byte(temp, 1)] ^
+            Tks3[byte(temp, 0)];
+      #endif            
+     
+    }
+
+    /* copy last */
+    rrk -= 4;
+    rk  += 4;
+    *rk++ = *rrk++;
+    *rk++ = *rrk++;
+    *rk++ = *rrk++;
+    *rk   = *rrk;
+#endif /* ENCRYPT_ONLY */
+
+    return CRYPT_OK;   
+}
+
+/**
+  Encrypts a block of text with AES
+  @param pt The input plaintext (16 bytes)
+  @param ct The output ciphertext (16 bytes)
+  @param skey The key as scheduled
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) 
+#else
+int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#endif
+{
+    ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk;
+    int Nr, r;
+   
+    LTC_ARGCHK(pt != NULL);
+    LTC_ARGCHK(ct != NULL);
+    LTC_ARGCHK(skey != NULL);
+    
+    Nr = skey->rijndael.Nr;
+    rk = skey->rijndael.eK;
+    
+    /*
+     * map byte array block to cipher state
+     * and add initial round key:
+     */
+    LOAD32H(s0, pt      ); s0 ^= rk[0];
+    LOAD32H(s1, pt  +  4); s1 ^= rk[1];
+    LOAD32H(s2, pt  +  8); s2 ^= rk[2];
+    LOAD32H(s3, pt  + 12); s3 ^= rk[3];
+
+#ifdef LTC_SMALL_CODE
+
+    for (r = 0; ; r++) {
+        rk += 4;
+        t0 =
+            Te0(byte(s0, 3)) ^
+            Te1(byte(s1, 2)) ^
+            Te2(byte(s2, 1)) ^
+            Te3(byte(s3, 0)) ^
+            rk[0];
+        t1 =
+            Te0(byte(s1, 3)) ^
+            Te1(byte(s2, 2)) ^
+            Te2(byte(s3, 1)) ^
+            Te3(byte(s0, 0)) ^
+            rk[1];
+        t2 =
+            Te0(byte(s2, 3)) ^
+            Te1(byte(s3, 2)) ^
+            Te2(byte(s0, 1)) ^
+            Te3(byte(s1, 0)) ^
+            rk[2];
+        t3 =
+            Te0(byte(s3, 3)) ^
+            Te1(byte(s0, 2)) ^
+            Te2(byte(s1, 1)) ^
+            Te3(byte(s2, 0)) ^
+            rk[3];
+        if (r == Nr-2) { 
+           break;
+        }
+        s0 = t0; s1 = t1; s2 = t2; s3 = t3;
+    }
+    rk += 4;
+
+#else
+
+    /*
+     * Nr - 1 full rounds:
+     */
+    r = Nr >> 1;
+    for (;;) {
+        t0 =
+            Te0(byte(s0, 3)) ^
+            Te1(byte(s1, 2)) ^
+            Te2(byte(s2, 1)) ^
+            Te3(byte(s3, 0)) ^
+            rk[4];
+        t1 =
+            Te0(byte(s1, 3)) ^
+            Te1(byte(s2, 2)) ^
+            Te2(byte(s3, 1)) ^
+            Te3(byte(s0, 0)) ^
+            rk[5];
+        t2 =
+            Te0(byte(s2, 3)) ^
+            Te1(byte(s3, 2)) ^
+            Te2(byte(s0, 1)) ^
+            Te3(byte(s1, 0)) ^
+            rk[6];
+        t3 =
+            Te0(byte(s3, 3)) ^
+            Te1(byte(s0, 2)) ^
+            Te2(byte(s1, 1)) ^
+            Te3(byte(s2, 0)) ^
+            rk[7];
+
+        rk += 8;
+        if (--r == 0) {
+            break;
+        }
+
+        s0 =
+            Te0(byte(t0, 3)) ^
+            Te1(byte(t1, 2)) ^
+            Te2(byte(t2, 1)) ^
+            Te3(byte(t3, 0)) ^
+            rk[0];
+        s1 =
+            Te0(byte(t1, 3)) ^
+            Te1(byte(t2, 2)) ^
+            Te2(byte(t3, 1)) ^
+            Te3(byte(t0, 0)) ^
+            rk[1];
+        s2 =
+            Te0(byte(t2, 3)) ^
+            Te1(byte(t3, 2)) ^
+            Te2(byte(t0, 1)) ^
+            Te3(byte(t1, 0)) ^
+            rk[2];
+        s3 =
+            Te0(byte(t3, 3)) ^
+            Te1(byte(t0, 2)) ^
+            Te2(byte(t1, 1)) ^
+            Te3(byte(t2, 0)) ^
+            rk[3];
+    }
+
+#endif
+
+    /*
+     * apply last round and
+     * map cipher state to byte array block:
+     */
+    s0 =
+        (Te4_3[byte(t0, 3)]) ^
+        (Te4_2[byte(t1, 2)]) ^
+        (Te4_1[byte(t2, 1)]) ^
+        (Te4_0[byte(t3, 0)]) ^
+        rk[0];
+    STORE32H(s0, ct);
+    s1 =
+        (Te4_3[byte(t1, 3)]) ^
+        (Te4_2[byte(t2, 2)]) ^
+        (Te4_1[byte(t3, 1)]) ^
+        (Te4_0[byte(t0, 0)]) ^
+        rk[1];
+    STORE32H(s1, ct+4);
+    s2 =
+        (Te4_3[byte(t2, 3)]) ^
+        (Te4_2[byte(t3, 2)]) ^
+        (Te4_1[byte(t0, 1)]) ^
+        (Te4_0[byte(t1, 0)]) ^
+        rk[2];
+    STORE32H(s2, ct+8);
+    s3 =
+        (Te4_3[byte(t3, 3)]) ^
+        (Te4_2[byte(t0, 2)]) ^
+        (Te4_1[byte(t1, 1)]) ^
+        (Te4_0[byte(t2, 0)]) ^ 
+        rk[3];
+    STORE32H(s3, ct+12);
+
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) 
+{
+   int err = _rijndael_ecb_encrypt(pt, ct, skey);
+   burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2);
+   return err;
+}
+#endif
+
+#ifndef ENCRYPT_ONLY 
+
+/**
+  Decrypts a block of text with AES
+  @param ct The input ciphertext (16 bytes)
+  @param pt The output plaintext (16 bytes)
+  @param skey The key as scheduled 
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) 
+#else
+int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#endif
+{
+    ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk;
+    int Nr, r;
+
+    LTC_ARGCHK(pt != NULL);
+    LTC_ARGCHK(ct != NULL);
+    LTC_ARGCHK(skey != NULL);
+    
+    Nr = skey->rijndael.Nr;
+    rk = skey->rijndael.dK;
+
+    /*
+     * map byte array block to cipher state
+     * and add initial round key:
+     */
+    LOAD32H(s0, ct      ); s0 ^= rk[0];
+    LOAD32H(s1, ct  +  4); s1 ^= rk[1];
+    LOAD32H(s2, ct  +  8); s2 ^= rk[2];
+    LOAD32H(s3, ct  + 12); s3 ^= rk[3];
+
+#ifdef LTC_SMALL_CODE
+    for (r = 0; ; r++) {
+        rk += 4;
+        t0 =
+            Td0(byte(s0, 3)) ^
+            Td1(byte(s3, 2)) ^
+            Td2(byte(s2, 1)) ^
+            Td3(byte(s1, 0)) ^
+            rk[0];
+        t1 =
+            Td0(byte(s1, 3)) ^
+            Td1(byte(s0, 2)) ^
+            Td2(byte(s3, 1)) ^
+            Td3(byte(s2, 0)) ^
+            rk[1];
+        t2 =
+            Td0(byte(s2, 3)) ^
+            Td1(byte(s1, 2)) ^
+            Td2(byte(s0, 1)) ^
+            Td3(byte(s3, 0)) ^
+            rk[2];
+        t3 =
+            Td0(byte(s3, 3)) ^
+            Td1(byte(s2, 2)) ^
+            Td2(byte(s1, 1)) ^
+            Td3(byte(s0, 0)) ^
+            rk[3];
+        if (r == Nr-2) {
+           break; 
+        }
+        s0 = t0; s1 = t1; s2 = t2; s3 = t3;
+    }
+    rk += 4;
+
+#else       
+
+    /*
+     * Nr - 1 full rounds:
+     */
+    r = Nr >> 1;
+    for (;;) {
+
+        t0 =
+            Td0(byte(s0, 3)) ^
+            Td1(byte(s3, 2)) ^
+            Td2(byte(s2, 1)) ^
+            Td3(byte(s1, 0)) ^
+            rk[4];
+        t1 =
+            Td0(byte(s1, 3)) ^
+            Td1(byte(s0, 2)) ^
+            Td2(byte(s3, 1)) ^
+            Td3(byte(s2, 0)) ^
+            rk[5];
+        t2 =
+            Td0(byte(s2, 3)) ^
+            Td1(byte(s1, 2)) ^
+            Td2(byte(s0, 1)) ^
+            Td3(byte(s3, 0)) ^
+            rk[6];
+        t3 =
+            Td0(byte(s3, 3)) ^
+            Td1(byte(s2, 2)) ^
+            Td2(byte(s1, 1)) ^
+            Td3(byte(s0, 0)) ^
+            rk[7];
+
+        rk += 8;
+        if (--r == 0) {
+            break;
+        }
+
+
+        s0 =
+            Td0(byte(t0, 3)) ^
+            Td1(byte(t3, 2)) ^
+            Td2(byte(t2, 1)) ^
+            Td3(byte(t1, 0)) ^
+            rk[0];
+        s1 =
+            Td0(byte(t1, 3)) ^
+            Td1(byte(t0, 2)) ^
+            Td2(byte(t3, 1)) ^
+            Td3(byte(t2, 0)) ^
+            rk[1];
+        s2 =
+            Td0(byte(t2, 3)) ^
+            Td1(byte(t1, 2)) ^
+            Td2(byte(t0, 1)) ^
+            Td3(byte(t3, 0)) ^
+            rk[2];
+        s3 =
+            Td0(byte(t3, 3)) ^
+            Td1(byte(t2, 2)) ^
+            Td2(byte(t1, 1)) ^
+            Td3(byte(t0, 0)) ^
+            rk[3];
+    }
+#endif
+
+    /*
+     * apply last round and
+     * map cipher state to byte array block:
+     */
+    s0 =
+        (Td4[byte(t0, 3)] & 0xff000000) ^
+        (Td4[byte(t3, 2)] & 0x00ff0000) ^
+        (Td4[byte(t2, 1)] & 0x0000ff00) ^
+        (Td4[byte(t1, 0)] & 0x000000ff) ^
+        rk[0];
+    STORE32H(s0, pt);
+    s1 =
+        (Td4[byte(t1, 3)] & 0xff000000) ^
+        (Td4[byte(t0, 2)] & 0x00ff0000) ^
+        (Td4[byte(t3, 1)] & 0x0000ff00) ^
+        (Td4[byte(t2, 0)] & 0x000000ff) ^
+        rk[1];
+    STORE32H(s1, pt+4);
+    s2 =
+        (Td4[byte(t2, 3)] & 0xff000000) ^
+        (Td4[byte(t1, 2)] & 0x00ff0000) ^
+        (Td4[byte(t0, 1)] & 0x0000ff00) ^
+        (Td4[byte(t3, 0)] & 0x000000ff) ^
+        rk[2];
+    STORE32H(s2, pt+8);
+    s3 =
+        (Td4[byte(t3, 3)] & 0xff000000) ^
+        (Td4[byte(t2, 2)] & 0x00ff0000) ^
+        (Td4[byte(t1, 1)] & 0x0000ff00) ^
+        (Td4[byte(t0, 0)] & 0x000000ff) ^
+        rk[3];
+    STORE32H(s3, pt+12);
+
+    return CRYPT_OK;
+}
+
+
+#ifdef LTC_CLEAN_STACK
+int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) 
+{
+   int err = _rijndael_ecb_decrypt(ct, pt, skey);
+   burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2);
+   return err;
+}
+#endif
+
+/**
+  Performs a self-test of the AES block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int ECB_TEST(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+ int err;
+ static const struct {
+     int keylen;
+     unsigned char key[32], pt[16], ct[16];
+ } tests[] = {
+    { 16,
+      { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 
+        0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, 
+      { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77,
+        0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff },
+      { 0x69, 0xc4, 0xe0, 0xd8, 0x6a, 0x7b, 0x04, 0x30, 
+        0xd8, 0xcd, 0xb7, 0x80, 0x70, 0xb4, 0xc5, 0x5a }
+    }, { 
+      24,
+      { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 
+        0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
+        0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17 },
+      { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77,
+        0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff },
+      { 0xdd, 0xa9, 0x7c, 0xa4, 0x86, 0x4c, 0xdf, 0xe0, 
+        0x6e, 0xaf, 0x70, 0xa0, 0xec, 0x0d, 0x71, 0x91 }
+    }, {
+      32,
+      { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 
+        0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
+        0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 
+        0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f },
+      { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77,
+        0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff },
+      { 0x8e, 0xa2, 0xb7, 0xca, 0x51, 0x67, 0x45, 0xbf, 
+        0xea, 0xfc, 0x49, 0x90, 0x4b, 0x49, 0x60, 0x89 }
+    }
+ };
+ 
+ symmetric_key key;
+ unsigned char tmp[2][16];
+ int i, y;
+ 
+ for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+    zeromem(&key, sizeof(key));
+    if ((err = rijndael_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { 
+       return err;
+    }
+  
+    rijndael_ecb_encrypt(tests[i].pt, tmp[0], &key);
+    rijndael_ecb_decrypt(tmp[0], tmp[1], &key);
+    if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { 
+#if 0
+       printf("\n\nTest %d failed\n", i);
+       if (XMEMCMP(tmp[0], tests[i].ct, 16)) {
+          printf("CT: ");
+          for (i = 0; i < 16; i++) {
+             printf("%02x ", tmp[0][i]);
+          }
+          printf("\n");
+       } else {
+          printf("PT: ");
+          for (i = 0; i < 16; i++) {
+             printf("%02x ", tmp[1][i]);
+          }
+          printf("\n");
+       }
+#endif       
+        return CRYPT_FAIL_TESTVECTOR;
+    }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 16; y++) tmp[0][y] = 0;
+      for (y = 0; y < 1000; y++) rijndael_ecb_encrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 1000; y++) rijndael_ecb_decrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+ }       
+ return CRYPT_OK;
+ #endif
+}
+
+#endif /* ENCRYPT_ONLY */
+
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void ECB_DONE(symmetric_key *skey)
+{
+}
+
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int ECB_KS(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+
+   if (*keysize < 16)
+      return CRYPT_INVALID_KEYSIZE;
+   if (*keysize < 24) {
+      *keysize = 16;
+      return CRYPT_OK;
+   } else if (*keysize < 32) {
+      *keysize = 24;
+      return CRYPT_OK;
+   } else {
+      *keysize = 32;
+      return CRYPT_OK;
+   }
+}
+
+#endif
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/aes/aes.c,v $ */
+/* $Revision: 1.14 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/blowfish.c

@@ -0,0 +1,594 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+/**
+  @file blowfish.c
+  Implementation of the Blowfish block cipher, Tom St Denis
+*/
+#include "tomcrypt.h"
+
+#ifdef BLOWFISH
+
+const struct ltc_cipher_descriptor blowfish_desc =
+{
+    "blowfish",
+    0,
+    8, 56, 8, 16,
+    &blowfish_setup,
+    &blowfish_ecb_encrypt,
+    &blowfish_ecb_decrypt,
+    &blowfish_test,
+    &blowfish_done,
+    &blowfish_keysize,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+static const ulong32 ORIG_P[16 + 2] = {
+        0x243F6A88UL, 0x85A308D3UL, 0x13198A2EUL, 0x03707344UL,
+        0xA4093822UL, 0x299F31D0UL, 0x082EFA98UL, 0xEC4E6C89UL,
+        0x452821E6UL, 0x38D01377UL, 0xBE5466CFUL, 0x34E90C6CUL,
+        0xC0AC29B7UL, 0xC97C50DDUL, 0x3F84D5B5UL, 0xB5470917UL,
+        0x9216D5D9UL, 0x8979FB1BUL
+};
+
+static const ulong32 ORIG_S[4][256] = {
+    {   0xD1310BA6UL, 0x98DFB5ACUL, 0x2FFD72DBUL, 0xD01ADFB7UL,
+        0xB8E1AFEDUL, 0x6A267E96UL, 0xBA7C9045UL, 0xF12C7F99UL,
+        0x24A19947UL, 0xB3916CF7UL, 0x0801F2E2UL, 0x858EFC16UL,
+        0x636920D8UL, 0x71574E69UL, 0xA458FEA3UL, 0xF4933D7EUL,
+        0x0D95748FUL, 0x728EB658UL, 0x718BCD58UL, 0x82154AEEUL,
+        0x7B54A41DUL, 0xC25A59B5UL, 0x9C30D539UL, 0x2AF26013UL,
+        0xC5D1B023UL, 0x286085F0UL, 0xCA417918UL, 0xB8DB38EFUL,
+        0x8E79DCB0UL, 0x603A180EUL, 0x6C9E0E8BUL, 0xB01E8A3EUL,
+        0xD71577C1UL, 0xBD314B27UL, 0x78AF2FDAUL, 0x55605C60UL,
+        0xE65525F3UL, 0xAA55AB94UL, 0x57489862UL, 0x63E81440UL,
+        0x55CA396AUL, 0x2AAB10B6UL, 0xB4CC5C34UL, 0x1141E8CEUL,
+        0xA15486AFUL, 0x7C72E993UL, 0xB3EE1411UL, 0x636FBC2AUL,
+        0x2BA9C55DUL, 0x741831F6UL, 0xCE5C3E16UL, 0x9B87931EUL,
+        0xAFD6BA33UL, 0x6C24CF5CUL, 0x7A325381UL, 0x28958677UL,
+        0x3B8F4898UL, 0x6B4BB9AFUL, 0xC4BFE81BUL, 0x66282193UL,
+        0x61D809CCUL, 0xFB21A991UL, 0x487CAC60UL, 0x5DEC8032UL,
+        0xEF845D5DUL, 0xE98575B1UL, 0xDC262302UL, 0xEB651B88UL,
+        0x23893E81UL, 0xD396ACC5UL, 0x0F6D6FF3UL, 0x83F44239UL,
+        0x2E0B4482UL, 0xA4842004UL, 0x69C8F04AUL, 0x9E1F9B5EUL,
+        0x21C66842UL, 0xF6E96C9AUL, 0x670C9C61UL, 0xABD388F0UL,
+        0x6A51A0D2UL, 0xD8542F68UL, 0x960FA728UL, 0xAB5133A3UL,
+        0x6EEF0B6CUL, 0x137A3BE4UL, 0xBA3BF050UL, 0x7EFB2A98UL,
+        0xA1F1651DUL, 0x39AF0176UL, 0x66CA593EUL, 0x82430E88UL,
+        0x8CEE8619UL, 0x456F9FB4UL, 0x7D84A5C3UL, 0x3B8B5EBEUL,
+        0xE06F75D8UL, 0x85C12073UL, 0x401A449FUL, 0x56C16AA6UL,
+        0x4ED3AA62UL, 0x363F7706UL, 0x1BFEDF72UL, 0x429B023DUL,
+        0x37D0D724UL, 0xD00A1248UL, 0xDB0FEAD3UL, 0x49F1C09BUL,
+        0x075372C9UL, 0x80991B7BUL, 0x25D479D8UL, 0xF6E8DEF7UL,
+        0xE3FE501AUL, 0xB6794C3BUL, 0x976CE0BDUL, 0x04C006BAUL,
+        0xC1A94FB6UL, 0x409F60C4UL, 0x5E5C9EC2UL, 0x196A2463UL,
+        0x68FB6FAFUL, 0x3E6C53B5UL, 0x1339B2EBUL, 0x3B52EC6FUL,
+        0x6DFC511FUL, 0x9B30952CUL, 0xCC814544UL, 0xAF5EBD09UL,
+        0xBEE3D004UL, 0xDE334AFDUL, 0x660F2807UL, 0x192E4BB3UL,
+        0xC0CBA857UL, 0x45C8740FUL, 0xD20B5F39UL, 0xB9D3FBDBUL,
+        0x5579C0BDUL, 0x1A60320AUL, 0xD6A100C6UL, 0x402C7279UL,
+        0x679F25FEUL, 0xFB1FA3CCUL, 0x8EA5E9F8UL, 0xDB3222F8UL,
+        0x3C7516DFUL, 0xFD616B15UL, 0x2F501EC8UL, 0xAD0552ABUL,
+        0x323DB5FAUL, 0xFD238760UL, 0x53317B48UL, 0x3E00DF82UL,
+        0x9E5C57BBUL, 0xCA6F8CA0UL, 0x1A87562EUL, 0xDF1769DBUL,
+        0xD542A8F6UL, 0x287EFFC3UL, 0xAC6732C6UL, 0x8C4F5573UL,
+        0x695B27B0UL, 0xBBCA58C8UL, 0xE1FFA35DUL, 0xB8F011A0UL,
+        0x10FA3D98UL, 0xFD2183B8UL, 0x4AFCB56CUL, 0x2DD1D35BUL,
+        0x9A53E479UL, 0xB6F84565UL, 0xD28E49BCUL, 0x4BFB9790UL,
+        0xE1DDF2DAUL, 0xA4CB7E33UL, 0x62FB1341UL, 0xCEE4C6E8UL,
+        0xEF20CADAUL, 0x36774C01UL, 0xD07E9EFEUL, 0x2BF11FB4UL,
+        0x95DBDA4DUL, 0xAE909198UL, 0xEAAD8E71UL, 0x6B93D5A0UL,
+        0xD08ED1D0UL, 0xAFC725E0UL, 0x8E3C5B2FUL, 0x8E7594B7UL,
+        0x8FF6E2FBUL, 0xF2122B64UL, 0x8888B812UL, 0x900DF01CUL,
+        0x4FAD5EA0UL, 0x688FC31CUL, 0xD1CFF191UL, 0xB3A8C1ADUL,
+        0x2F2F2218UL, 0xBE0E1777UL, 0xEA752DFEUL, 0x8B021FA1UL,
+        0xE5A0CC0FUL, 0xB56F74E8UL, 0x18ACF3D6UL, 0xCE89E299UL,
+        0xB4A84FE0UL, 0xFD13E0B7UL, 0x7CC43B81UL, 0xD2ADA8D9UL,
+        0x165FA266UL, 0x80957705UL, 0x93CC7314UL, 0x211A1477UL,
+        0xE6AD2065UL, 0x77B5FA86UL, 0xC75442F5UL, 0xFB9D35CFUL,
+        0xEBCDAF0CUL, 0x7B3E89A0UL, 0xD6411BD3UL, 0xAE1E7E49UL,
+        0x00250E2DUL, 0x2071B35EUL, 0x226800BBUL, 0x57B8E0AFUL,
+        0x2464369BUL, 0xF009B91EUL, 0x5563911DUL, 0x59DFA6AAUL,
+        0x78C14389UL, 0xD95A537FUL, 0x207D5BA2UL, 0x02E5B9C5UL,
+        0x83260376UL, 0x6295CFA9UL, 0x11C81968UL, 0x4E734A41UL,
+        0xB3472DCAUL, 0x7B14A94AUL, 0x1B510052UL, 0x9A532915UL,
+        0xD60F573FUL, 0xBC9BC6E4UL, 0x2B60A476UL, 0x81E67400UL,
+        0x08BA6FB5UL, 0x571BE91FUL, 0xF296EC6BUL, 0x2A0DD915UL,
+        0xB6636521UL, 0xE7B9F9B6UL, 0xFF34052EUL, 0xC5855664UL,
+        0x53B02D5DUL, 0xA99F8FA1UL, 0x08BA4799UL, 0x6E85076AUL   },
+    {   0x4B7A70E9UL, 0xB5B32944UL, 0xDB75092EUL, 0xC4192623UL,
+        0xAD6EA6B0UL, 0x49A7DF7DUL, 0x9CEE60B8UL, 0x8FEDB266UL,
+        0xECAA8C71UL, 0x699A17FFUL, 0x5664526CUL, 0xC2B19EE1UL,
+        0x193602A5UL, 0x75094C29UL, 0xA0591340UL, 0xE4183A3EUL,
+        0x3F54989AUL, 0x5B429D65UL, 0x6B8FE4D6UL, 0x99F73FD6UL,
+        0xA1D29C07UL, 0xEFE830F5UL, 0x4D2D38E6UL, 0xF0255DC1UL,
+        0x4CDD2086UL, 0x8470EB26UL, 0x6382E9C6UL, 0x021ECC5EUL,
+        0x09686B3FUL, 0x3EBAEFC9UL, 0x3C971814UL, 0x6B6A70A1UL,
+        0x687F3584UL, 0x52A0E286UL, 0xB79C5305UL, 0xAA500737UL,
+        0x3E07841CUL, 0x7FDEAE5CUL, 0x8E7D44ECUL, 0x5716F2B8UL,
+        0xB03ADA37UL, 0xF0500C0DUL, 0xF01C1F04UL, 0x0200B3FFUL,
+        0xAE0CF51AUL, 0x3CB574B2UL, 0x25837A58UL, 0xDC0921BDUL,
+        0xD19113F9UL, 0x7CA92FF6UL, 0x94324773UL, 0x22F54701UL,
+        0x3AE5E581UL, 0x37C2DADCUL, 0xC8B57634UL, 0x9AF3DDA7UL,
+        0xA9446146UL, 0x0FD0030EUL, 0xECC8C73EUL, 0xA4751E41UL,
+        0xE238CD99UL, 0x3BEA0E2FUL, 0x3280BBA1UL, 0x183EB331UL,
+        0x4E548B38UL, 0x4F6DB908UL, 0x6F420D03UL, 0xF60A04BFUL,
+        0x2CB81290UL, 0x24977C79UL, 0x5679B072UL, 0xBCAF89AFUL,
+        0xDE9A771FUL, 0xD9930810UL, 0xB38BAE12UL, 0xDCCF3F2EUL,
+        0x5512721FUL, 0x2E6B7124UL, 0x501ADDE6UL, 0x9F84CD87UL,
+        0x7A584718UL, 0x7408DA17UL, 0xBC9F9ABCUL, 0xE94B7D8CUL,
+        0xEC7AEC3AUL, 0xDB851DFAUL, 0x63094366UL, 0xC464C3D2UL,
+        0xEF1C1847UL, 0x3215D908UL, 0xDD433B37UL, 0x24C2BA16UL,
+        0x12A14D43UL, 0x2A65C451UL, 0x50940002UL, 0x133AE4DDUL,
+        0x71DFF89EUL, 0x10314E55UL, 0x81AC77D6UL, 0x5F11199BUL,
+        0x043556F1UL, 0xD7A3C76BUL, 0x3C11183BUL, 0x5924A509UL,
+        0xF28FE6EDUL, 0x97F1FBFAUL, 0x9EBABF2CUL, 0x1E153C6EUL,
+        0x86E34570UL, 0xEAE96FB1UL, 0x860E5E0AUL, 0x5A3E2AB3UL,
+        0x771FE71CUL, 0x4E3D06FAUL, 0x2965DCB9UL, 0x99E71D0FUL,
+        0x803E89D6UL, 0x5266C825UL, 0x2E4CC978UL, 0x9C10B36AUL,
+        0xC6150EBAUL, 0x94E2EA78UL, 0xA5FC3C53UL, 0x1E0A2DF4UL,
+        0xF2F74EA7UL, 0x361D2B3DUL, 0x1939260FUL, 0x19C27960UL,
+        0x5223A708UL, 0xF71312B6UL, 0xEBADFE6EUL, 0xEAC31F66UL,
+        0xE3BC4595UL, 0xA67BC883UL, 0xB17F37D1UL, 0x018CFF28UL,
+        0xC332DDEFUL, 0xBE6C5AA5UL, 0x65582185UL, 0x68AB9802UL,
+        0xEECEA50FUL, 0xDB2F953BUL, 0x2AEF7DADUL, 0x5B6E2F84UL,
+        0x1521B628UL, 0x29076170UL, 0xECDD4775UL, 0x619F1510UL,
+        0x13CCA830UL, 0xEB61BD96UL, 0x0334FE1EUL, 0xAA0363CFUL,
+        0xB5735C90UL, 0x4C70A239UL, 0xD59E9E0BUL, 0xCBAADE14UL,
+        0xEECC86BCUL, 0x60622CA7UL, 0x9CAB5CABUL, 0xB2F3846EUL,
+        0x648B1EAFUL, 0x19BDF0CAUL, 0xA02369B9UL, 0x655ABB50UL,
+        0x40685A32UL, 0x3C2AB4B3UL, 0x319EE9D5UL, 0xC021B8F7UL,
+        0x9B540B19UL, 0x875FA099UL, 0x95F7997EUL, 0x623D7DA8UL,
+        0xF837889AUL, 0x97E32D77UL, 0x11ED935FUL, 0x16681281UL,
+        0x0E358829UL, 0xC7E61FD6UL, 0x96DEDFA1UL, 0x7858BA99UL,
+        0x57F584A5UL, 0x1B227263UL, 0x9B83C3FFUL, 0x1AC24696UL,
+        0xCDB30AEBUL, 0x532E3054UL, 0x8FD948E4UL, 0x6DBC3128UL,
+        0x58EBF2EFUL, 0x34C6FFEAUL, 0xFE28ED61UL, 0xEE7C3C73UL,
+        0x5D4A14D9UL, 0xE864B7E3UL, 0x42105D14UL, 0x203E13E0UL,
+        0x45EEE2B6UL, 0xA3AAABEAUL, 0xDB6C4F15UL, 0xFACB4FD0UL,
+        0xC742F442UL, 0xEF6ABBB5UL, 0x654F3B1DUL, 0x41CD2105UL,
+        0xD81E799EUL, 0x86854DC7UL, 0xE44B476AUL, 0x3D816250UL,
+        0xCF62A1F2UL, 0x5B8D2646UL, 0xFC8883A0UL, 0xC1C7B6A3UL,
+        0x7F1524C3UL, 0x69CB7492UL, 0x47848A0BUL, 0x5692B285UL,
+        0x095BBF00UL, 0xAD19489DUL, 0x1462B174UL, 0x23820E00UL,
+        0x58428D2AUL, 0x0C55F5EAUL, 0x1DADF43EUL, 0x233F7061UL,
+        0x3372F092UL, 0x8D937E41UL, 0xD65FECF1UL, 0x6C223BDBUL,
+        0x7CDE3759UL, 0xCBEE7460UL, 0x4085F2A7UL, 0xCE77326EUL,
+        0xA6078084UL, 0x19F8509EUL, 0xE8EFD855UL, 0x61D99735UL,
+        0xA969A7AAUL, 0xC50C06C2UL, 0x5A04ABFCUL, 0x800BCADCUL,
+        0x9E447A2EUL, 0xC3453484UL, 0xFDD56705UL, 0x0E1E9EC9UL,
+        0xDB73DBD3UL, 0x105588CDUL, 0x675FDA79UL, 0xE3674340UL,
+        0xC5C43465UL, 0x713E38D8UL, 0x3D28F89EUL, 0xF16DFF20UL,
+        0x153E21E7UL, 0x8FB03D4AUL, 0xE6E39F2BUL, 0xDB83ADF7UL   },
+    {   0xE93D5A68UL, 0x948140F7UL, 0xF64C261CUL, 0x94692934UL,
+        0x411520F7UL, 0x7602D4F7UL, 0xBCF46B2EUL, 0xD4A20068UL,
+        0xD4082471UL, 0x3320F46AUL, 0x43B7D4B7UL, 0x500061AFUL,
+        0x1E39F62EUL, 0x97244546UL, 0x14214F74UL, 0xBF8B8840UL,
+        0x4D95FC1DUL, 0x96B591AFUL, 0x70F4DDD3UL, 0x66A02F45UL,
+        0xBFBC09ECUL, 0x03BD9785UL, 0x7FAC6DD0UL, 0x31CB8504UL,
+        0x96EB27B3UL, 0x55FD3941UL, 0xDA2547E6UL, 0xABCA0A9AUL,
+        0x28507825UL, 0x530429F4UL, 0x0A2C86DAUL, 0xE9B66DFBUL,
+        0x68DC1462UL, 0xD7486900UL, 0x680EC0A4UL, 0x27A18DEEUL,
+        0x4F3FFEA2UL, 0xE887AD8CUL, 0xB58CE006UL, 0x7AF4D6B6UL,
+        0xAACE1E7CUL, 0xD3375FECUL, 0xCE78A399UL, 0x406B2A42UL,
+        0x20FE9E35UL, 0xD9F385B9UL, 0xEE39D7ABUL, 0x3B124E8BUL,
+        0x1DC9FAF7UL, 0x4B6D1856UL, 0x26A36631UL, 0xEAE397B2UL,
+        0x3A6EFA74UL, 0xDD5B4332UL, 0x6841E7F7UL, 0xCA7820FBUL,
+        0xFB0AF54EUL, 0xD8FEB397UL, 0x454056ACUL, 0xBA489527UL,
+        0x55533A3AUL, 0x20838D87UL, 0xFE6BA9B7UL, 0xD096954BUL,
+        0x55A867BCUL, 0xA1159A58UL, 0xCCA92963UL, 0x99E1DB33UL,
+        0xA62A4A56UL, 0x3F3125F9UL, 0x5EF47E1CUL, 0x9029317CUL,
+        0xFDF8E802UL, 0x04272F70UL, 0x80BB155CUL, 0x05282CE3UL,
+        0x95C11548UL, 0xE4C66D22UL, 0x48C1133FUL, 0xC70F86DCUL,
+        0x07F9C9EEUL, 0x41041F0FUL, 0x404779A4UL, 0x5D886E17UL,
+        0x325F51EBUL, 0xD59BC0D1UL, 0xF2BCC18FUL, 0x41113564UL,
+        0x257B7834UL, 0x602A9C60UL, 0xDFF8E8A3UL, 0x1F636C1BUL,
+        0x0E12B4C2UL, 0x02E1329EUL, 0xAF664FD1UL, 0xCAD18115UL,
+        0x6B2395E0UL, 0x333E92E1UL, 0x3B240B62UL, 0xEEBEB922UL,
+        0x85B2A20EUL, 0xE6BA0D99UL, 0xDE720C8CUL, 0x2DA2F728UL,
+        0xD0127845UL, 0x95B794FDUL, 0x647D0862UL, 0xE7CCF5F0UL,
+        0x5449A36FUL, 0x877D48FAUL, 0xC39DFD27UL, 0xF33E8D1EUL,
+        0x0A476341UL, 0x992EFF74UL, 0x3A6F6EABUL, 0xF4F8FD37UL,
+        0xA812DC60UL, 0xA1EBDDF8UL, 0x991BE14CUL, 0xDB6E6B0DUL,
+        0xC67B5510UL, 0x6D672C37UL, 0x2765D43BUL, 0xDCD0E804UL,
+        0xF1290DC7UL, 0xCC00FFA3UL, 0xB5390F92UL, 0x690FED0BUL,
+        0x667B9FFBUL, 0xCEDB7D9CUL, 0xA091CF0BUL, 0xD9155EA3UL,
+        0xBB132F88UL, 0x515BAD24UL, 0x7B9479BFUL, 0x763BD6EBUL,
+        0x37392EB3UL, 0xCC115979UL, 0x8026E297UL, 0xF42E312DUL,
+        0x6842ADA7UL, 0xC66A2B3BUL, 0x12754CCCUL, 0x782EF11CUL,
+        0x6A124237UL, 0xB79251E7UL, 0x06A1BBE6UL, 0x4BFB6350UL,
+        0x1A6B1018UL, 0x11CAEDFAUL, 0x3D25BDD8UL, 0xE2E1C3C9UL,
+        0x44421659UL, 0x0A121386UL, 0xD90CEC6EUL, 0xD5ABEA2AUL,
+        0x64AF674EUL, 0xDA86A85FUL, 0xBEBFE988UL, 0x64E4C3FEUL,
+        0x9DBC8057UL, 0xF0F7C086UL, 0x60787BF8UL, 0x6003604DUL,
+        0xD1FD8346UL, 0xF6381FB0UL, 0x7745AE04UL, 0xD736FCCCUL,
+        0x83426B33UL, 0xF01EAB71UL, 0xB0804187UL, 0x3C005E5FUL,
+        0x77A057BEUL, 0xBDE8AE24UL, 0x55464299UL, 0xBF582E61UL,
+        0x4E58F48FUL, 0xF2DDFDA2UL, 0xF474EF38UL, 0x8789BDC2UL,
+        0x5366F9C3UL, 0xC8B38E74UL, 0xB475F255UL, 0x46FCD9B9UL,
+        0x7AEB2661UL, 0x8B1DDF84UL, 0x846A0E79UL, 0x915F95E2UL,
+        0x466E598EUL, 0x20B45770UL, 0x8CD55591UL, 0xC902DE4CUL,
+        0xB90BACE1UL, 0xBB8205D0UL, 0x11A86248UL, 0x7574A99EUL,
+        0xB77F19B6UL, 0xE0A9DC09UL, 0x662D09A1UL, 0xC4324633UL,
+        0xE85A1F02UL, 0x09F0BE8CUL, 0x4A99A025UL, 0x1D6EFE10UL,
+        0x1AB93D1DUL, 0x0BA5A4DFUL, 0xA186F20FUL, 0x2868F169UL,
+        0xDCB7DA83UL, 0x573906FEUL, 0xA1E2CE9BUL, 0x4FCD7F52UL,
+        0x50115E01UL, 0xA70683FAUL, 0xA002B5C4UL, 0x0DE6D027UL,
+        0x9AF88C27UL, 0x773F8641UL, 0xC3604C06UL, 0x61A806B5UL,
+        0xF0177A28UL, 0xC0F586E0UL, 0x006058AAUL, 0x30DC7D62UL,
+        0x11E69ED7UL, 0x2338EA63UL, 0x53C2DD94UL, 0xC2C21634UL,
+        0xBBCBEE56UL, 0x90BCB6DEUL, 0xEBFC7DA1UL, 0xCE591D76UL,
+        0x6F05E409UL, 0x4B7C0188UL, 0x39720A3DUL, 0x7C927C24UL,
+        0x86E3725FUL, 0x724D9DB9UL, 0x1AC15BB4UL, 0xD39EB8FCUL,
+        0xED545578UL, 0x08FCA5B5UL, 0xD83D7CD3UL, 0x4DAD0FC4UL,
+        0x1E50EF5EUL, 0xB161E6F8UL, 0xA28514D9UL, 0x6C51133CUL,
+        0x6FD5C7E7UL, 0x56E14EC4UL, 0x362ABFCEUL, 0xDDC6C837UL,
+        0xD79A3234UL, 0x92638212UL, 0x670EFA8EUL, 0x406000E0UL  },
+    {   0x3A39CE37UL, 0xD3FAF5CFUL, 0xABC27737UL, 0x5AC52D1BUL,
+        0x5CB0679EUL, 0x4FA33742UL, 0xD3822740UL, 0x99BC9BBEUL,
+        0xD5118E9DUL, 0xBF0F7315UL, 0xD62D1C7EUL, 0xC700C47BUL,
+        0xB78C1B6BUL, 0x21A19045UL, 0xB26EB1BEUL, 0x6A366EB4UL,
+        0x5748AB2FUL, 0xBC946E79UL, 0xC6A376D2UL, 0x6549C2C8UL,
+        0x530FF8EEUL, 0x468DDE7DUL, 0xD5730A1DUL, 0x4CD04DC6UL,
+        0x2939BBDBUL, 0xA9BA4650UL, 0xAC9526E8UL, 0xBE5EE304UL,
+        0xA1FAD5F0UL, 0x6A2D519AUL, 0x63EF8CE2UL, 0x9A86EE22UL,
+        0xC089C2B8UL, 0x43242EF6UL, 0xA51E03AAUL, 0x9CF2D0A4UL,
+        0x83C061BAUL, 0x9BE96A4DUL, 0x8FE51550UL, 0xBA645BD6UL,
+        0x2826A2F9UL, 0xA73A3AE1UL, 0x4BA99586UL, 0xEF5562E9UL,
+        0xC72FEFD3UL, 0xF752F7DAUL, 0x3F046F69UL, 0x77FA0A59UL,
+        0x80E4A915UL, 0x87B08601UL, 0x9B09E6ADUL, 0x3B3EE593UL,
+        0xE990FD5AUL, 0x9E34D797UL, 0x2CF0B7D9UL, 0x022B8B51UL,
+        0x96D5AC3AUL, 0x017DA67DUL, 0xD1CF3ED6UL, 0x7C7D2D28UL,
+        0x1F9F25CFUL, 0xADF2B89BUL, 0x5AD6B472UL, 0x5A88F54CUL,
+        0xE029AC71UL, 0xE019A5E6UL, 0x47B0ACFDUL, 0xED93FA9BUL,
+        0xE8D3C48DUL, 0x283B57CCUL, 0xF8D56629UL, 0x79132E28UL,
+        0x785F0191UL, 0xED756055UL, 0xF7960E44UL, 0xE3D35E8CUL,
+        0x15056DD4UL, 0x88F46DBAUL, 0x03A16125UL, 0x0564F0BDUL,
+        0xC3EB9E15UL, 0x3C9057A2UL, 0x97271AECUL, 0xA93A072AUL,
+        0x1B3F6D9BUL, 0x1E6321F5UL, 0xF59C66FBUL, 0x26DCF319UL,
+        0x7533D928UL, 0xB155FDF5UL, 0x03563482UL, 0x8ABA3CBBUL,
+        0x28517711UL, 0xC20AD9F8UL, 0xABCC5167UL, 0xCCAD925FUL,
+        0x4DE81751UL, 0x3830DC8EUL, 0x379D5862UL, 0x9320F991UL,
+        0xEA7A90C2UL, 0xFB3E7BCEUL, 0x5121CE64UL, 0x774FBE32UL,
+        0xA8B6E37EUL, 0xC3293D46UL, 0x48DE5369UL, 0x6413E680UL,
+        0xA2AE0810UL, 0xDD6DB224UL, 0x69852DFDUL, 0x09072166UL,
+        0xB39A460AUL, 0x6445C0DDUL, 0x586CDECFUL, 0x1C20C8AEUL,
+        0x5BBEF7DDUL, 0x1B588D40UL, 0xCCD2017FUL, 0x6BB4E3BBUL,
+        0xDDA26A7EUL, 0x3A59FF45UL, 0x3E350A44UL, 0xBCB4CDD5UL,
+        0x72EACEA8UL, 0xFA6484BBUL, 0x8D6612AEUL, 0xBF3C6F47UL,
+        0xD29BE463UL, 0x542F5D9EUL, 0xAEC2771BUL, 0xF64E6370UL,
+        0x740E0D8DUL, 0xE75B1357UL, 0xF8721671UL, 0xAF537D5DUL,
+        0x4040CB08UL, 0x4EB4E2CCUL, 0x34D2466AUL, 0x0115AF84UL,
+        0xE1B00428UL, 0x95983A1DUL, 0x06B89FB4UL, 0xCE6EA048UL,
+        0x6F3F3B82UL, 0x3520AB82UL, 0x011A1D4BUL, 0x277227F8UL,
+        0x611560B1UL, 0xE7933FDCUL, 0xBB3A792BUL, 0x344525BDUL,
+        0xA08839E1UL, 0x51CE794BUL, 0x2F32C9B7UL, 0xA01FBAC9UL,
+        0xE01CC87EUL, 0xBCC7D1F6UL, 0xCF0111C3UL, 0xA1E8AAC7UL,
+        0x1A908749UL, 0xD44FBD9AUL, 0xD0DADECBUL, 0xD50ADA38UL,
+        0x0339C32AUL, 0xC6913667UL, 0x8DF9317CUL, 0xE0B12B4FUL,
+        0xF79E59B7UL, 0x43F5BB3AUL, 0xF2D519FFUL, 0x27D9459CUL,
+        0xBF97222CUL, 0x15E6FC2AUL, 0x0F91FC71UL, 0x9B941525UL,
+        0xFAE59361UL, 0xCEB69CEBUL, 0xC2A86459UL, 0x12BAA8D1UL,
+        0xB6C1075EUL, 0xE3056A0CUL, 0x10D25065UL, 0xCB03A442UL,
+        0xE0EC6E0EUL, 0x1698DB3BUL, 0x4C98A0BEUL, 0x3278E964UL,
+        0x9F1F9532UL, 0xE0D392DFUL, 0xD3A0342BUL, 0x8971F21EUL,
+        0x1B0A7441UL, 0x4BA3348CUL, 0xC5BE7120UL, 0xC37632D8UL,
+        0xDF359F8DUL, 0x9B992F2EUL, 0xE60B6F47UL, 0x0FE3F11DUL,
+        0xE54CDA54UL, 0x1EDAD891UL, 0xCE6279CFUL, 0xCD3E7E6FUL,
+        0x1618B166UL, 0xFD2C1D05UL, 0x848FD2C5UL, 0xF6FB2299UL,
+        0xF523F357UL, 0xA6327623UL, 0x93A83531UL, 0x56CCCD02UL,
+        0xACF08162UL, 0x5A75EBB5UL, 0x6E163697UL, 0x88D273CCUL,
+        0xDE966292UL, 0x81B949D0UL, 0x4C50901BUL, 0x71C65614UL,
+        0xE6C6C7BDUL, 0x327A140AUL, 0x45E1D006UL, 0xC3F27B9AUL,
+        0xC9AA53FDUL, 0x62A80F00UL, 0xBB25BFE2UL, 0x35BDD2F6UL,
+        0x71126905UL, 0xB2040222UL, 0xB6CBCF7CUL, 0xCD769C2BUL,
+        0x53113EC0UL, 0x1640E3D3UL, 0x38ABBD60UL, 0x2547ADF0UL,
+        0xBA38209CUL, 0xF746CE76UL, 0x77AFA1C5UL, 0x20756060UL,
+        0x85CBFE4EUL, 0x8AE88DD8UL, 0x7AAAF9B0UL, 0x4CF9AA7EUL,
+        0x1948C25CUL, 0x02FB8A8CUL, 0x01C36AE4UL, 0xD6EBE1F9UL,
+        0x90D4F869UL, 0xA65CDEA0UL, 0x3F09252DUL, 0xC208E69FUL,
+        0xB74E6132UL, 0xCE77E25BUL, 0x578FDFE3UL, 0x3AC372E6UL  }
+};
+
+ /**
+    Initialize the Blowfish block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+int blowfish_setup(const unsigned char *key, int keylen, int num_rounds,
+                   symmetric_key *skey)
+{
+   ulong32 x, y, z, A;
+   unsigned char B[8];
+
+   LTC_ARGCHK(key != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   /* check key length */
+   if (keylen < 8 || keylen > 56) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+
+   /* check rounds */
+   if (num_rounds != 0 && num_rounds != 16) {
+      return CRYPT_INVALID_ROUNDS;
+   }   
+
+   /* load in key bytes (Supplied by David Hopwood) */
+   for (x = y = 0; x < 18; x++) {
+       A = 0;
+       for (z = 0; z < 4; z++) {
+           A = (A << 8) | ((ulong32)key[y++] & 255);
+           if (y == (ulong32)keylen) { 
+              y = 0; 
+           }
+       }
+       skey->blowfish.K[x] = ORIG_P[x] ^ A;
+   }
+
+   /* copy sboxes */
+   for (x = 0; x < 4; x++) {
+       for (y = 0; y < 256; y++) {
+           skey->blowfish.S[x][y] = ORIG_S[x][y];
+       }
+   }
+
+   /* encrypt K array */
+   for (x = 0; x < 8; x++) {
+       B[x] = 0;
+   }
+   
+   for (x = 0; x < 18; x += 2) {
+       /* encrypt it */
+       blowfish_ecb_encrypt(B, B, skey);
+       /* copy it */
+       LOAD32H(skey->blowfish.K[x], &B[0]);
+       LOAD32H(skey->blowfish.K[x+1], &B[4]);
+   }
+
+   /* encrypt S array */
+   for (x = 0; x < 4; x++) {
+       for (y = 0; y < 256; y += 2) {
+          /* encrypt it */
+          blowfish_ecb_encrypt(B, B, skey);
+          /* copy it */
+          LOAD32H(skey->blowfish.S[x][y], &B[0]);
+          LOAD32H(skey->blowfish.S[x][y+1], &B[4]);
+       }
+   }
+
+#ifdef LTC_CLEAN_STACK
+   zeromem(B, sizeof(B));
+#endif
+
+   return CRYPT_OK;
+}
+
+#ifndef __GNUC__
+#define F(x) ((S1[byte(x,3)] + S2[byte(x,2)]) ^ S3[byte(x,1)]) + S4[byte(x,0)]
+#else
+#define F(x) ((skey->blowfish.S[0][byte(x,3)] + skey->blowfish.S[1][byte(x,2)]) ^ skey->blowfish.S[2][byte(x,1)]) + skey->blowfish.S[3][byte(x,0)]
+#endif
+
+/**
+  Encrypts a block of text with Blowfish
+  @param pt The input plaintext (8 bytes)
+  @param ct The output ciphertext (8 bytes)
+  @param skey The key as scheduled
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#else
+int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#endif
+{
+   ulong32 L, R;
+   int r;
+#ifndef __GNUC__
+   ulong32 *S1, *S2, *S3, *S4;
+#endif
+
+    LTC_ARGCHK(pt   != NULL);
+    LTC_ARGCHK(ct   != NULL);
+    LTC_ARGCHK(skey != NULL);
+
+#ifndef __GNUC__
+    S1 = skey->blowfish.S[0];
+    S2 = skey->blowfish.S[1];
+    S3 = skey->blowfish.S[2];
+    S4 = skey->blowfish.S[3];
+#endif
+
+   /* load it */
+   LOAD32H(L, &pt[0]);
+   LOAD32H(R, &pt[4]);
+
+   /* do 16 rounds */
+   for (r = 0; r < 16; ) {
+      L ^= skey->blowfish.K[r++];  R ^= F(L);
+      R ^= skey->blowfish.K[r++];  L ^= F(R);
+      L ^= skey->blowfish.K[r++];  R ^= F(L);
+      R ^= skey->blowfish.K[r++];  L ^= F(R);
+   }
+
+   /* last keying */
+   R ^= skey->blowfish.K[17];
+   L ^= skey->blowfish.K[16];
+
+   /* store */
+   STORE32H(R, &ct[0]);
+   STORE32H(L, &ct[4]);
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+    int err = _blowfish_ecb_encrypt(pt, ct, skey);
+    burn_stack(sizeof(ulong32) * 2 + sizeof(int));
+    return err;
+}
+#endif
+
+/**
+  Decrypts a block of text with Blowfish
+  @param ct The input ciphertext (8 bytes)
+  @param pt The output plaintext (8 bytes)
+  @param skey The key as scheduled 
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#else
+int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#endif
+{
+   ulong32 L, R;
+   int r;
+#ifndef __GNUC__
+   ulong32 *S1, *S2, *S3, *S4;
+#endif
+
+    LTC_ARGCHK(pt   != NULL);
+    LTC_ARGCHK(ct   != NULL);
+    LTC_ARGCHK(skey != NULL);
+    
+#ifndef __GNUC__
+    S1 = skey->blowfish.S[0];
+    S2 = skey->blowfish.S[1];
+    S3 = skey->blowfish.S[2];
+    S4 = skey->blowfish.S[3];
+#endif
+
+   /* load it */
+   LOAD32H(R, &ct[0]);
+   LOAD32H(L, &ct[4]);
+
+   /* undo last keying */
+   R ^= skey->blowfish.K[17];
+   L ^= skey->blowfish.K[16];
+
+   /* do 16 rounds */
+   for (r = 15; r > 0; ) {
+      L ^= F(R); R ^= skey->blowfish.K[r--];
+      R ^= F(L); L ^= skey->blowfish.K[r--];
+      L ^= F(R); R ^= skey->blowfish.K[r--];
+      R ^= F(L); L ^= skey->blowfish.K[r--];
+   }
+
+   /* store */
+   STORE32H(L, &pt[0]);
+   STORE32H(R, &pt[4]);
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+    int err = _blowfish_ecb_decrypt(ct, pt, skey);
+    burn_stack(sizeof(ulong32) * 2 + sizeof(int));
+    return err;
+}
+#endif
+
+
+/**
+  Performs a self-test of the Blowfish block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int blowfish_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   int err;
+   symmetric_key key;
+   static const struct {
+          unsigned char key[8], pt[8], ct[8];
+   } tests[] = {
+       {
+           { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00},
+           { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00},
+           { 0x4E, 0xF9, 0x97, 0x45, 0x61, 0x98, 0xDD, 0x78}
+       },
+       {
+           { 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF},
+           { 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF},
+           { 0x51, 0x86, 0x6F, 0xD5, 0xB8, 0x5E, 0xCB, 0x8A}
+       },
+       {
+           { 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00},
+           { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01},
+           { 0x7D, 0x85, 0x6F, 0x9A, 0x61, 0x30, 0x63, 0xF2}
+       }
+   };
+   unsigned char tmp[2][8];
+   int x, y;
+
+   for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) {
+      /* setup key */
+      if ((err = blowfish_setup(tests[x].key, 8, 16, &key)) != CRYPT_OK) {
+         return err;
+      }
+
+      /* encrypt and decrypt */
+      blowfish_ecb_encrypt(tests[x].pt, tmp[0], &key);
+      blowfish_ecb_decrypt(tmp[0], tmp[1], &key);
+
+      /* compare */
+      if ((XMEMCMP(tmp[0], tests[x].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[x].pt, 8) != 0)) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 8; y++) tmp[0][y] = 0;
+      for (y = 0; y < 1000; y++) blowfish_ecb_encrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 1000; y++) blowfish_ecb_decrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+   }
+   return CRYPT_OK;
+ #endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void blowfish_done(symmetric_key *skey)
+{
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int blowfish_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+
+   if (*keysize < 8) {
+      return CRYPT_INVALID_KEYSIZE;
+   } else if (*keysize > 56) {
+      *keysize = 56;
+   }
+   return CRYPT_OK;
+}
+
+#endif
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/blowfish.c,v $ */
+/* $Revision: 1.12 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/cast5.c

@@ -0,0 +1,720 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+ 
+ /** 
+   @file cast5.c
+   Implementation of CAST5 (RFC 2144) by Tom St Denis 
+ */
+#include "tomcrypt.h"
+
+#ifdef CAST5
+
+const struct ltc_cipher_descriptor cast5_desc = {
+   "cast5",
+   15,
+   5, 16, 8, 16,
+   &cast5_setup,
+   &cast5_ecb_encrypt,
+   &cast5_ecb_decrypt,
+   &cast5_test,
+   &cast5_done,
+   &cast5_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+static const ulong32 S1[256] = {
+0x30fb40d4UL, 0x9fa0ff0bUL, 0x6beccd2fUL, 0x3f258c7aUL, 0x1e213f2fUL, 0x9c004dd3UL, 
+0x6003e540UL, 0xcf9fc949UL, 0xbfd4af27UL, 0x88bbbdb5UL, 0xe2034090UL, 0x98d09675UL, 
+0x6e63a0e0UL, 0x15c361d2UL, 0xc2e7661dUL, 0x22d4ff8eUL, 0x28683b6fUL, 0xc07fd059UL, 
+0xff2379c8UL, 0x775f50e2UL, 0x43c340d3UL, 0xdf2f8656UL, 0x887ca41aUL, 0xa2d2bd2dUL, 
+0xa1c9e0d6UL, 0x346c4819UL, 0x61b76d87UL, 0x22540f2fUL, 0x2abe32e1UL, 0xaa54166bUL, 
+0x22568e3aUL, 0xa2d341d0UL, 0x66db40c8UL, 0xa784392fUL, 0x004dff2fUL, 0x2db9d2deUL, 
+0x97943facUL, 0x4a97c1d8UL, 0x527644b7UL, 0xb5f437a7UL, 0xb82cbaefUL, 0xd751d159UL, 
+0x6ff7f0edUL, 0x5a097a1fUL, 0x827b68d0UL, 0x90ecf52eUL, 0x22b0c054UL, 0xbc8e5935UL, 
+0x4b6d2f7fUL, 0x50bb64a2UL, 0xd2664910UL, 0xbee5812dUL, 0xb7332290UL, 0xe93b159fUL, 
+0xb48ee411UL, 0x4bff345dUL, 0xfd45c240UL, 0xad31973fUL, 0xc4f6d02eUL, 0x55fc8165UL, 
+0xd5b1caadUL, 0xa1ac2daeUL, 0xa2d4b76dUL, 0xc19b0c50UL, 0x882240f2UL, 0x0c6e4f38UL, 
+0xa4e4bfd7UL, 0x4f5ba272UL, 0x564c1d2fUL, 0xc59c5319UL, 0xb949e354UL, 0xb04669feUL, 
+0xb1b6ab8aUL, 0xc71358ddUL, 0x6385c545UL, 0x110f935dUL, 0x57538ad5UL, 0x6a390493UL, 
+0xe63d37e0UL, 0x2a54f6b3UL, 0x3a787d5fUL, 0x6276a0b5UL, 0x19a6fcdfUL, 0x7a42206aUL, 
+0x29f9d4d5UL, 0xf61b1891UL, 0xbb72275eUL, 0xaa508167UL, 0x38901091UL, 0xc6b505ebUL, 
+0x84c7cb8cUL, 0x2ad75a0fUL, 0x874a1427UL, 0xa2d1936bUL, 0x2ad286afUL, 0xaa56d291UL, 
+0xd7894360UL, 0x425c750dUL, 0x93b39e26UL, 0x187184c9UL, 0x6c00b32dUL, 0x73e2bb14UL, 
+0xa0bebc3cUL, 0x54623779UL, 0x64459eabUL, 0x3f328b82UL, 0x7718cf82UL, 0x59a2cea6UL, 
+0x04ee002eUL, 0x89fe78e6UL, 0x3fab0950UL, 0x325ff6c2UL, 0x81383f05UL, 0x6963c5c8UL, 
+0x76cb5ad6UL, 0xd49974c9UL, 0xca180dcfUL, 0x380782d5UL, 0xc7fa5cf6UL, 0x8ac31511UL, 
+0x35e79e13UL, 0x47da91d0UL, 0xf40f9086UL, 0xa7e2419eUL, 0x31366241UL, 0x051ef495UL, 
+0xaa573b04UL, 0x4a805d8dUL, 0x548300d0UL, 0x00322a3cUL, 0xbf64cddfUL, 0xba57a68eUL, 
+0x75c6372bUL, 0x50afd341UL, 0xa7c13275UL, 0x915a0bf5UL, 0x6b54bfabUL, 0x2b0b1426UL, 
+0xab4cc9d7UL, 0x449ccd82UL, 0xf7fbf265UL, 0xab85c5f3UL, 0x1b55db94UL, 0xaad4e324UL, 
+0xcfa4bd3fUL, 0x2deaa3e2UL, 0x9e204d02UL, 0xc8bd25acUL, 0xeadf55b3UL, 0xd5bd9e98UL, 
+0xe31231b2UL, 0x2ad5ad6cUL, 0x954329deUL, 0xadbe4528UL, 0xd8710f69UL, 0xaa51c90fUL, 
+0xaa786bf6UL, 0x22513f1eUL, 0xaa51a79bUL, 0x2ad344ccUL, 0x7b5a41f0UL, 0xd37cfbadUL, 
+0x1b069505UL, 0x41ece491UL, 0xb4c332e6UL, 0x032268d4UL, 0xc9600accUL, 0xce387e6dUL, 
+0xbf6bb16cUL, 0x6a70fb78UL, 0x0d03d9c9UL, 0xd4df39deUL, 0xe01063daUL, 0x4736f464UL, 
+0x5ad328d8UL, 0xb347cc96UL, 0x75bb0fc3UL, 0x98511bfbUL, 0x4ffbcc35UL, 0xb58bcf6aUL, 
+0xe11f0abcUL, 0xbfc5fe4aUL, 0xa70aec10UL, 0xac39570aUL, 0x3f04442fUL, 0x6188b153UL, 
+0xe0397a2eUL, 0x5727cb79UL, 0x9ceb418fUL, 0x1cacd68dUL, 0x2ad37c96UL, 0x0175cb9dUL, 
+0xc69dff09UL, 0xc75b65f0UL, 0xd9db40d8UL, 0xec0e7779UL, 0x4744ead4UL, 0xb11c3274UL, 
+0xdd24cb9eUL, 0x7e1c54bdUL, 0xf01144f9UL, 0xd2240eb1UL, 0x9675b3fdUL, 0xa3ac3755UL, 
+0xd47c27afUL, 0x51c85f4dUL, 0x56907596UL, 0xa5bb15e6UL, 0x580304f0UL, 0xca042cf1UL, 
+0x011a37eaUL, 0x8dbfaadbUL, 0x35ba3e4aUL, 0x3526ffa0UL, 0xc37b4d09UL, 0xbc306ed9UL, 
+0x98a52666UL, 0x5648f725UL, 0xff5e569dUL, 0x0ced63d0UL, 0x7c63b2cfUL, 0x700b45e1UL, 
+0xd5ea50f1UL, 0x85a92872UL, 0xaf1fbda7UL, 0xd4234870UL, 0xa7870bf3UL, 0x2d3b4d79UL, 
+0x42e04198UL, 0x0cd0ede7UL, 0x26470db8UL, 0xf881814cUL, 0x474d6ad7UL, 0x7c0c5e5cUL, 
+0xd1231959UL, 0x381b7298UL, 0xf5d2f4dbUL, 0xab838653UL, 0x6e2f1e23UL, 0x83719c9eUL, 
+0xbd91e046UL, 0x9a56456eUL, 0xdc39200cUL, 0x20c8c571UL, 0x962bda1cUL, 0xe1e696ffUL, 
+0xb141ab08UL, 0x7cca89b9UL, 0x1a69e783UL, 0x02cc4843UL, 0xa2f7c579UL, 0x429ef47dUL, 
+0x427b169cUL, 0x5ac9f049UL, 0xdd8f0f00UL, 0x5c8165bfUL};
+
+static const ulong32 S2[256] = {
+0x1f201094UL, 0xef0ba75bUL, 0x69e3cf7eUL, 0x393f4380UL, 0xfe61cf7aUL, 0xeec5207aUL, 
+0x55889c94UL, 0x72fc0651UL, 0xada7ef79UL, 0x4e1d7235UL, 0xd55a63ceUL, 0xde0436baUL, 
+0x99c430efUL, 0x5f0c0794UL, 0x18dcdb7dUL, 0xa1d6eff3UL, 0xa0b52f7bUL, 0x59e83605UL, 
+0xee15b094UL, 0xe9ffd909UL, 0xdc440086UL, 0xef944459UL, 0xba83ccb3UL, 0xe0c3cdfbUL, 
+0xd1da4181UL, 0x3b092ab1UL, 0xf997f1c1UL, 0xa5e6cf7bUL, 0x01420ddbUL, 0xe4e7ef5bUL, 
+0x25a1ff41UL, 0xe180f806UL, 0x1fc41080UL, 0x179bee7aUL, 0xd37ac6a9UL, 0xfe5830a4UL, 
+0x98de8b7fUL, 0x77e83f4eUL, 0x79929269UL, 0x24fa9f7bUL, 0xe113c85bUL, 0xacc40083UL, 
+0xd7503525UL, 0xf7ea615fUL, 0x62143154UL, 0x0d554b63UL, 0x5d681121UL, 0xc866c359UL, 
+0x3d63cf73UL, 0xcee234c0UL, 0xd4d87e87UL, 0x5c672b21UL, 0x071f6181UL, 0x39f7627fUL, 
+0x361e3084UL, 0xe4eb573bUL, 0x602f64a4UL, 0xd63acd9cUL, 0x1bbc4635UL, 0x9e81032dUL, 
+0x2701f50cUL, 0x99847ab4UL, 0xa0e3df79UL, 0xba6cf38cUL, 0x10843094UL, 0x2537a95eUL, 
+0xf46f6ffeUL, 0xa1ff3b1fUL, 0x208cfb6aUL, 0x8f458c74UL, 0xd9e0a227UL, 0x4ec73a34UL, 
+0xfc884f69UL, 0x3e4de8dfUL, 0xef0e0088UL, 0x3559648dUL, 0x8a45388cUL, 0x1d804366UL, 
+0x721d9bfdUL, 0xa58684bbUL, 0xe8256333UL, 0x844e8212UL, 0x128d8098UL, 0xfed33fb4UL, 
+0xce280ae1UL, 0x27e19ba5UL, 0xd5a6c252UL, 0xe49754bdUL, 0xc5d655ddUL, 0xeb667064UL, 
+0x77840b4dUL, 0xa1b6a801UL, 0x84db26a9UL, 0xe0b56714UL, 0x21f043b7UL, 0xe5d05860UL, 
+0x54f03084UL, 0x066ff472UL, 0xa31aa153UL, 0xdadc4755UL, 0xb5625dbfUL, 0x68561be6UL, 
+0x83ca6b94UL, 0x2d6ed23bUL, 0xeccf01dbUL, 0xa6d3d0baUL, 0xb6803d5cUL, 0xaf77a709UL, 
+0x33b4a34cUL, 0x397bc8d6UL, 0x5ee22b95UL, 0x5f0e5304UL, 0x81ed6f61UL, 0x20e74364UL, 
+0xb45e1378UL, 0xde18639bUL, 0x881ca122UL, 0xb96726d1UL, 0x8049a7e8UL, 0x22b7da7bUL, 
+0x5e552d25UL, 0x5272d237UL, 0x79d2951cUL, 0xc60d894cUL, 0x488cb402UL, 0x1ba4fe5bUL, 
+0xa4b09f6bUL, 0x1ca815cfUL, 0xa20c3005UL, 0x8871df63UL, 0xb9de2fcbUL, 0x0cc6c9e9UL, 
+0x0beeff53UL, 0xe3214517UL, 0xb4542835UL, 0x9f63293cUL, 0xee41e729UL, 0x6e1d2d7cUL, 
+0x50045286UL, 0x1e6685f3UL, 0xf33401c6UL, 0x30a22c95UL, 0x31a70850UL, 0x60930f13UL, 
+0x73f98417UL, 0xa1269859UL, 0xec645c44UL, 0x52c877a9UL, 0xcdff33a6UL, 0xa02b1741UL, 
+0x7cbad9a2UL, 0x2180036fUL, 0x50d99c08UL, 0xcb3f4861UL, 0xc26bd765UL, 0x64a3f6abUL, 
+0x80342676UL, 0x25a75e7bUL, 0xe4e6d1fcUL, 0x20c710e6UL, 0xcdf0b680UL, 0x17844d3bUL, 
+0x31eef84dUL, 0x7e0824e4UL, 0x2ccb49ebUL, 0x846a3baeUL, 0x8ff77888UL, 0xee5d60f6UL, 
+0x7af75673UL, 0x2fdd5cdbUL, 0xa11631c1UL, 0x30f66f43UL, 0xb3faec54UL, 0x157fd7faUL, 
+0xef8579ccUL, 0xd152de58UL, 0xdb2ffd5eUL, 0x8f32ce19UL, 0x306af97aUL, 0x02f03ef8UL, 
+0x99319ad5UL, 0xc242fa0fUL, 0xa7e3ebb0UL, 0xc68e4906UL, 0xb8da230cUL, 0x80823028UL, 
+0xdcdef3c8UL, 0xd35fb171UL, 0x088a1bc8UL, 0xbec0c560UL, 0x61a3c9e8UL, 0xbca8f54dUL, 
+0xc72feffaUL, 0x22822e99UL, 0x82c570b4UL, 0xd8d94e89UL, 0x8b1c34bcUL, 0x301e16e6UL, 
+0x273be979UL, 0xb0ffeaa6UL, 0x61d9b8c6UL, 0x00b24869UL, 0xb7ffce3fUL, 0x08dc283bUL, 
+0x43daf65aUL, 0xf7e19798UL, 0x7619b72fUL, 0x8f1c9ba4UL, 0xdc8637a0UL, 0x16a7d3b1UL, 
+0x9fc393b7UL, 0xa7136eebUL, 0xc6bcc63eUL, 0x1a513742UL, 0xef6828bcUL, 0x520365d6UL, 
+0x2d6a77abUL, 0x3527ed4bUL, 0x821fd216UL, 0x095c6e2eUL, 0xdb92f2fbUL, 0x5eea29cbUL, 
+0x145892f5UL, 0x91584f7fUL, 0x5483697bUL, 0x2667a8ccUL, 0x85196048UL, 0x8c4baceaUL, 
+0x833860d4UL, 0x0d23e0f9UL, 0x6c387e8aUL, 0x0ae6d249UL, 0xb284600cUL, 0xd835731dUL, 
+0xdcb1c647UL, 0xac4c56eaUL, 0x3ebd81b3UL, 0x230eabb0UL, 0x6438bc87UL, 0xf0b5b1faUL, 
+0x8f5ea2b3UL, 0xfc184642UL, 0x0a036b7aUL, 0x4fb089bdUL, 0x649da589UL, 0xa345415eUL, 
+0x5c038323UL, 0x3e5d3bb9UL, 0x43d79572UL, 0x7e6dd07cUL, 0x06dfdf1eUL, 0x6c6cc4efUL, 
+0x7160a539UL, 0x73bfbe70UL, 0x83877605UL, 0x4523ecf1UL};
+
+static const ulong32 S3[256] = {
+0x8defc240UL, 0x25fa5d9fUL, 0xeb903dbfUL, 0xe810c907UL, 0x47607fffUL, 0x369fe44bUL, 
+0x8c1fc644UL, 0xaececa90UL, 0xbeb1f9bfUL, 0xeefbcaeaUL, 0xe8cf1950UL, 0x51df07aeUL, 
+0x920e8806UL, 0xf0ad0548UL, 0xe13c8d83UL, 0x927010d5UL, 0x11107d9fUL, 0x07647db9UL, 
+0xb2e3e4d4UL, 0x3d4f285eUL, 0xb9afa820UL, 0xfade82e0UL, 0xa067268bUL, 0x8272792eUL, 
+0x553fb2c0UL, 0x489ae22bUL, 0xd4ef9794UL, 0x125e3fbcUL, 0x21fffceeUL, 0x825b1bfdUL, 
+0x9255c5edUL, 0x1257a240UL, 0x4e1a8302UL, 0xbae07fffUL, 0x528246e7UL, 0x8e57140eUL, 
+0x3373f7bfUL, 0x8c9f8188UL, 0xa6fc4ee8UL, 0xc982b5a5UL, 0xa8c01db7UL, 0x579fc264UL, 
+0x67094f31UL, 0xf2bd3f5fUL, 0x40fff7c1UL, 0x1fb78dfcUL, 0x8e6bd2c1UL, 0x437be59bUL, 
+0x99b03dbfUL, 0xb5dbc64bUL, 0x638dc0e6UL, 0x55819d99UL, 0xa197c81cUL, 0x4a012d6eUL, 
+0xc5884a28UL, 0xccc36f71UL, 0xb843c213UL, 0x6c0743f1UL, 0x8309893cUL, 0x0feddd5fUL, 
+0x2f7fe850UL, 0xd7c07f7eUL, 0x02507fbfUL, 0x5afb9a04UL, 0xa747d2d0UL, 0x1651192eUL, 
+0xaf70bf3eUL, 0x58c31380UL, 0x5f98302eUL, 0x727cc3c4UL, 0x0a0fb402UL, 0x0f7fef82UL, 
+0x8c96fdadUL, 0x5d2c2aaeUL, 0x8ee99a49UL, 0x50da88b8UL, 0x8427f4a0UL, 0x1eac5790UL, 
+0x796fb449UL, 0x8252dc15UL, 0xefbd7d9bUL, 0xa672597dUL, 0xada840d8UL, 0x45f54504UL, 
+0xfa5d7403UL, 0xe83ec305UL, 0x4f91751aUL, 0x925669c2UL, 0x23efe941UL, 0xa903f12eUL, 
+0x60270df2UL, 0x0276e4b6UL, 0x94fd6574UL, 0x927985b2UL, 0x8276dbcbUL, 0x02778176UL, 
+0xf8af918dUL, 0x4e48f79eUL, 0x8f616ddfUL, 0xe29d840eUL, 0x842f7d83UL, 0x340ce5c8UL, 
+0x96bbb682UL, 0x93b4b148UL, 0xef303cabUL, 0x984faf28UL, 0x779faf9bUL, 0x92dc560dUL, 
+0x224d1e20UL, 0x8437aa88UL, 0x7d29dc96UL, 0x2756d3dcUL, 0x8b907ceeUL, 0xb51fd240UL, 
+0xe7c07ce3UL, 0xe566b4a1UL, 0xc3e9615eUL, 0x3cf8209dUL, 0x6094d1e3UL, 0xcd9ca341UL, 
+0x5c76460eUL, 0x00ea983bUL, 0xd4d67881UL, 0xfd47572cUL, 0xf76cedd9UL, 0xbda8229cUL, 
+0x127dadaaUL, 0x438a074eUL, 0x1f97c090UL, 0x081bdb8aUL, 0x93a07ebeUL, 0xb938ca15UL, 
+0x97b03cffUL, 0x3dc2c0f8UL, 0x8d1ab2ecUL, 0x64380e51UL, 0x68cc7bfbUL, 0xd90f2788UL, 
+0x12490181UL, 0x5de5ffd4UL, 0xdd7ef86aUL, 0x76a2e214UL, 0xb9a40368UL, 0x925d958fUL, 
+0x4b39fffaUL, 0xba39aee9UL, 0xa4ffd30bUL, 0xfaf7933bUL, 0x6d498623UL, 0x193cbcfaUL, 
+0x27627545UL, 0x825cf47aUL, 0x61bd8ba0UL, 0xd11e42d1UL, 0xcead04f4UL, 0x127ea392UL, 
+0x10428db7UL, 0x8272a972UL, 0x9270c4a8UL, 0x127de50bUL, 0x285ba1c8UL, 0x3c62f44fUL, 
+0x35c0eaa5UL, 0xe805d231UL, 0x428929fbUL, 0xb4fcdf82UL, 0x4fb66a53UL, 0x0e7dc15bUL, 
+0x1f081fabUL, 0x108618aeUL, 0xfcfd086dUL, 0xf9ff2889UL, 0x694bcc11UL, 0x236a5caeUL, 
+0x12deca4dUL, 0x2c3f8cc5UL, 0xd2d02dfeUL, 0xf8ef5896UL, 0xe4cf52daUL, 0x95155b67UL, 
+0x494a488cUL, 0xb9b6a80cUL, 0x5c8f82bcUL, 0x89d36b45UL, 0x3a609437UL, 0xec00c9a9UL, 
+0x44715253UL, 0x0a874b49UL, 0xd773bc40UL, 0x7c34671cUL, 0x02717ef6UL, 0x4feb5536UL, 
+0xa2d02fffUL, 0xd2bf60c4UL, 0xd43f03c0UL, 0x50b4ef6dUL, 0x07478cd1UL, 0x006e1888UL, 
+0xa2e53f55UL, 0xb9e6d4bcUL, 0xa2048016UL, 0x97573833UL, 0xd7207d67UL, 0xde0f8f3dUL, 
+0x72f87b33UL, 0xabcc4f33UL, 0x7688c55dUL, 0x7b00a6b0UL, 0x947b0001UL, 0x570075d2UL, 
+0xf9bb88f8UL, 0x8942019eUL, 0x4264a5ffUL, 0x856302e0UL, 0x72dbd92bUL, 0xee971b69UL, 
+0x6ea22fdeUL, 0x5f08ae2bUL, 0xaf7a616dUL, 0xe5c98767UL, 0xcf1febd2UL, 0x61efc8c2UL, 
+0xf1ac2571UL, 0xcc8239c2UL, 0x67214cb8UL, 0xb1e583d1UL, 0xb7dc3e62UL, 0x7f10bdceUL, 
+0xf90a5c38UL, 0x0ff0443dUL, 0x606e6dc6UL, 0x60543a49UL, 0x5727c148UL, 0x2be98a1dUL, 
+0x8ab41738UL, 0x20e1be24UL, 0xaf96da0fUL, 0x68458425UL, 0x99833be5UL, 0x600d457dUL, 
+0x282f9350UL, 0x8334b362UL, 0xd91d1120UL, 0x2b6d8da0UL, 0x642b1e31UL, 0x9c305a00UL, 
+0x52bce688UL, 0x1b03588aUL, 0xf7baefd5UL, 0x4142ed9cUL, 0xa4315c11UL, 0x83323ec5UL, 
+0xdfef4636UL, 0xa133c501UL, 0xe9d3531cUL, 0xee353783UL};
+
+static const ulong32 S4[256] = {
+0x9db30420UL, 0x1fb6e9deUL, 0xa7be7befUL, 0xd273a298UL, 0x4a4f7bdbUL, 0x64ad8c57UL, 
+0x85510443UL, 0xfa020ed1UL, 0x7e287affUL, 0xe60fb663UL, 0x095f35a1UL, 0x79ebf120UL, 
+0xfd059d43UL, 0x6497b7b1UL, 0xf3641f63UL, 0x241e4adfUL, 0x28147f5fUL, 0x4fa2b8cdUL, 
+0xc9430040UL, 0x0cc32220UL, 0xfdd30b30UL, 0xc0a5374fUL, 0x1d2d00d9UL, 0x24147b15UL, 
+0xee4d111aUL, 0x0fca5167UL, 0x71ff904cUL, 0x2d195ffeUL, 0x1a05645fUL, 0x0c13fefeUL, 
+0x081b08caUL, 0x05170121UL, 0x80530100UL, 0xe83e5efeUL, 0xac9af4f8UL, 0x7fe72701UL, 
+0xd2b8ee5fUL, 0x06df4261UL, 0xbb9e9b8aUL, 0x7293ea25UL, 0xce84ffdfUL, 0xf5718801UL, 
+0x3dd64b04UL, 0xa26f263bUL, 0x7ed48400UL, 0x547eebe6UL, 0x446d4ca0UL, 0x6cf3d6f5UL, 
+0x2649abdfUL, 0xaea0c7f5UL, 0x36338cc1UL, 0x503f7e93UL, 0xd3772061UL, 0x11b638e1UL, 
+0x72500e03UL, 0xf80eb2bbUL, 0xabe0502eUL, 0xec8d77deUL, 0x57971e81UL, 0xe14f6746UL, 
+0xc9335400UL, 0x6920318fUL, 0x081dbb99UL, 0xffc304a5UL, 0x4d351805UL, 0x7f3d5ce3UL, 
+0xa6c866c6UL, 0x5d5bcca9UL, 0xdaec6feaUL, 0x9f926f91UL, 0x9f46222fUL, 0x3991467dUL, 
+0xa5bf6d8eUL, 0x1143c44fUL, 0x43958302UL, 0xd0214eebUL, 0x022083b8UL, 0x3fb6180cUL, 
+0x18f8931eUL, 0x281658e6UL, 0x26486e3eUL, 0x8bd78a70UL, 0x7477e4c1UL, 0xb506e07cUL, 
+0xf32d0a25UL, 0x79098b02UL, 0xe4eabb81UL, 0x28123b23UL, 0x69dead38UL, 0x1574ca16UL, 
+0xdf871b62UL, 0x211c40b7UL, 0xa51a9ef9UL, 0x0014377bUL, 0x041e8ac8UL, 0x09114003UL, 
+0xbd59e4d2UL, 0xe3d156d5UL, 0x4fe876d5UL, 0x2f91a340UL, 0x557be8deUL, 0x00eae4a7UL, 
+0x0ce5c2ecUL, 0x4db4bba6UL, 0xe756bdffUL, 0xdd3369acUL, 0xec17b035UL, 0x06572327UL, 
+0x99afc8b0UL, 0x56c8c391UL, 0x6b65811cUL, 0x5e146119UL, 0x6e85cb75UL, 0xbe07c002UL, 
+0xc2325577UL, 0x893ff4ecUL, 0x5bbfc92dUL, 0xd0ec3b25UL, 0xb7801ab7UL, 0x8d6d3b24UL, 
+0x20c763efUL, 0xc366a5fcUL, 0x9c382880UL, 0x0ace3205UL, 0xaac9548aUL, 0xeca1d7c7UL, 
+0x041afa32UL, 0x1d16625aUL, 0x6701902cUL, 0x9b757a54UL, 0x31d477f7UL, 0x9126b031UL, 
+0x36cc6fdbUL, 0xc70b8b46UL, 0xd9e66a48UL, 0x56e55a79UL, 0x026a4cebUL, 0x52437effUL, 
+0x2f8f76b4UL, 0x0df980a5UL, 0x8674cde3UL, 0xedda04ebUL, 0x17a9be04UL, 0x2c18f4dfUL, 
+0xb7747f9dUL, 0xab2af7b4UL, 0xefc34d20UL, 0x2e096b7cUL, 0x1741a254UL, 0xe5b6a035UL, 
+0x213d42f6UL, 0x2c1c7c26UL, 0x61c2f50fUL, 0x6552daf9UL, 0xd2c231f8UL, 0x25130f69UL, 
+0xd8167fa2UL, 0x0418f2c8UL, 0x001a96a6UL, 0x0d1526abUL, 0x63315c21UL, 0x5e0a72ecUL, 
+0x49bafefdUL, 0x187908d9UL, 0x8d0dbd86UL, 0x311170a7UL, 0x3e9b640cUL, 0xcc3e10d7UL, 
+0xd5cad3b6UL, 0x0caec388UL, 0xf73001e1UL, 0x6c728affUL, 0x71eae2a1UL, 0x1f9af36eUL, 
+0xcfcbd12fUL, 0xc1de8417UL, 0xac07be6bUL, 0xcb44a1d8UL, 0x8b9b0f56UL, 0x013988c3UL, 
+0xb1c52fcaUL, 0xb4be31cdUL, 0xd8782806UL, 0x12a3a4e2UL, 0x6f7de532UL, 0x58fd7eb6UL, 
+0xd01ee900UL, 0x24adffc2UL, 0xf4990fc5UL, 0x9711aac5UL, 0x001d7b95UL, 0x82e5e7d2UL, 
+0x109873f6UL, 0x00613096UL, 0xc32d9521UL, 0xada121ffUL, 0x29908415UL, 0x7fbb977fUL, 
+0xaf9eb3dbUL, 0x29c9ed2aUL, 0x5ce2a465UL, 0xa730f32cUL, 0xd0aa3fe8UL, 0x8a5cc091UL, 
+0xd49e2ce7UL, 0x0ce454a9UL, 0xd60acd86UL, 0x015f1919UL, 0x77079103UL, 0xdea03af6UL, 
+0x78a8565eUL, 0xdee356dfUL, 0x21f05cbeUL, 0x8b75e387UL, 0xb3c50651UL, 0xb8a5c3efUL, 
+0xd8eeb6d2UL, 0xe523be77UL, 0xc2154529UL, 0x2f69efdfUL, 0xafe67afbUL, 0xf470c4b2UL, 
+0xf3e0eb5bUL, 0xd6cc9876UL, 0x39e4460cUL, 0x1fda8538UL, 0x1987832fUL, 0xca007367UL, 
+0xa99144f8UL, 0x296b299eUL, 0x492fc295UL, 0x9266beabUL, 0xb5676e69UL, 0x9bd3dddaUL, 
+0xdf7e052fUL, 0xdb25701cUL, 0x1b5e51eeUL, 0xf65324e6UL, 0x6afce36cUL, 0x0316cc04UL, 
+0x8644213eUL, 0xb7dc59d0UL, 0x7965291fUL, 0xccd6fd43UL, 0x41823979UL, 0x932bcdf6UL, 
+0xb657c34dUL, 0x4edfd282UL, 0x7ae5290cUL, 0x3cb9536bUL, 0x851e20feUL, 0x9833557eUL, 
+0x13ecf0b0UL, 0xd3ffb372UL, 0x3f85c5c1UL, 0x0aef7ed2UL};
+
+static const ulong32 S5[256] = {
+0x7ec90c04UL, 0x2c6e74b9UL, 0x9b0e66dfUL, 0xa6337911UL, 0xb86a7fffUL, 0x1dd358f5UL, 
+0x44dd9d44UL, 0x1731167fUL, 0x08fbf1faUL, 0xe7f511ccUL, 0xd2051b00UL, 0x735aba00UL, 
+0x2ab722d8UL, 0x386381cbUL, 0xacf6243aUL, 0x69befd7aUL, 0xe6a2e77fUL, 0xf0c720cdUL, 
+0xc4494816UL, 0xccf5c180UL, 0x38851640UL, 0x15b0a848UL, 0xe68b18cbUL, 0x4caadeffUL, 
+0x5f480a01UL, 0x0412b2aaUL, 0x259814fcUL, 0x41d0efe2UL, 0x4e40b48dUL, 0x248eb6fbUL, 
+0x8dba1cfeUL, 0x41a99b02UL, 0x1a550a04UL, 0xba8f65cbUL, 0x7251f4e7UL, 0x95a51725UL, 
+0xc106ecd7UL, 0x97a5980aUL, 0xc539b9aaUL, 0x4d79fe6aUL, 0xf2f3f763UL, 0x68af8040UL, 
+0xed0c9e56UL, 0x11b4958bUL, 0xe1eb5a88UL, 0x8709e6b0UL, 0xd7e07156UL, 0x4e29fea7UL, 
+0x6366e52dUL, 0x02d1c000UL, 0xc4ac8e05UL, 0x9377f571UL, 0x0c05372aUL, 0x578535f2UL, 
+0x2261be02UL, 0xd642a0c9UL, 0xdf13a280UL, 0x74b55bd2UL, 0x682199c0UL, 0xd421e5ecUL, 
+0x53fb3ce8UL, 0xc8adedb3UL, 0x28a87fc9UL, 0x3d959981UL, 0x5c1ff900UL, 0xfe38d399UL, 
+0x0c4eff0bUL, 0x062407eaUL, 0xaa2f4fb1UL, 0x4fb96976UL, 0x90c79505UL, 0xb0a8a774UL, 
+0xef55a1ffUL, 0xe59ca2c2UL, 0xa6b62d27UL, 0xe66a4263UL, 0xdf65001fUL, 0x0ec50966UL, 
+0xdfdd55bcUL, 0x29de0655UL, 0x911e739aUL, 0x17af8975UL, 0x32c7911cUL, 0x89f89468UL, 
+0x0d01e980UL, 0x524755f4UL, 0x03b63cc9UL, 0x0cc844b2UL, 0xbcf3f0aaUL, 0x87ac36e9UL, 
+0xe53a7426UL, 0x01b3d82bUL, 0x1a9e7449UL, 0x64ee2d7eUL, 0xcddbb1daUL, 0x01c94910UL, 
+0xb868bf80UL, 0x0d26f3fdUL, 0x9342ede7UL, 0x04a5c284UL, 0x636737b6UL, 0x50f5b616UL, 
+0xf24766e3UL, 0x8eca36c1UL, 0x136e05dbUL, 0xfef18391UL, 0xfb887a37UL, 0xd6e7f7d4UL, 
+0xc7fb7dc9UL, 0x3063fcdfUL, 0xb6f589deUL, 0xec2941daUL, 0x26e46695UL, 0xb7566419UL, 
+0xf654efc5UL, 0xd08d58b7UL, 0x48925401UL, 0xc1bacb7fUL, 0xe5ff550fUL, 0xb6083049UL, 
+0x5bb5d0e8UL, 0x87d72e5aUL, 0xab6a6ee1UL, 0x223a66ceUL, 0xc62bf3cdUL, 0x9e0885f9UL, 
+0x68cb3e47UL, 0x086c010fUL, 0xa21de820UL, 0xd18b69deUL, 0xf3f65777UL, 0xfa02c3f6UL, 
+0x407edac3UL, 0xcbb3d550UL, 0x1793084dUL, 0xb0d70ebaUL, 0x0ab378d5UL, 0xd951fb0cUL, 
+0xded7da56UL, 0x4124bbe4UL, 0x94ca0b56UL, 0x0f5755d1UL, 0xe0e1e56eUL, 0x6184b5beUL, 
+0x580a249fUL, 0x94f74bc0UL, 0xe327888eUL, 0x9f7b5561UL, 0xc3dc0280UL, 0x05687715UL, 
+0x646c6bd7UL, 0x44904db3UL, 0x66b4f0a3UL, 0xc0f1648aUL, 0x697ed5afUL, 0x49e92ff6UL, 
+0x309e374fUL, 0x2cb6356aUL, 0x85808573UL, 0x4991f840UL, 0x76f0ae02UL, 0x083be84dUL, 
+0x28421c9aUL, 0x44489406UL, 0x736e4cb8UL, 0xc1092910UL, 0x8bc95fc6UL, 0x7d869cf4UL, 
+0x134f616fUL, 0x2e77118dUL, 0xb31b2be1UL, 0xaa90b472UL, 0x3ca5d717UL, 0x7d161bbaUL, 
+0x9cad9010UL, 0xaf462ba2UL, 0x9fe459d2UL, 0x45d34559UL, 0xd9f2da13UL, 0xdbc65487UL, 
+0xf3e4f94eUL, 0x176d486fUL, 0x097c13eaUL, 0x631da5c7UL, 0x445f7382UL, 0x175683f4UL, 
+0xcdc66a97UL, 0x70be0288UL, 0xb3cdcf72UL, 0x6e5dd2f3UL, 0x20936079UL, 0x459b80a5UL, 
+0xbe60e2dbUL, 0xa9c23101UL, 0xeba5315cUL, 0x224e42f2UL, 0x1c5c1572UL, 0xf6721b2cUL, 
+0x1ad2fff3UL, 0x8c25404eUL, 0x324ed72fUL, 0x4067b7fdUL, 0x0523138eUL, 0x5ca3bc78UL, 
+0xdc0fd66eUL, 0x75922283UL, 0x784d6b17UL, 0x58ebb16eUL, 0x44094f85UL, 0x3f481d87UL, 
+0xfcfeae7bUL, 0x77b5ff76UL, 0x8c2302bfUL, 0xaaf47556UL, 0x5f46b02aUL, 0x2b092801UL, 
+0x3d38f5f7UL, 0x0ca81f36UL, 0x52af4a8aUL, 0x66d5e7c0UL, 0xdf3b0874UL, 0x95055110UL, 
+0x1b5ad7a8UL, 0xf61ed5adUL, 0x6cf6e479UL, 0x20758184UL, 0xd0cefa65UL, 0x88f7be58UL, 
+0x4a046826UL, 0x0ff6f8f3UL, 0xa09c7f70UL, 0x5346aba0UL, 0x5ce96c28UL, 0xe176eda3UL, 
+0x6bac307fUL, 0x376829d2UL, 0x85360fa9UL, 0x17e3fe2aUL, 0x24b79767UL, 0xf5a96b20UL, 
+0xd6cd2595UL, 0x68ff1ebfUL, 0x7555442cUL, 0xf19f06beUL, 0xf9e0659aUL, 0xeeb9491dUL, 
+0x34010718UL, 0xbb30cab8UL, 0xe822fe15UL, 0x88570983UL, 0x750e6249UL, 0xda627e55UL, 
+0x5e76ffa8UL, 0xb1534546UL, 0x6d47de08UL, 0xefe9e7d4UL};
+
+static const ulong32 S6[256] = {
+0xf6fa8f9dUL, 0x2cac6ce1UL, 0x4ca34867UL, 0xe2337f7cUL, 0x95db08e7UL, 0x016843b4UL, 
+0xeced5cbcUL, 0x325553acUL, 0xbf9f0960UL, 0xdfa1e2edUL, 0x83f0579dUL, 0x63ed86b9UL, 
+0x1ab6a6b8UL, 0xde5ebe39UL, 0xf38ff732UL, 0x8989b138UL, 0x33f14961UL, 0xc01937bdUL, 
+0xf506c6daUL, 0xe4625e7eUL, 0xa308ea99UL, 0x4e23e33cUL, 0x79cbd7ccUL, 0x48a14367UL, 
+0xa3149619UL, 0xfec94bd5UL, 0xa114174aUL, 0xeaa01866UL, 0xa084db2dUL, 0x09a8486fUL, 
+0xa888614aUL, 0x2900af98UL, 0x01665991UL, 0xe1992863UL, 0xc8f30c60UL, 0x2e78ef3cUL, 
+0xd0d51932UL, 0xcf0fec14UL, 0xf7ca07d2UL, 0xd0a82072UL, 0xfd41197eUL, 0x9305a6b0UL, 
+0xe86be3daUL, 0x74bed3cdUL, 0x372da53cUL, 0x4c7f4448UL, 0xdab5d440UL, 0x6dba0ec3UL, 
+0x083919a7UL, 0x9fbaeed9UL, 0x49dbcfb0UL, 0x4e670c53UL, 0x5c3d9c01UL, 0x64bdb941UL, 
+0x2c0e636aUL, 0xba7dd9cdUL, 0xea6f7388UL, 0xe70bc762UL, 0x35f29adbUL, 0x5c4cdd8dUL, 
+0xf0d48d8cUL, 0xb88153e2UL, 0x08a19866UL, 0x1ae2eac8UL, 0x284caf89UL, 0xaa928223UL, 
+0x9334be53UL, 0x3b3a21bfUL, 0x16434be3UL, 0x9aea3906UL, 0xefe8c36eUL, 0xf890cdd9UL, 
+0x80226daeUL, 0xc340a4a3UL, 0xdf7e9c09UL, 0xa694a807UL, 0x5b7c5eccUL, 0x221db3a6UL, 
+0x9a69a02fUL, 0x68818a54UL, 0xceb2296fUL, 0x53c0843aUL, 0xfe893655UL, 0x25bfe68aUL, 
+0xb4628abcUL, 0xcf222ebfUL, 0x25ac6f48UL, 0xa9a99387UL, 0x53bddb65UL, 0xe76ffbe7UL, 
+0xe967fd78UL, 0x0ba93563UL, 0x8e342bc1UL, 0xe8a11be9UL, 0x4980740dUL, 0xc8087dfcUL, 
+0x8de4bf99UL, 0xa11101a0UL, 0x7fd37975UL, 0xda5a26c0UL, 0xe81f994fUL, 0x9528cd89UL, 
+0xfd339fedUL, 0xb87834bfUL, 0x5f04456dUL, 0x22258698UL, 0xc9c4c83bUL, 0x2dc156beUL, 
+0x4f628daaUL, 0x57f55ec5UL, 0xe2220abeUL, 0xd2916ebfUL, 0x4ec75b95UL, 0x24f2c3c0UL, 
+0x42d15d99UL, 0xcd0d7fa0UL, 0x7b6e27ffUL, 0xa8dc8af0UL, 0x7345c106UL, 0xf41e232fUL, 
+0x35162386UL, 0xe6ea8926UL, 0x3333b094UL, 0x157ec6f2UL, 0x372b74afUL, 0x692573e4UL, 
+0xe9a9d848UL, 0xf3160289UL, 0x3a62ef1dUL, 0xa787e238UL, 0xf3a5f676UL, 0x74364853UL, 
+0x20951063UL, 0x4576698dUL, 0xb6fad407UL, 0x592af950UL, 0x36f73523UL, 0x4cfb6e87UL, 
+0x7da4cec0UL, 0x6c152daaUL, 0xcb0396a8UL, 0xc50dfe5dUL, 0xfcd707abUL, 0x0921c42fUL, 
+0x89dff0bbUL, 0x5fe2be78UL, 0x448f4f33UL, 0x754613c9UL, 0x2b05d08dUL, 0x48b9d585UL, 
+0xdc049441UL, 0xc8098f9bUL, 0x7dede786UL, 0xc39a3373UL, 0x42410005UL, 0x6a091751UL, 
+0x0ef3c8a6UL, 0x890072d6UL, 0x28207682UL, 0xa9a9f7beUL, 0xbf32679dUL, 0xd45b5b75UL, 
+0xb353fd00UL, 0xcbb0e358UL, 0x830f220aUL, 0x1f8fb214UL, 0xd372cf08UL, 0xcc3c4a13UL, 
+0x8cf63166UL, 0x061c87beUL, 0x88c98f88UL, 0x6062e397UL, 0x47cf8e7aUL, 0xb6c85283UL, 
+0x3cc2acfbUL, 0x3fc06976UL, 0x4e8f0252UL, 0x64d8314dUL, 0xda3870e3UL, 0x1e665459UL, 
+0xc10908f0UL, 0x513021a5UL, 0x6c5b68b7UL, 0x822f8aa0UL, 0x3007cd3eUL, 0x74719eefUL, 
+0xdc872681UL, 0x073340d4UL, 0x7e432fd9UL, 0x0c5ec241UL, 0x8809286cUL, 0xf592d891UL, 
+0x08a930f6UL, 0x957ef305UL, 0xb7fbffbdUL, 0xc266e96fUL, 0x6fe4ac98UL, 0xb173ecc0UL, 
+0xbc60b42aUL, 0x953498daUL, 0xfba1ae12UL, 0x2d4bd736UL, 0x0f25faabUL, 0xa4f3fcebUL, 
+0xe2969123UL, 0x257f0c3dUL, 0x9348af49UL, 0x361400bcUL, 0xe8816f4aUL, 0x3814f200UL, 
+0xa3f94043UL, 0x9c7a54c2UL, 0xbc704f57UL, 0xda41e7f9UL, 0xc25ad33aUL, 0x54f4a084UL, 
+0xb17f5505UL, 0x59357cbeUL, 0xedbd15c8UL, 0x7f97c5abUL, 0xba5ac7b5UL, 0xb6f6deafUL, 
+0x3a479c3aUL, 0x5302da25UL, 0x653d7e6aUL, 0x54268d49UL, 0x51a477eaUL, 0x5017d55bUL, 
+0xd7d25d88UL, 0x44136c76UL, 0x0404a8c8UL, 0xb8e5a121UL, 0xb81a928aUL, 0x60ed5869UL, 
+0x97c55b96UL, 0xeaec991bUL, 0x29935913UL, 0x01fdb7f1UL, 0x088e8dfaUL, 0x9ab6f6f5UL, 
+0x3b4cbf9fUL, 0x4a5de3abUL, 0xe6051d35UL, 0xa0e1d855UL, 0xd36b4cf1UL, 0xf544edebUL, 
+0xb0e93524UL, 0xbebb8fbdUL, 0xa2d762cfUL, 0x49c92f54UL, 0x38b5f331UL, 0x7128a454UL, 
+0x48392905UL, 0xa65b1db8UL, 0x851c97bdUL, 0xd675cf2fUL};
+
+static const ulong32 S7[256] = {
+0x85e04019UL, 0x332bf567UL, 0x662dbfffUL, 0xcfc65693UL, 0x2a8d7f6fUL, 0xab9bc912UL, 
+0xde6008a1UL, 0x2028da1fUL, 0x0227bce7UL, 0x4d642916UL, 0x18fac300UL, 0x50f18b82UL, 
+0x2cb2cb11UL, 0xb232e75cUL, 0x4b3695f2UL, 0xb28707deUL, 0xa05fbcf6UL, 0xcd4181e9UL, 
+0xe150210cUL, 0xe24ef1bdUL, 0xb168c381UL, 0xfde4e789UL, 0x5c79b0d8UL, 0x1e8bfd43UL, 
+0x4d495001UL, 0x38be4341UL, 0x913cee1dUL, 0x92a79c3fUL, 0x089766beUL, 0xbaeeadf4UL, 
+0x1286becfUL, 0xb6eacb19UL, 0x2660c200UL, 0x7565bde4UL, 0x64241f7aUL, 0x8248dca9UL, 
+0xc3b3ad66UL, 0x28136086UL, 0x0bd8dfa8UL, 0x356d1cf2UL, 0x107789beUL, 0xb3b2e9ceUL, 
+0x0502aa8fUL, 0x0bc0351eUL, 0x166bf52aUL, 0xeb12ff82UL, 0xe3486911UL, 0xd34d7516UL, 
+0x4e7b3affUL, 0x5f43671bUL, 0x9cf6e037UL, 0x4981ac83UL, 0x334266ceUL, 0x8c9341b7UL, 
+0xd0d854c0UL, 0xcb3a6c88UL, 0x47bc2829UL, 0x4725ba37UL, 0xa66ad22bUL, 0x7ad61f1eUL, 
+0x0c5cbafaUL, 0x4437f107UL, 0xb6e79962UL, 0x42d2d816UL, 0x0a961288UL, 0xe1a5c06eUL, 
+0x13749e67UL, 0x72fc081aUL, 0xb1d139f7UL, 0xf9583745UL, 0xcf19df58UL, 0xbec3f756UL, 
+0xc06eba30UL, 0x07211b24UL, 0x45c28829UL, 0xc95e317fUL, 0xbc8ec511UL, 0x38bc46e9UL, 
+0xc6e6fa14UL, 0xbae8584aUL, 0xad4ebc46UL, 0x468f508bUL, 0x7829435fUL, 0xf124183bUL, 
+0x821dba9fUL, 0xaff60ff4UL, 0xea2c4e6dUL, 0x16e39264UL, 0x92544a8bUL, 0x009b4fc3UL, 
+0xaba68cedUL, 0x9ac96f78UL, 0x06a5b79aUL, 0xb2856e6eUL, 0x1aec3ca9UL, 0xbe838688UL, 
+0x0e0804e9UL, 0x55f1be56UL, 0xe7e5363bUL, 0xb3a1f25dUL, 0xf7debb85UL, 0x61fe033cUL, 
+0x16746233UL, 0x3c034c28UL, 0xda6d0c74UL, 0x79aac56cUL, 0x3ce4e1adUL, 0x51f0c802UL, 
+0x98f8f35aUL, 0x1626a49fUL, 0xeed82b29UL, 0x1d382fe3UL, 0x0c4fb99aUL, 0xbb325778UL, 
+0x3ec6d97bUL, 0x6e77a6a9UL, 0xcb658b5cUL, 0xd45230c7UL, 0x2bd1408bUL, 0x60c03eb7UL, 
+0xb9068d78UL, 0xa33754f4UL, 0xf430c87dUL, 0xc8a71302UL, 0xb96d8c32UL, 0xebd4e7beUL, 
+0xbe8b9d2dUL, 0x7979fb06UL, 0xe7225308UL, 0x8b75cf77UL, 0x11ef8da4UL, 0xe083c858UL, 
+0x8d6b786fUL, 0x5a6317a6UL, 0xfa5cf7a0UL, 0x5dda0033UL, 0xf28ebfb0UL, 0xf5b9c310UL, 
+0xa0eac280UL, 0x08b9767aUL, 0xa3d9d2b0UL, 0x79d34217UL, 0x021a718dUL, 0x9ac6336aUL, 
+0x2711fd60UL, 0x438050e3UL, 0x069908a8UL, 0x3d7fedc4UL, 0x826d2befUL, 0x4eeb8476UL, 
+0x488dcf25UL, 0x36c9d566UL, 0x28e74e41UL, 0xc2610acaUL, 0x3d49a9cfUL, 0xbae3b9dfUL, 
+0xb65f8de6UL, 0x92aeaf64UL, 0x3ac7d5e6UL, 0x9ea80509UL, 0xf22b017dUL, 0xa4173f70UL, 
+0xdd1e16c3UL, 0x15e0d7f9UL, 0x50b1b887UL, 0x2b9f4fd5UL, 0x625aba82UL, 0x6a017962UL, 
+0x2ec01b9cUL, 0x15488aa9UL, 0xd716e740UL, 0x40055a2cUL, 0x93d29a22UL, 0xe32dbf9aUL, 
+0x058745b9UL, 0x3453dc1eUL, 0xd699296eUL, 0x496cff6fUL, 0x1c9f4986UL, 0xdfe2ed07UL, 
+0xb87242d1UL, 0x19de7eaeUL, 0x053e561aUL, 0x15ad6f8cUL, 0x66626c1cUL, 0x7154c24cUL, 
+0xea082b2aUL, 0x93eb2939UL, 0x17dcb0f0UL, 0x58d4f2aeUL, 0x9ea294fbUL, 0x52cf564cUL, 
+0x9883fe66UL, 0x2ec40581UL, 0x763953c3UL, 0x01d6692eUL, 0xd3a0c108UL, 0xa1e7160eUL, 
+0xe4f2dfa6UL, 0x693ed285UL, 0x74904698UL, 0x4c2b0eddUL, 0x4f757656UL, 0x5d393378UL, 
+0xa132234fUL, 0x3d321c5dUL, 0xc3f5e194UL, 0x4b269301UL, 0xc79f022fUL, 0x3c997e7eUL, 
+0x5e4f9504UL, 0x3ffafbbdUL, 0x76f7ad0eUL, 0x296693f4UL, 0x3d1fce6fUL, 0xc61e45beUL, 
+0xd3b5ab34UL, 0xf72bf9b7UL, 0x1b0434c0UL, 0x4e72b567UL, 0x5592a33dUL, 0xb5229301UL, 
+0xcfd2a87fUL, 0x60aeb767UL, 0x1814386bUL, 0x30bcc33dUL, 0x38a0c07dUL, 0xfd1606f2UL, 
+0xc363519bUL, 0x589dd390UL, 0x5479f8e6UL, 0x1cb8d647UL, 0x97fd61a9UL, 0xea7759f4UL, 
+0x2d57539dUL, 0x569a58cfUL, 0xe84e63adUL, 0x462e1b78UL, 0x6580f87eUL, 0xf3817914UL, 
+0x91da55f4UL, 0x40a230f3UL, 0xd1988f35UL, 0xb6e318d2UL, 0x3ffa50bcUL, 0x3d40f021UL, 
+0xc3c0bdaeUL, 0x4958c24cUL, 0x518f36b2UL, 0x84b1d370UL, 0x0fedce83UL, 0x878ddadaUL, 
+0xf2a279c7UL, 0x94e01be8UL, 0x90716f4bUL, 0x954b8aa3UL};
+
+static const ulong32 S8[256] = {
+0xe216300dUL, 0xbbddfffcUL, 0xa7ebdabdUL, 0x35648095UL, 0x7789f8b7UL, 0xe6c1121bUL, 
+0x0e241600UL, 0x052ce8b5UL, 0x11a9cfb0UL, 0xe5952f11UL, 0xece7990aUL, 0x9386d174UL, 
+0x2a42931cUL, 0x76e38111UL, 0xb12def3aUL, 0x37ddddfcUL, 0xde9adeb1UL, 0x0a0cc32cUL, 
+0xbe197029UL, 0x84a00940UL, 0xbb243a0fUL, 0xb4d137cfUL, 0xb44e79f0UL, 0x049eedfdUL, 
+0x0b15a15dUL, 0x480d3168UL, 0x8bbbde5aUL, 0x669ded42UL, 0xc7ece831UL, 0x3f8f95e7UL, 
+0x72df191bUL, 0x7580330dUL, 0x94074251UL, 0x5c7dcdfaUL, 0xabbe6d63UL, 0xaa402164UL, 
+0xb301d40aUL, 0x02e7d1caUL, 0x53571daeUL, 0x7a3182a2UL, 0x12a8ddecUL, 0xfdaa335dUL, 
+0x176f43e8UL, 0x71fb46d4UL, 0x38129022UL, 0xce949ad4UL, 0xb84769adUL, 0x965bd862UL, 
+0x82f3d055UL, 0x66fb9767UL, 0x15b80b4eUL, 0x1d5b47a0UL, 0x4cfde06fUL, 0xc28ec4b8UL, 
+0x57e8726eUL, 0x647a78fcUL, 0x99865d44UL, 0x608bd593UL, 0x6c200e03UL, 0x39dc5ff6UL, 
+0x5d0b00a3UL, 0xae63aff2UL, 0x7e8bd632UL, 0x70108c0cUL, 0xbbd35049UL, 0x2998df04UL, 
+0x980cf42aUL, 0x9b6df491UL, 0x9e7edd53UL, 0x06918548UL, 0x58cb7e07UL, 0x3b74ef2eUL, 
+0x522fffb1UL, 0xd24708ccUL, 0x1c7e27cdUL, 0xa4eb215bUL, 0x3cf1d2e2UL, 0x19b47a38UL, 
+0x424f7618UL, 0x35856039UL, 0x9d17dee7UL, 0x27eb35e6UL, 0xc9aff67bUL, 0x36baf5b8UL, 
+0x09c467cdUL, 0xc18910b1UL, 0xe11dbf7bUL, 0x06cd1af8UL, 0x7170c608UL, 0x2d5e3354UL, 
+0xd4de495aUL, 0x64c6d006UL, 0xbcc0c62cUL, 0x3dd00db3UL, 0x708f8f34UL, 0x77d51b42UL, 
+0x264f620fUL, 0x24b8d2bfUL, 0x15c1b79eUL, 0x46a52564UL, 0xf8d7e54eUL, 0x3e378160UL, 
+0x7895cda5UL, 0x859c15a5UL, 0xe6459788UL, 0xc37bc75fUL, 0xdb07ba0cUL, 0x0676a3abUL, 
+0x7f229b1eUL, 0x31842e7bUL, 0x24259fd7UL, 0xf8bef472UL, 0x835ffcb8UL, 0x6df4c1f2UL, 
+0x96f5b195UL, 0xfd0af0fcUL, 0xb0fe134cUL, 0xe2506d3dUL, 0x4f9b12eaUL, 0xf215f225UL, 
+0xa223736fUL, 0x9fb4c428UL, 0x25d04979UL, 0x34c713f8UL, 0xc4618187UL, 0xea7a6e98UL, 
+0x7cd16efcUL, 0x1436876cUL, 0xf1544107UL, 0xbedeee14UL, 0x56e9af27UL, 0xa04aa441UL, 
+0x3cf7c899UL, 0x92ecbae6UL, 0xdd67016dUL, 0x151682ebUL, 0xa842eedfUL, 0xfdba60b4UL, 
+0xf1907b75UL, 0x20e3030fUL, 0x24d8c29eUL, 0xe139673bUL, 0xefa63fb8UL, 0x71873054UL, 
+0xb6f2cf3bUL, 0x9f326442UL, 0xcb15a4ccUL, 0xb01a4504UL, 0xf1e47d8dUL, 0x844a1be5UL, 
+0xbae7dfdcUL, 0x42cbda70UL, 0xcd7dae0aUL, 0x57e85b7aUL, 0xd53f5af6UL, 0x20cf4d8cUL, 
+0xcea4d428UL, 0x79d130a4UL, 0x3486ebfbUL, 0x33d3cddcUL, 0x77853b53UL, 0x37effcb5UL, 
+0xc5068778UL, 0xe580b3e6UL, 0x4e68b8f4UL, 0xc5c8b37eUL, 0x0d809ea2UL, 0x398feb7cUL, 
+0x132a4f94UL, 0x43b7950eUL, 0x2fee7d1cUL, 0x223613bdUL, 0xdd06caa2UL, 0x37df932bUL, 
+0xc4248289UL, 0xacf3ebc3UL, 0x5715f6b7UL, 0xef3478ddUL, 0xf267616fUL, 0xc148cbe4UL, 
+0x9052815eUL, 0x5e410fabUL, 0xb48a2465UL, 0x2eda7fa4UL, 0xe87b40e4UL, 0xe98ea084UL, 
+0x5889e9e1UL, 0xefd390fcUL, 0xdd07d35bUL, 0xdb485694UL, 0x38d7e5b2UL, 0x57720101UL, 
+0x730edebcUL, 0x5b643113UL, 0x94917e4fUL, 0x503c2fbaUL, 0x646f1282UL, 0x7523d24aUL, 
+0xe0779695UL, 0xf9c17a8fUL, 0x7a5b2121UL, 0xd187b896UL, 0x29263a4dUL, 0xba510cdfUL, 
+0x81f47c9fUL, 0xad1163edUL, 0xea7b5965UL, 0x1a00726eUL, 0x11403092UL, 0x00da6d77UL, 
+0x4a0cdd61UL, 0xad1f4603UL, 0x605bdfb0UL, 0x9eedc364UL, 0x22ebe6a8UL, 0xcee7d28aUL, 
+0xa0e736a0UL, 0x5564a6b9UL, 0x10853209UL, 0xc7eb8f37UL, 0x2de705caUL, 0x8951570fUL, 
+0xdf09822bUL, 0xbd691a6cUL, 0xaa12e4f2UL, 0x87451c0fUL, 0xe0f6a27aUL, 0x3ada4819UL, 
+0x4cf1764fUL, 0x0d771c2bUL, 0x67cdb156UL, 0x350d8384UL, 0x5938fa0fUL, 0x42399ef3UL, 
+0x36997b07UL, 0x0e84093dUL, 0x4aa93e61UL, 0x8360d87bUL, 0x1fa98b0cUL, 0x1149382cUL, 
+0xe97625a5UL, 0x0614d1b7UL, 0x0e25244bUL, 0x0c768347UL, 0x589e8d82UL, 0x0d2059d1UL, 
+0xa466bb1eUL, 0xf8da0a82UL, 0x04f19130UL, 0xba6e4ec0UL, 0x99265164UL, 0x1ee7230dUL, 
+0x50b2ad80UL, 0xeaee6801UL, 0x8db2a283UL, 0xea8bf59eUL};
+
+/* returns the i'th byte of a variable */
+#ifdef _MSC_VER
+   #define GB(x, i) ((unsigned char)((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3))))
+#else   
+   #define GB(x, i) (((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3)))&255)
+#endif   
+
+ /**
+    Initialize the CAST5 block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+#ifdef LTC_CLEAN_STACK
+static int _cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+#else
+int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+#endif
+{
+   ulong32 x[4], z[4];
+   unsigned char buf[16];
+   int y, i;
+
+   LTC_ARGCHK(key != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   if (num_rounds != 12 && num_rounds != 16 && num_rounds != 0) {
+      return CRYPT_INVALID_ROUNDS; 
+   }
+ 
+   if (num_rounds == 12 && keylen > 10) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+
+   if (keylen < 5 || keylen > 16) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+
+   /* extend the key as required */
+   zeromem(buf, sizeof(buf));
+   XMEMCPY(buf, key, (size_t)keylen);
+
+   /* load and start the awful looking network */
+   for (y = 0; y < 4; y++) {
+       LOAD32H(x[3-y],buf+4*y);
+   }
+
+   for (i = y = 0; y < 2; y++) {
+        z[3] = x[3] ^ S5[GB(x, 0xD)] ^ S6[GB(x, 0xF)] ^ S7[GB(x, 0xC)] ^ S8[GB(x, 0xE)] ^ S7[GB(x, 0x8)];
+        z[2] = x[1] ^ S5[GB(z, 0x0)] ^ S6[GB(z, 0x2)] ^ S7[GB(z, 0x1)] ^ S8[GB(z, 0x3)] ^ S8[GB(x, 0xA)];
+        z[1] = x[0] ^ S5[GB(z, 0x7)] ^ S6[GB(z, 0x6)] ^ S7[GB(z, 0x5)] ^ S8[GB(z, 0x4)] ^ S5[GB(x, 0x9)];
+        z[0] = x[2] ^ S5[GB(z, 0xA)] ^ S6[GB(z, 0x9)] ^ S7[GB(z, 0xb)] ^ S8[GB(z, 0x8)] ^ S6[GB(x, 0xB)];
+        skey->cast5.K[i++] = S5[GB(z, 0x8)] ^ S6[GB(z, 0x9)] ^ S7[GB(z, 0x7)] ^ S8[GB(z, 0x6)] ^ S5[GB(z, 0x2)];
+        skey->cast5.K[i++] = S5[GB(z, 0xA)] ^ S6[GB(z, 0xB)] ^ S7[GB(z, 0x5)] ^ S8[GB(z, 0x4)] ^ S6[GB(z, 0x6)];
+        skey->cast5.K[i++] = S5[GB(z, 0xC)] ^ S6[GB(z, 0xd)] ^ S7[GB(z, 0x3)] ^ S8[GB(z, 0x2)] ^ S7[GB(z, 0x9)];
+        skey->cast5.K[i++] = S5[GB(z, 0xE)] ^ S6[GB(z, 0xF)] ^ S7[GB(z, 0x1)] ^ S8[GB(z, 0x0)] ^ S8[GB(z, 0xc)];
+
+        x[3] = z[1] ^ S5[GB(z, 0x5)] ^ S6[GB(z, 0x7)] ^ S7[GB(z, 0x4)] ^ S8[GB(z, 0x6)] ^ S7[GB(z, 0x0)];
+        x[2] = z[3] ^ S5[GB(x, 0x0)] ^ S6[GB(x, 0x2)] ^ S7[GB(x, 0x1)] ^ S8[GB(x, 0x3)] ^ S8[GB(z, 0x2)];
+        x[1] = z[2] ^ S5[GB(x, 0x7)] ^ S6[GB(x, 0x6)] ^ S7[GB(x, 0x5)] ^ S8[GB(x, 0x4)] ^ S5[GB(z, 0x1)];
+        x[0] = z[0] ^ S5[GB(x, 0xA)] ^ S6[GB(x, 0x9)] ^ S7[GB(x, 0xb)] ^ S8[GB(x, 0x8)] ^ S6[GB(z, 0x3)];
+        skey->cast5.K[i++] = S5[GB(x, 0x3)] ^ S6[GB(x, 0x2)] ^ S7[GB(x, 0xc)] ^ S8[GB(x, 0xd)] ^ S5[GB(x, 0x8)];
+        skey->cast5.K[i++] = S5[GB(x, 0x1)] ^ S6[GB(x, 0x0)] ^ S7[GB(x, 0xe)] ^ S8[GB(x, 0xf)] ^ S6[GB(x, 0xd)];
+        skey->cast5.K[i++] = S5[GB(x, 0x7)] ^ S6[GB(x, 0x6)] ^ S7[GB(x, 0x8)] ^ S8[GB(x, 0x9)] ^ S7[GB(x, 0x3)];
+        skey->cast5.K[i++] = S5[GB(x, 0x5)] ^ S6[GB(x, 0x4)] ^ S7[GB(x, 0xa)] ^ S8[GB(x, 0xb)] ^ S8[GB(x, 0x7)];
+
+        /* second half */
+        z[3] = x[3] ^ S5[GB(x, 0xD)] ^ S6[GB(x, 0xF)] ^ S7[GB(x, 0xC)] ^ S8[GB(x, 0xE)] ^ S7[GB(x, 0x8)];
+        z[2] = x[1] ^ S5[GB(z, 0x0)] ^ S6[GB(z, 0x2)] ^ S7[GB(z, 0x1)] ^ S8[GB(z, 0x3)] ^ S8[GB(x, 0xA)];
+        z[1] = x[0] ^ S5[GB(z, 0x7)] ^ S6[GB(z, 0x6)] ^ S7[GB(z, 0x5)] ^ S8[GB(z, 0x4)] ^ S5[GB(x, 0x9)];
+        z[0] = x[2] ^ S5[GB(z, 0xA)] ^ S6[GB(z, 0x9)] ^ S7[GB(z, 0xb)] ^ S8[GB(z, 0x8)] ^ S6[GB(x, 0xB)];
+        skey->cast5.K[i++] = S5[GB(z, 0x3)] ^ S6[GB(z, 0x2)] ^ S7[GB(z, 0xc)] ^ S8[GB(z, 0xd)] ^ S5[GB(z, 0x9)];
+        skey->cast5.K[i++] = S5[GB(z, 0x1)] ^ S6[GB(z, 0x0)] ^ S7[GB(z, 0xe)] ^ S8[GB(z, 0xf)] ^ S6[GB(z, 0xc)];
+        skey->cast5.K[i++] = S5[GB(z, 0x7)] ^ S6[GB(z, 0x6)] ^ S7[GB(z, 0x8)] ^ S8[GB(z, 0x9)] ^ S7[GB(z, 0x2)];
+        skey->cast5.K[i++] = S5[GB(z, 0x5)] ^ S6[GB(z, 0x4)] ^ S7[GB(z, 0xa)] ^ S8[GB(z, 0xb)] ^ S8[GB(z, 0x6)];
+
+        x[3] = z[1] ^ S5[GB(z, 0x5)] ^ S6[GB(z, 0x7)] ^ S7[GB(z, 0x4)] ^ S8[GB(z, 0x6)] ^ S7[GB(z, 0x0)];
+        x[2] = z[3] ^ S5[GB(x, 0x0)] ^ S6[GB(x, 0x2)] ^ S7[GB(x, 0x1)] ^ S8[GB(x, 0x3)] ^ S8[GB(z, 0x2)];
+        x[1] = z[2] ^ S5[GB(x, 0x7)] ^ S6[GB(x, 0x6)] ^ S7[GB(x, 0x5)] ^ S8[GB(x, 0x4)] ^ S5[GB(z, 0x1)];
+        x[0] = z[0] ^ S5[GB(x, 0xA)] ^ S6[GB(x, 0x9)] ^ S7[GB(x, 0xb)] ^ S8[GB(x, 0x8)] ^ S6[GB(z, 0x3)];
+        skey->cast5.K[i++] = S5[GB(x, 0x8)] ^ S6[GB(x, 0x9)] ^ S7[GB(x, 0x7)] ^ S8[GB(x, 0x6)] ^ S5[GB(x, 0x3)];
+        skey->cast5.K[i++] = S5[GB(x, 0xa)] ^ S6[GB(x, 0xb)] ^ S7[GB(x, 0x5)] ^ S8[GB(x, 0x4)] ^ S6[GB(x, 0x7)];
+        skey->cast5.K[i++] = S5[GB(x, 0xc)] ^ S6[GB(x, 0xd)] ^ S7[GB(x, 0x3)] ^ S8[GB(x, 0x2)] ^ S7[GB(x, 0x8)];
+        skey->cast5.K[i++] = S5[GB(x, 0xe)] ^ S6[GB(x, 0xf)] ^ S7[GB(x, 0x1)] ^ S8[GB(x, 0x0)] ^ S8[GB(x, 0xd)];
+   }
+
+   skey->cast5.keylen = keylen;
+
+#ifdef LTC_CLEAN_STACK
+   zeromem(buf, sizeof(buf));
+   zeromem(x, sizeof(x));
+   zeromem(z, sizeof(z));
+#endif  
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+   int z;
+   z = _cast5_setup(key, keylen, num_rounds, skey);
+   burn_stack(sizeof(ulong32)*8 + 16 + sizeof(int)*2);
+   return z;
+}
+#endif
+
+#ifdef _MSC_VER
+   #define INLINE __inline
+#else
+   #define INLINE 
+#endif   
+   
+INLINE static ulong32 FI(ulong32 R, ulong32 Km, ulong32 Kr)
+{
+   ulong32 I;
+   I = (Km + R);
+   I = ROL(I, Kr);
+   return ((S1[byte(I, 3)] ^ S2[byte(I,2)]) - S3[byte(I,1)]) + S4[byte(I,0)];
+}
+   
+INLINE static ulong32 FII(ulong32 R, ulong32 Km, ulong32 Kr)
+{
+   ulong32 I;
+   I = (Km ^ R);
+   I = ROL(I, Kr);
+   return ((S1[byte(I, 3)] - S2[byte(I,2)]) + S3[byte(I,1)]) ^ S4[byte(I,0)];
+}
+
+INLINE static ulong32 FIII(ulong32 R, ulong32 Km, ulong32 Kr)
+{
+   ulong32 I;
+   I = (Km - R);
+   I = ROL(I, Kr);
+   return ((S1[byte(I, 3)] + S2[byte(I,2)]) ^ S3[byte(I,1)]) - S4[byte(I,0)];
+}
+
+/**
+  Encrypts a block of text with CAST5
+  @param pt The input plaintext (8 bytes)
+  @param ct The output ciphertext (8 bytes)
+  @param skey The key as scheduled
+*/
+#ifdef LTC_CLEAN_STACK
+static int _cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#else
+int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#endif
+{
+   ulong32 R, L;
+
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   LOAD32H(L,&pt[0]); 
+   LOAD32H(R,&pt[4]);
+   L ^= FI(R, skey->cast5.K[0], skey->cast5.K[16]);
+   R ^= FII(L, skey->cast5.K[1], skey->cast5.K[17]);
+   L ^= FIII(R, skey->cast5.K[2], skey->cast5.K[18]);
+   R ^= FI(L, skey->cast5.K[3], skey->cast5.K[19]);
+   L ^= FII(R, skey->cast5.K[4], skey->cast5.K[20]);
+   R ^= FIII(L, skey->cast5.K[5], skey->cast5.K[21]);
+   L ^= FI(R, skey->cast5.K[6], skey->cast5.K[22]);
+   R ^= FII(L, skey->cast5.K[7], skey->cast5.K[23]);
+   L ^= FIII(R, skey->cast5.K[8], skey->cast5.K[24]);
+   R ^= FI(L, skey->cast5.K[9], skey->cast5.K[25]);
+   L ^= FII(R, skey->cast5.K[10], skey->cast5.K[26]);
+   R ^= FIII(L, skey->cast5.K[11], skey->cast5.K[27]);
+   if (skey->cast5.keylen > 10) {
+      L ^= FI(R, skey->cast5.K[12], skey->cast5.K[28]);
+      R ^= FII(L, skey->cast5.K[13], skey->cast5.K[29]);
+      L ^= FIII(R, skey->cast5.K[14], skey->cast5.K[30]);
+      R ^= FI(L, skey->cast5.K[15], skey->cast5.K[31]);
+   }
+   STORE32H(R,&ct[0]);
+   STORE32H(L,&ct[4]);
+   return CRYPT_OK;
+}
+
+
+#ifdef LTC_CLEAN_STACK
+int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+   int err =_cast5_ecb_encrypt(pt,ct,skey);
+   burn_stack(sizeof(ulong32)*3);
+   return err;
+}
+#endif
+
+/**
+  Decrypts a block of text with CAST5
+  @param ct The input ciphertext (8 bytes)
+  @param pt The output plaintext (8 bytes)
+  @param skey The key as scheduled 
+*/
+#ifdef LTC_CLEAN_STACK
+static int _cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#else
+int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#endif
+{
+   ulong32 R, L;
+
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   LOAD32H(R,&ct[0]); 
+   LOAD32H(L,&ct[4]);
+   if (skey->cast5.keylen > 10) {
+      R ^= FI(L, skey->cast5.K[15], skey->cast5.K[31]);
+      L ^= FIII(R, skey->cast5.K[14], skey->cast5.K[30]);
+      R ^= FII(L, skey->cast5.K[13], skey->cast5.K[29]);
+      L ^= FI(R, skey->cast5.K[12], skey->cast5.K[28]);
+   }
+   R ^= FIII(L, skey->cast5.K[11], skey->cast5.K[27]);
+   L ^= FII(R, skey->cast5.K[10], skey->cast5.K[26]);
+   R ^= FI(L, skey->cast5.K[9], skey->cast5.K[25]);
+   L ^= FIII(R, skey->cast5.K[8], skey->cast5.K[24]);
+   R ^= FII(L, skey->cast5.K[7], skey->cast5.K[23]);
+   L ^= FI(R, skey->cast5.K[6], skey->cast5.K[22]);
+   R ^= FIII(L, skey->cast5.K[5], skey->cast5.K[21]);
+   L ^= FII(R, skey->cast5.K[4], skey->cast5.K[20]);
+   R ^= FI(L, skey->cast5.K[3], skey->cast5.K[19]);
+   L ^= FIII(R, skey->cast5.K[2], skey->cast5.K[18]);
+   R ^= FII(L, skey->cast5.K[1], skey->cast5.K[17]);
+   L ^= FI(R, skey->cast5.K[0], skey->cast5.K[16]);
+   STORE32H(L,&pt[0]);
+   STORE32H(R,&pt[4]);
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+   int err = _cast5_ecb_decrypt(ct,pt,skey);
+   burn_stack(sizeof(ulong32)*3);
+   return err;
+}
+#endif
+
+/**
+  Performs a self-test of the CAST5 block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int cast5_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   static const struct {
+       int keylen;
+       unsigned char key[16];
+       unsigned char pt[8];
+       unsigned char ct[8];
+   } tests[] = {
+     { 16,
+       {0x01, 0x23, 0x45, 0x67, 0x12, 0x34, 0x56, 0x78, 0x23, 0x45, 0x67, 0x89, 0x34, 0x56, 0x78, 0x9A},
+       {0x01, 0x23, 0x45, 0x67, 0x89, 0xAB, 0xCD, 0xEF},
+       {0x23, 0x8B, 0x4F, 0xE5, 0x84, 0x7E, 0x44, 0xB2}
+     },
+     { 10,
+       {0x01, 0x23, 0x45, 0x67, 0x12, 0x34, 0x56, 0x78, 0x23, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00},
+       {0x01, 0x23, 0x45, 0x67, 0x89, 0xAB, 0xCD, 0xEF},
+       {0xEB, 0x6A, 0x71, 0x1A, 0x2C, 0x02, 0x27, 0x1B},
+     },
+     { 5,
+       {0x01, 0x23, 0x45, 0x67, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00},
+       {0x01, 0x23, 0x45, 0x67, 0x89, 0xAB, 0xCD, 0xEF},
+       {0x7A, 0xC8, 0x16, 0xD1, 0x6E, 0x9B, 0x30, 0x2E}
+     }
+   };
+   int i, y, err;
+   symmetric_key key;
+   unsigned char tmp[2][8];
+
+   for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+       if ((err = cast5_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) {
+          return err;
+       }
+       cast5_ecb_encrypt(tests[i].pt, tmp[0], &key);
+       cast5_ecb_decrypt(tmp[0], tmp[1], &key);
+       if ((XMEMCMP(tmp[0], tests[i].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[i].pt, 8) != 0)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 8; y++) tmp[0][y] = 0;
+      for (y = 0; y < 1000; y++) cast5_ecb_encrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 1000; y++) cast5_ecb_decrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+   
+   }
+   return CRYPT_OK;
+ #endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void cast5_done(symmetric_key *skey)
+{
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int cast5_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize < 5) {
+      return CRYPT_INVALID_KEYSIZE;
+   } else if (*keysize > 16) {
+      *keysize = 16;
+   }
+   return CRYPT_OK;
+} 
+
+#endif
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/cast5.c,v $ */
+/* $Revision: 1.12 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/kasumi.c

@@ -0,0 +1,318 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+
+/**
+  @file kasumi.c
+  Implementation of the 3GPP Kasumi block cipher
+  Derived from the 3GPP standard source code
+*/
+
+#include "tomcrypt.h"
+
+#ifdef LTC_KASUMI
+
+typedef unsigned u16;
+
+#define ROL16(x, y) ((((x)<<(y)) | ((x)>>(16-(y)))) & 0xFFFF)
+
+const struct ltc_cipher_descriptor kasumi_desc = {
+   "kasumi",
+   21,
+   16, 16, 8, 8,
+   &kasumi_setup,
+   &kasumi_ecb_encrypt,
+   &kasumi_ecb_decrypt,
+   &kasumi_test,
+   &kasumi_done,
+   &kasumi_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+static u16 FI( u16 in, u16 subkey )
+{
+   u16 nine, seven;
+   static const u16 S7[128] = {
+      54, 50, 62, 56, 22, 34, 94, 96, 38, 6, 63, 93, 2, 18,123, 33,
+      55,113, 39,114, 21, 67, 65, 12, 47, 73, 46, 27, 25,111,124, 81,
+      53, 9,121, 79, 52, 60, 58, 48,101,127, 40,120,104, 70, 71, 43,
+      20,122, 72, 61, 23,109, 13,100, 77, 1, 16, 7, 82, 10,105, 98,
+      117,116, 76, 11, 89,106, 0,125,118, 99, 86, 69, 30, 57,126, 87,
+      112, 51, 17, 5, 95, 14, 90, 84, 91, 8, 35,103, 32, 97, 28, 66,
+      102, 31, 26, 45, 75, 4, 85, 92, 37, 74, 80, 49, 68, 29,115, 44,
+      64,107,108, 24,110, 83, 36, 78, 42, 19, 15, 41, 88,119, 59, 3 };
+  static const u16 S9[512] = {
+      167,239,161,379,391,334, 9,338, 38,226, 48,358,452,385, 90,397,
+      183,253,147,331,415,340, 51,362,306,500,262, 82,216,159,356,177,
+      175,241,489, 37,206, 17, 0,333, 44,254,378, 58,143,220, 81,400,
+       95, 3,315,245, 54,235,218,405,472,264,172,494,371,290,399, 76,
+      165,197,395,121,257,480,423,212,240, 28,462,176,406,507,288,223,
+      501,407,249,265, 89,186,221,428,164, 74,440,196,458,421,350,163,
+      232,158,134,354, 13,250,491,142,191, 69,193,425,152,227,366,135,
+      344,300,276,242,437,320,113,278, 11,243, 87,317, 36, 93,496, 27,
+      487,446,482, 41, 68,156,457,131,326,403,339, 20, 39,115,442,124,
+      475,384,508, 53,112,170,479,151,126,169, 73,268,279,321,168,364,
+      363,292, 46,499,393,327,324, 24,456,267,157,460,488,426,309,229,
+      439,506,208,271,349,401,434,236, 16,209,359, 52, 56,120,199,277,
+      465,416,252,287,246, 6, 83,305,420,345,153,502, 65, 61,244,282,
+      173,222,418, 67,386,368,261,101,476,291,195,430, 49, 79,166,330,
+      280,383,373,128,382,408,155,495,367,388,274,107,459,417, 62,454,
+      132,225,203,316,234, 14,301, 91,503,286,424,211,347,307,140,374,
+       35,103,125,427, 19,214,453,146,498,314,444,230,256,329,198,285,
+       50,116, 78,410, 10,205,510,171,231, 45,139,467, 29, 86,505, 32,
+       72, 26,342,150,313,490,431,238,411,325,149,473, 40,119,174,355,
+      185,233,389, 71,448,273,372, 55,110,178,322, 12,469,392,369,190,
+        1,109,375,137,181, 88, 75,308,260,484, 98,272,370,275,412,111,
+      336,318, 4,504,492,259,304, 77,337,435, 21,357,303,332,483, 18,
+       47, 85, 25,497,474,289,100,269,296,478,270,106, 31,104,433, 84,
+      414,486,394, 96, 99,154,511,148,413,361,409,255,162,215,302,201,
+      266,351,343,144,441,365,108,298,251, 34,182,509,138,210,335,133,
+      311,352,328,141,396,346,123,319,450,281,429,228,443,481, 92,404,
+      485,422,248,297, 23,213,130,466, 22,217,283, 70,294,360,419,127,
+      312,377, 7,468,194, 2,117,295,463,258,224,447,247,187, 80,398,
+      284,353,105,390,299,471,470,184, 57,200,348, 63,204,188, 33,451,
+       97, 30,310,219, 94,160,129,493, 64,179,263,102,189,207,114,402,
+      438,477,387,122,192, 42,381, 5,145,118,180,449,293,323,136,380,
+       43, 66, 60,455,341,445,202,432, 8,237, 15,376,436,464, 59,461};
+
+  /* The sixteen bit input is split into two unequal halves, *
+   * nine bits and seven bits - as is the subkey            */
+
+  nine  = (u16)(in>>7)&0x1FF;
+  seven = (u16)(in&0x7F);
+
+  /* Now run the various operations */
+  nine   = (u16)(S9[nine] ^ seven);
+  seven  = (u16)(S7[seven] ^ (nine & 0x7F));
+  seven ^= (subkey>>9);
+  nine  ^= (subkey&0x1FF);
+  nine   = (u16)(S9[nine] ^ seven);
+  seven  = (u16)(S7[seven] ^ (nine & 0x7F));
+  return (u16)(seven<<9) + nine;
+}
+
+static ulong32 FO( ulong32 in, int round_no, symmetric_key *key)
+{
+   u16 left, right;
+
+  /* Split the input into two 16-bit words */
+  left = (u16)(in>>16);
+  right = (u16) in&0xFFFF;
+
+  /* Now apply the same basic transformation three times */
+  left ^= key->kasumi.KOi1[round_no];
+  left = FI( left, key->kasumi.KIi1[round_no] );
+  left ^= right;
+
+  right ^= key->kasumi.KOi2[round_no];
+  right = FI( right, key->kasumi.KIi2[round_no] );
+  right ^= left;
+
+  left ^= key->kasumi.KOi3[round_no];
+  left = FI( left, key->kasumi.KIi3[round_no] );
+  left ^= right;
+
+  return (((ulong32)right)<<16)+left;
+}
+
+static ulong32 FL( ulong32 in, int round_no, symmetric_key *key )
+{
+    u16 l, r, a, b;
+    /* split out the left and right halves */
+    l = (u16)(in>>16);
+    r = (u16)(in)&0xFFFF;
+    /* do the FL() operations           */
+    a = (u16) (l & key->kasumi.KLi1[round_no]);
+    r ^= ROL16(a,1);
+    b = (u16)(r | key->kasumi.KLi2[round_no]);
+    l ^= ROL16(b,1);
+    /* put the two halves back together */
+
+    return (((ulong32)l)<<16) + r;
+}
+
+int kasumi_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+    ulong32 left, right, temp;
+    int n;
+
+    LTC_ARGCHK(pt   != NULL);
+    LTC_ARGCHK(ct   != NULL);
+    LTC_ARGCHK(skey != NULL);
+
+    LOAD32H(left, pt);
+    LOAD32H(right, pt+4);
+
+    for (n = 0; n <= 7; ) {     
+        temp = FL(left,  n,   skey);
+        temp = FO(temp,  n++, skey);
+        right ^= temp;
+        temp = FO(right, n,   skey);
+        temp = FL(temp,  n++, skey);
+        left ^= temp;
+    }
+
+    STORE32H(left, ct);
+    STORE32H(right, ct+4);
+
+    return CRYPT_OK;
+}
+
+int kasumi_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+    ulong32 left, right, temp;
+    int n;
+
+    LTC_ARGCHK(pt   != NULL);
+    LTC_ARGCHK(ct   != NULL);
+    LTC_ARGCHK(skey != NULL);
+
+    LOAD32H(left, ct);
+    LOAD32H(right, ct+4);
+
+    for (n = 7; n >= 0; ) {
+        temp = FO(right, n,   skey);
+        temp = FL(temp,  n--, skey);
+        left ^= temp;
+        temp = FL(left,  n,   skey);
+        temp = FO(temp,  n--, skey);
+        right ^= temp;
+    }
+
+    STORE32H(left, pt);
+    STORE32H(right, pt+4);
+
+    return CRYPT_OK;
+}
+
+int kasumi_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+    static const u16 C[8] = { 0x0123,0x4567,0x89AB,0xCDEF, 0xFEDC,0xBA98,0x7654,0x3210 };
+    u16 ukey[8], Kprime[8];
+    int n;
+
+    LTC_ARGCHK(key  != NULL);
+    LTC_ARGCHK(skey != NULL);
+
+    if (keylen != 16) {
+       return CRYPT_INVALID_KEYSIZE;
+    }
+
+    if (num_rounds != 0 && num_rounds != 8) {
+       return CRYPT_INVALID_ROUNDS;
+    }
+
+    /* Start by ensuring the subkeys are endian correct on a 16-bit basis */
+    for (n = 0; n < 8; n++ ) {
+        ukey[n] = (((u16)key[2*n]) << 8) | key[2*n+1];
+    }
+
+    /* Now build the K'[] keys */
+    for (n = 0; n < 8; n++) {
+        Kprime[n] = ukey[n] ^ C[n];
+    }
+
+    /* Finally construct the various sub keys */
+    for(n = 0; n < 8; n++) {
+        skey->kasumi.KLi1[n] = ROL16(ukey[n],1);
+        skey->kasumi.KLi2[n] = Kprime[(n+2)&0x7];
+        skey->kasumi.KOi1[n] = ROL16(ukey[(n+1)&0x7],5);
+        skey->kasumi.KOi2[n] = ROL16(ukey[(n+5)&0x7],8);
+        skey->kasumi.KOi3[n] = ROL16(ukey[(n+6)&0x7],13);
+        skey->kasumi.KIi1[n] = Kprime[(n+4)&0x7];
+        skey->kasumi.KIi2[n] = Kprime[(n+3)&0x7];
+        skey->kasumi.KIi3[n] = Kprime[(n+7)&0x7];
+    }
+
+    return CRYPT_OK;
+}
+
+void kasumi_done(symmetric_key *skey)
+{
+}
+
+int kasumi_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize >= 16) {
+      *keysize = 16;
+      return CRYPT_OK;
+   } else {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+}
+
+int kasumi_test(void)
+{
+#ifndef LTC_TEST
+   return CRYPT_NOP;
+#else
+   static const struct {
+      unsigned char key[16], pt[8], ct[8];
+   } tests[] = {
+
+{
+   { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x4B, 0x58, 0xA7, 0x71, 0xAF, 0xC7, 0xE5, 0xE8 }
+},
+
+{
+   { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x7E, 0xEF, 0x11, 0x3C, 0x95, 0xBB, 0x5A, 0x77 }
+},
+
+{
+   { 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x5F, 0x14, 0x06, 0x86, 0xD7, 0xAD, 0x5A, 0x39 },
+},
+
+{
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x2E, 0x14, 0x91, 0xCF, 0x70, 0xAA, 0x46, 0x5D }
+},
+
+{
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0xB5, 0x45, 0x86, 0xF4, 0xAB, 0x9A, 0xE5, 0x46 }
+},
+
+};
+   unsigned char buf[2][8];
+   symmetric_key key;
+   int err, x;
+
+   for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
+       if ((err = kasumi_setup(tests[x].key, 16, 0, &key)) != CRYPT_OK) {
+          return err;
+       }
+       if ((err = kasumi_ecb_encrypt(tests[x].pt, buf[0], &key)) != CRYPT_OK) {
+          return err;
+       }
+       if ((err = kasumi_ecb_decrypt(tests[x].ct, buf[1], &key)) != CRYPT_OK) {
+          return err;
+       }
+       if (XMEMCMP(tests[x].pt, buf[1], 8) || XMEMCMP(tests[x].ct, buf[0], 8)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/kasumi.c,v $ */
+/* $Revision: 1.7 $ */
+/* $Date: 2006/11/09 03:05:44 $ */

libtomcrypt/src/ciphers/khazad.c

@@ -0,0 +1,855 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+#include "tomcrypt.h"
+
+/**
+  @file khazad.c
+  Khazad implementation derived from public domain source
+  Authors: Paulo S.L.M. Barreto and Vincent Rijmen.
+*/
+
+#ifdef KHAZAD
+
+const struct ltc_cipher_descriptor khazad_desc = {
+   "khazad",
+   18,
+   16, 16, 8, 8,
+   &khazad_setup,
+   &khazad_ecb_encrypt,
+   &khazad_ecb_decrypt,
+   &khazad_test,
+   &khazad_done,
+   &khazad_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+#define R      8 
+#define KEYSIZE      128 
+#define KEYSIZEB   (KEYSIZE/8) 
+#define BLOCKSIZE   64 
+#define BLOCKSIZEB   (BLOCKSIZE/8) 
+
+static const ulong64 T0[256] = {
+    CONST64(0xbad3d268bbb96a01), CONST64(0x54fc4d19e59a66b1), CONST64(0x2f71bc93e26514cd), CONST64(0x749ccdb925871b51),
+    CONST64(0x53f55102f7a257a4), CONST64(0xd3686bb8d0d6be03), CONST64(0xd26b6fbdd6deb504), CONST64(0x4dd72964b35285fe),
+    CONST64(0x50f05d0dfdba4aad), CONST64(0xace98a26cf09e063), CONST64(0x8d8a0e83091c9684), CONST64(0xbfdcc679a5914d1a),
+    CONST64(0x7090ddad3da7374d), CONST64(0x52f65507f1aa5ca3), CONST64(0x9ab352c87ba417e1), CONST64(0x4cd42d61b55a8ef9),
+    CONST64(0xea238f65460320ac), CONST64(0xd56273a6c4e68411), CONST64(0x97a466f155cc68c2), CONST64(0xd16e63b2dcc6a80d),
+    CONST64(0x3355ccffaa85d099), CONST64(0x51f35908fbb241aa), CONST64(0x5bed712ac7e20f9c), CONST64(0xa6f7a204f359ae55),
+    CONST64(0xde7f5f81febec120), CONST64(0x48d83d75ad7aa2e5), CONST64(0xa8e59a32d729cc7f), CONST64(0x99b65ec771bc0ae8),
+    CONST64(0xdb704b90e096e63b), CONST64(0x3256c8faac8ddb9e), CONST64(0xb7c4e65195d11522), CONST64(0xfc19d72b32b3aace),
+    CONST64(0xe338ab48704b7393), CONST64(0x9ebf42dc63843bfd), CONST64(0x91ae7eef41fc52d0), CONST64(0x9bb056cd7dac1ce6),
+    CONST64(0xe23baf4d76437894), CONST64(0xbbd0d66dbdb16106), CONST64(0x41c319589b32f1da), CONST64(0x6eb2a5cb7957e517),
+    CONST64(0xa5f2ae0bf941b35c), CONST64(0xcb400bc08016564b), CONST64(0x6bbdb1da677fc20c), CONST64(0x95a26efb59dc7ecc),
+    CONST64(0xa1febe1fe1619f40), CONST64(0xf308eb1810cbc3e3), CONST64(0xb1cefe4f81e12f30), CONST64(0x0206080a0c10160e),
+    CONST64(0xcc4917db922e675e), CONST64(0xc45137f3a26e3f66), CONST64(0x1d2774694ee8cf53), CONST64(0x143c504478a09c6c),
+    CONST64(0xc3582be8b0560e73), CONST64(0x63a591f2573f9a34), CONST64(0xda734f95e69eed3c), CONST64(0x5de76934d3d2358e),
+    CONST64(0x5fe1613edfc22380), CONST64(0xdc79578bf2aed72e), CONST64(0x7d87e99413cf486e), CONST64(0xcd4a13de94266c59),
+    CONST64(0x7f81e19e1fdf5e60), CONST64(0x5aee752fc1ea049b), CONST64(0x6cb4adc17547f319), CONST64(0x5ce46d31d5da3e89),
+    CONST64(0xf704fb0c08ebefff), CONST64(0x266a98bed42d47f2), CONST64(0xff1cdb2438abb7c7), CONST64(0xed2a937e543b11b9),
+    CONST64(0xe825876f4a1336a2), CONST64(0x9dba4ed3699c26f4), CONST64(0x6fb1a1ce7f5fee10), CONST64(0x8e8f028c03048b8d),
+    CONST64(0x192b647d56c8e34f), CONST64(0xa0fdba1ae7699447), CONST64(0xf00de7171ad3deea), CONST64(0x89861e97113cba98),
+    CONST64(0x0f113c332278692d), CONST64(0x07091c1b12383115), CONST64(0xafec8629c511fd6a), CONST64(0xfb10cb30208b9bdb),
+    CONST64(0x0818202830405838), CONST64(0x153f54417ea8976b), CONST64(0x0d1734392e687f23), CONST64(0x040c101418202c1c),
+    CONST64(0x0103040506080b07), CONST64(0x64ac8de94507ab21), CONST64(0xdf7c5b84f8b6ca27), CONST64(0x769ac5b329970d5f),
+    CONST64(0x798bf9800bef6472), CONST64(0xdd7a538ef4a6dc29), CONST64(0x3d47f4c98ef5b2b3), CONST64(0x163a584e74b08a62),
+    CONST64(0x3f41fcc382e5a4bd), CONST64(0x3759dcebb2a5fc85), CONST64(0x6db7a9c4734ff81e), CONST64(0x3848e0d890dd95a8),
+    CONST64(0xb9d6de67b1a17708), CONST64(0x7395d1a237bf2a44), CONST64(0xe926836a4c1b3da5), CONST64(0x355fd4e1beb5ea8b),
+    CONST64(0x55ff491ce3926db6), CONST64(0x7193d9a83baf3c4a), CONST64(0x7b8df18a07ff727c), CONST64(0x8c890a860f149d83),
+    CONST64(0x7296d5a731b72143), CONST64(0x88851a921734b19f), CONST64(0xf607ff090ee3e4f8), CONST64(0x2a7ea882fc4d33d6),
+    CONST64(0x3e42f8c684edafba), CONST64(0x5ee2653bd9ca2887), CONST64(0x27699cbbd2254cf5), CONST64(0x46ca0543890ac0cf),
+    CONST64(0x0c14303c28607424), CONST64(0x65af89ec430fa026), CONST64(0x68b8bdd56d67df05), CONST64(0x61a399f85b2f8c3a),
+    CONST64(0x03050c0f0a181d09), CONST64(0xc15e23e2bc46187d), CONST64(0x57f94116ef827bb8), CONST64(0xd6677fa9cefe9918),
+    CONST64(0xd976439aec86f035), CONST64(0x58e87d25cdfa1295), CONST64(0xd875479fea8efb32), CONST64(0x66aa85e34917bd2f),
+    CONST64(0xd7647bacc8f6921f), CONST64(0x3a4ee8d29ccd83a6), CONST64(0xc84507cf8a0e4b42), CONST64(0x3c44f0cc88fdb9b4),
+    CONST64(0xfa13cf35268390dc), CONST64(0x96a762f453c463c5), CONST64(0xa7f4a601f551a552), CONST64(0x98b55ac277b401ef),
+    CONST64(0xec29977b52331abe), CONST64(0xb8d5da62b7a97c0f), CONST64(0xc7543bfca876226f), CONST64(0xaeef822cc319f66d),
+    CONST64(0x69bbb9d06b6fd402), CONST64(0x4bdd317aa762bfec), CONST64(0xabe0963ddd31d176), CONST64(0xa9e69e37d121c778),
+    CONST64(0x67a981e64f1fb628), CONST64(0x0a1e28223c504e36), CONST64(0x47c901468f02cbc8), CONST64(0xf20bef1d16c3c8e4),
+    CONST64(0xb5c2ee5b99c1032c), CONST64(0x226688aacc0d6bee), CONST64(0xe532b356647b4981), CONST64(0xee2f9f715e230cb0),
+    CONST64(0xbedfc27ca399461d), CONST64(0x2b7dac87fa4538d1), CONST64(0x819e3ebf217ce2a0), CONST64(0x1236485a6c90a67e),
+    CONST64(0x839836b52d6cf4ae), CONST64(0x1b2d6c775ad8f541), CONST64(0x0e1238362470622a), CONST64(0x23658cafca0560e9),
+    CONST64(0xf502f30604fbf9f1), CONST64(0x45cf094c8312ddc6), CONST64(0x216384a5c61576e7), CONST64(0xce4f1fd19e3e7150),
+    CONST64(0x49db3970ab72a9e2), CONST64(0x2c74b09ce87d09c4), CONST64(0xf916c33a2c9b8dd5), CONST64(0xe637bf596e635488),
+    CONST64(0xb6c7e25493d91e25), CONST64(0x2878a088f05d25d8), CONST64(0x17395c4b72b88165), CONST64(0x829b32b02b64ffa9),
+    CONST64(0x1a2e68725cd0fe46), CONST64(0x8b80169d1d2cac96), CONST64(0xfe1fdf213ea3bcc0), CONST64(0x8a8312981b24a791),
+    CONST64(0x091b242d3648533f), CONST64(0xc94603ca8c064045), CONST64(0x879426a1354cd8b2), CONST64(0x4ed2256bb94a98f7),
+    CONST64(0xe13ea3427c5b659d), CONST64(0x2e72b896e46d1fca), CONST64(0xe431b75362734286), CONST64(0xe03da7477a536e9a),
+    CONST64(0xeb208b60400b2bab), CONST64(0x90ad7aea47f459d7), CONST64(0xa4f1aa0eff49b85b), CONST64(0x1e22786644f0d25a),
+    CONST64(0x85922eab395ccebc), CONST64(0x60a09dfd5d27873d), CONST64(0x0000000000000000), CONST64(0x256f94b1de355afb),
+    CONST64(0xf401f70302f3f2f6), CONST64(0xf10ee3121cdbd5ed), CONST64(0x94a16afe5fd475cb), CONST64(0x0b1d2c273a584531),
+    CONST64(0xe734bb5c686b5f8f), CONST64(0x759fc9bc238f1056), CONST64(0xef2c9b74582b07b7), CONST64(0x345cd0e4b8bde18c),
+    CONST64(0x3153c4f5a695c697), CONST64(0xd46177a3c2ee8f16), CONST64(0xd06d67b7dacea30a), CONST64(0x869722a43344d3b5),
+    CONST64(0x7e82e59b19d75567), CONST64(0xadea8e23c901eb64), CONST64(0xfd1ad32e34bba1c9), CONST64(0x297ba48df6552edf),
+    CONST64(0x3050c0f0a09dcd90), CONST64(0x3b4decd79ac588a1), CONST64(0x9fbc46d9658c30fa), CONST64(0xf815c73f2a9386d2),
+    CONST64(0xc6573ff9ae7e2968), CONST64(0x13354c5f6a98ad79), CONST64(0x060a181e14303a12), CONST64(0x050f14111e28271b),
+    CONST64(0xc55233f6a4663461), CONST64(0x113344556688bb77), CONST64(0x7799c1b62f9f0658), CONST64(0x7c84ed9115c74369),
+    CONST64(0x7a8ef58f01f7797b), CONST64(0x7888fd850de76f75), CONST64(0x365ad8eeb4adf782), CONST64(0x1c24706c48e0c454),
+    CONST64(0x394be4dd96d59eaf), CONST64(0x59eb7920cbf21992), CONST64(0x1828607850c0e848), CONST64(0x56fa4513e98a70bf),
+    CONST64(0xb3c8f6458df1393e), CONST64(0xb0cdfa4a87e92437), CONST64(0x246c90b4d83d51fc), CONST64(0x206080a0c01d7de0),
+    CONST64(0xb2cbf2408bf93239), CONST64(0x92ab72e04be44fd9), CONST64(0xa3f8b615ed71894e), CONST64(0xc05d27e7ba4e137a),
+    CONST64(0x44cc0d49851ad6c1), CONST64(0x62a695f751379133), CONST64(0x103040506080b070), CONST64(0xb4c1ea5e9fc9082b),
+    CONST64(0x84912aae3f54c5bb), CONST64(0x43c511529722e7d4), CONST64(0x93a876e54dec44de), CONST64(0xc25b2fedb65e0574),
+    CONST64(0x4ade357fa16ab4eb), CONST64(0xbddace73a9815b14), CONST64(0x8f8c0689050c808a), CONST64(0x2d77b499ee7502c3),
+    CONST64(0xbcd9ca76af895013), CONST64(0x9cb94ad66f942df3), CONST64(0x6abeb5df6177c90b), CONST64(0x40c01d5d9d3afadd),
+    CONST64(0xcf4c1bd498367a57), CONST64(0xa2fbb210eb798249), CONST64(0x809d3aba2774e9a7), CONST64(0x4fd1216ebf4293f0),
+    CONST64(0x1f217c6342f8d95d), CONST64(0xca430fc5861e5d4c), CONST64(0xaae39238db39da71), CONST64(0x42c61557912aecd3),
+};
+
+static const ulong64 T1[256] = {
+    CONST64(0xd3ba68d2b9bb016a), CONST64(0xfc54194d9ae5b166), CONST64(0x712f93bc65e2cd14), CONST64(0x9c74b9cd8725511b),
+    CONST64(0xf5530251a2f7a457), CONST64(0x68d3b86bd6d003be), CONST64(0x6bd2bd6fded604b5), CONST64(0xd74d642952b3fe85),
+    CONST64(0xf0500d5dbafdad4a), CONST64(0xe9ac268a09cf63e0), CONST64(0x8a8d830e1c098496), CONST64(0xdcbf79c691a51a4d),
+    CONST64(0x9070addda73d4d37), CONST64(0xf6520755aaf1a35c), CONST64(0xb39ac852a47be117), CONST64(0xd44c612d5ab5f98e),
+    CONST64(0x23ea658f0346ac20), CONST64(0x62d5a673e6c41184), CONST64(0xa497f166cc55c268), CONST64(0x6ed1b263c6dc0da8),
+    CONST64(0x5533ffcc85aa99d0), CONST64(0xf3510859b2fbaa41), CONST64(0xed5b2a71e2c79c0f), CONST64(0xf7a604a259f355ae),
+    CONST64(0x7fde815fbefe20c1), CONST64(0xd848753d7aade5a2), CONST64(0xe5a8329a29d77fcc), CONST64(0xb699c75ebc71e80a),
+    CONST64(0x70db904b96e03be6), CONST64(0x5632fac88dac9edb), CONST64(0xc4b751e6d1952215), CONST64(0x19fc2bd7b332ceaa),
+    CONST64(0x38e348ab4b709373), CONST64(0xbf9edc428463fd3b), CONST64(0xae91ef7efc41d052), CONST64(0xb09bcd56ac7de61c),
+    CONST64(0x3be24daf43769478), CONST64(0xd0bb6dd6b1bd0661), CONST64(0xc3415819329bdaf1), CONST64(0xb26ecba5577917e5),
+    CONST64(0xf2a50bae41f95cb3), CONST64(0x40cbc00b16804b56), CONST64(0xbd6bdab17f670cc2), CONST64(0xa295fb6edc59cc7e),
+    CONST64(0xfea11fbe61e1409f), CONST64(0x08f318ebcb10e3c3), CONST64(0xceb14ffee181302f), CONST64(0x06020a08100c0e16),
+    CONST64(0x49ccdb172e925e67), CONST64(0x51c4f3376ea2663f), CONST64(0x271d6974e84e53cf), CONST64(0x3c144450a0786c9c),
+    CONST64(0x58c3e82b56b0730e), CONST64(0xa563f2913f57349a), CONST64(0x73da954f9ee63ced), CONST64(0xe75d3469d2d38e35),
+    CONST64(0xe15f3e61c2df8023), CONST64(0x79dc8b57aef22ed7), CONST64(0x877d94e9cf136e48), CONST64(0x4acdde132694596c),
+    CONST64(0x817f9ee1df1f605e), CONST64(0xee5a2f75eac19b04), CONST64(0xb46cc1ad477519f3), CONST64(0xe45c316ddad5893e),
+    CONST64(0x04f70cfbeb08ffef), CONST64(0x6a26be982dd4f247), CONST64(0x1cff24dbab38c7b7), CONST64(0x2aed7e933b54b911),
+    CONST64(0x25e86f87134aa236), CONST64(0xba9dd34e9c69f426), CONST64(0xb16fcea15f7f10ee), CONST64(0x8f8e8c0204038d8b),
+    CONST64(0x2b197d64c8564fe3), CONST64(0xfda01aba69e74794), CONST64(0x0df017e7d31aeade), CONST64(0x8689971e3c1198ba),
+    CONST64(0x110f333c78222d69), CONST64(0x09071b1c38121531), CONST64(0xecaf298611c56afd), CONST64(0x10fb30cb8b20db9b),
+    CONST64(0x1808282040303858), CONST64(0x3f154154a87e6b97), CONST64(0x170d3934682e237f), CONST64(0x0c04141020181c2c),
+    CONST64(0x030105040806070b), CONST64(0xac64e98d074521ab), CONST64(0x7cdf845bb6f827ca), CONST64(0x9a76b3c597295f0d),
+    CONST64(0x8b7980f9ef0b7264), CONST64(0x7add8e53a6f429dc), CONST64(0x473dc9f4f58eb3b2), CONST64(0x3a164e58b074628a),
+    CONST64(0x413fc3fce582bda4), CONST64(0x5937ebdca5b285fc), CONST64(0xb76dc4a94f731ef8), CONST64(0x4838d8e0dd90a895),
+    CONST64(0xd6b967dea1b10877), CONST64(0x9573a2d1bf37442a), CONST64(0x26e96a831b4ca53d), CONST64(0x5f35e1d4b5be8bea),
+    CONST64(0xff551c4992e3b66d), CONST64(0x9371a8d9af3b4a3c), CONST64(0x8d7b8af1ff077c72), CONST64(0x898c860a140f839d),
+    CONST64(0x9672a7d5b7314321), CONST64(0x8588921a34179fb1), CONST64(0x07f609ffe30ef8e4), CONST64(0x7e2a82a84dfcd633),
+    CONST64(0x423ec6f8ed84baaf), CONST64(0xe25e3b65cad98728), CONST64(0x6927bb9c25d2f54c), CONST64(0xca4643050a89cfc0),
+    CONST64(0x140c3c3060282474), CONST64(0xaf65ec890f4326a0), CONST64(0xb868d5bd676d05df), CONST64(0xa361f8992f5b3a8c),
+    CONST64(0x05030f0c180a091d), CONST64(0x5ec1e22346bc7d18), CONST64(0xf957164182efb87b), CONST64(0x67d6a97ffece1899),
+    CONST64(0x76d99a4386ec35f0), CONST64(0xe858257dfacd9512), CONST64(0x75d89f478eea32fb), CONST64(0xaa66e38517492fbd),
+    CONST64(0x64d7ac7bf6c81f92), CONST64(0x4e3ad2e8cd9ca683), CONST64(0x45c8cf070e8a424b), CONST64(0x443cccf0fd88b4b9),
+    CONST64(0x13fa35cf8326dc90), CONST64(0xa796f462c453c563), CONST64(0xf4a701a651f552a5), CONST64(0xb598c25ab477ef01),
+    CONST64(0x29ec7b973352be1a), CONST64(0xd5b862daa9b70f7c), CONST64(0x54c7fc3b76a86f22), CONST64(0xefae2c8219c36df6),
+    CONST64(0xbb69d0b96f6b02d4), CONST64(0xdd4b7a3162a7ecbf), CONST64(0xe0ab3d9631dd76d1), CONST64(0xe6a9379e21d178c7),
+    CONST64(0xa967e6811f4f28b6), CONST64(0x1e0a2228503c364e), CONST64(0xc9474601028fc8cb), CONST64(0x0bf21defc316e4c8),
+    CONST64(0xc2b55beec1992c03), CONST64(0x6622aa880dccee6b), CONST64(0x32e556b37b648149), CONST64(0x2fee719f235eb00c),
+    CONST64(0xdfbe7cc299a31d46), CONST64(0x7d2b87ac45fad138), CONST64(0x9e81bf3e7c21a0e2), CONST64(0x36125a48906c7ea6),
+    CONST64(0x9883b5366c2daef4), CONST64(0x2d1b776cd85a41f5), CONST64(0x120e363870242a62), CONST64(0x6523af8c05cae960),
+    CONST64(0x02f506f3fb04f1f9), CONST64(0xcf454c091283c6dd), CONST64(0x6321a58415c6e776), CONST64(0x4fced11f3e9e5071),
+    CONST64(0xdb49703972abe2a9), CONST64(0x742c9cb07de8c409), CONST64(0x16f93ac39b2cd58d), CONST64(0x37e659bf636e8854),
+    CONST64(0xc7b654e2d993251e), CONST64(0x782888a05df0d825), CONST64(0x39174b5cb8726581), CONST64(0x9b82b032642ba9ff),
+    CONST64(0x2e1a7268d05c46fe), CONST64(0x808b9d162c1d96ac), CONST64(0x1ffe21dfa33ec0bc), CONST64(0x838a9812241b91a7),
+    CONST64(0x1b092d2448363f53), CONST64(0x46c9ca03068c4540), CONST64(0x9487a1264c35b2d8), CONST64(0xd24e6b254ab9f798),
+    CONST64(0x3ee142a35b7c9d65), CONST64(0x722e96b86de4ca1f), CONST64(0x31e453b773628642), CONST64(0x3de047a7537a9a6e),
+    CONST64(0x20eb608b0b40ab2b), CONST64(0xad90ea7af447d759), CONST64(0xf1a40eaa49ff5bb8), CONST64(0x221e6678f0445ad2),
+    CONST64(0x9285ab2e5c39bcce), CONST64(0xa060fd9d275d3d87), CONST64(0x0000000000000000), CONST64(0x6f25b19435defb5a),
+    CONST64(0x01f403f7f302f6f2), CONST64(0x0ef112e3db1cedd5), CONST64(0xa194fe6ad45fcb75), CONST64(0x1d0b272c583a3145),
+    CONST64(0x34e75cbb6b688f5f), CONST64(0x9f75bcc98f235610), CONST64(0x2cef749b2b58b707), CONST64(0x5c34e4d0bdb88ce1),
+    CONST64(0x5331f5c495a697c6), CONST64(0x61d4a377eec2168f), CONST64(0x6dd0b767ceda0aa3), CONST64(0x9786a4224433b5d3),
+    CONST64(0x827e9be5d7196755), CONST64(0xeaad238e01c964eb), CONST64(0x1afd2ed3bb34c9a1), CONST64(0x7b298da455f6df2e),
+    CONST64(0x5030f0c09da090cd), CONST64(0x4d3bd7ecc59aa188), CONST64(0xbc9fd9468c65fa30), CONST64(0x15f83fc7932ad286),
+    CONST64(0x57c6f93f7eae6829), CONST64(0x35135f4c986a79ad), CONST64(0x0a061e183014123a), CONST64(0x0f051114281e1b27),
+    CONST64(0x52c5f63366a46134), CONST64(0x33115544886677bb), CONST64(0x9977b6c19f2f5806), CONST64(0x847c91edc7156943),
+    CONST64(0x8e7a8ff5f7017b79), CONST64(0x887885fde70d756f), CONST64(0x5a36eed8adb482f7), CONST64(0x241c6c70e04854c4),
+    CONST64(0x4b39dde4d596af9e), CONST64(0xeb592079f2cb9219), CONST64(0x28187860c05048e8), CONST64(0xfa5613458ae9bf70),
+    CONST64(0xc8b345f6f18d3e39), CONST64(0xcdb04afae9873724), CONST64(0x6c24b4903dd8fc51), CONST64(0x6020a0801dc0e07d),
+    CONST64(0xcbb240f2f98b3932), CONST64(0xab92e072e44bd94f), CONST64(0xf8a315b671ed4e89), CONST64(0x5dc0e7274eba7a13),
+    CONST64(0xcc44490d1a85c1d6), CONST64(0xa662f79537513391), CONST64(0x30105040806070b0), CONST64(0xc1b45eeac99f2b08),
+    CONST64(0x9184ae2a543fbbc5), CONST64(0xc54352112297d4e7), CONST64(0xa893e576ec4dde44), CONST64(0x5bc2ed2f5eb67405),
+    CONST64(0xde4a7f356aa1ebb4), CONST64(0xdabd73ce81a9145b), CONST64(0x8c8f89060c058a80), CONST64(0x772d99b475eec302),
+    CONST64(0xd9bc76ca89af1350), CONST64(0xb99cd64a946ff32d), CONST64(0xbe6adfb577610bc9), CONST64(0xc0405d1d3a9dddfa),
+    CONST64(0x4ccfd41b3698577a), CONST64(0xfba210b279eb4982), CONST64(0x9d80ba3a7427a7e9), CONST64(0xd14f6e2142bff093),
+    CONST64(0x211f637cf8425dd9), CONST64(0x43cac50f1e864c5d), CONST64(0xe3aa389239db71da), CONST64(0xc64257152a91d3ec),
+};
+
+static const ulong64 T2[256] = {
+    CONST64(0xd268bad36a01bbb9), CONST64(0x4d1954fc66b1e59a), CONST64(0xbc932f7114cde265), CONST64(0xcdb9749c1b512587),
+    CONST64(0x510253f557a4f7a2), CONST64(0x6bb8d368be03d0d6), CONST64(0x6fbdd26bb504d6de), CONST64(0x29644dd785feb352),
+    CONST64(0x5d0d50f04aadfdba), CONST64(0x8a26ace9e063cf09), CONST64(0x0e838d8a9684091c), CONST64(0xc679bfdc4d1aa591),
+    CONST64(0xddad7090374d3da7), CONST64(0x550752f65ca3f1aa), CONST64(0x52c89ab317e17ba4), CONST64(0x2d614cd48ef9b55a),
+    CONST64(0x8f65ea2320ac4603), CONST64(0x73a6d5628411c4e6), CONST64(0x66f197a468c255cc), CONST64(0x63b2d16ea80ddcc6),
+    CONST64(0xccff3355d099aa85), CONST64(0x590851f341aafbb2), CONST64(0x712a5bed0f9cc7e2), CONST64(0xa204a6f7ae55f359),
+    CONST64(0x5f81de7fc120febe), CONST64(0x3d7548d8a2e5ad7a), CONST64(0x9a32a8e5cc7fd729), CONST64(0x5ec799b60ae871bc),
+    CONST64(0x4b90db70e63be096), CONST64(0xc8fa3256db9eac8d), CONST64(0xe651b7c4152295d1), CONST64(0xd72bfc19aace32b3),
+    CONST64(0xab48e3387393704b), CONST64(0x42dc9ebf3bfd6384), CONST64(0x7eef91ae52d041fc), CONST64(0x56cd9bb01ce67dac),
+    CONST64(0xaf4de23b78947643), CONST64(0xd66dbbd06106bdb1), CONST64(0x195841c3f1da9b32), CONST64(0xa5cb6eb2e5177957),
+    CONST64(0xae0ba5f2b35cf941), CONST64(0x0bc0cb40564b8016), CONST64(0xb1da6bbdc20c677f), CONST64(0x6efb95a27ecc59dc),
+    CONST64(0xbe1fa1fe9f40e161), CONST64(0xeb18f308c3e310cb), CONST64(0xfe4fb1ce2f3081e1), CONST64(0x080a0206160e0c10),
+    CONST64(0x17dbcc49675e922e), CONST64(0x37f3c4513f66a26e), CONST64(0x74691d27cf534ee8), CONST64(0x5044143c9c6c78a0),
+    CONST64(0x2be8c3580e73b056), CONST64(0x91f263a59a34573f), CONST64(0x4f95da73ed3ce69e), CONST64(0x69345de7358ed3d2),
+    CONST64(0x613e5fe12380dfc2), CONST64(0x578bdc79d72ef2ae), CONST64(0xe9947d87486e13cf), CONST64(0x13decd4a6c599426),
+    CONST64(0xe19e7f815e601fdf), CONST64(0x752f5aee049bc1ea), CONST64(0xadc16cb4f3197547), CONST64(0x6d315ce43e89d5da),
+    CONST64(0xfb0cf704efff08eb), CONST64(0x98be266a47f2d42d), CONST64(0xdb24ff1cb7c738ab), CONST64(0x937eed2a11b9543b),
+    CONST64(0x876fe82536a24a13), CONST64(0x4ed39dba26f4699c), CONST64(0xa1ce6fb1ee107f5f), CONST64(0x028c8e8f8b8d0304),
+    CONST64(0x647d192be34f56c8), CONST64(0xba1aa0fd9447e769), CONST64(0xe717f00ddeea1ad3), CONST64(0x1e978986ba98113c),
+    CONST64(0x3c330f11692d2278), CONST64(0x1c1b070931151238), CONST64(0x8629afecfd6ac511), CONST64(0xcb30fb109bdb208b),
+    CONST64(0x2028081858383040), CONST64(0x5441153f976b7ea8), CONST64(0x34390d177f232e68), CONST64(0x1014040c2c1c1820),
+    CONST64(0x040501030b070608), CONST64(0x8de964acab214507), CONST64(0x5b84df7cca27f8b6), CONST64(0xc5b3769a0d5f2997),
+    CONST64(0xf980798b64720bef), CONST64(0x538edd7adc29f4a6), CONST64(0xf4c93d47b2b38ef5), CONST64(0x584e163a8a6274b0),
+    CONST64(0xfcc33f41a4bd82e5), CONST64(0xdceb3759fc85b2a5), CONST64(0xa9c46db7f81e734f), CONST64(0xe0d8384895a890dd),
+    CONST64(0xde67b9d67708b1a1), CONST64(0xd1a273952a4437bf), CONST64(0x836ae9263da54c1b), CONST64(0xd4e1355fea8bbeb5),
+    CONST64(0x491c55ff6db6e392), CONST64(0xd9a871933c4a3baf), CONST64(0xf18a7b8d727c07ff), CONST64(0x0a868c899d830f14),
+    CONST64(0xd5a77296214331b7), CONST64(0x1a928885b19f1734), CONST64(0xff09f607e4f80ee3), CONST64(0xa8822a7e33d6fc4d),
+    CONST64(0xf8c63e42afba84ed), CONST64(0x653b5ee22887d9ca), CONST64(0x9cbb27694cf5d225), CONST64(0x054346cac0cf890a),
+    CONST64(0x303c0c1474242860), CONST64(0x89ec65afa026430f), CONST64(0xbdd568b8df056d67), CONST64(0x99f861a38c3a5b2f),
+    CONST64(0x0c0f03051d090a18), CONST64(0x23e2c15e187dbc46), CONST64(0x411657f97bb8ef82), CONST64(0x7fa9d6679918cefe),
+    CONST64(0x439ad976f035ec86), CONST64(0x7d2558e81295cdfa), CONST64(0x479fd875fb32ea8e), CONST64(0x85e366aabd2f4917),
+    CONST64(0x7bacd764921fc8f6), CONST64(0xe8d23a4e83a69ccd), CONST64(0x07cfc8454b428a0e), CONST64(0xf0cc3c44b9b488fd),
+    CONST64(0xcf35fa1390dc2683), CONST64(0x62f496a763c553c4), CONST64(0xa601a7f4a552f551), CONST64(0x5ac298b501ef77b4),
+    CONST64(0x977bec291abe5233), CONST64(0xda62b8d57c0fb7a9), CONST64(0x3bfcc754226fa876), CONST64(0x822caeeff66dc319),
+    CONST64(0xb9d069bbd4026b6f), CONST64(0x317a4bddbfeca762), CONST64(0x963dabe0d176dd31), CONST64(0x9e37a9e6c778d121),
+    CONST64(0x81e667a9b6284f1f), CONST64(0x28220a1e4e363c50), CONST64(0x014647c9cbc88f02), CONST64(0xef1df20bc8e416c3),
+    CONST64(0xee5bb5c2032c99c1), CONST64(0x88aa22666beecc0d), CONST64(0xb356e5324981647b), CONST64(0x9f71ee2f0cb05e23),
+    CONST64(0xc27cbedf461da399), CONST64(0xac872b7d38d1fa45), CONST64(0x3ebf819ee2a0217c), CONST64(0x485a1236a67e6c90),
+    CONST64(0x36b58398f4ae2d6c), CONST64(0x6c771b2df5415ad8), CONST64(0x38360e12622a2470), CONST64(0x8caf236560e9ca05),
+    CONST64(0xf306f502f9f104fb), CONST64(0x094c45cfddc68312), CONST64(0x84a5216376e7c615), CONST64(0x1fd1ce4f71509e3e),
+    CONST64(0x397049dba9e2ab72), CONST64(0xb09c2c7409c4e87d), CONST64(0xc33af9168dd52c9b), CONST64(0xbf59e63754886e63),
+    CONST64(0xe254b6c71e2593d9), CONST64(0xa088287825d8f05d), CONST64(0x5c4b1739816572b8), CONST64(0x32b0829bffa92b64),
+    CONST64(0x68721a2efe465cd0), CONST64(0x169d8b80ac961d2c), CONST64(0xdf21fe1fbcc03ea3), CONST64(0x12988a83a7911b24),
+    CONST64(0x242d091b533f3648), CONST64(0x03cac94640458c06), CONST64(0x26a18794d8b2354c), CONST64(0x256b4ed298f7b94a),
+    CONST64(0xa342e13e659d7c5b), CONST64(0xb8962e721fcae46d), CONST64(0xb753e43142866273), CONST64(0xa747e03d6e9a7a53),
+    CONST64(0x8b60eb202bab400b), CONST64(0x7aea90ad59d747f4), CONST64(0xaa0ea4f1b85bff49), CONST64(0x78661e22d25a44f0),
+    CONST64(0x2eab8592cebc395c), CONST64(0x9dfd60a0873d5d27), CONST64(0x0000000000000000), CONST64(0x94b1256f5afbde35),
+    CONST64(0xf703f401f2f602f3), CONST64(0xe312f10ed5ed1cdb), CONST64(0x6afe94a175cb5fd4), CONST64(0x2c270b1d45313a58),
+    CONST64(0xbb5ce7345f8f686b), CONST64(0xc9bc759f1056238f), CONST64(0x9b74ef2c07b7582b), CONST64(0xd0e4345ce18cb8bd),
+    CONST64(0xc4f53153c697a695), CONST64(0x77a3d4618f16c2ee), CONST64(0x67b7d06da30adace), CONST64(0x22a48697d3b53344),
+    CONST64(0xe59b7e82556719d7), CONST64(0x8e23adeaeb64c901), CONST64(0xd32efd1aa1c934bb), CONST64(0xa48d297b2edff655),
+    CONST64(0xc0f03050cd90a09d), CONST64(0xecd73b4d88a19ac5), CONST64(0x46d99fbc30fa658c), CONST64(0xc73ff81586d22a93),
+    CONST64(0x3ff9c6572968ae7e), CONST64(0x4c5f1335ad796a98), CONST64(0x181e060a3a121430), CONST64(0x1411050f271b1e28),
+    CONST64(0x33f6c5523461a466), CONST64(0x44551133bb776688), CONST64(0xc1b6779906582f9f), CONST64(0xed917c84436915c7),
+    CONST64(0xf58f7a8e797b01f7), CONST64(0xfd8578886f750de7), CONST64(0xd8ee365af782b4ad), CONST64(0x706c1c24c45448e0),
+    CONST64(0xe4dd394b9eaf96d5), CONST64(0x792059eb1992cbf2), CONST64(0x60781828e84850c0), CONST64(0x451356fa70bfe98a),
+    CONST64(0xf645b3c8393e8df1), CONST64(0xfa4ab0cd243787e9), CONST64(0x90b4246c51fcd83d), CONST64(0x80a020607de0c01d),
+    CONST64(0xf240b2cb32398bf9), CONST64(0x72e092ab4fd94be4), CONST64(0xb615a3f8894eed71), CONST64(0x27e7c05d137aba4e),
+    CONST64(0x0d4944ccd6c1851a), CONST64(0x95f762a691335137), CONST64(0x40501030b0706080), CONST64(0xea5eb4c1082b9fc9),
+    CONST64(0x2aae8491c5bb3f54), CONST64(0x115243c5e7d49722), CONST64(0x76e593a844de4dec), CONST64(0x2fedc25b0574b65e),
+    CONST64(0x357f4adeb4eba16a), CONST64(0xce73bdda5b14a981), CONST64(0x06898f8c808a050c), CONST64(0xb4992d7702c3ee75),
+    CONST64(0xca76bcd95013af89), CONST64(0x4ad69cb92df36f94), CONST64(0xb5df6abec90b6177), CONST64(0x1d5d40c0fadd9d3a),
+    CONST64(0x1bd4cf4c7a579836), CONST64(0xb210a2fb8249eb79), CONST64(0x3aba809de9a72774), CONST64(0x216e4fd193f0bf42),
+    CONST64(0x7c631f21d95d42f8), CONST64(0x0fc5ca435d4c861e), CONST64(0x9238aae3da71db39), CONST64(0x155742c6ecd3912a),
+};
+
+static const ulong64 T3[256] = {
+    CONST64(0x68d2d3ba016ab9bb), CONST64(0x194dfc54b1669ae5), CONST64(0x93bc712fcd1465e2), CONST64(0xb9cd9c74511b8725),
+    CONST64(0x0251f553a457a2f7), CONST64(0xb86b68d303bed6d0), CONST64(0xbd6f6bd204b5ded6), CONST64(0x6429d74dfe8552b3),
+    CONST64(0x0d5df050ad4abafd), CONST64(0x268ae9ac63e009cf), CONST64(0x830e8a8d84961c09), CONST64(0x79c6dcbf1a4d91a5),
+    CONST64(0xaddd90704d37a73d), CONST64(0x0755f652a35caaf1), CONST64(0xc852b39ae117a47b), CONST64(0x612dd44cf98e5ab5),
+    CONST64(0x658f23eaac200346), CONST64(0xa67362d51184e6c4), CONST64(0xf166a497c268cc55), CONST64(0xb2636ed10da8c6dc),
+    CONST64(0xffcc553399d085aa), CONST64(0x0859f351aa41b2fb), CONST64(0x2a71ed5b9c0fe2c7), CONST64(0x04a2f7a655ae59f3),
+    CONST64(0x815f7fde20c1befe), CONST64(0x753dd848e5a27aad), CONST64(0x329ae5a87fcc29d7), CONST64(0xc75eb699e80abc71),
+    CONST64(0x904b70db3be696e0), CONST64(0xfac856329edb8dac), CONST64(0x51e6c4b72215d195), CONST64(0x2bd719fcceaab332),
+    CONST64(0x48ab38e393734b70), CONST64(0xdc42bf9efd3b8463), CONST64(0xef7eae91d052fc41), CONST64(0xcd56b09be61cac7d),
+    CONST64(0x4daf3be294784376), CONST64(0x6dd6d0bb0661b1bd), CONST64(0x5819c341daf1329b), CONST64(0xcba5b26e17e55779),
+    CONST64(0x0baef2a55cb341f9), CONST64(0xc00b40cb4b561680), CONST64(0xdab1bd6b0cc27f67), CONST64(0xfb6ea295cc7edc59),
+    CONST64(0x1fbefea1409f61e1), CONST64(0x18eb08f3e3c3cb10), CONST64(0x4ffeceb1302fe181), CONST64(0x0a0806020e16100c),
+    CONST64(0xdb1749cc5e672e92), CONST64(0xf33751c4663f6ea2), CONST64(0x6974271d53cfe84e), CONST64(0x44503c146c9ca078),
+    CONST64(0xe82b58c3730e56b0), CONST64(0xf291a563349a3f57), CONST64(0x954f73da3ced9ee6), CONST64(0x3469e75d8e35d2d3),
+    CONST64(0x3e61e15f8023c2df), CONST64(0x8b5779dc2ed7aef2), CONST64(0x94e9877d6e48cf13), CONST64(0xde134acd596c2694),
+    CONST64(0x9ee1817f605edf1f), CONST64(0x2f75ee5a9b04eac1), CONST64(0xc1adb46c19f34775), CONST64(0x316de45c893edad5),
+    CONST64(0x0cfb04f7ffefeb08), CONST64(0xbe986a26f2472dd4), CONST64(0x24db1cffc7b7ab38), CONST64(0x7e932aedb9113b54),
+    CONST64(0x6f8725e8a236134a), CONST64(0xd34eba9df4269c69), CONST64(0xcea1b16f10ee5f7f), CONST64(0x8c028f8e8d8b0403),
+    CONST64(0x7d642b194fe3c856), CONST64(0x1abafda0479469e7), CONST64(0x17e70df0eaded31a), CONST64(0x971e868998ba3c11),
+    CONST64(0x333c110f2d697822), CONST64(0x1b1c090715313812), CONST64(0x2986ecaf6afd11c5), CONST64(0x30cb10fbdb9b8b20),
+    CONST64(0x2820180838584030), CONST64(0x41543f156b97a87e), CONST64(0x3934170d237f682e), CONST64(0x14100c041c2c2018),
+    CONST64(0x05040301070b0806), CONST64(0xe98dac6421ab0745), CONST64(0x845b7cdf27cab6f8), CONST64(0xb3c59a765f0d9729),
+    CONST64(0x80f98b797264ef0b), CONST64(0x8e537add29dca6f4), CONST64(0xc9f4473db3b2f58e), CONST64(0x4e583a16628ab074),
+    CONST64(0xc3fc413fbda4e582), CONST64(0xebdc593785fca5b2), CONST64(0xc4a9b76d1ef84f73), CONST64(0xd8e04838a895dd90),
+    CONST64(0x67ded6b90877a1b1), CONST64(0xa2d19573442abf37), CONST64(0x6a8326e9a53d1b4c), CONST64(0xe1d45f358beab5be),
+    CONST64(0x1c49ff55b66d92e3), CONST64(0xa8d993714a3caf3b), CONST64(0x8af18d7b7c72ff07), CONST64(0x860a898c839d140f),
+    CONST64(0xa7d596724321b731), CONST64(0x921a85889fb13417), CONST64(0x09ff07f6f8e4e30e), CONST64(0x82a87e2ad6334dfc),
+    CONST64(0xc6f8423ebaafed84), CONST64(0x3b65e25e8728cad9), CONST64(0xbb9c6927f54c25d2), CONST64(0x4305ca46cfc00a89),
+    CONST64(0x3c30140c24746028), CONST64(0xec89af6526a00f43), CONST64(0xd5bdb86805df676d), CONST64(0xf899a3613a8c2f5b),
+    CONST64(0x0f0c0503091d180a), CONST64(0xe2235ec17d1846bc), CONST64(0x1641f957b87b82ef), CONST64(0xa97f67d61899fece),
+    CONST64(0x9a4376d935f086ec), CONST64(0x257de8589512facd), CONST64(0x9f4775d832fb8eea), CONST64(0xe385aa662fbd1749),
+    CONST64(0xac7b64d71f92f6c8), CONST64(0xd2e84e3aa683cd9c), CONST64(0xcf0745c8424b0e8a), CONST64(0xccf0443cb4b9fd88),
+    CONST64(0x35cf13fadc908326), CONST64(0xf462a796c563c453), CONST64(0x01a6f4a752a551f5), CONST64(0xc25ab598ef01b477),
+    CONST64(0x7b9729ecbe1a3352), CONST64(0x62dad5b80f7ca9b7), CONST64(0xfc3b54c76f2276a8), CONST64(0x2c82efae6df619c3),
+    CONST64(0xd0b9bb6902d46f6b), CONST64(0x7a31dd4becbf62a7), CONST64(0x3d96e0ab76d131dd), CONST64(0x379ee6a978c721d1),
+    CONST64(0xe681a96728b61f4f), CONST64(0x22281e0a364e503c), CONST64(0x4601c947c8cb028f), CONST64(0x1def0bf2e4c8c316),
+    CONST64(0x5beec2b52c03c199), CONST64(0xaa886622ee6b0dcc), CONST64(0x56b332e581497b64), CONST64(0x719f2feeb00c235e),
+    CONST64(0x7cc2dfbe1d4699a3), CONST64(0x87ac7d2bd13845fa), CONST64(0xbf3e9e81a0e27c21), CONST64(0x5a4836127ea6906c),
+    CONST64(0xb5369883aef46c2d), CONST64(0x776c2d1b41f5d85a), CONST64(0x3638120e2a627024), CONST64(0xaf8c6523e96005ca),
+    CONST64(0x06f302f5f1f9fb04), CONST64(0x4c09cf45c6dd1283), CONST64(0xa5846321e77615c6), CONST64(0xd11f4fce50713e9e),
+    CONST64(0x7039db49e2a972ab), CONST64(0x9cb0742cc4097de8), CONST64(0x3ac316f9d58d9b2c), CONST64(0x59bf37e68854636e),
+    CONST64(0x54e2c7b6251ed993), CONST64(0x88a07828d8255df0), CONST64(0x4b5c39176581b872), CONST64(0xb0329b82a9ff642b),
+    CONST64(0x72682e1a46fed05c), CONST64(0x9d16808b96ac2c1d), CONST64(0x21df1ffec0bca33e), CONST64(0x9812838a91a7241b),
+    CONST64(0x2d241b093f534836), CONST64(0xca0346c94540068c), CONST64(0xa1269487b2d84c35), CONST64(0x6b25d24ef7984ab9),
+    CONST64(0x42a33ee19d655b7c), CONST64(0x96b8722eca1f6de4), CONST64(0x53b731e486427362), CONST64(0x47a73de09a6e537a),
+    CONST64(0x608b20ebab2b0b40), CONST64(0xea7aad90d759f447), CONST64(0x0eaaf1a45bb849ff), CONST64(0x6678221e5ad2f044),
+    CONST64(0xab2e9285bcce5c39), CONST64(0xfd9da0603d87275d), CONST64(0x0000000000000000), CONST64(0xb1946f25fb5a35de),
+    CONST64(0x03f701f4f6f2f302), CONST64(0x12e30ef1edd5db1c), CONST64(0xfe6aa194cb75d45f), CONST64(0x272c1d0b3145583a),
+    CONST64(0x5cbb34e78f5f6b68), CONST64(0xbcc99f7556108f23), CONST64(0x749b2cefb7072b58), CONST64(0xe4d05c348ce1bdb8),
+    CONST64(0xf5c4533197c695a6), CONST64(0xa37761d4168feec2), CONST64(0xb7676dd00aa3ceda), CONST64(0xa4229786b5d34433),
+    CONST64(0x9be5827e6755d719), CONST64(0x238eeaad64eb01c9), CONST64(0x2ed31afdc9a1bb34), CONST64(0x8da47b29df2e55f6),
+    CONST64(0xf0c0503090cd9da0), CONST64(0xd7ec4d3ba188c59a), CONST64(0xd946bc9ffa308c65), CONST64(0x3fc715f8d286932a),
+    CONST64(0xf93f57c668297eae), CONST64(0x5f4c351379ad986a), CONST64(0x1e180a06123a3014), CONST64(0x11140f051b27281e),
+    CONST64(0xf63352c5613466a4), CONST64(0x5544331177bb8866), CONST64(0xb6c1997758069f2f), CONST64(0x91ed847c6943c715),
+    CONST64(0x8ff58e7a7b79f701), CONST64(0x85fd8878756fe70d), CONST64(0xeed85a3682f7adb4), CONST64(0x6c70241c54c4e048),
+    CONST64(0xdde44b39af9ed596), CONST64(0x2079eb599219f2cb), CONST64(0x7860281848e8c050), CONST64(0x1345fa56bf708ae9),
+    CONST64(0x45f6c8b33e39f18d), CONST64(0x4afacdb03724e987), CONST64(0xb4906c24fc513dd8), CONST64(0xa0806020e07d1dc0),
+    CONST64(0x40f2cbb23932f98b), CONST64(0xe072ab92d94fe44b), CONST64(0x15b6f8a34e8971ed), CONST64(0xe7275dc07a134eba),
+    CONST64(0x490dcc44c1d61a85), CONST64(0xf795a66233913751), CONST64(0x5040301070b08060), CONST64(0x5eeac1b42b08c99f),
+    CONST64(0xae2a9184bbc5543f), CONST64(0x5211c543d4e72297), CONST64(0xe576a893de44ec4d), CONST64(0xed2f5bc274055eb6),
+    CONST64(0x7f35de4aebb46aa1), CONST64(0x73cedabd145b81a9), CONST64(0x89068c8f8a800c05), CONST64(0x99b4772dc30275ee),
+    CONST64(0x76cad9bc135089af), CONST64(0xd64ab99cf32d946f), CONST64(0xdfb5be6a0bc97761), CONST64(0x5d1dc040ddfa3a9d),
+    CONST64(0xd41b4ccf577a3698), CONST64(0x10b2fba2498279eb), CONST64(0xba3a9d80a7e97427), CONST64(0x6e21d14ff09342bf),
+    CONST64(0x637c211f5dd9f842), CONST64(0xc50f43ca4c5d1e86), CONST64(0x3892e3aa71da39db), CONST64(0x5715c642d3ec2a91),
+};
+
+static const ulong64 T4[256] = {
+    CONST64(0xbbb96a01bad3d268), CONST64(0xe59a66b154fc4d19), CONST64(0xe26514cd2f71bc93), CONST64(0x25871b51749ccdb9),
+    CONST64(0xf7a257a453f55102), CONST64(0xd0d6be03d3686bb8), CONST64(0xd6deb504d26b6fbd), CONST64(0xb35285fe4dd72964),
+    CONST64(0xfdba4aad50f05d0d), CONST64(0xcf09e063ace98a26), CONST64(0x091c96848d8a0e83), CONST64(0xa5914d1abfdcc679),
+    CONST64(0x3da7374d7090ddad), CONST64(0xf1aa5ca352f65507), CONST64(0x7ba417e19ab352c8), CONST64(0xb55a8ef94cd42d61),
+    CONST64(0x460320acea238f65), CONST64(0xc4e68411d56273a6), CONST64(0x55cc68c297a466f1), CONST64(0xdcc6a80dd16e63b2),
+    CONST64(0xaa85d0993355ccff), CONST64(0xfbb241aa51f35908), CONST64(0xc7e20f9c5bed712a), CONST64(0xf359ae55a6f7a204),
+    CONST64(0xfebec120de7f5f81), CONST64(0xad7aa2e548d83d75), CONST64(0xd729cc7fa8e59a32), CONST64(0x71bc0ae899b65ec7),
+    CONST64(0xe096e63bdb704b90), CONST64(0xac8ddb9e3256c8fa), CONST64(0x95d11522b7c4e651), CONST64(0x32b3aacefc19d72b),
+    CONST64(0x704b7393e338ab48), CONST64(0x63843bfd9ebf42dc), CONST64(0x41fc52d091ae7eef), CONST64(0x7dac1ce69bb056cd),
+    CONST64(0x76437894e23baf4d), CONST64(0xbdb16106bbd0d66d), CONST64(0x9b32f1da41c31958), CONST64(0x7957e5176eb2a5cb),
+    CONST64(0xf941b35ca5f2ae0b), CONST64(0x8016564bcb400bc0), CONST64(0x677fc20c6bbdb1da), CONST64(0x59dc7ecc95a26efb),
+    CONST64(0xe1619f40a1febe1f), CONST64(0x10cbc3e3f308eb18), CONST64(0x81e12f30b1cefe4f), CONST64(0x0c10160e0206080a),
+    CONST64(0x922e675ecc4917db), CONST64(0xa26e3f66c45137f3), CONST64(0x4ee8cf531d277469), CONST64(0x78a09c6c143c5044),
+    CONST64(0xb0560e73c3582be8), CONST64(0x573f9a3463a591f2), CONST64(0xe69eed3cda734f95), CONST64(0xd3d2358e5de76934),
+    CONST64(0xdfc223805fe1613e), CONST64(0xf2aed72edc79578b), CONST64(0x13cf486e7d87e994), CONST64(0x94266c59cd4a13de),
+    CONST64(0x1fdf5e607f81e19e), CONST64(0xc1ea049b5aee752f), CONST64(0x7547f3196cb4adc1), CONST64(0xd5da3e895ce46d31),
+    CONST64(0x08ebeffff704fb0c), CONST64(0xd42d47f2266a98be), CONST64(0x38abb7c7ff1cdb24), CONST64(0x543b11b9ed2a937e),
+    CONST64(0x4a1336a2e825876f), CONST64(0x699c26f49dba4ed3), CONST64(0x7f5fee106fb1a1ce), CONST64(0x03048b8d8e8f028c),
+    CONST64(0x56c8e34f192b647d), CONST64(0xe7699447a0fdba1a), CONST64(0x1ad3deeaf00de717), CONST64(0x113cba9889861e97),
+    CONST64(0x2278692d0f113c33), CONST64(0x1238311507091c1b), CONST64(0xc511fd6aafec8629), CONST64(0x208b9bdbfb10cb30),
+    CONST64(0x3040583808182028), CONST64(0x7ea8976b153f5441), CONST64(0x2e687f230d173439), CONST64(0x18202c1c040c1014),
+    CONST64(0x06080b0701030405), CONST64(0x4507ab2164ac8de9), CONST64(0xf8b6ca27df7c5b84), CONST64(0x29970d5f769ac5b3),
+    CONST64(0x0bef6472798bf980), CONST64(0xf4a6dc29dd7a538e), CONST64(0x8ef5b2b33d47f4c9), CONST64(0x74b08a62163a584e),
+    CONST64(0x82e5a4bd3f41fcc3), CONST64(0xb2a5fc853759dceb), CONST64(0x734ff81e6db7a9c4), CONST64(0x90dd95a83848e0d8),
+    CONST64(0xb1a17708b9d6de67), CONST64(0x37bf2a447395d1a2), CONST64(0x4c1b3da5e926836a), CONST64(0xbeb5ea8b355fd4e1),
+    CONST64(0xe3926db655ff491c), CONST64(0x3baf3c4a7193d9a8), CONST64(0x07ff727c7b8df18a), CONST64(0x0f149d838c890a86),
+    CONST64(0x31b721437296d5a7), CONST64(0x1734b19f88851a92), CONST64(0x0ee3e4f8f607ff09), CONST64(0xfc4d33d62a7ea882),
+    CONST64(0x84edafba3e42f8c6), CONST64(0xd9ca28875ee2653b), CONST64(0xd2254cf527699cbb), CONST64(0x890ac0cf46ca0543),
+    CONST64(0x286074240c14303c), CONST64(0x430fa02665af89ec), CONST64(0x6d67df0568b8bdd5), CONST64(0x5b2f8c3a61a399f8),
+    CONST64(0x0a181d0903050c0f), CONST64(0xbc46187dc15e23e2), CONST64(0xef827bb857f94116), CONST64(0xcefe9918d6677fa9),
+    CONST64(0xec86f035d976439a), CONST64(0xcdfa129558e87d25), CONST64(0xea8efb32d875479f), CONST64(0x4917bd2f66aa85e3),
+    CONST64(0xc8f6921fd7647bac), CONST64(0x9ccd83a63a4ee8d2), CONST64(0x8a0e4b42c84507cf), CONST64(0x88fdb9b43c44f0cc),
+    CONST64(0x268390dcfa13cf35), CONST64(0x53c463c596a762f4), CONST64(0xf551a552a7f4a601), CONST64(0x77b401ef98b55ac2),
+    CONST64(0x52331abeec29977b), CONST64(0xb7a97c0fb8d5da62), CONST64(0xa876226fc7543bfc), CONST64(0xc319f66daeef822c),
+    CONST64(0x6b6fd40269bbb9d0), CONST64(0xa762bfec4bdd317a), CONST64(0xdd31d176abe0963d), CONST64(0xd121c778a9e69e37),
+    CONST64(0x4f1fb62867a981e6), CONST64(0x3c504e360a1e2822), CONST64(0x8f02cbc847c90146), CONST64(0x16c3c8e4f20bef1d),
+    CONST64(0x99c1032cb5c2ee5b), CONST64(0xcc0d6bee226688aa), CONST64(0x647b4981e532b356), CONST64(0x5e230cb0ee2f9f71),
+    CONST64(0xa399461dbedfc27c), CONST64(0xfa4538d12b7dac87), CONST64(0x217ce2a0819e3ebf), CONST64(0x6c90a67e1236485a),
+    CONST64(0x2d6cf4ae839836b5), CONST64(0x5ad8f5411b2d6c77), CONST64(0x2470622a0e123836), CONST64(0xca0560e923658caf),
+    CONST64(0x04fbf9f1f502f306), CONST64(0x8312ddc645cf094c), CONST64(0xc61576e7216384a5), CONST64(0x9e3e7150ce4f1fd1),
+    CONST64(0xab72a9e249db3970), CONST64(0xe87d09c42c74b09c), CONST64(0x2c9b8dd5f916c33a), CONST64(0x6e635488e637bf59),
+    CONST64(0x93d91e25b6c7e254), CONST64(0xf05d25d82878a088), CONST64(0x72b8816517395c4b), CONST64(0x2b64ffa9829b32b0),
+    CONST64(0x5cd0fe461a2e6872), CONST64(0x1d2cac968b80169d), CONST64(0x3ea3bcc0fe1fdf21), CONST64(0x1b24a7918a831298),
+    CONST64(0x3648533f091b242d), CONST64(0x8c064045c94603ca), CONST64(0x354cd8b2879426a1), CONST64(0xb94a98f74ed2256b),
+    CONST64(0x7c5b659de13ea342), CONST64(0xe46d1fca2e72b896), CONST64(0x62734286e431b753), CONST64(0x7a536e9ae03da747),
+    CONST64(0x400b2babeb208b60), CONST64(0x47f459d790ad7aea), CONST64(0xff49b85ba4f1aa0e), CONST64(0x44f0d25a1e227866),
+    CONST64(0x395ccebc85922eab), CONST64(0x5d27873d60a09dfd), CONST64(0x0000000000000000), CONST64(0xde355afb256f94b1),
+    CONST64(0x02f3f2f6f401f703), CONST64(0x1cdbd5edf10ee312), CONST64(0x5fd475cb94a16afe), CONST64(0x3a5845310b1d2c27),
+    CONST64(0x686b5f8fe734bb5c), CONST64(0x238f1056759fc9bc), CONST64(0x582b07b7ef2c9b74), CONST64(0xb8bde18c345cd0e4),
+    CONST64(0xa695c6973153c4f5), CONST64(0xc2ee8f16d46177a3), CONST64(0xdacea30ad06d67b7), CONST64(0x3344d3b5869722a4),
+    CONST64(0x19d755677e82e59b), CONST64(0xc901eb64adea8e23), CONST64(0x34bba1c9fd1ad32e), CONST64(0xf6552edf297ba48d),
+    CONST64(0xa09dcd903050c0f0), CONST64(0x9ac588a13b4decd7), CONST64(0x658c30fa9fbc46d9), CONST64(0x2a9386d2f815c73f),
+    CONST64(0xae7e2968c6573ff9), CONST64(0x6a98ad7913354c5f), CONST64(0x14303a12060a181e), CONST64(0x1e28271b050f1411),
+    CONST64(0xa4663461c55233f6), CONST64(0x6688bb7711334455), CONST64(0x2f9f06587799c1b6), CONST64(0x15c743697c84ed91),
+    CONST64(0x01f7797b7a8ef58f), CONST64(0x0de76f757888fd85), CONST64(0xb4adf782365ad8ee), CONST64(0x48e0c4541c24706c),
+    CONST64(0x96d59eaf394be4dd), CONST64(0xcbf2199259eb7920), CONST64(0x50c0e84818286078), CONST64(0xe98a70bf56fa4513),
+    CONST64(0x8df1393eb3c8f645), CONST64(0x87e92437b0cdfa4a), CONST64(0xd83d51fc246c90b4), CONST64(0xc01d7de0206080a0),
+    CONST64(0x8bf93239b2cbf240), CONST64(0x4be44fd992ab72e0), CONST64(0xed71894ea3f8b615), CONST64(0xba4e137ac05d27e7),
+    CONST64(0x851ad6c144cc0d49), CONST64(0x5137913362a695f7), CONST64(0x6080b07010304050), CONST64(0x9fc9082bb4c1ea5e),
+    CONST64(0x3f54c5bb84912aae), CONST64(0x9722e7d443c51152), CONST64(0x4dec44de93a876e5), CONST64(0xb65e0574c25b2fed),
+    CONST64(0xa16ab4eb4ade357f), CONST64(0xa9815b14bddace73), CONST64(0x050c808a8f8c0689), CONST64(0xee7502c32d77b499),
+    CONST64(0xaf895013bcd9ca76), CONST64(0x6f942df39cb94ad6), CONST64(0x6177c90b6abeb5df), CONST64(0x9d3afadd40c01d5d),
+    CONST64(0x98367a57cf4c1bd4), CONST64(0xeb798249a2fbb210), CONST64(0x2774e9a7809d3aba), CONST64(0xbf4293f04fd1216e),
+    CONST64(0x42f8d95d1f217c63), CONST64(0x861e5d4cca430fc5), CONST64(0xdb39da71aae39238), CONST64(0x912aecd342c61557),
+};
+
+static const ulong64 T5[256] = {
+    CONST64(0xb9bb016ad3ba68d2), CONST64(0x9ae5b166fc54194d), CONST64(0x65e2cd14712f93bc), CONST64(0x8725511b9c74b9cd),
+    CONST64(0xa2f7a457f5530251), CONST64(0xd6d003be68d3b86b), CONST64(0xded604b56bd2bd6f), CONST64(0x52b3fe85d74d6429),
+    CONST64(0xbafdad4af0500d5d), CONST64(0x09cf63e0e9ac268a), CONST64(0x1c0984968a8d830e), CONST64(0x91a51a4ddcbf79c6),
+    CONST64(0xa73d4d379070addd), CONST64(0xaaf1a35cf6520755), CONST64(0xa47be117b39ac852), CONST64(0x5ab5f98ed44c612d),
+    CONST64(0x0346ac2023ea658f), CONST64(0xe6c4118462d5a673), CONST64(0xcc55c268a497f166), CONST64(0xc6dc0da86ed1b263),
+    CONST64(0x85aa99d05533ffcc), CONST64(0xb2fbaa41f3510859), CONST64(0xe2c79c0fed5b2a71), CONST64(0x59f355aef7a604a2),
+    CONST64(0xbefe20c17fde815f), CONST64(0x7aade5a2d848753d), CONST64(0x29d77fcce5a8329a), CONST64(0xbc71e80ab699c75e),
+    CONST64(0x96e03be670db904b), CONST64(0x8dac9edb5632fac8), CONST64(0xd1952215c4b751e6), CONST64(0xb332ceaa19fc2bd7),
+    CONST64(0x4b70937338e348ab), CONST64(0x8463fd3bbf9edc42), CONST64(0xfc41d052ae91ef7e), CONST64(0xac7de61cb09bcd56),
+    CONST64(0x437694783be24daf), CONST64(0xb1bd0661d0bb6dd6), CONST64(0x329bdaf1c3415819), CONST64(0x577917e5b26ecba5),
+    CONST64(0x41f95cb3f2a50bae), CONST64(0x16804b5640cbc00b), CONST64(0x7f670cc2bd6bdab1), CONST64(0xdc59cc7ea295fb6e),
+    CONST64(0x61e1409ffea11fbe), CONST64(0xcb10e3c308f318eb), CONST64(0xe181302fceb14ffe), CONST64(0x100c0e1606020a08),
+    CONST64(0x2e925e6749ccdb17), CONST64(0x6ea2663f51c4f337), CONST64(0xe84e53cf271d6974), CONST64(0xa0786c9c3c144450),
+    CONST64(0x56b0730e58c3e82b), CONST64(0x3f57349aa563f291), CONST64(0x9ee63ced73da954f), CONST64(0xd2d38e35e75d3469),
+    CONST64(0xc2df8023e15f3e61), CONST64(0xaef22ed779dc8b57), CONST64(0xcf136e48877d94e9), CONST64(0x2694596c4acdde13),
+    CONST64(0xdf1f605e817f9ee1), CONST64(0xeac19b04ee5a2f75), CONST64(0x477519f3b46cc1ad), CONST64(0xdad5893ee45c316d),
+    CONST64(0xeb08ffef04f70cfb), CONST64(0x2dd4f2476a26be98), CONST64(0xab38c7b71cff24db), CONST64(0x3b54b9112aed7e93),
+    CONST64(0x134aa23625e86f87), CONST64(0x9c69f426ba9dd34e), CONST64(0x5f7f10eeb16fcea1), CONST64(0x04038d8b8f8e8c02),
+    CONST64(0xc8564fe32b197d64), CONST64(0x69e74794fda01aba), CONST64(0xd31aeade0df017e7), CONST64(0x3c1198ba8689971e),
+    CONST64(0x78222d69110f333c), CONST64(0x3812153109071b1c), CONST64(0x11c56afdecaf2986), CONST64(0x8b20db9b10fb30cb),
+    CONST64(0x4030385818082820), CONST64(0xa87e6b973f154154), CONST64(0x682e237f170d3934), CONST64(0x20181c2c0c041410),
+    CONST64(0x0806070b03010504), CONST64(0x074521abac64e98d), CONST64(0xb6f827ca7cdf845b), CONST64(0x97295f0d9a76b3c5),
+    CONST64(0xef0b72648b7980f9), CONST64(0xa6f429dc7add8e53), CONST64(0xf58eb3b2473dc9f4), CONST64(0xb074628a3a164e58),
+    CONST64(0xe582bda4413fc3fc), CONST64(0xa5b285fc5937ebdc), CONST64(0x4f731ef8b76dc4a9), CONST64(0xdd90a8954838d8e0),
+    CONST64(0xa1b10877d6b967de), CONST64(0xbf37442a9573a2d1), CONST64(0x1b4ca53d26e96a83), CONST64(0xb5be8bea5f35e1d4),
+    CONST64(0x92e3b66dff551c49), CONST64(0xaf3b4a3c9371a8d9), CONST64(0xff077c728d7b8af1), CONST64(0x140f839d898c860a),
+    CONST64(0xb73143219672a7d5), CONST64(0x34179fb18588921a), CONST64(0xe30ef8e407f609ff), CONST64(0x4dfcd6337e2a82a8),
+    CONST64(0xed84baaf423ec6f8), CONST64(0xcad98728e25e3b65), CONST64(0x25d2f54c6927bb9c), CONST64(0x0a89cfc0ca464305),
+    CONST64(0x60282474140c3c30), CONST64(0x0f4326a0af65ec89), CONST64(0x676d05dfb868d5bd), CONST64(0x2f5b3a8ca361f899),
+    CONST64(0x180a091d05030f0c), CONST64(0x46bc7d185ec1e223), CONST64(0x82efb87bf9571641), CONST64(0xfece189967d6a97f),
+    CONST64(0x86ec35f076d99a43), CONST64(0xfacd9512e858257d), CONST64(0x8eea32fb75d89f47), CONST64(0x17492fbdaa66e385),
+    CONST64(0xf6c81f9264d7ac7b), CONST64(0xcd9ca6834e3ad2e8), CONST64(0x0e8a424b45c8cf07), CONST64(0xfd88b4b9443cccf0),
+    CONST64(0x8326dc9013fa35cf), CONST64(0xc453c563a796f462), CONST64(0x51f552a5f4a701a6), CONST64(0xb477ef01b598c25a),
+    CONST64(0x3352be1a29ec7b97), CONST64(0xa9b70f7cd5b862da), CONST64(0x76a86f2254c7fc3b), CONST64(0x19c36df6efae2c82),
+    CONST64(0x6f6b02d4bb69d0b9), CONST64(0x62a7ecbfdd4b7a31), CONST64(0x31dd76d1e0ab3d96), CONST64(0x21d178c7e6a9379e),
+    CONST64(0x1f4f28b6a967e681), CONST64(0x503c364e1e0a2228), CONST64(0x028fc8cbc9474601), CONST64(0xc316e4c80bf21def),
+    CONST64(0xc1992c03c2b55bee), CONST64(0x0dccee6b6622aa88), CONST64(0x7b64814932e556b3), CONST64(0x235eb00c2fee719f),
+    CONST64(0x99a31d46dfbe7cc2), CONST64(0x45fad1387d2b87ac), CONST64(0x7c21a0e29e81bf3e), CONST64(0x906c7ea636125a48),
+    CONST64(0x6c2daef49883b536), CONST64(0xd85a41f52d1b776c), CONST64(0x70242a62120e3638), CONST64(0x05cae9606523af8c),
+    CONST64(0xfb04f1f902f506f3), CONST64(0x1283c6ddcf454c09), CONST64(0x15c6e7766321a584), CONST64(0x3e9e50714fced11f),
+    CONST64(0x72abe2a9db497039), CONST64(0x7de8c409742c9cb0), CONST64(0x9b2cd58d16f93ac3), CONST64(0x636e885437e659bf),
+    CONST64(0xd993251ec7b654e2), CONST64(0x5df0d825782888a0), CONST64(0xb872658139174b5c), CONST64(0x642ba9ff9b82b032),
+    CONST64(0xd05c46fe2e1a7268), CONST64(0x2c1d96ac808b9d16), CONST64(0xa33ec0bc1ffe21df), CONST64(0x241b91a7838a9812),
+    CONST64(0x48363f531b092d24), CONST64(0x068c454046c9ca03), CONST64(0x4c35b2d89487a126), CONST64(0x4ab9f798d24e6b25),
+    CONST64(0x5b7c9d653ee142a3), CONST64(0x6de4ca1f722e96b8), CONST64(0x7362864231e453b7), CONST64(0x537a9a6e3de047a7),
+    CONST64(0x0b40ab2b20eb608b), CONST64(0xf447d759ad90ea7a), CONST64(0x49ff5bb8f1a40eaa), CONST64(0xf0445ad2221e6678),
+    CONST64(0x5c39bcce9285ab2e), CONST64(0x275d3d87a060fd9d), CONST64(0x0000000000000000), CONST64(0x35defb5a6f25b194),
+    CONST64(0xf302f6f201f403f7), CONST64(0xdb1cedd50ef112e3), CONST64(0xd45fcb75a194fe6a), CONST64(0x583a31451d0b272c),
+    CONST64(0x6b688f5f34e75cbb), CONST64(0x8f2356109f75bcc9), CONST64(0x2b58b7072cef749b), CONST64(0xbdb88ce15c34e4d0),
+    CONST64(0x95a697c65331f5c4), CONST64(0xeec2168f61d4a377), CONST64(0xceda0aa36dd0b767), CONST64(0x4433b5d39786a422),
+    CONST64(0xd7196755827e9be5), CONST64(0x01c964ebeaad238e), CONST64(0xbb34c9a11afd2ed3), CONST64(0x55f6df2e7b298da4),
+    CONST64(0x9da090cd5030f0c0), CONST64(0xc59aa1884d3bd7ec), CONST64(0x8c65fa30bc9fd946), CONST64(0x932ad28615f83fc7),
+    CONST64(0x7eae682957c6f93f), CONST64(0x986a79ad35135f4c), CONST64(0x3014123a0a061e18), CONST64(0x281e1b270f051114),
+    CONST64(0x66a4613452c5f633), CONST64(0x886677bb33115544), CONST64(0x9f2f58069977b6c1), CONST64(0xc7156943847c91ed),
+    CONST64(0xf7017b798e7a8ff5), CONST64(0xe70d756f887885fd), CONST64(0xadb482f75a36eed8), CONST64(0xe04854c4241c6c70),
+    CONST64(0xd596af9e4b39dde4), CONST64(0xf2cb9219eb592079), CONST64(0xc05048e828187860), CONST64(0x8ae9bf70fa561345),
+    CONST64(0xf18d3e39c8b345f6), CONST64(0xe9873724cdb04afa), CONST64(0x3dd8fc516c24b490), CONST64(0x1dc0e07d6020a080),
+    CONST64(0xf98b3932cbb240f2), CONST64(0xe44bd94fab92e072), CONST64(0x71ed4e89f8a315b6), CONST64(0x4eba7a135dc0e727),
+    CONST64(0x1a85c1d6cc44490d), CONST64(0x37513391a662f795), CONST64(0x806070b030105040), CONST64(0xc99f2b08c1b45eea),
+    CONST64(0x543fbbc59184ae2a), CONST64(0x2297d4e7c5435211), CONST64(0xec4dde44a893e576), CONST64(0x5eb674055bc2ed2f),
+    CONST64(0x6aa1ebb4de4a7f35), CONST64(0x81a9145bdabd73ce), CONST64(0x0c058a808c8f8906), CONST64(0x75eec302772d99b4),
+    CONST64(0x89af1350d9bc76ca), CONST64(0x946ff32db99cd64a), CONST64(0x77610bc9be6adfb5), CONST64(0x3a9dddfac0405d1d),
+    CONST64(0x3698577a4ccfd41b), CONST64(0x79eb4982fba210b2), CONST64(0x7427a7e99d80ba3a), CONST64(0x42bff093d14f6e21),
+    CONST64(0xf8425dd9211f637c), CONST64(0x1e864c5d43cac50f), CONST64(0x39db71dae3aa3892), CONST64(0x2a91d3ecc6425715),
+};
+
+static const ulong64 T6[256] = {
+    CONST64(0x6a01bbb9d268bad3), CONST64(0x66b1e59a4d1954fc), CONST64(0x14cde265bc932f71), CONST64(0x1b512587cdb9749c),
+    CONST64(0x57a4f7a2510253f5), CONST64(0xbe03d0d66bb8d368), CONST64(0xb504d6de6fbdd26b), CONST64(0x85feb35229644dd7),
+    CONST64(0x4aadfdba5d0d50f0), CONST64(0xe063cf098a26ace9), CONST64(0x9684091c0e838d8a), CONST64(0x4d1aa591c679bfdc),
+    CONST64(0x374d3da7ddad7090), CONST64(0x5ca3f1aa550752f6), CONST64(0x17e17ba452c89ab3), CONST64(0x8ef9b55a2d614cd4),
+    CONST64(0x20ac46038f65ea23), CONST64(0x8411c4e673a6d562), CONST64(0x68c255cc66f197a4), CONST64(0xa80ddcc663b2d16e),
+    CONST64(0xd099aa85ccff3355), CONST64(0x41aafbb2590851f3), CONST64(0x0f9cc7e2712a5bed), CONST64(0xae55f359a204a6f7),
+    CONST64(0xc120febe5f81de7f), CONST64(0xa2e5ad7a3d7548d8), CONST64(0xcc7fd7299a32a8e5), CONST64(0x0ae871bc5ec799b6),
+    CONST64(0xe63be0964b90db70), CONST64(0xdb9eac8dc8fa3256), CONST64(0x152295d1e651b7c4), CONST64(0xaace32b3d72bfc19),
+    CONST64(0x7393704bab48e338), CONST64(0x3bfd638442dc9ebf), CONST64(0x52d041fc7eef91ae), CONST64(0x1ce67dac56cd9bb0),
+    CONST64(0x78947643af4de23b), CONST64(0x6106bdb1d66dbbd0), CONST64(0xf1da9b32195841c3), CONST64(0xe5177957a5cb6eb2),
+    CONST64(0xb35cf941ae0ba5f2), CONST64(0x564b80160bc0cb40), CONST64(0xc20c677fb1da6bbd), CONST64(0x7ecc59dc6efb95a2),
+    CONST64(0x9f40e161be1fa1fe), CONST64(0xc3e310cbeb18f308), CONST64(0x2f3081e1fe4fb1ce), CONST64(0x160e0c10080a0206),
+    CONST64(0x675e922e17dbcc49), CONST64(0x3f66a26e37f3c451), CONST64(0xcf534ee874691d27), CONST64(0x9c6c78a05044143c),
+    CONST64(0x0e73b0562be8c358), CONST64(0x9a34573f91f263a5), CONST64(0xed3ce69e4f95da73), CONST64(0x358ed3d269345de7),
+    CONST64(0x2380dfc2613e5fe1), CONST64(0xd72ef2ae578bdc79), CONST64(0x486e13cfe9947d87), CONST64(0x6c59942613decd4a),
+    CONST64(0x5e601fdfe19e7f81), CONST64(0x049bc1ea752f5aee), CONST64(0xf3197547adc16cb4), CONST64(0x3e89d5da6d315ce4),
+    CONST64(0xefff08ebfb0cf704), CONST64(0x47f2d42d98be266a), CONST64(0xb7c738abdb24ff1c), CONST64(0x11b9543b937eed2a),
+    CONST64(0x36a24a13876fe825), CONST64(0x26f4699c4ed39dba), CONST64(0xee107f5fa1ce6fb1), CONST64(0x8b8d0304028c8e8f),
+    CONST64(0xe34f56c8647d192b), CONST64(0x9447e769ba1aa0fd), CONST64(0xdeea1ad3e717f00d), CONST64(0xba98113c1e978986),
+    CONST64(0x692d22783c330f11), CONST64(0x311512381c1b0709), CONST64(0xfd6ac5118629afec), CONST64(0x9bdb208bcb30fb10),
+    CONST64(0x5838304020280818), CONST64(0x976b7ea85441153f), CONST64(0x7f232e6834390d17), CONST64(0x2c1c18201014040c),
+    CONST64(0x0b07060804050103), CONST64(0xab2145078de964ac), CONST64(0xca27f8b65b84df7c), CONST64(0x0d5f2997c5b3769a),
+    CONST64(0x64720beff980798b), CONST64(0xdc29f4a6538edd7a), CONST64(0xb2b38ef5f4c93d47), CONST64(0x8a6274b0584e163a),
+    CONST64(0xa4bd82e5fcc33f41), CONST64(0xfc85b2a5dceb3759), CONST64(0xf81e734fa9c46db7), CONST64(0x95a890dde0d83848),
+    CONST64(0x7708b1a1de67b9d6), CONST64(0x2a4437bfd1a27395), CONST64(0x3da54c1b836ae926), CONST64(0xea8bbeb5d4e1355f),
+    CONST64(0x6db6e392491c55ff), CONST64(0x3c4a3bafd9a87193), CONST64(0x727c07fff18a7b8d), CONST64(0x9d830f140a868c89),
+    CONST64(0x214331b7d5a77296), CONST64(0xb19f17341a928885), CONST64(0xe4f80ee3ff09f607), CONST64(0x33d6fc4da8822a7e),
+    CONST64(0xafba84edf8c63e42), CONST64(0x2887d9ca653b5ee2), CONST64(0x4cf5d2259cbb2769), CONST64(0xc0cf890a054346ca),
+    CONST64(0x74242860303c0c14), CONST64(0xa026430f89ec65af), CONST64(0xdf056d67bdd568b8), CONST64(0x8c3a5b2f99f861a3),
+    CONST64(0x1d090a180c0f0305), CONST64(0x187dbc4623e2c15e), CONST64(0x7bb8ef82411657f9), CONST64(0x9918cefe7fa9d667),
+    CONST64(0xf035ec86439ad976), CONST64(0x1295cdfa7d2558e8), CONST64(0xfb32ea8e479fd875), CONST64(0xbd2f491785e366aa),
+    CONST64(0x921fc8f67bacd764), CONST64(0x83a69ccde8d23a4e), CONST64(0x4b428a0e07cfc845), CONST64(0xb9b488fdf0cc3c44),
+    CONST64(0x90dc2683cf35fa13), CONST64(0x63c553c462f496a7), CONST64(0xa552f551a601a7f4), CONST64(0x01ef77b45ac298b5),
+    CONST64(0x1abe5233977bec29), CONST64(0x7c0fb7a9da62b8d5), CONST64(0x226fa8763bfcc754), CONST64(0xf66dc319822caeef),
+    CONST64(0xd4026b6fb9d069bb), CONST64(0xbfeca762317a4bdd), CONST64(0xd176dd31963dabe0), CONST64(0xc778d1219e37a9e6),
+    CONST64(0xb6284f1f81e667a9), CONST64(0x4e363c5028220a1e), CONST64(0xcbc88f02014647c9), CONST64(0xc8e416c3ef1df20b),
+    CONST64(0x032c99c1ee5bb5c2), CONST64(0x6beecc0d88aa2266), CONST64(0x4981647bb356e532), CONST64(0x0cb05e239f71ee2f),
+    CONST64(0x461da399c27cbedf), CONST64(0x38d1fa45ac872b7d), CONST64(0xe2a0217c3ebf819e), CONST64(0xa67e6c90485a1236),
+    CONST64(0xf4ae2d6c36b58398), CONST64(0xf5415ad86c771b2d), CONST64(0x622a247038360e12), CONST64(0x60e9ca058caf2365),
+    CONST64(0xf9f104fbf306f502), CONST64(0xddc68312094c45cf), CONST64(0x76e7c61584a52163), CONST64(0x71509e3e1fd1ce4f),
+    CONST64(0xa9e2ab72397049db), CONST64(0x09c4e87db09c2c74), CONST64(0x8dd52c9bc33af916), CONST64(0x54886e63bf59e637),
+    CONST64(0x1e2593d9e254b6c7), CONST64(0x25d8f05da0882878), CONST64(0x816572b85c4b1739), CONST64(0xffa92b6432b0829b),
+    CONST64(0xfe465cd068721a2e), CONST64(0xac961d2c169d8b80), CONST64(0xbcc03ea3df21fe1f), CONST64(0xa7911b2412988a83),
+    CONST64(0x533f3648242d091b), CONST64(0x40458c0603cac946), CONST64(0xd8b2354c26a18794), CONST64(0x98f7b94a256b4ed2),
+    CONST64(0x659d7c5ba342e13e), CONST64(0x1fcae46db8962e72), CONST64(0x42866273b753e431), CONST64(0x6e9a7a53a747e03d),
+    CONST64(0x2bab400b8b60eb20), CONST64(0x59d747f47aea90ad), CONST64(0xb85bff49aa0ea4f1), CONST64(0xd25a44f078661e22),
+    CONST64(0xcebc395c2eab8592), CONST64(0x873d5d279dfd60a0), CONST64(0x0000000000000000), CONST64(0x5afbde3594b1256f),
+    CONST64(0xf2f602f3f703f401), CONST64(0xd5ed1cdbe312f10e), CONST64(0x75cb5fd46afe94a1), CONST64(0x45313a582c270b1d),
+    CONST64(0x5f8f686bbb5ce734), CONST64(0x1056238fc9bc759f), CONST64(0x07b7582b9b74ef2c), CONST64(0xe18cb8bdd0e4345c),
+    CONST64(0xc697a695c4f53153), CONST64(0x8f16c2ee77a3d461), CONST64(0xa30adace67b7d06d), CONST64(0xd3b5334422a48697),
+    CONST64(0x556719d7e59b7e82), CONST64(0xeb64c9018e23adea), CONST64(0xa1c934bbd32efd1a), CONST64(0x2edff655a48d297b),
+    CONST64(0xcd90a09dc0f03050), CONST64(0x88a19ac5ecd73b4d), CONST64(0x30fa658c46d99fbc), CONST64(0x86d22a93c73ff815),
+    CONST64(0x2968ae7e3ff9c657), CONST64(0xad796a984c5f1335), CONST64(0x3a121430181e060a), CONST64(0x271b1e281411050f),
+    CONST64(0x3461a46633f6c552), CONST64(0xbb77668844551133), CONST64(0x06582f9fc1b67799), CONST64(0x436915c7ed917c84),
+    CONST64(0x797b01f7f58f7a8e), CONST64(0x6f750de7fd857888), CONST64(0xf782b4add8ee365a), CONST64(0xc45448e0706c1c24),
+    CONST64(0x9eaf96d5e4dd394b), CONST64(0x1992cbf2792059eb), CONST64(0xe84850c060781828), CONST64(0x70bfe98a451356fa),
+    CONST64(0x393e8df1f645b3c8), CONST64(0x243787e9fa4ab0cd), CONST64(0x51fcd83d90b4246c), CONST64(0x7de0c01d80a02060),
+    CONST64(0x32398bf9f240b2cb), CONST64(0x4fd94be472e092ab), CONST64(0x894eed71b615a3f8), CONST64(0x137aba4e27e7c05d),
+    CONST64(0xd6c1851a0d4944cc), CONST64(0x9133513795f762a6), CONST64(0xb070608040501030), CONST64(0x082b9fc9ea5eb4c1),
+    CONST64(0xc5bb3f542aae8491), CONST64(0xe7d49722115243c5), CONST64(0x44de4dec76e593a8), CONST64(0x0574b65e2fedc25b),
+    CONST64(0xb4eba16a357f4ade), CONST64(0x5b14a981ce73bdda), CONST64(0x808a050c06898f8c), CONST64(0x02c3ee75b4992d77),
+    CONST64(0x5013af89ca76bcd9), CONST64(0x2df36f944ad69cb9), CONST64(0xc90b6177b5df6abe), CONST64(0xfadd9d3a1d5d40c0),
+    CONST64(0x7a5798361bd4cf4c), CONST64(0x8249eb79b210a2fb), CONST64(0xe9a727743aba809d), CONST64(0x93f0bf42216e4fd1),
+    CONST64(0xd95d42f87c631f21), CONST64(0x5d4c861e0fc5ca43), CONST64(0xda71db399238aae3), CONST64(0xecd3912a155742c6),
+};
+
+static const ulong64 T7[256] = {
+    CONST64(0x016ab9bb68d2d3ba), CONST64(0xb1669ae5194dfc54), CONST64(0xcd1465e293bc712f), CONST64(0x511b8725b9cd9c74),
+    CONST64(0xa457a2f70251f553), CONST64(0x03bed6d0b86b68d3), CONST64(0x04b5ded6bd6f6bd2), CONST64(0xfe8552b36429d74d),
+    CONST64(0xad4abafd0d5df050), CONST64(0x63e009cf268ae9ac), CONST64(0x84961c09830e8a8d), CONST64(0x1a4d91a579c6dcbf),
+    CONST64(0x4d37a73daddd9070), CONST64(0xa35caaf10755f652), CONST64(0xe117a47bc852b39a), CONST64(0xf98e5ab5612dd44c),
+    CONST64(0xac200346658f23ea), CONST64(0x1184e6c4a67362d5), CONST64(0xc268cc55f166a497), CONST64(0x0da8c6dcb2636ed1),
+    CONST64(0x99d085aaffcc5533), CONST64(0xaa41b2fb0859f351), CONST64(0x9c0fe2c72a71ed5b), CONST64(0x55ae59f304a2f7a6),
+    CONST64(0x20c1befe815f7fde), CONST64(0xe5a27aad753dd848), CONST64(0x7fcc29d7329ae5a8), CONST64(0xe80abc71c75eb699),
+    CONST64(0x3be696e0904b70db), CONST64(0x9edb8dacfac85632), CONST64(0x2215d19551e6c4b7), CONST64(0xceaab3322bd719fc),
+    CONST64(0x93734b7048ab38e3), CONST64(0xfd3b8463dc42bf9e), CONST64(0xd052fc41ef7eae91), CONST64(0xe61cac7dcd56b09b),
+    CONST64(0x947843764daf3be2), CONST64(0x0661b1bd6dd6d0bb), CONST64(0xdaf1329b5819c341), CONST64(0x17e55779cba5b26e),
+    CONST64(0x5cb341f90baef2a5), CONST64(0x4b561680c00b40cb), CONST64(0x0cc27f67dab1bd6b), CONST64(0xcc7edc59fb6ea295),
+    CONST64(0x409f61e11fbefea1), CONST64(0xe3c3cb1018eb08f3), CONST64(0x302fe1814ffeceb1), CONST64(0x0e16100c0a080602),
+    CONST64(0x5e672e92db1749cc), CONST64(0x663f6ea2f33751c4), CONST64(0x53cfe84e6974271d), CONST64(0x6c9ca07844503c14),
+    CONST64(0x730e56b0e82b58c3), CONST64(0x349a3f57f291a563), CONST64(0x3ced9ee6954f73da), CONST64(0x8e35d2d33469e75d),
+    CONST64(0x8023c2df3e61e15f), CONST64(0x2ed7aef28b5779dc), CONST64(0x6e48cf1394e9877d), CONST64(0x596c2694de134acd),
+    CONST64(0x605edf1f9ee1817f), CONST64(0x9b04eac12f75ee5a), CONST64(0x19f34775c1adb46c), CONST64(0x893edad5316de45c),
+    CONST64(0xffefeb080cfb04f7), CONST64(0xf2472dd4be986a26), CONST64(0xc7b7ab3824db1cff), CONST64(0xb9113b547e932aed),
+    CONST64(0xa236134a6f8725e8), CONST64(0xf4269c69d34eba9d), CONST64(0x10ee5f7fcea1b16f), CONST64(0x8d8b04038c028f8e),
+    CONST64(0x4fe3c8567d642b19), CONST64(0x479469e71abafda0), CONST64(0xeaded31a17e70df0), CONST64(0x98ba3c11971e8689),
+    CONST64(0x2d697822333c110f), CONST64(0x153138121b1c0907), CONST64(0x6afd11c52986ecaf), CONST64(0xdb9b8b2030cb10fb),
+    CONST64(0x3858403028201808), CONST64(0x6b97a87e41543f15), CONST64(0x237f682e3934170d), CONST64(0x1c2c201814100c04),
+    CONST64(0x070b080605040301), CONST64(0x21ab0745e98dac64), CONST64(0x27cab6f8845b7cdf), CONST64(0x5f0d9729b3c59a76),
+    CONST64(0x7264ef0b80f98b79), CONST64(0x29dca6f48e537add), CONST64(0xb3b2f58ec9f4473d), CONST64(0x628ab0744e583a16),
+    CONST64(0xbda4e582c3fc413f), CONST64(0x85fca5b2ebdc5937), CONST64(0x1ef84f73c4a9b76d), CONST64(0xa895dd90d8e04838),
+    CONST64(0x0877a1b167ded6b9), CONST64(0x442abf37a2d19573), CONST64(0xa53d1b4c6a8326e9), CONST64(0x8beab5bee1d45f35),
+    CONST64(0xb66d92e31c49ff55), CONST64(0x4a3caf3ba8d99371), CONST64(0x7c72ff078af18d7b), CONST64(0x839d140f860a898c),
+    CONST64(0x4321b731a7d59672), CONST64(0x9fb13417921a8588), CONST64(0xf8e4e30e09ff07f6), CONST64(0xd6334dfc82a87e2a),
+    CONST64(0xbaafed84c6f8423e), CONST64(0x8728cad93b65e25e), CONST64(0xf54c25d2bb9c6927), CONST64(0xcfc00a894305ca46),
+    CONST64(0x247460283c30140c), CONST64(0x26a00f43ec89af65), CONST64(0x05df676dd5bdb868), CONST64(0x3a8c2f5bf899a361),
+    CONST64(0x091d180a0f0c0503), CONST64(0x7d1846bce2235ec1), CONST64(0xb87b82ef1641f957), CONST64(0x1899fecea97f67d6),
+    CONST64(0x35f086ec9a4376d9), CONST64(0x9512facd257de858), CONST64(0x32fb8eea9f4775d8), CONST64(0x2fbd1749e385aa66),
+    CONST64(0x1f92f6c8ac7b64d7), CONST64(0xa683cd9cd2e84e3a), CONST64(0x424b0e8acf0745c8), CONST64(0xb4b9fd88ccf0443c),
+    CONST64(0xdc90832635cf13fa), CONST64(0xc563c453f462a796), CONST64(0x52a551f501a6f4a7), CONST64(0xef01b477c25ab598),
+    CONST64(0xbe1a33527b9729ec), CONST64(0x0f7ca9b762dad5b8), CONST64(0x6f2276a8fc3b54c7), CONST64(0x6df619c32c82efae),
+    CONST64(0x02d46f6bd0b9bb69), CONST64(0xecbf62a77a31dd4b), CONST64(0x76d131dd3d96e0ab), CONST64(0x78c721d1379ee6a9),
+    CONST64(0x28b61f4fe681a967), CONST64(0x364e503c22281e0a), CONST64(0xc8cb028f4601c947), CONST64(0xe4c8c3161def0bf2),
+    CONST64(0x2c03c1995beec2b5), CONST64(0xee6b0dccaa886622), CONST64(0x81497b6456b332e5), CONST64(0xb00c235e719f2fee),
+    CONST64(0x1d4699a37cc2dfbe), CONST64(0xd13845fa87ac7d2b), CONST64(0xa0e27c21bf3e9e81), CONST64(0x7ea6906c5a483612),
+    CONST64(0xaef46c2db5369883), CONST64(0x41f5d85a776c2d1b), CONST64(0x2a6270243638120e), CONST64(0xe96005caaf8c6523),
+    CONST64(0xf1f9fb0406f302f5), CONST64(0xc6dd12834c09cf45), CONST64(0xe77615c6a5846321), CONST64(0x50713e9ed11f4fce),
+    CONST64(0xe2a972ab7039db49), CONST64(0xc4097de89cb0742c), CONST64(0xd58d9b2c3ac316f9), CONST64(0x8854636e59bf37e6),
+    CONST64(0x251ed99354e2c7b6), CONST64(0xd8255df088a07828), CONST64(0x6581b8724b5c3917), CONST64(0xa9ff642bb0329b82),
+    CONST64(0x46fed05c72682e1a), CONST64(0x96ac2c1d9d16808b), CONST64(0xc0bca33e21df1ffe), CONST64(0x91a7241b9812838a),
+    CONST64(0x3f5348362d241b09), CONST64(0x4540068cca0346c9), CONST64(0xb2d84c35a1269487), CONST64(0xf7984ab96b25d24e),
+    CONST64(0x9d655b7c42a33ee1), CONST64(0xca1f6de496b8722e), CONST64(0x8642736253b731e4), CONST64(0x9a6e537a47a73de0),
+    CONST64(0xab2b0b40608b20eb), CONST64(0xd759f447ea7aad90), CONST64(0x5bb849ff0eaaf1a4), CONST64(0x5ad2f0446678221e),
+    CONST64(0xbcce5c39ab2e9285), CONST64(0x3d87275dfd9da060), CONST64(0x0000000000000000), CONST64(0xfb5a35deb1946f25),
+    CONST64(0xf6f2f30203f701f4), CONST64(0xedd5db1c12e30ef1), CONST64(0xcb75d45ffe6aa194), CONST64(0x3145583a272c1d0b),
+    CONST64(0x8f5f6b685cbb34e7), CONST64(0x56108f23bcc99f75), CONST64(0xb7072b58749b2cef), CONST64(0x8ce1bdb8e4d05c34),
+    CONST64(0x97c695a6f5c45331), CONST64(0x168feec2a37761d4), CONST64(0x0aa3cedab7676dd0), CONST64(0xb5d34433a4229786),
+    CONST64(0x6755d7199be5827e), CONST64(0x64eb01c9238eeaad), CONST64(0xc9a1bb342ed31afd), CONST64(0xdf2e55f68da47b29),
+    CONST64(0x90cd9da0f0c05030), CONST64(0xa188c59ad7ec4d3b), CONST64(0xfa308c65d946bc9f), CONST64(0xd286932a3fc715f8),
+    CONST64(0x68297eaef93f57c6), CONST64(0x79ad986a5f4c3513), CONST64(0x123a30141e180a06), CONST64(0x1b27281e11140f05),
+    CONST64(0x613466a4f63352c5), CONST64(0x77bb886655443311), CONST64(0x58069f2fb6c19977), CONST64(0x6943c71591ed847c),
+    CONST64(0x7b79f7018ff58e7a), CONST64(0x756fe70d85fd8878), CONST64(0x82f7adb4eed85a36), CONST64(0x54c4e0486c70241c),
+    CONST64(0xaf9ed596dde44b39), CONST64(0x9219f2cb2079eb59), CONST64(0x48e8c05078602818), CONST64(0xbf708ae91345fa56),
+    CONST64(0x3e39f18d45f6c8b3), CONST64(0x3724e9874afacdb0), CONST64(0xfc513dd8b4906c24), CONST64(0xe07d1dc0a0806020),
+    CONST64(0x3932f98b40f2cbb2), CONST64(0xd94fe44be072ab92), CONST64(0x4e8971ed15b6f8a3), CONST64(0x7a134ebae7275dc0),
+    CONST64(0xc1d61a85490dcc44), CONST64(0x33913751f795a662), CONST64(0x70b0806050403010), CONST64(0x2b08c99f5eeac1b4),
+    CONST64(0xbbc5543fae2a9184), CONST64(0xd4e722975211c543), CONST64(0xde44ec4de576a893), CONST64(0x74055eb6ed2f5bc2),
+    CONST64(0xebb46aa17f35de4a), CONST64(0x145b81a973cedabd), CONST64(0x8a800c0589068c8f), CONST64(0xc30275ee99b4772d),
+    CONST64(0x135089af76cad9bc), CONST64(0xf32d946fd64ab99c), CONST64(0x0bc97761dfb5be6a), CONST64(0xddfa3a9d5d1dc040),
+    CONST64(0x577a3698d41b4ccf), CONST64(0x498279eb10b2fba2), CONST64(0xa7e97427ba3a9d80), CONST64(0xf09342bf6e21d14f),
+    CONST64(0x5dd9f842637c211f), CONST64(0x4c5d1e86c50f43ca), CONST64(0x71da39db3892e3aa), CONST64(0xd3ec2a915715c642),
+};
+
+static const ulong64 c[R + 1] = {
+    CONST64(0xba542f7453d3d24d),
+    CONST64(0x50ac8dbf70529a4c),
+    CONST64(0xead597d133515ba6),
+    CONST64(0xde48a899db32b7fc),
+    CONST64(0xe39e919be2bb416e),
+    CONST64(0xa5cb6b95a1f3b102),
+    CONST64(0xccc41d14c363da5d),
+    CONST64(0x5fdc7dcd7f5a6c5c),
+    CONST64(0xf726ffede89d6f8e),
+};
+
+ /**
+    Initialize the Khazad block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+int khazad_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+   int               r;
+   const ulong64    *S;
+   ulong64           K2, K1;
+
+   LTC_ARGCHK(key  != NULL);
+   LTC_ARGCHK(skey != NULL);
+   if (keylen != 16) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+   if (num_rounds != 8 && num_rounds != 0) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+
+   /* use 7th table */
+   S = T7;
+
+    /*
+    * map unsigned char array cipher key to initial key state (mu):
+    */
+   K2 =
+      ((ulong64)key[ 0] << 56) ^
+      ((ulong64)key[ 1] << 48) ^
+      ((ulong64)key[ 2] << 40) ^
+      ((ulong64)key[ 3] << 32) ^
+      ((ulong64)key[ 4] << 24) ^
+      ((ulong64)key[ 5] << 16) ^
+      ((ulong64)key[ 6] <<  8) ^
+      ((ulong64)key[ 7]      );
+   K1 =
+      ((ulong64)key[ 8] << 56) ^
+      ((ulong64)key[ 9] << 48) ^
+      ((ulong64)key[10] << 40) ^
+      ((ulong64)key[11] << 32) ^
+      ((ulong64)key[12] << 24) ^
+      ((ulong64)key[13] << 16) ^
+      ((ulong64)key[14] <<  8) ^
+      ((ulong64)key[15]      );
+
+   /*
+    * compute the round keys:
+    */
+   for (r = 0; r <= R; r++) {
+      /*
+       * K[r] = rho(c[r], K1) ^ K2;
+       */
+      skey->khazad.roundKeyEnc[r] =
+         T0[(int)(K1 >> 56)       ] ^
+         T1[(int)(K1 >> 48) & 0xff] ^
+         T2[(int)(K1 >> 40) & 0xff] ^
+         T3[(int)(K1 >> 32) & 0xff] ^
+         T4[(int)(K1 >> 24) & 0xff] ^
+         T5[(int)(K1 >> 16) & 0xff] ^
+         T6[(int)(K1 >>  8) & 0xff] ^
+         T7[(int)(K1      ) & 0xff] ^
+         c[r] ^ K2;
+      K2 = K1; K1 = skey->khazad.roundKeyEnc[r];
+   }
+   /*
+    * compute the inverse key schedule:
+    * K'^0 = K^R, K'^R = K^0, K'^r = theta(K^{R-r})
+    */
+   skey->khazad.roundKeyDec[0] = skey->khazad.roundKeyEnc[R];
+   for (r = 1; r < R; r++) {
+      K1 = skey->khazad.roundKeyEnc[R - r];
+      skey->khazad.roundKeyDec[r] =
+         T0[(int)S[(int)(K1 >> 56)       ] & 0xff] ^
+         T1[(int)S[(int)(K1 >> 48) & 0xff] & 0xff] ^
+         T2[(int)S[(int)(K1 >> 40) & 0xff] & 0xff] ^
+         T3[(int)S[(int)(K1 >> 32) & 0xff] & 0xff] ^
+         T4[(int)S[(int)(K1 >> 24) & 0xff] & 0xff] ^
+         T5[(int)S[(int)(K1 >> 16) & 0xff] & 0xff] ^
+         T6[(int)S[(int)(K1 >>  8) & 0xff] & 0xff] ^
+         T7[(int)S[(int)(K1      ) & 0xff] & 0xff];
+   }
+   skey->khazad.roundKeyDec[R] = skey->khazad.roundKeyEnc[0];
+
+   return CRYPT_OK;
+}
+
+static void khazad_crypt(const unsigned char *plaintext, unsigned char *ciphertext,
+                         const ulong64       *roundKey) {
+   int     r;
+   ulong64 state;
+    /*
+    * map plaintext block to cipher state (mu)
+    * and add initial round key (sigma[K^0]):
+    */
+   state =
+      ((ulong64)plaintext[0] << 56) ^
+      ((ulong64)plaintext[1] << 48) ^
+      ((ulong64)plaintext[2] << 40) ^
+      ((ulong64)plaintext[3] << 32) ^
+      ((ulong64)plaintext[4] << 24) ^
+      ((ulong64)plaintext[5] << 16) ^
+      ((ulong64)plaintext[6] <<  8) ^
+      ((ulong64)plaintext[7]      ) ^
+      roundKey[0];
+
+    /*
+    * R - 1 full rounds:
+    */
+    for (r = 1; r < R; r++) {
+      state =
+         T0[(int)(state >> 56)       ] ^
+         T1[(int)(state >> 48) & 0xff] ^
+         T2[(int)(state >> 40) & 0xff] ^
+         T3[(int)(state >> 32) & 0xff] ^
+         T4[(int)(state >> 24) & 0xff] ^
+         T5[(int)(state >> 16) & 0xff] ^
+         T6[(int)(state >>  8) & 0xff] ^
+         T7[(int)(state      ) & 0xff] ^
+         roundKey[r];
+    }
+
+    /*
+    * last round:
+    */
+   state =
+      (T0[(int)(state >> 56)       ] & CONST64(0xff00000000000000)) ^
+      (T1[(int)(state >> 48) & 0xff] & CONST64(0x00ff000000000000)) ^
+      (T2[(int)(state >> 40) & 0xff] & CONST64(0x0000ff0000000000)) ^
+      (T3[(int)(state >> 32) & 0xff] & CONST64(0x000000ff00000000)) ^
+      (T4[(int)(state >> 24) & 0xff] & CONST64(0x00000000ff000000)) ^
+      (T5[(int)(state >> 16) & 0xff] & CONST64(0x0000000000ff0000)) ^
+      (T6[(int)(state >>  8) & 0xff] & CONST64(0x000000000000ff00)) ^
+      (T7[(int)(state      ) & 0xff] & CONST64(0x00000000000000ff)) ^
+      roundKey[R];
+
+   /*
+    * map cipher state to ciphertext block (mu^{-1}):
+    */
+   ciphertext[0] = (unsigned char)(state >> 56);
+   ciphertext[1] = (unsigned char)(state >> 48);
+   ciphertext[2] = (unsigned char)(state >> 40);
+   ciphertext[3] = (unsigned char)(state >> 32);
+   ciphertext[4] = (unsigned char)(state >> 24);
+   ciphertext[5] = (unsigned char)(state >> 16);
+   ciphertext[6] = (unsigned char)(state >>  8);
+   ciphertext[7] = (unsigned char)(state      );
+}
+
+/**
+  Encrypts a block of text with Khazad
+  @param pt The input plaintext (8 bytes)
+  @param ct The output ciphertext (8 bytes)
+  @param skey The key as scheduled
+  @return CRYPT_OK if successful
+*/
+int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   LTC_ARGCHK(skey != NULL);
+   khazad_crypt(pt, ct, skey->khazad.roundKeyEnc);
+   return CRYPT_OK;
+}
+
+/**
+  Decrypts a block of text with Khazad
+  @param ct The input ciphertext (8 bytes)
+  @param pt The output plaintext (8 bytes)
+  @param skey The key as scheduled 
+  @return CRYPT_OK if successful
+*/
+int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   LTC_ARGCHK(skey != NULL);
+   khazad_crypt(ct, pt, skey->khazad.roundKeyDec);
+   return CRYPT_OK;
+}
+
+/**
+  Performs a self-test of the Khazad block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int khazad_test(void)
+{
+#ifndef LTC_TEST
+  return CRYPT_NOP;
+#else
+  static const struct test {
+     unsigned char pt[8], ct[8], key[16];
+  } tests[] = {
+{
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x49, 0xA4, 0xCE, 0x32, 0xAC, 0x19, 0x0E, 0x3F },
+   { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+     0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }
+}, {
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x64, 0x5D, 0x77, 0x3E, 0x40, 0xAB, 0xDD, 0x53 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+     0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }
+}, {
+   { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+   { 0x9E, 0x39, 0x98, 0x64, 0xF7, 0x8E, 0xCA, 0x02 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+     0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }
+}, {
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
+   { 0xA9, 0xDF, 0x3D, 0x2C, 0x64, 0xD3, 0xEA, 0x28 },
+   { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+     0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }
+}
+};
+   int x, y;
+   unsigned char buf[2][8];
+   symmetric_key skey;
+
+   for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
+       khazad_setup(tests[x].key, 16, 0, &skey);
+       khazad_ecb_encrypt(tests[x].pt, buf[0], &skey);
+       khazad_ecb_decrypt(buf[0], buf[1], &skey);
+       if (XMEMCMP(buf[0], tests[x].ct, 8) || XMEMCMP(buf[1], tests[x].pt, 8)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+
+       for (y = 0; y < 1000; y++) khazad_ecb_encrypt(buf[0], buf[0], &skey);
+       for (y = 0; y < 1000; y++) khazad_ecb_decrypt(buf[0], buf[0], &skey);
+       if (XMEMCMP(buf[0], tests[x].ct, 8)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void khazad_done(symmetric_key *skey)
+{
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int khazad_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize >= 16) {
+      *keysize = 16;
+      return CRYPT_OK;
+   } else {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+}
+
+#endif
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/khazad.c,v $ */
+/* $Revision: 1.12 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/kseed.c

@@ -0,0 +1,376 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+
+/**
+  @file kseed.c
+  seed implementation of SEED derived from RFC4269
+  Tom St Denis
+*/
+
+#include "tomcrypt.h"
+
+#ifdef KSEED
+
+const struct ltc_cipher_descriptor kseed_desc = {
+   "seed",
+   20,
+   16, 16, 16, 16,
+   &kseed_setup,
+   &kseed_ecb_encrypt,
+   &kseed_ecb_decrypt,
+   &kseed_test,
+   &kseed_done,
+   &kseed_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+static const ulong32 SS0[256] = {
+0x2989A1A8UL,0x05858184UL,0x16C6D2D4UL,0x13C3D3D0UL,0x14445054UL,0x1D0D111CUL,0x2C8CA0ACUL,0x25052124UL,
+0x1D4D515CUL,0x03434340UL,0x18081018UL,0x1E0E121CUL,0x11415150UL,0x3CCCF0FCUL,0x0ACAC2C8UL,0x23436360UL,
+0x28082028UL,0x04444044UL,0x20002020UL,0x1D8D919CUL,0x20C0E0E0UL,0x22C2E2E0UL,0x08C8C0C8UL,0x17071314UL,
+0x2585A1A4UL,0x0F8F838CUL,0x03030300UL,0x3B4B7378UL,0x3B8BB3B8UL,0x13031310UL,0x12C2D2D0UL,0x2ECEE2ECUL,
+0x30407070UL,0x0C8C808CUL,0x3F0F333CUL,0x2888A0A8UL,0x32023230UL,0x1DCDD1DCUL,0x36C6F2F4UL,0x34447074UL,
+0x2CCCE0ECUL,0x15859194UL,0x0B0B0308UL,0x17475354UL,0x1C4C505CUL,0x1B4B5358UL,0x3D8DB1BCUL,0x01010100UL,
+0x24042024UL,0x1C0C101CUL,0x33437370UL,0x18889098UL,0x10001010UL,0x0CCCC0CCUL,0x32C2F2F0UL,0x19C9D1D8UL,
+0x2C0C202CUL,0x27C7E3E4UL,0x32427270UL,0x03838380UL,0x1B8B9398UL,0x11C1D1D0UL,0x06868284UL,0x09C9C1C8UL,
+0x20406060UL,0x10405050UL,0x2383A3A0UL,0x2BCBE3E8UL,0x0D0D010CUL,0x3686B2B4UL,0x1E8E929CUL,0x0F4F434CUL,
+0x3787B3B4UL,0x1A4A5258UL,0x06C6C2C4UL,0x38487078UL,0x2686A2A4UL,0x12021210UL,0x2F8FA3ACUL,0x15C5D1D4UL,
+0x21416160UL,0x03C3C3C0UL,0x3484B0B4UL,0x01414140UL,0x12425250UL,0x3D4D717CUL,0x0D8D818CUL,0x08080008UL,
+0x1F0F131CUL,0x19899198UL,0x00000000UL,0x19091118UL,0x04040004UL,0x13435350UL,0x37C7F3F4UL,0x21C1E1E0UL,
+0x3DCDF1FCUL,0x36467274UL,0x2F0F232CUL,0x27072324UL,0x3080B0B0UL,0x0B8B8388UL,0x0E0E020CUL,0x2B8BA3A8UL,
+0x2282A2A0UL,0x2E4E626CUL,0x13839390UL,0x0D4D414CUL,0x29496168UL,0x3C4C707CUL,0x09090108UL,0x0A0A0208UL,
+0x3F8FB3BCUL,0x2FCFE3ECUL,0x33C3F3F0UL,0x05C5C1C4UL,0x07878384UL,0x14041014UL,0x3ECEF2FCUL,0x24446064UL,
+0x1ECED2DCUL,0x2E0E222CUL,0x0B4B4348UL,0x1A0A1218UL,0x06060204UL,0x21012120UL,0x2B4B6368UL,0x26466264UL,
+0x02020200UL,0x35C5F1F4UL,0x12829290UL,0x0A8A8288UL,0x0C0C000CUL,0x3383B3B0UL,0x3E4E727CUL,0x10C0D0D0UL,
+0x3A4A7278UL,0x07474344UL,0x16869294UL,0x25C5E1E4UL,0x26062224UL,0x00808080UL,0x2D8DA1ACUL,0x1FCFD3DCUL,
+0x2181A1A0UL,0x30003030UL,0x37073334UL,0x2E8EA2ACUL,0x36063234UL,0x15051114UL,0x22022220UL,0x38083038UL,
+0x34C4F0F4UL,0x2787A3A4UL,0x05454144UL,0x0C4C404CUL,0x01818180UL,0x29C9E1E8UL,0x04848084UL,0x17879394UL,
+0x35053134UL,0x0BCBC3C8UL,0x0ECEC2CCUL,0x3C0C303CUL,0x31417170UL,0x11011110UL,0x07C7C3C4UL,0x09898188UL,
+0x35457174UL,0x3BCBF3F8UL,0x1ACAD2D8UL,0x38C8F0F8UL,0x14849094UL,0x19495158UL,0x02828280UL,0x04C4C0C4UL,
+0x3FCFF3FCUL,0x09494148UL,0x39093138UL,0x27476364UL,0x00C0C0C0UL,0x0FCFC3CCUL,0x17C7D3D4UL,0x3888B0B8UL,
+0x0F0F030CUL,0x0E8E828CUL,0x02424240UL,0x23032320UL,0x11819190UL,0x2C4C606CUL,0x1BCBD3D8UL,0x2484A0A4UL,
+0x34043034UL,0x31C1F1F0UL,0x08484048UL,0x02C2C2C0UL,0x2F4F636CUL,0x3D0D313CUL,0x2D0D212CUL,0x00404040UL,
+0x3E8EB2BCUL,0x3E0E323CUL,0x3C8CB0BCUL,0x01C1C1C0UL,0x2A8AA2A8UL,0x3A8AB2B8UL,0x0E4E424CUL,0x15455154UL,
+0x3B0B3338UL,0x1CCCD0DCUL,0x28486068UL,0x3F4F737CUL,0x1C8C909CUL,0x18C8D0D8UL,0x0A4A4248UL,0x16465254UL,
+0x37477374UL,0x2080A0A0UL,0x2DCDE1ECUL,0x06464244UL,0x3585B1B4UL,0x2B0B2328UL,0x25456164UL,0x3ACAF2F8UL,
+0x23C3E3E0UL,0x3989B1B8UL,0x3181B1B0UL,0x1F8F939CUL,0x1E4E525CUL,0x39C9F1F8UL,0x26C6E2E4UL,0x3282B2B0UL,
+0x31013130UL,0x2ACAE2E8UL,0x2D4D616CUL,0x1F4F535CUL,0x24C4E0E4UL,0x30C0F0F0UL,0x0DCDC1CCUL,0x08888088UL,
+0x16061214UL,0x3A0A3238UL,0x18485058UL,0x14C4D0D4UL,0x22426260UL,0x29092128UL,0x07070304UL,0x33033330UL,
+0x28C8E0E8UL,0x1B0B1318UL,0x05050104UL,0x39497178UL,0x10809090UL,0x2A4A6268UL,0x2A0A2228UL,0x1A8A9298UL
+};
+
+static const ulong32 SS1[256] = {
+0x38380830UL,0xE828C8E0UL,0x2C2D0D21UL,0xA42686A2UL,0xCC0FCFC3UL,0xDC1ECED2UL,0xB03383B3UL,0xB83888B0UL,
+0xAC2F8FA3UL,0x60204060UL,0x54154551UL,0xC407C7C3UL,0x44044440UL,0x6C2F4F63UL,0x682B4B63UL,0x581B4B53UL,
+0xC003C3C3UL,0x60224262UL,0x30330333UL,0xB43585B1UL,0x28290921UL,0xA02080A0UL,0xE022C2E2UL,0xA42787A3UL,
+0xD013C3D3UL,0x90118191UL,0x10110111UL,0x04060602UL,0x1C1C0C10UL,0xBC3C8CB0UL,0x34360632UL,0x480B4B43UL,
+0xEC2FCFE3UL,0x88088880UL,0x6C2C4C60UL,0xA82888A0UL,0x14170713UL,0xC404C4C0UL,0x14160612UL,0xF434C4F0UL,
+0xC002C2C2UL,0x44054541UL,0xE021C1E1UL,0xD416C6D2UL,0x3C3F0F33UL,0x3C3D0D31UL,0x8C0E8E82UL,0x98188890UL,
+0x28280820UL,0x4C0E4E42UL,0xF436C6F2UL,0x3C3E0E32UL,0xA42585A1UL,0xF839C9F1UL,0x0C0D0D01UL,0xDC1FCFD3UL,
+0xD818C8D0UL,0x282B0B23UL,0x64264662UL,0x783A4A72UL,0x24270723UL,0x2C2F0F23UL,0xF031C1F1UL,0x70324272UL,
+0x40024242UL,0xD414C4D0UL,0x40014141UL,0xC000C0C0UL,0x70334373UL,0x64274763UL,0xAC2C8CA0UL,0x880B8B83UL,
+0xF437C7F3UL,0xAC2D8DA1UL,0x80008080UL,0x1C1F0F13UL,0xC80ACAC2UL,0x2C2C0C20UL,0xA82A8AA2UL,0x34340430UL,
+0xD012C2D2UL,0x080B0B03UL,0xEC2ECEE2UL,0xE829C9E1UL,0x5C1D4D51UL,0x94148490UL,0x18180810UL,0xF838C8F0UL,
+0x54174753UL,0xAC2E8EA2UL,0x08080800UL,0xC405C5C1UL,0x10130313UL,0xCC0DCDC1UL,0x84068682UL,0xB83989B1UL,
+0xFC3FCFF3UL,0x7C3D4D71UL,0xC001C1C1UL,0x30310131UL,0xF435C5F1UL,0x880A8A82UL,0x682A4A62UL,0xB03181B1UL,
+0xD011C1D1UL,0x20200020UL,0xD417C7D3UL,0x00020202UL,0x20220222UL,0x04040400UL,0x68284860UL,0x70314171UL,
+0x04070703UL,0xD81BCBD3UL,0x9C1D8D91UL,0x98198991UL,0x60214161UL,0xBC3E8EB2UL,0xE426C6E2UL,0x58194951UL,
+0xDC1DCDD1UL,0x50114151UL,0x90108090UL,0xDC1CCCD0UL,0x981A8A92UL,0xA02383A3UL,0xA82B8BA3UL,0xD010C0D0UL,
+0x80018181UL,0x0C0F0F03UL,0x44074743UL,0x181A0A12UL,0xE023C3E3UL,0xEC2CCCE0UL,0x8C0D8D81UL,0xBC3F8FB3UL,
+0x94168692UL,0x783B4B73UL,0x5C1C4C50UL,0xA02282A2UL,0xA02181A1UL,0x60234363UL,0x20230323UL,0x4C0D4D41UL,
+0xC808C8C0UL,0x9C1E8E92UL,0x9C1C8C90UL,0x383A0A32UL,0x0C0C0C00UL,0x2C2E0E22UL,0xB83A8AB2UL,0x6C2E4E62UL,
+0x9C1F8F93UL,0x581A4A52UL,0xF032C2F2UL,0x90128292UL,0xF033C3F3UL,0x48094941UL,0x78384870UL,0xCC0CCCC0UL,
+0x14150511UL,0xF83BCBF3UL,0x70304070UL,0x74354571UL,0x7C3F4F73UL,0x34350531UL,0x10100010UL,0x00030303UL,
+0x64244460UL,0x6C2D4D61UL,0xC406C6C2UL,0x74344470UL,0xD415C5D1UL,0xB43484B0UL,0xE82ACAE2UL,0x08090901UL,
+0x74364672UL,0x18190911UL,0xFC3ECEF2UL,0x40004040UL,0x10120212UL,0xE020C0E0UL,0xBC3D8DB1UL,0x04050501UL,
+0xF83ACAF2UL,0x00010101UL,0xF030C0F0UL,0x282A0A22UL,0x5C1E4E52UL,0xA82989A1UL,0x54164652UL,0x40034343UL,
+0x84058581UL,0x14140410UL,0x88098981UL,0x981B8B93UL,0xB03080B0UL,0xE425C5E1UL,0x48084840UL,0x78394971UL,
+0x94178793UL,0xFC3CCCF0UL,0x1C1E0E12UL,0x80028282UL,0x20210121UL,0x8C0C8C80UL,0x181B0B13UL,0x5C1F4F53UL,
+0x74374773UL,0x54144450UL,0xB03282B2UL,0x1C1D0D11UL,0x24250521UL,0x4C0F4F43UL,0x00000000UL,0x44064642UL,
+0xEC2DCDE1UL,0x58184850UL,0x50124252UL,0xE82BCBE3UL,0x7C3E4E72UL,0xD81ACAD2UL,0xC809C9C1UL,0xFC3DCDF1UL,
+0x30300030UL,0x94158591UL,0x64254561UL,0x3C3C0C30UL,0xB43686B2UL,0xE424C4E0UL,0xB83B8BB3UL,0x7C3C4C70UL,
+0x0C0E0E02UL,0x50104050UL,0x38390931UL,0x24260622UL,0x30320232UL,0x84048480UL,0x68294961UL,0x90138393UL,
+0x34370733UL,0xE427C7E3UL,0x24240420UL,0xA42484A0UL,0xC80BCBC3UL,0x50134353UL,0x080A0A02UL,0x84078783UL,
+0xD819C9D1UL,0x4C0C4C40UL,0x80038383UL,0x8C0F8F83UL,0xCC0ECEC2UL,0x383B0B33UL,0x480A4A42UL,0xB43787B3UL
+};
+
+static const ulong32 SS2[256] = {
+0xA1A82989UL,0x81840585UL,0xD2D416C6UL,0xD3D013C3UL,0x50541444UL,0x111C1D0DUL,0xA0AC2C8CUL,0x21242505UL,
+0x515C1D4DUL,0x43400343UL,0x10181808UL,0x121C1E0EUL,0x51501141UL,0xF0FC3CCCUL,0xC2C80ACAUL,0x63602343UL,
+0x20282808UL,0x40440444UL,0x20202000UL,0x919C1D8DUL,0xE0E020C0UL,0xE2E022C2UL,0xC0C808C8UL,0x13141707UL,
+0xA1A42585UL,0x838C0F8FUL,0x03000303UL,0x73783B4BUL,0xB3B83B8BUL,0x13101303UL,0xD2D012C2UL,0xE2EC2ECEUL,
+0x70703040UL,0x808C0C8CUL,0x333C3F0FUL,0xA0A82888UL,0x32303202UL,0xD1DC1DCDUL,0xF2F436C6UL,0x70743444UL,
+0xE0EC2CCCUL,0x91941585UL,0x03080B0BUL,0x53541747UL,0x505C1C4CUL,0x53581B4BUL,0xB1BC3D8DUL,0x01000101UL,
+0x20242404UL,0x101C1C0CUL,0x73703343UL,0x90981888UL,0x10101000UL,0xC0CC0CCCUL,0xF2F032C2UL,0xD1D819C9UL,
+0x202C2C0CUL,0xE3E427C7UL,0x72703242UL,0x83800383UL,0x93981B8BUL,0xD1D011C1UL,0x82840686UL,0xC1C809C9UL,
+0x60602040UL,0x50501040UL,0xA3A02383UL,0xE3E82BCBUL,0x010C0D0DUL,0xB2B43686UL,0x929C1E8EUL,0x434C0F4FUL,
+0xB3B43787UL,0x52581A4AUL,0xC2C406C6UL,0x70783848UL,0xA2A42686UL,0x12101202UL,0xA3AC2F8FUL,0xD1D415C5UL,
+0x61602141UL,0xC3C003C3UL,0xB0B43484UL,0x41400141UL,0x52501242UL,0x717C3D4DUL,0x818C0D8DUL,0x00080808UL,
+0x131C1F0FUL,0x91981989UL,0x00000000UL,0x11181909UL,0x00040404UL,0x53501343UL,0xF3F437C7UL,0xE1E021C1UL,
+0xF1FC3DCDUL,0x72743646UL,0x232C2F0FUL,0x23242707UL,0xB0B03080UL,0x83880B8BUL,0x020C0E0EUL,0xA3A82B8BUL,
+0xA2A02282UL,0x626C2E4EUL,0x93901383UL,0x414C0D4DUL,0x61682949UL,0x707C3C4CUL,0x01080909UL,0x02080A0AUL,
+0xB3BC3F8FUL,0xE3EC2FCFUL,0xF3F033C3UL,0xC1C405C5UL,0x83840787UL,0x10141404UL,0xF2FC3ECEUL,0x60642444UL,
+0xD2DC1ECEUL,0x222C2E0EUL,0x43480B4BUL,0x12181A0AUL,0x02040606UL,0x21202101UL,0x63682B4BUL,0x62642646UL,
+0x02000202UL,0xF1F435C5UL,0x92901282UL,0x82880A8AUL,0x000C0C0CUL,0xB3B03383UL,0x727C3E4EUL,0xD0D010C0UL,
+0x72783A4AUL,0x43440747UL,0x92941686UL,0xE1E425C5UL,0x22242606UL,0x80800080UL,0xA1AC2D8DUL,0xD3DC1FCFUL,
+0xA1A02181UL,0x30303000UL,0x33343707UL,0xA2AC2E8EUL,0x32343606UL,0x11141505UL,0x22202202UL,0x30383808UL,
+0xF0F434C4UL,0xA3A42787UL,0x41440545UL,0x404C0C4CUL,0x81800181UL,0xE1E829C9UL,0x80840484UL,0x93941787UL,
+0x31343505UL,0xC3C80BCBUL,0xC2CC0ECEUL,0x303C3C0CUL,0x71703141UL,0x11101101UL,0xC3C407C7UL,0x81880989UL,
+0x71743545UL,0xF3F83BCBUL,0xD2D81ACAUL,0xF0F838C8UL,0x90941484UL,0x51581949UL,0x82800282UL,0xC0C404C4UL,
+0xF3FC3FCFUL,0x41480949UL,0x31383909UL,0x63642747UL,0xC0C000C0UL,0xC3CC0FCFUL,0xD3D417C7UL,0xB0B83888UL,
+0x030C0F0FUL,0x828C0E8EUL,0x42400242UL,0x23202303UL,0x91901181UL,0x606C2C4CUL,0xD3D81BCBUL,0xA0A42484UL,
+0x30343404UL,0xF1F031C1UL,0x40480848UL,0xC2C002C2UL,0x636C2F4FUL,0x313C3D0DUL,0x212C2D0DUL,0x40400040UL,
+0xB2BC3E8EUL,0x323C3E0EUL,0xB0BC3C8CUL,0xC1C001C1UL,0xA2A82A8AUL,0xB2B83A8AUL,0x424C0E4EUL,0x51541545UL,
+0x33383B0BUL,0xD0DC1CCCUL,0x60682848UL,0x737C3F4FUL,0x909C1C8CUL,0xD0D818C8UL,0x42480A4AUL,0x52541646UL,
+0x73743747UL,0xA0A02080UL,0xE1EC2DCDUL,0x42440646UL,0xB1B43585UL,0x23282B0BUL,0x61642545UL,0xF2F83ACAUL,
+0xE3E023C3UL,0xB1B83989UL,0xB1B03181UL,0x939C1F8FUL,0x525C1E4EUL,0xF1F839C9UL,0xE2E426C6UL,0xB2B03282UL,
+0x31303101UL,0xE2E82ACAUL,0x616C2D4DUL,0x535C1F4FUL,0xE0E424C4UL,0xF0F030C0UL,0xC1CC0DCDUL,0x80880888UL,
+0x12141606UL,0x32383A0AUL,0x50581848UL,0xD0D414C4UL,0x62602242UL,0x21282909UL,0x03040707UL,0x33303303UL,
+0xE0E828C8UL,0x13181B0BUL,0x01040505UL,0x71783949UL,0x90901080UL,0x62682A4AUL,0x22282A0AUL,0x92981A8AUL
+};
+
+static const ulong32 SS3[256] = {
+0x08303838UL,0xC8E0E828UL,0x0D212C2DUL,0x86A2A426UL,0xCFC3CC0FUL,0xCED2DC1EUL,0x83B3B033UL,0x88B0B838UL,
+0x8FA3AC2FUL,0x40606020UL,0x45515415UL,0xC7C3C407UL,0x44404404UL,0x4F636C2FUL,0x4B63682BUL,0x4B53581BUL,
+0xC3C3C003UL,0x42626022UL,0x03333033UL,0x85B1B435UL,0x09212829UL,0x80A0A020UL,0xC2E2E022UL,0x87A3A427UL,
+0xC3D3D013UL,0x81919011UL,0x01111011UL,0x06020406UL,0x0C101C1CUL,0x8CB0BC3CUL,0x06323436UL,0x4B43480BUL,
+0xCFE3EC2FUL,0x88808808UL,0x4C606C2CUL,0x88A0A828UL,0x07131417UL,0xC4C0C404UL,0x06121416UL,0xC4F0F434UL,
+0xC2C2C002UL,0x45414405UL,0xC1E1E021UL,0xC6D2D416UL,0x0F333C3FUL,0x0D313C3DUL,0x8E828C0EUL,0x88909818UL,
+0x08202828UL,0x4E424C0EUL,0xC6F2F436UL,0x0E323C3EUL,0x85A1A425UL,0xC9F1F839UL,0x0D010C0DUL,0xCFD3DC1FUL,
+0xC8D0D818UL,0x0B23282BUL,0x46626426UL,0x4A72783AUL,0x07232427UL,0x0F232C2FUL,0xC1F1F031UL,0x42727032UL,
+0x42424002UL,0xC4D0D414UL,0x41414001UL,0xC0C0C000UL,0x43737033UL,0x47636427UL,0x8CA0AC2CUL,0x8B83880BUL,
+0xC7F3F437UL,0x8DA1AC2DUL,0x80808000UL,0x0F131C1FUL,0xCAC2C80AUL,0x0C202C2CUL,0x8AA2A82AUL,0x04303434UL,
+0xC2D2D012UL,0x0B03080BUL,0xCEE2EC2EUL,0xC9E1E829UL,0x4D515C1DUL,0x84909414UL,0x08101818UL,0xC8F0F838UL,
+0x47535417UL,0x8EA2AC2EUL,0x08000808UL,0xC5C1C405UL,0x03131013UL,0xCDC1CC0DUL,0x86828406UL,0x89B1B839UL,
+0xCFF3FC3FUL,0x4D717C3DUL,0xC1C1C001UL,0x01313031UL,0xC5F1F435UL,0x8A82880AUL,0x4A62682AUL,0x81B1B031UL,
+0xC1D1D011UL,0x00202020UL,0xC7D3D417UL,0x02020002UL,0x02222022UL,0x04000404UL,0x48606828UL,0x41717031UL,
+0x07030407UL,0xCBD3D81BUL,0x8D919C1DUL,0x89919819UL,0x41616021UL,0x8EB2BC3EUL,0xC6E2E426UL,0x49515819UL,
+0xCDD1DC1DUL,0x41515011UL,0x80909010UL,0xCCD0DC1CUL,0x8A92981AUL,0x83A3A023UL,0x8BA3A82BUL,0xC0D0D010UL,
+0x81818001UL,0x0F030C0FUL,0x47434407UL,0x0A12181AUL,0xC3E3E023UL,0xCCE0EC2CUL,0x8D818C0DUL,0x8FB3BC3FUL,
+0x86929416UL,0x4B73783BUL,0x4C505C1CUL,0x82A2A022UL,0x81A1A021UL,0x43636023UL,0x03232023UL,0x4D414C0DUL,
+0xC8C0C808UL,0x8E929C1EUL,0x8C909C1CUL,0x0A32383AUL,0x0C000C0CUL,0x0E222C2EUL,0x8AB2B83AUL,0x4E626C2EUL,
+0x8F939C1FUL,0x4A52581AUL,0xC2F2F032UL,0x82929012UL,0xC3F3F033UL,0x49414809UL,0x48707838UL,0xCCC0CC0CUL,
+0x05111415UL,0xCBF3F83BUL,0x40707030UL,0x45717435UL,0x4F737C3FUL,0x05313435UL,0x00101010UL,0x03030003UL,
+0x44606424UL,0x4D616C2DUL,0xC6C2C406UL,0x44707434UL,0xC5D1D415UL,0x84B0B434UL,0xCAE2E82AUL,0x09010809UL,
+0x46727436UL,0x09111819UL,0xCEF2FC3EUL,0x40404000UL,0x02121012UL,0xC0E0E020UL,0x8DB1BC3DUL,0x05010405UL,
+0xCAF2F83AUL,0x01010001UL,0xC0F0F030UL,0x0A22282AUL,0x4E525C1EUL,0x89A1A829UL,0x46525416UL,0x43434003UL,
+0x85818405UL,0x04101414UL,0x89818809UL,0x8B93981BUL,0x80B0B030UL,0xC5E1E425UL,0x48404808UL,0x49717839UL,
+0x87939417UL,0xCCF0FC3CUL,0x0E121C1EUL,0x82828002UL,0x01212021UL,0x8C808C0CUL,0x0B13181BUL,0x4F535C1FUL,
+0x47737437UL,0x44505414UL,0x82B2B032UL,0x0D111C1DUL,0x05212425UL,0x4F434C0FUL,0x00000000UL,0x46424406UL,
+0xCDE1EC2DUL,0x48505818UL,0x42525012UL,0xCBE3E82BUL,0x4E727C3EUL,0xCAD2D81AUL,0xC9C1C809UL,0xCDF1FC3DUL,
+0x00303030UL,0x85919415UL,0x45616425UL,0x0C303C3CUL,0x86B2B436UL,0xC4E0E424UL,0x8BB3B83BUL,0x4C707C3CUL,
+0x0E020C0EUL,0x40505010UL,0x09313839UL,0x06222426UL,0x02323032UL,0x84808404UL,0x49616829UL,0x83939013UL,
+0x07333437UL,0xC7E3E427UL,0x04202424UL,0x84A0A424UL,0xCBC3C80BUL,0x43535013UL,0x0A02080AUL,0x87838407UL,
+0xC9D1D819UL,0x4C404C0CUL,0x83838003UL,0x8F838C0FUL,0xCEC2CC0EUL,0x0B33383BUL,0x4A42480AUL,0x87B3B437UL
+};
+
+static const ulong32 KCi[16] = {
+0x9E3779B9,0x3C6EF373,
+0x78DDE6E6,0xF1BBCDCC,
+0xE3779B99,0xC6EF3733,
+0x8DDE6E67,0x1BBCDCCF,
+0x3779B99E,0x6EF3733C,
+0xDDE6E678,0xBBCDCCF1,
+0x779B99E3,0xEF3733C6,
+0xDE6E678D,0xBCDCCF1B
+};
+
+#define G(x) (SS3[((x)>>24)&255] ^ SS2[((x)>>16)&255] ^ SS1[((x)>>8)&255] ^ SS0[(x)&255])
+
+#define F(L1, L2, R1, R2, K1, K2) \
+   T2 = G((R1 ^ K1) ^ (R2 ^ K2)); \
+   T = G( G(T2 + (R1 ^ K1)) + T2); \
+   L2 ^= T; \
+   L1 ^= (T + G(T2 + (R1 ^ K1))); \
+
+ /**
+    Initialize the SEED block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+    int     i;
+    ulong32 tmp, k1, k2, k3, k4;
+
+    if (keylen != 16) {
+       return CRYPT_INVALID_KEYSIZE;
+    }
+   
+    if (num_rounds != 16 && num_rounds != 0) {
+       return CRYPT_INVALID_ROUNDS;
+    }
+
+    /* load key */
+    LOAD32H(k1, key);
+    LOAD32H(k2, key+4);
+    LOAD32H(k3, key+8);
+    LOAD32H(k4, key+12);
+
+    for (i = 0; i < 16; i++) {
+       skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]);
+       skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]);
+       if (i&1) {
+          tmp = k3;
+          k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF;
+          k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF;
+       } else {
+          tmp = k1;
+          k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF;
+          k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF;
+      }
+      /* reverse keys for decrypt */
+      skey->kseed.dK[2*(15-i)+0] = skey->kseed.K[2*i+0];
+      skey->kseed.dK[2*(15-i)+1] = skey->kseed.K[2*i+1];
+    }
+
+    return CRYPT_OK;
+}
+
+static void rounds(ulong32 *P, ulong32 *K)
+{
+   ulong32 T, T2;
+   int     i;
+   for (i = 0; i < 16; i += 2) {
+     F(P[0], P[1], P[2], P[3], K[0], K[1]);
+     F(P[2], P[3], P[0], P[1], K[2], K[3]);
+     K += 4;
+   }
+}
+
+/**
+  Encrypts a block of text with SEED
+  @param pt The input plaintext (16 bytes)
+  @param ct The output ciphertext (16 bytes)
+  @param skey The key as scheduled
+  @return CRYPT_OK if successful
+*/
+int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+   ulong32 P[4];
+   LOAD32H(P[0], pt);
+   LOAD32H(P[1], pt+4);
+   LOAD32H(P[2], pt+8);
+   LOAD32H(P[3], pt+12);
+   rounds(P, skey->kseed.K);
+   STORE32H(P[2], ct);
+   STORE32H(P[3], ct+4);
+   STORE32H(P[0], ct+8);
+   STORE32H(P[1], ct+12);
+   return CRYPT_OK;
+}
+
+/**
+  Decrypts a block of text with SEED
+  @param ct The input ciphertext (16 bytes)
+  @param pt The output plaintext (16 bytes)
+  @param skey The key as scheduled 
+  @return CRYPT_OK if successful
+*/
+int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+   ulong32 P[4];
+   LOAD32H(P[0], ct);
+   LOAD32H(P[1], ct+4);
+   LOAD32H(P[2], ct+8);
+   LOAD32H(P[3], ct+12);
+   rounds(P, skey->kseed.dK);
+   STORE32H(P[2], pt);
+   STORE32H(P[3], pt+4);
+   STORE32H(P[0], pt+8);
+   STORE32H(P[1], pt+12);
+   return CRYPT_OK;
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void kseed_done(symmetric_key *skey)
+{
+}
+
+/**
+  Performs a self-test of the SEED block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int kseed_test(void)
+{
+#if !defined(LTC_TEST)
+  return CRYPT_NOP;
+#else
+  static const struct test {
+     unsigned char pt[16], ct[16], key[16];
+  } tests[] = {
+
+{
+  { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F },
+  { 0x5E,0xBA,0xC6,0xE0,0x05,0x4E,0x16,0x68,0x19,0xAF,0xF1,0xCC,0x6D,0x34,0x6C,0xDB },
+  { 0 },
+},
+
+{
+  { 0 },
+  { 0xC1,0x1F,0x22,0xF2,0x01,0x40,0x50,0x50,0x84,0x48,0x35,0x97,0xE4,0x37,0x0F,0x43 },
+  { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F },
+},
+
+{
+  { 0x83,0xA2,0xF8,0xA2,0x88,0x64,0x1F,0xB9,0xA4,0xE9,0xA5,0xCC,0x2F,0x13,0x1C,0x7D },
+  { 0xEE,0x54,0xD1,0x3E,0xBC,0xAE,0x70,0x6D,0x22,0x6B,0xC3,0x14,0x2C,0xD4,0x0D,0x4A },
+  { 0x47,0x06,0x48,0x08,0x51,0xE6,0x1B,0xE8,0x5D,0x74,0xBF,0xB3,0xFD,0x95,0x61,0x85 },
+},
+
+{
+  { 0xB4,0x1E,0x6B,0xE2,0xEB,0xA8,0x4A,0x14,0x8E,0x2E,0xED,0x84,0x59,0x3C,0x5E,0xC7 },
+  { 0x9B,0x9B,0x7B,0xFC,0xD1,0x81,0x3C,0xB9,0x5D,0x0B,0x36,0x18,0xF4,0x0F,0x51,0x22 },
+  { 0x28,0xDB,0xC3,0xBC,0x49,0xFF,0xD8,0x7D,0xCF,0xA5,0x09,0xB1,0x1D,0x42,0x2B,0xE7 },
+}
+};
+   int x;
+   unsigned char buf[2][16];
+   symmetric_key skey;
+
+   for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
+       kseed_setup(tests[x].key, 16, 0, &skey);
+       kseed_ecb_encrypt(tests[x].pt, buf[0], &skey);
+       kseed_ecb_decrypt(buf[0], buf[1], &skey);
+       if (XMEMCMP(buf[0], tests[x].ct, 16) || XMEMCMP(buf[1], tests[x].pt, 16)) {
+          return CRYPT_FAIL_TESTVECTOR;
+       }
+   }
+   return CRYPT_OK;
+#endif
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int kseed_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize >= 16) {
+      *keysize = 16;
+   } else {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+   return CRYPT_OK;
+}
+
+#endif
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/kseed.c,v $ */
+/* $Revision: 1.8 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/noekeon.c

@@ -0,0 +1,303 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+/**
+   @file noekeon.c
+   Implementation of the Noekeon block cipher by Tom St Denis 
+*/
+#include "tomcrypt.h"
+
+#ifdef NOEKEON
+
+const struct ltc_cipher_descriptor noekeon_desc =
+{
+    "noekeon",
+    16,
+    16, 16, 16, 16,
+    &noekeon_setup,
+    &noekeon_ecb_encrypt,
+    &noekeon_ecb_decrypt,
+    &noekeon_test,
+    &noekeon_done,
+    &noekeon_keysize,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+static const ulong32 RC[] = {
+   0x00000080UL, 0x0000001bUL, 0x00000036UL, 0x0000006cUL,
+   0x000000d8UL, 0x000000abUL, 0x0000004dUL, 0x0000009aUL,
+   0x0000002fUL, 0x0000005eUL, 0x000000bcUL, 0x00000063UL,
+   0x000000c6UL, 0x00000097UL, 0x00000035UL, 0x0000006aUL,
+   0x000000d4UL 
+};
+
+#define kTHETA(a, b, c, d)                                 \
+    temp = a^c; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \
+    b ^= temp; d ^= temp;                                  \
+    temp = b^d; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \
+    a ^= temp; c ^= temp;
+
+#define THETA(k, a, b, c, d)                               \
+    temp = a^c; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \
+    b ^= temp ^ k[1]; d ^= temp ^ k[3];                    \
+    temp = b^d; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \
+    a ^= temp ^ k[0]; c ^= temp ^ k[2];
+    
+#define GAMMA(a, b, c, d)     \
+    b ^= ~(d|c);              \
+    a ^= c&b;                 \
+    temp = d; d = a; a = temp;\
+    c ^= a ^ b ^ d;           \
+    b ^= ~(d|c);              \
+    a ^= c&b;
+    
+#define PI1(a, b, c, d) \
+    a = ROLc(a, 1); c = ROLc(c, 5); d = ROLc(d, 2);
+    
+#define PI2(a, b, c, d) \
+    a = RORc(a, 1); c = RORc(c, 5); d = RORc(d, 2);
+    
+ /**
+    Initialize the Noekeon block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+   ulong32 temp;
+   
+   LTC_ARGCHK(key != NULL);
+   LTC_ARGCHK(skey != NULL);
+   
+   if (keylen != 16) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+   
+   if (num_rounds != 16 && num_rounds != 0) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+   
+   LOAD32H(skey->noekeon.K[0],&key[0]);
+   LOAD32H(skey->noekeon.K[1],&key[4]);
+   LOAD32H(skey->noekeon.K[2],&key[8]);
+   LOAD32H(skey->noekeon.K[3],&key[12]);
+   
+   LOAD32H(skey->noekeon.dK[0],&key[0]);
+   LOAD32H(skey->noekeon.dK[1],&key[4]);
+   LOAD32H(skey->noekeon.dK[2],&key[8]);
+   LOAD32H(skey->noekeon.dK[3],&key[12]);
+
+   kTHETA(skey->noekeon.dK[0], skey->noekeon.dK[1], skey->noekeon.dK[2], skey->noekeon.dK[3]);
+
+   return CRYPT_OK;
+}
+
+/**
+  Encrypts a block of text with Noekeon
+  @param pt The input plaintext (16 bytes)
+  @param ct The output ciphertext (16 bytes)
+  @param skey The key as scheduled
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#else
+int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#endif
+{
+   ulong32 a,b,c,d,temp;
+   int r;
+
+   LTC_ARGCHK(skey != NULL);
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   
+   LOAD32H(a,&pt[0]); LOAD32H(b,&pt[4]);
+   LOAD32H(c,&pt[8]); LOAD32H(d,&pt[12]);
+   
+#define ROUND(i) \
+       a ^= RC[i]; \
+       THETA(skey->noekeon.K, a,b,c,d); \
+       PI1(a,b,c,d); \
+       GAMMA(a,b,c,d); \
+       PI2(a,b,c,d);
+
+   for (r = 0; r < 16; ++r) {
+       ROUND(r);
+   }
+
+#undef ROUND
+
+   a ^= RC[16];
+   THETA(skey->noekeon.K, a, b, c, d);
+   
+   STORE32H(a,&ct[0]); STORE32H(b,&ct[4]);
+   STORE32H(c,&ct[8]); STORE32H(d,&ct[12]);
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+   int err = _noekeon_ecb_encrypt(pt, ct, skey);
+   burn_stack(sizeof(ulong32) * 5 + sizeof(int));
+   return CRYPT_OK;
+}
+#endif
+
+/**
+  Decrypts a block of text with Noekeon
+  @param ct The input ciphertext (16 bytes)
+  @param pt The output plaintext (16 bytes)
+  @param skey The key as scheduled 
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#else
+int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#endif
+{
+   ulong32 a,b,c,d, temp;
+   int r;
+
+   LTC_ARGCHK(skey != NULL);
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   
+   LOAD32H(a,&ct[0]); LOAD32H(b,&ct[4]);
+   LOAD32H(c,&ct[8]); LOAD32H(d,&ct[12]);
+   
+
+#define ROUND(i) \
+       THETA(skey->noekeon.dK, a,b,c,d); \
+       a ^= RC[i]; \
+       PI1(a,b,c,d); \
+       GAMMA(a,b,c,d); \
+       PI2(a,b,c,d); 
+
+   for (r = 16; r > 0; --r) {
+       ROUND(r);
+   }
+
+#undef ROUND
+
+   THETA(skey->noekeon.dK, a,b,c,d);
+   a ^= RC[0];
+   STORE32H(a,&pt[0]); STORE32H(b, &pt[4]);
+   STORE32H(c,&pt[8]); STORE32H(d, &pt[12]);
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+   int err = _noekeon_ecb_decrypt(ct, pt, skey);
+   burn_stack(sizeof(ulong32) * 5 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+  Performs a self-test of the Noekeon block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int noekeon_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else
+ static const struct {
+     int keylen;
+     unsigned char key[16], pt[16], ct[16];
+ } tests[] = {
+   {
+      16,
+      { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 },
+      { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 },
+      { 0x18, 0xa6, 0xec, 0xe5, 0x28, 0xaa, 0x79, 0x73,
+        0x28, 0xb2, 0xc0, 0x91, 0xa0, 0x2f, 0x54, 0xc5}
+   }
+ };
+ symmetric_key key;
+ unsigned char tmp[2][16];
+ int err, i, y;
+ 
+ for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+    zeromem(&key, sizeof(key));
+    if ((err = noekeon_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { 
+       return err;
+    }
+  
+    noekeon_ecb_encrypt(tests[i].pt, tmp[0], &key);
+    noekeon_ecb_decrypt(tmp[0], tmp[1], &key);
+    if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { 
+#if 0
+       printf("\n\nTest %d failed\n", i);
+       if (XMEMCMP(tmp[0], tests[i].ct, 16)) {
+          printf("CT: ");
+          for (i = 0; i < 16; i++) {
+             printf("%02x ", tmp[0][i]);
+          }
+          printf("\n");
+       } else {
+          printf("PT: ");
+          for (i = 0; i < 16; i++) {
+             printf("%02x ", tmp[1][i]);
+          }
+          printf("\n");
+       }
+#endif       
+        return CRYPT_FAIL_TESTVECTOR;
+    }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 16; y++) tmp[0][y] = 0;
+      for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+ }       
+ return CRYPT_OK;
+ #endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void noekeon_done(symmetric_key *skey)
+{
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int noekeon_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize < 16) {
+      return CRYPT_INVALID_KEYSIZE;
+   } else {
+      *keysize = 16;
+      return CRYPT_OK;
+   }
+}
+
+#endif
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/noekeon.c,v $ */
+/* $Revision: 1.12 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/rc2.c

@@ -0,0 +1,362 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+/**********************************************************************\
+* To commemorate the 1996 RSA Data Security Conference, the following  *
+* code is released into the public domain by its author.  Prost!       *
+*                                                                      *
+* This cipher uses 16-bit words and little-endian byte ordering.       *
+* I wonder which processor it was optimized for?                       *
+*                                                                      *
+* Thanks to CodeView, SoftIce, and D86 for helping bring this code to  *
+* the public.                                                          *
+\**********************************************************************/
+#include <tomcrypt.h>
+
+/**
+  @file rc2.c
+  Implementation of RC2
+*/  
+
+#ifdef RC2
+
+const struct ltc_cipher_descriptor rc2_desc = {
+   "rc2",
+   12, 8, 128, 8, 16,
+   &rc2_setup,
+   &rc2_ecb_encrypt,
+   &rc2_ecb_decrypt,
+   &rc2_test,
+   &rc2_done,
+   &rc2_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+/* 256-entry permutation table, probably derived somehow from pi */
+static const unsigned char permute[256] = {
+        217,120,249,196, 25,221,181,237, 40,233,253,121, 74,160,216,157,
+        198,126, 55,131, 43,118, 83,142, 98, 76,100,136, 68,139,251,162,
+         23,154, 89,245,135,179, 79, 19, 97, 69,109,141,  9,129,125, 50,
+        189,143, 64,235,134,183,123, 11,240,149, 33, 34, 92,107, 78,130,
+         84,214,101,147,206, 96,178, 28,115, 86,192, 20,167,140,241,220,
+         18,117,202, 31, 59,190,228,209, 66, 61,212, 48,163, 60,182, 38,
+        111,191, 14,218, 70,105,  7, 87, 39,242, 29,155,188,148, 67,  3,
+        248, 17,199,246,144,239, 62,231,  6,195,213, 47,200,102, 30,215,
+          8,232,234,222,128, 82,238,247,132,170,114,172, 53, 77,106, 42,
+        150, 26,210,113, 90, 21, 73,116, 75,159,208, 94,  4, 24,164,236,
+        194,224, 65,110, 15, 81,203,204, 36,145,175, 80,161,244,112, 57,
+        153,124, 58,133, 35,184,180,122,252,  2, 54, 91, 37, 85,151, 49,
+         45, 93,250,152,227,138,146,174,  5,223, 41, 16,103,108,186,201,
+        211,  0,230,207,225,158,168, 44, 99, 22,  1, 63, 88,226,137,169,
+         13, 56, 52, 27,171, 51,255,176,187, 72, 12, 95,185,177,205, 46,
+        197,243,219, 71,229,165,156,119, 10,166, 32,104,254,127,193,173
+};
+
+ /**
+    Initialize the RC2 block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+   unsigned *xkey = skey->rc2.xkey;
+   unsigned char tmp[128];
+   unsigned T8, TM;
+   int i, bits;
+
+   LTC_ARGCHK(key  != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   if (keylen < 8 || keylen > 128) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+
+   if (num_rounds != 0 && num_rounds != 16) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+
+   for (i = 0; i < keylen; i++) {
+       tmp[i] = key[i] & 255;
+   }
+
+    /* Phase 1: Expand input key to 128 bytes */
+    if (keylen < 128) {
+        for (i = keylen; i < 128; i++) {
+            tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255];
+        }
+    }
+    
+    /* Phase 2 - reduce effective key size to "bits" */
+    bits = keylen<<3;
+    T8   = (unsigned)(bits+7)>>3;
+    TM   = (255 >> (unsigned)(7 & -bits));
+    tmp[128 - T8] = permute[tmp[128 - T8] & TM];
+    for (i = 127 - T8; i >= 0; i--) {
+        tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]];
+    }
+
+    /* Phase 3 - copy to xkey in little-endian order */
+    for (i = 0; i < 64; i++) {
+        xkey[i] =  (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8);
+    }        
+
+#ifdef LTC_CLEAN_STACK
+    zeromem(tmp, sizeof(tmp));
+#endif
+    
+    return CRYPT_OK;
+}
+
+/**********************************************************************\
+* Encrypt an 8-byte block of plaintext using the given key.            *
+\**********************************************************************/
+/**
+  Encrypts a block of text with RC2
+  @param pt The input plaintext (8 bytes)
+  @param ct The output ciphertext (8 bytes)
+  @param skey The key as scheduled
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rc2_ecb_encrypt( const unsigned char *pt,
+                            unsigned char *ct,
+                            symmetric_key *skey)
+#else
+int rc2_ecb_encrypt( const unsigned char *pt,
+                            unsigned char *ct,
+                            symmetric_key *skey)
+#endif
+{
+    unsigned *xkey;
+    unsigned x76, x54, x32, x10, i;
+
+    LTC_ARGCHK(pt  != NULL);
+    LTC_ARGCHK(ct != NULL);
+    LTC_ARGCHK(skey   != NULL);
+
+    xkey = skey->rc2.xkey;
+
+    x76 = ((unsigned)pt[7] << 8) + (unsigned)pt[6];
+    x54 = ((unsigned)pt[5] << 8) + (unsigned)pt[4];
+    x32 = ((unsigned)pt[3] << 8) + (unsigned)pt[2];
+    x10 = ((unsigned)pt[1] << 8) + (unsigned)pt[0];
+
+    for (i = 0; i < 16; i++) {
+        x10 = (x10 + (x32 & ~x76) + (x54 & x76) + xkey[4*i+0]) & 0xFFFF;
+        x10 = ((x10 << 1) | (x10 >> 15));
+
+        x32 = (x32 + (x54 & ~x10) + (x76 & x10) + xkey[4*i+1]) & 0xFFFF;
+        x32 = ((x32 << 2) | (x32 >> 14));
+
+        x54 = (x54 + (x76 & ~x32) + (x10 & x32) + xkey[4*i+2]) & 0xFFFF;
+        x54 = ((x54 << 3) | (x54 >> 13));
+
+        x76 = (x76 + (x10 & ~x54) + (x32 & x54) + xkey[4*i+3]) & 0xFFFF;
+        x76 = ((x76 << 5) | (x76 >> 11));
+
+        if (i == 4 || i == 10) {
+            x10 = (x10 + xkey[x76 & 63]) & 0xFFFF;
+            x32 = (x32 + xkey[x10 & 63]) & 0xFFFF;
+            x54 = (x54 + xkey[x32 & 63]) & 0xFFFF;
+            x76 = (x76 + xkey[x54 & 63]) & 0xFFFF;
+        }
+    }
+
+    ct[0] = (unsigned char)x10;
+    ct[1] = (unsigned char)(x10 >> 8);
+    ct[2] = (unsigned char)x32;
+    ct[3] = (unsigned char)(x32 >> 8);
+    ct[4] = (unsigned char)x54;
+    ct[5] = (unsigned char)(x54 >> 8);
+    ct[6] = (unsigned char)x76;
+    ct[7] = (unsigned char)(x76 >> 8);
+ 
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc2_ecb_encrypt( const unsigned char *pt,
+                            unsigned char *ct,
+                            symmetric_key *skey)
+{
+    int err = _rc2_ecb_encrypt(pt, ct, skey);
+    burn_stack(sizeof(unsigned *) + sizeof(unsigned) * 5);
+    return err;
+}
+#endif
+
+/**********************************************************************\
+* Decrypt an 8-byte block of ciphertext using the given key.           *
+\**********************************************************************/
+/**
+  Decrypts a block of text with RC2
+  @param ct The input ciphertext (8 bytes)
+  @param pt The output plaintext (8 bytes)
+  @param skey The key as scheduled 
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rc2_ecb_decrypt( const unsigned char *ct,
+                            unsigned char *pt,
+                            symmetric_key *skey)
+#else
+int rc2_ecb_decrypt( const unsigned char *ct,
+                            unsigned char *pt,
+                            symmetric_key *skey)
+#endif
+{
+    unsigned x76, x54, x32, x10;
+    unsigned *xkey;
+    int i;
+
+    LTC_ARGCHK(pt  != NULL);
+    LTC_ARGCHK(ct != NULL);
+    LTC_ARGCHK(skey   != NULL);
+
+    xkey = skey->rc2.xkey;
+
+    x76 = ((unsigned)ct[7] << 8) + (unsigned)ct[6];
+    x54 = ((unsigned)ct[5] << 8) + (unsigned)ct[4];
+    x32 = ((unsigned)ct[3] << 8) + (unsigned)ct[2];
+    x10 = ((unsigned)ct[1] << 8) + (unsigned)ct[0];
+
+    for (i = 15; i >= 0; i--) {
+        if (i == 4 || i == 10) {
+            x76 = (x76 - xkey[x54 & 63]) & 0xFFFF;
+            x54 = (x54 - xkey[x32 & 63]) & 0xFFFF;
+            x32 = (x32 - xkey[x10 & 63]) & 0xFFFF;
+            x10 = (x10 - xkey[x76 & 63]) & 0xFFFF;
+        }
+
+        x76 = ((x76 << 11) | (x76 >> 5));
+        x76 = (x76 - ((x10 & ~x54) + (x32 & x54) + xkey[4*i+3])) & 0xFFFF;
+
+        x54 = ((x54 << 13) | (x54 >> 3));
+        x54 = (x54 - ((x76 & ~x32) + (x10 & x32) + xkey[4*i+2])) & 0xFFFF;
+
+        x32 = ((x32 << 14) | (x32 >> 2));
+        x32 = (x32 - ((x54 & ~x10) + (x76 & x10) + xkey[4*i+1])) & 0xFFFF;
+
+        x10 = ((x10 << 15) | (x10 >> 1));
+        x10 = (x10 - ((x32 & ~x76) + (x54 & x76) + xkey[4*i+0])) & 0xFFFF;
+    }
+
+    pt[0] = (unsigned char)x10;
+    pt[1] = (unsigned char)(x10 >> 8);
+    pt[2] = (unsigned char)x32;
+    pt[3] = (unsigned char)(x32 >> 8);
+    pt[4] = (unsigned char)x54;
+    pt[5] = (unsigned char)(x54 >> 8);
+    pt[6] = (unsigned char)x76;
+    pt[7] = (unsigned char)(x76 >> 8);
+
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc2_ecb_decrypt( const unsigned char *ct,
+                            unsigned char *pt,
+                            symmetric_key *skey)
+{
+    int err = _rc2_ecb_decrypt(ct, pt, skey);
+    burn_stack(sizeof(unsigned *) + sizeof(unsigned) * 4 + sizeof(int));
+    return err;
+}
+#endif
+
+/**
+  Performs a self-test of the RC2 block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int rc2_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   static const struct {
+        int keylen;
+        unsigned char key[16], pt[8], ct[8];
+   } tests[] = {
+
+   { 8,
+     { 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+       0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+     { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
+     { 0x30, 0x64, 0x9e, 0xdf, 0x9b, 0xe7, 0xd2, 0xc2 }
+
+   },
+   { 16,
+     { 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x7f,
+       0x0f, 0x79, 0xc3, 0x84, 0x62, 0x7b, 0xaf, 0xb2 },
+     { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+     { 0x22, 0x69, 0x55, 0x2a, 0xb0, 0xf8, 0x5c, 0xa6 }
+   }
+  };
+    int x, y, err;
+    symmetric_key skey;
+    unsigned char tmp[2][8];
+
+    for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) {
+        zeromem(tmp, sizeof(tmp));
+        if ((err = rc2_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) {
+           return err;
+        }
+        
+        rc2_ecb_encrypt(tests[x].pt, tmp[0], &skey);
+        rc2_ecb_decrypt(tmp[0], tmp[1], &skey);
+        
+        if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) {
+           return CRYPT_FAIL_TESTVECTOR;
+        }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 8; y++) tmp[0][y] = 0;
+      for (y = 0; y < 1000; y++) rc2_ecb_encrypt(tmp[0], tmp[0], &skey);
+      for (y = 0; y < 1000; y++) rc2_ecb_decrypt(tmp[0], tmp[0], &skey);
+      for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+    }
+    return CRYPT_OK;
+   #endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void rc2_done(symmetric_key *skey)
+{
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int rc2_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize < 8) {
+       return CRYPT_INVALID_KEYSIZE;
+   } else if (*keysize > 128) {
+       *keysize = 128;
+   }
+   return CRYPT_OK;
+}
+
+#endif
+
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc2.c,v $ */
+/* $Revision: 1.12 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/rc5.c

@@ -0,0 +1,322 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+
+/**
+   @file rc5.c
+   RC5 code by Tom St Denis 
+*/
+
+#include "tomcrypt.h"
+
+#ifdef RC5
+
+const struct ltc_cipher_descriptor rc5_desc =
+{
+    "rc5",
+    2,
+    8, 128, 8, 12,
+    &rc5_setup,
+    &rc5_ecb_encrypt,
+    &rc5_ecb_decrypt,
+    &rc5_test,
+    &rc5_done,
+    &rc5_keysize,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+static const ulong32 stab[50] = {
+0xb7e15163UL, 0x5618cb1cUL, 0xf45044d5UL, 0x9287be8eUL, 0x30bf3847UL, 0xcef6b200UL, 0x6d2e2bb9UL, 0x0b65a572UL,
+0xa99d1f2bUL, 0x47d498e4UL, 0xe60c129dUL, 0x84438c56UL, 0x227b060fUL, 0xc0b27fc8UL, 0x5ee9f981UL, 0xfd21733aUL,
+0x9b58ecf3UL, 0x399066acUL, 0xd7c7e065UL, 0x75ff5a1eUL, 0x1436d3d7UL, 0xb26e4d90UL, 0x50a5c749UL, 0xeedd4102UL,
+0x8d14babbUL, 0x2b4c3474UL, 0xc983ae2dUL, 0x67bb27e6UL, 0x05f2a19fUL, 0xa42a1b58UL, 0x42619511UL, 0xe0990ecaUL,
+0x7ed08883UL, 0x1d08023cUL, 0xbb3f7bf5UL, 0x5976f5aeUL, 0xf7ae6f67UL, 0x95e5e920UL, 0x341d62d9UL, 0xd254dc92UL,
+0x708c564bUL, 0x0ec3d004UL, 0xacfb49bdUL, 0x4b32c376UL, 0xe96a3d2fUL, 0x87a1b6e8UL, 0x25d930a1UL, 0xc410aa5aUL,
+0x62482413UL, 0x007f9dccUL
+};
+
+ /**
+    Initialize the RC5 block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+#ifdef LTC_CLEAN_STACK
+static int _rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+#else
+int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+#endif
+{
+    ulong32 L[64], *S, A, B, i, j, v, s, t, l;
+
+    LTC_ARGCHK(skey != NULL);
+    LTC_ARGCHK(key  != NULL);
+    
+    /* test parameters */
+    if (num_rounds == 0) { 
+       num_rounds = rc5_desc.default_rounds;
+    }
+
+    if (num_rounds < 12 || num_rounds > 24) { 
+       return CRYPT_INVALID_ROUNDS;
+    }
+
+    /* key must be between 64 and 1024 bits */
+    if (keylen < 8 || keylen > 128) {
+       return CRYPT_INVALID_KEYSIZE;
+    }
+    
+    skey->rc5.rounds = num_rounds;
+    S = skey->rc5.K;
+
+    /* copy the key into the L array */
+    for (A = i = j = 0; i < (ulong32)keylen; ) { 
+        A = (A << 8) | ((ulong32)(key[i++] & 255));
+        if ((i & 3) == 0) {
+           L[j++] = BSWAP(A);
+           A = 0;
+        }
+    }
+
+    if ((keylen & 3) != 0) { 
+       A <<= (ulong32)((8 * (4 - (keylen&3)))); 
+       L[j++] = BSWAP(A);
+    }
+
+    /* setup the S array */
+    t = (ulong32)(2 * (num_rounds + 1));
+    XMEMCPY(S, stab, t * sizeof(*S));
+
+    /* mix buffer */
+    s = 3 * MAX(t, j);
+    l = j;
+    for (A = B = i = j = v = 0; v < s; v++) { 
+        A = S[i] = ROLc(S[i] + A + B, 3);
+        B = L[j] = ROL(L[j] + A + B, (A+B));
+        if (++i == t) { i = 0; }
+        if (++j == l) { j = 0; }
+    }
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+   int x;
+   x = _rc5_setup(key, keylen, num_rounds, skey);
+   burn_stack(sizeof(ulong32) * 122 + sizeof(int));
+   return x;
+}
+#endif
+
+/**
+  Encrypts a block of text with RC5
+  @param pt The input plaintext (8 bytes)
+  @param ct The output ciphertext (8 bytes)
+  @param skey The key as scheduled
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#else
+int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#endif
+{
+   ulong32 A, B, *K;
+   int r;
+   LTC_ARGCHK(skey != NULL);
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+
+   LOAD32L(A, &pt[0]);
+   LOAD32L(B, &pt[4]);
+   A += skey->rc5.K[0];
+   B += skey->rc5.K[1];
+   K  = skey->rc5.K + 2;
+   
+   if ((skey->rc5.rounds & 1) == 0) {
+      for (r = 0; r < skey->rc5.rounds; r += 2) {
+          A = ROL(A ^ B, B) + K[0];
+          B = ROL(B ^ A, A) + K[1];
+          A = ROL(A ^ B, B) + K[2];
+          B = ROL(B ^ A, A) + K[3];
+          K += 4;
+      }
+   } else {
+      for (r = 0; r < skey->rc5.rounds; r++) {
+          A = ROL(A ^ B, B) + K[0];
+          B = ROL(B ^ A, A) + K[1];
+          K += 2;
+      }
+   }
+   STORE32L(A, &ct[0]);
+   STORE32L(B, &ct[4]);
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+   int err = _rc5_ecb_encrypt(pt, ct, skey);
+   burn_stack(sizeof(ulong32) * 2 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+  Decrypts a block of text with RC5
+  @param ct The input ciphertext (8 bytes)
+  @param pt The output plaintext (8 bytes)
+  @param skey The key as scheduled 
+  @return CRYPT_OK if successful
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#else
+int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#endif
+{
+   ulong32 A, B, *K;
+   int r;
+   LTC_ARGCHK(skey != NULL);
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+
+   LOAD32L(A, &ct[0]);
+   LOAD32L(B, &ct[4]);
+   K = skey->rc5.K + (skey->rc5.rounds << 1);
+   
+   if ((skey->rc5.rounds & 1) == 0) {
+       K -= 2;
+       for (r = skey->rc5.rounds - 1; r >= 0; r -= 2) {
+          B = ROR(B - K[3], A) ^ A;
+          A = ROR(A - K[2], B) ^ B;
+          B = ROR(B - K[1], A) ^ A;
+          A = ROR(A - K[0], B) ^ B;
+          K -= 4;
+        }
+   } else {
+      for (r = skey->rc5.rounds - 1; r >= 0; r--) {
+          B = ROR(B - K[1], A) ^ A;
+          A = ROR(A - K[0], B) ^ B;
+          K -= 2;
+      }
+   }
+   A -= skey->rc5.K[0];
+   B -= skey->rc5.K[1];
+   STORE32L(A, &pt[0]);
+   STORE32L(B, &pt[4]);
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+   int err = _rc5_ecb_decrypt(ct, pt, skey);
+   burn_stack(sizeof(ulong32) * 2 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+  Performs a self-test of the RC5 block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int rc5_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   static const struct {
+       unsigned char key[16], pt[8], ct[8];
+   } tests[] = {
+   {
+       { 0x91, 0x5f, 0x46, 0x19, 0xbe, 0x41, 0xb2, 0x51,
+         0x63, 0x55, 0xa5, 0x01, 0x10, 0xa9, 0xce, 0x91 },
+       { 0x21, 0xa5, 0xdb, 0xee, 0x15, 0x4b, 0x8f, 0x6d },
+       { 0xf7, 0xc0, 0x13, 0xac, 0x5b, 0x2b, 0x89, 0x52 }
+   },
+   {
+       { 0x78, 0x33, 0x48, 0xe7, 0x5a, 0xeb, 0x0f, 0x2f,
+         0xd7, 0xb1, 0x69, 0xbb, 0x8d, 0xc1, 0x67, 0x87 },
+       { 0xF7, 0xC0, 0x13, 0xAC, 0x5B, 0x2B, 0x89, 0x52 },
+       { 0x2F, 0x42, 0xB3, 0xB7, 0x03, 0x69, 0xFC, 0x92 }
+   },
+   {
+       { 0xDC, 0x49, 0xdb, 0x13, 0x75, 0xa5, 0x58, 0x4f,
+         0x64, 0x85, 0xb4, 0x13, 0xb5, 0xf1, 0x2b, 0xaf },
+       { 0x2F, 0x42, 0xB3, 0xB7, 0x03, 0x69, 0xFC, 0x92 },
+       { 0x65, 0xc1, 0x78, 0xb2, 0x84, 0xd1, 0x97, 0xcc }
+   }
+   };
+   unsigned char tmp[2][8];
+   int x, y, err;
+   symmetric_key key;
+
+   for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) {
+      /* setup key */
+      if ((err = rc5_setup(tests[x].key, 16, 12, &key)) != CRYPT_OK) {
+         return err;
+      }
+
+      /* encrypt and decrypt */
+      rc5_ecb_encrypt(tests[x].pt, tmp[0], &key);
+      rc5_ecb_decrypt(tmp[0], tmp[1], &key);
+
+      /* compare */
+      if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) {
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 8; y++) tmp[0][y] = 0;
+      for (y = 0; y < 1000; y++) rc5_ecb_encrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 1000; y++) rc5_ecb_decrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+   }
+   return CRYPT_OK;
+  #endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void rc5_done(symmetric_key *skey)
+{
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int rc5_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize < 8) {
+      return CRYPT_INVALID_KEYSIZE;
+   } else if (*keysize > 128) {
+      *keysize = 128;
+   }
+   return CRYPT_OK;
+}
+
+#endif
+
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc5.c,v $ */
+/* $Revision: 1.12 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/rc6.c

@@ -0,0 +1,348 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+
+/**
+   @file rc6.c
+   RC6 code by Tom St Denis 
+*/
+#include "tomcrypt.h"
+
+#ifdef RC6
+
+const struct ltc_cipher_descriptor rc6_desc =
+{
+    "rc6",
+    3,
+    8, 128, 16, 20,
+    &rc6_setup,
+    &rc6_ecb_encrypt,
+    &rc6_ecb_decrypt,
+    &rc6_test,
+    &rc6_done,
+    &rc6_keysize,
+    NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+static const ulong32 stab[44] = {
+0xb7e15163UL, 0x5618cb1cUL, 0xf45044d5UL, 0x9287be8eUL, 0x30bf3847UL, 0xcef6b200UL, 0x6d2e2bb9UL, 0x0b65a572UL,
+0xa99d1f2bUL, 0x47d498e4UL, 0xe60c129dUL, 0x84438c56UL, 0x227b060fUL, 0xc0b27fc8UL, 0x5ee9f981UL, 0xfd21733aUL,
+0x9b58ecf3UL, 0x399066acUL, 0xd7c7e065UL, 0x75ff5a1eUL, 0x1436d3d7UL, 0xb26e4d90UL, 0x50a5c749UL, 0xeedd4102UL,
+0x8d14babbUL, 0x2b4c3474UL, 0xc983ae2dUL, 0x67bb27e6UL, 0x05f2a19fUL, 0xa42a1b58UL, 0x42619511UL, 0xe0990ecaUL,
+0x7ed08883UL, 0x1d08023cUL, 0xbb3f7bf5UL, 0x5976f5aeUL, 0xf7ae6f67UL, 0x95e5e920UL, 0x341d62d9UL, 0xd254dc92UL,
+0x708c564bUL, 0x0ec3d004UL, 0xacfb49bdUL, 0x4b32c376UL };
+
+ /**
+    Initialize the RC6 block cipher
+    @param key The symmetric key you wish to pass
+    @param keylen The key length in bytes
+    @param num_rounds The number of rounds desired (0 for default)
+    @param skey The key in as scheduled by this function.
+    @return CRYPT_OK if successful
+ */
+#ifdef LTC_CLEAN_STACK
+static int _rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+#else
+int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+#endif
+{
+    ulong32 L[64], S[50], A, B, i, j, v, s, l;
+
+    LTC_ARGCHK(key != NULL);
+    LTC_ARGCHK(skey != NULL);
+
+    /* test parameters */
+    if (num_rounds != 0 && num_rounds != 20) { 
+       return CRYPT_INVALID_ROUNDS;
+    }
+
+    /* key must be between 64 and 1024 bits */
+    if (keylen < 8 || keylen > 128) {
+       return CRYPT_INVALID_KEYSIZE;
+    }
+
+    /* copy the key into the L array */
+    for (A = i = j = 0; i < (ulong32)keylen; ) { 
+        A = (A << 8) | ((ulong32)(key[i++] & 255));
+        if (!(i & 3)) {
+           L[j++] = BSWAP(A);
+           A = 0;
+        }
+    }
+
+    /* handle odd sized keys */
+    if (keylen & 3) { 
+       A <<= (8 * (4 - (keylen&3))); 
+       L[j++] = BSWAP(A); 
+    }
+
+    /* setup the S array */
+    XMEMCPY(S, stab, 44 * sizeof(stab[0]));
+
+    /* mix buffer */
+    s = 3 * MAX(44, j);
+    l = j;
+    for (A = B = i = j = v = 0; v < s; v++) { 
+        A = S[i] = ROLc(S[i] + A + B, 3);
+        B = L[j] = ROL(L[j] + A + B, (A+B));
+        if (++i == 44) { i = 0; }
+        if (++j == l)  { j = 0; }
+    }
+    
+    /* copy to key */
+    for (i = 0; i < 44; i++) { 
+        skey->rc6.K[i] = S[i];
+    }
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+   int x;
+   x = _rc6_setup(key, keylen, num_rounds, skey);
+   burn_stack(sizeof(ulong32) * 122);
+   return x;
+}
+#endif
+
+/**
+  Encrypts a block of text with RC6
+  @param pt The input plaintext (16 bytes)
+  @param ct The output ciphertext (16 bytes)
+  @param skey The key as scheduled
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#else
+int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+#endif
+{
+   ulong32 a,b,c,d,t,u, *K;
+   int r;
+   
+   LTC_ARGCHK(skey != NULL);
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   LOAD32L(a,&pt[0]);LOAD32L(b,&pt[4]);LOAD32L(c,&pt[8]);LOAD32L(d,&pt[12]);
+
+   b += skey->rc6.K[0];
+   d += skey->rc6.K[1];
+
+#define RND(a,b,c,d) \
+       t = (b * (b + b + 1)); t = ROLc(t, 5); \
+       u = (d * (d + d + 1)); u = ROLc(u, 5); \
+       a = ROL(a^t,u) + K[0];                \
+       c = ROL(c^u,t) + K[1]; K += 2;   
+    
+   K = skey->rc6.K + 2;
+   for (r = 0; r < 20; r += 4) {
+       RND(a,b,c,d);
+       RND(b,c,d,a);
+       RND(c,d,a,b);
+       RND(d,a,b,c);
+   }
+   
+#undef RND
+
+   a += skey->rc6.K[42];
+   c += skey->rc6.K[43];
+   STORE32L(a,&ct[0]);STORE32L(b,&ct[4]);STORE32L(c,&ct[8]);STORE32L(d,&ct[12]);
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+   int err = _rc6_ecb_encrypt(pt, ct, skey);
+   burn_stack(sizeof(ulong32) * 6 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+  Decrypts a block of text with RC6
+  @param ct The input ciphertext (16 bytes)
+  @param pt The output plaintext (16 bytes)
+  @param skey The key as scheduled 
+*/
+#ifdef LTC_CLEAN_STACK
+static int _rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#else
+int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+#endif
+{
+   ulong32 a,b,c,d,t,u, *K;
+   int r;
+
+   LTC_ARGCHK(skey != NULL);
+   LTC_ARGCHK(pt   != NULL);
+   LTC_ARGCHK(ct   != NULL);
+   
+   LOAD32L(a,&ct[0]);LOAD32L(b,&ct[4]);LOAD32L(c,&ct[8]);LOAD32L(d,&ct[12]);
+   a -= skey->rc6.K[42];
+   c -= skey->rc6.K[43];
+   
+#define RND(a,b,c,d) \
+       t = (b * (b + b + 1)); t = ROLc(t, 5); \
+       u = (d * (d + d + 1)); u = ROLc(u, 5); \
+       c = ROR(c - K[1], t) ^ u; \
+       a = ROR(a - K[0], u) ^ t; K -= 2;
+   
+   K = skey->rc6.K + 40;
+   
+   for (r = 0; r < 20; r += 4) {
+       RND(d,a,b,c);
+       RND(c,d,a,b);
+       RND(b,c,d,a);
+       RND(a,b,c,d);
+   }
+   
+#undef RND
+
+   b -= skey->rc6.K[0];
+   d -= skey->rc6.K[1];
+   STORE32L(a,&pt[0]);STORE32L(b,&pt[4]);STORE32L(c,&pt[8]);STORE32L(d,&pt[12]);
+
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+   int err = _rc6_ecb_decrypt(ct, pt, skey);
+   burn_stack(sizeof(ulong32) * 6 + sizeof(int));
+   return err;
+}
+#endif
+
+/**
+  Performs a self-test of the RC6 block cipher
+  @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int rc6_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   static const struct {
+       int keylen;
+       unsigned char key[32], pt[16], ct[16];
+   } tests[] = {
+   {
+       16,
+       { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
+         0x01, 0x12, 0x23, 0x34, 0x45, 0x56, 0x67, 0x78,
+         0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+         0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+       { 0x02, 0x13, 0x24, 0x35, 0x46, 0x57, 0x68, 0x79,
+         0x8a, 0x9b, 0xac, 0xbd, 0xce, 0xdf, 0xe0, 0xf1 },
+       { 0x52, 0x4e, 0x19, 0x2f, 0x47, 0x15, 0xc6, 0x23,
+         0x1f, 0x51, 0xf6, 0x36, 0x7e, 0xa4, 0x3f, 0x18 }
+   },
+   {
+       24,
+       { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
+         0x01, 0x12, 0x23, 0x34, 0x45, 0x56, 0x67, 0x78,
+         0x89, 0x9a, 0xab, 0xbc, 0xcd, 0xde, 0xef, 0xf0,
+         0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
+       { 0x02, 0x13, 0x24, 0x35, 0x46, 0x57, 0x68, 0x79,
+         0x8a, 0x9b, 0xac, 0xbd, 0xce, 0xdf, 0xe0, 0xf1 },
+       { 0x68, 0x83, 0x29, 0xd0, 0x19, 0xe5, 0x05, 0x04,
+         0x1e, 0x52, 0xe9, 0x2a, 0xf9, 0x52, 0x91, 0xd4 }
+   },
+   {
+       32,
+       { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
+         0x01, 0x12, 0x23, 0x34, 0x45, 0x56, 0x67, 0x78,
+         0x89, 0x9a, 0xab, 0xbc, 0xcd, 0xde, 0xef, 0xf0,
+         0x10, 0x32, 0x54, 0x76, 0x98, 0xba, 0xdc, 0xfe },
+       { 0x02, 0x13, 0x24, 0x35, 0x46, 0x57, 0x68, 0x79,
+         0x8a, 0x9b, 0xac, 0xbd, 0xce, 0xdf, 0xe0, 0xf1 },
+       { 0xc8, 0x24, 0x18, 0x16, 0xf0, 0xd7, 0xe4, 0x89,
+         0x20, 0xad, 0x16, 0xa1, 0x67, 0x4e, 0x5d, 0x48 }
+   }
+   };
+   unsigned char tmp[2][16];
+   int x, y, err;
+   symmetric_key key;
+
+   for (x  = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) {
+      /* setup key */
+      if ((err = rc6_setup(tests[x].key, tests[x].keylen, 0, &key)) != CRYPT_OK) {
+         return err;
+      }
+
+      /* encrypt and decrypt */
+      rc6_ecb_encrypt(tests[x].pt, tmp[0], &key);
+      rc6_ecb_decrypt(tmp[0], tmp[1], &key);
+
+      /* compare */
+      if (XMEMCMP(tmp[0], tests[x].ct, 16) || XMEMCMP(tmp[1], tests[x].pt, 16)) {
+#if 0
+         printf("\n\nFailed test %d\n", x);
+         if (XMEMCMP(tmp[0], tests[x].ct, 16)) {
+            printf("Ciphertext:  ");
+            for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]);
+            printf("\nExpected  :  ");
+            for (y = 0; y < 16; y++) printf("%02x ", tests[x].ct[y]);
+            printf("\n");
+         }
+         if (XMEMCMP(tmp[1], tests[x].pt, 16)) {
+            printf("Plaintext:  ");
+            for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]);
+            printf("\nExpected :  ");
+            for (y = 0; y < 16; y++) printf("%02x ", tests[x].pt[y]);
+            printf("\n");
+         }
+#endif
+         return CRYPT_FAIL_TESTVECTOR;
+      }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 16; y++) tmp[0][y] = 0;
+      for (y = 0; y < 1000; y++) rc6_ecb_encrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 1000; y++) rc6_ecb_decrypt(tmp[0], tmp[0], &key);
+      for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+   }
+   return CRYPT_OK;
+  #endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void rc6_done(symmetric_key *skey)
+{
+}
+
+/**
+  Gets suitable key size
+  @param keysize [in/out] The length of the recommended key (in bytes).  This function will store the suitable size back in this variable.
+  @return CRYPT_OK if the input key size is acceptable.
+*/
+int rc6_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize < 8) {
+      return CRYPT_INVALID_KEYSIZE;
+   } else if (*keysize > 128) {
+      *keysize = 128;
+   }
+   return CRYPT_OK;
+}
+
+#endif /*RC6*/
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc6.c,v $ */
+/* $Revision: 1.12 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/safer/safer.c

@@ -0,0 +1,491 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+
+/*******************************************************************************
+*
+* FILE:           safer.c
+*
+* DESCRIPTION:    block-cipher algorithm SAFER (Secure And Fast Encryption
+*                 Routine) in its four versions: SAFER K-64, SAFER K-128,
+*                 SAFER SK-64 and SAFER SK-128.
+*
+* AUTHOR:         Richard De Moliner (demoliner@isi.ee.ethz.ch)
+*                 Signal and Information Processing Laboratory
+*                 Swiss Federal Institute of Technology
+*                 CH-8092 Zuerich, Switzerland
+*
+* DATE:           September 9, 1995
+*
+* CHANGE HISTORY:
+*
+*******************************************************************************/
+
+#include <tomcrypt.h>
+
+#ifdef SAFER
+
+const struct ltc_cipher_descriptor 
+   safer_k64_desc = {
+   "safer-k64", 
+   8, 8, 8, 8, SAFER_K64_DEFAULT_NOF_ROUNDS,
+   &safer_k64_setup,
+   &safer_ecb_encrypt,
+   &safer_ecb_decrypt,
+   &safer_k64_test,
+   &safer_done,
+   &safer_64_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+   },
+
+   safer_sk64_desc = {
+   "safer-sk64",
+   9, 8, 8, 8, SAFER_SK64_DEFAULT_NOF_ROUNDS,
+   &safer_sk64_setup,
+   &safer_ecb_encrypt,
+   &safer_ecb_decrypt,
+   &safer_sk64_test,
+   &safer_done,
+   &safer_64_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+   },
+
+   safer_k128_desc = {
+   "safer-k128",
+   10, 16, 16, 8, SAFER_K128_DEFAULT_NOF_ROUNDS,
+   &safer_k128_setup,
+   &safer_ecb_encrypt,
+   &safer_ecb_decrypt,
+   &safer_sk128_test,
+   &safer_done,
+   &safer_128_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+   },
+
+   safer_sk128_desc = {
+   "safer-sk128",
+   11, 16, 16, 8, SAFER_SK128_DEFAULT_NOF_ROUNDS,
+   &safer_sk128_setup,
+   &safer_ecb_encrypt,
+   &safer_ecb_decrypt,
+   &safer_sk128_test,
+   &safer_done,
+   &safer_128_keysize,
+   NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+   };
+
+/******************* Constants ************************************************/
+/* #define TAB_LEN      256  */
+
+/******************* Assertions ***********************************************/
+
+/******************* Macros ***************************************************/
+#define ROL8(x, n)   ((unsigned char)((unsigned int)(x) << (n)\
+                                     |(unsigned int)((x) & 0xFF) >> (8 - (n))))
+#define EXP(x)       safer_ebox[(x) & 0xFF]
+#define LOG(x)       safer_lbox[(x) & 0xFF]
+#define PHT(x, y)    { y += x; x += y; }
+#define IPHT(x, y)   { x -= y; y -= x; }
+
+/******************* Types ****************************************************/
+extern const unsigned char safer_ebox[], safer_lbox[];
+
+#ifdef LTC_CLEAN_STACK
+static void _Safer_Expand_Userkey(const unsigned char *userkey_1,
+                                 const unsigned char *userkey_2,
+                                 unsigned int nof_rounds,
+                                 int strengthened,
+                                 safer_key_t key)
+#else
+static void Safer_Expand_Userkey(const unsigned char *userkey_1,
+                                 const unsigned char *userkey_2,
+                                 unsigned int nof_rounds,
+                                 int strengthened,
+                                 safer_key_t key)
+#endif
+{   unsigned int i, j, k;
+    unsigned char ka[SAFER_BLOCK_LEN + 1];
+    unsigned char kb[SAFER_BLOCK_LEN + 1];
+
+    if (SAFER_MAX_NOF_ROUNDS < nof_rounds)
+        nof_rounds = SAFER_MAX_NOF_ROUNDS;
+    *key++ = (unsigned char)nof_rounds;
+    ka[SAFER_BLOCK_LEN] = (unsigned char)0;
+    kb[SAFER_BLOCK_LEN] = (unsigned char)0;
+    k = 0;
+    for (j = 0; j < SAFER_BLOCK_LEN; j++) {
+        ka[j] = ROL8(userkey_1[j], 5);
+        ka[SAFER_BLOCK_LEN] ^= ka[j];
+        kb[j] = *key++ = userkey_2[j];
+        kb[SAFER_BLOCK_LEN] ^= kb[j];
+    }
+    for (i = 1; i <= nof_rounds; i++) {
+        for (j = 0; j < SAFER_BLOCK_LEN + 1; j++) {
+            ka[j] = ROL8(ka[j], 6);
+            kb[j] = ROL8(kb[j], 6);
+        }
+        if (strengthened) {
+           k = 2 * i - 1;
+           while (k >= (SAFER_BLOCK_LEN + 1)) { k -= SAFER_BLOCK_LEN + 1; }
+        }
+        for (j = 0; j < SAFER_BLOCK_LEN; j++) {
+            if (strengthened) {
+                *key++ = (ka[k]
+                                + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 1)&0xFF)]]) & 0xFF;
+                if (++k == (SAFER_BLOCK_LEN + 1)) { k = 0; }
+            } else {
+                *key++ = (ka[j] + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 1)&0xFF)]]) & 0xFF;
+            }
+        }
+        if (strengthened) {
+           k = 2 * i;
+           while (k >= (SAFER_BLOCK_LEN + 1)) { k -= SAFER_BLOCK_LEN + 1; }
+        }
+        for (j = 0; j < SAFER_BLOCK_LEN; j++) {
+            if (strengthened) {
+                *key++ = (kb[k]
+                                + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 10)&0xFF)]]) & 0xFF;
+                if (++k == (SAFER_BLOCK_LEN + 1)) { k = 0; }
+            } else {
+                *key++ = (kb[j] + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 10)&0xFF)]]) & 0xFF;
+            }
+        }
+    }
+    
+#ifdef LTC_CLEAN_STACK
+    zeromem(ka, sizeof(ka));
+    zeromem(kb, sizeof(kb));
+#endif
+}
+
+#ifdef LTC_CLEAN_STACK
+static void Safer_Expand_Userkey(const unsigned char *userkey_1,
+                                 const unsigned char *userkey_2,
+                                 unsigned int nof_rounds,
+                                 int strengthened,
+                                 safer_key_t key)
+{
+   _Safer_Expand_Userkey(userkey_1, userkey_2, nof_rounds, strengthened, key);
+   burn_stack(sizeof(unsigned char) * (2 * (SAFER_BLOCK_LEN + 1)) + sizeof(unsigned int)*2);
+}
+#endif
+
+int safer_k64_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey)
+{
+   LTC_ARGCHK(key != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+
+   if (keylen != 8) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+
+   Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:SAFER_K64_DEFAULT_NOF_ROUNDS), 0, skey->safer.key);
+   return CRYPT_OK;
+}
+   
+int safer_sk64_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey)
+{
+   LTC_ARGCHK(key != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+
+   if (keylen != 8) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+
+   Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:SAFER_SK64_DEFAULT_NOF_ROUNDS), 1, skey->safer.key);
+   return CRYPT_OK;
+}
+
+int safer_k128_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey)
+{
+   LTC_ARGCHK(key != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+
+   if (keylen != 16) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+
+   Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0 ?numrounds:SAFER_K128_DEFAULT_NOF_ROUNDS), 0, skey->safer.key);
+   return CRYPT_OK;
+}
+
+int safer_sk128_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey)
+{
+   LTC_ARGCHK(key != NULL);
+   LTC_ARGCHK(skey != NULL);
+
+   if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+      return CRYPT_INVALID_ROUNDS;
+   }
+
+   if (keylen != 16) {
+      return CRYPT_INVALID_KEYSIZE;
+   }
+
+   Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0?numrounds:SAFER_SK128_DEFAULT_NOF_ROUNDS), 1, skey->safer.key);
+   return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int _safer_ecb_encrypt(const unsigned char *block_in,
+                             unsigned char *block_out,
+                             symmetric_key *skey)
+#else
+int safer_ecb_encrypt(const unsigned char *block_in,
+                             unsigned char *block_out,
+                             symmetric_key *skey)
+#endif
+{   unsigned char a, b, c, d, e, f, g, h, t;
+    unsigned int round;
+    unsigned char *key;
+
+    LTC_ARGCHK(block_in != NULL);
+    LTC_ARGCHK(block_out != NULL);
+    LTC_ARGCHK(skey != NULL);
+
+    key = skey->safer.key;
+    a = block_in[0]; b = block_in[1]; c = block_in[2]; d = block_in[3];
+    e = block_in[4]; f = block_in[5]; g = block_in[6]; h = block_in[7];
+    if (SAFER_MAX_NOF_ROUNDS < (round = *key)) round = SAFER_MAX_NOF_ROUNDS;
+    while(round-- > 0)
+    {
+        a ^= *++key; b += *++key; c += *++key; d ^= *++key;
+        e ^= *++key; f += *++key; g += *++key; h ^= *++key;
+        a = EXP(a) + *++key; b = LOG(b) ^ *++key;
+        c = LOG(c) ^ *++key; d = EXP(d) + *++key;
+        e = EXP(e) + *++key; f = LOG(f) ^ *++key;
+        g = LOG(g) ^ *++key; h = EXP(h) + *++key;
+        PHT(a, b); PHT(c, d); PHT(e, f); PHT(g, h);
+        PHT(a, c); PHT(e, g); PHT(b, d); PHT(f, h);
+        PHT(a, e); PHT(b, f); PHT(c, g); PHT(d, h);
+        t = b; b = e; e = c; c = t; t = d; d = f; f = g; g = t;
+    }
+    a ^= *++key; b += *++key; c += *++key; d ^= *++key;
+    e ^= *++key; f += *++key; g += *++key; h ^= *++key;
+    block_out[0] = a & 0xFF; block_out[1] = b & 0xFF;
+    block_out[2] = c & 0xFF; block_out[3] = d & 0xFF;
+    block_out[4] = e & 0xFF; block_out[5] = f & 0xFF;
+    block_out[6] = g & 0xFF; block_out[7] = h & 0xFF;
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int safer_ecb_encrypt(const unsigned char *block_in,
+                             unsigned char *block_out,
+                             symmetric_key *skey)
+{
+    int err = _safer_ecb_encrypt(block_in, block_out, skey);
+    burn_stack(sizeof(unsigned char) * 9 + sizeof(unsigned int) + sizeof(unsigned char *));
+    return err;
+}
+#endif
+
+#ifdef LTC_CLEAN_STACK
+static int _safer_ecb_decrypt(const unsigned char *block_in,
+                             unsigned char *block_out,
+                             symmetric_key *skey)
+#else
+int safer_ecb_decrypt(const unsigned char *block_in,
+                             unsigned char *block_out,
+                             symmetric_key *skey)
+#endif
+{   unsigned char a, b, c, d, e, f, g, h, t;
+    unsigned int round;
+    unsigned char *key;
+
+    LTC_ARGCHK(block_in != NULL);
+    LTC_ARGCHK(block_out != NULL);
+    LTC_ARGCHK(skey != NULL);
+
+    key = skey->safer.key;
+    a = block_in[0]; b = block_in[1]; c = block_in[2]; d = block_in[3];
+    e = block_in[4]; f = block_in[5]; g = block_in[6]; h = block_in[7];
+    if (SAFER_MAX_NOF_ROUNDS < (round = *key)) round = SAFER_MAX_NOF_ROUNDS;
+    key += SAFER_BLOCK_LEN * (1 + 2 * round);
+    h ^= *key; g -= *--key; f -= *--key; e ^= *--key;
+    d ^= *--key; c -= *--key; b -= *--key; a ^= *--key;
+    while (round--)
+    {
+        t = e; e = b; b = c; c = t; t = f; f = d; d = g; g = t;
+        IPHT(a, e); IPHT(b, f); IPHT(c, g); IPHT(d, h);
+        IPHT(a, c); IPHT(e, g); IPHT(b, d); IPHT(f, h);
+        IPHT(a, b); IPHT(c, d); IPHT(e, f); IPHT(g, h);
+        h -= *--key; g ^= *--key; f ^= *--key; e -= *--key;
+        d -= *--key; c ^= *--key; b ^= *--key; a -= *--key;
+        h = LOG(h) ^ *--key; g = EXP(g) - *--key;
+        f = EXP(f) - *--key; e = LOG(e) ^ *--key;
+        d = LOG(d) ^ *--key; c = EXP(c) - *--key;
+        b = EXP(b) - *--key; a = LOG(a) ^ *--key;
+    }
+    block_out[0] = a & 0xFF; block_out[1] = b & 0xFF;
+    block_out[2] = c & 0xFF; block_out[3] = d & 0xFF;
+    block_out[4] = e & 0xFF; block_out[5] = f & 0xFF;
+    block_out[6] = g & 0xFF; block_out[7] = h & 0xFF;
+    return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+int safer_ecb_decrypt(const unsigned char *block_in,
+                             unsigned char *block_out,
+                             symmetric_key *skey)
+{
+    int err = _safer_ecb_decrypt(block_in, block_out, skey);
+    burn_stack(sizeof(unsigned char) * 9 + sizeof(unsigned int) + sizeof(unsigned char *));
+    return err;
+}
+#endif
+
+int safer_64_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize < 8) {
+      return CRYPT_INVALID_KEYSIZE;
+   } else {
+      *keysize = 8;
+      return CRYPT_OK;
+   }
+}
+
+int safer_128_keysize(int *keysize)
+{
+   LTC_ARGCHK(keysize != NULL);
+   if (*keysize < 16) {
+      return CRYPT_INVALID_KEYSIZE;
+   } else {
+      *keysize = 16;
+      return CRYPT_OK;
+   }
+}
+
+int safer_k64_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   static const unsigned char k64_pt[]  = { 1, 2, 3, 4, 5, 6, 7, 8 },
+                              k64_key[] = { 8, 7, 6, 5, 4, 3, 2, 1 },
+                              k64_ct[]  = { 200, 242, 156, 221, 135, 120, 62, 217 };
+
+   symmetric_key skey;
+   unsigned char buf[2][8];
+   int err;
+
+   /* test K64 */
+   if ((err = safer_k64_setup(k64_key, 8, 6, &skey)) != CRYPT_OK) {
+      return err;
+   }
+   safer_ecb_encrypt(k64_pt, buf[0], &skey);
+   safer_ecb_decrypt(buf[0], buf[1], &skey);
+
+   if (XMEMCMP(buf[0], k64_ct, 8) != 0 || XMEMCMP(buf[1], k64_pt, 8) != 0) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+   return CRYPT_OK;
+ #endif
+}
+
+
+int safer_sk64_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   static const unsigned char sk64_pt[]  = { 1, 2, 3, 4, 5, 6, 7, 8 },
+                              sk64_key[] = { 1, 2, 3, 4, 5, 6, 7, 8 },
+                              sk64_ct[]  = { 95, 206, 155, 162, 5, 132, 56, 199 };
+
+   symmetric_key skey;
+   unsigned char buf[2][8];
+   int err, y;
+
+   /* test SK64 */
+   if ((err = safer_sk64_setup(sk64_key, 8, 6, &skey)) != CRYPT_OK) {
+      return err;
+   }
+
+   safer_ecb_encrypt(sk64_pt, buf[0], &skey);
+   safer_ecb_decrypt(buf[0], buf[1], &skey);
+
+   if (XMEMCMP(buf[0], sk64_ct, 8) != 0 || XMEMCMP(buf[1], sk64_pt, 8) != 0) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 8; y++) buf[0][y] = 0;
+      for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey);
+      for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey);
+      for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+
+   return CRYPT_OK;
+  #endif
+}
+
+/** Terminate the context 
+   @param skey    The scheduled key
+*/
+void safer_done(symmetric_key *skey)
+{
+}
+
+int safer_sk128_test(void)
+{
+ #ifndef LTC_TEST
+    return CRYPT_NOP;
+ #else    
+   static const unsigned char sk128_pt[]  = { 1, 2, 3, 4, 5, 6, 7, 8 },
+                              sk128_key[] = { 1, 2, 3, 4, 5, 6, 7, 8,
+                                              0, 0, 0, 0, 0, 0, 0, 0 },
+                              sk128_ct[]  = { 255, 120, 17, 228, 179, 167, 46, 113 };
+
+   symmetric_key skey;
+   unsigned char buf[2][8];
+   int err, y;
+
+   /* test SK128 */
+   if ((err = safer_sk128_setup(sk128_key, 16, 0, &skey)) != CRYPT_OK) {
+      return err;
+   }
+   safer_ecb_encrypt(sk128_pt, buf[0], &skey);
+   safer_ecb_decrypt(buf[0], buf[1], &skey);
+
+   if (XMEMCMP(buf[0], sk128_ct, 8) != 0 || XMEMCMP(buf[1], sk128_pt, 8) != 0) {
+      return CRYPT_FAIL_TESTVECTOR;
+   }
+
+      /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
+      for (y = 0; y < 8; y++) buf[0][y] = 0;
+      for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey);
+      for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey);
+      for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
+  return CRYPT_OK;
+ #endif
+}
+
+#endif
+
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/safer.c,v $ */
+/* $Revision: 1.13 $ */
+/* $Date: 2006/11/08 23:01:06 $ */

libtomcrypt/src/ciphers/safer/safer_tab.c

@@ -0,0 +1,68 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ */
+
+/**
+  @file safer_tab.c
+  Tables for SAFER block ciphers
+*/ 
+ 
+#include "tomcrypt.h"
+
+#if defined(SAFERP) || defined(SAFER)
+
+/* This is the box defined by ebox[x] = 45^x mod 257.  
+ * Its assumed that the value "256" corresponds to zero. */
+const unsigned char safer_ebox[256] = {
+  1,  45, 226, 147, 190,  69,  21, 174, 120,   3, 135, 164, 184,  56, 207,  63, 
+  8, 103,   9, 148, 235,  38, 168, 107, 189,  24,  52,  27, 187, 191, 114, 247, 
+ 64,  53,  72, 156,  81,  47,  59,  85, 227, 192, 159, 216, 211, 243, 141, 177, 
+255, 167,  62, 220, 134, 119, 215, 166,  17, 251, 244, 186, 146, 145, 100, 131, 
+241,  51, 239, 218,  44, 181, 178,  43, 136, 209, 153, 203, 140, 132,  29,  20, 
+129, 151, 113, 202,  95, 163, 139,  87,  60, 130, 196,  82,  92,  28, 232, 160, 
+  4, 180, 133,  74, 246,  19,  84, 182, 223,  12,  26, 142, 222, 224,  57, 252, 
+ 32, 155,  36,  78, 169, 152, 158, 171, 242,  96, 208, 108, 234, 250, 199, 217, 
+  0, 212,  31, 110,  67, 188, 236,  83, 137, 254, 122,  93,  73, 201,  50, 194, 
+249, 154, 248, 109,  22, 219,  89, 150,  68, 233, 205, 230,  70,  66, 143,  10, 
+193, 204, 185, 101, 176, 210, 198, 172,  30,  65,  98,  41,  46,  14, 116,  80, 
+  2,  90, 195,  37, 123, 138,  42,  91, 240,   6,  13,  71, 111, 112, 157, 126, 
+ 16, 206,  18,  39, 213,  76,  79, 214, 121,  48, 104,  54, 117, 125, 228, 237, 
+128, 106, 144,  55, 162,  94, 118, 170, 197, 127,  61, 175, 165, 229,  25,  97, 
+253,  77, 124, 183,  11, 238, 173,  75,  34, 245, 231, 115,  35,  33, 200,   5, 
+225, 102, 221, 179,  88, 105,  99,  86,  15, 161,  49, 149,  23,   7,  58,  40
+};
+
+/* This is the inverse of ebox or the base 45 logarithm */
+const unsigned char safer_lbox[256] = {
+128,   0, 176,   9,  96, 239, 185, 253,  16,  18, 159, 228, 105, 186, 173, 248,
+192,  56, 194, 101,  79,   6, 148, 252,  25, 222, 106,  27,  93,  78, 168, 130,
+112, 237, 232, 236, 114, 179,  21, 195, 255, 171, 182,  71,  68,   1, 172,  37, 
+201, 250, 142,  65,  26,  33, 203, 211,  13, 110, 254,  38,  88, 218,  50,  15, 
+ 32, 169, 157, 132, 152,   5, 156, 187,  34, 140,  99, 231, 197, 225, 115, 198, 
+175,  36,  91, 135, 102,  39, 247,  87, 244, 150, 177, 183,  92, 139, 213,  84, 
+121, 223, 170, 246,  62, 163, 241,  17, 202, 245, 209,  23, 123, 147, 131, 188, 
+189,  82,  30, 235, 174, 204, 214,  53,   8, 200, 138, 180, 226, 205, 191, 217,
+208,  80,  89,  63,  77,  98,  52,  10,  72, 136, 181,  86,  76,  46, 107, 158, 
+210,  61,  60,   3,  19, 251, 151,  81, 117,  74, 145, 113,  35, 190, 118,  42, 
+ 95, 249, 212,  85,  11, 220,  55,  49,  22, 116, 215, 119, 167, 230,   7, 219,
+164,  47,  70, 243,  97,  69, 103, 227,  12, 162,  59,  28, 133,  24,   4,  29, 
+ 41, 160, 143, 178,  90, 216, 166, 126, 238, 141,  83,  75, 161, 154, 193,  14, 
+122,  73, 165,  44, 129, 196, 199,  54,  43, 127,  67, 149,  51, 242, 108, 104, 
+109, 240,   2,  40, 206, 221, 155, 234,  94, 153, 124,  20, 134, 207, 229,  66, 
+184,  64, 120,  45,  58, 233, 100,  31, 146, 144, 125,  57, 111, 224, 137,  48
+};
+
+#endif
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/safer_tab.c,v $ */
+/* $Revision: 1.4 $ */
+/* $Date: 2006/03/31 14:15:35 $ */