mirror of
https://github.com/clearml/dropbear
synced 2025-06-26 18:17:32 +00:00
Update to libtomcrypt 1.18.1, merged with Dropbear changes
This commit is contained in:
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/* AES implementation by Tom St Denis
|
||||
@@ -50,7 +48,7 @@ const struct ltc_cipher_descriptor rijndael_desc =
|
||||
6,
|
||||
16, 32, 16, 10,
|
||||
SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
#endif
|
||||
|
||||
@@ -60,7 +58,7 @@ const struct ltc_cipher_descriptor aes_desc =
|
||||
6,
|
||||
16, 32, 16, 10,
|
||||
SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
#else
|
||||
@@ -76,7 +74,7 @@ const struct ltc_cipher_descriptor rijndael_enc_desc =
|
||||
6,
|
||||
16, 32, 16, 10,
|
||||
SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
const struct ltc_cipher_descriptor aes_enc_desc =
|
||||
@@ -85,11 +83,12 @@ const struct ltc_cipher_descriptor aes_enc_desc =
|
||||
6,
|
||||
16, 32, 16, 10,
|
||||
SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
#endif
|
||||
|
||||
#define __LTC_AES_TAB_C__
|
||||
#include "aes_tab.c"
|
||||
|
||||
static ulong32 setup_mix(ulong32 temp)
|
||||
@@ -149,9 +148,6 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s
|
||||
LOAD32H(rk[2], key + 8);
|
||||
LOAD32H(rk[3], key + 12);
|
||||
if (keylen == 16) {
|
||||
#ifndef ENCRYPT_ONLY
|
||||
j = 44;
|
||||
#endif
|
||||
for (;;) {
|
||||
temp = rk[3];
|
||||
rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i];
|
||||
@@ -164,9 +160,6 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s
|
||||
rk += 4;
|
||||
}
|
||||
} else if (keylen == 24) {
|
||||
#ifndef ENCRYPT_ONLY
|
||||
j = 52;
|
||||
#endif
|
||||
LOAD32H(rk[4], key + 16);
|
||||
LOAD32H(rk[5], key + 20);
|
||||
for (;;) {
|
||||
@@ -187,9 +180,6 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s
|
||||
rk += 6;
|
||||
}
|
||||
} else if (keylen == 32) {
|
||||
#ifndef ENCRYPT_ONLY
|
||||
j = 60;
|
||||
#endif
|
||||
LOAD32H(rk[4], key + 16);
|
||||
LOAD32H(rk[5], key + 20);
|
||||
LOAD32H(rk[6], key + 24);
|
||||
@@ -216,13 +206,14 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s
|
||||
}
|
||||
} else {
|
||||
/* this can't happen */
|
||||
/* coverity[dead_error_line] */
|
||||
return CRYPT_ERROR;
|
||||
}
|
||||
|
||||
#ifndef ENCRYPT_ONLY
|
||||
/* setup the inverse key now */
|
||||
rk = skey->rijndael.dK;
|
||||
rrk = skey->rijndael.eK + j - 4;
|
||||
rrk = skey->rijndael.eK + (28 + keylen) - 4;
|
||||
|
||||
/* apply the inverse MixColumn transform to all round keys but the first and the last: */
|
||||
/* copy first */
|
||||
@@ -697,23 +688,8 @@ int ECB_TEST(void)
|
||||
|
||||
rijndael_ecb_encrypt(tests[i].pt, tmp[0], &key);
|
||||
rijndael_ecb_decrypt(tmp[0], tmp[1], &key);
|
||||
if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) {
|
||||
#if 0
|
||||
printf("\n\nTest %d failed\n", i);
|
||||
if (XMEMCMP(tmp[0], tests[i].ct, 16)) {
|
||||
printf("CT: ");
|
||||
for (i = 0; i < 16; i++) {
|
||||
printf("%02x ", tmp[0][i]);
|
||||
}
|
||||
printf("\n");
|
||||
} else {
|
||||
printf("PT: ");
|
||||
for (i = 0; i < 16; i++) {
|
||||
printf("%02x ", tmp[1][i]);
|
||||
}
|
||||
printf("\n");
|
||||
}
|
||||
#endif
|
||||
if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "AES Encrypt", i) ||
|
||||
compare_testvector(tmp[1], 16, tests[i].pt, 16, "AES Decrypt", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -735,7 +711,7 @@ int ECB_TEST(void)
|
||||
*/
|
||||
void ECB_DONE(symmetric_key *skey)
|
||||
{
|
||||
(void)skey;
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
|
||||
@@ -765,6 +741,6 @@ int ECB_KS(int *keysize)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
/* The precomputed tables for AES */
|
||||
/*
|
||||
@@ -23,10 +21,12 @@ Td3[x] = Si[x].[09, 0d, 0b, 0e];
|
||||
Td4[x] = Si[x].[01, 01, 01, 01];
|
||||
*/
|
||||
|
||||
#ifdef __LTC_AES_TAB_C__
|
||||
|
||||
/**
|
||||
@file aes_tab.c
|
||||
AES tables
|
||||
*/
|
||||
*/
|
||||
static const ulong32 TE0[256] = {
|
||||
0xc66363a5UL, 0xf87c7c84UL, 0xee777799UL, 0xf67b7b8dUL,
|
||||
0xfff2f20dUL, 0xd66b6bbdUL, 0xde6f6fb1UL, 0x91c5c554UL,
|
||||
@@ -532,142 +532,142 @@ static const ulong32 TE3[256] = {
|
||||
|
||||
#ifndef PELI_TAB
|
||||
static const ulong32 Te4_0[] = {
|
||||
0x00000063UL, 0x0000007cUL, 0x00000077UL, 0x0000007bUL, 0x000000f2UL, 0x0000006bUL, 0x0000006fUL, 0x000000c5UL,
|
||||
0x00000030UL, 0x00000001UL, 0x00000067UL, 0x0000002bUL, 0x000000feUL, 0x000000d7UL, 0x000000abUL, 0x00000076UL,
|
||||
0x000000caUL, 0x00000082UL, 0x000000c9UL, 0x0000007dUL, 0x000000faUL, 0x00000059UL, 0x00000047UL, 0x000000f0UL,
|
||||
0x000000adUL, 0x000000d4UL, 0x000000a2UL, 0x000000afUL, 0x0000009cUL, 0x000000a4UL, 0x00000072UL, 0x000000c0UL,
|
||||
0x000000b7UL, 0x000000fdUL, 0x00000093UL, 0x00000026UL, 0x00000036UL, 0x0000003fUL, 0x000000f7UL, 0x000000ccUL,
|
||||
0x00000034UL, 0x000000a5UL, 0x000000e5UL, 0x000000f1UL, 0x00000071UL, 0x000000d8UL, 0x00000031UL, 0x00000015UL,
|
||||
0x00000004UL, 0x000000c7UL, 0x00000023UL, 0x000000c3UL, 0x00000018UL, 0x00000096UL, 0x00000005UL, 0x0000009aUL,
|
||||
0x00000007UL, 0x00000012UL, 0x00000080UL, 0x000000e2UL, 0x000000ebUL, 0x00000027UL, 0x000000b2UL, 0x00000075UL,
|
||||
0x00000009UL, 0x00000083UL, 0x0000002cUL, 0x0000001aUL, 0x0000001bUL, 0x0000006eUL, 0x0000005aUL, 0x000000a0UL,
|
||||
0x00000052UL, 0x0000003bUL, 0x000000d6UL, 0x000000b3UL, 0x00000029UL, 0x000000e3UL, 0x0000002fUL, 0x00000084UL,
|
||||
0x00000053UL, 0x000000d1UL, 0x00000000UL, 0x000000edUL, 0x00000020UL, 0x000000fcUL, 0x000000b1UL, 0x0000005bUL,
|
||||
0x0000006aUL, 0x000000cbUL, 0x000000beUL, 0x00000039UL, 0x0000004aUL, 0x0000004cUL, 0x00000058UL, 0x000000cfUL,
|
||||
0x000000d0UL, 0x000000efUL, 0x000000aaUL, 0x000000fbUL, 0x00000043UL, 0x0000004dUL, 0x00000033UL, 0x00000085UL,
|
||||
0x00000045UL, 0x000000f9UL, 0x00000002UL, 0x0000007fUL, 0x00000050UL, 0x0000003cUL, 0x0000009fUL, 0x000000a8UL,
|
||||
0x00000051UL, 0x000000a3UL, 0x00000040UL, 0x0000008fUL, 0x00000092UL, 0x0000009dUL, 0x00000038UL, 0x000000f5UL,
|
||||
0x000000bcUL, 0x000000b6UL, 0x000000daUL, 0x00000021UL, 0x00000010UL, 0x000000ffUL, 0x000000f3UL, 0x000000d2UL,
|
||||
0x000000cdUL, 0x0000000cUL, 0x00000013UL, 0x000000ecUL, 0x0000005fUL, 0x00000097UL, 0x00000044UL, 0x00000017UL,
|
||||
0x000000c4UL, 0x000000a7UL, 0x0000007eUL, 0x0000003dUL, 0x00000064UL, 0x0000005dUL, 0x00000019UL, 0x00000073UL,
|
||||
0x00000060UL, 0x00000081UL, 0x0000004fUL, 0x000000dcUL, 0x00000022UL, 0x0000002aUL, 0x00000090UL, 0x00000088UL,
|
||||
0x00000046UL, 0x000000eeUL, 0x000000b8UL, 0x00000014UL, 0x000000deUL, 0x0000005eUL, 0x0000000bUL, 0x000000dbUL,
|
||||
0x000000e0UL, 0x00000032UL, 0x0000003aUL, 0x0000000aUL, 0x00000049UL, 0x00000006UL, 0x00000024UL, 0x0000005cUL,
|
||||
0x000000c2UL, 0x000000d3UL, 0x000000acUL, 0x00000062UL, 0x00000091UL, 0x00000095UL, 0x000000e4UL, 0x00000079UL,
|
||||
0x000000e7UL, 0x000000c8UL, 0x00000037UL, 0x0000006dUL, 0x0000008dUL, 0x000000d5UL, 0x0000004eUL, 0x000000a9UL,
|
||||
0x0000006cUL, 0x00000056UL, 0x000000f4UL, 0x000000eaUL, 0x00000065UL, 0x0000007aUL, 0x000000aeUL, 0x00000008UL,
|
||||
0x000000baUL, 0x00000078UL, 0x00000025UL, 0x0000002eUL, 0x0000001cUL, 0x000000a6UL, 0x000000b4UL, 0x000000c6UL,
|
||||
0x000000e8UL, 0x000000ddUL, 0x00000074UL, 0x0000001fUL, 0x0000004bUL, 0x000000bdUL, 0x0000008bUL, 0x0000008aUL,
|
||||
0x00000070UL, 0x0000003eUL, 0x000000b5UL, 0x00000066UL, 0x00000048UL, 0x00000003UL, 0x000000f6UL, 0x0000000eUL,
|
||||
0x00000061UL, 0x00000035UL, 0x00000057UL, 0x000000b9UL, 0x00000086UL, 0x000000c1UL, 0x0000001dUL, 0x0000009eUL,
|
||||
0x000000e1UL, 0x000000f8UL, 0x00000098UL, 0x00000011UL, 0x00000069UL, 0x000000d9UL, 0x0000008eUL, 0x00000094UL,
|
||||
0x0000009bUL, 0x0000001eUL, 0x00000087UL, 0x000000e9UL, 0x000000ceUL, 0x00000055UL, 0x00000028UL, 0x000000dfUL,
|
||||
0x0000008cUL, 0x000000a1UL, 0x00000089UL, 0x0000000dUL, 0x000000bfUL, 0x000000e6UL, 0x00000042UL, 0x00000068UL,
|
||||
0x00000063UL, 0x0000007cUL, 0x00000077UL, 0x0000007bUL, 0x000000f2UL, 0x0000006bUL, 0x0000006fUL, 0x000000c5UL,
|
||||
0x00000030UL, 0x00000001UL, 0x00000067UL, 0x0000002bUL, 0x000000feUL, 0x000000d7UL, 0x000000abUL, 0x00000076UL,
|
||||
0x000000caUL, 0x00000082UL, 0x000000c9UL, 0x0000007dUL, 0x000000faUL, 0x00000059UL, 0x00000047UL, 0x000000f0UL,
|
||||
0x000000adUL, 0x000000d4UL, 0x000000a2UL, 0x000000afUL, 0x0000009cUL, 0x000000a4UL, 0x00000072UL, 0x000000c0UL,
|
||||
0x000000b7UL, 0x000000fdUL, 0x00000093UL, 0x00000026UL, 0x00000036UL, 0x0000003fUL, 0x000000f7UL, 0x000000ccUL,
|
||||
0x00000034UL, 0x000000a5UL, 0x000000e5UL, 0x000000f1UL, 0x00000071UL, 0x000000d8UL, 0x00000031UL, 0x00000015UL,
|
||||
0x00000004UL, 0x000000c7UL, 0x00000023UL, 0x000000c3UL, 0x00000018UL, 0x00000096UL, 0x00000005UL, 0x0000009aUL,
|
||||
0x00000007UL, 0x00000012UL, 0x00000080UL, 0x000000e2UL, 0x000000ebUL, 0x00000027UL, 0x000000b2UL, 0x00000075UL,
|
||||
0x00000009UL, 0x00000083UL, 0x0000002cUL, 0x0000001aUL, 0x0000001bUL, 0x0000006eUL, 0x0000005aUL, 0x000000a0UL,
|
||||
0x00000052UL, 0x0000003bUL, 0x000000d6UL, 0x000000b3UL, 0x00000029UL, 0x000000e3UL, 0x0000002fUL, 0x00000084UL,
|
||||
0x00000053UL, 0x000000d1UL, 0x00000000UL, 0x000000edUL, 0x00000020UL, 0x000000fcUL, 0x000000b1UL, 0x0000005bUL,
|
||||
0x0000006aUL, 0x000000cbUL, 0x000000beUL, 0x00000039UL, 0x0000004aUL, 0x0000004cUL, 0x00000058UL, 0x000000cfUL,
|
||||
0x000000d0UL, 0x000000efUL, 0x000000aaUL, 0x000000fbUL, 0x00000043UL, 0x0000004dUL, 0x00000033UL, 0x00000085UL,
|
||||
0x00000045UL, 0x000000f9UL, 0x00000002UL, 0x0000007fUL, 0x00000050UL, 0x0000003cUL, 0x0000009fUL, 0x000000a8UL,
|
||||
0x00000051UL, 0x000000a3UL, 0x00000040UL, 0x0000008fUL, 0x00000092UL, 0x0000009dUL, 0x00000038UL, 0x000000f5UL,
|
||||
0x000000bcUL, 0x000000b6UL, 0x000000daUL, 0x00000021UL, 0x00000010UL, 0x000000ffUL, 0x000000f3UL, 0x000000d2UL,
|
||||
0x000000cdUL, 0x0000000cUL, 0x00000013UL, 0x000000ecUL, 0x0000005fUL, 0x00000097UL, 0x00000044UL, 0x00000017UL,
|
||||
0x000000c4UL, 0x000000a7UL, 0x0000007eUL, 0x0000003dUL, 0x00000064UL, 0x0000005dUL, 0x00000019UL, 0x00000073UL,
|
||||
0x00000060UL, 0x00000081UL, 0x0000004fUL, 0x000000dcUL, 0x00000022UL, 0x0000002aUL, 0x00000090UL, 0x00000088UL,
|
||||
0x00000046UL, 0x000000eeUL, 0x000000b8UL, 0x00000014UL, 0x000000deUL, 0x0000005eUL, 0x0000000bUL, 0x000000dbUL,
|
||||
0x000000e0UL, 0x00000032UL, 0x0000003aUL, 0x0000000aUL, 0x00000049UL, 0x00000006UL, 0x00000024UL, 0x0000005cUL,
|
||||
0x000000c2UL, 0x000000d3UL, 0x000000acUL, 0x00000062UL, 0x00000091UL, 0x00000095UL, 0x000000e4UL, 0x00000079UL,
|
||||
0x000000e7UL, 0x000000c8UL, 0x00000037UL, 0x0000006dUL, 0x0000008dUL, 0x000000d5UL, 0x0000004eUL, 0x000000a9UL,
|
||||
0x0000006cUL, 0x00000056UL, 0x000000f4UL, 0x000000eaUL, 0x00000065UL, 0x0000007aUL, 0x000000aeUL, 0x00000008UL,
|
||||
0x000000baUL, 0x00000078UL, 0x00000025UL, 0x0000002eUL, 0x0000001cUL, 0x000000a6UL, 0x000000b4UL, 0x000000c6UL,
|
||||
0x000000e8UL, 0x000000ddUL, 0x00000074UL, 0x0000001fUL, 0x0000004bUL, 0x000000bdUL, 0x0000008bUL, 0x0000008aUL,
|
||||
0x00000070UL, 0x0000003eUL, 0x000000b5UL, 0x00000066UL, 0x00000048UL, 0x00000003UL, 0x000000f6UL, 0x0000000eUL,
|
||||
0x00000061UL, 0x00000035UL, 0x00000057UL, 0x000000b9UL, 0x00000086UL, 0x000000c1UL, 0x0000001dUL, 0x0000009eUL,
|
||||
0x000000e1UL, 0x000000f8UL, 0x00000098UL, 0x00000011UL, 0x00000069UL, 0x000000d9UL, 0x0000008eUL, 0x00000094UL,
|
||||
0x0000009bUL, 0x0000001eUL, 0x00000087UL, 0x000000e9UL, 0x000000ceUL, 0x00000055UL, 0x00000028UL, 0x000000dfUL,
|
||||
0x0000008cUL, 0x000000a1UL, 0x00000089UL, 0x0000000dUL, 0x000000bfUL, 0x000000e6UL, 0x00000042UL, 0x00000068UL,
|
||||
0x00000041UL, 0x00000099UL, 0x0000002dUL, 0x0000000fUL, 0x000000b0UL, 0x00000054UL, 0x000000bbUL, 0x00000016UL
|
||||
};
|
||||
|
||||
static const ulong32 Te4_1[] = {
|
||||
0x00006300UL, 0x00007c00UL, 0x00007700UL, 0x00007b00UL, 0x0000f200UL, 0x00006b00UL, 0x00006f00UL, 0x0000c500UL,
|
||||
0x00003000UL, 0x00000100UL, 0x00006700UL, 0x00002b00UL, 0x0000fe00UL, 0x0000d700UL, 0x0000ab00UL, 0x00007600UL,
|
||||
0x0000ca00UL, 0x00008200UL, 0x0000c900UL, 0x00007d00UL, 0x0000fa00UL, 0x00005900UL, 0x00004700UL, 0x0000f000UL,
|
||||
0x0000ad00UL, 0x0000d400UL, 0x0000a200UL, 0x0000af00UL, 0x00009c00UL, 0x0000a400UL, 0x00007200UL, 0x0000c000UL,
|
||||
0x0000b700UL, 0x0000fd00UL, 0x00009300UL, 0x00002600UL, 0x00003600UL, 0x00003f00UL, 0x0000f700UL, 0x0000cc00UL,
|
||||
0x00003400UL, 0x0000a500UL, 0x0000e500UL, 0x0000f100UL, 0x00007100UL, 0x0000d800UL, 0x00003100UL, 0x00001500UL,
|
||||
0x00000400UL, 0x0000c700UL, 0x00002300UL, 0x0000c300UL, 0x00001800UL, 0x00009600UL, 0x00000500UL, 0x00009a00UL,
|
||||
0x00000700UL, 0x00001200UL, 0x00008000UL, 0x0000e200UL, 0x0000eb00UL, 0x00002700UL, 0x0000b200UL, 0x00007500UL,
|
||||
0x00000900UL, 0x00008300UL, 0x00002c00UL, 0x00001a00UL, 0x00001b00UL, 0x00006e00UL, 0x00005a00UL, 0x0000a000UL,
|
||||
0x00005200UL, 0x00003b00UL, 0x0000d600UL, 0x0000b300UL, 0x00002900UL, 0x0000e300UL, 0x00002f00UL, 0x00008400UL,
|
||||
0x00005300UL, 0x0000d100UL, 0x00000000UL, 0x0000ed00UL, 0x00002000UL, 0x0000fc00UL, 0x0000b100UL, 0x00005b00UL,
|
||||
0x00006a00UL, 0x0000cb00UL, 0x0000be00UL, 0x00003900UL, 0x00004a00UL, 0x00004c00UL, 0x00005800UL, 0x0000cf00UL,
|
||||
0x0000d000UL, 0x0000ef00UL, 0x0000aa00UL, 0x0000fb00UL, 0x00004300UL, 0x00004d00UL, 0x00003300UL, 0x00008500UL,
|
||||
0x00004500UL, 0x0000f900UL, 0x00000200UL, 0x00007f00UL, 0x00005000UL, 0x00003c00UL, 0x00009f00UL, 0x0000a800UL,
|
||||
0x00005100UL, 0x0000a300UL, 0x00004000UL, 0x00008f00UL, 0x00009200UL, 0x00009d00UL, 0x00003800UL, 0x0000f500UL,
|
||||
0x0000bc00UL, 0x0000b600UL, 0x0000da00UL, 0x00002100UL, 0x00001000UL, 0x0000ff00UL, 0x0000f300UL, 0x0000d200UL,
|
||||
0x0000cd00UL, 0x00000c00UL, 0x00001300UL, 0x0000ec00UL, 0x00005f00UL, 0x00009700UL, 0x00004400UL, 0x00001700UL,
|
||||
0x0000c400UL, 0x0000a700UL, 0x00007e00UL, 0x00003d00UL, 0x00006400UL, 0x00005d00UL, 0x00001900UL, 0x00007300UL,
|
||||
0x00006000UL, 0x00008100UL, 0x00004f00UL, 0x0000dc00UL, 0x00002200UL, 0x00002a00UL, 0x00009000UL, 0x00008800UL,
|
||||
0x00004600UL, 0x0000ee00UL, 0x0000b800UL, 0x00001400UL, 0x0000de00UL, 0x00005e00UL, 0x00000b00UL, 0x0000db00UL,
|
||||
0x0000e000UL, 0x00003200UL, 0x00003a00UL, 0x00000a00UL, 0x00004900UL, 0x00000600UL, 0x00002400UL, 0x00005c00UL,
|
||||
0x0000c200UL, 0x0000d300UL, 0x0000ac00UL, 0x00006200UL, 0x00009100UL, 0x00009500UL, 0x0000e400UL, 0x00007900UL,
|
||||
0x0000e700UL, 0x0000c800UL, 0x00003700UL, 0x00006d00UL, 0x00008d00UL, 0x0000d500UL, 0x00004e00UL, 0x0000a900UL,
|
||||
0x00006c00UL, 0x00005600UL, 0x0000f400UL, 0x0000ea00UL, 0x00006500UL, 0x00007a00UL, 0x0000ae00UL, 0x00000800UL,
|
||||
0x0000ba00UL, 0x00007800UL, 0x00002500UL, 0x00002e00UL, 0x00001c00UL, 0x0000a600UL, 0x0000b400UL, 0x0000c600UL,
|
||||
0x0000e800UL, 0x0000dd00UL, 0x00007400UL, 0x00001f00UL, 0x00004b00UL, 0x0000bd00UL, 0x00008b00UL, 0x00008a00UL,
|
||||
0x00007000UL, 0x00003e00UL, 0x0000b500UL, 0x00006600UL, 0x00004800UL, 0x00000300UL, 0x0000f600UL, 0x00000e00UL,
|
||||
0x00006100UL, 0x00003500UL, 0x00005700UL, 0x0000b900UL, 0x00008600UL, 0x0000c100UL, 0x00001d00UL, 0x00009e00UL,
|
||||
0x0000e100UL, 0x0000f800UL, 0x00009800UL, 0x00001100UL, 0x00006900UL, 0x0000d900UL, 0x00008e00UL, 0x00009400UL,
|
||||
0x00009b00UL, 0x00001e00UL, 0x00008700UL, 0x0000e900UL, 0x0000ce00UL, 0x00005500UL, 0x00002800UL, 0x0000df00UL,
|
||||
0x00008c00UL, 0x0000a100UL, 0x00008900UL, 0x00000d00UL, 0x0000bf00UL, 0x0000e600UL, 0x00004200UL, 0x00006800UL,
|
||||
0x00006300UL, 0x00007c00UL, 0x00007700UL, 0x00007b00UL, 0x0000f200UL, 0x00006b00UL, 0x00006f00UL, 0x0000c500UL,
|
||||
0x00003000UL, 0x00000100UL, 0x00006700UL, 0x00002b00UL, 0x0000fe00UL, 0x0000d700UL, 0x0000ab00UL, 0x00007600UL,
|
||||
0x0000ca00UL, 0x00008200UL, 0x0000c900UL, 0x00007d00UL, 0x0000fa00UL, 0x00005900UL, 0x00004700UL, 0x0000f000UL,
|
||||
0x0000ad00UL, 0x0000d400UL, 0x0000a200UL, 0x0000af00UL, 0x00009c00UL, 0x0000a400UL, 0x00007200UL, 0x0000c000UL,
|
||||
0x0000b700UL, 0x0000fd00UL, 0x00009300UL, 0x00002600UL, 0x00003600UL, 0x00003f00UL, 0x0000f700UL, 0x0000cc00UL,
|
||||
0x00003400UL, 0x0000a500UL, 0x0000e500UL, 0x0000f100UL, 0x00007100UL, 0x0000d800UL, 0x00003100UL, 0x00001500UL,
|
||||
0x00000400UL, 0x0000c700UL, 0x00002300UL, 0x0000c300UL, 0x00001800UL, 0x00009600UL, 0x00000500UL, 0x00009a00UL,
|
||||
0x00000700UL, 0x00001200UL, 0x00008000UL, 0x0000e200UL, 0x0000eb00UL, 0x00002700UL, 0x0000b200UL, 0x00007500UL,
|
||||
0x00000900UL, 0x00008300UL, 0x00002c00UL, 0x00001a00UL, 0x00001b00UL, 0x00006e00UL, 0x00005a00UL, 0x0000a000UL,
|
||||
0x00005200UL, 0x00003b00UL, 0x0000d600UL, 0x0000b300UL, 0x00002900UL, 0x0000e300UL, 0x00002f00UL, 0x00008400UL,
|
||||
0x00005300UL, 0x0000d100UL, 0x00000000UL, 0x0000ed00UL, 0x00002000UL, 0x0000fc00UL, 0x0000b100UL, 0x00005b00UL,
|
||||
0x00006a00UL, 0x0000cb00UL, 0x0000be00UL, 0x00003900UL, 0x00004a00UL, 0x00004c00UL, 0x00005800UL, 0x0000cf00UL,
|
||||
0x0000d000UL, 0x0000ef00UL, 0x0000aa00UL, 0x0000fb00UL, 0x00004300UL, 0x00004d00UL, 0x00003300UL, 0x00008500UL,
|
||||
0x00004500UL, 0x0000f900UL, 0x00000200UL, 0x00007f00UL, 0x00005000UL, 0x00003c00UL, 0x00009f00UL, 0x0000a800UL,
|
||||
0x00005100UL, 0x0000a300UL, 0x00004000UL, 0x00008f00UL, 0x00009200UL, 0x00009d00UL, 0x00003800UL, 0x0000f500UL,
|
||||
0x0000bc00UL, 0x0000b600UL, 0x0000da00UL, 0x00002100UL, 0x00001000UL, 0x0000ff00UL, 0x0000f300UL, 0x0000d200UL,
|
||||
0x0000cd00UL, 0x00000c00UL, 0x00001300UL, 0x0000ec00UL, 0x00005f00UL, 0x00009700UL, 0x00004400UL, 0x00001700UL,
|
||||
0x0000c400UL, 0x0000a700UL, 0x00007e00UL, 0x00003d00UL, 0x00006400UL, 0x00005d00UL, 0x00001900UL, 0x00007300UL,
|
||||
0x00006000UL, 0x00008100UL, 0x00004f00UL, 0x0000dc00UL, 0x00002200UL, 0x00002a00UL, 0x00009000UL, 0x00008800UL,
|
||||
0x00004600UL, 0x0000ee00UL, 0x0000b800UL, 0x00001400UL, 0x0000de00UL, 0x00005e00UL, 0x00000b00UL, 0x0000db00UL,
|
||||
0x0000e000UL, 0x00003200UL, 0x00003a00UL, 0x00000a00UL, 0x00004900UL, 0x00000600UL, 0x00002400UL, 0x00005c00UL,
|
||||
0x0000c200UL, 0x0000d300UL, 0x0000ac00UL, 0x00006200UL, 0x00009100UL, 0x00009500UL, 0x0000e400UL, 0x00007900UL,
|
||||
0x0000e700UL, 0x0000c800UL, 0x00003700UL, 0x00006d00UL, 0x00008d00UL, 0x0000d500UL, 0x00004e00UL, 0x0000a900UL,
|
||||
0x00006c00UL, 0x00005600UL, 0x0000f400UL, 0x0000ea00UL, 0x00006500UL, 0x00007a00UL, 0x0000ae00UL, 0x00000800UL,
|
||||
0x0000ba00UL, 0x00007800UL, 0x00002500UL, 0x00002e00UL, 0x00001c00UL, 0x0000a600UL, 0x0000b400UL, 0x0000c600UL,
|
||||
0x0000e800UL, 0x0000dd00UL, 0x00007400UL, 0x00001f00UL, 0x00004b00UL, 0x0000bd00UL, 0x00008b00UL, 0x00008a00UL,
|
||||
0x00007000UL, 0x00003e00UL, 0x0000b500UL, 0x00006600UL, 0x00004800UL, 0x00000300UL, 0x0000f600UL, 0x00000e00UL,
|
||||
0x00006100UL, 0x00003500UL, 0x00005700UL, 0x0000b900UL, 0x00008600UL, 0x0000c100UL, 0x00001d00UL, 0x00009e00UL,
|
||||
0x0000e100UL, 0x0000f800UL, 0x00009800UL, 0x00001100UL, 0x00006900UL, 0x0000d900UL, 0x00008e00UL, 0x00009400UL,
|
||||
0x00009b00UL, 0x00001e00UL, 0x00008700UL, 0x0000e900UL, 0x0000ce00UL, 0x00005500UL, 0x00002800UL, 0x0000df00UL,
|
||||
0x00008c00UL, 0x0000a100UL, 0x00008900UL, 0x00000d00UL, 0x0000bf00UL, 0x0000e600UL, 0x00004200UL, 0x00006800UL,
|
||||
0x00004100UL, 0x00009900UL, 0x00002d00UL, 0x00000f00UL, 0x0000b000UL, 0x00005400UL, 0x0000bb00UL, 0x00001600UL
|
||||
};
|
||||
|
||||
static const ulong32 Te4_2[] = {
|
||||
0x00630000UL, 0x007c0000UL, 0x00770000UL, 0x007b0000UL, 0x00f20000UL, 0x006b0000UL, 0x006f0000UL, 0x00c50000UL,
|
||||
0x00300000UL, 0x00010000UL, 0x00670000UL, 0x002b0000UL, 0x00fe0000UL, 0x00d70000UL, 0x00ab0000UL, 0x00760000UL,
|
||||
0x00ca0000UL, 0x00820000UL, 0x00c90000UL, 0x007d0000UL, 0x00fa0000UL, 0x00590000UL, 0x00470000UL, 0x00f00000UL,
|
||||
0x00ad0000UL, 0x00d40000UL, 0x00a20000UL, 0x00af0000UL, 0x009c0000UL, 0x00a40000UL, 0x00720000UL, 0x00c00000UL,
|
||||
0x00b70000UL, 0x00fd0000UL, 0x00930000UL, 0x00260000UL, 0x00360000UL, 0x003f0000UL, 0x00f70000UL, 0x00cc0000UL,
|
||||
0x00340000UL, 0x00a50000UL, 0x00e50000UL, 0x00f10000UL, 0x00710000UL, 0x00d80000UL, 0x00310000UL, 0x00150000UL,
|
||||
0x00040000UL, 0x00c70000UL, 0x00230000UL, 0x00c30000UL, 0x00180000UL, 0x00960000UL, 0x00050000UL, 0x009a0000UL,
|
||||
0x00070000UL, 0x00120000UL, 0x00800000UL, 0x00e20000UL, 0x00eb0000UL, 0x00270000UL, 0x00b20000UL, 0x00750000UL,
|
||||
0x00090000UL, 0x00830000UL, 0x002c0000UL, 0x001a0000UL, 0x001b0000UL, 0x006e0000UL, 0x005a0000UL, 0x00a00000UL,
|
||||
0x00520000UL, 0x003b0000UL, 0x00d60000UL, 0x00b30000UL, 0x00290000UL, 0x00e30000UL, 0x002f0000UL, 0x00840000UL,
|
||||
0x00530000UL, 0x00d10000UL, 0x00000000UL, 0x00ed0000UL, 0x00200000UL, 0x00fc0000UL, 0x00b10000UL, 0x005b0000UL,
|
||||
0x006a0000UL, 0x00cb0000UL, 0x00be0000UL, 0x00390000UL, 0x004a0000UL, 0x004c0000UL, 0x00580000UL, 0x00cf0000UL,
|
||||
0x00d00000UL, 0x00ef0000UL, 0x00aa0000UL, 0x00fb0000UL, 0x00430000UL, 0x004d0000UL, 0x00330000UL, 0x00850000UL,
|
||||
0x00450000UL, 0x00f90000UL, 0x00020000UL, 0x007f0000UL, 0x00500000UL, 0x003c0000UL, 0x009f0000UL, 0x00a80000UL,
|
||||
0x00510000UL, 0x00a30000UL, 0x00400000UL, 0x008f0000UL, 0x00920000UL, 0x009d0000UL, 0x00380000UL, 0x00f50000UL,
|
||||
0x00bc0000UL, 0x00b60000UL, 0x00da0000UL, 0x00210000UL, 0x00100000UL, 0x00ff0000UL, 0x00f30000UL, 0x00d20000UL,
|
||||
0x00cd0000UL, 0x000c0000UL, 0x00130000UL, 0x00ec0000UL, 0x005f0000UL, 0x00970000UL, 0x00440000UL, 0x00170000UL,
|
||||
0x00c40000UL, 0x00a70000UL, 0x007e0000UL, 0x003d0000UL, 0x00640000UL, 0x005d0000UL, 0x00190000UL, 0x00730000UL,
|
||||
0x00600000UL, 0x00810000UL, 0x004f0000UL, 0x00dc0000UL, 0x00220000UL, 0x002a0000UL, 0x00900000UL, 0x00880000UL,
|
||||
0x00460000UL, 0x00ee0000UL, 0x00b80000UL, 0x00140000UL, 0x00de0000UL, 0x005e0000UL, 0x000b0000UL, 0x00db0000UL,
|
||||
0x00e00000UL, 0x00320000UL, 0x003a0000UL, 0x000a0000UL, 0x00490000UL, 0x00060000UL, 0x00240000UL, 0x005c0000UL,
|
||||
0x00c20000UL, 0x00d30000UL, 0x00ac0000UL, 0x00620000UL, 0x00910000UL, 0x00950000UL, 0x00e40000UL, 0x00790000UL,
|
||||
0x00e70000UL, 0x00c80000UL, 0x00370000UL, 0x006d0000UL, 0x008d0000UL, 0x00d50000UL, 0x004e0000UL, 0x00a90000UL,
|
||||
0x006c0000UL, 0x00560000UL, 0x00f40000UL, 0x00ea0000UL, 0x00650000UL, 0x007a0000UL, 0x00ae0000UL, 0x00080000UL,
|
||||
0x00ba0000UL, 0x00780000UL, 0x00250000UL, 0x002e0000UL, 0x001c0000UL, 0x00a60000UL, 0x00b40000UL, 0x00c60000UL,
|
||||
0x00e80000UL, 0x00dd0000UL, 0x00740000UL, 0x001f0000UL, 0x004b0000UL, 0x00bd0000UL, 0x008b0000UL, 0x008a0000UL,
|
||||
0x00700000UL, 0x003e0000UL, 0x00b50000UL, 0x00660000UL, 0x00480000UL, 0x00030000UL, 0x00f60000UL, 0x000e0000UL,
|
||||
0x00610000UL, 0x00350000UL, 0x00570000UL, 0x00b90000UL, 0x00860000UL, 0x00c10000UL, 0x001d0000UL, 0x009e0000UL,
|
||||
0x00e10000UL, 0x00f80000UL, 0x00980000UL, 0x00110000UL, 0x00690000UL, 0x00d90000UL, 0x008e0000UL, 0x00940000UL,
|
||||
0x009b0000UL, 0x001e0000UL, 0x00870000UL, 0x00e90000UL, 0x00ce0000UL, 0x00550000UL, 0x00280000UL, 0x00df0000UL,
|
||||
0x008c0000UL, 0x00a10000UL, 0x00890000UL, 0x000d0000UL, 0x00bf0000UL, 0x00e60000UL, 0x00420000UL, 0x00680000UL,
|
||||
0x00630000UL, 0x007c0000UL, 0x00770000UL, 0x007b0000UL, 0x00f20000UL, 0x006b0000UL, 0x006f0000UL, 0x00c50000UL,
|
||||
0x00300000UL, 0x00010000UL, 0x00670000UL, 0x002b0000UL, 0x00fe0000UL, 0x00d70000UL, 0x00ab0000UL, 0x00760000UL,
|
||||
0x00ca0000UL, 0x00820000UL, 0x00c90000UL, 0x007d0000UL, 0x00fa0000UL, 0x00590000UL, 0x00470000UL, 0x00f00000UL,
|
||||
0x00ad0000UL, 0x00d40000UL, 0x00a20000UL, 0x00af0000UL, 0x009c0000UL, 0x00a40000UL, 0x00720000UL, 0x00c00000UL,
|
||||
0x00b70000UL, 0x00fd0000UL, 0x00930000UL, 0x00260000UL, 0x00360000UL, 0x003f0000UL, 0x00f70000UL, 0x00cc0000UL,
|
||||
0x00340000UL, 0x00a50000UL, 0x00e50000UL, 0x00f10000UL, 0x00710000UL, 0x00d80000UL, 0x00310000UL, 0x00150000UL,
|
||||
0x00040000UL, 0x00c70000UL, 0x00230000UL, 0x00c30000UL, 0x00180000UL, 0x00960000UL, 0x00050000UL, 0x009a0000UL,
|
||||
0x00070000UL, 0x00120000UL, 0x00800000UL, 0x00e20000UL, 0x00eb0000UL, 0x00270000UL, 0x00b20000UL, 0x00750000UL,
|
||||
0x00090000UL, 0x00830000UL, 0x002c0000UL, 0x001a0000UL, 0x001b0000UL, 0x006e0000UL, 0x005a0000UL, 0x00a00000UL,
|
||||
0x00520000UL, 0x003b0000UL, 0x00d60000UL, 0x00b30000UL, 0x00290000UL, 0x00e30000UL, 0x002f0000UL, 0x00840000UL,
|
||||
0x00530000UL, 0x00d10000UL, 0x00000000UL, 0x00ed0000UL, 0x00200000UL, 0x00fc0000UL, 0x00b10000UL, 0x005b0000UL,
|
||||
0x006a0000UL, 0x00cb0000UL, 0x00be0000UL, 0x00390000UL, 0x004a0000UL, 0x004c0000UL, 0x00580000UL, 0x00cf0000UL,
|
||||
0x00d00000UL, 0x00ef0000UL, 0x00aa0000UL, 0x00fb0000UL, 0x00430000UL, 0x004d0000UL, 0x00330000UL, 0x00850000UL,
|
||||
0x00450000UL, 0x00f90000UL, 0x00020000UL, 0x007f0000UL, 0x00500000UL, 0x003c0000UL, 0x009f0000UL, 0x00a80000UL,
|
||||
0x00510000UL, 0x00a30000UL, 0x00400000UL, 0x008f0000UL, 0x00920000UL, 0x009d0000UL, 0x00380000UL, 0x00f50000UL,
|
||||
0x00bc0000UL, 0x00b60000UL, 0x00da0000UL, 0x00210000UL, 0x00100000UL, 0x00ff0000UL, 0x00f30000UL, 0x00d20000UL,
|
||||
0x00cd0000UL, 0x000c0000UL, 0x00130000UL, 0x00ec0000UL, 0x005f0000UL, 0x00970000UL, 0x00440000UL, 0x00170000UL,
|
||||
0x00c40000UL, 0x00a70000UL, 0x007e0000UL, 0x003d0000UL, 0x00640000UL, 0x005d0000UL, 0x00190000UL, 0x00730000UL,
|
||||
0x00600000UL, 0x00810000UL, 0x004f0000UL, 0x00dc0000UL, 0x00220000UL, 0x002a0000UL, 0x00900000UL, 0x00880000UL,
|
||||
0x00460000UL, 0x00ee0000UL, 0x00b80000UL, 0x00140000UL, 0x00de0000UL, 0x005e0000UL, 0x000b0000UL, 0x00db0000UL,
|
||||
0x00e00000UL, 0x00320000UL, 0x003a0000UL, 0x000a0000UL, 0x00490000UL, 0x00060000UL, 0x00240000UL, 0x005c0000UL,
|
||||
0x00c20000UL, 0x00d30000UL, 0x00ac0000UL, 0x00620000UL, 0x00910000UL, 0x00950000UL, 0x00e40000UL, 0x00790000UL,
|
||||
0x00e70000UL, 0x00c80000UL, 0x00370000UL, 0x006d0000UL, 0x008d0000UL, 0x00d50000UL, 0x004e0000UL, 0x00a90000UL,
|
||||
0x006c0000UL, 0x00560000UL, 0x00f40000UL, 0x00ea0000UL, 0x00650000UL, 0x007a0000UL, 0x00ae0000UL, 0x00080000UL,
|
||||
0x00ba0000UL, 0x00780000UL, 0x00250000UL, 0x002e0000UL, 0x001c0000UL, 0x00a60000UL, 0x00b40000UL, 0x00c60000UL,
|
||||
0x00e80000UL, 0x00dd0000UL, 0x00740000UL, 0x001f0000UL, 0x004b0000UL, 0x00bd0000UL, 0x008b0000UL, 0x008a0000UL,
|
||||
0x00700000UL, 0x003e0000UL, 0x00b50000UL, 0x00660000UL, 0x00480000UL, 0x00030000UL, 0x00f60000UL, 0x000e0000UL,
|
||||
0x00610000UL, 0x00350000UL, 0x00570000UL, 0x00b90000UL, 0x00860000UL, 0x00c10000UL, 0x001d0000UL, 0x009e0000UL,
|
||||
0x00e10000UL, 0x00f80000UL, 0x00980000UL, 0x00110000UL, 0x00690000UL, 0x00d90000UL, 0x008e0000UL, 0x00940000UL,
|
||||
0x009b0000UL, 0x001e0000UL, 0x00870000UL, 0x00e90000UL, 0x00ce0000UL, 0x00550000UL, 0x00280000UL, 0x00df0000UL,
|
||||
0x008c0000UL, 0x00a10000UL, 0x00890000UL, 0x000d0000UL, 0x00bf0000UL, 0x00e60000UL, 0x00420000UL, 0x00680000UL,
|
||||
0x00410000UL, 0x00990000UL, 0x002d0000UL, 0x000f0000UL, 0x00b00000UL, 0x00540000UL, 0x00bb0000UL, 0x00160000UL
|
||||
};
|
||||
|
||||
static const ulong32 Te4_3[] = {
|
||||
0x63000000UL, 0x7c000000UL, 0x77000000UL, 0x7b000000UL, 0xf2000000UL, 0x6b000000UL, 0x6f000000UL, 0xc5000000UL,
|
||||
0x30000000UL, 0x01000000UL, 0x67000000UL, 0x2b000000UL, 0xfe000000UL, 0xd7000000UL, 0xab000000UL, 0x76000000UL,
|
||||
0xca000000UL, 0x82000000UL, 0xc9000000UL, 0x7d000000UL, 0xfa000000UL, 0x59000000UL, 0x47000000UL, 0xf0000000UL,
|
||||
0xad000000UL, 0xd4000000UL, 0xa2000000UL, 0xaf000000UL, 0x9c000000UL, 0xa4000000UL, 0x72000000UL, 0xc0000000UL,
|
||||
0xb7000000UL, 0xfd000000UL, 0x93000000UL, 0x26000000UL, 0x36000000UL, 0x3f000000UL, 0xf7000000UL, 0xcc000000UL,
|
||||
0x34000000UL, 0xa5000000UL, 0xe5000000UL, 0xf1000000UL, 0x71000000UL, 0xd8000000UL, 0x31000000UL, 0x15000000UL,
|
||||
0x04000000UL, 0xc7000000UL, 0x23000000UL, 0xc3000000UL, 0x18000000UL, 0x96000000UL, 0x05000000UL, 0x9a000000UL,
|
||||
0x07000000UL, 0x12000000UL, 0x80000000UL, 0xe2000000UL, 0xeb000000UL, 0x27000000UL, 0xb2000000UL, 0x75000000UL,
|
||||
0x09000000UL, 0x83000000UL, 0x2c000000UL, 0x1a000000UL, 0x1b000000UL, 0x6e000000UL, 0x5a000000UL, 0xa0000000UL,
|
||||
0x52000000UL, 0x3b000000UL, 0xd6000000UL, 0xb3000000UL, 0x29000000UL, 0xe3000000UL, 0x2f000000UL, 0x84000000UL,
|
||||
0x53000000UL, 0xd1000000UL, 0x00000000UL, 0xed000000UL, 0x20000000UL, 0xfc000000UL, 0xb1000000UL, 0x5b000000UL,
|
||||
0x6a000000UL, 0xcb000000UL, 0xbe000000UL, 0x39000000UL, 0x4a000000UL, 0x4c000000UL, 0x58000000UL, 0xcf000000UL,
|
||||
0xd0000000UL, 0xef000000UL, 0xaa000000UL, 0xfb000000UL, 0x43000000UL, 0x4d000000UL, 0x33000000UL, 0x85000000UL,
|
||||
0x45000000UL, 0xf9000000UL, 0x02000000UL, 0x7f000000UL, 0x50000000UL, 0x3c000000UL, 0x9f000000UL, 0xa8000000UL,
|
||||
0x51000000UL, 0xa3000000UL, 0x40000000UL, 0x8f000000UL, 0x92000000UL, 0x9d000000UL, 0x38000000UL, 0xf5000000UL,
|
||||
0xbc000000UL, 0xb6000000UL, 0xda000000UL, 0x21000000UL, 0x10000000UL, 0xff000000UL, 0xf3000000UL, 0xd2000000UL,
|
||||
0xcd000000UL, 0x0c000000UL, 0x13000000UL, 0xec000000UL, 0x5f000000UL, 0x97000000UL, 0x44000000UL, 0x17000000UL,
|
||||
0xc4000000UL, 0xa7000000UL, 0x7e000000UL, 0x3d000000UL, 0x64000000UL, 0x5d000000UL, 0x19000000UL, 0x73000000UL,
|
||||
0x60000000UL, 0x81000000UL, 0x4f000000UL, 0xdc000000UL, 0x22000000UL, 0x2a000000UL, 0x90000000UL, 0x88000000UL,
|
||||
0x46000000UL, 0xee000000UL, 0xb8000000UL, 0x14000000UL, 0xde000000UL, 0x5e000000UL, 0x0b000000UL, 0xdb000000UL,
|
||||
0xe0000000UL, 0x32000000UL, 0x3a000000UL, 0x0a000000UL, 0x49000000UL, 0x06000000UL, 0x24000000UL, 0x5c000000UL,
|
||||
0xc2000000UL, 0xd3000000UL, 0xac000000UL, 0x62000000UL, 0x91000000UL, 0x95000000UL, 0xe4000000UL, 0x79000000UL,
|
||||
0xe7000000UL, 0xc8000000UL, 0x37000000UL, 0x6d000000UL, 0x8d000000UL, 0xd5000000UL, 0x4e000000UL, 0xa9000000UL,
|
||||
0x6c000000UL, 0x56000000UL, 0xf4000000UL, 0xea000000UL, 0x65000000UL, 0x7a000000UL, 0xae000000UL, 0x08000000UL,
|
||||
0xba000000UL, 0x78000000UL, 0x25000000UL, 0x2e000000UL, 0x1c000000UL, 0xa6000000UL, 0xb4000000UL, 0xc6000000UL,
|
||||
0xe8000000UL, 0xdd000000UL, 0x74000000UL, 0x1f000000UL, 0x4b000000UL, 0xbd000000UL, 0x8b000000UL, 0x8a000000UL,
|
||||
0x70000000UL, 0x3e000000UL, 0xb5000000UL, 0x66000000UL, 0x48000000UL, 0x03000000UL, 0xf6000000UL, 0x0e000000UL,
|
||||
0x61000000UL, 0x35000000UL, 0x57000000UL, 0xb9000000UL, 0x86000000UL, 0xc1000000UL, 0x1d000000UL, 0x9e000000UL,
|
||||
0xe1000000UL, 0xf8000000UL, 0x98000000UL, 0x11000000UL, 0x69000000UL, 0xd9000000UL, 0x8e000000UL, 0x94000000UL,
|
||||
0x9b000000UL, 0x1e000000UL, 0x87000000UL, 0xe9000000UL, 0xce000000UL, 0x55000000UL, 0x28000000UL, 0xdf000000UL,
|
||||
0x8c000000UL, 0xa1000000UL, 0x89000000UL, 0x0d000000UL, 0xbf000000UL, 0xe6000000UL, 0x42000000UL, 0x68000000UL,
|
||||
0x63000000UL, 0x7c000000UL, 0x77000000UL, 0x7b000000UL, 0xf2000000UL, 0x6b000000UL, 0x6f000000UL, 0xc5000000UL,
|
||||
0x30000000UL, 0x01000000UL, 0x67000000UL, 0x2b000000UL, 0xfe000000UL, 0xd7000000UL, 0xab000000UL, 0x76000000UL,
|
||||
0xca000000UL, 0x82000000UL, 0xc9000000UL, 0x7d000000UL, 0xfa000000UL, 0x59000000UL, 0x47000000UL, 0xf0000000UL,
|
||||
0xad000000UL, 0xd4000000UL, 0xa2000000UL, 0xaf000000UL, 0x9c000000UL, 0xa4000000UL, 0x72000000UL, 0xc0000000UL,
|
||||
0xb7000000UL, 0xfd000000UL, 0x93000000UL, 0x26000000UL, 0x36000000UL, 0x3f000000UL, 0xf7000000UL, 0xcc000000UL,
|
||||
0x34000000UL, 0xa5000000UL, 0xe5000000UL, 0xf1000000UL, 0x71000000UL, 0xd8000000UL, 0x31000000UL, 0x15000000UL,
|
||||
0x04000000UL, 0xc7000000UL, 0x23000000UL, 0xc3000000UL, 0x18000000UL, 0x96000000UL, 0x05000000UL, 0x9a000000UL,
|
||||
0x07000000UL, 0x12000000UL, 0x80000000UL, 0xe2000000UL, 0xeb000000UL, 0x27000000UL, 0xb2000000UL, 0x75000000UL,
|
||||
0x09000000UL, 0x83000000UL, 0x2c000000UL, 0x1a000000UL, 0x1b000000UL, 0x6e000000UL, 0x5a000000UL, 0xa0000000UL,
|
||||
0x52000000UL, 0x3b000000UL, 0xd6000000UL, 0xb3000000UL, 0x29000000UL, 0xe3000000UL, 0x2f000000UL, 0x84000000UL,
|
||||
0x53000000UL, 0xd1000000UL, 0x00000000UL, 0xed000000UL, 0x20000000UL, 0xfc000000UL, 0xb1000000UL, 0x5b000000UL,
|
||||
0x6a000000UL, 0xcb000000UL, 0xbe000000UL, 0x39000000UL, 0x4a000000UL, 0x4c000000UL, 0x58000000UL, 0xcf000000UL,
|
||||
0xd0000000UL, 0xef000000UL, 0xaa000000UL, 0xfb000000UL, 0x43000000UL, 0x4d000000UL, 0x33000000UL, 0x85000000UL,
|
||||
0x45000000UL, 0xf9000000UL, 0x02000000UL, 0x7f000000UL, 0x50000000UL, 0x3c000000UL, 0x9f000000UL, 0xa8000000UL,
|
||||
0x51000000UL, 0xa3000000UL, 0x40000000UL, 0x8f000000UL, 0x92000000UL, 0x9d000000UL, 0x38000000UL, 0xf5000000UL,
|
||||
0xbc000000UL, 0xb6000000UL, 0xda000000UL, 0x21000000UL, 0x10000000UL, 0xff000000UL, 0xf3000000UL, 0xd2000000UL,
|
||||
0xcd000000UL, 0x0c000000UL, 0x13000000UL, 0xec000000UL, 0x5f000000UL, 0x97000000UL, 0x44000000UL, 0x17000000UL,
|
||||
0xc4000000UL, 0xa7000000UL, 0x7e000000UL, 0x3d000000UL, 0x64000000UL, 0x5d000000UL, 0x19000000UL, 0x73000000UL,
|
||||
0x60000000UL, 0x81000000UL, 0x4f000000UL, 0xdc000000UL, 0x22000000UL, 0x2a000000UL, 0x90000000UL, 0x88000000UL,
|
||||
0x46000000UL, 0xee000000UL, 0xb8000000UL, 0x14000000UL, 0xde000000UL, 0x5e000000UL, 0x0b000000UL, 0xdb000000UL,
|
||||
0xe0000000UL, 0x32000000UL, 0x3a000000UL, 0x0a000000UL, 0x49000000UL, 0x06000000UL, 0x24000000UL, 0x5c000000UL,
|
||||
0xc2000000UL, 0xd3000000UL, 0xac000000UL, 0x62000000UL, 0x91000000UL, 0x95000000UL, 0xe4000000UL, 0x79000000UL,
|
||||
0xe7000000UL, 0xc8000000UL, 0x37000000UL, 0x6d000000UL, 0x8d000000UL, 0xd5000000UL, 0x4e000000UL, 0xa9000000UL,
|
||||
0x6c000000UL, 0x56000000UL, 0xf4000000UL, 0xea000000UL, 0x65000000UL, 0x7a000000UL, 0xae000000UL, 0x08000000UL,
|
||||
0xba000000UL, 0x78000000UL, 0x25000000UL, 0x2e000000UL, 0x1c000000UL, 0xa6000000UL, 0xb4000000UL, 0xc6000000UL,
|
||||
0xe8000000UL, 0xdd000000UL, 0x74000000UL, 0x1f000000UL, 0x4b000000UL, 0xbd000000UL, 0x8b000000UL, 0x8a000000UL,
|
||||
0x70000000UL, 0x3e000000UL, 0xb5000000UL, 0x66000000UL, 0x48000000UL, 0x03000000UL, 0xf6000000UL, 0x0e000000UL,
|
||||
0x61000000UL, 0x35000000UL, 0x57000000UL, 0xb9000000UL, 0x86000000UL, 0xc1000000UL, 0x1d000000UL, 0x9e000000UL,
|
||||
0xe1000000UL, 0xf8000000UL, 0x98000000UL, 0x11000000UL, 0x69000000UL, 0xd9000000UL, 0x8e000000UL, 0x94000000UL,
|
||||
0x9b000000UL, 0x1e000000UL, 0x87000000UL, 0xe9000000UL, 0xce000000UL, 0x55000000UL, 0x28000000UL, 0xdf000000UL,
|
||||
0x8c000000UL, 0xa1000000UL, 0x89000000UL, 0x0d000000UL, 0xbf000000UL, 0xe6000000UL, 0x42000000UL, 0x68000000UL,
|
||||
0x41000000UL, 0x99000000UL, 0x2d000000UL, 0x0f000000UL, 0xb0000000UL, 0x54000000UL, 0xbb000000UL, 0x16000000UL
|
||||
};
|
||||
#endif /* pelimac */
|
||||
@@ -874,142 +874,142 @@ static const ulong32 TD3[256] = {
|
||||
};
|
||||
|
||||
static const ulong32 Tks0[] = {
|
||||
0x00000000UL, 0x0e090d0bUL, 0x1c121a16UL, 0x121b171dUL, 0x3824342cUL, 0x362d3927UL, 0x24362e3aUL, 0x2a3f2331UL,
|
||||
0x70486858UL, 0x7e416553UL, 0x6c5a724eUL, 0x62537f45UL, 0x486c5c74UL, 0x4665517fUL, 0x547e4662UL, 0x5a774b69UL,
|
||||
0xe090d0b0UL, 0xee99ddbbUL, 0xfc82caa6UL, 0xf28bc7adUL, 0xd8b4e49cUL, 0xd6bde997UL, 0xc4a6fe8aUL, 0xcaaff381UL,
|
||||
0x90d8b8e8UL, 0x9ed1b5e3UL, 0x8ccaa2feUL, 0x82c3aff5UL, 0xa8fc8cc4UL, 0xa6f581cfUL, 0xb4ee96d2UL, 0xbae79bd9UL,
|
||||
0xdb3bbb7bUL, 0xd532b670UL, 0xc729a16dUL, 0xc920ac66UL, 0xe31f8f57UL, 0xed16825cUL, 0xff0d9541UL, 0xf104984aUL,
|
||||
0xab73d323UL, 0xa57ade28UL, 0xb761c935UL, 0xb968c43eUL, 0x9357e70fUL, 0x9d5eea04UL, 0x8f45fd19UL, 0x814cf012UL,
|
||||
0x3bab6bcbUL, 0x35a266c0UL, 0x27b971ddUL, 0x29b07cd6UL, 0x038f5fe7UL, 0x0d8652ecUL, 0x1f9d45f1UL, 0x119448faUL,
|
||||
0x4be30393UL, 0x45ea0e98UL, 0x57f11985UL, 0x59f8148eUL, 0x73c737bfUL, 0x7dce3ab4UL, 0x6fd52da9UL, 0x61dc20a2UL,
|
||||
0xad766df6UL, 0xa37f60fdUL, 0xb16477e0UL, 0xbf6d7aebUL, 0x955259daUL, 0x9b5b54d1UL, 0x894043ccUL, 0x87494ec7UL,
|
||||
0xdd3e05aeUL, 0xd33708a5UL, 0xc12c1fb8UL, 0xcf2512b3UL, 0xe51a3182UL, 0xeb133c89UL, 0xf9082b94UL, 0xf701269fUL,
|
||||
0x4de6bd46UL, 0x43efb04dUL, 0x51f4a750UL, 0x5ffdaa5bUL, 0x75c2896aUL, 0x7bcb8461UL, 0x69d0937cUL, 0x67d99e77UL,
|
||||
0x3daed51eUL, 0x33a7d815UL, 0x21bccf08UL, 0x2fb5c203UL, 0x058ae132UL, 0x0b83ec39UL, 0x1998fb24UL, 0x1791f62fUL,
|
||||
0x764dd68dUL, 0x7844db86UL, 0x6a5fcc9bUL, 0x6456c190UL, 0x4e69e2a1UL, 0x4060efaaUL, 0x527bf8b7UL, 0x5c72f5bcUL,
|
||||
0x0605bed5UL, 0x080cb3deUL, 0x1a17a4c3UL, 0x141ea9c8UL, 0x3e218af9UL, 0x302887f2UL, 0x223390efUL, 0x2c3a9de4UL,
|
||||
0x96dd063dUL, 0x98d40b36UL, 0x8acf1c2bUL, 0x84c61120UL, 0xaef93211UL, 0xa0f03f1aUL, 0xb2eb2807UL, 0xbce2250cUL,
|
||||
0xe6956e65UL, 0xe89c636eUL, 0xfa877473UL, 0xf48e7978UL, 0xdeb15a49UL, 0xd0b85742UL, 0xc2a3405fUL, 0xccaa4d54UL,
|
||||
0x41ecdaf7UL, 0x4fe5d7fcUL, 0x5dfec0e1UL, 0x53f7cdeaUL, 0x79c8eedbUL, 0x77c1e3d0UL, 0x65daf4cdUL, 0x6bd3f9c6UL,
|
||||
0x31a4b2afUL, 0x3fadbfa4UL, 0x2db6a8b9UL, 0x23bfa5b2UL, 0x09808683UL, 0x07898b88UL, 0x15929c95UL, 0x1b9b919eUL,
|
||||
0xa17c0a47UL, 0xaf75074cUL, 0xbd6e1051UL, 0xb3671d5aUL, 0x99583e6bUL, 0x97513360UL, 0x854a247dUL, 0x8b432976UL,
|
||||
0xd134621fUL, 0xdf3d6f14UL, 0xcd267809UL, 0xc32f7502UL, 0xe9105633UL, 0xe7195b38UL, 0xf5024c25UL, 0xfb0b412eUL,
|
||||
0x9ad7618cUL, 0x94de6c87UL, 0x86c57b9aUL, 0x88cc7691UL, 0xa2f355a0UL, 0xacfa58abUL, 0xbee14fb6UL, 0xb0e842bdUL,
|
||||
0xea9f09d4UL, 0xe49604dfUL, 0xf68d13c2UL, 0xf8841ec9UL, 0xd2bb3df8UL, 0xdcb230f3UL, 0xcea927eeUL, 0xc0a02ae5UL,
|
||||
0x7a47b13cUL, 0x744ebc37UL, 0x6655ab2aUL, 0x685ca621UL, 0x42638510UL, 0x4c6a881bUL, 0x5e719f06UL, 0x5078920dUL,
|
||||
0x0a0fd964UL, 0x0406d46fUL, 0x161dc372UL, 0x1814ce79UL, 0x322bed48UL, 0x3c22e043UL, 0x2e39f75eUL, 0x2030fa55UL,
|
||||
0xec9ab701UL, 0xe293ba0aUL, 0xf088ad17UL, 0xfe81a01cUL, 0xd4be832dUL, 0xdab78e26UL, 0xc8ac993bUL, 0xc6a59430UL,
|
||||
0x9cd2df59UL, 0x92dbd252UL, 0x80c0c54fUL, 0x8ec9c844UL, 0xa4f6eb75UL, 0xaaffe67eUL, 0xb8e4f163UL, 0xb6edfc68UL,
|
||||
0x0c0a67b1UL, 0x02036abaUL, 0x10187da7UL, 0x1e1170acUL, 0x342e539dUL, 0x3a275e96UL, 0x283c498bUL, 0x26354480UL,
|
||||
0x7c420fe9UL, 0x724b02e2UL, 0x605015ffUL, 0x6e5918f4UL, 0x44663bc5UL, 0x4a6f36ceUL, 0x587421d3UL, 0x567d2cd8UL,
|
||||
0x37a10c7aUL, 0x39a80171UL, 0x2bb3166cUL, 0x25ba1b67UL, 0x0f853856UL, 0x018c355dUL, 0x13972240UL, 0x1d9e2f4bUL,
|
||||
0x47e96422UL, 0x49e06929UL, 0x5bfb7e34UL, 0x55f2733fUL, 0x7fcd500eUL, 0x71c45d05UL, 0x63df4a18UL, 0x6dd64713UL,
|
||||
0xd731dccaUL, 0xd938d1c1UL, 0xcb23c6dcUL, 0xc52acbd7UL, 0xef15e8e6UL, 0xe11ce5edUL, 0xf307f2f0UL, 0xfd0efffbUL,
|
||||
0x00000000UL, 0x0e090d0bUL, 0x1c121a16UL, 0x121b171dUL, 0x3824342cUL, 0x362d3927UL, 0x24362e3aUL, 0x2a3f2331UL,
|
||||
0x70486858UL, 0x7e416553UL, 0x6c5a724eUL, 0x62537f45UL, 0x486c5c74UL, 0x4665517fUL, 0x547e4662UL, 0x5a774b69UL,
|
||||
0xe090d0b0UL, 0xee99ddbbUL, 0xfc82caa6UL, 0xf28bc7adUL, 0xd8b4e49cUL, 0xd6bde997UL, 0xc4a6fe8aUL, 0xcaaff381UL,
|
||||
0x90d8b8e8UL, 0x9ed1b5e3UL, 0x8ccaa2feUL, 0x82c3aff5UL, 0xa8fc8cc4UL, 0xa6f581cfUL, 0xb4ee96d2UL, 0xbae79bd9UL,
|
||||
0xdb3bbb7bUL, 0xd532b670UL, 0xc729a16dUL, 0xc920ac66UL, 0xe31f8f57UL, 0xed16825cUL, 0xff0d9541UL, 0xf104984aUL,
|
||||
0xab73d323UL, 0xa57ade28UL, 0xb761c935UL, 0xb968c43eUL, 0x9357e70fUL, 0x9d5eea04UL, 0x8f45fd19UL, 0x814cf012UL,
|
||||
0x3bab6bcbUL, 0x35a266c0UL, 0x27b971ddUL, 0x29b07cd6UL, 0x038f5fe7UL, 0x0d8652ecUL, 0x1f9d45f1UL, 0x119448faUL,
|
||||
0x4be30393UL, 0x45ea0e98UL, 0x57f11985UL, 0x59f8148eUL, 0x73c737bfUL, 0x7dce3ab4UL, 0x6fd52da9UL, 0x61dc20a2UL,
|
||||
0xad766df6UL, 0xa37f60fdUL, 0xb16477e0UL, 0xbf6d7aebUL, 0x955259daUL, 0x9b5b54d1UL, 0x894043ccUL, 0x87494ec7UL,
|
||||
0xdd3e05aeUL, 0xd33708a5UL, 0xc12c1fb8UL, 0xcf2512b3UL, 0xe51a3182UL, 0xeb133c89UL, 0xf9082b94UL, 0xf701269fUL,
|
||||
0x4de6bd46UL, 0x43efb04dUL, 0x51f4a750UL, 0x5ffdaa5bUL, 0x75c2896aUL, 0x7bcb8461UL, 0x69d0937cUL, 0x67d99e77UL,
|
||||
0x3daed51eUL, 0x33a7d815UL, 0x21bccf08UL, 0x2fb5c203UL, 0x058ae132UL, 0x0b83ec39UL, 0x1998fb24UL, 0x1791f62fUL,
|
||||
0x764dd68dUL, 0x7844db86UL, 0x6a5fcc9bUL, 0x6456c190UL, 0x4e69e2a1UL, 0x4060efaaUL, 0x527bf8b7UL, 0x5c72f5bcUL,
|
||||
0x0605bed5UL, 0x080cb3deUL, 0x1a17a4c3UL, 0x141ea9c8UL, 0x3e218af9UL, 0x302887f2UL, 0x223390efUL, 0x2c3a9de4UL,
|
||||
0x96dd063dUL, 0x98d40b36UL, 0x8acf1c2bUL, 0x84c61120UL, 0xaef93211UL, 0xa0f03f1aUL, 0xb2eb2807UL, 0xbce2250cUL,
|
||||
0xe6956e65UL, 0xe89c636eUL, 0xfa877473UL, 0xf48e7978UL, 0xdeb15a49UL, 0xd0b85742UL, 0xc2a3405fUL, 0xccaa4d54UL,
|
||||
0x41ecdaf7UL, 0x4fe5d7fcUL, 0x5dfec0e1UL, 0x53f7cdeaUL, 0x79c8eedbUL, 0x77c1e3d0UL, 0x65daf4cdUL, 0x6bd3f9c6UL,
|
||||
0x31a4b2afUL, 0x3fadbfa4UL, 0x2db6a8b9UL, 0x23bfa5b2UL, 0x09808683UL, 0x07898b88UL, 0x15929c95UL, 0x1b9b919eUL,
|
||||
0xa17c0a47UL, 0xaf75074cUL, 0xbd6e1051UL, 0xb3671d5aUL, 0x99583e6bUL, 0x97513360UL, 0x854a247dUL, 0x8b432976UL,
|
||||
0xd134621fUL, 0xdf3d6f14UL, 0xcd267809UL, 0xc32f7502UL, 0xe9105633UL, 0xe7195b38UL, 0xf5024c25UL, 0xfb0b412eUL,
|
||||
0x9ad7618cUL, 0x94de6c87UL, 0x86c57b9aUL, 0x88cc7691UL, 0xa2f355a0UL, 0xacfa58abUL, 0xbee14fb6UL, 0xb0e842bdUL,
|
||||
0xea9f09d4UL, 0xe49604dfUL, 0xf68d13c2UL, 0xf8841ec9UL, 0xd2bb3df8UL, 0xdcb230f3UL, 0xcea927eeUL, 0xc0a02ae5UL,
|
||||
0x7a47b13cUL, 0x744ebc37UL, 0x6655ab2aUL, 0x685ca621UL, 0x42638510UL, 0x4c6a881bUL, 0x5e719f06UL, 0x5078920dUL,
|
||||
0x0a0fd964UL, 0x0406d46fUL, 0x161dc372UL, 0x1814ce79UL, 0x322bed48UL, 0x3c22e043UL, 0x2e39f75eUL, 0x2030fa55UL,
|
||||
0xec9ab701UL, 0xe293ba0aUL, 0xf088ad17UL, 0xfe81a01cUL, 0xd4be832dUL, 0xdab78e26UL, 0xc8ac993bUL, 0xc6a59430UL,
|
||||
0x9cd2df59UL, 0x92dbd252UL, 0x80c0c54fUL, 0x8ec9c844UL, 0xa4f6eb75UL, 0xaaffe67eUL, 0xb8e4f163UL, 0xb6edfc68UL,
|
||||
0x0c0a67b1UL, 0x02036abaUL, 0x10187da7UL, 0x1e1170acUL, 0x342e539dUL, 0x3a275e96UL, 0x283c498bUL, 0x26354480UL,
|
||||
0x7c420fe9UL, 0x724b02e2UL, 0x605015ffUL, 0x6e5918f4UL, 0x44663bc5UL, 0x4a6f36ceUL, 0x587421d3UL, 0x567d2cd8UL,
|
||||
0x37a10c7aUL, 0x39a80171UL, 0x2bb3166cUL, 0x25ba1b67UL, 0x0f853856UL, 0x018c355dUL, 0x13972240UL, 0x1d9e2f4bUL,
|
||||
0x47e96422UL, 0x49e06929UL, 0x5bfb7e34UL, 0x55f2733fUL, 0x7fcd500eUL, 0x71c45d05UL, 0x63df4a18UL, 0x6dd64713UL,
|
||||
0xd731dccaUL, 0xd938d1c1UL, 0xcb23c6dcUL, 0xc52acbd7UL, 0xef15e8e6UL, 0xe11ce5edUL, 0xf307f2f0UL, 0xfd0efffbUL,
|
||||
0xa779b492UL, 0xa970b999UL, 0xbb6bae84UL, 0xb562a38fUL, 0x9f5d80beUL, 0x91548db5UL, 0x834f9aa8UL, 0x8d4697a3UL
|
||||
};
|
||||
|
||||
static const ulong32 Tks1[] = {
|
||||
0x00000000UL, 0x0b0e090dUL, 0x161c121aUL, 0x1d121b17UL, 0x2c382434UL, 0x27362d39UL, 0x3a24362eUL, 0x312a3f23UL,
|
||||
0x58704868UL, 0x537e4165UL, 0x4e6c5a72UL, 0x4562537fUL, 0x74486c5cUL, 0x7f466551UL, 0x62547e46UL, 0x695a774bUL,
|
||||
0xb0e090d0UL, 0xbbee99ddUL, 0xa6fc82caUL, 0xadf28bc7UL, 0x9cd8b4e4UL, 0x97d6bde9UL, 0x8ac4a6feUL, 0x81caaff3UL,
|
||||
0xe890d8b8UL, 0xe39ed1b5UL, 0xfe8ccaa2UL, 0xf582c3afUL, 0xc4a8fc8cUL, 0xcfa6f581UL, 0xd2b4ee96UL, 0xd9bae79bUL,
|
||||
0x7bdb3bbbUL, 0x70d532b6UL, 0x6dc729a1UL, 0x66c920acUL, 0x57e31f8fUL, 0x5ced1682UL, 0x41ff0d95UL, 0x4af10498UL,
|
||||
0x23ab73d3UL, 0x28a57adeUL, 0x35b761c9UL, 0x3eb968c4UL, 0x0f9357e7UL, 0x049d5eeaUL, 0x198f45fdUL, 0x12814cf0UL,
|
||||
0xcb3bab6bUL, 0xc035a266UL, 0xdd27b971UL, 0xd629b07cUL, 0xe7038f5fUL, 0xec0d8652UL, 0xf11f9d45UL, 0xfa119448UL,
|
||||
0x934be303UL, 0x9845ea0eUL, 0x8557f119UL, 0x8e59f814UL, 0xbf73c737UL, 0xb47dce3aUL, 0xa96fd52dUL, 0xa261dc20UL,
|
||||
0xf6ad766dUL, 0xfda37f60UL, 0xe0b16477UL, 0xebbf6d7aUL, 0xda955259UL, 0xd19b5b54UL, 0xcc894043UL, 0xc787494eUL,
|
||||
0xaedd3e05UL, 0xa5d33708UL, 0xb8c12c1fUL, 0xb3cf2512UL, 0x82e51a31UL, 0x89eb133cUL, 0x94f9082bUL, 0x9ff70126UL,
|
||||
0x464de6bdUL, 0x4d43efb0UL, 0x5051f4a7UL, 0x5b5ffdaaUL, 0x6a75c289UL, 0x617bcb84UL, 0x7c69d093UL, 0x7767d99eUL,
|
||||
0x1e3daed5UL, 0x1533a7d8UL, 0x0821bccfUL, 0x032fb5c2UL, 0x32058ae1UL, 0x390b83ecUL, 0x241998fbUL, 0x2f1791f6UL,
|
||||
0x8d764dd6UL, 0x867844dbUL, 0x9b6a5fccUL, 0x906456c1UL, 0xa14e69e2UL, 0xaa4060efUL, 0xb7527bf8UL, 0xbc5c72f5UL,
|
||||
0xd50605beUL, 0xde080cb3UL, 0xc31a17a4UL, 0xc8141ea9UL, 0xf93e218aUL, 0xf2302887UL, 0xef223390UL, 0xe42c3a9dUL,
|
||||
0x3d96dd06UL, 0x3698d40bUL, 0x2b8acf1cUL, 0x2084c611UL, 0x11aef932UL, 0x1aa0f03fUL, 0x07b2eb28UL, 0x0cbce225UL,
|
||||
0x65e6956eUL, 0x6ee89c63UL, 0x73fa8774UL, 0x78f48e79UL, 0x49deb15aUL, 0x42d0b857UL, 0x5fc2a340UL, 0x54ccaa4dUL,
|
||||
0xf741ecdaUL, 0xfc4fe5d7UL, 0xe15dfec0UL, 0xea53f7cdUL, 0xdb79c8eeUL, 0xd077c1e3UL, 0xcd65daf4UL, 0xc66bd3f9UL,
|
||||
0xaf31a4b2UL, 0xa43fadbfUL, 0xb92db6a8UL, 0xb223bfa5UL, 0x83098086UL, 0x8807898bUL, 0x9515929cUL, 0x9e1b9b91UL,
|
||||
0x47a17c0aUL, 0x4caf7507UL, 0x51bd6e10UL, 0x5ab3671dUL, 0x6b99583eUL, 0x60975133UL, 0x7d854a24UL, 0x768b4329UL,
|
||||
0x1fd13462UL, 0x14df3d6fUL, 0x09cd2678UL, 0x02c32f75UL, 0x33e91056UL, 0x38e7195bUL, 0x25f5024cUL, 0x2efb0b41UL,
|
||||
0x8c9ad761UL, 0x8794de6cUL, 0x9a86c57bUL, 0x9188cc76UL, 0xa0a2f355UL, 0xabacfa58UL, 0xb6bee14fUL, 0xbdb0e842UL,
|
||||
0xd4ea9f09UL, 0xdfe49604UL, 0xc2f68d13UL, 0xc9f8841eUL, 0xf8d2bb3dUL, 0xf3dcb230UL, 0xeecea927UL, 0xe5c0a02aUL,
|
||||
0x3c7a47b1UL, 0x37744ebcUL, 0x2a6655abUL, 0x21685ca6UL, 0x10426385UL, 0x1b4c6a88UL, 0x065e719fUL, 0x0d507892UL,
|
||||
0x640a0fd9UL, 0x6f0406d4UL, 0x72161dc3UL, 0x791814ceUL, 0x48322bedUL, 0x433c22e0UL, 0x5e2e39f7UL, 0x552030faUL,
|
||||
0x01ec9ab7UL, 0x0ae293baUL, 0x17f088adUL, 0x1cfe81a0UL, 0x2dd4be83UL, 0x26dab78eUL, 0x3bc8ac99UL, 0x30c6a594UL,
|
||||
0x599cd2dfUL, 0x5292dbd2UL, 0x4f80c0c5UL, 0x448ec9c8UL, 0x75a4f6ebUL, 0x7eaaffe6UL, 0x63b8e4f1UL, 0x68b6edfcUL,
|
||||
0xb10c0a67UL, 0xba02036aUL, 0xa710187dUL, 0xac1e1170UL, 0x9d342e53UL, 0x963a275eUL, 0x8b283c49UL, 0x80263544UL,
|
||||
0xe97c420fUL, 0xe2724b02UL, 0xff605015UL, 0xf46e5918UL, 0xc544663bUL, 0xce4a6f36UL, 0xd3587421UL, 0xd8567d2cUL,
|
||||
0x7a37a10cUL, 0x7139a801UL, 0x6c2bb316UL, 0x6725ba1bUL, 0x560f8538UL, 0x5d018c35UL, 0x40139722UL, 0x4b1d9e2fUL,
|
||||
0x2247e964UL, 0x2949e069UL, 0x345bfb7eUL, 0x3f55f273UL, 0x0e7fcd50UL, 0x0571c45dUL, 0x1863df4aUL, 0x136dd647UL,
|
||||
0xcad731dcUL, 0xc1d938d1UL, 0xdccb23c6UL, 0xd7c52acbUL, 0xe6ef15e8UL, 0xede11ce5UL, 0xf0f307f2UL, 0xfbfd0effUL,
|
||||
0x00000000UL, 0x0b0e090dUL, 0x161c121aUL, 0x1d121b17UL, 0x2c382434UL, 0x27362d39UL, 0x3a24362eUL, 0x312a3f23UL,
|
||||
0x58704868UL, 0x537e4165UL, 0x4e6c5a72UL, 0x4562537fUL, 0x74486c5cUL, 0x7f466551UL, 0x62547e46UL, 0x695a774bUL,
|
||||
0xb0e090d0UL, 0xbbee99ddUL, 0xa6fc82caUL, 0xadf28bc7UL, 0x9cd8b4e4UL, 0x97d6bde9UL, 0x8ac4a6feUL, 0x81caaff3UL,
|
||||
0xe890d8b8UL, 0xe39ed1b5UL, 0xfe8ccaa2UL, 0xf582c3afUL, 0xc4a8fc8cUL, 0xcfa6f581UL, 0xd2b4ee96UL, 0xd9bae79bUL,
|
||||
0x7bdb3bbbUL, 0x70d532b6UL, 0x6dc729a1UL, 0x66c920acUL, 0x57e31f8fUL, 0x5ced1682UL, 0x41ff0d95UL, 0x4af10498UL,
|
||||
0x23ab73d3UL, 0x28a57adeUL, 0x35b761c9UL, 0x3eb968c4UL, 0x0f9357e7UL, 0x049d5eeaUL, 0x198f45fdUL, 0x12814cf0UL,
|
||||
0xcb3bab6bUL, 0xc035a266UL, 0xdd27b971UL, 0xd629b07cUL, 0xe7038f5fUL, 0xec0d8652UL, 0xf11f9d45UL, 0xfa119448UL,
|
||||
0x934be303UL, 0x9845ea0eUL, 0x8557f119UL, 0x8e59f814UL, 0xbf73c737UL, 0xb47dce3aUL, 0xa96fd52dUL, 0xa261dc20UL,
|
||||
0xf6ad766dUL, 0xfda37f60UL, 0xe0b16477UL, 0xebbf6d7aUL, 0xda955259UL, 0xd19b5b54UL, 0xcc894043UL, 0xc787494eUL,
|
||||
0xaedd3e05UL, 0xa5d33708UL, 0xb8c12c1fUL, 0xb3cf2512UL, 0x82e51a31UL, 0x89eb133cUL, 0x94f9082bUL, 0x9ff70126UL,
|
||||
0x464de6bdUL, 0x4d43efb0UL, 0x5051f4a7UL, 0x5b5ffdaaUL, 0x6a75c289UL, 0x617bcb84UL, 0x7c69d093UL, 0x7767d99eUL,
|
||||
0x1e3daed5UL, 0x1533a7d8UL, 0x0821bccfUL, 0x032fb5c2UL, 0x32058ae1UL, 0x390b83ecUL, 0x241998fbUL, 0x2f1791f6UL,
|
||||
0x8d764dd6UL, 0x867844dbUL, 0x9b6a5fccUL, 0x906456c1UL, 0xa14e69e2UL, 0xaa4060efUL, 0xb7527bf8UL, 0xbc5c72f5UL,
|
||||
0xd50605beUL, 0xde080cb3UL, 0xc31a17a4UL, 0xc8141ea9UL, 0xf93e218aUL, 0xf2302887UL, 0xef223390UL, 0xe42c3a9dUL,
|
||||
0x3d96dd06UL, 0x3698d40bUL, 0x2b8acf1cUL, 0x2084c611UL, 0x11aef932UL, 0x1aa0f03fUL, 0x07b2eb28UL, 0x0cbce225UL,
|
||||
0x65e6956eUL, 0x6ee89c63UL, 0x73fa8774UL, 0x78f48e79UL, 0x49deb15aUL, 0x42d0b857UL, 0x5fc2a340UL, 0x54ccaa4dUL,
|
||||
0xf741ecdaUL, 0xfc4fe5d7UL, 0xe15dfec0UL, 0xea53f7cdUL, 0xdb79c8eeUL, 0xd077c1e3UL, 0xcd65daf4UL, 0xc66bd3f9UL,
|
||||
0xaf31a4b2UL, 0xa43fadbfUL, 0xb92db6a8UL, 0xb223bfa5UL, 0x83098086UL, 0x8807898bUL, 0x9515929cUL, 0x9e1b9b91UL,
|
||||
0x47a17c0aUL, 0x4caf7507UL, 0x51bd6e10UL, 0x5ab3671dUL, 0x6b99583eUL, 0x60975133UL, 0x7d854a24UL, 0x768b4329UL,
|
||||
0x1fd13462UL, 0x14df3d6fUL, 0x09cd2678UL, 0x02c32f75UL, 0x33e91056UL, 0x38e7195bUL, 0x25f5024cUL, 0x2efb0b41UL,
|
||||
0x8c9ad761UL, 0x8794de6cUL, 0x9a86c57bUL, 0x9188cc76UL, 0xa0a2f355UL, 0xabacfa58UL, 0xb6bee14fUL, 0xbdb0e842UL,
|
||||
0xd4ea9f09UL, 0xdfe49604UL, 0xc2f68d13UL, 0xc9f8841eUL, 0xf8d2bb3dUL, 0xf3dcb230UL, 0xeecea927UL, 0xe5c0a02aUL,
|
||||
0x3c7a47b1UL, 0x37744ebcUL, 0x2a6655abUL, 0x21685ca6UL, 0x10426385UL, 0x1b4c6a88UL, 0x065e719fUL, 0x0d507892UL,
|
||||
0x640a0fd9UL, 0x6f0406d4UL, 0x72161dc3UL, 0x791814ceUL, 0x48322bedUL, 0x433c22e0UL, 0x5e2e39f7UL, 0x552030faUL,
|
||||
0x01ec9ab7UL, 0x0ae293baUL, 0x17f088adUL, 0x1cfe81a0UL, 0x2dd4be83UL, 0x26dab78eUL, 0x3bc8ac99UL, 0x30c6a594UL,
|
||||
0x599cd2dfUL, 0x5292dbd2UL, 0x4f80c0c5UL, 0x448ec9c8UL, 0x75a4f6ebUL, 0x7eaaffe6UL, 0x63b8e4f1UL, 0x68b6edfcUL,
|
||||
0xb10c0a67UL, 0xba02036aUL, 0xa710187dUL, 0xac1e1170UL, 0x9d342e53UL, 0x963a275eUL, 0x8b283c49UL, 0x80263544UL,
|
||||
0xe97c420fUL, 0xe2724b02UL, 0xff605015UL, 0xf46e5918UL, 0xc544663bUL, 0xce4a6f36UL, 0xd3587421UL, 0xd8567d2cUL,
|
||||
0x7a37a10cUL, 0x7139a801UL, 0x6c2bb316UL, 0x6725ba1bUL, 0x560f8538UL, 0x5d018c35UL, 0x40139722UL, 0x4b1d9e2fUL,
|
||||
0x2247e964UL, 0x2949e069UL, 0x345bfb7eUL, 0x3f55f273UL, 0x0e7fcd50UL, 0x0571c45dUL, 0x1863df4aUL, 0x136dd647UL,
|
||||
0xcad731dcUL, 0xc1d938d1UL, 0xdccb23c6UL, 0xd7c52acbUL, 0xe6ef15e8UL, 0xede11ce5UL, 0xf0f307f2UL, 0xfbfd0effUL,
|
||||
0x92a779b4UL, 0x99a970b9UL, 0x84bb6baeUL, 0x8fb562a3UL, 0xbe9f5d80UL, 0xb591548dUL, 0xa8834f9aUL, 0xa38d4697UL
|
||||
};
|
||||
|
||||
static const ulong32 Tks2[] = {
|
||||
0x00000000UL, 0x0d0b0e09UL, 0x1a161c12UL, 0x171d121bUL, 0x342c3824UL, 0x3927362dUL, 0x2e3a2436UL, 0x23312a3fUL,
|
||||
0x68587048UL, 0x65537e41UL, 0x724e6c5aUL, 0x7f456253UL, 0x5c74486cUL, 0x517f4665UL, 0x4662547eUL, 0x4b695a77UL,
|
||||
0xd0b0e090UL, 0xddbbee99UL, 0xcaa6fc82UL, 0xc7adf28bUL, 0xe49cd8b4UL, 0xe997d6bdUL, 0xfe8ac4a6UL, 0xf381caafUL,
|
||||
0xb8e890d8UL, 0xb5e39ed1UL, 0xa2fe8ccaUL, 0xaff582c3UL, 0x8cc4a8fcUL, 0x81cfa6f5UL, 0x96d2b4eeUL, 0x9bd9bae7UL,
|
||||
0xbb7bdb3bUL, 0xb670d532UL, 0xa16dc729UL, 0xac66c920UL, 0x8f57e31fUL, 0x825ced16UL, 0x9541ff0dUL, 0x984af104UL,
|
||||
0xd323ab73UL, 0xde28a57aUL, 0xc935b761UL, 0xc43eb968UL, 0xe70f9357UL, 0xea049d5eUL, 0xfd198f45UL, 0xf012814cUL,
|
||||
0x6bcb3babUL, 0x66c035a2UL, 0x71dd27b9UL, 0x7cd629b0UL, 0x5fe7038fUL, 0x52ec0d86UL, 0x45f11f9dUL, 0x48fa1194UL,
|
||||
0x03934be3UL, 0x0e9845eaUL, 0x198557f1UL, 0x148e59f8UL, 0x37bf73c7UL, 0x3ab47dceUL, 0x2da96fd5UL, 0x20a261dcUL,
|
||||
0x6df6ad76UL, 0x60fda37fUL, 0x77e0b164UL, 0x7aebbf6dUL, 0x59da9552UL, 0x54d19b5bUL, 0x43cc8940UL, 0x4ec78749UL,
|
||||
0x05aedd3eUL, 0x08a5d337UL, 0x1fb8c12cUL, 0x12b3cf25UL, 0x3182e51aUL, 0x3c89eb13UL, 0x2b94f908UL, 0x269ff701UL,
|
||||
0xbd464de6UL, 0xb04d43efUL, 0xa75051f4UL, 0xaa5b5ffdUL, 0x896a75c2UL, 0x84617bcbUL, 0x937c69d0UL, 0x9e7767d9UL,
|
||||
0xd51e3daeUL, 0xd81533a7UL, 0xcf0821bcUL, 0xc2032fb5UL, 0xe132058aUL, 0xec390b83UL, 0xfb241998UL, 0xf62f1791UL,
|
||||
0xd68d764dUL, 0xdb867844UL, 0xcc9b6a5fUL, 0xc1906456UL, 0xe2a14e69UL, 0xefaa4060UL, 0xf8b7527bUL, 0xf5bc5c72UL,
|
||||
0xbed50605UL, 0xb3de080cUL, 0xa4c31a17UL, 0xa9c8141eUL, 0x8af93e21UL, 0x87f23028UL, 0x90ef2233UL, 0x9de42c3aUL,
|
||||
0x063d96ddUL, 0x0b3698d4UL, 0x1c2b8acfUL, 0x112084c6UL, 0x3211aef9UL, 0x3f1aa0f0UL, 0x2807b2ebUL, 0x250cbce2UL,
|
||||
0x6e65e695UL, 0x636ee89cUL, 0x7473fa87UL, 0x7978f48eUL, 0x5a49deb1UL, 0x5742d0b8UL, 0x405fc2a3UL, 0x4d54ccaaUL,
|
||||
0xdaf741ecUL, 0xd7fc4fe5UL, 0xc0e15dfeUL, 0xcdea53f7UL, 0xeedb79c8UL, 0xe3d077c1UL, 0xf4cd65daUL, 0xf9c66bd3UL,
|
||||
0xb2af31a4UL, 0xbfa43fadUL, 0xa8b92db6UL, 0xa5b223bfUL, 0x86830980UL, 0x8b880789UL, 0x9c951592UL, 0x919e1b9bUL,
|
||||
0x0a47a17cUL, 0x074caf75UL, 0x1051bd6eUL, 0x1d5ab367UL, 0x3e6b9958UL, 0x33609751UL, 0x247d854aUL, 0x29768b43UL,
|
||||
0x621fd134UL, 0x6f14df3dUL, 0x7809cd26UL, 0x7502c32fUL, 0x5633e910UL, 0x5b38e719UL, 0x4c25f502UL, 0x412efb0bUL,
|
||||
0x618c9ad7UL, 0x6c8794deUL, 0x7b9a86c5UL, 0x769188ccUL, 0x55a0a2f3UL, 0x58abacfaUL, 0x4fb6bee1UL, 0x42bdb0e8UL,
|
||||
0x09d4ea9fUL, 0x04dfe496UL, 0x13c2f68dUL, 0x1ec9f884UL, 0x3df8d2bbUL, 0x30f3dcb2UL, 0x27eecea9UL, 0x2ae5c0a0UL,
|
||||
0xb13c7a47UL, 0xbc37744eUL, 0xab2a6655UL, 0xa621685cUL, 0x85104263UL, 0x881b4c6aUL, 0x9f065e71UL, 0x920d5078UL,
|
||||
0xd9640a0fUL, 0xd46f0406UL, 0xc372161dUL, 0xce791814UL, 0xed48322bUL, 0xe0433c22UL, 0xf75e2e39UL, 0xfa552030UL,
|
||||
0xb701ec9aUL, 0xba0ae293UL, 0xad17f088UL, 0xa01cfe81UL, 0x832dd4beUL, 0x8e26dab7UL, 0x993bc8acUL, 0x9430c6a5UL,
|
||||
0xdf599cd2UL, 0xd25292dbUL, 0xc54f80c0UL, 0xc8448ec9UL, 0xeb75a4f6UL, 0xe67eaaffUL, 0xf163b8e4UL, 0xfc68b6edUL,
|
||||
0x67b10c0aUL, 0x6aba0203UL, 0x7da71018UL, 0x70ac1e11UL, 0x539d342eUL, 0x5e963a27UL, 0x498b283cUL, 0x44802635UL,
|
||||
0x0fe97c42UL, 0x02e2724bUL, 0x15ff6050UL, 0x18f46e59UL, 0x3bc54466UL, 0x36ce4a6fUL, 0x21d35874UL, 0x2cd8567dUL,
|
||||
0x0c7a37a1UL, 0x017139a8UL, 0x166c2bb3UL, 0x1b6725baUL, 0x38560f85UL, 0x355d018cUL, 0x22401397UL, 0x2f4b1d9eUL,
|
||||
0x642247e9UL, 0x692949e0UL, 0x7e345bfbUL, 0x733f55f2UL, 0x500e7fcdUL, 0x5d0571c4UL, 0x4a1863dfUL, 0x47136dd6UL,
|
||||
0xdccad731UL, 0xd1c1d938UL, 0xc6dccb23UL, 0xcbd7c52aUL, 0xe8e6ef15UL, 0xe5ede11cUL, 0xf2f0f307UL, 0xfffbfd0eUL,
|
||||
0x00000000UL, 0x0d0b0e09UL, 0x1a161c12UL, 0x171d121bUL, 0x342c3824UL, 0x3927362dUL, 0x2e3a2436UL, 0x23312a3fUL,
|
||||
0x68587048UL, 0x65537e41UL, 0x724e6c5aUL, 0x7f456253UL, 0x5c74486cUL, 0x517f4665UL, 0x4662547eUL, 0x4b695a77UL,
|
||||
0xd0b0e090UL, 0xddbbee99UL, 0xcaa6fc82UL, 0xc7adf28bUL, 0xe49cd8b4UL, 0xe997d6bdUL, 0xfe8ac4a6UL, 0xf381caafUL,
|
||||
0xb8e890d8UL, 0xb5e39ed1UL, 0xa2fe8ccaUL, 0xaff582c3UL, 0x8cc4a8fcUL, 0x81cfa6f5UL, 0x96d2b4eeUL, 0x9bd9bae7UL,
|
||||
0xbb7bdb3bUL, 0xb670d532UL, 0xa16dc729UL, 0xac66c920UL, 0x8f57e31fUL, 0x825ced16UL, 0x9541ff0dUL, 0x984af104UL,
|
||||
0xd323ab73UL, 0xde28a57aUL, 0xc935b761UL, 0xc43eb968UL, 0xe70f9357UL, 0xea049d5eUL, 0xfd198f45UL, 0xf012814cUL,
|
||||
0x6bcb3babUL, 0x66c035a2UL, 0x71dd27b9UL, 0x7cd629b0UL, 0x5fe7038fUL, 0x52ec0d86UL, 0x45f11f9dUL, 0x48fa1194UL,
|
||||
0x03934be3UL, 0x0e9845eaUL, 0x198557f1UL, 0x148e59f8UL, 0x37bf73c7UL, 0x3ab47dceUL, 0x2da96fd5UL, 0x20a261dcUL,
|
||||
0x6df6ad76UL, 0x60fda37fUL, 0x77e0b164UL, 0x7aebbf6dUL, 0x59da9552UL, 0x54d19b5bUL, 0x43cc8940UL, 0x4ec78749UL,
|
||||
0x05aedd3eUL, 0x08a5d337UL, 0x1fb8c12cUL, 0x12b3cf25UL, 0x3182e51aUL, 0x3c89eb13UL, 0x2b94f908UL, 0x269ff701UL,
|
||||
0xbd464de6UL, 0xb04d43efUL, 0xa75051f4UL, 0xaa5b5ffdUL, 0x896a75c2UL, 0x84617bcbUL, 0x937c69d0UL, 0x9e7767d9UL,
|
||||
0xd51e3daeUL, 0xd81533a7UL, 0xcf0821bcUL, 0xc2032fb5UL, 0xe132058aUL, 0xec390b83UL, 0xfb241998UL, 0xf62f1791UL,
|
||||
0xd68d764dUL, 0xdb867844UL, 0xcc9b6a5fUL, 0xc1906456UL, 0xe2a14e69UL, 0xefaa4060UL, 0xf8b7527bUL, 0xf5bc5c72UL,
|
||||
0xbed50605UL, 0xb3de080cUL, 0xa4c31a17UL, 0xa9c8141eUL, 0x8af93e21UL, 0x87f23028UL, 0x90ef2233UL, 0x9de42c3aUL,
|
||||
0x063d96ddUL, 0x0b3698d4UL, 0x1c2b8acfUL, 0x112084c6UL, 0x3211aef9UL, 0x3f1aa0f0UL, 0x2807b2ebUL, 0x250cbce2UL,
|
||||
0x6e65e695UL, 0x636ee89cUL, 0x7473fa87UL, 0x7978f48eUL, 0x5a49deb1UL, 0x5742d0b8UL, 0x405fc2a3UL, 0x4d54ccaaUL,
|
||||
0xdaf741ecUL, 0xd7fc4fe5UL, 0xc0e15dfeUL, 0xcdea53f7UL, 0xeedb79c8UL, 0xe3d077c1UL, 0xf4cd65daUL, 0xf9c66bd3UL,
|
||||
0xb2af31a4UL, 0xbfa43fadUL, 0xa8b92db6UL, 0xa5b223bfUL, 0x86830980UL, 0x8b880789UL, 0x9c951592UL, 0x919e1b9bUL,
|
||||
0x0a47a17cUL, 0x074caf75UL, 0x1051bd6eUL, 0x1d5ab367UL, 0x3e6b9958UL, 0x33609751UL, 0x247d854aUL, 0x29768b43UL,
|
||||
0x621fd134UL, 0x6f14df3dUL, 0x7809cd26UL, 0x7502c32fUL, 0x5633e910UL, 0x5b38e719UL, 0x4c25f502UL, 0x412efb0bUL,
|
||||
0x618c9ad7UL, 0x6c8794deUL, 0x7b9a86c5UL, 0x769188ccUL, 0x55a0a2f3UL, 0x58abacfaUL, 0x4fb6bee1UL, 0x42bdb0e8UL,
|
||||
0x09d4ea9fUL, 0x04dfe496UL, 0x13c2f68dUL, 0x1ec9f884UL, 0x3df8d2bbUL, 0x30f3dcb2UL, 0x27eecea9UL, 0x2ae5c0a0UL,
|
||||
0xb13c7a47UL, 0xbc37744eUL, 0xab2a6655UL, 0xa621685cUL, 0x85104263UL, 0x881b4c6aUL, 0x9f065e71UL, 0x920d5078UL,
|
||||
0xd9640a0fUL, 0xd46f0406UL, 0xc372161dUL, 0xce791814UL, 0xed48322bUL, 0xe0433c22UL, 0xf75e2e39UL, 0xfa552030UL,
|
||||
0xb701ec9aUL, 0xba0ae293UL, 0xad17f088UL, 0xa01cfe81UL, 0x832dd4beUL, 0x8e26dab7UL, 0x993bc8acUL, 0x9430c6a5UL,
|
||||
0xdf599cd2UL, 0xd25292dbUL, 0xc54f80c0UL, 0xc8448ec9UL, 0xeb75a4f6UL, 0xe67eaaffUL, 0xf163b8e4UL, 0xfc68b6edUL,
|
||||
0x67b10c0aUL, 0x6aba0203UL, 0x7da71018UL, 0x70ac1e11UL, 0x539d342eUL, 0x5e963a27UL, 0x498b283cUL, 0x44802635UL,
|
||||
0x0fe97c42UL, 0x02e2724bUL, 0x15ff6050UL, 0x18f46e59UL, 0x3bc54466UL, 0x36ce4a6fUL, 0x21d35874UL, 0x2cd8567dUL,
|
||||
0x0c7a37a1UL, 0x017139a8UL, 0x166c2bb3UL, 0x1b6725baUL, 0x38560f85UL, 0x355d018cUL, 0x22401397UL, 0x2f4b1d9eUL,
|
||||
0x642247e9UL, 0x692949e0UL, 0x7e345bfbUL, 0x733f55f2UL, 0x500e7fcdUL, 0x5d0571c4UL, 0x4a1863dfUL, 0x47136dd6UL,
|
||||
0xdccad731UL, 0xd1c1d938UL, 0xc6dccb23UL, 0xcbd7c52aUL, 0xe8e6ef15UL, 0xe5ede11cUL, 0xf2f0f307UL, 0xfffbfd0eUL,
|
||||
0xb492a779UL, 0xb999a970UL, 0xae84bb6bUL, 0xa38fb562UL, 0x80be9f5dUL, 0x8db59154UL, 0x9aa8834fUL, 0x97a38d46UL
|
||||
};
|
||||
|
||||
static const ulong32 Tks3[] = {
|
||||
0x00000000UL, 0x090d0b0eUL, 0x121a161cUL, 0x1b171d12UL, 0x24342c38UL, 0x2d392736UL, 0x362e3a24UL, 0x3f23312aUL,
|
||||
0x48685870UL, 0x4165537eUL, 0x5a724e6cUL, 0x537f4562UL, 0x6c5c7448UL, 0x65517f46UL, 0x7e466254UL, 0x774b695aUL,
|
||||
0x90d0b0e0UL, 0x99ddbbeeUL, 0x82caa6fcUL, 0x8bc7adf2UL, 0xb4e49cd8UL, 0xbde997d6UL, 0xa6fe8ac4UL, 0xaff381caUL,
|
||||
0xd8b8e890UL, 0xd1b5e39eUL, 0xcaa2fe8cUL, 0xc3aff582UL, 0xfc8cc4a8UL, 0xf581cfa6UL, 0xee96d2b4UL, 0xe79bd9baUL,
|
||||
0x3bbb7bdbUL, 0x32b670d5UL, 0x29a16dc7UL, 0x20ac66c9UL, 0x1f8f57e3UL, 0x16825cedUL, 0x0d9541ffUL, 0x04984af1UL,
|
||||
0x73d323abUL, 0x7ade28a5UL, 0x61c935b7UL, 0x68c43eb9UL, 0x57e70f93UL, 0x5eea049dUL, 0x45fd198fUL, 0x4cf01281UL,
|
||||
0xab6bcb3bUL, 0xa266c035UL, 0xb971dd27UL, 0xb07cd629UL, 0x8f5fe703UL, 0x8652ec0dUL, 0x9d45f11fUL, 0x9448fa11UL,
|
||||
0xe303934bUL, 0xea0e9845UL, 0xf1198557UL, 0xf8148e59UL, 0xc737bf73UL, 0xce3ab47dUL, 0xd52da96fUL, 0xdc20a261UL,
|
||||
0x766df6adUL, 0x7f60fda3UL, 0x6477e0b1UL, 0x6d7aebbfUL, 0x5259da95UL, 0x5b54d19bUL, 0x4043cc89UL, 0x494ec787UL,
|
||||
0x3e05aeddUL, 0x3708a5d3UL, 0x2c1fb8c1UL, 0x2512b3cfUL, 0x1a3182e5UL, 0x133c89ebUL, 0x082b94f9UL, 0x01269ff7UL,
|
||||
0xe6bd464dUL, 0xefb04d43UL, 0xf4a75051UL, 0xfdaa5b5fUL, 0xc2896a75UL, 0xcb84617bUL, 0xd0937c69UL, 0xd99e7767UL,
|
||||
0xaed51e3dUL, 0xa7d81533UL, 0xbccf0821UL, 0xb5c2032fUL, 0x8ae13205UL, 0x83ec390bUL, 0x98fb2419UL, 0x91f62f17UL,
|
||||
0x4dd68d76UL, 0x44db8678UL, 0x5fcc9b6aUL, 0x56c19064UL, 0x69e2a14eUL, 0x60efaa40UL, 0x7bf8b752UL, 0x72f5bc5cUL,
|
||||
0x05bed506UL, 0x0cb3de08UL, 0x17a4c31aUL, 0x1ea9c814UL, 0x218af93eUL, 0x2887f230UL, 0x3390ef22UL, 0x3a9de42cUL,
|
||||
0xdd063d96UL, 0xd40b3698UL, 0xcf1c2b8aUL, 0xc6112084UL, 0xf93211aeUL, 0xf03f1aa0UL, 0xeb2807b2UL, 0xe2250cbcUL,
|
||||
0x956e65e6UL, 0x9c636ee8UL, 0x877473faUL, 0x8e7978f4UL, 0xb15a49deUL, 0xb85742d0UL, 0xa3405fc2UL, 0xaa4d54ccUL,
|
||||
0xecdaf741UL, 0xe5d7fc4fUL, 0xfec0e15dUL, 0xf7cdea53UL, 0xc8eedb79UL, 0xc1e3d077UL, 0xdaf4cd65UL, 0xd3f9c66bUL,
|
||||
0xa4b2af31UL, 0xadbfa43fUL, 0xb6a8b92dUL, 0xbfa5b223UL, 0x80868309UL, 0x898b8807UL, 0x929c9515UL, 0x9b919e1bUL,
|
||||
0x7c0a47a1UL, 0x75074cafUL, 0x6e1051bdUL, 0x671d5ab3UL, 0x583e6b99UL, 0x51336097UL, 0x4a247d85UL, 0x4329768bUL,
|
||||
0x34621fd1UL, 0x3d6f14dfUL, 0x267809cdUL, 0x2f7502c3UL, 0x105633e9UL, 0x195b38e7UL, 0x024c25f5UL, 0x0b412efbUL,
|
||||
0xd7618c9aUL, 0xde6c8794UL, 0xc57b9a86UL, 0xcc769188UL, 0xf355a0a2UL, 0xfa58abacUL, 0xe14fb6beUL, 0xe842bdb0UL,
|
||||
0x9f09d4eaUL, 0x9604dfe4UL, 0x8d13c2f6UL, 0x841ec9f8UL, 0xbb3df8d2UL, 0xb230f3dcUL, 0xa927eeceUL, 0xa02ae5c0UL,
|
||||
0x47b13c7aUL, 0x4ebc3774UL, 0x55ab2a66UL, 0x5ca62168UL, 0x63851042UL, 0x6a881b4cUL, 0x719f065eUL, 0x78920d50UL,
|
||||
0x0fd9640aUL, 0x06d46f04UL, 0x1dc37216UL, 0x14ce7918UL, 0x2bed4832UL, 0x22e0433cUL, 0x39f75e2eUL, 0x30fa5520UL,
|
||||
0x9ab701ecUL, 0x93ba0ae2UL, 0x88ad17f0UL, 0x81a01cfeUL, 0xbe832dd4UL, 0xb78e26daUL, 0xac993bc8UL, 0xa59430c6UL,
|
||||
0xd2df599cUL, 0xdbd25292UL, 0xc0c54f80UL, 0xc9c8448eUL, 0xf6eb75a4UL, 0xffe67eaaUL, 0xe4f163b8UL, 0xedfc68b6UL,
|
||||
0x0a67b10cUL, 0x036aba02UL, 0x187da710UL, 0x1170ac1eUL, 0x2e539d34UL, 0x275e963aUL, 0x3c498b28UL, 0x35448026UL,
|
||||
0x420fe97cUL, 0x4b02e272UL, 0x5015ff60UL, 0x5918f46eUL, 0x663bc544UL, 0x6f36ce4aUL, 0x7421d358UL, 0x7d2cd856UL,
|
||||
0xa10c7a37UL, 0xa8017139UL, 0xb3166c2bUL, 0xba1b6725UL, 0x8538560fUL, 0x8c355d01UL, 0x97224013UL, 0x9e2f4b1dUL,
|
||||
0xe9642247UL, 0xe0692949UL, 0xfb7e345bUL, 0xf2733f55UL, 0xcd500e7fUL, 0xc45d0571UL, 0xdf4a1863UL, 0xd647136dUL,
|
||||
0x31dccad7UL, 0x38d1c1d9UL, 0x23c6dccbUL, 0x2acbd7c5UL, 0x15e8e6efUL, 0x1ce5ede1UL, 0x07f2f0f3UL, 0x0efffbfdUL,
|
||||
0x00000000UL, 0x090d0b0eUL, 0x121a161cUL, 0x1b171d12UL, 0x24342c38UL, 0x2d392736UL, 0x362e3a24UL, 0x3f23312aUL,
|
||||
0x48685870UL, 0x4165537eUL, 0x5a724e6cUL, 0x537f4562UL, 0x6c5c7448UL, 0x65517f46UL, 0x7e466254UL, 0x774b695aUL,
|
||||
0x90d0b0e0UL, 0x99ddbbeeUL, 0x82caa6fcUL, 0x8bc7adf2UL, 0xb4e49cd8UL, 0xbde997d6UL, 0xa6fe8ac4UL, 0xaff381caUL,
|
||||
0xd8b8e890UL, 0xd1b5e39eUL, 0xcaa2fe8cUL, 0xc3aff582UL, 0xfc8cc4a8UL, 0xf581cfa6UL, 0xee96d2b4UL, 0xe79bd9baUL,
|
||||
0x3bbb7bdbUL, 0x32b670d5UL, 0x29a16dc7UL, 0x20ac66c9UL, 0x1f8f57e3UL, 0x16825cedUL, 0x0d9541ffUL, 0x04984af1UL,
|
||||
0x73d323abUL, 0x7ade28a5UL, 0x61c935b7UL, 0x68c43eb9UL, 0x57e70f93UL, 0x5eea049dUL, 0x45fd198fUL, 0x4cf01281UL,
|
||||
0xab6bcb3bUL, 0xa266c035UL, 0xb971dd27UL, 0xb07cd629UL, 0x8f5fe703UL, 0x8652ec0dUL, 0x9d45f11fUL, 0x9448fa11UL,
|
||||
0xe303934bUL, 0xea0e9845UL, 0xf1198557UL, 0xf8148e59UL, 0xc737bf73UL, 0xce3ab47dUL, 0xd52da96fUL, 0xdc20a261UL,
|
||||
0x766df6adUL, 0x7f60fda3UL, 0x6477e0b1UL, 0x6d7aebbfUL, 0x5259da95UL, 0x5b54d19bUL, 0x4043cc89UL, 0x494ec787UL,
|
||||
0x3e05aeddUL, 0x3708a5d3UL, 0x2c1fb8c1UL, 0x2512b3cfUL, 0x1a3182e5UL, 0x133c89ebUL, 0x082b94f9UL, 0x01269ff7UL,
|
||||
0xe6bd464dUL, 0xefb04d43UL, 0xf4a75051UL, 0xfdaa5b5fUL, 0xc2896a75UL, 0xcb84617bUL, 0xd0937c69UL, 0xd99e7767UL,
|
||||
0xaed51e3dUL, 0xa7d81533UL, 0xbccf0821UL, 0xb5c2032fUL, 0x8ae13205UL, 0x83ec390bUL, 0x98fb2419UL, 0x91f62f17UL,
|
||||
0x4dd68d76UL, 0x44db8678UL, 0x5fcc9b6aUL, 0x56c19064UL, 0x69e2a14eUL, 0x60efaa40UL, 0x7bf8b752UL, 0x72f5bc5cUL,
|
||||
0x05bed506UL, 0x0cb3de08UL, 0x17a4c31aUL, 0x1ea9c814UL, 0x218af93eUL, 0x2887f230UL, 0x3390ef22UL, 0x3a9de42cUL,
|
||||
0xdd063d96UL, 0xd40b3698UL, 0xcf1c2b8aUL, 0xc6112084UL, 0xf93211aeUL, 0xf03f1aa0UL, 0xeb2807b2UL, 0xe2250cbcUL,
|
||||
0x956e65e6UL, 0x9c636ee8UL, 0x877473faUL, 0x8e7978f4UL, 0xb15a49deUL, 0xb85742d0UL, 0xa3405fc2UL, 0xaa4d54ccUL,
|
||||
0xecdaf741UL, 0xe5d7fc4fUL, 0xfec0e15dUL, 0xf7cdea53UL, 0xc8eedb79UL, 0xc1e3d077UL, 0xdaf4cd65UL, 0xd3f9c66bUL,
|
||||
0xa4b2af31UL, 0xadbfa43fUL, 0xb6a8b92dUL, 0xbfa5b223UL, 0x80868309UL, 0x898b8807UL, 0x929c9515UL, 0x9b919e1bUL,
|
||||
0x7c0a47a1UL, 0x75074cafUL, 0x6e1051bdUL, 0x671d5ab3UL, 0x583e6b99UL, 0x51336097UL, 0x4a247d85UL, 0x4329768bUL,
|
||||
0x34621fd1UL, 0x3d6f14dfUL, 0x267809cdUL, 0x2f7502c3UL, 0x105633e9UL, 0x195b38e7UL, 0x024c25f5UL, 0x0b412efbUL,
|
||||
0xd7618c9aUL, 0xde6c8794UL, 0xc57b9a86UL, 0xcc769188UL, 0xf355a0a2UL, 0xfa58abacUL, 0xe14fb6beUL, 0xe842bdb0UL,
|
||||
0x9f09d4eaUL, 0x9604dfe4UL, 0x8d13c2f6UL, 0x841ec9f8UL, 0xbb3df8d2UL, 0xb230f3dcUL, 0xa927eeceUL, 0xa02ae5c0UL,
|
||||
0x47b13c7aUL, 0x4ebc3774UL, 0x55ab2a66UL, 0x5ca62168UL, 0x63851042UL, 0x6a881b4cUL, 0x719f065eUL, 0x78920d50UL,
|
||||
0x0fd9640aUL, 0x06d46f04UL, 0x1dc37216UL, 0x14ce7918UL, 0x2bed4832UL, 0x22e0433cUL, 0x39f75e2eUL, 0x30fa5520UL,
|
||||
0x9ab701ecUL, 0x93ba0ae2UL, 0x88ad17f0UL, 0x81a01cfeUL, 0xbe832dd4UL, 0xb78e26daUL, 0xac993bc8UL, 0xa59430c6UL,
|
||||
0xd2df599cUL, 0xdbd25292UL, 0xc0c54f80UL, 0xc9c8448eUL, 0xf6eb75a4UL, 0xffe67eaaUL, 0xe4f163b8UL, 0xedfc68b6UL,
|
||||
0x0a67b10cUL, 0x036aba02UL, 0x187da710UL, 0x1170ac1eUL, 0x2e539d34UL, 0x275e963aUL, 0x3c498b28UL, 0x35448026UL,
|
||||
0x420fe97cUL, 0x4b02e272UL, 0x5015ff60UL, 0x5918f46eUL, 0x663bc544UL, 0x6f36ce4aUL, 0x7421d358UL, 0x7d2cd856UL,
|
||||
0xa10c7a37UL, 0xa8017139UL, 0xb3166c2bUL, 0xba1b6725UL, 0x8538560fUL, 0x8c355d01UL, 0x97224013UL, 0x9e2f4b1dUL,
|
||||
0xe9642247UL, 0xe0692949UL, 0xfb7e345bUL, 0xf2733f55UL, 0xcd500e7fUL, 0xc45d0571UL, 0xdf4a1863UL, 0xd647136dUL,
|
||||
0x31dccad7UL, 0x38d1c1d9UL, 0x23c6dccbUL, 0x2acbd7c5UL, 0x15e8e6efUL, 0x1ce5ede1UL, 0x07f2f0f3UL, 0x0efffbfdUL,
|
||||
0x79b492a7UL, 0x70b999a9UL, 0x6bae84bbUL, 0x62a38fb5UL, 0x5d80be9fUL, 0x548db591UL, 0x4f9aa883UL, 0x4697a38dUL
|
||||
};
|
||||
|
||||
@@ -1023,6 +1023,8 @@ static const ulong32 rcon[] = {
|
||||
0x1B000000UL, 0x36000000UL, /* for 128-bit blocks, Rijndael never uses more than 10 rcon values */
|
||||
};
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
#endif /* __LTC_AES_TAB_C__ */
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -29,17 +27,17 @@ const struct ltc_cipher_descriptor anubis_desc = {
|
||||
&anubis_test,
|
||||
&anubis_done,
|
||||
&anubis_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
#define MIN_N 4
|
||||
#define MAX_N 10
|
||||
#define MIN_ROUNDS (8 + MIN_N)
|
||||
#define MAX_ROUNDS (8 + MAX_N)
|
||||
#define MIN_KEYSIZEB (4*MIN_N)
|
||||
#define MAX_KEYSIZEB (4*MAX_N)
|
||||
#define BLOCKSIZE 128
|
||||
#define BLOCKSIZEB (BLOCKSIZE/8)
|
||||
#define MIN_N 4
|
||||
#define MAX_N 10
|
||||
#define MIN_ROUNDS (8 + MIN_N)
|
||||
#define MAX_ROUNDS (8 + MAX_N)
|
||||
#define MIN_KEYSIZEB (4*MIN_N)
|
||||
#define MAX_KEYSIZEB (4*MAX_N)
|
||||
#define BLOCKSIZE 128
|
||||
#define BLOCKSIZEB (BLOCKSIZE/8)
|
||||
|
||||
|
||||
/*
|
||||
@@ -899,7 +897,7 @@ int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetri
|
||||
{
|
||||
int N, R, i, pos, r;
|
||||
ulong32 kappa[MAX_N];
|
||||
ulong32 inter[MAX_N];
|
||||
ulong32 inter[MAX_N] = { 0 }; /* initialize as all zeroes */
|
||||
ulong32 v, K0, K1, K2, K3;
|
||||
|
||||
LTC_ARGCHK(key != NULL);
|
||||
@@ -926,16 +924,16 @@ int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetri
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
/*
|
||||
* map cipher key to initial key state (mu):
|
||||
*/
|
||||
for (i = 0, pos = 0; i < N; i++, pos += 4) {
|
||||
/*
|
||||
* map cipher key to initial key state (mu):
|
||||
*/
|
||||
for (i = 0, pos = 0; i < N; i++, pos += 4) {
|
||||
kappa[i] =
|
||||
(key[pos ] << 24) ^
|
||||
(key[pos + 1] << 16) ^
|
||||
(key[pos + 2] << 8) ^
|
||||
(key[pos + 3] );
|
||||
}
|
||||
(((ulong32)key[pos ]) << 24) ^
|
||||
(((ulong32)key[pos + 1]) << 16) ^
|
||||
(((ulong32)key[pos + 2]) << 8) ^
|
||||
(((ulong32)key[pos + 3]) );
|
||||
}
|
||||
|
||||
/*
|
||||
* generate R + 1 round keys:
|
||||
@@ -1034,7 +1032,7 @@ int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetri
|
||||
return err;
|
||||
}
|
||||
#endif
|
||||
|
||||
|
||||
|
||||
static void anubis_crypt(const unsigned char *plaintext, unsigned char *ciphertext,
|
||||
ulong32 roundKey[18 + 1][4], int R) {
|
||||
@@ -1048,10 +1046,10 @@ static void anubis_crypt(const unsigned char *plaintext, unsigned char *cipherte
|
||||
*/
|
||||
for (i = 0, pos = 0; i < 4; i++, pos += 4) {
|
||||
state[i] =
|
||||
(plaintext[pos ] << 24) ^
|
||||
(plaintext[pos + 1] << 16) ^
|
||||
(plaintext[pos + 2] << 8) ^
|
||||
(plaintext[pos + 3] ) ^
|
||||
(((ulong32)plaintext[pos ]) << 24) ^
|
||||
(((ulong32)plaintext[pos + 1]) << 16) ^
|
||||
(((ulong32)plaintext[pos + 2]) << 8) ^
|
||||
(((ulong32)plaintext[pos + 3]) ) ^
|
||||
roundKey[0][i];
|
||||
}
|
||||
|
||||
@@ -1149,7 +1147,7 @@ int anubis_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
Decrypts a block of text with Anubis
|
||||
@param ct The input ciphertext (16 bytes)
|
||||
@param pt The output plaintext (16 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int anubis_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
@@ -1181,7 +1179,7 @@ int anubis_test(void)
|
||||
16,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xF0, 0x68, 0x60, 0xFC, 0x67, 0x30, 0xE8, 0x18,
|
||||
{ 0xF0, 0x68, 0x60, 0xFC, 0x67, 0x30, 0xE8, 0x18,
|
||||
0xF1, 0x32, 0xC7, 0x8A, 0xF4, 0x13, 0x2A, 0xFE },
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }
|
||||
@@ -1189,7 +1187,7 @@ int anubis_test(void)
|
||||
16,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xA8, 0x66, 0x84, 0x80, 0x07, 0x74, 0x5C, 0x89,
|
||||
{ 0xA8, 0x66, 0x84, 0x80, 0x07, 0x74, 0x5C, 0x89,
|
||||
0xFC, 0x5E, 0xB5, 0xBA, 0xD4, 0xFE, 0x32, 0x6D },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }
|
||||
@@ -1221,7 +1219,7 @@ int anubis_test(void)
|
||||
24,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x17, 0xAC, 0x57, 0x44, 0x9D, 0x59, 0x61, 0x66,
|
||||
{ 0x17, 0xAC, 0x57, 0x44, 0x9D, 0x59, 0x61, 0x66,
|
||||
0xD0, 0xC7, 0x9E, 0x04, 0x7C, 0xC7, 0x58, 0xF0 },
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1230,7 +1228,7 @@ int anubis_test(void)
|
||||
24,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x71, 0x52, 0xB4, 0xEB, 0x1D, 0xAA, 0x36, 0xFD,
|
||||
{ 0x71, 0x52, 0xB4, 0xEB, 0x1D, 0xAA, 0x36, 0xFD,
|
||||
0x57, 0x14, 0x5F, 0x57, 0x04, 0x9F, 0x70, 0x74 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1242,7 +1240,7 @@ int anubis_test(void)
|
||||
28,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xA2, 0xF0, 0xA6, 0xB9, 0x17, 0x93, 0x2A, 0x3B,
|
||||
{ 0xA2, 0xF0, 0xA6, 0xB9, 0x17, 0x93, 0x2A, 0x3B,
|
||||
0xEF, 0x08, 0xE8, 0x7A, 0x58, 0xD6, 0xF8, 0x53 },
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1252,7 +1250,7 @@ int anubis_test(void)
|
||||
28,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xF0, 0xCA, 0xFC, 0x78, 0x8B, 0x4B, 0x4E, 0x53,
|
||||
{ 0xF0, 0xCA, 0xFC, 0x78, 0x8B, 0x4B, 0x4E, 0x53,
|
||||
0x8B, 0xC4, 0x32, 0x6A, 0xF5, 0xB9, 0x1B, 0x5F },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1265,7 +1263,7 @@ int anubis_test(void)
|
||||
32,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xE0, 0x86, 0xAC, 0x45, 0x6B, 0x3C, 0xE5, 0x13,
|
||||
{ 0xE0, 0x86, 0xAC, 0x45, 0x6B, 0x3C, 0xE5, 0x13,
|
||||
0xED, 0xF5, 0xDF, 0xDD, 0xD6, 0x3B, 0x71, 0x93 },
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1275,7 +1273,7 @@ int anubis_test(void)
|
||||
32,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x50, 0x01, 0xB9, 0xF5, 0x21, 0xC1, 0xC1, 0x29,
|
||||
{ 0x50, 0x01, 0xB9, 0xF5, 0x21, 0xC1, 0xC1, 0x29,
|
||||
0x00, 0xD5, 0xEC, 0x98, 0x2B, 0x9E, 0xE8, 0x21 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1288,7 +1286,7 @@ int anubis_test(void)
|
||||
36,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xE8, 0xF4, 0xAF, 0x2B, 0x21, 0xA0, 0x87, 0x9B,
|
||||
{ 0xE8, 0xF4, 0xAF, 0x2B, 0x21, 0xA0, 0x87, 0x9B,
|
||||
0x41, 0x95, 0xB9, 0x71, 0x75, 0x79, 0x04, 0x7C },
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1299,7 +1297,7 @@ int anubis_test(void)
|
||||
36,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xE6, 0xA6, 0xA5, 0xBC, 0x8B, 0x63, 0x6F, 0xE2,
|
||||
{ 0xE6, 0xA6, 0xA5, 0xBC, 0x8B, 0x63, 0x6F, 0xE2,
|
||||
0xBD, 0xA7, 0xA7, 0x53, 0xAB, 0x40, 0x22, 0xE0 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1313,7 +1311,7 @@ int anubis_test(void)
|
||||
40,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x17, 0x04, 0xD7, 0x2C, 0xC6, 0x85, 0x76, 0x02,
|
||||
{ 0x17, 0x04, 0xD7, 0x2C, 0xC6, 0x85, 0x76, 0x02,
|
||||
0x4B, 0xCC, 0x39, 0x80, 0xD8, 0x22, 0xEA, 0xA4 },
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1324,7 +1322,7 @@ int anubis_test(void)
|
||||
40,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x7A, 0x41, 0xE6, 0x7D, 0x4F, 0xD8, 0x64, 0xF0,
|
||||
{ 0x7A, 0x41, 0xE6, 0x7D, 0x4F, 0xD8, 0x64, 0xF0,
|
||||
0x44, 0xA8, 0x3C, 0x73, 0x81, 0x7E, 0x53, 0xD8 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -1500,13 +1498,14 @@ int anubis_test(void)
|
||||
anubis_setup(tests[x].key, tests[x].keylen, 0, &skey);
|
||||
anubis_ecb_encrypt(tests[x].pt, buf[0], &skey);
|
||||
anubis_ecb_decrypt(buf[0], buf[1], &skey);
|
||||
if (XMEMCMP(buf[0], tests[x].ct, 16) || XMEMCMP(buf[1], tests[x].pt, 16)) {
|
||||
if (compare_testvector(buf[0], 16, tests[x].ct, 16, "Anubis Encrypt", x) ||
|
||||
compare_testvector(buf[1], 16, tests[x].pt, 16, "Anubis Decrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
for (y = 0; y < 1000; y++) anubis_ecb_encrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 1000; y++) anubis_ecb_decrypt(buf[0], buf[0], &skey);
|
||||
if (XMEMCMP(buf[0], tests[x].ct, 16)) {
|
||||
if (compare_testvector(buf[0], 16, tests[x].ct, 16, "Anubis 1000", 1000)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -1515,11 +1514,12 @@ int anubis_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void anubis_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1553,6 +1553,6 @@ int anubis_keysize(int *keysize)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
/**
|
||||
@file blowfish.c
|
||||
@@ -27,7 +25,7 @@ const struct ltc_cipher_descriptor blowfish_desc =
|
||||
&blowfish_test,
|
||||
&blowfish_done,
|
||||
&blowfish_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 ORIG_P[16 + 2] = {
|
||||
@@ -322,15 +320,15 @@ int blowfish_setup(const unsigned char *key, int keylen, int num_rounds,
|
||||
/* check rounds */
|
||||
if (num_rounds != 0 && num_rounds != 16) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
}
|
||||
|
||||
/* load in key bytes (Supplied by David Hopwood) */
|
||||
for (x = y = 0; x < 18; x++) {
|
||||
A = 0;
|
||||
for (z = 0; z < 4; z++) {
|
||||
A = (A << 8) | ((ulong32)key[y++] & 255);
|
||||
if (y == (ulong32)keylen) {
|
||||
y = 0;
|
||||
if (y == (ulong32)keylen) {
|
||||
y = 0;
|
||||
}
|
||||
}
|
||||
skey->blowfish.K[x] = ORIG_P[x] ^ A;
|
||||
@@ -347,7 +345,7 @@ int blowfish_setup(const unsigned char *key, int keylen, int num_rounds,
|
||||
for (x = 0; x < 8; x++) {
|
||||
B[x] = 0;
|
||||
}
|
||||
|
||||
|
||||
for (x = 0; x < 18; x += 2) {
|
||||
/* encrypt it */
|
||||
blowfish_ecb_encrypt(B, B, skey);
|
||||
@@ -446,7 +444,7 @@ int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_k
|
||||
Decrypts a block of text with Blowfish
|
||||
@param ct The input ciphertext (8 bytes)
|
||||
@param pt The output plaintext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
@@ -464,7 +462,7 @@ int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_k
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
|
||||
#ifndef __GNUC__
|
||||
S1 = skey->blowfish.S[0];
|
||||
S2 = skey->blowfish.S[1];
|
||||
@@ -512,7 +510,7 @@ int blowfish_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
int err;
|
||||
symmetric_key key;
|
||||
static const struct {
|
||||
@@ -548,7 +546,8 @@ int blowfish_test(void)
|
||||
blowfish_ecb_decrypt(tmp[0], tmp[1], &key);
|
||||
|
||||
/* compare */
|
||||
if ((XMEMCMP(tmp[0], tests[x].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[x].pt, 8) != 0)) {
|
||||
if ((compare_testvector(tmp[0], 8, tests[x].ct, 8, "Blowfish Encrypt", x) != 0) ||
|
||||
(compare_testvector(tmp[1], 8, tests[x].pt, 8, "Blowfish Decrypt", x) != 0)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -562,11 +561,12 @@ int blowfish_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void blowfish_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -589,6 +589,6 @@ int blowfish_keysize(int *keysize)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
726
libtomcrypt/src/ciphers/camellia.c
Normal file
726
libtomcrypt/src/ciphers/camellia.c
Normal file
@@ -0,0 +1,726 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file camellia.c
|
||||
Implementation by Tom St Denis of Elliptic Semiconductor
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CAMELLIA
|
||||
|
||||
const struct ltc_cipher_descriptor camellia_desc = {
|
||||
"camellia",
|
||||
23,
|
||||
16, 32, 16, 18,
|
||||
&camellia_setup,
|
||||
&camellia_ecb_encrypt,
|
||||
&camellia_ecb_decrypt,
|
||||
&camellia_test,
|
||||
&camellia_done,
|
||||
&camellia_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 SP1110[] = {
|
||||
0x70707000, 0x82828200, 0x2c2c2c00, 0xececec00, 0xb3b3b300, 0x27272700, 0xc0c0c000, 0xe5e5e500,
|
||||
0xe4e4e400, 0x85858500, 0x57575700, 0x35353500, 0xeaeaea00, 0x0c0c0c00, 0xaeaeae00, 0x41414100,
|
||||
0x23232300, 0xefefef00, 0x6b6b6b00, 0x93939300, 0x45454500, 0x19191900, 0xa5a5a500, 0x21212100,
|
||||
0xededed00, 0x0e0e0e00, 0x4f4f4f00, 0x4e4e4e00, 0x1d1d1d00, 0x65656500, 0x92929200, 0xbdbdbd00,
|
||||
0x86868600, 0xb8b8b800, 0xafafaf00, 0x8f8f8f00, 0x7c7c7c00, 0xebebeb00, 0x1f1f1f00, 0xcecece00,
|
||||
0x3e3e3e00, 0x30303000, 0xdcdcdc00, 0x5f5f5f00, 0x5e5e5e00, 0xc5c5c500, 0x0b0b0b00, 0x1a1a1a00,
|
||||
0xa6a6a600, 0xe1e1e100, 0x39393900, 0xcacaca00, 0xd5d5d500, 0x47474700, 0x5d5d5d00, 0x3d3d3d00,
|
||||
0xd9d9d900, 0x01010100, 0x5a5a5a00, 0xd6d6d600, 0x51515100, 0x56565600, 0x6c6c6c00, 0x4d4d4d00,
|
||||
0x8b8b8b00, 0x0d0d0d00, 0x9a9a9a00, 0x66666600, 0xfbfbfb00, 0xcccccc00, 0xb0b0b000, 0x2d2d2d00,
|
||||
0x74747400, 0x12121200, 0x2b2b2b00, 0x20202000, 0xf0f0f000, 0xb1b1b100, 0x84848400, 0x99999900,
|
||||
0xdfdfdf00, 0x4c4c4c00, 0xcbcbcb00, 0xc2c2c200, 0x34343400, 0x7e7e7e00, 0x76767600, 0x05050500,
|
||||
0x6d6d6d00, 0xb7b7b700, 0xa9a9a900, 0x31313100, 0xd1d1d100, 0x17171700, 0x04040400, 0xd7d7d700,
|
||||
0x14141400, 0x58585800, 0x3a3a3a00, 0x61616100, 0xdedede00, 0x1b1b1b00, 0x11111100, 0x1c1c1c00,
|
||||
0x32323200, 0x0f0f0f00, 0x9c9c9c00, 0x16161600, 0x53535300, 0x18181800, 0xf2f2f200, 0x22222200,
|
||||
0xfefefe00, 0x44444400, 0xcfcfcf00, 0xb2b2b200, 0xc3c3c300, 0xb5b5b500, 0x7a7a7a00, 0x91919100,
|
||||
0x24242400, 0x08080800, 0xe8e8e800, 0xa8a8a800, 0x60606000, 0xfcfcfc00, 0x69696900, 0x50505000,
|
||||
0xaaaaaa00, 0xd0d0d000, 0xa0a0a000, 0x7d7d7d00, 0xa1a1a100, 0x89898900, 0x62626200, 0x97979700,
|
||||
0x54545400, 0x5b5b5b00, 0x1e1e1e00, 0x95959500, 0xe0e0e000, 0xffffff00, 0x64646400, 0xd2d2d200,
|
||||
0x10101000, 0xc4c4c400, 0x00000000, 0x48484800, 0xa3a3a300, 0xf7f7f700, 0x75757500, 0xdbdbdb00,
|
||||
0x8a8a8a00, 0x03030300, 0xe6e6e600, 0xdadada00, 0x09090900, 0x3f3f3f00, 0xdddddd00, 0x94949400,
|
||||
0x87878700, 0x5c5c5c00, 0x83838300, 0x02020200, 0xcdcdcd00, 0x4a4a4a00, 0x90909000, 0x33333300,
|
||||
0x73737300, 0x67676700, 0xf6f6f600, 0xf3f3f300, 0x9d9d9d00, 0x7f7f7f00, 0xbfbfbf00, 0xe2e2e200,
|
||||
0x52525200, 0x9b9b9b00, 0xd8d8d800, 0x26262600, 0xc8c8c800, 0x37373700, 0xc6c6c600, 0x3b3b3b00,
|
||||
0x81818100, 0x96969600, 0x6f6f6f00, 0x4b4b4b00, 0x13131300, 0xbebebe00, 0x63636300, 0x2e2e2e00,
|
||||
0xe9e9e900, 0x79797900, 0xa7a7a700, 0x8c8c8c00, 0x9f9f9f00, 0x6e6e6e00, 0xbcbcbc00, 0x8e8e8e00,
|
||||
0x29292900, 0xf5f5f500, 0xf9f9f900, 0xb6b6b600, 0x2f2f2f00, 0xfdfdfd00, 0xb4b4b400, 0x59595900,
|
||||
0x78787800, 0x98989800, 0x06060600, 0x6a6a6a00, 0xe7e7e700, 0x46464600, 0x71717100, 0xbababa00,
|
||||
0xd4d4d400, 0x25252500, 0xababab00, 0x42424200, 0x88888800, 0xa2a2a200, 0x8d8d8d00, 0xfafafa00,
|
||||
0x72727200, 0x07070700, 0xb9b9b900, 0x55555500, 0xf8f8f800, 0xeeeeee00, 0xacacac00, 0x0a0a0a00,
|
||||
0x36363600, 0x49494900, 0x2a2a2a00, 0x68686800, 0x3c3c3c00, 0x38383800, 0xf1f1f100, 0xa4a4a400,
|
||||
0x40404000, 0x28282800, 0xd3d3d300, 0x7b7b7b00, 0xbbbbbb00, 0xc9c9c900, 0x43434300, 0xc1c1c100,
|
||||
0x15151500, 0xe3e3e300, 0xadadad00, 0xf4f4f400, 0x77777700, 0xc7c7c700, 0x80808000, 0x9e9e9e00,
|
||||
};
|
||||
|
||||
static const ulong32 SP0222[] = {
|
||||
0x00e0e0e0, 0x00050505, 0x00585858, 0x00d9d9d9, 0x00676767, 0x004e4e4e, 0x00818181, 0x00cbcbcb,
|
||||
0x00c9c9c9, 0x000b0b0b, 0x00aeaeae, 0x006a6a6a, 0x00d5d5d5, 0x00181818, 0x005d5d5d, 0x00828282,
|
||||
0x00464646, 0x00dfdfdf, 0x00d6d6d6, 0x00272727, 0x008a8a8a, 0x00323232, 0x004b4b4b, 0x00424242,
|
||||
0x00dbdbdb, 0x001c1c1c, 0x009e9e9e, 0x009c9c9c, 0x003a3a3a, 0x00cacaca, 0x00252525, 0x007b7b7b,
|
||||
0x000d0d0d, 0x00717171, 0x005f5f5f, 0x001f1f1f, 0x00f8f8f8, 0x00d7d7d7, 0x003e3e3e, 0x009d9d9d,
|
||||
0x007c7c7c, 0x00606060, 0x00b9b9b9, 0x00bebebe, 0x00bcbcbc, 0x008b8b8b, 0x00161616, 0x00343434,
|
||||
0x004d4d4d, 0x00c3c3c3, 0x00727272, 0x00959595, 0x00ababab, 0x008e8e8e, 0x00bababa, 0x007a7a7a,
|
||||
0x00b3b3b3, 0x00020202, 0x00b4b4b4, 0x00adadad, 0x00a2a2a2, 0x00acacac, 0x00d8d8d8, 0x009a9a9a,
|
||||
0x00171717, 0x001a1a1a, 0x00353535, 0x00cccccc, 0x00f7f7f7, 0x00999999, 0x00616161, 0x005a5a5a,
|
||||
0x00e8e8e8, 0x00242424, 0x00565656, 0x00404040, 0x00e1e1e1, 0x00636363, 0x00090909, 0x00333333,
|
||||
0x00bfbfbf, 0x00989898, 0x00979797, 0x00858585, 0x00686868, 0x00fcfcfc, 0x00ececec, 0x000a0a0a,
|
||||
0x00dadada, 0x006f6f6f, 0x00535353, 0x00626262, 0x00a3a3a3, 0x002e2e2e, 0x00080808, 0x00afafaf,
|
||||
0x00282828, 0x00b0b0b0, 0x00747474, 0x00c2c2c2, 0x00bdbdbd, 0x00363636, 0x00222222, 0x00383838,
|
||||
0x00646464, 0x001e1e1e, 0x00393939, 0x002c2c2c, 0x00a6a6a6, 0x00303030, 0x00e5e5e5, 0x00444444,
|
||||
0x00fdfdfd, 0x00888888, 0x009f9f9f, 0x00656565, 0x00878787, 0x006b6b6b, 0x00f4f4f4, 0x00232323,
|
||||
0x00484848, 0x00101010, 0x00d1d1d1, 0x00515151, 0x00c0c0c0, 0x00f9f9f9, 0x00d2d2d2, 0x00a0a0a0,
|
||||
0x00555555, 0x00a1a1a1, 0x00414141, 0x00fafafa, 0x00434343, 0x00131313, 0x00c4c4c4, 0x002f2f2f,
|
||||
0x00a8a8a8, 0x00b6b6b6, 0x003c3c3c, 0x002b2b2b, 0x00c1c1c1, 0x00ffffff, 0x00c8c8c8, 0x00a5a5a5,
|
||||
0x00202020, 0x00898989, 0x00000000, 0x00909090, 0x00474747, 0x00efefef, 0x00eaeaea, 0x00b7b7b7,
|
||||
0x00151515, 0x00060606, 0x00cdcdcd, 0x00b5b5b5, 0x00121212, 0x007e7e7e, 0x00bbbbbb, 0x00292929,
|
||||
0x000f0f0f, 0x00b8b8b8, 0x00070707, 0x00040404, 0x009b9b9b, 0x00949494, 0x00212121, 0x00666666,
|
||||
0x00e6e6e6, 0x00cecece, 0x00ededed, 0x00e7e7e7, 0x003b3b3b, 0x00fefefe, 0x007f7f7f, 0x00c5c5c5,
|
||||
0x00a4a4a4, 0x00373737, 0x00b1b1b1, 0x004c4c4c, 0x00919191, 0x006e6e6e, 0x008d8d8d, 0x00767676,
|
||||
0x00030303, 0x002d2d2d, 0x00dedede, 0x00969696, 0x00262626, 0x007d7d7d, 0x00c6c6c6, 0x005c5c5c,
|
||||
0x00d3d3d3, 0x00f2f2f2, 0x004f4f4f, 0x00191919, 0x003f3f3f, 0x00dcdcdc, 0x00797979, 0x001d1d1d,
|
||||
0x00525252, 0x00ebebeb, 0x00f3f3f3, 0x006d6d6d, 0x005e5e5e, 0x00fbfbfb, 0x00696969, 0x00b2b2b2,
|
||||
0x00f0f0f0, 0x00313131, 0x000c0c0c, 0x00d4d4d4, 0x00cfcfcf, 0x008c8c8c, 0x00e2e2e2, 0x00757575,
|
||||
0x00a9a9a9, 0x004a4a4a, 0x00575757, 0x00848484, 0x00111111, 0x00454545, 0x001b1b1b, 0x00f5f5f5,
|
||||
0x00e4e4e4, 0x000e0e0e, 0x00737373, 0x00aaaaaa, 0x00f1f1f1, 0x00dddddd, 0x00595959, 0x00141414,
|
||||
0x006c6c6c, 0x00929292, 0x00545454, 0x00d0d0d0, 0x00787878, 0x00707070, 0x00e3e3e3, 0x00494949,
|
||||
0x00808080, 0x00505050, 0x00a7a7a7, 0x00f6f6f6, 0x00777777, 0x00939393, 0x00868686, 0x00838383,
|
||||
0x002a2a2a, 0x00c7c7c7, 0x005b5b5b, 0x00e9e9e9, 0x00eeeeee, 0x008f8f8f, 0x00010101, 0x003d3d3d,
|
||||
};
|
||||
|
||||
static const ulong32 SP3033[] = {
|
||||
0x38003838, 0x41004141, 0x16001616, 0x76007676, 0xd900d9d9, 0x93009393, 0x60006060, 0xf200f2f2,
|
||||
0x72007272, 0xc200c2c2, 0xab00abab, 0x9a009a9a, 0x75007575, 0x06000606, 0x57005757, 0xa000a0a0,
|
||||
0x91009191, 0xf700f7f7, 0xb500b5b5, 0xc900c9c9, 0xa200a2a2, 0x8c008c8c, 0xd200d2d2, 0x90009090,
|
||||
0xf600f6f6, 0x07000707, 0xa700a7a7, 0x27002727, 0x8e008e8e, 0xb200b2b2, 0x49004949, 0xde00dede,
|
||||
0x43004343, 0x5c005c5c, 0xd700d7d7, 0xc700c7c7, 0x3e003e3e, 0xf500f5f5, 0x8f008f8f, 0x67006767,
|
||||
0x1f001f1f, 0x18001818, 0x6e006e6e, 0xaf00afaf, 0x2f002f2f, 0xe200e2e2, 0x85008585, 0x0d000d0d,
|
||||
0x53005353, 0xf000f0f0, 0x9c009c9c, 0x65006565, 0xea00eaea, 0xa300a3a3, 0xae00aeae, 0x9e009e9e,
|
||||
0xec00ecec, 0x80008080, 0x2d002d2d, 0x6b006b6b, 0xa800a8a8, 0x2b002b2b, 0x36003636, 0xa600a6a6,
|
||||
0xc500c5c5, 0x86008686, 0x4d004d4d, 0x33003333, 0xfd00fdfd, 0x66006666, 0x58005858, 0x96009696,
|
||||
0x3a003a3a, 0x09000909, 0x95009595, 0x10001010, 0x78007878, 0xd800d8d8, 0x42004242, 0xcc00cccc,
|
||||
0xef00efef, 0x26002626, 0xe500e5e5, 0x61006161, 0x1a001a1a, 0x3f003f3f, 0x3b003b3b, 0x82008282,
|
||||
0xb600b6b6, 0xdb00dbdb, 0xd400d4d4, 0x98009898, 0xe800e8e8, 0x8b008b8b, 0x02000202, 0xeb00ebeb,
|
||||
0x0a000a0a, 0x2c002c2c, 0x1d001d1d, 0xb000b0b0, 0x6f006f6f, 0x8d008d8d, 0x88008888, 0x0e000e0e,
|
||||
0x19001919, 0x87008787, 0x4e004e4e, 0x0b000b0b, 0xa900a9a9, 0x0c000c0c, 0x79007979, 0x11001111,
|
||||
0x7f007f7f, 0x22002222, 0xe700e7e7, 0x59005959, 0xe100e1e1, 0xda00dada, 0x3d003d3d, 0xc800c8c8,
|
||||
0x12001212, 0x04000404, 0x74007474, 0x54005454, 0x30003030, 0x7e007e7e, 0xb400b4b4, 0x28002828,
|
||||
0x55005555, 0x68006868, 0x50005050, 0xbe00bebe, 0xd000d0d0, 0xc400c4c4, 0x31003131, 0xcb00cbcb,
|
||||
0x2a002a2a, 0xad00adad, 0x0f000f0f, 0xca00caca, 0x70007070, 0xff00ffff, 0x32003232, 0x69006969,
|
||||
0x08000808, 0x62006262, 0x00000000, 0x24002424, 0xd100d1d1, 0xfb00fbfb, 0xba00baba, 0xed00eded,
|
||||
0x45004545, 0x81008181, 0x73007373, 0x6d006d6d, 0x84008484, 0x9f009f9f, 0xee00eeee, 0x4a004a4a,
|
||||
0xc300c3c3, 0x2e002e2e, 0xc100c1c1, 0x01000101, 0xe600e6e6, 0x25002525, 0x48004848, 0x99009999,
|
||||
0xb900b9b9, 0xb300b3b3, 0x7b007b7b, 0xf900f9f9, 0xce00cece, 0xbf00bfbf, 0xdf00dfdf, 0x71007171,
|
||||
0x29002929, 0xcd00cdcd, 0x6c006c6c, 0x13001313, 0x64006464, 0x9b009b9b, 0x63006363, 0x9d009d9d,
|
||||
0xc000c0c0, 0x4b004b4b, 0xb700b7b7, 0xa500a5a5, 0x89008989, 0x5f005f5f, 0xb100b1b1, 0x17001717,
|
||||
0xf400f4f4, 0xbc00bcbc, 0xd300d3d3, 0x46004646, 0xcf00cfcf, 0x37003737, 0x5e005e5e, 0x47004747,
|
||||
0x94009494, 0xfa00fafa, 0xfc00fcfc, 0x5b005b5b, 0x97009797, 0xfe00fefe, 0x5a005a5a, 0xac00acac,
|
||||
0x3c003c3c, 0x4c004c4c, 0x03000303, 0x35003535, 0xf300f3f3, 0x23002323, 0xb800b8b8, 0x5d005d5d,
|
||||
0x6a006a6a, 0x92009292, 0xd500d5d5, 0x21002121, 0x44004444, 0x51005151, 0xc600c6c6, 0x7d007d7d,
|
||||
0x39003939, 0x83008383, 0xdc00dcdc, 0xaa00aaaa, 0x7c007c7c, 0x77007777, 0x56005656, 0x05000505,
|
||||
0x1b001b1b, 0xa400a4a4, 0x15001515, 0x34003434, 0x1e001e1e, 0x1c001c1c, 0xf800f8f8, 0x52005252,
|
||||
0x20002020, 0x14001414, 0xe900e9e9, 0xbd00bdbd, 0xdd00dddd, 0xe400e4e4, 0xa100a1a1, 0xe000e0e0,
|
||||
0x8a008a8a, 0xf100f1f1, 0xd600d6d6, 0x7a007a7a, 0xbb00bbbb, 0xe300e3e3, 0x40004040, 0x4f004f4f,
|
||||
};
|
||||
|
||||
static const ulong32 SP4404[] = {
|
||||
0x70700070, 0x2c2c002c, 0xb3b300b3, 0xc0c000c0, 0xe4e400e4, 0x57570057, 0xeaea00ea, 0xaeae00ae,
|
||||
0x23230023, 0x6b6b006b, 0x45450045, 0xa5a500a5, 0xeded00ed, 0x4f4f004f, 0x1d1d001d, 0x92920092,
|
||||
0x86860086, 0xafaf00af, 0x7c7c007c, 0x1f1f001f, 0x3e3e003e, 0xdcdc00dc, 0x5e5e005e, 0x0b0b000b,
|
||||
0xa6a600a6, 0x39390039, 0xd5d500d5, 0x5d5d005d, 0xd9d900d9, 0x5a5a005a, 0x51510051, 0x6c6c006c,
|
||||
0x8b8b008b, 0x9a9a009a, 0xfbfb00fb, 0xb0b000b0, 0x74740074, 0x2b2b002b, 0xf0f000f0, 0x84840084,
|
||||
0xdfdf00df, 0xcbcb00cb, 0x34340034, 0x76760076, 0x6d6d006d, 0xa9a900a9, 0xd1d100d1, 0x04040004,
|
||||
0x14140014, 0x3a3a003a, 0xdede00de, 0x11110011, 0x32320032, 0x9c9c009c, 0x53530053, 0xf2f200f2,
|
||||
0xfefe00fe, 0xcfcf00cf, 0xc3c300c3, 0x7a7a007a, 0x24240024, 0xe8e800e8, 0x60600060, 0x69690069,
|
||||
0xaaaa00aa, 0xa0a000a0, 0xa1a100a1, 0x62620062, 0x54540054, 0x1e1e001e, 0xe0e000e0, 0x64640064,
|
||||
0x10100010, 0x00000000, 0xa3a300a3, 0x75750075, 0x8a8a008a, 0xe6e600e6, 0x09090009, 0xdddd00dd,
|
||||
0x87870087, 0x83830083, 0xcdcd00cd, 0x90900090, 0x73730073, 0xf6f600f6, 0x9d9d009d, 0xbfbf00bf,
|
||||
0x52520052, 0xd8d800d8, 0xc8c800c8, 0xc6c600c6, 0x81810081, 0x6f6f006f, 0x13130013, 0x63630063,
|
||||
0xe9e900e9, 0xa7a700a7, 0x9f9f009f, 0xbcbc00bc, 0x29290029, 0xf9f900f9, 0x2f2f002f, 0xb4b400b4,
|
||||
0x78780078, 0x06060006, 0xe7e700e7, 0x71710071, 0xd4d400d4, 0xabab00ab, 0x88880088, 0x8d8d008d,
|
||||
0x72720072, 0xb9b900b9, 0xf8f800f8, 0xacac00ac, 0x36360036, 0x2a2a002a, 0x3c3c003c, 0xf1f100f1,
|
||||
0x40400040, 0xd3d300d3, 0xbbbb00bb, 0x43430043, 0x15150015, 0xadad00ad, 0x77770077, 0x80800080,
|
||||
0x82820082, 0xecec00ec, 0x27270027, 0xe5e500e5, 0x85850085, 0x35350035, 0x0c0c000c, 0x41410041,
|
||||
0xefef00ef, 0x93930093, 0x19190019, 0x21210021, 0x0e0e000e, 0x4e4e004e, 0x65650065, 0xbdbd00bd,
|
||||
0xb8b800b8, 0x8f8f008f, 0xebeb00eb, 0xcece00ce, 0x30300030, 0x5f5f005f, 0xc5c500c5, 0x1a1a001a,
|
||||
0xe1e100e1, 0xcaca00ca, 0x47470047, 0x3d3d003d, 0x01010001, 0xd6d600d6, 0x56560056, 0x4d4d004d,
|
||||
0x0d0d000d, 0x66660066, 0xcccc00cc, 0x2d2d002d, 0x12120012, 0x20200020, 0xb1b100b1, 0x99990099,
|
||||
0x4c4c004c, 0xc2c200c2, 0x7e7e007e, 0x05050005, 0xb7b700b7, 0x31310031, 0x17170017, 0xd7d700d7,
|
||||
0x58580058, 0x61610061, 0x1b1b001b, 0x1c1c001c, 0x0f0f000f, 0x16160016, 0x18180018, 0x22220022,
|
||||
0x44440044, 0xb2b200b2, 0xb5b500b5, 0x91910091, 0x08080008, 0xa8a800a8, 0xfcfc00fc, 0x50500050,
|
||||
0xd0d000d0, 0x7d7d007d, 0x89890089, 0x97970097, 0x5b5b005b, 0x95950095, 0xffff00ff, 0xd2d200d2,
|
||||
0xc4c400c4, 0x48480048, 0xf7f700f7, 0xdbdb00db, 0x03030003, 0xdada00da, 0x3f3f003f, 0x94940094,
|
||||
0x5c5c005c, 0x02020002, 0x4a4a004a, 0x33330033, 0x67670067, 0xf3f300f3, 0x7f7f007f, 0xe2e200e2,
|
||||
0x9b9b009b, 0x26260026, 0x37370037, 0x3b3b003b, 0x96960096, 0x4b4b004b, 0xbebe00be, 0x2e2e002e,
|
||||
0x79790079, 0x8c8c008c, 0x6e6e006e, 0x8e8e008e, 0xf5f500f5, 0xb6b600b6, 0xfdfd00fd, 0x59590059,
|
||||
0x98980098, 0x6a6a006a, 0x46460046, 0xbaba00ba, 0x25250025, 0x42420042, 0xa2a200a2, 0xfafa00fa,
|
||||
0x07070007, 0x55550055, 0xeeee00ee, 0x0a0a000a, 0x49490049, 0x68680068, 0x38380038, 0xa4a400a4,
|
||||
0x28280028, 0x7b7b007b, 0xc9c900c9, 0xc1c100c1, 0xe3e300e3, 0xf4f400f4, 0xc7c700c7, 0x9e9e009e,
|
||||
};
|
||||
|
||||
static const ulong64 key_sigma[] = {
|
||||
CONST64(0xA09E667F3BCC908B),
|
||||
CONST64(0xB67AE8584CAA73B2),
|
||||
CONST64(0xC6EF372FE94F82BE),
|
||||
CONST64(0x54FF53A5F1D36F1C),
|
||||
CONST64(0x10E527FADE682D1D),
|
||||
CONST64(0xB05688C2B3E6C1FD)
|
||||
};
|
||||
|
||||
static ulong64 F(ulong64 x)
|
||||
{
|
||||
ulong32 D, U;
|
||||
|
||||
#define loc(i) ((8-i)*8)
|
||||
|
||||
D = SP1110[(x >> loc(8)) & 0xFF] ^ SP0222[(x >> loc(5)) & 0xFF] ^ SP3033[(x >> loc(6)) & 0xFF] ^ SP4404[(x >> loc(7)) & 0xFF];
|
||||
U = SP1110[(x >> loc(1)) & 0xFF] ^ SP0222[(x >> loc(2)) & 0xFF] ^ SP3033[(x >> loc(3)) & 0xFF] ^ SP4404[(x >> loc(4)) & 0xFF];
|
||||
|
||||
D ^= U;
|
||||
U = D ^ RORc(U, 8);
|
||||
|
||||
return ((ulong64)U) | (((ulong64)D) << CONST64(32));
|
||||
}
|
||||
|
||||
static void rot_128(unsigned char *in, unsigned count, unsigned char *out)
|
||||
{
|
||||
unsigned x, w, b;
|
||||
|
||||
w = count >> 3;
|
||||
b = count & 7;
|
||||
|
||||
for (x = 0; x < 16; x++) {
|
||||
out[x] = (in[(x+w)&15] << b) | (in[(x+w+1)&15] >> (8 - b));
|
||||
}
|
||||
}
|
||||
|
||||
int camellia_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
|
||||
{
|
||||
unsigned char T[48], kA[16], kB[16], kR[16], kL[16];
|
||||
int x;
|
||||
ulong64 A, B;
|
||||
|
||||
LTC_ARGCHK(key != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
/* Valid sizes (in bytes) are 16, 24, 32 */
|
||||
if (keylen != 16 && keylen != 24 && keylen != 32) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
|
||||
/* number of rounds */
|
||||
skey->camellia.R = (keylen == 16) ? 18 : 24;
|
||||
|
||||
if (num_rounds != 0 && num_rounds != skey->camellia.R) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
/* expand key */
|
||||
if (keylen == 16) {
|
||||
for (x = 0; x < 16; x++) {
|
||||
T[x] = key[x];
|
||||
T[x + 16] = 0;
|
||||
}
|
||||
} else if (keylen == 24) {
|
||||
for (x = 0; x < 24; x++) {
|
||||
T[x] = key[x];
|
||||
}
|
||||
for (x = 24; x < 32; x++) {
|
||||
T[x] = key[x-8] ^ 0xFF;
|
||||
}
|
||||
} else {
|
||||
for (x = 0; x < 32; x++) {
|
||||
T[x] = key[x];
|
||||
}
|
||||
}
|
||||
|
||||
for (x = 0; x < 16; x++) {
|
||||
kL[x] = T[x];
|
||||
kR[x] = T[x + 16];
|
||||
}
|
||||
|
||||
for (x = 32; x < 48; x++) {
|
||||
T[x] = T[x - 32] ^ T[x - 16];
|
||||
}
|
||||
|
||||
/* first two rounds */
|
||||
LOAD64H(A, T+32); LOAD64H(B, T+40);
|
||||
B ^= F(A ^ key_sigma[0]);
|
||||
A ^= F(B ^ key_sigma[1]);
|
||||
STORE64H(A, T+32); STORE64H(B, T+40);
|
||||
|
||||
/* xor kL in */
|
||||
for (x = 0; x < 16; x++) { T[x+32] ^= kL[x]; }
|
||||
|
||||
/* next two rounds */
|
||||
LOAD64H(A, T+32); LOAD64H(B, T+40);
|
||||
B ^= F(A ^ key_sigma[2]);
|
||||
A ^= F(B ^ key_sigma[3]);
|
||||
STORE64H(A, T+32); STORE64H(B, T+40);
|
||||
|
||||
/* grab KA */
|
||||
for (x = 0; x < 16; x++) { kA[x] = T[x+32]; }
|
||||
|
||||
/* xor kR in */
|
||||
for (x = 0; x < 16; x++) { T[x+32] ^= kR[x]; }
|
||||
|
||||
if (keylen == 16) {
|
||||
/* grab whitening keys kw1 and kw2 */
|
||||
LOAD64H(skey->camellia.kw[0], kL);
|
||||
LOAD64H(skey->camellia.kw[1], kL+8);
|
||||
|
||||
/* k1-k2 */
|
||||
LOAD64H(skey->camellia.k[0], kA);
|
||||
LOAD64H(skey->camellia.k[1], kA+8);
|
||||
|
||||
/* rotate kL by 15, k3/k4 */
|
||||
rot_128(kL, 15, T+32);
|
||||
LOAD64H(skey->camellia.k[2], T+32);
|
||||
LOAD64H(skey->camellia.k[3], T+40);
|
||||
|
||||
/* rotate kA by 15, k5/k6 */
|
||||
rot_128(kA, 15, T+32);
|
||||
LOAD64H(skey->camellia.k[4], T+32);
|
||||
LOAD64H(skey->camellia.k[5], T+40);
|
||||
|
||||
/* rotate kA by 30, kl1, kl2 */
|
||||
rot_128(kA, 30, T+32);
|
||||
LOAD64H(skey->camellia.kl[0], T+32);
|
||||
LOAD64H(skey->camellia.kl[1], T+40);
|
||||
|
||||
/* rotate kL by 45, k7/k8 */
|
||||
rot_128(kL, 45, T+32);
|
||||
LOAD64H(skey->camellia.k[6], T+32);
|
||||
LOAD64H(skey->camellia.k[7], T+40);
|
||||
|
||||
/* rotate kA by 45, k9/k10 */
|
||||
rot_128(kA, 45, T+32);
|
||||
LOAD64H(skey->camellia.k[8], T+32);
|
||||
rot_128(kL, 60, T+32);
|
||||
LOAD64H(skey->camellia.k[9], T+40);
|
||||
|
||||
/* rotate kA by 60, k11/k12 */
|
||||
rot_128(kA, 60, T+32);
|
||||
LOAD64H(skey->camellia.k[10], T+32);
|
||||
LOAD64H(skey->camellia.k[11], T+40);
|
||||
|
||||
/* rotate kL by 77, kl3, kl4 */
|
||||
rot_128(kL, 77, T+32);
|
||||
LOAD64H(skey->camellia.kl[2], T+32);
|
||||
LOAD64H(skey->camellia.kl[3], T+40);
|
||||
|
||||
/* rotate kL by 94, k13/k14 */
|
||||
rot_128(kL, 94, T+32);
|
||||
LOAD64H(skey->camellia.k[12], T+32);
|
||||
LOAD64H(skey->camellia.k[13], T+40);
|
||||
|
||||
/* rotate kA by 94, k15/k16 */
|
||||
rot_128(kA, 94, T+32);
|
||||
LOAD64H(skey->camellia.k[14], T+32);
|
||||
LOAD64H(skey->camellia.k[15], T+40);
|
||||
|
||||
/* rotate kL by 111, k17/k18 */
|
||||
rot_128(kL, 111, T+32);
|
||||
LOAD64H(skey->camellia.k[16], T+32);
|
||||
LOAD64H(skey->camellia.k[17], T+40);
|
||||
|
||||
/* rotate kA by 111, kw3/kw4 */
|
||||
rot_128(kA, 111, T+32);
|
||||
LOAD64H(skey->camellia.kw[2], T+32);
|
||||
LOAD64H(skey->camellia.kw[3], T+40);
|
||||
} else {
|
||||
/* last two rounds */
|
||||
LOAD64H(A, T+32); LOAD64H(B, T+40);
|
||||
B ^= F(A ^ key_sigma[4]);
|
||||
A ^= F(B ^ key_sigma[5]);
|
||||
STORE64H(A, T+32); STORE64H(B, T+40);
|
||||
|
||||
/* grab kB */
|
||||
for (x = 0; x < 16; x++) { kB[x] = T[x+32]; }
|
||||
|
||||
/* kw1/2 from kL*/
|
||||
LOAD64H(skey->camellia.kw[0], kL);
|
||||
LOAD64H(skey->camellia.kw[1], kL+8);
|
||||
|
||||
/* k1/k2 = kB */
|
||||
LOAD64H(skey->camellia.k[0], kB);
|
||||
LOAD64H(skey->camellia.k[1], kB+8);
|
||||
|
||||
/* k3/k4 = kR by 15 */
|
||||
rot_128(kR, 15, T+32);
|
||||
LOAD64H(skey->camellia.k[2], T+32);
|
||||
LOAD64H(skey->camellia.k[3], T+40);
|
||||
|
||||
/* k5/k7 = kA by 15 */
|
||||
rot_128(kA, 15, T+32);
|
||||
LOAD64H(skey->camellia.k[4], T+32);
|
||||
LOAD64H(skey->camellia.k[5], T+40);
|
||||
|
||||
/* kl1/2 = kR by 30 */
|
||||
rot_128(kR, 30, T+32);
|
||||
LOAD64H(skey->camellia.kl[0], T+32);
|
||||
LOAD64H(skey->camellia.kl[1], T+40);
|
||||
|
||||
/* k7/k8 = kB by 30 */
|
||||
rot_128(kB, 30, T+32);
|
||||
LOAD64H(skey->camellia.k[6], T+32);
|
||||
LOAD64H(skey->camellia.k[7], T+40);
|
||||
|
||||
/* k9/k10 = kL by 45 */
|
||||
rot_128(kL, 45, T+32);
|
||||
LOAD64H(skey->camellia.k[8], T+32);
|
||||
LOAD64H(skey->camellia.k[9], T+40);
|
||||
|
||||
/* k11/k12 = kA by 45 */
|
||||
rot_128(kA, 45, T+32);
|
||||
LOAD64H(skey->camellia.k[10], T+32);
|
||||
LOAD64H(skey->camellia.k[11], T+40);
|
||||
|
||||
/* kl3/4 = kL by 60 */
|
||||
rot_128(kL, 60, T+32);
|
||||
LOAD64H(skey->camellia.kl[2], T+32);
|
||||
LOAD64H(skey->camellia.kl[3], T+40);
|
||||
|
||||
/* k13/k14 = kR by 60 */
|
||||
rot_128(kR, 60, T+32);
|
||||
LOAD64H(skey->camellia.k[12], T+32);
|
||||
LOAD64H(skey->camellia.k[13], T+40);
|
||||
|
||||
/* k15/k16 = kB by 15 */
|
||||
rot_128(kB, 60, T+32);
|
||||
LOAD64H(skey->camellia.k[14], T+32);
|
||||
LOAD64H(skey->camellia.k[15], T+40);
|
||||
|
||||
/* k17/k18 = kL by 77 */
|
||||
rot_128(kL, 77, T+32);
|
||||
LOAD64H(skey->camellia.k[16], T+32);
|
||||
LOAD64H(skey->camellia.k[17], T+40);
|
||||
|
||||
/* kl5/6 = kA by 77 */
|
||||
rot_128(kA, 77, T+32);
|
||||
LOAD64H(skey->camellia.kl[4], T+32);
|
||||
LOAD64H(skey->camellia.kl[5], T+40);
|
||||
|
||||
/* k19/k20 = kR by 94 */
|
||||
rot_128(kR, 94, T+32);
|
||||
LOAD64H(skey->camellia.k[18], T+32);
|
||||
LOAD64H(skey->camellia.k[19], T+40);
|
||||
|
||||
/* k21/k22 = kA by 94 */
|
||||
rot_128(kA, 94, T+32);
|
||||
LOAD64H(skey->camellia.k[20], T+32);
|
||||
LOAD64H(skey->camellia.k[21], T+40);
|
||||
|
||||
/* k23/k24 = kL by 111 */
|
||||
rot_128(kL, 111, T+32);
|
||||
LOAD64H(skey->camellia.k[22], T+32);
|
||||
LOAD64H(skey->camellia.k[23], T+40);
|
||||
|
||||
/* kw2/kw3 = kB by 111 */
|
||||
rot_128(kB, 111, T+32);
|
||||
LOAD64H(skey->camellia.kw[2], T+32);
|
||||
LOAD64H(skey->camellia.kw[3], T+40);
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int camellia_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
|
||||
{
|
||||
ulong64 L, R;
|
||||
ulong32 a, b;
|
||||
|
||||
LOAD64H(L, pt+0); LOAD64H(R, pt+8);
|
||||
L ^= skey->camellia.kw[0];
|
||||
R ^= skey->camellia.kw[1];
|
||||
|
||||
/* first 6 rounds */
|
||||
R ^= F(L ^ skey->camellia.k[0]);
|
||||
L ^= F(R ^ skey->camellia.k[1]);
|
||||
R ^= F(L ^ skey->camellia.k[2]);
|
||||
L ^= F(R ^ skey->camellia.k[3]);
|
||||
R ^= F(L ^ skey->camellia.k[4]);
|
||||
L ^= F(R ^ skey->camellia.k[5]);
|
||||
|
||||
/* FL */
|
||||
a = (ulong32)(L >> 32);
|
||||
b = (ulong32)(L & 0xFFFFFFFFUL);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[0] >> 32)), 1);
|
||||
a ^= b | (skey->camellia.kl[0] & 0xFFFFFFFFU);
|
||||
L = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* FL^-1 */
|
||||
a = (ulong32)(R >> 32);
|
||||
b = (ulong32)(R & 0xFFFFFFFFUL);
|
||||
a ^= b | (skey->camellia.kl[1] & 0xFFFFFFFFU);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[1] >> 32)), 1);
|
||||
R = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* second 6 rounds */
|
||||
R ^= F(L ^ skey->camellia.k[6]);
|
||||
L ^= F(R ^ skey->camellia.k[7]);
|
||||
R ^= F(L ^ skey->camellia.k[8]);
|
||||
L ^= F(R ^ skey->camellia.k[9]);
|
||||
R ^= F(L ^ skey->camellia.k[10]);
|
||||
L ^= F(R ^ skey->camellia.k[11]);
|
||||
|
||||
/* FL */
|
||||
a = (ulong32)(L >> 32);
|
||||
b = (ulong32)(L & 0xFFFFFFFFUL);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[2] >> 32)), 1);
|
||||
a ^= b | (skey->camellia.kl[2] & 0xFFFFFFFFU);
|
||||
L = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* FL^-1 */
|
||||
a = (ulong32)(R >> 32);
|
||||
b = (ulong32)(R & 0xFFFFFFFFUL);
|
||||
a ^= b | (skey->camellia.kl[3] & 0xFFFFFFFFU);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[3] >> 32)), 1);
|
||||
R = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* third 6 rounds */
|
||||
R ^= F(L ^ skey->camellia.k[12]);
|
||||
L ^= F(R ^ skey->camellia.k[13]);
|
||||
R ^= F(L ^ skey->camellia.k[14]);
|
||||
L ^= F(R ^ skey->camellia.k[15]);
|
||||
R ^= F(L ^ skey->camellia.k[16]);
|
||||
L ^= F(R ^ skey->camellia.k[17]);
|
||||
|
||||
/* next FL */
|
||||
if (skey->camellia.R == 24) {
|
||||
/* FL */
|
||||
a = (ulong32)(L >> 32);
|
||||
b = (ulong32)(L & 0xFFFFFFFFUL);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[4] >> 32)), 1);
|
||||
a ^= b | (skey->camellia.kl[4] & 0xFFFFFFFFU);
|
||||
L = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* FL^-1 */
|
||||
a = (ulong32)(R >> 32);
|
||||
b = (ulong32)(R & 0xFFFFFFFFUL);
|
||||
a ^= b | (skey->camellia.kl[5] & 0xFFFFFFFFU);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[5] >> 32)), 1);
|
||||
R = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* fourth 6 rounds */
|
||||
R ^= F(L ^ skey->camellia.k[18]);
|
||||
L ^= F(R ^ skey->camellia.k[19]);
|
||||
R ^= F(L ^ skey->camellia.k[20]);
|
||||
L ^= F(R ^ skey->camellia.k[21]);
|
||||
R ^= F(L ^ skey->camellia.k[22]);
|
||||
L ^= F(R ^ skey->camellia.k[23]);
|
||||
}
|
||||
|
||||
L ^= skey->camellia.kw[3];
|
||||
R ^= skey->camellia.kw[2];
|
||||
|
||||
STORE64H(R, ct+0); STORE64H(L, ct+8);
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int camellia_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
{
|
||||
ulong64 L, R;
|
||||
ulong32 a, b;
|
||||
|
||||
LOAD64H(R, ct+0); LOAD64H(L, ct+8);
|
||||
L ^= skey->camellia.kw[3];
|
||||
R ^= skey->camellia.kw[2];
|
||||
|
||||
/* next FL */
|
||||
if (skey->camellia.R == 24) {
|
||||
/* fourth 6 rounds */
|
||||
L ^= F(R ^ skey->camellia.k[23]);
|
||||
R ^= F(L ^ skey->camellia.k[22]);
|
||||
L ^= F(R ^ skey->camellia.k[21]);
|
||||
R ^= F(L ^ skey->camellia.k[20]);
|
||||
L ^= F(R ^ skey->camellia.k[19]);
|
||||
R ^= F(L ^ skey->camellia.k[18]);
|
||||
|
||||
/* FL */
|
||||
a = (ulong32)(L >> 32);
|
||||
b = (ulong32)(L & 0xFFFFFFFFUL);
|
||||
a ^= b | (skey->camellia.kl[4] & 0xFFFFFFFFU);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[4] >> 32)), 1);
|
||||
L = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* FL^-1 */
|
||||
a = (ulong32)(R >> 32);
|
||||
b = (ulong32)(R & 0xFFFFFFFFUL);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[5] >> 32)), 1);
|
||||
a ^= b | (skey->camellia.kl[5] & 0xFFFFFFFFU);
|
||||
R = (((ulong64)a) << 32) | b;
|
||||
|
||||
}
|
||||
|
||||
/* third 6 rounds */
|
||||
L ^= F(R ^ skey->camellia.k[17]);
|
||||
R ^= F(L ^ skey->camellia.k[16]);
|
||||
L ^= F(R ^ skey->camellia.k[15]);
|
||||
R ^= F(L ^ skey->camellia.k[14]);
|
||||
L ^= F(R ^ skey->camellia.k[13]);
|
||||
R ^= F(L ^ skey->camellia.k[12]);
|
||||
|
||||
/* FL */
|
||||
a = (ulong32)(L >> 32);
|
||||
b = (ulong32)(L & 0xFFFFFFFFUL);
|
||||
a ^= b | (skey->camellia.kl[2] & 0xFFFFFFFFU);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[2] >> 32)), 1);
|
||||
L = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* FL^-1 */
|
||||
a = (ulong32)(R >> 32);
|
||||
b = (ulong32)(R & 0xFFFFFFFFUL);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[3] >> 32)), 1);
|
||||
a ^= b | (skey->camellia.kl[3] & 0xFFFFFFFFU);
|
||||
R = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* second 6 rounds */
|
||||
L ^= F(R ^ skey->camellia.k[11]);
|
||||
R ^= F(L ^ skey->camellia.k[10]);
|
||||
L ^= F(R ^ skey->camellia.k[9]);
|
||||
R ^= F(L ^ skey->camellia.k[8]);
|
||||
L ^= F(R ^ skey->camellia.k[7]);
|
||||
R ^= F(L ^ skey->camellia.k[6]);
|
||||
|
||||
/* FL */
|
||||
a = (ulong32)(L >> 32);
|
||||
b = (ulong32)(L & 0xFFFFFFFFUL);
|
||||
a ^= b | (skey->camellia.kl[0] & 0xFFFFFFFFU);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[0] >> 32)), 1);
|
||||
L = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* FL^-1 */
|
||||
a = (ulong32)(R >> 32);
|
||||
b = (ulong32)(R & 0xFFFFFFFFUL);
|
||||
b ^= ROL((a & (ulong32)(skey->camellia.kl[1] >> 32)), 1);
|
||||
a ^= b | (skey->camellia.kl[1] & 0xFFFFFFFFU);
|
||||
R = (((ulong64)a) << 32) | b;
|
||||
|
||||
/* first 6 rounds */
|
||||
L ^= F(R ^ skey->camellia.k[5]);
|
||||
R ^= F(L ^ skey->camellia.k[4]);
|
||||
L ^= F(R ^ skey->camellia.k[3]);
|
||||
R ^= F(L ^ skey->camellia.k[2]);
|
||||
L ^= F(R ^ skey->camellia.k[1]);
|
||||
R ^= F(L ^ skey->camellia.k[0]);
|
||||
|
||||
R ^= skey->camellia.kw[1];
|
||||
L ^= skey->camellia.kw[0];
|
||||
|
||||
STORE64H(R, pt+8); STORE64H(L, pt+0);
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int camellia_test(void)
|
||||
{
|
||||
static const struct {
|
||||
int keylen;
|
||||
unsigned char key[32], pt[16], ct[16];
|
||||
} tests[] = {
|
||||
|
||||
{
|
||||
16,
|
||||
{ 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
|
||||
0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 },
|
||||
{ 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
|
||||
0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 },
|
||||
{ 0x67, 0x67, 0x31, 0x38, 0x54, 0x96, 0x69, 0x73,
|
||||
0x08, 0x57, 0x06, 0x56, 0x48, 0xea, 0xbe, 0x43 }
|
||||
},
|
||||
|
||||
{
|
||||
24,
|
||||
{ 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
|
||||
0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10,
|
||||
0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77 },
|
||||
{ 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
|
||||
0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 },
|
||||
{ 0xb4, 0x99, 0x34, 0x01, 0xb3, 0xe9, 0x96, 0xf8,
|
||||
0x4e, 0xe5, 0xce, 0xe7, 0xd7, 0x9b, 0x09, 0xb9 }
|
||||
},
|
||||
|
||||
|
||||
{
|
||||
32,
|
||||
{ 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
|
||||
0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10,
|
||||
0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77,
|
||||
0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff },
|
||||
{ 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef,
|
||||
0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 },
|
||||
{ 0x9a, 0xcc, 0x23, 0x7d, 0xff, 0x16, 0xd7, 0x6c,
|
||||
0x20, 0xef, 0x7c, 0x91, 0x9e, 0x3a, 0x75, 0x09 }
|
||||
},
|
||||
|
||||
{
|
||||
32,
|
||||
{ 0x60, 0x3D, 0xEB, 0x10, 0x15, 0xCA, 0x71, 0xBE,
|
||||
0x2B, 0x73, 0xAE, 0xF0, 0x85, 0x7D, 0x77, 0x81,
|
||||
0x1F, 0x35, 0x2C, 0x07, 0x3B, 0x61, 0x08, 0xD7,
|
||||
0x2D, 0x98, 0x10, 0xA3, 0x09, 0x14, 0xDF, 0xF4 },
|
||||
{ 0xF6, 0x9F, 0x24, 0x45, 0xDF, 0x4F, 0x9B, 0x17,
|
||||
0xAD, 0x2B, 0x41, 0x7B, 0xE6, 0x6C, 0x37, 0x10 },
|
||||
{ 0x79, 0x60, 0x10, 0x9F, 0xB6, 0xDC, 0x42, 0x94,
|
||||
0x7F, 0xCF, 0xE5, 0x9E, 0xA3, 0xC5, 0xEB, 0x6B }
|
||||
}
|
||||
};
|
||||
unsigned char buf[2][16];
|
||||
symmetric_key skey;
|
||||
int err;
|
||||
unsigned int x;
|
||||
|
||||
for (x = 0; x < sizeof(tests)/sizeof(tests[0]); x++) {
|
||||
zeromem(&skey, sizeof(skey));
|
||||
if ((err = camellia_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = camellia_ecb_encrypt(tests[x].pt, buf[0], &skey)) != CRYPT_OK) {
|
||||
camellia_done(&skey);
|
||||
return err;
|
||||
}
|
||||
if ((err = camellia_ecb_decrypt(tests[x].ct, buf[1], &skey)) != CRYPT_OK) {
|
||||
camellia_done(&skey);
|
||||
return err;
|
||||
}
|
||||
camellia_done(&skey);
|
||||
if (compare_testvector(tests[x].ct, 16, buf[0], 16, "Camellia Encrypt", x) ||
|
||||
compare_testvector(tests[x].pt, 16, buf[1], 16, "Camellia Decrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
void camellia_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
int camellia_keysize(int *keysize)
|
||||
{
|
||||
if (*keysize >= 32) { *keysize = 32; }
|
||||
else if (*keysize >= 24) { *keysize = 24; }
|
||||
else if (*keysize >= 16) { *keysize = 16; }
|
||||
else return CRYPT_INVALID_KEYSIZE;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -5,13 +5,11 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
|
||||
/**
|
||||
@file cast5.c
|
||||
Implementation of LTC_CAST5 (RFC 2144) by Tom St Denis
|
||||
Implementation of LTC_CAST5 (RFC 2144) by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -27,375 +25,375 @@ const struct ltc_cipher_descriptor cast5_desc = {
|
||||
&cast5_test,
|
||||
&cast5_done,
|
||||
&cast5_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 S1[256] = {
|
||||
0x30fb40d4UL, 0x9fa0ff0bUL, 0x6beccd2fUL, 0x3f258c7aUL, 0x1e213f2fUL, 0x9c004dd3UL,
|
||||
0x6003e540UL, 0xcf9fc949UL, 0xbfd4af27UL, 0x88bbbdb5UL, 0xe2034090UL, 0x98d09675UL,
|
||||
0x6e63a0e0UL, 0x15c361d2UL, 0xc2e7661dUL, 0x22d4ff8eUL, 0x28683b6fUL, 0xc07fd059UL,
|
||||
0xff2379c8UL, 0x775f50e2UL, 0x43c340d3UL, 0xdf2f8656UL, 0x887ca41aUL, 0xa2d2bd2dUL,
|
||||
0xa1c9e0d6UL, 0x346c4819UL, 0x61b76d87UL, 0x22540f2fUL, 0x2abe32e1UL, 0xaa54166bUL,
|
||||
0x22568e3aUL, 0xa2d341d0UL, 0x66db40c8UL, 0xa784392fUL, 0x004dff2fUL, 0x2db9d2deUL,
|
||||
0x97943facUL, 0x4a97c1d8UL, 0x527644b7UL, 0xb5f437a7UL, 0xb82cbaefUL, 0xd751d159UL,
|
||||
0x6ff7f0edUL, 0x5a097a1fUL, 0x827b68d0UL, 0x90ecf52eUL, 0x22b0c054UL, 0xbc8e5935UL,
|
||||
0x4b6d2f7fUL, 0x50bb64a2UL, 0xd2664910UL, 0xbee5812dUL, 0xb7332290UL, 0xe93b159fUL,
|
||||
0xb48ee411UL, 0x4bff345dUL, 0xfd45c240UL, 0xad31973fUL, 0xc4f6d02eUL, 0x55fc8165UL,
|
||||
0xd5b1caadUL, 0xa1ac2daeUL, 0xa2d4b76dUL, 0xc19b0c50UL, 0x882240f2UL, 0x0c6e4f38UL,
|
||||
0xa4e4bfd7UL, 0x4f5ba272UL, 0x564c1d2fUL, 0xc59c5319UL, 0xb949e354UL, 0xb04669feUL,
|
||||
0xb1b6ab8aUL, 0xc71358ddUL, 0x6385c545UL, 0x110f935dUL, 0x57538ad5UL, 0x6a390493UL,
|
||||
0xe63d37e0UL, 0x2a54f6b3UL, 0x3a787d5fUL, 0x6276a0b5UL, 0x19a6fcdfUL, 0x7a42206aUL,
|
||||
0x29f9d4d5UL, 0xf61b1891UL, 0xbb72275eUL, 0xaa508167UL, 0x38901091UL, 0xc6b505ebUL,
|
||||
0x84c7cb8cUL, 0x2ad75a0fUL, 0x874a1427UL, 0xa2d1936bUL, 0x2ad286afUL, 0xaa56d291UL,
|
||||
0xd7894360UL, 0x425c750dUL, 0x93b39e26UL, 0x187184c9UL, 0x6c00b32dUL, 0x73e2bb14UL,
|
||||
0xa0bebc3cUL, 0x54623779UL, 0x64459eabUL, 0x3f328b82UL, 0x7718cf82UL, 0x59a2cea6UL,
|
||||
0x04ee002eUL, 0x89fe78e6UL, 0x3fab0950UL, 0x325ff6c2UL, 0x81383f05UL, 0x6963c5c8UL,
|
||||
0x76cb5ad6UL, 0xd49974c9UL, 0xca180dcfUL, 0x380782d5UL, 0xc7fa5cf6UL, 0x8ac31511UL,
|
||||
0x35e79e13UL, 0x47da91d0UL, 0xf40f9086UL, 0xa7e2419eUL, 0x31366241UL, 0x051ef495UL,
|
||||
0xaa573b04UL, 0x4a805d8dUL, 0x548300d0UL, 0x00322a3cUL, 0xbf64cddfUL, 0xba57a68eUL,
|
||||
0x75c6372bUL, 0x50afd341UL, 0xa7c13275UL, 0x915a0bf5UL, 0x6b54bfabUL, 0x2b0b1426UL,
|
||||
0xab4cc9d7UL, 0x449ccd82UL, 0xf7fbf265UL, 0xab85c5f3UL, 0x1b55db94UL, 0xaad4e324UL,
|
||||
0xcfa4bd3fUL, 0x2deaa3e2UL, 0x9e204d02UL, 0xc8bd25acUL, 0xeadf55b3UL, 0xd5bd9e98UL,
|
||||
0xe31231b2UL, 0x2ad5ad6cUL, 0x954329deUL, 0xadbe4528UL, 0xd8710f69UL, 0xaa51c90fUL,
|
||||
0xaa786bf6UL, 0x22513f1eUL, 0xaa51a79bUL, 0x2ad344ccUL, 0x7b5a41f0UL, 0xd37cfbadUL,
|
||||
0x1b069505UL, 0x41ece491UL, 0xb4c332e6UL, 0x032268d4UL, 0xc9600accUL, 0xce387e6dUL,
|
||||
0xbf6bb16cUL, 0x6a70fb78UL, 0x0d03d9c9UL, 0xd4df39deUL, 0xe01063daUL, 0x4736f464UL,
|
||||
0x5ad328d8UL, 0xb347cc96UL, 0x75bb0fc3UL, 0x98511bfbUL, 0x4ffbcc35UL, 0xb58bcf6aUL,
|
||||
0xe11f0abcUL, 0xbfc5fe4aUL, 0xa70aec10UL, 0xac39570aUL, 0x3f04442fUL, 0x6188b153UL,
|
||||
0xe0397a2eUL, 0x5727cb79UL, 0x9ceb418fUL, 0x1cacd68dUL, 0x2ad37c96UL, 0x0175cb9dUL,
|
||||
0xc69dff09UL, 0xc75b65f0UL, 0xd9db40d8UL, 0xec0e7779UL, 0x4744ead4UL, 0xb11c3274UL,
|
||||
0xdd24cb9eUL, 0x7e1c54bdUL, 0xf01144f9UL, 0xd2240eb1UL, 0x9675b3fdUL, 0xa3ac3755UL,
|
||||
0xd47c27afUL, 0x51c85f4dUL, 0x56907596UL, 0xa5bb15e6UL, 0x580304f0UL, 0xca042cf1UL,
|
||||
0x011a37eaUL, 0x8dbfaadbUL, 0x35ba3e4aUL, 0x3526ffa0UL, 0xc37b4d09UL, 0xbc306ed9UL,
|
||||
0x98a52666UL, 0x5648f725UL, 0xff5e569dUL, 0x0ced63d0UL, 0x7c63b2cfUL, 0x700b45e1UL,
|
||||
0xd5ea50f1UL, 0x85a92872UL, 0xaf1fbda7UL, 0xd4234870UL, 0xa7870bf3UL, 0x2d3b4d79UL,
|
||||
0x42e04198UL, 0x0cd0ede7UL, 0x26470db8UL, 0xf881814cUL, 0x474d6ad7UL, 0x7c0c5e5cUL,
|
||||
0xd1231959UL, 0x381b7298UL, 0xf5d2f4dbUL, 0xab838653UL, 0x6e2f1e23UL, 0x83719c9eUL,
|
||||
0xbd91e046UL, 0x9a56456eUL, 0xdc39200cUL, 0x20c8c571UL, 0x962bda1cUL, 0xe1e696ffUL,
|
||||
0xb141ab08UL, 0x7cca89b9UL, 0x1a69e783UL, 0x02cc4843UL, 0xa2f7c579UL, 0x429ef47dUL,
|
||||
0x30fb40d4UL, 0x9fa0ff0bUL, 0x6beccd2fUL, 0x3f258c7aUL, 0x1e213f2fUL, 0x9c004dd3UL,
|
||||
0x6003e540UL, 0xcf9fc949UL, 0xbfd4af27UL, 0x88bbbdb5UL, 0xe2034090UL, 0x98d09675UL,
|
||||
0x6e63a0e0UL, 0x15c361d2UL, 0xc2e7661dUL, 0x22d4ff8eUL, 0x28683b6fUL, 0xc07fd059UL,
|
||||
0xff2379c8UL, 0x775f50e2UL, 0x43c340d3UL, 0xdf2f8656UL, 0x887ca41aUL, 0xa2d2bd2dUL,
|
||||
0xa1c9e0d6UL, 0x346c4819UL, 0x61b76d87UL, 0x22540f2fUL, 0x2abe32e1UL, 0xaa54166bUL,
|
||||
0x22568e3aUL, 0xa2d341d0UL, 0x66db40c8UL, 0xa784392fUL, 0x004dff2fUL, 0x2db9d2deUL,
|
||||
0x97943facUL, 0x4a97c1d8UL, 0x527644b7UL, 0xb5f437a7UL, 0xb82cbaefUL, 0xd751d159UL,
|
||||
0x6ff7f0edUL, 0x5a097a1fUL, 0x827b68d0UL, 0x90ecf52eUL, 0x22b0c054UL, 0xbc8e5935UL,
|
||||
0x4b6d2f7fUL, 0x50bb64a2UL, 0xd2664910UL, 0xbee5812dUL, 0xb7332290UL, 0xe93b159fUL,
|
||||
0xb48ee411UL, 0x4bff345dUL, 0xfd45c240UL, 0xad31973fUL, 0xc4f6d02eUL, 0x55fc8165UL,
|
||||
0xd5b1caadUL, 0xa1ac2daeUL, 0xa2d4b76dUL, 0xc19b0c50UL, 0x882240f2UL, 0x0c6e4f38UL,
|
||||
0xa4e4bfd7UL, 0x4f5ba272UL, 0x564c1d2fUL, 0xc59c5319UL, 0xb949e354UL, 0xb04669feUL,
|
||||
0xb1b6ab8aUL, 0xc71358ddUL, 0x6385c545UL, 0x110f935dUL, 0x57538ad5UL, 0x6a390493UL,
|
||||
0xe63d37e0UL, 0x2a54f6b3UL, 0x3a787d5fUL, 0x6276a0b5UL, 0x19a6fcdfUL, 0x7a42206aUL,
|
||||
0x29f9d4d5UL, 0xf61b1891UL, 0xbb72275eUL, 0xaa508167UL, 0x38901091UL, 0xc6b505ebUL,
|
||||
0x84c7cb8cUL, 0x2ad75a0fUL, 0x874a1427UL, 0xa2d1936bUL, 0x2ad286afUL, 0xaa56d291UL,
|
||||
0xd7894360UL, 0x425c750dUL, 0x93b39e26UL, 0x187184c9UL, 0x6c00b32dUL, 0x73e2bb14UL,
|
||||
0xa0bebc3cUL, 0x54623779UL, 0x64459eabUL, 0x3f328b82UL, 0x7718cf82UL, 0x59a2cea6UL,
|
||||
0x04ee002eUL, 0x89fe78e6UL, 0x3fab0950UL, 0x325ff6c2UL, 0x81383f05UL, 0x6963c5c8UL,
|
||||
0x76cb5ad6UL, 0xd49974c9UL, 0xca180dcfUL, 0x380782d5UL, 0xc7fa5cf6UL, 0x8ac31511UL,
|
||||
0x35e79e13UL, 0x47da91d0UL, 0xf40f9086UL, 0xa7e2419eUL, 0x31366241UL, 0x051ef495UL,
|
||||
0xaa573b04UL, 0x4a805d8dUL, 0x548300d0UL, 0x00322a3cUL, 0xbf64cddfUL, 0xba57a68eUL,
|
||||
0x75c6372bUL, 0x50afd341UL, 0xa7c13275UL, 0x915a0bf5UL, 0x6b54bfabUL, 0x2b0b1426UL,
|
||||
0xab4cc9d7UL, 0x449ccd82UL, 0xf7fbf265UL, 0xab85c5f3UL, 0x1b55db94UL, 0xaad4e324UL,
|
||||
0xcfa4bd3fUL, 0x2deaa3e2UL, 0x9e204d02UL, 0xc8bd25acUL, 0xeadf55b3UL, 0xd5bd9e98UL,
|
||||
0xe31231b2UL, 0x2ad5ad6cUL, 0x954329deUL, 0xadbe4528UL, 0xd8710f69UL, 0xaa51c90fUL,
|
||||
0xaa786bf6UL, 0x22513f1eUL, 0xaa51a79bUL, 0x2ad344ccUL, 0x7b5a41f0UL, 0xd37cfbadUL,
|
||||
0x1b069505UL, 0x41ece491UL, 0xb4c332e6UL, 0x032268d4UL, 0xc9600accUL, 0xce387e6dUL,
|
||||
0xbf6bb16cUL, 0x6a70fb78UL, 0x0d03d9c9UL, 0xd4df39deUL, 0xe01063daUL, 0x4736f464UL,
|
||||
0x5ad328d8UL, 0xb347cc96UL, 0x75bb0fc3UL, 0x98511bfbUL, 0x4ffbcc35UL, 0xb58bcf6aUL,
|
||||
0xe11f0abcUL, 0xbfc5fe4aUL, 0xa70aec10UL, 0xac39570aUL, 0x3f04442fUL, 0x6188b153UL,
|
||||
0xe0397a2eUL, 0x5727cb79UL, 0x9ceb418fUL, 0x1cacd68dUL, 0x2ad37c96UL, 0x0175cb9dUL,
|
||||
0xc69dff09UL, 0xc75b65f0UL, 0xd9db40d8UL, 0xec0e7779UL, 0x4744ead4UL, 0xb11c3274UL,
|
||||
0xdd24cb9eUL, 0x7e1c54bdUL, 0xf01144f9UL, 0xd2240eb1UL, 0x9675b3fdUL, 0xa3ac3755UL,
|
||||
0xd47c27afUL, 0x51c85f4dUL, 0x56907596UL, 0xa5bb15e6UL, 0x580304f0UL, 0xca042cf1UL,
|
||||
0x011a37eaUL, 0x8dbfaadbUL, 0x35ba3e4aUL, 0x3526ffa0UL, 0xc37b4d09UL, 0xbc306ed9UL,
|
||||
0x98a52666UL, 0x5648f725UL, 0xff5e569dUL, 0x0ced63d0UL, 0x7c63b2cfUL, 0x700b45e1UL,
|
||||
0xd5ea50f1UL, 0x85a92872UL, 0xaf1fbda7UL, 0xd4234870UL, 0xa7870bf3UL, 0x2d3b4d79UL,
|
||||
0x42e04198UL, 0x0cd0ede7UL, 0x26470db8UL, 0xf881814cUL, 0x474d6ad7UL, 0x7c0c5e5cUL,
|
||||
0xd1231959UL, 0x381b7298UL, 0xf5d2f4dbUL, 0xab838653UL, 0x6e2f1e23UL, 0x83719c9eUL,
|
||||
0xbd91e046UL, 0x9a56456eUL, 0xdc39200cUL, 0x20c8c571UL, 0x962bda1cUL, 0xe1e696ffUL,
|
||||
0xb141ab08UL, 0x7cca89b9UL, 0x1a69e783UL, 0x02cc4843UL, 0xa2f7c579UL, 0x429ef47dUL,
|
||||
0x427b169cUL, 0x5ac9f049UL, 0xdd8f0f00UL, 0x5c8165bfUL};
|
||||
|
||||
static const ulong32 S2[256] = {
|
||||
0x1f201094UL, 0xef0ba75bUL, 0x69e3cf7eUL, 0x393f4380UL, 0xfe61cf7aUL, 0xeec5207aUL,
|
||||
0x55889c94UL, 0x72fc0651UL, 0xada7ef79UL, 0x4e1d7235UL, 0xd55a63ceUL, 0xde0436baUL,
|
||||
0x99c430efUL, 0x5f0c0794UL, 0x18dcdb7dUL, 0xa1d6eff3UL, 0xa0b52f7bUL, 0x59e83605UL,
|
||||
0xee15b094UL, 0xe9ffd909UL, 0xdc440086UL, 0xef944459UL, 0xba83ccb3UL, 0xe0c3cdfbUL,
|
||||
0xd1da4181UL, 0x3b092ab1UL, 0xf997f1c1UL, 0xa5e6cf7bUL, 0x01420ddbUL, 0xe4e7ef5bUL,
|
||||
0x25a1ff41UL, 0xe180f806UL, 0x1fc41080UL, 0x179bee7aUL, 0xd37ac6a9UL, 0xfe5830a4UL,
|
||||
0x98de8b7fUL, 0x77e83f4eUL, 0x79929269UL, 0x24fa9f7bUL, 0xe113c85bUL, 0xacc40083UL,
|
||||
0xd7503525UL, 0xf7ea615fUL, 0x62143154UL, 0x0d554b63UL, 0x5d681121UL, 0xc866c359UL,
|
||||
0x3d63cf73UL, 0xcee234c0UL, 0xd4d87e87UL, 0x5c672b21UL, 0x071f6181UL, 0x39f7627fUL,
|
||||
0x361e3084UL, 0xe4eb573bUL, 0x602f64a4UL, 0xd63acd9cUL, 0x1bbc4635UL, 0x9e81032dUL,
|
||||
0x2701f50cUL, 0x99847ab4UL, 0xa0e3df79UL, 0xba6cf38cUL, 0x10843094UL, 0x2537a95eUL,
|
||||
0xf46f6ffeUL, 0xa1ff3b1fUL, 0x208cfb6aUL, 0x8f458c74UL, 0xd9e0a227UL, 0x4ec73a34UL,
|
||||
0xfc884f69UL, 0x3e4de8dfUL, 0xef0e0088UL, 0x3559648dUL, 0x8a45388cUL, 0x1d804366UL,
|
||||
0x721d9bfdUL, 0xa58684bbUL, 0xe8256333UL, 0x844e8212UL, 0x128d8098UL, 0xfed33fb4UL,
|
||||
0xce280ae1UL, 0x27e19ba5UL, 0xd5a6c252UL, 0xe49754bdUL, 0xc5d655ddUL, 0xeb667064UL,
|
||||
0x77840b4dUL, 0xa1b6a801UL, 0x84db26a9UL, 0xe0b56714UL, 0x21f043b7UL, 0xe5d05860UL,
|
||||
0x54f03084UL, 0x066ff472UL, 0xa31aa153UL, 0xdadc4755UL, 0xb5625dbfUL, 0x68561be6UL,
|
||||
0x83ca6b94UL, 0x2d6ed23bUL, 0xeccf01dbUL, 0xa6d3d0baUL, 0xb6803d5cUL, 0xaf77a709UL,
|
||||
0x33b4a34cUL, 0x397bc8d6UL, 0x5ee22b95UL, 0x5f0e5304UL, 0x81ed6f61UL, 0x20e74364UL,
|
||||
0xb45e1378UL, 0xde18639bUL, 0x881ca122UL, 0xb96726d1UL, 0x8049a7e8UL, 0x22b7da7bUL,
|
||||
0x5e552d25UL, 0x5272d237UL, 0x79d2951cUL, 0xc60d894cUL, 0x488cb402UL, 0x1ba4fe5bUL,
|
||||
0xa4b09f6bUL, 0x1ca815cfUL, 0xa20c3005UL, 0x8871df63UL, 0xb9de2fcbUL, 0x0cc6c9e9UL,
|
||||
0x0beeff53UL, 0xe3214517UL, 0xb4542835UL, 0x9f63293cUL, 0xee41e729UL, 0x6e1d2d7cUL,
|
||||
0x50045286UL, 0x1e6685f3UL, 0xf33401c6UL, 0x30a22c95UL, 0x31a70850UL, 0x60930f13UL,
|
||||
0x73f98417UL, 0xa1269859UL, 0xec645c44UL, 0x52c877a9UL, 0xcdff33a6UL, 0xa02b1741UL,
|
||||
0x7cbad9a2UL, 0x2180036fUL, 0x50d99c08UL, 0xcb3f4861UL, 0xc26bd765UL, 0x64a3f6abUL,
|
||||
0x80342676UL, 0x25a75e7bUL, 0xe4e6d1fcUL, 0x20c710e6UL, 0xcdf0b680UL, 0x17844d3bUL,
|
||||
0x31eef84dUL, 0x7e0824e4UL, 0x2ccb49ebUL, 0x846a3baeUL, 0x8ff77888UL, 0xee5d60f6UL,
|
||||
0x7af75673UL, 0x2fdd5cdbUL, 0xa11631c1UL, 0x30f66f43UL, 0xb3faec54UL, 0x157fd7faUL,
|
||||
0xef8579ccUL, 0xd152de58UL, 0xdb2ffd5eUL, 0x8f32ce19UL, 0x306af97aUL, 0x02f03ef8UL,
|
||||
0x99319ad5UL, 0xc242fa0fUL, 0xa7e3ebb0UL, 0xc68e4906UL, 0xb8da230cUL, 0x80823028UL,
|
||||
0xdcdef3c8UL, 0xd35fb171UL, 0x088a1bc8UL, 0xbec0c560UL, 0x61a3c9e8UL, 0xbca8f54dUL,
|
||||
0xc72feffaUL, 0x22822e99UL, 0x82c570b4UL, 0xd8d94e89UL, 0x8b1c34bcUL, 0x301e16e6UL,
|
||||
0x273be979UL, 0xb0ffeaa6UL, 0x61d9b8c6UL, 0x00b24869UL, 0xb7ffce3fUL, 0x08dc283bUL,
|
||||
0x43daf65aUL, 0xf7e19798UL, 0x7619b72fUL, 0x8f1c9ba4UL, 0xdc8637a0UL, 0x16a7d3b1UL,
|
||||
0x9fc393b7UL, 0xa7136eebUL, 0xc6bcc63eUL, 0x1a513742UL, 0xef6828bcUL, 0x520365d6UL,
|
||||
0x2d6a77abUL, 0x3527ed4bUL, 0x821fd216UL, 0x095c6e2eUL, 0xdb92f2fbUL, 0x5eea29cbUL,
|
||||
0x145892f5UL, 0x91584f7fUL, 0x5483697bUL, 0x2667a8ccUL, 0x85196048UL, 0x8c4baceaUL,
|
||||
0x833860d4UL, 0x0d23e0f9UL, 0x6c387e8aUL, 0x0ae6d249UL, 0xb284600cUL, 0xd835731dUL,
|
||||
0xdcb1c647UL, 0xac4c56eaUL, 0x3ebd81b3UL, 0x230eabb0UL, 0x6438bc87UL, 0xf0b5b1faUL,
|
||||
0x8f5ea2b3UL, 0xfc184642UL, 0x0a036b7aUL, 0x4fb089bdUL, 0x649da589UL, 0xa345415eUL,
|
||||
0x5c038323UL, 0x3e5d3bb9UL, 0x43d79572UL, 0x7e6dd07cUL, 0x06dfdf1eUL, 0x6c6cc4efUL,
|
||||
0x1f201094UL, 0xef0ba75bUL, 0x69e3cf7eUL, 0x393f4380UL, 0xfe61cf7aUL, 0xeec5207aUL,
|
||||
0x55889c94UL, 0x72fc0651UL, 0xada7ef79UL, 0x4e1d7235UL, 0xd55a63ceUL, 0xde0436baUL,
|
||||
0x99c430efUL, 0x5f0c0794UL, 0x18dcdb7dUL, 0xa1d6eff3UL, 0xa0b52f7bUL, 0x59e83605UL,
|
||||
0xee15b094UL, 0xe9ffd909UL, 0xdc440086UL, 0xef944459UL, 0xba83ccb3UL, 0xe0c3cdfbUL,
|
||||
0xd1da4181UL, 0x3b092ab1UL, 0xf997f1c1UL, 0xa5e6cf7bUL, 0x01420ddbUL, 0xe4e7ef5bUL,
|
||||
0x25a1ff41UL, 0xe180f806UL, 0x1fc41080UL, 0x179bee7aUL, 0xd37ac6a9UL, 0xfe5830a4UL,
|
||||
0x98de8b7fUL, 0x77e83f4eUL, 0x79929269UL, 0x24fa9f7bUL, 0xe113c85bUL, 0xacc40083UL,
|
||||
0xd7503525UL, 0xf7ea615fUL, 0x62143154UL, 0x0d554b63UL, 0x5d681121UL, 0xc866c359UL,
|
||||
0x3d63cf73UL, 0xcee234c0UL, 0xd4d87e87UL, 0x5c672b21UL, 0x071f6181UL, 0x39f7627fUL,
|
||||
0x361e3084UL, 0xe4eb573bUL, 0x602f64a4UL, 0xd63acd9cUL, 0x1bbc4635UL, 0x9e81032dUL,
|
||||
0x2701f50cUL, 0x99847ab4UL, 0xa0e3df79UL, 0xba6cf38cUL, 0x10843094UL, 0x2537a95eUL,
|
||||
0xf46f6ffeUL, 0xa1ff3b1fUL, 0x208cfb6aUL, 0x8f458c74UL, 0xd9e0a227UL, 0x4ec73a34UL,
|
||||
0xfc884f69UL, 0x3e4de8dfUL, 0xef0e0088UL, 0x3559648dUL, 0x8a45388cUL, 0x1d804366UL,
|
||||
0x721d9bfdUL, 0xa58684bbUL, 0xe8256333UL, 0x844e8212UL, 0x128d8098UL, 0xfed33fb4UL,
|
||||
0xce280ae1UL, 0x27e19ba5UL, 0xd5a6c252UL, 0xe49754bdUL, 0xc5d655ddUL, 0xeb667064UL,
|
||||
0x77840b4dUL, 0xa1b6a801UL, 0x84db26a9UL, 0xe0b56714UL, 0x21f043b7UL, 0xe5d05860UL,
|
||||
0x54f03084UL, 0x066ff472UL, 0xa31aa153UL, 0xdadc4755UL, 0xb5625dbfUL, 0x68561be6UL,
|
||||
0x83ca6b94UL, 0x2d6ed23bUL, 0xeccf01dbUL, 0xa6d3d0baUL, 0xb6803d5cUL, 0xaf77a709UL,
|
||||
0x33b4a34cUL, 0x397bc8d6UL, 0x5ee22b95UL, 0x5f0e5304UL, 0x81ed6f61UL, 0x20e74364UL,
|
||||
0xb45e1378UL, 0xde18639bUL, 0x881ca122UL, 0xb96726d1UL, 0x8049a7e8UL, 0x22b7da7bUL,
|
||||
0x5e552d25UL, 0x5272d237UL, 0x79d2951cUL, 0xc60d894cUL, 0x488cb402UL, 0x1ba4fe5bUL,
|
||||
0xa4b09f6bUL, 0x1ca815cfUL, 0xa20c3005UL, 0x8871df63UL, 0xb9de2fcbUL, 0x0cc6c9e9UL,
|
||||
0x0beeff53UL, 0xe3214517UL, 0xb4542835UL, 0x9f63293cUL, 0xee41e729UL, 0x6e1d2d7cUL,
|
||||
0x50045286UL, 0x1e6685f3UL, 0xf33401c6UL, 0x30a22c95UL, 0x31a70850UL, 0x60930f13UL,
|
||||
0x73f98417UL, 0xa1269859UL, 0xec645c44UL, 0x52c877a9UL, 0xcdff33a6UL, 0xa02b1741UL,
|
||||
0x7cbad9a2UL, 0x2180036fUL, 0x50d99c08UL, 0xcb3f4861UL, 0xc26bd765UL, 0x64a3f6abUL,
|
||||
0x80342676UL, 0x25a75e7bUL, 0xe4e6d1fcUL, 0x20c710e6UL, 0xcdf0b680UL, 0x17844d3bUL,
|
||||
0x31eef84dUL, 0x7e0824e4UL, 0x2ccb49ebUL, 0x846a3baeUL, 0x8ff77888UL, 0xee5d60f6UL,
|
||||
0x7af75673UL, 0x2fdd5cdbUL, 0xa11631c1UL, 0x30f66f43UL, 0xb3faec54UL, 0x157fd7faUL,
|
||||
0xef8579ccUL, 0xd152de58UL, 0xdb2ffd5eUL, 0x8f32ce19UL, 0x306af97aUL, 0x02f03ef8UL,
|
||||
0x99319ad5UL, 0xc242fa0fUL, 0xa7e3ebb0UL, 0xc68e4906UL, 0xb8da230cUL, 0x80823028UL,
|
||||
0xdcdef3c8UL, 0xd35fb171UL, 0x088a1bc8UL, 0xbec0c560UL, 0x61a3c9e8UL, 0xbca8f54dUL,
|
||||
0xc72feffaUL, 0x22822e99UL, 0x82c570b4UL, 0xd8d94e89UL, 0x8b1c34bcUL, 0x301e16e6UL,
|
||||
0x273be979UL, 0xb0ffeaa6UL, 0x61d9b8c6UL, 0x00b24869UL, 0xb7ffce3fUL, 0x08dc283bUL,
|
||||
0x43daf65aUL, 0xf7e19798UL, 0x7619b72fUL, 0x8f1c9ba4UL, 0xdc8637a0UL, 0x16a7d3b1UL,
|
||||
0x9fc393b7UL, 0xa7136eebUL, 0xc6bcc63eUL, 0x1a513742UL, 0xef6828bcUL, 0x520365d6UL,
|
||||
0x2d6a77abUL, 0x3527ed4bUL, 0x821fd216UL, 0x095c6e2eUL, 0xdb92f2fbUL, 0x5eea29cbUL,
|
||||
0x145892f5UL, 0x91584f7fUL, 0x5483697bUL, 0x2667a8ccUL, 0x85196048UL, 0x8c4baceaUL,
|
||||
0x833860d4UL, 0x0d23e0f9UL, 0x6c387e8aUL, 0x0ae6d249UL, 0xb284600cUL, 0xd835731dUL,
|
||||
0xdcb1c647UL, 0xac4c56eaUL, 0x3ebd81b3UL, 0x230eabb0UL, 0x6438bc87UL, 0xf0b5b1faUL,
|
||||
0x8f5ea2b3UL, 0xfc184642UL, 0x0a036b7aUL, 0x4fb089bdUL, 0x649da589UL, 0xa345415eUL,
|
||||
0x5c038323UL, 0x3e5d3bb9UL, 0x43d79572UL, 0x7e6dd07cUL, 0x06dfdf1eUL, 0x6c6cc4efUL,
|
||||
0x7160a539UL, 0x73bfbe70UL, 0x83877605UL, 0x4523ecf1UL};
|
||||
|
||||
static const ulong32 S3[256] = {
|
||||
0x8defc240UL, 0x25fa5d9fUL, 0xeb903dbfUL, 0xe810c907UL, 0x47607fffUL, 0x369fe44bUL,
|
||||
0x8c1fc644UL, 0xaececa90UL, 0xbeb1f9bfUL, 0xeefbcaeaUL, 0xe8cf1950UL, 0x51df07aeUL,
|
||||
0x920e8806UL, 0xf0ad0548UL, 0xe13c8d83UL, 0x927010d5UL, 0x11107d9fUL, 0x07647db9UL,
|
||||
0xb2e3e4d4UL, 0x3d4f285eUL, 0xb9afa820UL, 0xfade82e0UL, 0xa067268bUL, 0x8272792eUL,
|
||||
0x553fb2c0UL, 0x489ae22bUL, 0xd4ef9794UL, 0x125e3fbcUL, 0x21fffceeUL, 0x825b1bfdUL,
|
||||
0x9255c5edUL, 0x1257a240UL, 0x4e1a8302UL, 0xbae07fffUL, 0x528246e7UL, 0x8e57140eUL,
|
||||
0x3373f7bfUL, 0x8c9f8188UL, 0xa6fc4ee8UL, 0xc982b5a5UL, 0xa8c01db7UL, 0x579fc264UL,
|
||||
0x67094f31UL, 0xf2bd3f5fUL, 0x40fff7c1UL, 0x1fb78dfcUL, 0x8e6bd2c1UL, 0x437be59bUL,
|
||||
0x99b03dbfUL, 0xb5dbc64bUL, 0x638dc0e6UL, 0x55819d99UL, 0xa197c81cUL, 0x4a012d6eUL,
|
||||
0xc5884a28UL, 0xccc36f71UL, 0xb843c213UL, 0x6c0743f1UL, 0x8309893cUL, 0x0feddd5fUL,
|
||||
0x2f7fe850UL, 0xd7c07f7eUL, 0x02507fbfUL, 0x5afb9a04UL, 0xa747d2d0UL, 0x1651192eUL,
|
||||
0xaf70bf3eUL, 0x58c31380UL, 0x5f98302eUL, 0x727cc3c4UL, 0x0a0fb402UL, 0x0f7fef82UL,
|
||||
0x8c96fdadUL, 0x5d2c2aaeUL, 0x8ee99a49UL, 0x50da88b8UL, 0x8427f4a0UL, 0x1eac5790UL,
|
||||
0x796fb449UL, 0x8252dc15UL, 0xefbd7d9bUL, 0xa672597dUL, 0xada840d8UL, 0x45f54504UL,
|
||||
0xfa5d7403UL, 0xe83ec305UL, 0x4f91751aUL, 0x925669c2UL, 0x23efe941UL, 0xa903f12eUL,
|
||||
0x60270df2UL, 0x0276e4b6UL, 0x94fd6574UL, 0x927985b2UL, 0x8276dbcbUL, 0x02778176UL,
|
||||
0xf8af918dUL, 0x4e48f79eUL, 0x8f616ddfUL, 0xe29d840eUL, 0x842f7d83UL, 0x340ce5c8UL,
|
||||
0x96bbb682UL, 0x93b4b148UL, 0xef303cabUL, 0x984faf28UL, 0x779faf9bUL, 0x92dc560dUL,
|
||||
0x224d1e20UL, 0x8437aa88UL, 0x7d29dc96UL, 0x2756d3dcUL, 0x8b907ceeUL, 0xb51fd240UL,
|
||||
0xe7c07ce3UL, 0xe566b4a1UL, 0xc3e9615eUL, 0x3cf8209dUL, 0x6094d1e3UL, 0xcd9ca341UL,
|
||||
0x5c76460eUL, 0x00ea983bUL, 0xd4d67881UL, 0xfd47572cUL, 0xf76cedd9UL, 0xbda8229cUL,
|
||||
0x127dadaaUL, 0x438a074eUL, 0x1f97c090UL, 0x081bdb8aUL, 0x93a07ebeUL, 0xb938ca15UL,
|
||||
0x97b03cffUL, 0x3dc2c0f8UL, 0x8d1ab2ecUL, 0x64380e51UL, 0x68cc7bfbUL, 0xd90f2788UL,
|
||||
0x12490181UL, 0x5de5ffd4UL, 0xdd7ef86aUL, 0x76a2e214UL, 0xb9a40368UL, 0x925d958fUL,
|
||||
0x4b39fffaUL, 0xba39aee9UL, 0xa4ffd30bUL, 0xfaf7933bUL, 0x6d498623UL, 0x193cbcfaUL,
|
||||
0x27627545UL, 0x825cf47aUL, 0x61bd8ba0UL, 0xd11e42d1UL, 0xcead04f4UL, 0x127ea392UL,
|
||||
0x10428db7UL, 0x8272a972UL, 0x9270c4a8UL, 0x127de50bUL, 0x285ba1c8UL, 0x3c62f44fUL,
|
||||
0x35c0eaa5UL, 0xe805d231UL, 0x428929fbUL, 0xb4fcdf82UL, 0x4fb66a53UL, 0x0e7dc15bUL,
|
||||
0x1f081fabUL, 0x108618aeUL, 0xfcfd086dUL, 0xf9ff2889UL, 0x694bcc11UL, 0x236a5caeUL,
|
||||
0x12deca4dUL, 0x2c3f8cc5UL, 0xd2d02dfeUL, 0xf8ef5896UL, 0xe4cf52daUL, 0x95155b67UL,
|
||||
0x494a488cUL, 0xb9b6a80cUL, 0x5c8f82bcUL, 0x89d36b45UL, 0x3a609437UL, 0xec00c9a9UL,
|
||||
0x44715253UL, 0x0a874b49UL, 0xd773bc40UL, 0x7c34671cUL, 0x02717ef6UL, 0x4feb5536UL,
|
||||
0xa2d02fffUL, 0xd2bf60c4UL, 0xd43f03c0UL, 0x50b4ef6dUL, 0x07478cd1UL, 0x006e1888UL,
|
||||
0xa2e53f55UL, 0xb9e6d4bcUL, 0xa2048016UL, 0x97573833UL, 0xd7207d67UL, 0xde0f8f3dUL,
|
||||
0x72f87b33UL, 0xabcc4f33UL, 0x7688c55dUL, 0x7b00a6b0UL, 0x947b0001UL, 0x570075d2UL,
|
||||
0xf9bb88f8UL, 0x8942019eUL, 0x4264a5ffUL, 0x856302e0UL, 0x72dbd92bUL, 0xee971b69UL,
|
||||
0x6ea22fdeUL, 0x5f08ae2bUL, 0xaf7a616dUL, 0xe5c98767UL, 0xcf1febd2UL, 0x61efc8c2UL,
|
||||
0xf1ac2571UL, 0xcc8239c2UL, 0x67214cb8UL, 0xb1e583d1UL, 0xb7dc3e62UL, 0x7f10bdceUL,
|
||||
0xf90a5c38UL, 0x0ff0443dUL, 0x606e6dc6UL, 0x60543a49UL, 0x5727c148UL, 0x2be98a1dUL,
|
||||
0x8ab41738UL, 0x20e1be24UL, 0xaf96da0fUL, 0x68458425UL, 0x99833be5UL, 0x600d457dUL,
|
||||
0x282f9350UL, 0x8334b362UL, 0xd91d1120UL, 0x2b6d8da0UL, 0x642b1e31UL, 0x9c305a00UL,
|
||||
0x52bce688UL, 0x1b03588aUL, 0xf7baefd5UL, 0x4142ed9cUL, 0xa4315c11UL, 0x83323ec5UL,
|
||||
0x8defc240UL, 0x25fa5d9fUL, 0xeb903dbfUL, 0xe810c907UL, 0x47607fffUL, 0x369fe44bUL,
|
||||
0x8c1fc644UL, 0xaececa90UL, 0xbeb1f9bfUL, 0xeefbcaeaUL, 0xe8cf1950UL, 0x51df07aeUL,
|
||||
0x920e8806UL, 0xf0ad0548UL, 0xe13c8d83UL, 0x927010d5UL, 0x11107d9fUL, 0x07647db9UL,
|
||||
0xb2e3e4d4UL, 0x3d4f285eUL, 0xb9afa820UL, 0xfade82e0UL, 0xa067268bUL, 0x8272792eUL,
|
||||
0x553fb2c0UL, 0x489ae22bUL, 0xd4ef9794UL, 0x125e3fbcUL, 0x21fffceeUL, 0x825b1bfdUL,
|
||||
0x9255c5edUL, 0x1257a240UL, 0x4e1a8302UL, 0xbae07fffUL, 0x528246e7UL, 0x8e57140eUL,
|
||||
0x3373f7bfUL, 0x8c9f8188UL, 0xa6fc4ee8UL, 0xc982b5a5UL, 0xa8c01db7UL, 0x579fc264UL,
|
||||
0x67094f31UL, 0xf2bd3f5fUL, 0x40fff7c1UL, 0x1fb78dfcUL, 0x8e6bd2c1UL, 0x437be59bUL,
|
||||
0x99b03dbfUL, 0xb5dbc64bUL, 0x638dc0e6UL, 0x55819d99UL, 0xa197c81cUL, 0x4a012d6eUL,
|
||||
0xc5884a28UL, 0xccc36f71UL, 0xb843c213UL, 0x6c0743f1UL, 0x8309893cUL, 0x0feddd5fUL,
|
||||
0x2f7fe850UL, 0xd7c07f7eUL, 0x02507fbfUL, 0x5afb9a04UL, 0xa747d2d0UL, 0x1651192eUL,
|
||||
0xaf70bf3eUL, 0x58c31380UL, 0x5f98302eUL, 0x727cc3c4UL, 0x0a0fb402UL, 0x0f7fef82UL,
|
||||
0x8c96fdadUL, 0x5d2c2aaeUL, 0x8ee99a49UL, 0x50da88b8UL, 0x8427f4a0UL, 0x1eac5790UL,
|
||||
0x796fb449UL, 0x8252dc15UL, 0xefbd7d9bUL, 0xa672597dUL, 0xada840d8UL, 0x45f54504UL,
|
||||
0xfa5d7403UL, 0xe83ec305UL, 0x4f91751aUL, 0x925669c2UL, 0x23efe941UL, 0xa903f12eUL,
|
||||
0x60270df2UL, 0x0276e4b6UL, 0x94fd6574UL, 0x927985b2UL, 0x8276dbcbUL, 0x02778176UL,
|
||||
0xf8af918dUL, 0x4e48f79eUL, 0x8f616ddfUL, 0xe29d840eUL, 0x842f7d83UL, 0x340ce5c8UL,
|
||||
0x96bbb682UL, 0x93b4b148UL, 0xef303cabUL, 0x984faf28UL, 0x779faf9bUL, 0x92dc560dUL,
|
||||
0x224d1e20UL, 0x8437aa88UL, 0x7d29dc96UL, 0x2756d3dcUL, 0x8b907ceeUL, 0xb51fd240UL,
|
||||
0xe7c07ce3UL, 0xe566b4a1UL, 0xc3e9615eUL, 0x3cf8209dUL, 0x6094d1e3UL, 0xcd9ca341UL,
|
||||
0x5c76460eUL, 0x00ea983bUL, 0xd4d67881UL, 0xfd47572cUL, 0xf76cedd9UL, 0xbda8229cUL,
|
||||
0x127dadaaUL, 0x438a074eUL, 0x1f97c090UL, 0x081bdb8aUL, 0x93a07ebeUL, 0xb938ca15UL,
|
||||
0x97b03cffUL, 0x3dc2c0f8UL, 0x8d1ab2ecUL, 0x64380e51UL, 0x68cc7bfbUL, 0xd90f2788UL,
|
||||
0x12490181UL, 0x5de5ffd4UL, 0xdd7ef86aUL, 0x76a2e214UL, 0xb9a40368UL, 0x925d958fUL,
|
||||
0x4b39fffaUL, 0xba39aee9UL, 0xa4ffd30bUL, 0xfaf7933bUL, 0x6d498623UL, 0x193cbcfaUL,
|
||||
0x27627545UL, 0x825cf47aUL, 0x61bd8ba0UL, 0xd11e42d1UL, 0xcead04f4UL, 0x127ea392UL,
|
||||
0x10428db7UL, 0x8272a972UL, 0x9270c4a8UL, 0x127de50bUL, 0x285ba1c8UL, 0x3c62f44fUL,
|
||||
0x35c0eaa5UL, 0xe805d231UL, 0x428929fbUL, 0xb4fcdf82UL, 0x4fb66a53UL, 0x0e7dc15bUL,
|
||||
0x1f081fabUL, 0x108618aeUL, 0xfcfd086dUL, 0xf9ff2889UL, 0x694bcc11UL, 0x236a5caeUL,
|
||||
0x12deca4dUL, 0x2c3f8cc5UL, 0xd2d02dfeUL, 0xf8ef5896UL, 0xe4cf52daUL, 0x95155b67UL,
|
||||
0x494a488cUL, 0xb9b6a80cUL, 0x5c8f82bcUL, 0x89d36b45UL, 0x3a609437UL, 0xec00c9a9UL,
|
||||
0x44715253UL, 0x0a874b49UL, 0xd773bc40UL, 0x7c34671cUL, 0x02717ef6UL, 0x4feb5536UL,
|
||||
0xa2d02fffUL, 0xd2bf60c4UL, 0xd43f03c0UL, 0x50b4ef6dUL, 0x07478cd1UL, 0x006e1888UL,
|
||||
0xa2e53f55UL, 0xb9e6d4bcUL, 0xa2048016UL, 0x97573833UL, 0xd7207d67UL, 0xde0f8f3dUL,
|
||||
0x72f87b33UL, 0xabcc4f33UL, 0x7688c55dUL, 0x7b00a6b0UL, 0x947b0001UL, 0x570075d2UL,
|
||||
0xf9bb88f8UL, 0x8942019eUL, 0x4264a5ffUL, 0x856302e0UL, 0x72dbd92bUL, 0xee971b69UL,
|
||||
0x6ea22fdeUL, 0x5f08ae2bUL, 0xaf7a616dUL, 0xe5c98767UL, 0xcf1febd2UL, 0x61efc8c2UL,
|
||||
0xf1ac2571UL, 0xcc8239c2UL, 0x67214cb8UL, 0xb1e583d1UL, 0xb7dc3e62UL, 0x7f10bdceUL,
|
||||
0xf90a5c38UL, 0x0ff0443dUL, 0x606e6dc6UL, 0x60543a49UL, 0x5727c148UL, 0x2be98a1dUL,
|
||||
0x8ab41738UL, 0x20e1be24UL, 0xaf96da0fUL, 0x68458425UL, 0x99833be5UL, 0x600d457dUL,
|
||||
0x282f9350UL, 0x8334b362UL, 0xd91d1120UL, 0x2b6d8da0UL, 0x642b1e31UL, 0x9c305a00UL,
|
||||
0x52bce688UL, 0x1b03588aUL, 0xf7baefd5UL, 0x4142ed9cUL, 0xa4315c11UL, 0x83323ec5UL,
|
||||
0xdfef4636UL, 0xa133c501UL, 0xe9d3531cUL, 0xee353783UL};
|
||||
|
||||
static const ulong32 S4[256] = {
|
||||
0x9db30420UL, 0x1fb6e9deUL, 0xa7be7befUL, 0xd273a298UL, 0x4a4f7bdbUL, 0x64ad8c57UL,
|
||||
0x85510443UL, 0xfa020ed1UL, 0x7e287affUL, 0xe60fb663UL, 0x095f35a1UL, 0x79ebf120UL,
|
||||
0xfd059d43UL, 0x6497b7b1UL, 0xf3641f63UL, 0x241e4adfUL, 0x28147f5fUL, 0x4fa2b8cdUL,
|
||||
0xc9430040UL, 0x0cc32220UL, 0xfdd30b30UL, 0xc0a5374fUL, 0x1d2d00d9UL, 0x24147b15UL,
|
||||
0xee4d111aUL, 0x0fca5167UL, 0x71ff904cUL, 0x2d195ffeUL, 0x1a05645fUL, 0x0c13fefeUL,
|
||||
0x081b08caUL, 0x05170121UL, 0x80530100UL, 0xe83e5efeUL, 0xac9af4f8UL, 0x7fe72701UL,
|
||||
0xd2b8ee5fUL, 0x06df4261UL, 0xbb9e9b8aUL, 0x7293ea25UL, 0xce84ffdfUL, 0xf5718801UL,
|
||||
0x3dd64b04UL, 0xa26f263bUL, 0x7ed48400UL, 0x547eebe6UL, 0x446d4ca0UL, 0x6cf3d6f5UL,
|
||||
0x2649abdfUL, 0xaea0c7f5UL, 0x36338cc1UL, 0x503f7e93UL, 0xd3772061UL, 0x11b638e1UL,
|
||||
0x72500e03UL, 0xf80eb2bbUL, 0xabe0502eUL, 0xec8d77deUL, 0x57971e81UL, 0xe14f6746UL,
|
||||
0xc9335400UL, 0x6920318fUL, 0x081dbb99UL, 0xffc304a5UL, 0x4d351805UL, 0x7f3d5ce3UL,
|
||||
0xa6c866c6UL, 0x5d5bcca9UL, 0xdaec6feaUL, 0x9f926f91UL, 0x9f46222fUL, 0x3991467dUL,
|
||||
0xa5bf6d8eUL, 0x1143c44fUL, 0x43958302UL, 0xd0214eebUL, 0x022083b8UL, 0x3fb6180cUL,
|
||||
0x18f8931eUL, 0x281658e6UL, 0x26486e3eUL, 0x8bd78a70UL, 0x7477e4c1UL, 0xb506e07cUL,
|
||||
0xf32d0a25UL, 0x79098b02UL, 0xe4eabb81UL, 0x28123b23UL, 0x69dead38UL, 0x1574ca16UL,
|
||||
0xdf871b62UL, 0x211c40b7UL, 0xa51a9ef9UL, 0x0014377bUL, 0x041e8ac8UL, 0x09114003UL,
|
||||
0xbd59e4d2UL, 0xe3d156d5UL, 0x4fe876d5UL, 0x2f91a340UL, 0x557be8deUL, 0x00eae4a7UL,
|
||||
0x0ce5c2ecUL, 0x4db4bba6UL, 0xe756bdffUL, 0xdd3369acUL, 0xec17b035UL, 0x06572327UL,
|
||||
0x99afc8b0UL, 0x56c8c391UL, 0x6b65811cUL, 0x5e146119UL, 0x6e85cb75UL, 0xbe07c002UL,
|
||||
0xc2325577UL, 0x893ff4ecUL, 0x5bbfc92dUL, 0xd0ec3b25UL, 0xb7801ab7UL, 0x8d6d3b24UL,
|
||||
0x20c763efUL, 0xc366a5fcUL, 0x9c382880UL, 0x0ace3205UL, 0xaac9548aUL, 0xeca1d7c7UL,
|
||||
0x041afa32UL, 0x1d16625aUL, 0x6701902cUL, 0x9b757a54UL, 0x31d477f7UL, 0x9126b031UL,
|
||||
0x36cc6fdbUL, 0xc70b8b46UL, 0xd9e66a48UL, 0x56e55a79UL, 0x026a4cebUL, 0x52437effUL,
|
||||
0x2f8f76b4UL, 0x0df980a5UL, 0x8674cde3UL, 0xedda04ebUL, 0x17a9be04UL, 0x2c18f4dfUL,
|
||||
0xb7747f9dUL, 0xab2af7b4UL, 0xefc34d20UL, 0x2e096b7cUL, 0x1741a254UL, 0xe5b6a035UL,
|
||||
0x213d42f6UL, 0x2c1c7c26UL, 0x61c2f50fUL, 0x6552daf9UL, 0xd2c231f8UL, 0x25130f69UL,
|
||||
0xd8167fa2UL, 0x0418f2c8UL, 0x001a96a6UL, 0x0d1526abUL, 0x63315c21UL, 0x5e0a72ecUL,
|
||||
0x49bafefdUL, 0x187908d9UL, 0x8d0dbd86UL, 0x311170a7UL, 0x3e9b640cUL, 0xcc3e10d7UL,
|
||||
0xd5cad3b6UL, 0x0caec388UL, 0xf73001e1UL, 0x6c728affUL, 0x71eae2a1UL, 0x1f9af36eUL,
|
||||
0xcfcbd12fUL, 0xc1de8417UL, 0xac07be6bUL, 0xcb44a1d8UL, 0x8b9b0f56UL, 0x013988c3UL,
|
||||
0xb1c52fcaUL, 0xb4be31cdUL, 0xd8782806UL, 0x12a3a4e2UL, 0x6f7de532UL, 0x58fd7eb6UL,
|
||||
0xd01ee900UL, 0x24adffc2UL, 0xf4990fc5UL, 0x9711aac5UL, 0x001d7b95UL, 0x82e5e7d2UL,
|
||||
0x109873f6UL, 0x00613096UL, 0xc32d9521UL, 0xada121ffUL, 0x29908415UL, 0x7fbb977fUL,
|
||||
0xaf9eb3dbUL, 0x29c9ed2aUL, 0x5ce2a465UL, 0xa730f32cUL, 0xd0aa3fe8UL, 0x8a5cc091UL,
|
||||
0xd49e2ce7UL, 0x0ce454a9UL, 0xd60acd86UL, 0x015f1919UL, 0x77079103UL, 0xdea03af6UL,
|
||||
0x78a8565eUL, 0xdee356dfUL, 0x21f05cbeUL, 0x8b75e387UL, 0xb3c50651UL, 0xb8a5c3efUL,
|
||||
0xd8eeb6d2UL, 0xe523be77UL, 0xc2154529UL, 0x2f69efdfUL, 0xafe67afbUL, 0xf470c4b2UL,
|
||||
0xf3e0eb5bUL, 0xd6cc9876UL, 0x39e4460cUL, 0x1fda8538UL, 0x1987832fUL, 0xca007367UL,
|
||||
0xa99144f8UL, 0x296b299eUL, 0x492fc295UL, 0x9266beabUL, 0xb5676e69UL, 0x9bd3dddaUL,
|
||||
0xdf7e052fUL, 0xdb25701cUL, 0x1b5e51eeUL, 0xf65324e6UL, 0x6afce36cUL, 0x0316cc04UL,
|
||||
0x8644213eUL, 0xb7dc59d0UL, 0x7965291fUL, 0xccd6fd43UL, 0x41823979UL, 0x932bcdf6UL,
|
||||
0xb657c34dUL, 0x4edfd282UL, 0x7ae5290cUL, 0x3cb9536bUL, 0x851e20feUL, 0x9833557eUL,
|
||||
0x9db30420UL, 0x1fb6e9deUL, 0xa7be7befUL, 0xd273a298UL, 0x4a4f7bdbUL, 0x64ad8c57UL,
|
||||
0x85510443UL, 0xfa020ed1UL, 0x7e287affUL, 0xe60fb663UL, 0x095f35a1UL, 0x79ebf120UL,
|
||||
0xfd059d43UL, 0x6497b7b1UL, 0xf3641f63UL, 0x241e4adfUL, 0x28147f5fUL, 0x4fa2b8cdUL,
|
||||
0xc9430040UL, 0x0cc32220UL, 0xfdd30b30UL, 0xc0a5374fUL, 0x1d2d00d9UL, 0x24147b15UL,
|
||||
0xee4d111aUL, 0x0fca5167UL, 0x71ff904cUL, 0x2d195ffeUL, 0x1a05645fUL, 0x0c13fefeUL,
|
||||
0x081b08caUL, 0x05170121UL, 0x80530100UL, 0xe83e5efeUL, 0xac9af4f8UL, 0x7fe72701UL,
|
||||
0xd2b8ee5fUL, 0x06df4261UL, 0xbb9e9b8aUL, 0x7293ea25UL, 0xce84ffdfUL, 0xf5718801UL,
|
||||
0x3dd64b04UL, 0xa26f263bUL, 0x7ed48400UL, 0x547eebe6UL, 0x446d4ca0UL, 0x6cf3d6f5UL,
|
||||
0x2649abdfUL, 0xaea0c7f5UL, 0x36338cc1UL, 0x503f7e93UL, 0xd3772061UL, 0x11b638e1UL,
|
||||
0x72500e03UL, 0xf80eb2bbUL, 0xabe0502eUL, 0xec8d77deUL, 0x57971e81UL, 0xe14f6746UL,
|
||||
0xc9335400UL, 0x6920318fUL, 0x081dbb99UL, 0xffc304a5UL, 0x4d351805UL, 0x7f3d5ce3UL,
|
||||
0xa6c866c6UL, 0x5d5bcca9UL, 0xdaec6feaUL, 0x9f926f91UL, 0x9f46222fUL, 0x3991467dUL,
|
||||
0xa5bf6d8eUL, 0x1143c44fUL, 0x43958302UL, 0xd0214eebUL, 0x022083b8UL, 0x3fb6180cUL,
|
||||
0x18f8931eUL, 0x281658e6UL, 0x26486e3eUL, 0x8bd78a70UL, 0x7477e4c1UL, 0xb506e07cUL,
|
||||
0xf32d0a25UL, 0x79098b02UL, 0xe4eabb81UL, 0x28123b23UL, 0x69dead38UL, 0x1574ca16UL,
|
||||
0xdf871b62UL, 0x211c40b7UL, 0xa51a9ef9UL, 0x0014377bUL, 0x041e8ac8UL, 0x09114003UL,
|
||||
0xbd59e4d2UL, 0xe3d156d5UL, 0x4fe876d5UL, 0x2f91a340UL, 0x557be8deUL, 0x00eae4a7UL,
|
||||
0x0ce5c2ecUL, 0x4db4bba6UL, 0xe756bdffUL, 0xdd3369acUL, 0xec17b035UL, 0x06572327UL,
|
||||
0x99afc8b0UL, 0x56c8c391UL, 0x6b65811cUL, 0x5e146119UL, 0x6e85cb75UL, 0xbe07c002UL,
|
||||
0xc2325577UL, 0x893ff4ecUL, 0x5bbfc92dUL, 0xd0ec3b25UL, 0xb7801ab7UL, 0x8d6d3b24UL,
|
||||
0x20c763efUL, 0xc366a5fcUL, 0x9c382880UL, 0x0ace3205UL, 0xaac9548aUL, 0xeca1d7c7UL,
|
||||
0x041afa32UL, 0x1d16625aUL, 0x6701902cUL, 0x9b757a54UL, 0x31d477f7UL, 0x9126b031UL,
|
||||
0x36cc6fdbUL, 0xc70b8b46UL, 0xd9e66a48UL, 0x56e55a79UL, 0x026a4cebUL, 0x52437effUL,
|
||||
0x2f8f76b4UL, 0x0df980a5UL, 0x8674cde3UL, 0xedda04ebUL, 0x17a9be04UL, 0x2c18f4dfUL,
|
||||
0xb7747f9dUL, 0xab2af7b4UL, 0xefc34d20UL, 0x2e096b7cUL, 0x1741a254UL, 0xe5b6a035UL,
|
||||
0x213d42f6UL, 0x2c1c7c26UL, 0x61c2f50fUL, 0x6552daf9UL, 0xd2c231f8UL, 0x25130f69UL,
|
||||
0xd8167fa2UL, 0x0418f2c8UL, 0x001a96a6UL, 0x0d1526abUL, 0x63315c21UL, 0x5e0a72ecUL,
|
||||
0x49bafefdUL, 0x187908d9UL, 0x8d0dbd86UL, 0x311170a7UL, 0x3e9b640cUL, 0xcc3e10d7UL,
|
||||
0xd5cad3b6UL, 0x0caec388UL, 0xf73001e1UL, 0x6c728affUL, 0x71eae2a1UL, 0x1f9af36eUL,
|
||||
0xcfcbd12fUL, 0xc1de8417UL, 0xac07be6bUL, 0xcb44a1d8UL, 0x8b9b0f56UL, 0x013988c3UL,
|
||||
0xb1c52fcaUL, 0xb4be31cdUL, 0xd8782806UL, 0x12a3a4e2UL, 0x6f7de532UL, 0x58fd7eb6UL,
|
||||
0xd01ee900UL, 0x24adffc2UL, 0xf4990fc5UL, 0x9711aac5UL, 0x001d7b95UL, 0x82e5e7d2UL,
|
||||
0x109873f6UL, 0x00613096UL, 0xc32d9521UL, 0xada121ffUL, 0x29908415UL, 0x7fbb977fUL,
|
||||
0xaf9eb3dbUL, 0x29c9ed2aUL, 0x5ce2a465UL, 0xa730f32cUL, 0xd0aa3fe8UL, 0x8a5cc091UL,
|
||||
0xd49e2ce7UL, 0x0ce454a9UL, 0xd60acd86UL, 0x015f1919UL, 0x77079103UL, 0xdea03af6UL,
|
||||
0x78a8565eUL, 0xdee356dfUL, 0x21f05cbeUL, 0x8b75e387UL, 0xb3c50651UL, 0xb8a5c3efUL,
|
||||
0xd8eeb6d2UL, 0xe523be77UL, 0xc2154529UL, 0x2f69efdfUL, 0xafe67afbUL, 0xf470c4b2UL,
|
||||
0xf3e0eb5bUL, 0xd6cc9876UL, 0x39e4460cUL, 0x1fda8538UL, 0x1987832fUL, 0xca007367UL,
|
||||
0xa99144f8UL, 0x296b299eUL, 0x492fc295UL, 0x9266beabUL, 0xb5676e69UL, 0x9bd3dddaUL,
|
||||
0xdf7e052fUL, 0xdb25701cUL, 0x1b5e51eeUL, 0xf65324e6UL, 0x6afce36cUL, 0x0316cc04UL,
|
||||
0x8644213eUL, 0xb7dc59d0UL, 0x7965291fUL, 0xccd6fd43UL, 0x41823979UL, 0x932bcdf6UL,
|
||||
0xb657c34dUL, 0x4edfd282UL, 0x7ae5290cUL, 0x3cb9536bUL, 0x851e20feUL, 0x9833557eUL,
|
||||
0x13ecf0b0UL, 0xd3ffb372UL, 0x3f85c5c1UL, 0x0aef7ed2UL};
|
||||
|
||||
static const ulong32 S5[256] = {
|
||||
0x7ec90c04UL, 0x2c6e74b9UL, 0x9b0e66dfUL, 0xa6337911UL, 0xb86a7fffUL, 0x1dd358f5UL,
|
||||
0x44dd9d44UL, 0x1731167fUL, 0x08fbf1faUL, 0xe7f511ccUL, 0xd2051b00UL, 0x735aba00UL,
|
||||
0x2ab722d8UL, 0x386381cbUL, 0xacf6243aUL, 0x69befd7aUL, 0xe6a2e77fUL, 0xf0c720cdUL,
|
||||
0xc4494816UL, 0xccf5c180UL, 0x38851640UL, 0x15b0a848UL, 0xe68b18cbUL, 0x4caadeffUL,
|
||||
0x5f480a01UL, 0x0412b2aaUL, 0x259814fcUL, 0x41d0efe2UL, 0x4e40b48dUL, 0x248eb6fbUL,
|
||||
0x8dba1cfeUL, 0x41a99b02UL, 0x1a550a04UL, 0xba8f65cbUL, 0x7251f4e7UL, 0x95a51725UL,
|
||||
0xc106ecd7UL, 0x97a5980aUL, 0xc539b9aaUL, 0x4d79fe6aUL, 0xf2f3f763UL, 0x68af8040UL,
|
||||
0xed0c9e56UL, 0x11b4958bUL, 0xe1eb5a88UL, 0x8709e6b0UL, 0xd7e07156UL, 0x4e29fea7UL,
|
||||
0x6366e52dUL, 0x02d1c000UL, 0xc4ac8e05UL, 0x9377f571UL, 0x0c05372aUL, 0x578535f2UL,
|
||||
0x2261be02UL, 0xd642a0c9UL, 0xdf13a280UL, 0x74b55bd2UL, 0x682199c0UL, 0xd421e5ecUL,
|
||||
0x53fb3ce8UL, 0xc8adedb3UL, 0x28a87fc9UL, 0x3d959981UL, 0x5c1ff900UL, 0xfe38d399UL,
|
||||
0x0c4eff0bUL, 0x062407eaUL, 0xaa2f4fb1UL, 0x4fb96976UL, 0x90c79505UL, 0xb0a8a774UL,
|
||||
0xef55a1ffUL, 0xe59ca2c2UL, 0xa6b62d27UL, 0xe66a4263UL, 0xdf65001fUL, 0x0ec50966UL,
|
||||
0xdfdd55bcUL, 0x29de0655UL, 0x911e739aUL, 0x17af8975UL, 0x32c7911cUL, 0x89f89468UL,
|
||||
0x0d01e980UL, 0x524755f4UL, 0x03b63cc9UL, 0x0cc844b2UL, 0xbcf3f0aaUL, 0x87ac36e9UL,
|
||||
0xe53a7426UL, 0x01b3d82bUL, 0x1a9e7449UL, 0x64ee2d7eUL, 0xcddbb1daUL, 0x01c94910UL,
|
||||
0xb868bf80UL, 0x0d26f3fdUL, 0x9342ede7UL, 0x04a5c284UL, 0x636737b6UL, 0x50f5b616UL,
|
||||
0xf24766e3UL, 0x8eca36c1UL, 0x136e05dbUL, 0xfef18391UL, 0xfb887a37UL, 0xd6e7f7d4UL,
|
||||
0xc7fb7dc9UL, 0x3063fcdfUL, 0xb6f589deUL, 0xec2941daUL, 0x26e46695UL, 0xb7566419UL,
|
||||
0xf654efc5UL, 0xd08d58b7UL, 0x48925401UL, 0xc1bacb7fUL, 0xe5ff550fUL, 0xb6083049UL,
|
||||
0x5bb5d0e8UL, 0x87d72e5aUL, 0xab6a6ee1UL, 0x223a66ceUL, 0xc62bf3cdUL, 0x9e0885f9UL,
|
||||
0x68cb3e47UL, 0x086c010fUL, 0xa21de820UL, 0xd18b69deUL, 0xf3f65777UL, 0xfa02c3f6UL,
|
||||
0x407edac3UL, 0xcbb3d550UL, 0x1793084dUL, 0xb0d70ebaUL, 0x0ab378d5UL, 0xd951fb0cUL,
|
||||
0xded7da56UL, 0x4124bbe4UL, 0x94ca0b56UL, 0x0f5755d1UL, 0xe0e1e56eUL, 0x6184b5beUL,
|
||||
0x580a249fUL, 0x94f74bc0UL, 0xe327888eUL, 0x9f7b5561UL, 0xc3dc0280UL, 0x05687715UL,
|
||||
0x646c6bd7UL, 0x44904db3UL, 0x66b4f0a3UL, 0xc0f1648aUL, 0x697ed5afUL, 0x49e92ff6UL,
|
||||
0x309e374fUL, 0x2cb6356aUL, 0x85808573UL, 0x4991f840UL, 0x76f0ae02UL, 0x083be84dUL,
|
||||
0x28421c9aUL, 0x44489406UL, 0x736e4cb8UL, 0xc1092910UL, 0x8bc95fc6UL, 0x7d869cf4UL,
|
||||
0x134f616fUL, 0x2e77118dUL, 0xb31b2be1UL, 0xaa90b472UL, 0x3ca5d717UL, 0x7d161bbaUL,
|
||||
0x9cad9010UL, 0xaf462ba2UL, 0x9fe459d2UL, 0x45d34559UL, 0xd9f2da13UL, 0xdbc65487UL,
|
||||
0xf3e4f94eUL, 0x176d486fUL, 0x097c13eaUL, 0x631da5c7UL, 0x445f7382UL, 0x175683f4UL,
|
||||
0xcdc66a97UL, 0x70be0288UL, 0xb3cdcf72UL, 0x6e5dd2f3UL, 0x20936079UL, 0x459b80a5UL,
|
||||
0xbe60e2dbUL, 0xa9c23101UL, 0xeba5315cUL, 0x224e42f2UL, 0x1c5c1572UL, 0xf6721b2cUL,
|
||||
0x1ad2fff3UL, 0x8c25404eUL, 0x324ed72fUL, 0x4067b7fdUL, 0x0523138eUL, 0x5ca3bc78UL,
|
||||
0xdc0fd66eUL, 0x75922283UL, 0x784d6b17UL, 0x58ebb16eUL, 0x44094f85UL, 0x3f481d87UL,
|
||||
0xfcfeae7bUL, 0x77b5ff76UL, 0x8c2302bfUL, 0xaaf47556UL, 0x5f46b02aUL, 0x2b092801UL,
|
||||
0x3d38f5f7UL, 0x0ca81f36UL, 0x52af4a8aUL, 0x66d5e7c0UL, 0xdf3b0874UL, 0x95055110UL,
|
||||
0x1b5ad7a8UL, 0xf61ed5adUL, 0x6cf6e479UL, 0x20758184UL, 0xd0cefa65UL, 0x88f7be58UL,
|
||||
0x4a046826UL, 0x0ff6f8f3UL, 0xa09c7f70UL, 0x5346aba0UL, 0x5ce96c28UL, 0xe176eda3UL,
|
||||
0x6bac307fUL, 0x376829d2UL, 0x85360fa9UL, 0x17e3fe2aUL, 0x24b79767UL, 0xf5a96b20UL,
|
||||
0xd6cd2595UL, 0x68ff1ebfUL, 0x7555442cUL, 0xf19f06beUL, 0xf9e0659aUL, 0xeeb9491dUL,
|
||||
0x34010718UL, 0xbb30cab8UL, 0xe822fe15UL, 0x88570983UL, 0x750e6249UL, 0xda627e55UL,
|
||||
0x7ec90c04UL, 0x2c6e74b9UL, 0x9b0e66dfUL, 0xa6337911UL, 0xb86a7fffUL, 0x1dd358f5UL,
|
||||
0x44dd9d44UL, 0x1731167fUL, 0x08fbf1faUL, 0xe7f511ccUL, 0xd2051b00UL, 0x735aba00UL,
|
||||
0x2ab722d8UL, 0x386381cbUL, 0xacf6243aUL, 0x69befd7aUL, 0xe6a2e77fUL, 0xf0c720cdUL,
|
||||
0xc4494816UL, 0xccf5c180UL, 0x38851640UL, 0x15b0a848UL, 0xe68b18cbUL, 0x4caadeffUL,
|
||||
0x5f480a01UL, 0x0412b2aaUL, 0x259814fcUL, 0x41d0efe2UL, 0x4e40b48dUL, 0x248eb6fbUL,
|
||||
0x8dba1cfeUL, 0x41a99b02UL, 0x1a550a04UL, 0xba8f65cbUL, 0x7251f4e7UL, 0x95a51725UL,
|
||||
0xc106ecd7UL, 0x97a5980aUL, 0xc539b9aaUL, 0x4d79fe6aUL, 0xf2f3f763UL, 0x68af8040UL,
|
||||
0xed0c9e56UL, 0x11b4958bUL, 0xe1eb5a88UL, 0x8709e6b0UL, 0xd7e07156UL, 0x4e29fea7UL,
|
||||
0x6366e52dUL, 0x02d1c000UL, 0xc4ac8e05UL, 0x9377f571UL, 0x0c05372aUL, 0x578535f2UL,
|
||||
0x2261be02UL, 0xd642a0c9UL, 0xdf13a280UL, 0x74b55bd2UL, 0x682199c0UL, 0xd421e5ecUL,
|
||||
0x53fb3ce8UL, 0xc8adedb3UL, 0x28a87fc9UL, 0x3d959981UL, 0x5c1ff900UL, 0xfe38d399UL,
|
||||
0x0c4eff0bUL, 0x062407eaUL, 0xaa2f4fb1UL, 0x4fb96976UL, 0x90c79505UL, 0xb0a8a774UL,
|
||||
0xef55a1ffUL, 0xe59ca2c2UL, 0xa6b62d27UL, 0xe66a4263UL, 0xdf65001fUL, 0x0ec50966UL,
|
||||
0xdfdd55bcUL, 0x29de0655UL, 0x911e739aUL, 0x17af8975UL, 0x32c7911cUL, 0x89f89468UL,
|
||||
0x0d01e980UL, 0x524755f4UL, 0x03b63cc9UL, 0x0cc844b2UL, 0xbcf3f0aaUL, 0x87ac36e9UL,
|
||||
0xe53a7426UL, 0x01b3d82bUL, 0x1a9e7449UL, 0x64ee2d7eUL, 0xcddbb1daUL, 0x01c94910UL,
|
||||
0xb868bf80UL, 0x0d26f3fdUL, 0x9342ede7UL, 0x04a5c284UL, 0x636737b6UL, 0x50f5b616UL,
|
||||
0xf24766e3UL, 0x8eca36c1UL, 0x136e05dbUL, 0xfef18391UL, 0xfb887a37UL, 0xd6e7f7d4UL,
|
||||
0xc7fb7dc9UL, 0x3063fcdfUL, 0xb6f589deUL, 0xec2941daUL, 0x26e46695UL, 0xb7566419UL,
|
||||
0xf654efc5UL, 0xd08d58b7UL, 0x48925401UL, 0xc1bacb7fUL, 0xe5ff550fUL, 0xb6083049UL,
|
||||
0x5bb5d0e8UL, 0x87d72e5aUL, 0xab6a6ee1UL, 0x223a66ceUL, 0xc62bf3cdUL, 0x9e0885f9UL,
|
||||
0x68cb3e47UL, 0x086c010fUL, 0xa21de820UL, 0xd18b69deUL, 0xf3f65777UL, 0xfa02c3f6UL,
|
||||
0x407edac3UL, 0xcbb3d550UL, 0x1793084dUL, 0xb0d70ebaUL, 0x0ab378d5UL, 0xd951fb0cUL,
|
||||
0xded7da56UL, 0x4124bbe4UL, 0x94ca0b56UL, 0x0f5755d1UL, 0xe0e1e56eUL, 0x6184b5beUL,
|
||||
0x580a249fUL, 0x94f74bc0UL, 0xe327888eUL, 0x9f7b5561UL, 0xc3dc0280UL, 0x05687715UL,
|
||||
0x646c6bd7UL, 0x44904db3UL, 0x66b4f0a3UL, 0xc0f1648aUL, 0x697ed5afUL, 0x49e92ff6UL,
|
||||
0x309e374fUL, 0x2cb6356aUL, 0x85808573UL, 0x4991f840UL, 0x76f0ae02UL, 0x083be84dUL,
|
||||
0x28421c9aUL, 0x44489406UL, 0x736e4cb8UL, 0xc1092910UL, 0x8bc95fc6UL, 0x7d869cf4UL,
|
||||
0x134f616fUL, 0x2e77118dUL, 0xb31b2be1UL, 0xaa90b472UL, 0x3ca5d717UL, 0x7d161bbaUL,
|
||||
0x9cad9010UL, 0xaf462ba2UL, 0x9fe459d2UL, 0x45d34559UL, 0xd9f2da13UL, 0xdbc65487UL,
|
||||
0xf3e4f94eUL, 0x176d486fUL, 0x097c13eaUL, 0x631da5c7UL, 0x445f7382UL, 0x175683f4UL,
|
||||
0xcdc66a97UL, 0x70be0288UL, 0xb3cdcf72UL, 0x6e5dd2f3UL, 0x20936079UL, 0x459b80a5UL,
|
||||
0xbe60e2dbUL, 0xa9c23101UL, 0xeba5315cUL, 0x224e42f2UL, 0x1c5c1572UL, 0xf6721b2cUL,
|
||||
0x1ad2fff3UL, 0x8c25404eUL, 0x324ed72fUL, 0x4067b7fdUL, 0x0523138eUL, 0x5ca3bc78UL,
|
||||
0xdc0fd66eUL, 0x75922283UL, 0x784d6b17UL, 0x58ebb16eUL, 0x44094f85UL, 0x3f481d87UL,
|
||||
0xfcfeae7bUL, 0x77b5ff76UL, 0x8c2302bfUL, 0xaaf47556UL, 0x5f46b02aUL, 0x2b092801UL,
|
||||
0x3d38f5f7UL, 0x0ca81f36UL, 0x52af4a8aUL, 0x66d5e7c0UL, 0xdf3b0874UL, 0x95055110UL,
|
||||
0x1b5ad7a8UL, 0xf61ed5adUL, 0x6cf6e479UL, 0x20758184UL, 0xd0cefa65UL, 0x88f7be58UL,
|
||||
0x4a046826UL, 0x0ff6f8f3UL, 0xa09c7f70UL, 0x5346aba0UL, 0x5ce96c28UL, 0xe176eda3UL,
|
||||
0x6bac307fUL, 0x376829d2UL, 0x85360fa9UL, 0x17e3fe2aUL, 0x24b79767UL, 0xf5a96b20UL,
|
||||
0xd6cd2595UL, 0x68ff1ebfUL, 0x7555442cUL, 0xf19f06beUL, 0xf9e0659aUL, 0xeeb9491dUL,
|
||||
0x34010718UL, 0xbb30cab8UL, 0xe822fe15UL, 0x88570983UL, 0x750e6249UL, 0xda627e55UL,
|
||||
0x5e76ffa8UL, 0xb1534546UL, 0x6d47de08UL, 0xefe9e7d4UL};
|
||||
|
||||
static const ulong32 S6[256] = {
|
||||
0xf6fa8f9dUL, 0x2cac6ce1UL, 0x4ca34867UL, 0xe2337f7cUL, 0x95db08e7UL, 0x016843b4UL,
|
||||
0xeced5cbcUL, 0x325553acUL, 0xbf9f0960UL, 0xdfa1e2edUL, 0x83f0579dUL, 0x63ed86b9UL,
|
||||
0x1ab6a6b8UL, 0xde5ebe39UL, 0xf38ff732UL, 0x8989b138UL, 0x33f14961UL, 0xc01937bdUL,
|
||||
0xf506c6daUL, 0xe4625e7eUL, 0xa308ea99UL, 0x4e23e33cUL, 0x79cbd7ccUL, 0x48a14367UL,
|
||||
0xa3149619UL, 0xfec94bd5UL, 0xa114174aUL, 0xeaa01866UL, 0xa084db2dUL, 0x09a8486fUL,
|
||||
0xa888614aUL, 0x2900af98UL, 0x01665991UL, 0xe1992863UL, 0xc8f30c60UL, 0x2e78ef3cUL,
|
||||
0xd0d51932UL, 0xcf0fec14UL, 0xf7ca07d2UL, 0xd0a82072UL, 0xfd41197eUL, 0x9305a6b0UL,
|
||||
0xe86be3daUL, 0x74bed3cdUL, 0x372da53cUL, 0x4c7f4448UL, 0xdab5d440UL, 0x6dba0ec3UL,
|
||||
0x083919a7UL, 0x9fbaeed9UL, 0x49dbcfb0UL, 0x4e670c53UL, 0x5c3d9c01UL, 0x64bdb941UL,
|
||||
0x2c0e636aUL, 0xba7dd9cdUL, 0xea6f7388UL, 0xe70bc762UL, 0x35f29adbUL, 0x5c4cdd8dUL,
|
||||
0xf0d48d8cUL, 0xb88153e2UL, 0x08a19866UL, 0x1ae2eac8UL, 0x284caf89UL, 0xaa928223UL,
|
||||
0x9334be53UL, 0x3b3a21bfUL, 0x16434be3UL, 0x9aea3906UL, 0xefe8c36eUL, 0xf890cdd9UL,
|
||||
0x80226daeUL, 0xc340a4a3UL, 0xdf7e9c09UL, 0xa694a807UL, 0x5b7c5eccUL, 0x221db3a6UL,
|
||||
0x9a69a02fUL, 0x68818a54UL, 0xceb2296fUL, 0x53c0843aUL, 0xfe893655UL, 0x25bfe68aUL,
|
||||
0xb4628abcUL, 0xcf222ebfUL, 0x25ac6f48UL, 0xa9a99387UL, 0x53bddb65UL, 0xe76ffbe7UL,
|
||||
0xe967fd78UL, 0x0ba93563UL, 0x8e342bc1UL, 0xe8a11be9UL, 0x4980740dUL, 0xc8087dfcUL,
|
||||
0x8de4bf99UL, 0xa11101a0UL, 0x7fd37975UL, 0xda5a26c0UL, 0xe81f994fUL, 0x9528cd89UL,
|
||||
0xfd339fedUL, 0xb87834bfUL, 0x5f04456dUL, 0x22258698UL, 0xc9c4c83bUL, 0x2dc156beUL,
|
||||
0x4f628daaUL, 0x57f55ec5UL, 0xe2220abeUL, 0xd2916ebfUL, 0x4ec75b95UL, 0x24f2c3c0UL,
|
||||
0x42d15d99UL, 0xcd0d7fa0UL, 0x7b6e27ffUL, 0xa8dc8af0UL, 0x7345c106UL, 0xf41e232fUL,
|
||||
0x35162386UL, 0xe6ea8926UL, 0x3333b094UL, 0x157ec6f2UL, 0x372b74afUL, 0x692573e4UL,
|
||||
0xe9a9d848UL, 0xf3160289UL, 0x3a62ef1dUL, 0xa787e238UL, 0xf3a5f676UL, 0x74364853UL,
|
||||
0x20951063UL, 0x4576698dUL, 0xb6fad407UL, 0x592af950UL, 0x36f73523UL, 0x4cfb6e87UL,
|
||||
0x7da4cec0UL, 0x6c152daaUL, 0xcb0396a8UL, 0xc50dfe5dUL, 0xfcd707abUL, 0x0921c42fUL,
|
||||
0x89dff0bbUL, 0x5fe2be78UL, 0x448f4f33UL, 0x754613c9UL, 0x2b05d08dUL, 0x48b9d585UL,
|
||||
0xdc049441UL, 0xc8098f9bUL, 0x7dede786UL, 0xc39a3373UL, 0x42410005UL, 0x6a091751UL,
|
||||
0x0ef3c8a6UL, 0x890072d6UL, 0x28207682UL, 0xa9a9f7beUL, 0xbf32679dUL, 0xd45b5b75UL,
|
||||
0xb353fd00UL, 0xcbb0e358UL, 0x830f220aUL, 0x1f8fb214UL, 0xd372cf08UL, 0xcc3c4a13UL,
|
||||
0x8cf63166UL, 0x061c87beUL, 0x88c98f88UL, 0x6062e397UL, 0x47cf8e7aUL, 0xb6c85283UL,
|
||||
0x3cc2acfbUL, 0x3fc06976UL, 0x4e8f0252UL, 0x64d8314dUL, 0xda3870e3UL, 0x1e665459UL,
|
||||
0xc10908f0UL, 0x513021a5UL, 0x6c5b68b7UL, 0x822f8aa0UL, 0x3007cd3eUL, 0x74719eefUL,
|
||||
0xdc872681UL, 0x073340d4UL, 0x7e432fd9UL, 0x0c5ec241UL, 0x8809286cUL, 0xf592d891UL,
|
||||
0x08a930f6UL, 0x957ef305UL, 0xb7fbffbdUL, 0xc266e96fUL, 0x6fe4ac98UL, 0xb173ecc0UL,
|
||||
0xbc60b42aUL, 0x953498daUL, 0xfba1ae12UL, 0x2d4bd736UL, 0x0f25faabUL, 0xa4f3fcebUL,
|
||||
0xe2969123UL, 0x257f0c3dUL, 0x9348af49UL, 0x361400bcUL, 0xe8816f4aUL, 0x3814f200UL,
|
||||
0xa3f94043UL, 0x9c7a54c2UL, 0xbc704f57UL, 0xda41e7f9UL, 0xc25ad33aUL, 0x54f4a084UL,
|
||||
0xb17f5505UL, 0x59357cbeUL, 0xedbd15c8UL, 0x7f97c5abUL, 0xba5ac7b5UL, 0xb6f6deafUL,
|
||||
0x3a479c3aUL, 0x5302da25UL, 0x653d7e6aUL, 0x54268d49UL, 0x51a477eaUL, 0x5017d55bUL,
|
||||
0xd7d25d88UL, 0x44136c76UL, 0x0404a8c8UL, 0xb8e5a121UL, 0xb81a928aUL, 0x60ed5869UL,
|
||||
0x97c55b96UL, 0xeaec991bUL, 0x29935913UL, 0x01fdb7f1UL, 0x088e8dfaUL, 0x9ab6f6f5UL,
|
||||
0x3b4cbf9fUL, 0x4a5de3abUL, 0xe6051d35UL, 0xa0e1d855UL, 0xd36b4cf1UL, 0xf544edebUL,
|
||||
0xb0e93524UL, 0xbebb8fbdUL, 0xa2d762cfUL, 0x49c92f54UL, 0x38b5f331UL, 0x7128a454UL,
|
||||
0xf6fa8f9dUL, 0x2cac6ce1UL, 0x4ca34867UL, 0xe2337f7cUL, 0x95db08e7UL, 0x016843b4UL,
|
||||
0xeced5cbcUL, 0x325553acUL, 0xbf9f0960UL, 0xdfa1e2edUL, 0x83f0579dUL, 0x63ed86b9UL,
|
||||
0x1ab6a6b8UL, 0xde5ebe39UL, 0xf38ff732UL, 0x8989b138UL, 0x33f14961UL, 0xc01937bdUL,
|
||||
0xf506c6daUL, 0xe4625e7eUL, 0xa308ea99UL, 0x4e23e33cUL, 0x79cbd7ccUL, 0x48a14367UL,
|
||||
0xa3149619UL, 0xfec94bd5UL, 0xa114174aUL, 0xeaa01866UL, 0xa084db2dUL, 0x09a8486fUL,
|
||||
0xa888614aUL, 0x2900af98UL, 0x01665991UL, 0xe1992863UL, 0xc8f30c60UL, 0x2e78ef3cUL,
|
||||
0xd0d51932UL, 0xcf0fec14UL, 0xf7ca07d2UL, 0xd0a82072UL, 0xfd41197eUL, 0x9305a6b0UL,
|
||||
0xe86be3daUL, 0x74bed3cdUL, 0x372da53cUL, 0x4c7f4448UL, 0xdab5d440UL, 0x6dba0ec3UL,
|
||||
0x083919a7UL, 0x9fbaeed9UL, 0x49dbcfb0UL, 0x4e670c53UL, 0x5c3d9c01UL, 0x64bdb941UL,
|
||||
0x2c0e636aUL, 0xba7dd9cdUL, 0xea6f7388UL, 0xe70bc762UL, 0x35f29adbUL, 0x5c4cdd8dUL,
|
||||
0xf0d48d8cUL, 0xb88153e2UL, 0x08a19866UL, 0x1ae2eac8UL, 0x284caf89UL, 0xaa928223UL,
|
||||
0x9334be53UL, 0x3b3a21bfUL, 0x16434be3UL, 0x9aea3906UL, 0xefe8c36eUL, 0xf890cdd9UL,
|
||||
0x80226daeUL, 0xc340a4a3UL, 0xdf7e9c09UL, 0xa694a807UL, 0x5b7c5eccUL, 0x221db3a6UL,
|
||||
0x9a69a02fUL, 0x68818a54UL, 0xceb2296fUL, 0x53c0843aUL, 0xfe893655UL, 0x25bfe68aUL,
|
||||
0xb4628abcUL, 0xcf222ebfUL, 0x25ac6f48UL, 0xa9a99387UL, 0x53bddb65UL, 0xe76ffbe7UL,
|
||||
0xe967fd78UL, 0x0ba93563UL, 0x8e342bc1UL, 0xe8a11be9UL, 0x4980740dUL, 0xc8087dfcUL,
|
||||
0x8de4bf99UL, 0xa11101a0UL, 0x7fd37975UL, 0xda5a26c0UL, 0xe81f994fUL, 0x9528cd89UL,
|
||||
0xfd339fedUL, 0xb87834bfUL, 0x5f04456dUL, 0x22258698UL, 0xc9c4c83bUL, 0x2dc156beUL,
|
||||
0x4f628daaUL, 0x57f55ec5UL, 0xe2220abeUL, 0xd2916ebfUL, 0x4ec75b95UL, 0x24f2c3c0UL,
|
||||
0x42d15d99UL, 0xcd0d7fa0UL, 0x7b6e27ffUL, 0xa8dc8af0UL, 0x7345c106UL, 0xf41e232fUL,
|
||||
0x35162386UL, 0xe6ea8926UL, 0x3333b094UL, 0x157ec6f2UL, 0x372b74afUL, 0x692573e4UL,
|
||||
0xe9a9d848UL, 0xf3160289UL, 0x3a62ef1dUL, 0xa787e238UL, 0xf3a5f676UL, 0x74364853UL,
|
||||
0x20951063UL, 0x4576698dUL, 0xb6fad407UL, 0x592af950UL, 0x36f73523UL, 0x4cfb6e87UL,
|
||||
0x7da4cec0UL, 0x6c152daaUL, 0xcb0396a8UL, 0xc50dfe5dUL, 0xfcd707abUL, 0x0921c42fUL,
|
||||
0x89dff0bbUL, 0x5fe2be78UL, 0x448f4f33UL, 0x754613c9UL, 0x2b05d08dUL, 0x48b9d585UL,
|
||||
0xdc049441UL, 0xc8098f9bUL, 0x7dede786UL, 0xc39a3373UL, 0x42410005UL, 0x6a091751UL,
|
||||
0x0ef3c8a6UL, 0x890072d6UL, 0x28207682UL, 0xa9a9f7beUL, 0xbf32679dUL, 0xd45b5b75UL,
|
||||
0xb353fd00UL, 0xcbb0e358UL, 0x830f220aUL, 0x1f8fb214UL, 0xd372cf08UL, 0xcc3c4a13UL,
|
||||
0x8cf63166UL, 0x061c87beUL, 0x88c98f88UL, 0x6062e397UL, 0x47cf8e7aUL, 0xb6c85283UL,
|
||||
0x3cc2acfbUL, 0x3fc06976UL, 0x4e8f0252UL, 0x64d8314dUL, 0xda3870e3UL, 0x1e665459UL,
|
||||
0xc10908f0UL, 0x513021a5UL, 0x6c5b68b7UL, 0x822f8aa0UL, 0x3007cd3eUL, 0x74719eefUL,
|
||||
0xdc872681UL, 0x073340d4UL, 0x7e432fd9UL, 0x0c5ec241UL, 0x8809286cUL, 0xf592d891UL,
|
||||
0x08a930f6UL, 0x957ef305UL, 0xb7fbffbdUL, 0xc266e96fUL, 0x6fe4ac98UL, 0xb173ecc0UL,
|
||||
0xbc60b42aUL, 0x953498daUL, 0xfba1ae12UL, 0x2d4bd736UL, 0x0f25faabUL, 0xa4f3fcebUL,
|
||||
0xe2969123UL, 0x257f0c3dUL, 0x9348af49UL, 0x361400bcUL, 0xe8816f4aUL, 0x3814f200UL,
|
||||
0xa3f94043UL, 0x9c7a54c2UL, 0xbc704f57UL, 0xda41e7f9UL, 0xc25ad33aUL, 0x54f4a084UL,
|
||||
0xb17f5505UL, 0x59357cbeUL, 0xedbd15c8UL, 0x7f97c5abUL, 0xba5ac7b5UL, 0xb6f6deafUL,
|
||||
0x3a479c3aUL, 0x5302da25UL, 0x653d7e6aUL, 0x54268d49UL, 0x51a477eaUL, 0x5017d55bUL,
|
||||
0xd7d25d88UL, 0x44136c76UL, 0x0404a8c8UL, 0xb8e5a121UL, 0xb81a928aUL, 0x60ed5869UL,
|
||||
0x97c55b96UL, 0xeaec991bUL, 0x29935913UL, 0x01fdb7f1UL, 0x088e8dfaUL, 0x9ab6f6f5UL,
|
||||
0x3b4cbf9fUL, 0x4a5de3abUL, 0xe6051d35UL, 0xa0e1d855UL, 0xd36b4cf1UL, 0xf544edebUL,
|
||||
0xb0e93524UL, 0xbebb8fbdUL, 0xa2d762cfUL, 0x49c92f54UL, 0x38b5f331UL, 0x7128a454UL,
|
||||
0x48392905UL, 0xa65b1db8UL, 0x851c97bdUL, 0xd675cf2fUL};
|
||||
|
||||
static const ulong32 S7[256] = {
|
||||
0x85e04019UL, 0x332bf567UL, 0x662dbfffUL, 0xcfc65693UL, 0x2a8d7f6fUL, 0xab9bc912UL,
|
||||
0xde6008a1UL, 0x2028da1fUL, 0x0227bce7UL, 0x4d642916UL, 0x18fac300UL, 0x50f18b82UL,
|
||||
0x2cb2cb11UL, 0xb232e75cUL, 0x4b3695f2UL, 0xb28707deUL, 0xa05fbcf6UL, 0xcd4181e9UL,
|
||||
0xe150210cUL, 0xe24ef1bdUL, 0xb168c381UL, 0xfde4e789UL, 0x5c79b0d8UL, 0x1e8bfd43UL,
|
||||
0x4d495001UL, 0x38be4341UL, 0x913cee1dUL, 0x92a79c3fUL, 0x089766beUL, 0xbaeeadf4UL,
|
||||
0x1286becfUL, 0xb6eacb19UL, 0x2660c200UL, 0x7565bde4UL, 0x64241f7aUL, 0x8248dca9UL,
|
||||
0xc3b3ad66UL, 0x28136086UL, 0x0bd8dfa8UL, 0x356d1cf2UL, 0x107789beUL, 0xb3b2e9ceUL,
|
||||
0x0502aa8fUL, 0x0bc0351eUL, 0x166bf52aUL, 0xeb12ff82UL, 0xe3486911UL, 0xd34d7516UL,
|
||||
0x4e7b3affUL, 0x5f43671bUL, 0x9cf6e037UL, 0x4981ac83UL, 0x334266ceUL, 0x8c9341b7UL,
|
||||
0xd0d854c0UL, 0xcb3a6c88UL, 0x47bc2829UL, 0x4725ba37UL, 0xa66ad22bUL, 0x7ad61f1eUL,
|
||||
0x0c5cbafaUL, 0x4437f107UL, 0xb6e79962UL, 0x42d2d816UL, 0x0a961288UL, 0xe1a5c06eUL,
|
||||
0x13749e67UL, 0x72fc081aUL, 0xb1d139f7UL, 0xf9583745UL, 0xcf19df58UL, 0xbec3f756UL,
|
||||
0xc06eba30UL, 0x07211b24UL, 0x45c28829UL, 0xc95e317fUL, 0xbc8ec511UL, 0x38bc46e9UL,
|
||||
0xc6e6fa14UL, 0xbae8584aUL, 0xad4ebc46UL, 0x468f508bUL, 0x7829435fUL, 0xf124183bUL,
|
||||
0x821dba9fUL, 0xaff60ff4UL, 0xea2c4e6dUL, 0x16e39264UL, 0x92544a8bUL, 0x009b4fc3UL,
|
||||
0xaba68cedUL, 0x9ac96f78UL, 0x06a5b79aUL, 0xb2856e6eUL, 0x1aec3ca9UL, 0xbe838688UL,
|
||||
0x0e0804e9UL, 0x55f1be56UL, 0xe7e5363bUL, 0xb3a1f25dUL, 0xf7debb85UL, 0x61fe033cUL,
|
||||
0x16746233UL, 0x3c034c28UL, 0xda6d0c74UL, 0x79aac56cUL, 0x3ce4e1adUL, 0x51f0c802UL,
|
||||
0x98f8f35aUL, 0x1626a49fUL, 0xeed82b29UL, 0x1d382fe3UL, 0x0c4fb99aUL, 0xbb325778UL,
|
||||
0x3ec6d97bUL, 0x6e77a6a9UL, 0xcb658b5cUL, 0xd45230c7UL, 0x2bd1408bUL, 0x60c03eb7UL,
|
||||
0xb9068d78UL, 0xa33754f4UL, 0xf430c87dUL, 0xc8a71302UL, 0xb96d8c32UL, 0xebd4e7beUL,
|
||||
0xbe8b9d2dUL, 0x7979fb06UL, 0xe7225308UL, 0x8b75cf77UL, 0x11ef8da4UL, 0xe083c858UL,
|
||||
0x8d6b786fUL, 0x5a6317a6UL, 0xfa5cf7a0UL, 0x5dda0033UL, 0xf28ebfb0UL, 0xf5b9c310UL,
|
||||
0xa0eac280UL, 0x08b9767aUL, 0xa3d9d2b0UL, 0x79d34217UL, 0x021a718dUL, 0x9ac6336aUL,
|
||||
0x2711fd60UL, 0x438050e3UL, 0x069908a8UL, 0x3d7fedc4UL, 0x826d2befUL, 0x4eeb8476UL,
|
||||
0x488dcf25UL, 0x36c9d566UL, 0x28e74e41UL, 0xc2610acaUL, 0x3d49a9cfUL, 0xbae3b9dfUL,
|
||||
0xb65f8de6UL, 0x92aeaf64UL, 0x3ac7d5e6UL, 0x9ea80509UL, 0xf22b017dUL, 0xa4173f70UL,
|
||||
0xdd1e16c3UL, 0x15e0d7f9UL, 0x50b1b887UL, 0x2b9f4fd5UL, 0x625aba82UL, 0x6a017962UL,
|
||||
0x2ec01b9cUL, 0x15488aa9UL, 0xd716e740UL, 0x40055a2cUL, 0x93d29a22UL, 0xe32dbf9aUL,
|
||||
0x058745b9UL, 0x3453dc1eUL, 0xd699296eUL, 0x496cff6fUL, 0x1c9f4986UL, 0xdfe2ed07UL,
|
||||
0xb87242d1UL, 0x19de7eaeUL, 0x053e561aUL, 0x15ad6f8cUL, 0x66626c1cUL, 0x7154c24cUL,
|
||||
0xea082b2aUL, 0x93eb2939UL, 0x17dcb0f0UL, 0x58d4f2aeUL, 0x9ea294fbUL, 0x52cf564cUL,
|
||||
0x9883fe66UL, 0x2ec40581UL, 0x763953c3UL, 0x01d6692eUL, 0xd3a0c108UL, 0xa1e7160eUL,
|
||||
0xe4f2dfa6UL, 0x693ed285UL, 0x74904698UL, 0x4c2b0eddUL, 0x4f757656UL, 0x5d393378UL,
|
||||
0xa132234fUL, 0x3d321c5dUL, 0xc3f5e194UL, 0x4b269301UL, 0xc79f022fUL, 0x3c997e7eUL,
|
||||
0x5e4f9504UL, 0x3ffafbbdUL, 0x76f7ad0eUL, 0x296693f4UL, 0x3d1fce6fUL, 0xc61e45beUL,
|
||||
0xd3b5ab34UL, 0xf72bf9b7UL, 0x1b0434c0UL, 0x4e72b567UL, 0x5592a33dUL, 0xb5229301UL,
|
||||
0xcfd2a87fUL, 0x60aeb767UL, 0x1814386bUL, 0x30bcc33dUL, 0x38a0c07dUL, 0xfd1606f2UL,
|
||||
0xc363519bUL, 0x589dd390UL, 0x5479f8e6UL, 0x1cb8d647UL, 0x97fd61a9UL, 0xea7759f4UL,
|
||||
0x2d57539dUL, 0x569a58cfUL, 0xe84e63adUL, 0x462e1b78UL, 0x6580f87eUL, 0xf3817914UL,
|
||||
0x91da55f4UL, 0x40a230f3UL, 0xd1988f35UL, 0xb6e318d2UL, 0x3ffa50bcUL, 0x3d40f021UL,
|
||||
0xc3c0bdaeUL, 0x4958c24cUL, 0x518f36b2UL, 0x84b1d370UL, 0x0fedce83UL, 0x878ddadaUL,
|
||||
0x85e04019UL, 0x332bf567UL, 0x662dbfffUL, 0xcfc65693UL, 0x2a8d7f6fUL, 0xab9bc912UL,
|
||||
0xde6008a1UL, 0x2028da1fUL, 0x0227bce7UL, 0x4d642916UL, 0x18fac300UL, 0x50f18b82UL,
|
||||
0x2cb2cb11UL, 0xb232e75cUL, 0x4b3695f2UL, 0xb28707deUL, 0xa05fbcf6UL, 0xcd4181e9UL,
|
||||
0xe150210cUL, 0xe24ef1bdUL, 0xb168c381UL, 0xfde4e789UL, 0x5c79b0d8UL, 0x1e8bfd43UL,
|
||||
0x4d495001UL, 0x38be4341UL, 0x913cee1dUL, 0x92a79c3fUL, 0x089766beUL, 0xbaeeadf4UL,
|
||||
0x1286becfUL, 0xb6eacb19UL, 0x2660c200UL, 0x7565bde4UL, 0x64241f7aUL, 0x8248dca9UL,
|
||||
0xc3b3ad66UL, 0x28136086UL, 0x0bd8dfa8UL, 0x356d1cf2UL, 0x107789beUL, 0xb3b2e9ceUL,
|
||||
0x0502aa8fUL, 0x0bc0351eUL, 0x166bf52aUL, 0xeb12ff82UL, 0xe3486911UL, 0xd34d7516UL,
|
||||
0x4e7b3affUL, 0x5f43671bUL, 0x9cf6e037UL, 0x4981ac83UL, 0x334266ceUL, 0x8c9341b7UL,
|
||||
0xd0d854c0UL, 0xcb3a6c88UL, 0x47bc2829UL, 0x4725ba37UL, 0xa66ad22bUL, 0x7ad61f1eUL,
|
||||
0x0c5cbafaUL, 0x4437f107UL, 0xb6e79962UL, 0x42d2d816UL, 0x0a961288UL, 0xe1a5c06eUL,
|
||||
0x13749e67UL, 0x72fc081aUL, 0xb1d139f7UL, 0xf9583745UL, 0xcf19df58UL, 0xbec3f756UL,
|
||||
0xc06eba30UL, 0x07211b24UL, 0x45c28829UL, 0xc95e317fUL, 0xbc8ec511UL, 0x38bc46e9UL,
|
||||
0xc6e6fa14UL, 0xbae8584aUL, 0xad4ebc46UL, 0x468f508bUL, 0x7829435fUL, 0xf124183bUL,
|
||||
0x821dba9fUL, 0xaff60ff4UL, 0xea2c4e6dUL, 0x16e39264UL, 0x92544a8bUL, 0x009b4fc3UL,
|
||||
0xaba68cedUL, 0x9ac96f78UL, 0x06a5b79aUL, 0xb2856e6eUL, 0x1aec3ca9UL, 0xbe838688UL,
|
||||
0x0e0804e9UL, 0x55f1be56UL, 0xe7e5363bUL, 0xb3a1f25dUL, 0xf7debb85UL, 0x61fe033cUL,
|
||||
0x16746233UL, 0x3c034c28UL, 0xda6d0c74UL, 0x79aac56cUL, 0x3ce4e1adUL, 0x51f0c802UL,
|
||||
0x98f8f35aUL, 0x1626a49fUL, 0xeed82b29UL, 0x1d382fe3UL, 0x0c4fb99aUL, 0xbb325778UL,
|
||||
0x3ec6d97bUL, 0x6e77a6a9UL, 0xcb658b5cUL, 0xd45230c7UL, 0x2bd1408bUL, 0x60c03eb7UL,
|
||||
0xb9068d78UL, 0xa33754f4UL, 0xf430c87dUL, 0xc8a71302UL, 0xb96d8c32UL, 0xebd4e7beUL,
|
||||
0xbe8b9d2dUL, 0x7979fb06UL, 0xe7225308UL, 0x8b75cf77UL, 0x11ef8da4UL, 0xe083c858UL,
|
||||
0x8d6b786fUL, 0x5a6317a6UL, 0xfa5cf7a0UL, 0x5dda0033UL, 0xf28ebfb0UL, 0xf5b9c310UL,
|
||||
0xa0eac280UL, 0x08b9767aUL, 0xa3d9d2b0UL, 0x79d34217UL, 0x021a718dUL, 0x9ac6336aUL,
|
||||
0x2711fd60UL, 0x438050e3UL, 0x069908a8UL, 0x3d7fedc4UL, 0x826d2befUL, 0x4eeb8476UL,
|
||||
0x488dcf25UL, 0x36c9d566UL, 0x28e74e41UL, 0xc2610acaUL, 0x3d49a9cfUL, 0xbae3b9dfUL,
|
||||
0xb65f8de6UL, 0x92aeaf64UL, 0x3ac7d5e6UL, 0x9ea80509UL, 0xf22b017dUL, 0xa4173f70UL,
|
||||
0xdd1e16c3UL, 0x15e0d7f9UL, 0x50b1b887UL, 0x2b9f4fd5UL, 0x625aba82UL, 0x6a017962UL,
|
||||
0x2ec01b9cUL, 0x15488aa9UL, 0xd716e740UL, 0x40055a2cUL, 0x93d29a22UL, 0xe32dbf9aUL,
|
||||
0x058745b9UL, 0x3453dc1eUL, 0xd699296eUL, 0x496cff6fUL, 0x1c9f4986UL, 0xdfe2ed07UL,
|
||||
0xb87242d1UL, 0x19de7eaeUL, 0x053e561aUL, 0x15ad6f8cUL, 0x66626c1cUL, 0x7154c24cUL,
|
||||
0xea082b2aUL, 0x93eb2939UL, 0x17dcb0f0UL, 0x58d4f2aeUL, 0x9ea294fbUL, 0x52cf564cUL,
|
||||
0x9883fe66UL, 0x2ec40581UL, 0x763953c3UL, 0x01d6692eUL, 0xd3a0c108UL, 0xa1e7160eUL,
|
||||
0xe4f2dfa6UL, 0x693ed285UL, 0x74904698UL, 0x4c2b0eddUL, 0x4f757656UL, 0x5d393378UL,
|
||||
0xa132234fUL, 0x3d321c5dUL, 0xc3f5e194UL, 0x4b269301UL, 0xc79f022fUL, 0x3c997e7eUL,
|
||||
0x5e4f9504UL, 0x3ffafbbdUL, 0x76f7ad0eUL, 0x296693f4UL, 0x3d1fce6fUL, 0xc61e45beUL,
|
||||
0xd3b5ab34UL, 0xf72bf9b7UL, 0x1b0434c0UL, 0x4e72b567UL, 0x5592a33dUL, 0xb5229301UL,
|
||||
0xcfd2a87fUL, 0x60aeb767UL, 0x1814386bUL, 0x30bcc33dUL, 0x38a0c07dUL, 0xfd1606f2UL,
|
||||
0xc363519bUL, 0x589dd390UL, 0x5479f8e6UL, 0x1cb8d647UL, 0x97fd61a9UL, 0xea7759f4UL,
|
||||
0x2d57539dUL, 0x569a58cfUL, 0xe84e63adUL, 0x462e1b78UL, 0x6580f87eUL, 0xf3817914UL,
|
||||
0x91da55f4UL, 0x40a230f3UL, 0xd1988f35UL, 0xb6e318d2UL, 0x3ffa50bcUL, 0x3d40f021UL,
|
||||
0xc3c0bdaeUL, 0x4958c24cUL, 0x518f36b2UL, 0x84b1d370UL, 0x0fedce83UL, 0x878ddadaUL,
|
||||
0xf2a279c7UL, 0x94e01be8UL, 0x90716f4bUL, 0x954b8aa3UL};
|
||||
|
||||
static const ulong32 S8[256] = {
|
||||
0xe216300dUL, 0xbbddfffcUL, 0xa7ebdabdUL, 0x35648095UL, 0x7789f8b7UL, 0xe6c1121bUL,
|
||||
0x0e241600UL, 0x052ce8b5UL, 0x11a9cfb0UL, 0xe5952f11UL, 0xece7990aUL, 0x9386d174UL,
|
||||
0x2a42931cUL, 0x76e38111UL, 0xb12def3aUL, 0x37ddddfcUL, 0xde9adeb1UL, 0x0a0cc32cUL,
|
||||
0xbe197029UL, 0x84a00940UL, 0xbb243a0fUL, 0xb4d137cfUL, 0xb44e79f0UL, 0x049eedfdUL,
|
||||
0x0b15a15dUL, 0x480d3168UL, 0x8bbbde5aUL, 0x669ded42UL, 0xc7ece831UL, 0x3f8f95e7UL,
|
||||
0x72df191bUL, 0x7580330dUL, 0x94074251UL, 0x5c7dcdfaUL, 0xabbe6d63UL, 0xaa402164UL,
|
||||
0xb301d40aUL, 0x02e7d1caUL, 0x53571daeUL, 0x7a3182a2UL, 0x12a8ddecUL, 0xfdaa335dUL,
|
||||
0x176f43e8UL, 0x71fb46d4UL, 0x38129022UL, 0xce949ad4UL, 0xb84769adUL, 0x965bd862UL,
|
||||
0x82f3d055UL, 0x66fb9767UL, 0x15b80b4eUL, 0x1d5b47a0UL, 0x4cfde06fUL, 0xc28ec4b8UL,
|
||||
0x57e8726eUL, 0x647a78fcUL, 0x99865d44UL, 0x608bd593UL, 0x6c200e03UL, 0x39dc5ff6UL,
|
||||
0x5d0b00a3UL, 0xae63aff2UL, 0x7e8bd632UL, 0x70108c0cUL, 0xbbd35049UL, 0x2998df04UL,
|
||||
0x980cf42aUL, 0x9b6df491UL, 0x9e7edd53UL, 0x06918548UL, 0x58cb7e07UL, 0x3b74ef2eUL,
|
||||
0x522fffb1UL, 0xd24708ccUL, 0x1c7e27cdUL, 0xa4eb215bUL, 0x3cf1d2e2UL, 0x19b47a38UL,
|
||||
0x424f7618UL, 0x35856039UL, 0x9d17dee7UL, 0x27eb35e6UL, 0xc9aff67bUL, 0x36baf5b8UL,
|
||||
0x09c467cdUL, 0xc18910b1UL, 0xe11dbf7bUL, 0x06cd1af8UL, 0x7170c608UL, 0x2d5e3354UL,
|
||||
0xd4de495aUL, 0x64c6d006UL, 0xbcc0c62cUL, 0x3dd00db3UL, 0x708f8f34UL, 0x77d51b42UL,
|
||||
0x264f620fUL, 0x24b8d2bfUL, 0x15c1b79eUL, 0x46a52564UL, 0xf8d7e54eUL, 0x3e378160UL,
|
||||
0x7895cda5UL, 0x859c15a5UL, 0xe6459788UL, 0xc37bc75fUL, 0xdb07ba0cUL, 0x0676a3abUL,
|
||||
0x7f229b1eUL, 0x31842e7bUL, 0x24259fd7UL, 0xf8bef472UL, 0x835ffcb8UL, 0x6df4c1f2UL,
|
||||
0x96f5b195UL, 0xfd0af0fcUL, 0xb0fe134cUL, 0xe2506d3dUL, 0x4f9b12eaUL, 0xf215f225UL,
|
||||
0xa223736fUL, 0x9fb4c428UL, 0x25d04979UL, 0x34c713f8UL, 0xc4618187UL, 0xea7a6e98UL,
|
||||
0x7cd16efcUL, 0x1436876cUL, 0xf1544107UL, 0xbedeee14UL, 0x56e9af27UL, 0xa04aa441UL,
|
||||
0x3cf7c899UL, 0x92ecbae6UL, 0xdd67016dUL, 0x151682ebUL, 0xa842eedfUL, 0xfdba60b4UL,
|
||||
0xf1907b75UL, 0x20e3030fUL, 0x24d8c29eUL, 0xe139673bUL, 0xefa63fb8UL, 0x71873054UL,
|
||||
0xb6f2cf3bUL, 0x9f326442UL, 0xcb15a4ccUL, 0xb01a4504UL, 0xf1e47d8dUL, 0x844a1be5UL,
|
||||
0xbae7dfdcUL, 0x42cbda70UL, 0xcd7dae0aUL, 0x57e85b7aUL, 0xd53f5af6UL, 0x20cf4d8cUL,
|
||||
0xcea4d428UL, 0x79d130a4UL, 0x3486ebfbUL, 0x33d3cddcUL, 0x77853b53UL, 0x37effcb5UL,
|
||||
0xc5068778UL, 0xe580b3e6UL, 0x4e68b8f4UL, 0xc5c8b37eUL, 0x0d809ea2UL, 0x398feb7cUL,
|
||||
0x132a4f94UL, 0x43b7950eUL, 0x2fee7d1cUL, 0x223613bdUL, 0xdd06caa2UL, 0x37df932bUL,
|
||||
0xc4248289UL, 0xacf3ebc3UL, 0x5715f6b7UL, 0xef3478ddUL, 0xf267616fUL, 0xc148cbe4UL,
|
||||
0x9052815eUL, 0x5e410fabUL, 0xb48a2465UL, 0x2eda7fa4UL, 0xe87b40e4UL, 0xe98ea084UL,
|
||||
0x5889e9e1UL, 0xefd390fcUL, 0xdd07d35bUL, 0xdb485694UL, 0x38d7e5b2UL, 0x57720101UL,
|
||||
0x730edebcUL, 0x5b643113UL, 0x94917e4fUL, 0x503c2fbaUL, 0x646f1282UL, 0x7523d24aUL,
|
||||
0xe0779695UL, 0xf9c17a8fUL, 0x7a5b2121UL, 0xd187b896UL, 0x29263a4dUL, 0xba510cdfUL,
|
||||
0x81f47c9fUL, 0xad1163edUL, 0xea7b5965UL, 0x1a00726eUL, 0x11403092UL, 0x00da6d77UL,
|
||||
0x4a0cdd61UL, 0xad1f4603UL, 0x605bdfb0UL, 0x9eedc364UL, 0x22ebe6a8UL, 0xcee7d28aUL,
|
||||
0xa0e736a0UL, 0x5564a6b9UL, 0x10853209UL, 0xc7eb8f37UL, 0x2de705caUL, 0x8951570fUL,
|
||||
0xdf09822bUL, 0xbd691a6cUL, 0xaa12e4f2UL, 0x87451c0fUL, 0xe0f6a27aUL, 0x3ada4819UL,
|
||||
0x4cf1764fUL, 0x0d771c2bUL, 0x67cdb156UL, 0x350d8384UL, 0x5938fa0fUL, 0x42399ef3UL,
|
||||
0x36997b07UL, 0x0e84093dUL, 0x4aa93e61UL, 0x8360d87bUL, 0x1fa98b0cUL, 0x1149382cUL,
|
||||
0xe97625a5UL, 0x0614d1b7UL, 0x0e25244bUL, 0x0c768347UL, 0x589e8d82UL, 0x0d2059d1UL,
|
||||
0xa466bb1eUL, 0xf8da0a82UL, 0x04f19130UL, 0xba6e4ec0UL, 0x99265164UL, 0x1ee7230dUL,
|
||||
0xe216300dUL, 0xbbddfffcUL, 0xa7ebdabdUL, 0x35648095UL, 0x7789f8b7UL, 0xe6c1121bUL,
|
||||
0x0e241600UL, 0x052ce8b5UL, 0x11a9cfb0UL, 0xe5952f11UL, 0xece7990aUL, 0x9386d174UL,
|
||||
0x2a42931cUL, 0x76e38111UL, 0xb12def3aUL, 0x37ddddfcUL, 0xde9adeb1UL, 0x0a0cc32cUL,
|
||||
0xbe197029UL, 0x84a00940UL, 0xbb243a0fUL, 0xb4d137cfUL, 0xb44e79f0UL, 0x049eedfdUL,
|
||||
0x0b15a15dUL, 0x480d3168UL, 0x8bbbde5aUL, 0x669ded42UL, 0xc7ece831UL, 0x3f8f95e7UL,
|
||||
0x72df191bUL, 0x7580330dUL, 0x94074251UL, 0x5c7dcdfaUL, 0xabbe6d63UL, 0xaa402164UL,
|
||||
0xb301d40aUL, 0x02e7d1caUL, 0x53571daeUL, 0x7a3182a2UL, 0x12a8ddecUL, 0xfdaa335dUL,
|
||||
0x176f43e8UL, 0x71fb46d4UL, 0x38129022UL, 0xce949ad4UL, 0xb84769adUL, 0x965bd862UL,
|
||||
0x82f3d055UL, 0x66fb9767UL, 0x15b80b4eUL, 0x1d5b47a0UL, 0x4cfde06fUL, 0xc28ec4b8UL,
|
||||
0x57e8726eUL, 0x647a78fcUL, 0x99865d44UL, 0x608bd593UL, 0x6c200e03UL, 0x39dc5ff6UL,
|
||||
0x5d0b00a3UL, 0xae63aff2UL, 0x7e8bd632UL, 0x70108c0cUL, 0xbbd35049UL, 0x2998df04UL,
|
||||
0x980cf42aUL, 0x9b6df491UL, 0x9e7edd53UL, 0x06918548UL, 0x58cb7e07UL, 0x3b74ef2eUL,
|
||||
0x522fffb1UL, 0xd24708ccUL, 0x1c7e27cdUL, 0xa4eb215bUL, 0x3cf1d2e2UL, 0x19b47a38UL,
|
||||
0x424f7618UL, 0x35856039UL, 0x9d17dee7UL, 0x27eb35e6UL, 0xc9aff67bUL, 0x36baf5b8UL,
|
||||
0x09c467cdUL, 0xc18910b1UL, 0xe11dbf7bUL, 0x06cd1af8UL, 0x7170c608UL, 0x2d5e3354UL,
|
||||
0xd4de495aUL, 0x64c6d006UL, 0xbcc0c62cUL, 0x3dd00db3UL, 0x708f8f34UL, 0x77d51b42UL,
|
||||
0x264f620fUL, 0x24b8d2bfUL, 0x15c1b79eUL, 0x46a52564UL, 0xf8d7e54eUL, 0x3e378160UL,
|
||||
0x7895cda5UL, 0x859c15a5UL, 0xe6459788UL, 0xc37bc75fUL, 0xdb07ba0cUL, 0x0676a3abUL,
|
||||
0x7f229b1eUL, 0x31842e7bUL, 0x24259fd7UL, 0xf8bef472UL, 0x835ffcb8UL, 0x6df4c1f2UL,
|
||||
0x96f5b195UL, 0xfd0af0fcUL, 0xb0fe134cUL, 0xe2506d3dUL, 0x4f9b12eaUL, 0xf215f225UL,
|
||||
0xa223736fUL, 0x9fb4c428UL, 0x25d04979UL, 0x34c713f8UL, 0xc4618187UL, 0xea7a6e98UL,
|
||||
0x7cd16efcUL, 0x1436876cUL, 0xf1544107UL, 0xbedeee14UL, 0x56e9af27UL, 0xa04aa441UL,
|
||||
0x3cf7c899UL, 0x92ecbae6UL, 0xdd67016dUL, 0x151682ebUL, 0xa842eedfUL, 0xfdba60b4UL,
|
||||
0xf1907b75UL, 0x20e3030fUL, 0x24d8c29eUL, 0xe139673bUL, 0xefa63fb8UL, 0x71873054UL,
|
||||
0xb6f2cf3bUL, 0x9f326442UL, 0xcb15a4ccUL, 0xb01a4504UL, 0xf1e47d8dUL, 0x844a1be5UL,
|
||||
0xbae7dfdcUL, 0x42cbda70UL, 0xcd7dae0aUL, 0x57e85b7aUL, 0xd53f5af6UL, 0x20cf4d8cUL,
|
||||
0xcea4d428UL, 0x79d130a4UL, 0x3486ebfbUL, 0x33d3cddcUL, 0x77853b53UL, 0x37effcb5UL,
|
||||
0xc5068778UL, 0xe580b3e6UL, 0x4e68b8f4UL, 0xc5c8b37eUL, 0x0d809ea2UL, 0x398feb7cUL,
|
||||
0x132a4f94UL, 0x43b7950eUL, 0x2fee7d1cUL, 0x223613bdUL, 0xdd06caa2UL, 0x37df932bUL,
|
||||
0xc4248289UL, 0xacf3ebc3UL, 0x5715f6b7UL, 0xef3478ddUL, 0xf267616fUL, 0xc148cbe4UL,
|
||||
0x9052815eUL, 0x5e410fabUL, 0xb48a2465UL, 0x2eda7fa4UL, 0xe87b40e4UL, 0xe98ea084UL,
|
||||
0x5889e9e1UL, 0xefd390fcUL, 0xdd07d35bUL, 0xdb485694UL, 0x38d7e5b2UL, 0x57720101UL,
|
||||
0x730edebcUL, 0x5b643113UL, 0x94917e4fUL, 0x503c2fbaUL, 0x646f1282UL, 0x7523d24aUL,
|
||||
0xe0779695UL, 0xf9c17a8fUL, 0x7a5b2121UL, 0xd187b896UL, 0x29263a4dUL, 0xba510cdfUL,
|
||||
0x81f47c9fUL, 0xad1163edUL, 0xea7b5965UL, 0x1a00726eUL, 0x11403092UL, 0x00da6d77UL,
|
||||
0x4a0cdd61UL, 0xad1f4603UL, 0x605bdfb0UL, 0x9eedc364UL, 0x22ebe6a8UL, 0xcee7d28aUL,
|
||||
0xa0e736a0UL, 0x5564a6b9UL, 0x10853209UL, 0xc7eb8f37UL, 0x2de705caUL, 0x8951570fUL,
|
||||
0xdf09822bUL, 0xbd691a6cUL, 0xaa12e4f2UL, 0x87451c0fUL, 0xe0f6a27aUL, 0x3ada4819UL,
|
||||
0x4cf1764fUL, 0x0d771c2bUL, 0x67cdb156UL, 0x350d8384UL, 0x5938fa0fUL, 0x42399ef3UL,
|
||||
0x36997b07UL, 0x0e84093dUL, 0x4aa93e61UL, 0x8360d87bUL, 0x1fa98b0cUL, 0x1149382cUL,
|
||||
0xe97625a5UL, 0x0614d1b7UL, 0x0e25244bUL, 0x0c768347UL, 0x589e8d82UL, 0x0d2059d1UL,
|
||||
0xa466bb1eUL, 0xf8da0a82UL, 0x04f19130UL, 0xba6e4ec0UL, 0x99265164UL, 0x1ee7230dUL,
|
||||
0x50b2ad80UL, 0xeaee6801UL, 0x8db2a283UL, 0xea8bf59eUL};
|
||||
|
||||
/* returns the i'th byte of a variable */
|
||||
#ifdef _MSC_VER
|
||||
#define GB(x, i) ((unsigned char)((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3))))
|
||||
#else
|
||||
#else
|
||||
#define GB(x, i) (((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3)))&255)
|
||||
#endif
|
||||
#endif
|
||||
|
||||
/**
|
||||
Initialize the LTC_CAST5 block cipher
|
||||
@@ -419,9 +417,9 @@ int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
if (num_rounds != 12 && num_rounds != 16 && num_rounds != 0) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
|
||||
if (num_rounds == 12 && keylen > 10) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
@@ -484,7 +482,7 @@ int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_
|
||||
zeromem(buf, sizeof(buf));
|
||||
zeromem(x, sizeof(x));
|
||||
zeromem(z, sizeof(z));
|
||||
#endif
|
||||
#endif
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
@@ -502,9 +500,9 @@ int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_
|
||||
#ifdef _MSC_VER
|
||||
#define INLINE __inline
|
||||
#else
|
||||
#define INLINE
|
||||
#endif
|
||||
|
||||
#define INLINE
|
||||
#endif
|
||||
|
||||
INLINE static ulong32 FI(ulong32 R, ulong32 Km, ulong32 Kr)
|
||||
{
|
||||
ulong32 I;
|
||||
@@ -512,7 +510,7 @@ INLINE static ulong32 FI(ulong32 R, ulong32 Km, ulong32 Kr)
|
||||
I = ROL(I, Kr);
|
||||
return ((S1[byte(I, 3)] ^ S2[byte(I,2)]) - S3[byte(I,1)]) + S4[byte(I,0)];
|
||||
}
|
||||
|
||||
|
||||
INLINE static ulong32 FII(ulong32 R, ulong32 Km, ulong32 Kr)
|
||||
{
|
||||
ulong32 I;
|
||||
@@ -547,7 +545,7 @@ int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
LOAD32H(L,&pt[0]);
|
||||
LOAD32H(L,&pt[0]);
|
||||
LOAD32H(R,&pt[4]);
|
||||
L ^= FI(R, skey->cast5.K[0], skey->cast5.K[16]);
|
||||
R ^= FII(L, skey->cast5.K[1], skey->cast5.K[17]);
|
||||
@@ -586,7 +584,7 @@ int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
Decrypts a block of text with LTC_CAST5
|
||||
@param ct The input ciphertext (8 bytes)
|
||||
@param pt The output plaintext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
*/
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static int _cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
@@ -600,7 +598,7 @@ int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
LOAD32H(R,&ct[0]);
|
||||
LOAD32H(R,&ct[0]);
|
||||
LOAD32H(L,&ct[4]);
|
||||
if (skey->cast5.keylen > 10) {
|
||||
R ^= FI(L, skey->cast5.K[15], skey->cast5.K[31]);
|
||||
@@ -643,7 +641,7 @@ int cast5_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
int keylen;
|
||||
unsigned char key[16];
|
||||
@@ -676,7 +674,8 @@ int cast5_test(void)
|
||||
}
|
||||
cast5_ecb_encrypt(tests[i].pt, tmp[0], &key);
|
||||
cast5_ecb_decrypt(tmp[0], tmp[1], &key);
|
||||
if ((XMEMCMP(tmp[0], tests[i].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[i].pt, 8) != 0)) {
|
||||
if ((compare_testvector(tmp[0], 8, tests[i].ct, 8, "CAST5 Encrypt", i) != 0) ||
|
||||
(compare_testvector(tmp[1], 8, tests[i].pt, 8, "CAST5 Decrypt", i) != 0)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
@@ -684,17 +683,18 @@ int cast5_test(void)
|
||||
for (y = 0; y < 1000; y++) cast5_ecb_encrypt(tmp[0], tmp[0], &key);
|
||||
for (y = 0; y < 1000; y++) cast5_ecb_decrypt(tmp[0], tmp[0], &key);
|
||||
for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void cast5_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -711,10 +711,10 @@ int cast5_keysize(int *keysize)
|
||||
*keysize = 16;
|
||||
}
|
||||
return CRYPT_OK;
|
||||
}
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,14 +5,12 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@file des.c
|
||||
LTC_DES code submitted by Dobes Vandermeer
|
||||
DES code submitted by Dobes Vandermeer
|
||||
*/
|
||||
|
||||
#ifdef LTC_DES
|
||||
@@ -32,7 +30,7 @@ const struct ltc_cipher_descriptor des_desc =
|
||||
&des_test,
|
||||
&des_done,
|
||||
&des_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
#endif
|
||||
|
||||
@@ -47,7 +45,7 @@ const struct ltc_cipher_descriptor des3_desc =
|
||||
&des3_test,
|
||||
&des3_done,
|
||||
&des3_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 bytebit[8] =
|
||||
@@ -1387,7 +1385,7 @@ static void cookey(const ulong32 *raw1, ulong32 *keyout)
|
||||
*cook++ |= (*raw1 & 0x0000003fL);
|
||||
}
|
||||
|
||||
XMEMCPY(keyout, dough, sizeof dough);
|
||||
XMEMCPY(keyout, dough, sizeof(dough));
|
||||
}
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
@@ -1566,17 +1564,27 @@ int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
if (keylen != 24) {
|
||||
if (keylen != 24 && keylen != 16) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
|
||||
deskey(key, EN0, skey->des3.ek[0]);
|
||||
deskey(key+8, DE1, skey->des3.ek[1]);
|
||||
if (keylen == 24) {
|
||||
deskey(key+16, EN0, skey->des3.ek[2]);
|
||||
} else {
|
||||
/* two-key 3DES: K3=K1 */
|
||||
deskey(key, EN0, skey->des3.ek[2]);
|
||||
}
|
||||
|
||||
deskey(key, DE1, skey->des3.dk[2]);
|
||||
deskey(key+8, EN0, skey->des3.dk[1]);
|
||||
if (keylen == 24) {
|
||||
deskey(key+16, DE1, skey->des3.dk[0]);
|
||||
} else {
|
||||
/* two-key 3DES: K3=K1 */
|
||||
deskey(key, DE1, skey->des3.dk[0]);
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
@@ -1747,7 +1755,178 @@ int des_test(void)
|
||||
{ 0x0D, 0x9F, 0x27, 0x9B, 0xA5, 0xD8, 0x72, 0x60 } },
|
||||
{10, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A } }
|
||||
{ 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A } },
|
||||
|
||||
#ifdef LTC_TEST_EXT
|
||||
{ 0+11, 0, { 0x80, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x95, 0xA8, 0xD7, 0x28, 0x13, 0xDA, 0xA9, 0x4D } },
|
||||
{ 1+11, 0, { 0x40, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x0E, 0xEC, 0x14, 0x87, 0xDD, 0x8C, 0x26, 0xD5 } },
|
||||
{ 2+11, 0, { 0x20, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x7A, 0xD1, 0x6F, 0xFB, 0x79, 0xC4, 0x59, 0x26 } },
|
||||
{ 3+11, 0, { 0x10, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xD3, 0x74, 0x62, 0x94, 0xCA, 0x6A, 0x6C, 0xF3 } },
|
||||
{ 4+11, 0, { 0x08, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x80, 0x9F, 0x5F, 0x87, 0x3C, 0x1F, 0xD7, 0x61 } },
|
||||
{ 5+11, 0, { 0x04, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xC0, 0x2F, 0xAF, 0xFE, 0xC9, 0x89, 0xD1, 0xFC } },
|
||||
{ 6+11, 0, { 0x02, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x46, 0x15, 0xAA, 0x1D, 0x33, 0xE7, 0x2F, 0x10 } },
|
||||
{ 7+11, 0, { 0x01, 0x80, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x20, 0x55, 0x12, 0x33, 0x50, 0xC0, 0x08, 0x58 } },
|
||||
{ 8+11, 0, { 0x01, 0x40, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xDF, 0x3B, 0x99, 0xD6, 0x57, 0x73, 0x97, 0xC8 } },
|
||||
{ 9+11, 0, { 0x01, 0x20, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x31, 0xFE, 0x17, 0x36, 0x9B, 0x52, 0x88, 0xC9 } },
|
||||
{10+11, 0, { 0x01, 0x10, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xDF, 0xDD, 0x3C, 0xC6, 0x4D, 0xAE, 0x16, 0x42 } },
|
||||
{11+11, 0, { 0x01, 0x08, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x17, 0x8C, 0x83, 0xCE, 0x2B, 0x39, 0x9D, 0x94 } },
|
||||
{12+11, 0, { 0x01, 0x04, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x50, 0xF6, 0x36, 0x32, 0x4A, 0x9B, 0x7F, 0x80 } },
|
||||
{13+11, 0, { 0x01, 0x02, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xA8, 0x46, 0x8E, 0xE3, 0xBC, 0x18, 0xF0, 0x6D } },
|
||||
{14+11, 0, { 0x01, 0x01, 0x80, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xA2, 0xDC, 0x9E, 0x92, 0xFD, 0x3C, 0xDE, 0x92 } },
|
||||
{15+11, 0, { 0x01, 0x01, 0x40, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xCA, 0xC0, 0x9F, 0x79, 0x7D, 0x03, 0x12, 0x87 } },
|
||||
{16+11, 0, { 0x01, 0x01, 0x20, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x90, 0xBA, 0x68, 0x0B, 0x22, 0xAE, 0xB5, 0x25 } },
|
||||
{17+11, 0, { 0x01, 0x01, 0x10, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xCE, 0x7A, 0x24, 0xF3, 0x50, 0xE2, 0x80, 0xB6 } },
|
||||
{18+11, 0, { 0x01, 0x01, 0x08, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x88, 0x2B, 0xFF, 0x0A, 0xA0, 0x1A, 0x0B, 0x87 } },
|
||||
{19+11, 0, { 0x01, 0x01, 0x04, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x25, 0x61, 0x02, 0x88, 0x92, 0x45, 0x11, 0xC2 } },
|
||||
{20+11, 0, { 0x01, 0x01, 0x02, 0x01, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xC7, 0x15, 0x16, 0xC2, 0x9C, 0x75, 0xD1, 0x70 } },
|
||||
{21+11, 0, { 0x01, 0x01, 0x01, 0x80, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x51, 0x99, 0xC2, 0x9A, 0x52, 0xC9, 0xF0, 0x59 } },
|
||||
{22+11, 0, { 0x01, 0x01, 0x01, 0x40, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xC2, 0x2F, 0x0A, 0x29, 0x4A, 0x71, 0xF2, 0x9F } },
|
||||
{23+11, 0, { 0x01, 0x01, 0x01, 0x20, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xEE, 0x37, 0x14, 0x83, 0x71, 0x4C, 0x02, 0xEA } },
|
||||
{24+11, 0, { 0x01, 0x01, 0x01, 0x10, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xA8, 0x1F, 0xBD, 0x44, 0x8F, 0x9E, 0x52, 0x2F } },
|
||||
{25+11, 0, { 0x01, 0x01, 0x01, 0x08, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x4F, 0x64, 0x4C, 0x92, 0xE1, 0x92, 0xDF, 0xED } },
|
||||
{26+11, 0, { 0x01, 0x01, 0x01, 0x04, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x1A, 0xFA, 0x9A, 0x66, 0xA6, 0xDF, 0x92, 0xAE } },
|
||||
{27+11, 0, { 0x01, 0x01, 0x01, 0x02, 0x01, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xB3, 0xC1, 0xCC, 0x71, 0x5C, 0xB8, 0x79, 0xD8 } },
|
||||
{28+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x80, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x19, 0xD0, 0x32, 0xE6, 0x4A, 0xB0, 0xBD, 0x8B } },
|
||||
{29+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x40, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x3C, 0xFA, 0xA7, 0xA7, 0xDC, 0x87, 0x20, 0xDC } },
|
||||
{30+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x20, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xB7, 0x26, 0x5F, 0x7F, 0x44, 0x7A, 0xC6, 0xF3 } },
|
||||
{31+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x10, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x9D, 0xB7, 0x3B, 0x3C, 0x0D, 0x16, 0x3F, 0x54 } },
|
||||
{32+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x08, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x81, 0x81, 0xB6, 0x5B, 0xAB, 0xF4, 0xA9, 0x75 } },
|
||||
{33+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x04, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x93, 0xC9, 0xB6, 0x40, 0x42, 0xEA, 0xA2, 0x40 } },
|
||||
{34+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x02, 0x01, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x55, 0x70, 0x53, 0x08, 0x29, 0x70, 0x55, 0x92 } },
|
||||
{35+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x80, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x86, 0x38, 0x80, 0x9E, 0x87, 0x87, 0x87, 0xA0 } },
|
||||
{36+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x40, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x41, 0xB9, 0xA7, 0x9A, 0xF7, 0x9A, 0xC2, 0x08 } },
|
||||
{37+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x20, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x7A, 0x9B, 0xE4, 0x2F, 0x20, 0x09, 0xA8, 0x92 } },
|
||||
{38+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x10, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x29, 0x03, 0x8D, 0x56, 0xBA, 0x6D, 0x27, 0x45 } },
|
||||
{39+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x08, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x54, 0x95, 0xC6, 0xAB, 0xF1, 0xE5, 0xDF, 0x51 } },
|
||||
{40+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x04, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xAE, 0x13, 0xDB, 0xD5, 0x61, 0x48, 0x89, 0x33 } },
|
||||
{41+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x02, 0x01, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x02, 0x4D, 0x1F, 0xFA, 0x89, 0x04, 0xE3, 0x89 } },
|
||||
{42+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x80, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xD1, 0x39, 0x97, 0x12, 0xF9, 0x9B, 0xF0, 0x2E } },
|
||||
{43+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x40, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x14, 0xC1, 0xD7, 0xC1, 0xCF, 0xFE, 0xC7, 0x9E } },
|
||||
{44+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x20, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x1D, 0xE5, 0x27, 0x9D, 0xAE, 0x3B, 0xED, 0x6F } },
|
||||
{45+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x10, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xE9, 0x41, 0xA3, 0x3F, 0x85, 0x50, 0x13, 0x03 } },
|
||||
{46+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x08, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xDA, 0x99, 0xDB, 0xBC, 0x9A, 0x03, 0xF3, 0x79 } },
|
||||
{47+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x04, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xB7, 0xFC, 0x92, 0xF9, 0x1D, 0x8E, 0x92, 0xE9 } },
|
||||
{48+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x02, 0x01 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xAE, 0x8E, 0x5C, 0xAA, 0x3C, 0xA0, 0x4E, 0x85 } },
|
||||
{49+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x80 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x9C, 0xC6, 0x2D, 0xF4, 0x3B, 0x6E, 0xED, 0x74 } },
|
||||
{50+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x40 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xD8, 0x63, 0xDB, 0xB5, 0xC5, 0x9A, 0x91, 0xA0 } },
|
||||
{51+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x20 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xA1, 0xAB, 0x21, 0x90, 0x54, 0x5B, 0x91, 0xD7 } },
|
||||
{52+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x10 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x08, 0x75, 0x04, 0x1E, 0x64, 0xC5, 0x70, 0xF7 } },
|
||||
{53+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x08 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x5A, 0x59, 0x45, 0x28, 0xBE, 0xBE, 0xF1, 0xCC } },
|
||||
{54+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x04 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xFC, 0xDB, 0x32, 0x91, 0xDE, 0x21, 0xF0, 0xC0 } },
|
||||
{55+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x02 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x86, 0x9E, 0xFD, 0x7F, 0x9F, 0x26, 0x5A, 0x09 } },
|
||||
#endif /* LTC_TEST_EXT */
|
||||
|
||||
/*** more test cases you could add if you are not convinced (the above test cases aren't really too good):
|
||||
|
||||
@@ -1805,7 +1984,7 @@ int des_test(void)
|
||||
des_ecb_decrypt(cases[i].txt, tmp, &des);
|
||||
}
|
||||
|
||||
if (XMEMCMP(cases[i].out, tmp, sizeof(tmp)) != 0) {
|
||||
if (compare_testvector(cases[i].out, sizeof(tmp), tmp, sizeof(tmp), "DES", i) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -1814,7 +1993,7 @@ int des_test(void)
|
||||
for (y = 0; y < 1000; y++) des_ecb_encrypt(tmp, tmp, &des);
|
||||
for (y = 0; y < 1000; y++) des_ecb_decrypt(tmp, tmp, &des);
|
||||
for (y = 0; y < 8; y++) if (tmp[y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
@@ -1849,7 +2028,7 @@ int des3_test(void)
|
||||
des3_ecb_encrypt(pt, ct, &skey);
|
||||
des3_ecb_decrypt(ct, tmp, &skey);
|
||||
|
||||
if (XMEMCMP(pt, tmp, 8) != 0) {
|
||||
if (compare_testvector(pt, 8, tmp, 8, "3DES", 0) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -1863,6 +2042,7 @@ int des3_test(void)
|
||||
*/
|
||||
void des_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
#endif
|
||||
|
||||
@@ -1871,7 +2051,7 @@ void des_done(symmetric_key *skey)
|
||||
*/
|
||||
void des3_done(symmetric_key *skey)
|
||||
{
|
||||
(void)skey;
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
|
||||
@@ -1910,6 +2090,6 @@ int des3_keysize(int *keysize)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -33,7 +31,7 @@ const struct ltc_cipher_descriptor kasumi_desc = {
|
||||
&kasumi_test,
|
||||
&kasumi_done,
|
||||
&kasumi_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static u16 FI( u16 in, u16 subkey )
|
||||
@@ -150,7 +148,7 @@ int kasumi_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
LOAD32H(left, pt);
|
||||
LOAD32H(right, pt+4);
|
||||
|
||||
for (n = 0; n <= 7; ) {
|
||||
for (n = 0; n <= 7; ) {
|
||||
temp = FL(left, n, skey);
|
||||
temp = FO(temp, n++, skey);
|
||||
right ^= temp;
|
||||
@@ -236,6 +234,7 @@ int kasumi_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
|
||||
|
||||
void kasumi_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
int kasumi_keysize(int *keysize)
|
||||
@@ -303,7 +302,8 @@ int kasumi_test(void)
|
||||
if ((err = kasumi_ecb_decrypt(tests[x].ct, buf[1], &key)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if (XMEMCMP(tests[x].pt, buf[1], 8) || XMEMCMP(tests[x].ct, buf[0], 8)) {
|
||||
if (compare_testvector(buf[1], 8, tests[x].pt, 8, "Kasumi Decrypt", x) ||
|
||||
compare_testvector(buf[0], 8, tests[x].ct, 8, "Kasumi Encrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -313,6 +313,6 @@ int kasumi_test(void)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -28,14 +26,14 @@ const struct ltc_cipher_descriptor khazad_desc = {
|
||||
&khazad_test,
|
||||
&khazad_done,
|
||||
&khazad_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
#define R 8
|
||||
#define KEYSIZE 128
|
||||
#define KEYSIZEB (KEYSIZE/8)
|
||||
#define BLOCKSIZE 64
|
||||
#define BLOCKSIZEB (BLOCKSIZE/8)
|
||||
#define R 8
|
||||
#define KEYSIZE 128
|
||||
#define KEYSIZEB (KEYSIZE/8)
|
||||
#define BLOCKSIZE 64
|
||||
#define BLOCKSIZEB (BLOCKSIZE/8)
|
||||
|
||||
static const ulong64 T0[256] = {
|
||||
CONST64(0xbad3d268bbb96a01), CONST64(0x54fc4d19e59a66b1), CONST64(0x2f71bc93e26514cd), CONST64(0x749ccdb925871b51),
|
||||
@@ -756,7 +754,7 @@ int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
Decrypts a block of text with Khazad
|
||||
@param ct The input ciphertext (8 bytes)
|
||||
@param pt The output plaintext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
@@ -783,22 +781,22 @@ int khazad_test(void)
|
||||
{
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x49, 0xA4, 0xCE, 0x32, 0xAC, 0x19, 0x0E, 0x3F },
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }
|
||||
}, {
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x64, 0x5D, 0x77, 0x3E, 0x40, 0xAB, 0xDD, 0x53 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }
|
||||
}, {
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x9E, 0x39, 0x98, 0x64, 0xF7, 0x8E, 0xCA, 0x02 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }
|
||||
}, {
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
|
||||
{ 0xA9, 0xDF, 0x3D, 0x2C, 0x64, 0xD3, 0xEA, 0x28 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }
|
||||
}
|
||||
};
|
||||
@@ -810,13 +808,14 @@ int khazad_test(void)
|
||||
khazad_setup(tests[x].key, 16, 0, &skey);
|
||||
khazad_ecb_encrypt(tests[x].pt, buf[0], &skey);
|
||||
khazad_ecb_decrypt(buf[0], buf[1], &skey);
|
||||
if (XMEMCMP(buf[0], tests[x].ct, 8) || XMEMCMP(buf[1], tests[x].pt, 8)) {
|
||||
if (compare_testvector(buf[0], 8, tests[x].ct, 8, "Khazad Encrypt", x) ||
|
||||
compare_testvector(buf[1], 8, tests[x].pt, 8, "Khazad Decrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
for (y = 0; y < 1000; y++) khazad_ecb_encrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 1000; y++) khazad_ecb_decrypt(buf[0], buf[0], &skey);
|
||||
if (XMEMCMP(buf[0], tests[x].ct, 8)) {
|
||||
if (compare_testvector(buf[0], 8, tests[x].ct, 8, "Khazad 1000", 1000)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -825,11 +824,12 @@ int khazad_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void khazad_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -850,6 +850,6 @@ int khazad_keysize(int *keysize)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -29,7 +27,7 @@ const struct ltc_cipher_descriptor kseed_desc = {
|
||||
&kseed_test,
|
||||
&kseed_done,
|
||||
&kseed_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 SS0[256] = {
|
||||
@@ -201,41 +199,41 @@ static const ulong32 KCi[16] = {
|
||||
*/
|
||||
int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
|
||||
{
|
||||
int i;
|
||||
ulong32 tmp, k1, k2, k3, k4;
|
||||
int i;
|
||||
ulong32 tmp, k1, k2, k3, k4;
|
||||
|
||||
if (keylen != 16) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
|
||||
if (num_rounds != 16 && num_rounds != 0) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
if (keylen != 16) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
|
||||
/* load key */
|
||||
LOAD32H(k1, key);
|
||||
LOAD32H(k2, key+4);
|
||||
LOAD32H(k3, key+8);
|
||||
LOAD32H(k4, key+12);
|
||||
if (num_rounds != 16 && num_rounds != 0) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
for (i = 0; i < 16; i++) {
|
||||
skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]);
|
||||
skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]);
|
||||
if (i&1) {
|
||||
tmp = k3;
|
||||
k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF;
|
||||
k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF;
|
||||
} else {
|
||||
tmp = k1;
|
||||
k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF;
|
||||
k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF;
|
||||
/* load key */
|
||||
LOAD32H(k1, key);
|
||||
LOAD32H(k2, key+4);
|
||||
LOAD32H(k3, key+8);
|
||||
LOAD32H(k4, key+12);
|
||||
|
||||
for (i = 0; i < 16; i++) {
|
||||
skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]);
|
||||
skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]);
|
||||
if (i&1) {
|
||||
tmp = k3;
|
||||
k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF;
|
||||
k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF;
|
||||
} else {
|
||||
tmp = k1;
|
||||
k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF;
|
||||
k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF;
|
||||
}
|
||||
/* reverse keys for decrypt */
|
||||
skey->kseed.dK[2*(15-i)+0] = skey->kseed.K[2*i+0];
|
||||
skey->kseed.dK[2*(15-i)+1] = skey->kseed.K[2*i+1];
|
||||
}
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
static void rounds(ulong32 *P, ulong32 *K)
|
||||
@@ -275,7 +273,7 @@ int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
Decrypts a block of text with SEED
|
||||
@param ct The input ciphertext (16 bytes)
|
||||
@param pt The output plaintext (16 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
@@ -293,11 +291,12 @@ int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void kseed_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -345,7 +344,8 @@ int kseed_test(void)
|
||||
kseed_setup(tests[x].key, 16, 0, &skey);
|
||||
kseed_ecb_encrypt(tests[x].pt, buf[0], &skey);
|
||||
kseed_ecb_decrypt(buf[0], buf[1], &skey);
|
||||
if (XMEMCMP(buf[0], tests[x].ct, 16) || XMEMCMP(buf[1], tests[x].pt, 16)) {
|
||||
if (compare_testvector(buf[0], 16, tests[x].ct, 16, "KSEED Encrypt", x) ||
|
||||
compare_testvector(buf[1], 16, tests[x].pt, 16, "KSEED Decrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -371,6 +371,6 @@ int kseed_keysize(int *keysize)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -58,7 +56,7 @@ static void setup(ulong32 *dk, ulong32 *k, ulong32 *uk)
|
||||
|
||||
p[0] = dk[0]; p[1] = dk[1];
|
||||
|
||||
t = 4;
|
||||
t = 4;
|
||||
n = 0;
|
||||
pi1(p);
|
||||
pi2(p, k);
|
||||
@@ -83,28 +81,28 @@ static void encrypt(ulong32 *p, int N, ulong32 *uk)
|
||||
{
|
||||
int n, t;
|
||||
for (t = n = 0; ; ) {
|
||||
pi1(p); if (++n == N) break;
|
||||
pi1(p); if (++n == N) break;
|
||||
pi2(p, uk+t); if (++n == N) break;
|
||||
pi3(p, uk+t); if (++n == N) break;
|
||||
pi4(p, uk+t); if (++n == N) break;
|
||||
t ^= 4;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
static void decrypt(ulong32 *p, int N, ulong32 *uk)
|
||||
{
|
||||
int n, t;
|
||||
for (t = 4*((N&1)^1), n = N; ; ) {
|
||||
switch (n >= 4 ? 4 : 0) {
|
||||
case 4: pi4(p, uk+t); --n;
|
||||
case 3: pi3(p, uk+t); --n;
|
||||
case 2: pi2(p, uk+t); --n;
|
||||
for (t = 4*(((N-1)>>2)&1), n = N; ; ) {
|
||||
switch (n<=4 ? n : ((n-1)%4)+1) {
|
||||
case 4: pi4(p, uk+t); --n; /* FALLTHROUGH */
|
||||
case 3: pi3(p, uk+t); --n; /* FALLTHROUGH */
|
||||
case 2: pi2(p, uk+t); --n; /* FALLTHROUGH */
|
||||
case 1: pi1(p); --n; break;
|
||||
case 0: return;
|
||||
}
|
||||
t ^= 4;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
const struct ltc_cipher_descriptor multi2_desc = {
|
||||
"multi2",
|
||||
@@ -116,7 +114,7 @@ const struct ltc_cipher_descriptor multi2_desc = {
|
||||
&multi2_test,
|
||||
&multi2_done,
|
||||
&multi2_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
|
||||
@@ -129,7 +127,7 @@ int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetri
|
||||
|
||||
if (keylen != 40) return CRYPT_INVALID_KEYSIZE;
|
||||
if (num_rounds == 0) num_rounds = 128;
|
||||
|
||||
|
||||
skey->multi2.N = num_rounds;
|
||||
for (x = 0; x < 8; x++) {
|
||||
LOAD32H(sk[x], key + x*4);
|
||||
@@ -159,7 +157,7 @@ int multi2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
LOAD32H(p[0], pt);
|
||||
LOAD32H(p[1], pt+4);
|
||||
encrypt(p, skey->multi2.N, skey->multi2.uk);
|
||||
STORE32H(p[0], ct);
|
||||
STORE32H(p[0], ct);
|
||||
STORE32H(p[1], ct+4);
|
||||
return CRYPT_OK;
|
||||
}
|
||||
@@ -180,7 +178,7 @@ int multi2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key
|
||||
LOAD32H(p[0], ct);
|
||||
LOAD32H(p[1], ct+4);
|
||||
decrypt(p, skey->multi2.N, skey->multi2.uk);
|
||||
STORE32H(p[0], pt);
|
||||
STORE32H(p[0], pt);
|
||||
STORE32H(p[1], pt+4);
|
||||
return CRYPT_OK;
|
||||
}
|
||||
@@ -207,7 +205,7 @@ int multi2_test(void)
|
||||
0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00,
|
||||
|
||||
|
||||
0x01, 0x23, 0x45, 0x67,
|
||||
0x89, 0xAB, 0xCD, 0xEF
|
||||
},
|
||||
@@ -235,7 +233,7 @@ int multi2_test(void)
|
||||
0xb1, 0x27, 0xb9, 0x06,
|
||||
0xe7, 0x56, 0x22, 0x38,
|
||||
},
|
||||
{
|
||||
{
|
||||
0x1f, 0xb4, 0x60, 0x60,
|
||||
0xd0, 0xb3, 0x4f, 0xa5
|
||||
},
|
||||
@@ -258,26 +256,44 @@ int multi2_test(void)
|
||||
return err;
|
||||
}
|
||||
|
||||
if (XMEMCMP(buf, tests[x].ct, 8)) {
|
||||
if (compare_testvector(buf, 8, tests[x].ct, 8, "Multi2 Encrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
|
||||
if ((err = multi2_ecb_decrypt(buf, buf, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if (XMEMCMP(buf, tests[x].pt, 8)) {
|
||||
if (compare_testvector(buf, 8, tests[x].pt, 8, "Multi2 Decrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
for (x = 128; x < 256; ++x) {
|
||||
unsigned char ct[8];
|
||||
|
||||
if ((err = multi2_setup(tests[0].key, 40, x, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = multi2_ecb_encrypt(tests[0].pt, ct, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = multi2_ecb_decrypt(ct, buf, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if (compare_testvector(buf, 8, tests[0].pt, 8, "Multi2 Rounds", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void multi2_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -298,6 +314,6 @@ int multi2_keysize(int *keysize)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,12 +5,10 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
/**
|
||||
@file noekeon.c
|
||||
Implementation of the Noekeon block cipher by Tom St Denis
|
||||
Implementation of the Noekeon block cipher by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -27,7 +25,7 @@ const struct ltc_cipher_descriptor noekeon_desc =
|
||||
&noekeon_test,
|
||||
&noekeon_done,
|
||||
&noekeon_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 RC[] = {
|
||||
@@ -35,7 +33,7 @@ static const ulong32 RC[] = {
|
||||
0x000000d8UL, 0x000000abUL, 0x0000004dUL, 0x0000009aUL,
|
||||
0x0000002fUL, 0x0000005eUL, 0x000000bcUL, 0x00000063UL,
|
||||
0x000000c6UL, 0x00000097UL, 0x00000035UL, 0x0000006aUL,
|
||||
0x000000d4UL
|
||||
0x000000d4UL
|
||||
};
|
||||
|
||||
#define kTHETA(a, b, c, d) \
|
||||
@@ -49,7 +47,7 @@ static const ulong32 RC[] = {
|
||||
b ^= temp ^ k[1]; d ^= temp ^ k[3]; \
|
||||
temp = b^d; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \
|
||||
a ^= temp ^ k[0]; c ^= temp ^ k[2];
|
||||
|
||||
|
||||
#define GAMMA(a, b, c, d) \
|
||||
b ^= ~(d|c); \
|
||||
a ^= c&b; \
|
||||
@@ -57,13 +55,13 @@ static const ulong32 RC[] = {
|
||||
c ^= a ^ b ^ d; \
|
||||
b ^= ~(d|c); \
|
||||
a ^= c&b;
|
||||
|
||||
|
||||
#define PI1(a, b, c, d) \
|
||||
a = ROLc(a, 1); c = ROLc(c, 5); d = ROLc(d, 2);
|
||||
|
||||
b = ROLc(b, 1); c = ROLc(c, 5); d = ROLc(d, 2);
|
||||
|
||||
#define PI2(a, b, c, d) \
|
||||
a = RORc(a, 1); c = RORc(c, 5); d = RORc(d, 2);
|
||||
|
||||
b = RORc(b, 1); c = RORc(c, 5); d = RORc(d, 2);
|
||||
|
||||
/**
|
||||
Initialize the Noekeon block cipher
|
||||
@param key The symmetric key you wish to pass
|
||||
@@ -75,23 +73,23 @@ static const ulong32 RC[] = {
|
||||
int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
|
||||
{
|
||||
ulong32 temp;
|
||||
|
||||
|
||||
LTC_ARGCHK(key != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
|
||||
if (keylen != 16) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
|
||||
|
||||
if (num_rounds != 16 && num_rounds != 0) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
|
||||
LOAD32H(skey->noekeon.K[0],&key[0]);
|
||||
LOAD32H(skey->noekeon.K[1],&key[4]);
|
||||
LOAD32H(skey->noekeon.K[2],&key[8]);
|
||||
LOAD32H(skey->noekeon.K[3],&key[12]);
|
||||
|
||||
|
||||
LOAD32H(skey->noekeon.dK[0],&key[0]);
|
||||
LOAD32H(skey->noekeon.dK[1],&key[4]);
|
||||
LOAD32H(skey->noekeon.dK[2],&key[8]);
|
||||
@@ -121,10 +119,10 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
|
||||
|
||||
LOAD32H(a,&pt[0]); LOAD32H(b,&pt[4]);
|
||||
LOAD32H(c,&pt[8]); LOAD32H(d,&pt[12]);
|
||||
|
||||
|
||||
#define ROUND(i) \
|
||||
a ^= RC[i]; \
|
||||
THETA(skey->noekeon.K, a,b,c,d); \
|
||||
@@ -140,7 +138,7 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke
|
||||
|
||||
a ^= RC[16];
|
||||
THETA(skey->noekeon.K, a, b, c, d);
|
||||
|
||||
|
||||
STORE32H(a,&ct[0]); STORE32H(b,&ct[4]);
|
||||
STORE32H(c,&ct[8]); STORE32H(d,&ct[12]);
|
||||
|
||||
@@ -152,7 +150,7 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke
|
||||
{
|
||||
int err = _noekeon_ecb_encrypt(pt, ct, skey);
|
||||
burn_stack(sizeof(ulong32) * 5 + sizeof(int));
|
||||
return CRYPT_OK;
|
||||
return err;
|
||||
}
|
||||
#endif
|
||||
|
||||
@@ -160,7 +158,7 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke
|
||||
Decrypts a block of text with Noekeon
|
||||
@param ct The input ciphertext (16 bytes)
|
||||
@param pt The output plaintext (16 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
@@ -175,17 +173,17 @@ int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_ke
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
|
||||
|
||||
LOAD32H(a,&ct[0]); LOAD32H(b,&ct[4]);
|
||||
LOAD32H(c,&ct[8]); LOAD32H(d,&ct[12]);
|
||||
|
||||
|
||||
|
||||
#define ROUND(i) \
|
||||
THETA(skey->noekeon.dK, a,b,c,d); \
|
||||
a ^= RC[i]; \
|
||||
PI1(a,b,c,d); \
|
||||
GAMMA(a,b,c,d); \
|
||||
PI2(a,b,c,d);
|
||||
PI2(a,b,c,d);
|
||||
|
||||
for (r = 16; r > 0; --r) {
|
||||
ROUND(r);
|
||||
@@ -224,59 +222,86 @@ int noekeon_test(void)
|
||||
} tests[] = {
|
||||
{
|
||||
16,
|
||||
{ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 },
|
||||
{ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 },
|
||||
{ 0x18, 0xa6, 0xec, 0xe5, 0x28, 0xaa, 0x79, 0x73,
|
||||
0x28, 0xb2, 0xc0, 0x91, 0xa0, 0x2f, 0x54, 0xc5}
|
||||
{ 0xAA, 0x3C, 0x8C, 0x86, 0xD9, 0x8B, 0xF8, 0xBE, 0x21, 0xE0, 0x36, 0x09, 0x78, 0xFB, 0xE4, 0x90 },
|
||||
{ 0xE4, 0x96, 0x6C, 0xD3, 0x13, 0xA0, 0x6C, 0xAF, 0xD0, 0x23, 0xC9, 0xFD, 0x45, 0x32, 0x23, 0x16 },
|
||||
{ 0xA6, 0xEC, 0xB8, 0xA8, 0x61, 0xFD, 0x62, 0xD9, 0x13, 0x02, 0xFE, 0x9E, 0x47, 0x01, 0x3F, 0xC3 }
|
||||
},
|
||||
{
|
||||
16,
|
||||
{ 0xED, 0x43, 0xD1, 0x87, 0x21, 0x7E, 0xE0, 0x97, 0x3D, 0x76, 0xC3, 0x37, 0x2E, 0x7D, 0xAE, 0xD3 },
|
||||
{ 0xE3, 0x38, 0x32, 0xCC, 0xF2, 0x2F, 0x2F, 0x0A, 0x4A, 0x8B, 0x8F, 0x18, 0x12, 0x20, 0x17, 0xD3 },
|
||||
{ 0x94, 0xA5, 0xDF, 0xF5, 0xAE, 0x1C, 0xBB, 0x22, 0xAD, 0xEB, 0xA7, 0x0D, 0xB7, 0x82, 0x90, 0xA0 }
|
||||
},
|
||||
{
|
||||
16,
|
||||
{ 0x6F, 0xDC, 0x23, 0x38, 0xF2, 0x10, 0xFB, 0xD3, 0xC1, 0x8C, 0x02, 0xF6, 0xB4, 0x6A, 0xD5, 0xA8 },
|
||||
{ 0xDB, 0x29, 0xED, 0xB5, 0x5F, 0xB3, 0x60, 0x3A, 0x92, 0xA8, 0xEB, 0x9C, 0x6D, 0x9D, 0x3E, 0x8F },
|
||||
{ 0x78, 0xF3, 0x6F, 0xF8, 0x9E, 0xBB, 0x8C, 0x6A, 0xE8, 0x10, 0xF7, 0x00, 0x22, 0x15, 0x30, 0x3D }
|
||||
},
|
||||
{
|
||||
16,
|
||||
{ 0x2C, 0x0C, 0x02, 0xEF, 0x6B, 0xC4, 0xF2, 0x0B, 0x2E, 0xB9, 0xE0, 0xBF, 0xD9, 0x36, 0xC2, 0x4E },
|
||||
{ 0x84, 0xE2, 0xFE, 0x64, 0xB1, 0xB9, 0xFE, 0x76, 0xA8, 0x3F, 0x45, 0xC7, 0x40, 0x7A, 0xAF, 0xEE },
|
||||
{ 0x2A, 0x08, 0xD6, 0xA2, 0x1C, 0x63, 0x08, 0xB0, 0xF8, 0xBC, 0xB3, 0xA1, 0x66, 0xF7, 0xAE, 0xCF }
|
||||
},
|
||||
{
|
||||
16,
|
||||
{ 0x6F, 0x30, 0xF8, 0x9F, 0xDA, 0x6E, 0xA0, 0x91, 0x04, 0x0F, 0x6C, 0x8B, 0x7D, 0xF7, 0x2A, 0x4B },
|
||||
{ 0x65, 0xB6, 0xA6, 0xD0, 0x42, 0x14, 0x08, 0x60, 0x34, 0x8D, 0x37, 0x2F, 0x01, 0xF0, 0x46, 0xBE },
|
||||
{ 0x66, 0xAC, 0x0B, 0x62, 0x1D, 0x68, 0x11, 0xF5, 0x27, 0xB1, 0x13, 0x5D, 0xF3, 0x2A, 0xE9, 0x18 }
|
||||
},
|
||||
{
|
||||
16,
|
||||
{ 0xCA, 0xA4, 0x16, 0xB7, 0x1C, 0x92, 0x2E, 0xAD, 0xEB, 0xA7, 0xDB, 0x69, 0x92, 0xCB, 0x35, 0xEF },
|
||||
{ 0x81, 0x6F, 0x8E, 0x4D, 0x96, 0xC6, 0xB3, 0x67, 0x83, 0xF5, 0x63, 0xC7, 0x20, 0x6D, 0x40, 0x23 },
|
||||
{ 0x44, 0xF7, 0x63, 0x62, 0xF0, 0x43, 0xBB, 0x67, 0x4A, 0x75, 0x12, 0x42, 0x46, 0x29, 0x28, 0x19 }
|
||||
},
|
||||
{
|
||||
16,
|
||||
{ 0x6B, 0xCF, 0x22, 0x2F, 0xE0, 0x1B, 0xB0, 0xAA, 0xD8, 0x3C, 0x91, 0x99, 0x18, 0xB2, 0x28, 0xE8 },
|
||||
{ 0x7C, 0x37, 0xC7, 0xD0, 0xAC, 0x92, 0x29, 0xF1, 0x60, 0x82, 0x93, 0x89, 0xAA, 0x61, 0xAA, 0xA9 },
|
||||
{ 0xE5, 0x89, 0x1B, 0xB3, 0xFE, 0x8B, 0x0C, 0xA1, 0xA6, 0xC7, 0xBE, 0x12, 0x73, 0x0F, 0xC1, 0x19 }
|
||||
},
|
||||
{
|
||||
16,
|
||||
{ 0xE6, 0xD0, 0xF1, 0x03, 0x2E, 0xDE, 0x70, 0x8D, 0xD8, 0x9E, 0x36, 0x5C, 0x05, 0x52, 0xE7, 0x0D },
|
||||
{ 0xE2, 0x42, 0xE7, 0x92, 0x0E, 0xF7, 0x82, 0xA2, 0xB8, 0x21, 0x8D, 0x26, 0xBA, 0x2D, 0xE6, 0x32 },
|
||||
{ 0x1E, 0xDD, 0x75, 0x22, 0xB9, 0x36, 0x8A, 0x0F, 0x32, 0xFD, 0xD4, 0x48, 0x65, 0x12, 0x5A, 0x2F }
|
||||
}
|
||||
};
|
||||
symmetric_key key;
|
||||
unsigned char tmp[2][16];
|
||||
int err, i, y;
|
||||
|
||||
|
||||
for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
|
||||
zeromem(&key, sizeof(key));
|
||||
if ((err = noekeon_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) {
|
||||
if ((err = noekeon_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
|
||||
noekeon_ecb_encrypt(tests[i].pt, tmp[0], &key);
|
||||
noekeon_ecb_decrypt(tmp[0], tmp[1], &key);
|
||||
if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) {
|
||||
#if 0
|
||||
printf("\n\nTest %d failed\n", i);
|
||||
if (XMEMCMP(tmp[0], tests[i].ct, 16)) {
|
||||
printf("CT: ");
|
||||
for (i = 0; i < 16; i++) {
|
||||
printf("%02x ", tmp[0][i]);
|
||||
}
|
||||
printf("\n");
|
||||
} else {
|
||||
printf("PT: ");
|
||||
for (i = 0; i < 16; i++) {
|
||||
printf("%02x ", tmp[1][i]);
|
||||
}
|
||||
printf("\n");
|
||||
}
|
||||
#endif
|
||||
if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "Noekeon Encrypt", i) ||
|
||||
compare_testvector(tmp[1], 16, tests[i].pt, 16, "Noekeon Decrypt", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
for (y = 0; y < 16; y++) tmp[0][y] = 0;
|
||||
for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key);
|
||||
for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key);
|
||||
for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
for (y = 0; y < 16; y++) tmp[0][y] = 0;
|
||||
for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key);
|
||||
for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key);
|
||||
for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void noekeon_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -298,6 +323,6 @@ int noekeon_keysize(int *keysize)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
/**********************************************************************\
|
||||
* To commemorate the 1996 RSA Data Security Conference, the following *
|
||||
@@ -18,12 +16,12 @@
|
||||
* Thanks to CodeView, SoftIce, and D86 for helping bring this code to *
|
||||
* the public. *
|
||||
\**********************************************************************/
|
||||
#include <tomcrypt.h>
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@file rc2.c
|
||||
Implementation of LTC_RC2
|
||||
*/
|
||||
Implementation of RC2 with fixed effective key length of 64bits
|
||||
*/
|
||||
|
||||
#ifdef LTC_RC2
|
||||
|
||||
@@ -36,7 +34,7 @@ const struct ltc_cipher_descriptor rc2_desc = {
|
||||
&rc2_test,
|
||||
&rc2_done,
|
||||
&rc2_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
/* 256-entry permutation table, probably derived somehow from pi */
|
||||
@@ -60,68 +58,87 @@ static const unsigned char permute[256] = {
|
||||
};
|
||||
|
||||
/**
|
||||
Initialize the LTC_RC2 block cipher
|
||||
Initialize the RC2 block cipher
|
||||
@param key The symmetric key you wish to pass
|
||||
@param keylen The key length in bytes
|
||||
@param bits The effective key length in bits
|
||||
@param num_rounds The number of rounds desired (0 for default)
|
||||
@param skey The key in as scheduled by this function.
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
|
||||
int rc2_setup_ex(const unsigned char *key, int keylen, int bits, int num_rounds, symmetric_key *skey)
|
||||
{
|
||||
unsigned *xkey = skey->rc2.xkey;
|
||||
unsigned char tmp[128];
|
||||
unsigned T8, TM;
|
||||
int i, bits;
|
||||
int i;
|
||||
|
||||
LTC_ARGCHK(key != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
if (keylen < 8 || keylen > 128) {
|
||||
if (keylen == 0 || keylen > 128 || bits > 1024) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
if (bits == 0) {
|
||||
bits = 1024;
|
||||
}
|
||||
|
||||
if (num_rounds != 0 && num_rounds != 16) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
for (i = 0; i < keylen; i++) {
|
||||
tmp[i] = key[i] & 255;
|
||||
tmp[i] = key[i] & 255;
|
||||
}
|
||||
|
||||
/* Phase 1: Expand input key to 128 bytes */
|
||||
if (keylen < 128) {
|
||||
for (i = keylen; i < 128; i++) {
|
||||
tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255];
|
||||
}
|
||||
}
|
||||
|
||||
/* Phase 2 - reduce effective key size to "bits" */
|
||||
bits = keylen<<3;
|
||||
T8 = (unsigned)(bits+7)>>3;
|
||||
TM = (255 >> (unsigned)(7 & -bits));
|
||||
tmp[128 - T8] = permute[tmp[128 - T8] & TM];
|
||||
for (i = 127 - T8; i >= 0; i--) {
|
||||
tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]];
|
||||
}
|
||||
/* Phase 1: Expand input key to 128 bytes */
|
||||
if (keylen < 128) {
|
||||
for (i = keylen; i < 128; i++) {
|
||||
tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255];
|
||||
}
|
||||
}
|
||||
|
||||
/* Phase 3 - copy to xkey in little-endian order */
|
||||
for (i = 0; i < 64; i++) {
|
||||
xkey[i] = (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8);
|
||||
}
|
||||
/* Phase 2 - reduce effective key size to "bits" */
|
||||
T8 = (unsigned)(bits+7)>>3;
|
||||
TM = (255 >> (unsigned)(7 & -bits));
|
||||
tmp[128 - T8] = permute[tmp[128 - T8] & TM];
|
||||
for (i = 127 - T8; i >= 0; i--) {
|
||||
tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]];
|
||||
}
|
||||
|
||||
/* Phase 3 - copy to xkey in little-endian order */
|
||||
for (i = 0; i < 64; i++) {
|
||||
xkey[i] = (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8);
|
||||
}
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(tmp, sizeof(tmp));
|
||||
zeromem(tmp, sizeof(tmp));
|
||||
#endif
|
||||
|
||||
return CRYPT_OK;
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Initialize the RC2 block cipher
|
||||
|
||||
The effective key length is here always keylen * 8
|
||||
|
||||
@param key The symmetric key you wish to pass
|
||||
@param keylen The key length in bytes
|
||||
@param num_rounds The number of rounds desired (0 for default)
|
||||
@param skey The key in as scheduled by this function.
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
|
||||
{
|
||||
return rc2_setup_ex(key, keylen, keylen * 8, num_rounds, skey);
|
||||
}
|
||||
|
||||
/**********************************************************************\
|
||||
* Encrypt an 8-byte block of plaintext using the given key. *
|
||||
\**********************************************************************/
|
||||
/**
|
||||
Encrypts a block of text with LTC_RC2
|
||||
Encrypts a block of text with RC2
|
||||
@param pt The input plaintext (8 bytes)
|
||||
@param ct The output ciphertext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@@ -180,7 +197,7 @@ int rc2_ecb_encrypt( const unsigned char *pt,
|
||||
ct[5] = (unsigned char)(x54 >> 8);
|
||||
ct[6] = (unsigned char)x76;
|
||||
ct[7] = (unsigned char)(x76 >> 8);
|
||||
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
@@ -199,10 +216,10 @@ int rc2_ecb_encrypt( const unsigned char *pt,
|
||||
* Decrypt an 8-byte block of ciphertext using the given key. *
|
||||
\**********************************************************************/
|
||||
/**
|
||||
Decrypts a block of text with LTC_RC2
|
||||
Decrypts a block of text with RC2
|
||||
@param ct The input ciphertext (8 bytes)
|
||||
@param pt The output plaintext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
@@ -275,27 +292,56 @@ int rc2_ecb_decrypt( const unsigned char *ct,
|
||||
#endif
|
||||
|
||||
/**
|
||||
Performs a self-test of the LTC_RC2 block cipher
|
||||
Performs a self-test of the RC2 block cipher
|
||||
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
|
||||
*/
|
||||
int rc2_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
int keylen;
|
||||
int keylen, bits;
|
||||
unsigned char key[16], pt[8], ct[8];
|
||||
} tests[] = {
|
||||
|
||||
{ 8,
|
||||
{ 8, 63,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xeb, 0xb7, 0x73, 0xf9, 0x93, 0x27, 0x8e, 0xff }
|
||||
},
|
||||
{ 8, 64,
|
||||
{ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff },
|
||||
{ 0x27, 0x8b, 0x27, 0xe4, 0x2e, 0x2f, 0x0d, 0x49 }
|
||||
},
|
||||
{ 8, 64,
|
||||
{ 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
|
||||
{ 0x30, 0x64, 0x9e, 0xdf, 0x9b, 0xe7, 0xd2, 0xc2 }
|
||||
|
||||
},
|
||||
{ 16,
|
||||
{ 1, 64,
|
||||
{ 0x88, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x61, 0xa8, 0xa2, 0x44, 0xad, 0xac, 0xcc, 0xf0 }
|
||||
},
|
||||
{ 7, 64,
|
||||
{ 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x6c, 0xcf, 0x43, 0x08, 0x97, 0x4c, 0x26, 0x7f }
|
||||
},
|
||||
{ 16, 64,
|
||||
{ 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x7f,
|
||||
0x0f, 0x79, 0xc3, 0x84, 0x62, 0x7b, 0xaf, 0xb2 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x1a, 0x80, 0x7d, 0x27, 0x2b, 0xbe, 0x5d, 0xb1 }
|
||||
},
|
||||
{ 16, 128,
|
||||
{ 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x7f,
|
||||
0x0f, 0x79, 0xc3, 0x84, 0x62, 0x7b, 0xaf, 0xb2 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
@@ -308,14 +354,22 @@ int rc2_test(void)
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) {
|
||||
zeromem(tmp, sizeof(tmp));
|
||||
if ((err = rc2_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
if (tests[x].bits == (tests[x].keylen * 8)) {
|
||||
if ((err = rc2_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
}
|
||||
|
||||
else {
|
||||
if ((err = rc2_setup_ex(tests[x].key, tests[x].keylen, tests[x].bits, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
}
|
||||
|
||||
rc2_ecb_encrypt(tests[x].pt, tmp[0], &skey);
|
||||
rc2_ecb_decrypt(tmp[0], tmp[1], &skey);
|
||||
|
||||
if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) {
|
||||
|
||||
if (compare_testvector(tmp[0], 8, tests[x].ct, 8, "RC2 CT", x) ||
|
||||
compare_testvector(tmp[1], 8, tests[x].pt, 8, "RC2 PT", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -329,11 +383,12 @@ int rc2_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void rc2_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -344,7 +399,7 @@ void rc2_done(symmetric_key *skey)
|
||||
int rc2_keysize(int *keysize)
|
||||
{
|
||||
LTC_ARGCHK(keysize != NULL);
|
||||
if (*keysize < 8) {
|
||||
if (*keysize < 1) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
} else if (*keysize > 128) {
|
||||
*keysize = 128;
|
||||
@@ -357,6 +412,6 @@ int rc2_keysize(int *keysize)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,13 +5,11 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@file rc5.c
|
||||
LTC_RC5 code by Tom St Denis
|
||||
LTC_RC5 code by Tom St Denis
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
@@ -29,7 +27,7 @@ const struct ltc_cipher_descriptor rc5_desc =
|
||||
&rc5_test,
|
||||
&rc5_done,
|
||||
&rc5_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 stab[50] = {
|
||||
@@ -60,13 +58,13 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
LTC_ARGCHK(key != NULL);
|
||||
|
||||
|
||||
/* test parameters */
|
||||
if (num_rounds == 0) {
|
||||
if (num_rounds == 0) {
|
||||
num_rounds = rc5_desc.default_rounds;
|
||||
}
|
||||
|
||||
if (num_rounds < 12 || num_rounds > 24) {
|
||||
if (num_rounds < 12 || num_rounds > 24) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
@@ -74,12 +72,12 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
if (keylen < 8 || keylen > 128) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
|
||||
|
||||
skey->rc5.rounds = num_rounds;
|
||||
S = skey->rc5.K;
|
||||
|
||||
/* copy the key into the L array */
|
||||
for (A = i = j = 0; i < (ulong32)keylen; ) {
|
||||
for (A = i = j = 0; i < (ulong32)keylen; ) {
|
||||
A = (A << 8) | ((ulong32)(key[i++] & 255));
|
||||
if ((i & 3) == 0) {
|
||||
L[j++] = BSWAP(A);
|
||||
@@ -87,8 +85,8 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
}
|
||||
}
|
||||
|
||||
if ((keylen & 3) != 0) {
|
||||
A <<= (ulong32)((8 * (4 - (keylen&3))));
|
||||
if ((keylen & 3) != 0) {
|
||||
A <<= (ulong32)((8 * (4 - (keylen&3))));
|
||||
L[j++] = BSWAP(A);
|
||||
}
|
||||
|
||||
@@ -99,7 +97,7 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
/* mix buffer */
|
||||
s = 3 * MAX(t, j);
|
||||
l = j;
|
||||
for (A = B = i = j = v = 0; v < s; v++) {
|
||||
for (A = B = i = j = v = 0; v < s; v++) {
|
||||
A = S[i] = ROLc(S[i] + A + B, 3);
|
||||
B = L[j] = ROL(L[j] + A + B, (A+B));
|
||||
if (++i == t) { i = 0; }
|
||||
@@ -142,7 +140,7 @@ int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
|
||||
A += skey->rc5.K[0];
|
||||
B += skey->rc5.K[1];
|
||||
K = skey->rc5.K + 2;
|
||||
|
||||
|
||||
if ((skey->rc5.rounds & 1) == 0) {
|
||||
for (r = 0; r < skey->rc5.rounds; r += 2) {
|
||||
A = ROL(A ^ B, B) + K[0];
|
||||
@@ -177,7 +175,7 @@ int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
|
||||
Decrypts a block of text with LTC_RC5
|
||||
@param ct The input ciphertext (8 bytes)
|
||||
@param pt The output plaintext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
@@ -195,7 +193,7 @@ int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *s
|
||||
LOAD32L(A, &ct[0]);
|
||||
LOAD32L(B, &ct[4]);
|
||||
K = skey->rc5.K + (skey->rc5.rounds << 1);
|
||||
|
||||
|
||||
if ((skey->rc5.rounds & 1) == 0) {
|
||||
K -= 2;
|
||||
for (r = skey->rc5.rounds - 1; r >= 0; r -= 2) {
|
||||
@@ -237,7 +235,7 @@ int rc5_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
unsigned char key[16], pt[8], ct[8];
|
||||
} tests[] = {
|
||||
@@ -275,7 +273,8 @@ int rc5_test(void)
|
||||
rc5_ecb_decrypt(tmp[0], tmp[1], &key);
|
||||
|
||||
/* compare */
|
||||
if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) {
|
||||
if (compare_testvector(tmp[0], 8, tests[x].ct, 8, "RC5 Encrypt", x) != 0 ||
|
||||
compare_testvector(tmp[1], 8, tests[x].pt, 8, "RC5 Decrypt", x) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -289,11 +288,12 @@ int rc5_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void rc5_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -317,6 +317,6 @@ int rc5_keysize(int *keysize)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,13 +5,11 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@file rc6.c
|
||||
LTC_RC6 code by Tom St Denis
|
||||
LTC_RC6 code by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -28,7 +26,7 @@ const struct ltc_cipher_descriptor rc6_desc =
|
||||
&rc6_test,
|
||||
&rc6_done,
|
||||
&rc6_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const ulong32 stab[44] = {
|
||||
@@ -59,7 +57,7 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
/* test parameters */
|
||||
if (num_rounds != 0 && num_rounds != 20) {
|
||||
if (num_rounds != 0 && num_rounds != 20) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
@@ -69,7 +67,7 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
}
|
||||
|
||||
/* copy the key into the L array */
|
||||
for (A = i = j = 0; i < (ulong32)keylen; ) {
|
||||
for (A = i = j = 0; i < (ulong32)keylen; ) {
|
||||
A = (A << 8) | ((ulong32)(key[i++] & 255));
|
||||
if (!(i & 3)) {
|
||||
L[j++] = BSWAP(A);
|
||||
@@ -78,9 +76,9 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
}
|
||||
|
||||
/* handle odd sized keys */
|
||||
if (keylen & 3) {
|
||||
A <<= (8 * (4 - (keylen&3)));
|
||||
L[j++] = BSWAP(A);
|
||||
if (keylen & 3) {
|
||||
A <<= (8 * (4 - (keylen&3)));
|
||||
L[j++] = BSWAP(A);
|
||||
}
|
||||
|
||||
/* setup the S array */
|
||||
@@ -89,15 +87,15 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
|
||||
/* mix buffer */
|
||||
s = 3 * MAX(44, j);
|
||||
l = j;
|
||||
for (A = B = i = j = v = 0; v < s; v++) {
|
||||
for (A = B = i = j = v = 0; v < s; v++) {
|
||||
A = S[i] = ROLc(S[i] + A + B, 3);
|
||||
B = L[j] = ROL(L[j] + A + B, (A+B));
|
||||
if (++i == 44) { i = 0; }
|
||||
if (++j == l) { j = 0; }
|
||||
}
|
||||
|
||||
|
||||
/* copy to key */
|
||||
for (i = 0; i < 44; i++) {
|
||||
for (i = 0; i < 44; i++) {
|
||||
skey->rc6.K[i] = S[i];
|
||||
}
|
||||
return CRYPT_OK;
|
||||
@@ -127,7 +125,7 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
|
||||
{
|
||||
ulong32 a,b,c,d,t,u, *K;
|
||||
int r;
|
||||
|
||||
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
@@ -140,8 +138,8 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
|
||||
t = (b * (b + b + 1)); t = ROLc(t, 5); \
|
||||
u = (d * (d + d + 1)); u = ROLc(u, 5); \
|
||||
a = ROL(a^t,u) + K[0]; \
|
||||
c = ROL(c^u,t) + K[1]; K += 2;
|
||||
|
||||
c = ROL(c^u,t) + K[1]; K += 2;
|
||||
|
||||
K = skey->rc6.K + 2;
|
||||
for (r = 0; r < 20; r += 4) {
|
||||
RND(a,b,c,d);
|
||||
@@ -149,7 +147,7 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
|
||||
RND(c,d,a,b);
|
||||
RND(d,a,b,c);
|
||||
}
|
||||
|
||||
|
||||
#undef RND
|
||||
|
||||
a += skey->rc6.K[42];
|
||||
@@ -171,7 +169,7 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
|
||||
Decrypts a block of text with LTC_RC6
|
||||
@param ct The input ciphertext (16 bytes)
|
||||
@param pt The output plaintext (16 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
*/
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static int _rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
@@ -185,26 +183,26 @@ int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *s
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
|
||||
|
||||
LOAD32L(a,&ct[0]);LOAD32L(b,&ct[4]);LOAD32L(c,&ct[8]);LOAD32L(d,&ct[12]);
|
||||
a -= skey->rc6.K[42];
|
||||
c -= skey->rc6.K[43];
|
||||
|
||||
|
||||
#define RND(a,b,c,d) \
|
||||
t = (b * (b + b + 1)); t = ROLc(t, 5); \
|
||||
u = (d * (d + d + 1)); u = ROLc(u, 5); \
|
||||
c = ROR(c - K[1], t) ^ u; \
|
||||
a = ROR(a - K[0], u) ^ t; K -= 2;
|
||||
|
||||
|
||||
K = skey->rc6.K + 40;
|
||||
|
||||
|
||||
for (r = 0; r < 20; r += 4) {
|
||||
RND(d,a,b,c);
|
||||
RND(c,d,a,b);
|
||||
RND(b,c,d,a);
|
||||
RND(a,b,c,d);
|
||||
}
|
||||
|
||||
|
||||
#undef RND
|
||||
|
||||
b -= skey->rc6.K[0];
|
||||
@@ -231,7 +229,7 @@ int rc6_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
int keylen;
|
||||
unsigned char key[32], pt[16], ct[16];
|
||||
@@ -285,24 +283,8 @@ int rc6_test(void)
|
||||
rc6_ecb_decrypt(tmp[0], tmp[1], &key);
|
||||
|
||||
/* compare */
|
||||
if (XMEMCMP(tmp[0], tests[x].ct, 16) || XMEMCMP(tmp[1], tests[x].pt, 16)) {
|
||||
#if 0
|
||||
printf("\n\nFailed test %d\n", x);
|
||||
if (XMEMCMP(tmp[0], tests[x].ct, 16)) {
|
||||
printf("Ciphertext: ");
|
||||
for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]);
|
||||
printf("\nExpected : ");
|
||||
for (y = 0; y < 16; y++) printf("%02x ", tests[x].ct[y]);
|
||||
printf("\n");
|
||||
}
|
||||
if (XMEMCMP(tmp[1], tests[x].pt, 16)) {
|
||||
printf("Plaintext: ");
|
||||
for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]);
|
||||
printf("\nExpected : ");
|
||||
for (y = 0; y < 16; y++) printf("%02x ", tests[x].pt[y]);
|
||||
printf("\n");
|
||||
}
|
||||
#endif
|
||||
if (compare_testvector(tmp[0], 16, tests[x].ct, 16, "RC6 Encrypt", x) ||
|
||||
compare_testvector(tmp[1], 16, tests[x].pt, 16, "RC6 Decrypt", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -316,11 +298,12 @@ int rc6_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void rc6_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -343,6 +326,6 @@ int rc6_keysize(int *keysize)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/*******************************************************************************
|
||||
@@ -28,13 +26,15 @@
|
||||
*
|
||||
*******************************************************************************/
|
||||
|
||||
#include <tomcrypt.h>
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_SAFER
|
||||
|
||||
const struct ltc_cipher_descriptor
|
||||
safer_k64_desc = {
|
||||
"safer-k64",
|
||||
#define __LTC_SAFER_TAB_C__
|
||||
#include "safer_tab.c"
|
||||
|
||||
const struct ltc_cipher_descriptor safer_k64_desc = {
|
||||
"safer-k64",
|
||||
8, 8, 8, 8, LTC_SAFER_K64_DEFAULT_NOF_ROUNDS,
|
||||
&safer_k64_setup,
|
||||
&safer_ecb_encrypt,
|
||||
@@ -42,7 +42,7 @@ const struct ltc_cipher_descriptor
|
||||
&safer_k64_test,
|
||||
&safer_done,
|
||||
&safer_64_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
},
|
||||
|
||||
safer_sk64_desc = {
|
||||
@@ -54,7 +54,7 @@ const struct ltc_cipher_descriptor
|
||||
&safer_sk64_test,
|
||||
&safer_done,
|
||||
&safer_64_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
},
|
||||
|
||||
safer_k128_desc = {
|
||||
@@ -66,7 +66,7 @@ const struct ltc_cipher_descriptor
|
||||
&safer_sk128_test,
|
||||
&safer_done,
|
||||
&safer_128_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
},
|
||||
|
||||
safer_sk128_desc = {
|
||||
@@ -78,7 +78,7 @@ const struct ltc_cipher_descriptor
|
||||
&safer_sk128_test,
|
||||
&safer_done,
|
||||
&safer_128_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
/******************* Constants ************************************************/
|
||||
@@ -95,7 +95,6 @@ const struct ltc_cipher_descriptor
|
||||
#define IPHT(x, y) { x -= y; y -= x; }
|
||||
|
||||
/******************* Types ****************************************************/
|
||||
extern const unsigned char safer_ebox[], safer_lbox[];
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static void _Safer_Expand_Userkey(const unsigned char *userkey_1,
|
||||
@@ -158,7 +157,7 @@ static void Safer_Expand_Userkey(const unsigned char *userkey_1,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(ka, sizeof(ka));
|
||||
zeromem(kb, sizeof(kb));
|
||||
@@ -193,7 +192,7 @@ int safer_k64_setup(const unsigned char *key, int keylen, int numrounds, symmetr
|
||||
Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:LTC_SAFER_K64_DEFAULT_NOF_ROUNDS), 0, skey->safer.key);
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
|
||||
int safer_sk64_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey)
|
||||
{
|
||||
LTC_ARGCHK(key != NULL);
|
||||
@@ -380,7 +379,7 @@ int safer_k64_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const unsigned char k64_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 },
|
||||
k64_key[] = { 8, 7, 6, 5, 4, 3, 2, 1 },
|
||||
k64_ct[] = { 200, 242, 156, 221, 135, 120, 62, 217 };
|
||||
@@ -396,7 +395,8 @@ int safer_k64_test(void)
|
||||
safer_ecb_encrypt(k64_pt, buf[0], &skey);
|
||||
safer_ecb_decrypt(buf[0], buf[1], &skey);
|
||||
|
||||
if (XMEMCMP(buf[0], k64_ct, 8) != 0 || XMEMCMP(buf[1], k64_pt, 8) != 0) {
|
||||
if (compare_testvector(buf[0], 8, k64_ct, 8, "Safer K64 Encrypt", 0) != 0 ||
|
||||
compare_testvector(buf[1], 8, k64_pt, 8, "Safer K64 Decrypt", 0) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -409,7 +409,7 @@ int safer_sk64_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const unsigned char sk64_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 },
|
||||
sk64_key[] = { 1, 2, 3, 4, 5, 6, 7, 8 },
|
||||
sk64_ct[] = { 95, 206, 155, 162, 5, 132, 56, 199 };
|
||||
@@ -426,32 +426,34 @@ int safer_sk64_test(void)
|
||||
safer_ecb_encrypt(sk64_pt, buf[0], &skey);
|
||||
safer_ecb_decrypt(buf[0], buf[1], &skey);
|
||||
|
||||
if (XMEMCMP(buf[0], sk64_ct, 8) != 0 || XMEMCMP(buf[1], sk64_pt, 8) != 0) {
|
||||
if (compare_testvector(buf[0], 8, sk64_ct, 8, "Safer SK64 Encrypt", 0) != 0 ||
|
||||
compare_testvector(buf[1], 8, sk64_pt, 8, "Safer SK64 Decrypt", 0) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
for (y = 0; y < 8; y++) buf[0][y] = 0;
|
||||
for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
for (y = 0; y < 8; y++) buf[0][y] = 0;
|
||||
for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void safer_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
int safer_sk128_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const unsigned char sk128_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 },
|
||||
sk128_key[] = { 1, 2, 3, 4, 5, 6, 7, 8,
|
||||
0, 0, 0, 0, 0, 0, 0, 0 },
|
||||
@@ -468,16 +470,18 @@ int safer_sk128_test(void)
|
||||
safer_ecb_encrypt(sk128_pt, buf[0], &skey);
|
||||
safer_ecb_decrypt(buf[0], buf[1], &skey);
|
||||
|
||||
if (XMEMCMP(buf[0], sk128_ct, 8) != 0 || XMEMCMP(buf[1], sk128_pt, 8) != 0) {
|
||||
if (compare_testvector(buf[0], 8, sk128_ct, 8, "Safer SK128 Encrypt", 0) != 0 ||
|
||||
compare_testvector(buf[1], 8, sk128_pt, 8, "Safer SK128 Decrypt", 0) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
for (y = 0; y < 8; y++) buf[0][y] = 0;
|
||||
for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
return CRYPT_OK;
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
for (y = 0; y < 8; y++) buf[0][y] = 0;
|
||||
for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey);
|
||||
for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
@@ -486,6 +490,6 @@ int safer_sk128_test(void)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,64 +5,60 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@file safer_tab.c
|
||||
Tables for LTC_SAFER block ciphers
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
*/
|
||||
|
||||
#if defined(LTC_SAFERP) || defined(LTC_SAFER)
|
||||
#ifdef __LTC_SAFER_TAB_C__
|
||||
|
||||
/* This is the box defined by ebox[x] = 45^x mod 257.
|
||||
/* This is the box defined by ebox[x] = 45^x mod 257.
|
||||
* Its assumed that the value "256" corresponds to zero. */
|
||||
const unsigned char safer_ebox[256] = {
|
||||
1, 45, 226, 147, 190, 69, 21, 174, 120, 3, 135, 164, 184, 56, 207, 63,
|
||||
8, 103, 9, 148, 235, 38, 168, 107, 189, 24, 52, 27, 187, 191, 114, 247,
|
||||
64, 53, 72, 156, 81, 47, 59, 85, 227, 192, 159, 216, 211, 243, 141, 177,
|
||||
255, 167, 62, 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131,
|
||||
241, 51, 239, 218, 44, 181, 178, 43, 136, 209, 153, 203, 140, 132, 29, 20,
|
||||
129, 151, 113, 202, 95, 163, 139, 87, 60, 130, 196, 82, 92, 28, 232, 160,
|
||||
4, 180, 133, 74, 246, 19, 84, 182, 223, 12, 26, 142, 222, 224, 57, 252,
|
||||
32, 155, 36, 78, 169, 152, 158, 171, 242, 96, 208, 108, 234, 250, 199, 217,
|
||||
0, 212, 31, 110, 67, 188, 236, 83, 137, 254, 122, 93, 73, 201, 50, 194,
|
||||
249, 154, 248, 109, 22, 219, 89, 150, 68, 233, 205, 230, 70, 66, 143, 10,
|
||||
193, 204, 185, 101, 176, 210, 198, 172, 30, 65, 98, 41, 46, 14, 116, 80,
|
||||
2, 90, 195, 37, 123, 138, 42, 91, 240, 6, 13, 71, 111, 112, 157, 126,
|
||||
16, 206, 18, 39, 213, 76, 79, 214, 121, 48, 104, 54, 117, 125, 228, 237,
|
||||
128, 106, 144, 55, 162, 94, 118, 170, 197, 127, 61, 175, 165, 229, 25, 97,
|
||||
253, 77, 124, 183, 11, 238, 173, 75, 34, 245, 231, 115, 35, 33, 200, 5,
|
||||
static const unsigned char safer_ebox[256] = {
|
||||
1, 45, 226, 147, 190, 69, 21, 174, 120, 3, 135, 164, 184, 56, 207, 63,
|
||||
8, 103, 9, 148, 235, 38, 168, 107, 189, 24, 52, 27, 187, 191, 114, 247,
|
||||
64, 53, 72, 156, 81, 47, 59, 85, 227, 192, 159, 216, 211, 243, 141, 177,
|
||||
255, 167, 62, 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131,
|
||||
241, 51, 239, 218, 44, 181, 178, 43, 136, 209, 153, 203, 140, 132, 29, 20,
|
||||
129, 151, 113, 202, 95, 163, 139, 87, 60, 130, 196, 82, 92, 28, 232, 160,
|
||||
4, 180, 133, 74, 246, 19, 84, 182, 223, 12, 26, 142, 222, 224, 57, 252,
|
||||
32, 155, 36, 78, 169, 152, 158, 171, 242, 96, 208, 108, 234, 250, 199, 217,
|
||||
0, 212, 31, 110, 67, 188, 236, 83, 137, 254, 122, 93, 73, 201, 50, 194,
|
||||
249, 154, 248, 109, 22, 219, 89, 150, 68, 233, 205, 230, 70, 66, 143, 10,
|
||||
193, 204, 185, 101, 176, 210, 198, 172, 30, 65, 98, 41, 46, 14, 116, 80,
|
||||
2, 90, 195, 37, 123, 138, 42, 91, 240, 6, 13, 71, 111, 112, 157, 126,
|
||||
16, 206, 18, 39, 213, 76, 79, 214, 121, 48, 104, 54, 117, 125, 228, 237,
|
||||
128, 106, 144, 55, 162, 94, 118, 170, 197, 127, 61, 175, 165, 229, 25, 97,
|
||||
253, 77, 124, 183, 11, 238, 173, 75, 34, 245, 231, 115, 35, 33, 200, 5,
|
||||
225, 102, 221, 179, 88, 105, 99, 86, 15, 161, 49, 149, 23, 7, 58, 40
|
||||
};
|
||||
|
||||
/* This is the inverse of ebox or the base 45 logarithm */
|
||||
const unsigned char safer_lbox[256] = {
|
||||
static const unsigned char safer_lbox[256] = {
|
||||
128, 0, 176, 9, 96, 239, 185, 253, 16, 18, 159, 228, 105, 186, 173, 248,
|
||||
192, 56, 194, 101, 79, 6, 148, 252, 25, 222, 106, 27, 93, 78, 168, 130,
|
||||
112, 237, 232, 236, 114, 179, 21, 195, 255, 171, 182, 71, 68, 1, 172, 37,
|
||||
201, 250, 142, 65, 26, 33, 203, 211, 13, 110, 254, 38, 88, 218, 50, 15,
|
||||
32, 169, 157, 132, 152, 5, 156, 187, 34, 140, 99, 231, 197, 225, 115, 198,
|
||||
175, 36, 91, 135, 102, 39, 247, 87, 244, 150, 177, 183, 92, 139, 213, 84,
|
||||
121, 223, 170, 246, 62, 163, 241, 17, 202, 245, 209, 23, 123, 147, 131, 188,
|
||||
112, 237, 232, 236, 114, 179, 21, 195, 255, 171, 182, 71, 68, 1, 172, 37,
|
||||
201, 250, 142, 65, 26, 33, 203, 211, 13, 110, 254, 38, 88, 218, 50, 15,
|
||||
32, 169, 157, 132, 152, 5, 156, 187, 34, 140, 99, 231, 197, 225, 115, 198,
|
||||
175, 36, 91, 135, 102, 39, 247, 87, 244, 150, 177, 183, 92, 139, 213, 84,
|
||||
121, 223, 170, 246, 62, 163, 241, 17, 202, 245, 209, 23, 123, 147, 131, 188,
|
||||
189, 82, 30, 235, 174, 204, 214, 53, 8, 200, 138, 180, 226, 205, 191, 217,
|
||||
208, 80, 89, 63, 77, 98, 52, 10, 72, 136, 181, 86, 76, 46, 107, 158,
|
||||
210, 61, 60, 3, 19, 251, 151, 81, 117, 74, 145, 113, 35, 190, 118, 42,
|
||||
208, 80, 89, 63, 77, 98, 52, 10, 72, 136, 181, 86, 76, 46, 107, 158,
|
||||
210, 61, 60, 3, 19, 251, 151, 81, 117, 74, 145, 113, 35, 190, 118, 42,
|
||||
95, 249, 212, 85, 11, 220, 55, 49, 22, 116, 215, 119, 167, 230, 7, 219,
|
||||
164, 47, 70, 243, 97, 69, 103, 227, 12, 162, 59, 28, 133, 24, 4, 29,
|
||||
41, 160, 143, 178, 90, 216, 166, 126, 238, 141, 83, 75, 161, 154, 193, 14,
|
||||
122, 73, 165, 44, 129, 196, 199, 54, 43, 127, 67, 149, 51, 242, 108, 104,
|
||||
109, 240, 2, 40, 206, 221, 155, 234, 94, 153, 124, 20, 134, 207, 229, 66,
|
||||
164, 47, 70, 243, 97, 69, 103, 227, 12, 162, 59, 28, 133, 24, 4, 29,
|
||||
41, 160, 143, 178, 90, 216, 166, 126, 238, 141, 83, 75, 161, 154, 193, 14,
|
||||
122, 73, 165, 44, 129, 196, 199, 54, 43, 127, 67, 149, 51, 242, 108, 104,
|
||||
109, 240, 2, 40, 206, 221, 155, 234, 94, 153, 124, 20, 134, 207, 229, 66,
|
||||
184, 64, 120, 45, 58, 233, 100, 31, 146, 144, 125, 57, 111, 224, 137, 48
|
||||
};
|
||||
|
||||
#endif
|
||||
#endif /* __LTC_SAFER_TAB_C__ */
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,18 +5,19 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file saferp.c
|
||||
LTC_SAFER+ Implementation by Tom St Denis
|
||||
LTC_SAFER+ Implementation by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_SAFERP
|
||||
|
||||
#define __LTC_SAFER_TAB_C__
|
||||
#include "safer_tab.c"
|
||||
|
||||
const struct ltc_cipher_descriptor saferp_desc =
|
||||
{
|
||||
"safer+",
|
||||
@@ -28,23 +29,21 @@ const struct ltc_cipher_descriptor saferp_desc =
|
||||
&saferp_test,
|
||||
&saferp_done,
|
||||
&saferp_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
/* ROUND(b,i)
|
||||
/* ROUND(b,i)
|
||||
*
|
||||
* This is one forward key application. Note the basic form is
|
||||
* key addition, substitution, key addition. The safer_ebox and safer_lbox
|
||||
* are the exponentiation box and logarithm boxes respectively.
|
||||
* The value of 'i' is the current round number which allows this
|
||||
* function to be unrolled massively. Most of LTC_SAFER+'s speed
|
||||
* comes from not having to compute indirect accesses into the
|
||||
* This is one forward key application. Note the basic form is
|
||||
* key addition, substitution, key addition. The safer_ebox and safer_lbox
|
||||
* are the exponentiation box and logarithm boxes respectively.
|
||||
* The value of 'i' is the current round number which allows this
|
||||
* function to be unrolled massively. Most of LTC_SAFER+'s speed
|
||||
* comes from not having to compute indirect accesses into the
|
||||
* array of 16 bytes b[0..15] which is the block of data
|
||||
*/
|
||||
|
||||
extern const unsigned char safer_ebox[], safer_lbox[];
|
||||
|
||||
#define ROUND(b, i) \
|
||||
#define ROUND(b, i) do { \
|
||||
b[0] = (safer_ebox[(b[0] ^ skey->saferp.K[i][0]) & 255] + skey->saferp.K[i+1][0]) & 255; \
|
||||
b[1] = safer_lbox[(b[1] + skey->saferp.K[i][1]) & 255] ^ skey->saferp.K[i+1][1]; \
|
||||
b[2] = safer_lbox[(b[2] + skey->saferp.K[i][2]) & 255] ^ skey->saferp.K[i+1][2]; \
|
||||
@@ -60,10 +59,11 @@ extern const unsigned char safer_ebox[], safer_lbox[];
|
||||
b[12] = (safer_ebox[(b[12] ^ skey->saferp.K[i][12]) & 255] + skey->saferp.K[i+1][12]) & 255; \
|
||||
b[13] = safer_lbox[(b[13] + skey->saferp.K[i][13]) & 255] ^ skey->saferp.K[i+1][13]; \
|
||||
b[14] = safer_lbox[(b[14] + skey->saferp.K[i][14]) & 255] ^ skey->saferp.K[i+1][14]; \
|
||||
b[15] = (safer_ebox[(b[15] ^ skey->saferp.K[i][15]) & 255] + skey->saferp.K[i+1][15]) & 255;
|
||||
b[15] = (safer_ebox[(b[15] ^ skey->saferp.K[i][15]) & 255] + skey->saferp.K[i+1][15]) & 255; \
|
||||
} while (0)
|
||||
|
||||
/* This is one inverse key application */
|
||||
#define iROUND(b, i) \
|
||||
#define iROUND(b, i) do { \
|
||||
b[0] = safer_lbox[(b[0] - skey->saferp.K[i+1][0]) & 255] ^ skey->saferp.K[i][0]; \
|
||||
b[1] = (safer_ebox[(b[1] ^ skey->saferp.K[i+1][1]) & 255] - skey->saferp.K[i][1]) & 255; \
|
||||
b[2] = (safer_ebox[(b[2] ^ skey->saferp.K[i+1][2]) & 255] - skey->saferp.K[i][2]) & 255; \
|
||||
@@ -79,10 +79,11 @@ extern const unsigned char safer_ebox[], safer_lbox[];
|
||||
b[12] = safer_lbox[(b[12] - skey->saferp.K[i+1][12]) & 255] ^ skey->saferp.K[i][12]; \
|
||||
b[13] = (safer_ebox[(b[13] ^ skey->saferp.K[i+1][13]) & 255] - skey->saferp.K[i][13]) & 255; \
|
||||
b[14] = (safer_ebox[(b[14] ^ skey->saferp.K[i+1][14]) & 255] - skey->saferp.K[i][14]) & 255; \
|
||||
b[15] = safer_lbox[(b[15] - skey->saferp.K[i+1][15]) & 255] ^ skey->saferp.K[i][15];
|
||||
b[15] = safer_lbox[(b[15] - skey->saferp.K[i+1][15]) & 255] ^ skey->saferp.K[i][15]; \
|
||||
} while (0)
|
||||
|
||||
/* This is a forward single layer PHT transform. */
|
||||
#define PHT(b) \
|
||||
#define PHT(b) do { \
|
||||
b[0] = (b[0] + (b[1] = (b[0] + b[1]) & 255)) & 255; \
|
||||
b[2] = (b[2] + (b[3] = (b[3] + b[2]) & 255)) & 255; \
|
||||
b[4] = (b[4] + (b[5] = (b[5] + b[4]) & 255)) & 255; \
|
||||
@@ -90,10 +91,11 @@ extern const unsigned char safer_ebox[], safer_lbox[];
|
||||
b[8] = (b[8] + (b[9] = (b[9] + b[8]) & 255)) & 255; \
|
||||
b[10] = (b[10] + (b[11] = (b[11] + b[10]) & 255)) & 255; \
|
||||
b[12] = (b[12] + (b[13] = (b[13] + b[12]) & 255)) & 255; \
|
||||
b[14] = (b[14] + (b[15] = (b[15] + b[14]) & 255)) & 255;
|
||||
b[14] = (b[14] + (b[15] = (b[15] + b[14]) & 255)) & 255; \
|
||||
} while (0)
|
||||
|
||||
/* This is an inverse single layer PHT transform */
|
||||
#define iPHT(b) \
|
||||
#define iPHT(b) do { \
|
||||
b[15] = (b[15] - (b[14] = (b[14] - b[15]) & 255)) & 255; \
|
||||
b[13] = (b[13] - (b[12] = (b[12] - b[13]) & 255)) & 255; \
|
||||
b[11] = (b[11] - (b[10] = (b[10] - b[11]) & 255)) & 255; \
|
||||
@@ -102,41 +104,46 @@ extern const unsigned char safer_ebox[], safer_lbox[];
|
||||
b[5] = (b[5] - (b[4] = (b[4] - b[5]) & 255)) & 255; \
|
||||
b[3] = (b[3] - (b[2] = (b[2] - b[3]) & 255)) & 255; \
|
||||
b[1] = (b[1] - (b[0] = (b[0] - b[1]) & 255)) & 255; \
|
||||
} while (0)
|
||||
|
||||
/* This is the "Armenian" Shuffle. It takes the input from b and stores it in b2 */
|
||||
#define SHUF(b, b2) \
|
||||
#define SHUF(b, b2) do { \
|
||||
b2[0] = b[8]; b2[1] = b[11]; b2[2] = b[12]; b2[3] = b[15]; \
|
||||
b2[4] = b[2]; b2[5] = b[1]; b2[6] = b[6]; b2[7] = b[5]; \
|
||||
b2[8] = b[10]; b2[9] = b[9]; b2[10] = b[14]; b2[11] = b[13]; \
|
||||
b2[12] = b[0]; b2[13] = b[7]; b2[14] = b[4]; b2[15] = b[3];
|
||||
b2[12] = b[0]; b2[13] = b[7]; b2[14] = b[4]; b2[15] = b[3]; \
|
||||
} while (0)
|
||||
|
||||
/* This is the inverse shuffle. It takes from b and gives to b2 */
|
||||
#define iSHUF(b, b2) \
|
||||
#define iSHUF(b, b2) do { \
|
||||
b2[0] = b[12]; b2[1] = b[5]; b2[2] = b[4]; b2[3] = b[15]; \
|
||||
b2[4] = b[14]; b2[5] = b[7]; b2[6] = b[6]; b2[7] = b[13]; \
|
||||
b2[8] = b[0]; b2[9] = b[9]; b2[10] = b[8]; b2[11] = b[1]; \
|
||||
b2[12] = b[2]; b2[13] = b[11]; b2[14] = b[10]; b2[15] = b[3];
|
||||
b2[12] = b[2]; b2[13] = b[11]; b2[14] = b[10]; b2[15] = b[3]; \
|
||||
} while (0)
|
||||
|
||||
/* The complete forward Linear Transform layer.
|
||||
* Note that alternating usage of b and b2.
|
||||
* Each round of LT starts in 'b' and ends in 'b2'.
|
||||
/* The complete forward Linear Transform layer.
|
||||
* Note that alternating usage of b and b2.
|
||||
* Each round of LT starts in 'b' and ends in 'b2'.
|
||||
*/
|
||||
#define LT(b, b2) \
|
||||
#define LT(b, b2) do { \
|
||||
PHT(b); SHUF(b, b2); \
|
||||
PHT(b2); SHUF(b2, b); \
|
||||
PHT(b); SHUF(b, b2); \
|
||||
PHT(b2);
|
||||
PHT(b2); \
|
||||
} while (0)
|
||||
|
||||
/* This is the inverse linear transform layer. */
|
||||
#define iLT(b, b2) \
|
||||
#define iLT(b, b2) do { \
|
||||
iPHT(b); \
|
||||
iSHUF(b, b2); iPHT(b2); \
|
||||
iSHUF(b2, b); iPHT(b); \
|
||||
iSHUF(b, b2); iPHT(b2);
|
||||
|
||||
#ifdef LTC_SMALL_CODE
|
||||
iSHUF(b, b2); iPHT(b2); \
|
||||
} while (0)
|
||||
|
||||
static void _round(unsigned char *b, int i, symmetric_key *skey)
|
||||
#ifdef LTC_SMALL_CODE
|
||||
|
||||
static void _round(unsigned char *b, int i, symmetric_key *skey)
|
||||
{
|
||||
ROUND(b, i);
|
||||
}
|
||||
@@ -154,7 +161,7 @@ static void _lt(unsigned char *b, unsigned char *b2)
|
||||
static void _ilt(unsigned char *b, unsigned char *b2)
|
||||
{
|
||||
iLT(b, b2);
|
||||
}
|
||||
}
|
||||
|
||||
#undef ROUND
|
||||
#define ROUND(b, i) _round(b, i, skey)
|
||||
@@ -228,7 +235,7 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
|
||||
}
|
||||
|
||||
/* Is the number of rounds valid? Either use zero for default or
|
||||
* 8,12,16 rounds for 16,24,32 byte keys
|
||||
* 8,12,16 rounds for 16,24,32 byte keys
|
||||
*/
|
||||
if (num_rounds != 0 && num_rounds != rounds[(keylen/8)-2]) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
@@ -237,9 +244,9 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
|
||||
/* 128 bit key version */
|
||||
if (keylen == 16) {
|
||||
/* copy key into t */
|
||||
for (x = y = 0; x < 16; x++) {
|
||||
t[x] = key[x];
|
||||
y ^= key[x];
|
||||
for (x = y = 0; x < 16; x++) {
|
||||
t[x] = key[x];
|
||||
y ^= key[x];
|
||||
}
|
||||
t[16] = y;
|
||||
|
||||
@@ -265,9 +272,9 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
|
||||
skey->saferp.rounds = 8;
|
||||
} else if (keylen == 24) {
|
||||
/* copy key into t */
|
||||
for (x = y = 0; x < 24; x++) {
|
||||
t[x] = key[x];
|
||||
y ^= key[x];
|
||||
for (x = y = 0; x < 24; x++) {
|
||||
t[x] = key[x];
|
||||
y ^= key[x];
|
||||
}
|
||||
t[24] = y;
|
||||
|
||||
@@ -284,7 +291,7 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
|
||||
|
||||
/* select and add */
|
||||
z = x;
|
||||
for (y = 0; y < 16; y++) {
|
||||
for (y = 0; y < 16; y++) {
|
||||
skey->saferp.K[x][y] = (t[z] + safer_bias[x-1][y]) & 255;
|
||||
if (++z == 25) { z = 0; }
|
||||
}
|
||||
@@ -292,14 +299,14 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
|
||||
skey->saferp.rounds = 12;
|
||||
} else {
|
||||
/* copy key into t */
|
||||
for (x = y = 0; x < 32; x++) {
|
||||
t[x] = key[x];
|
||||
y ^= key[x];
|
||||
for (x = y = 0; x < 32; x++) {
|
||||
t[x] = key[x];
|
||||
y ^= key[x];
|
||||
}
|
||||
t[32] = y;
|
||||
|
||||
/* make round keys */
|
||||
for (x = 0; x < 16; x++) {
|
||||
for (x = 0; x < 16; x++) {
|
||||
skey->saferp.K[0][x] = t[x];
|
||||
}
|
||||
|
||||
@@ -308,7 +315,7 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
|
||||
for (y = 0; y < 33; y++) {
|
||||
t[y] = ((t[y]<<3)|(t[y]>>5)) & 255;
|
||||
}
|
||||
|
||||
|
||||
/* select and add */
|
||||
z = x;
|
||||
for (y = 0; y < 16; y++) {
|
||||
@@ -392,7 +399,7 @@ int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
|
||||
Decrypts a block of text with LTC_SAFER+
|
||||
@param ct The input ciphertext (16 bytes)
|
||||
@param pt The output plaintext (16 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
@@ -460,40 +467,40 @@ int saferp_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
int keylen;
|
||||
unsigned char key[32], pt[16], ct[16];
|
||||
} tests[] = {
|
||||
{
|
||||
16,
|
||||
{ 41, 35, 190, 132, 225, 108, 214, 174,
|
||||
{ 41, 35, 190, 132, 225, 108, 214, 174,
|
||||
82, 144, 73, 241, 241, 187, 233, 235 },
|
||||
{ 179, 166, 219, 60, 135, 12, 62, 153,
|
||||
{ 179, 166, 219, 60, 135, 12, 62, 153,
|
||||
36, 94, 13, 28, 6, 183, 71, 222 },
|
||||
{ 224, 31, 182, 10, 12, 255, 84, 70,
|
||||
{ 224, 31, 182, 10, 12, 255, 84, 70,
|
||||
127, 13, 89, 249, 9, 57, 165, 220 }
|
||||
}, {
|
||||
24,
|
||||
{ 72, 211, 143, 117, 230, 217, 29, 42,
|
||||
229, 192, 247, 43, 120, 129, 135, 68,
|
||||
{ 72, 211, 143, 117, 230, 217, 29, 42,
|
||||
229, 192, 247, 43, 120, 129, 135, 68,
|
||||
14, 95, 80, 0, 212, 97, 141, 190 },
|
||||
{ 123, 5, 21, 7, 59, 51, 130, 31,
|
||||
{ 123, 5, 21, 7, 59, 51, 130, 31,
|
||||
24, 112, 146, 218, 100, 84, 206, 177 },
|
||||
{ 92, 136, 4, 63, 57, 95, 100, 0,
|
||||
{ 92, 136, 4, 63, 57, 95, 100, 0,
|
||||
150, 130, 130, 16, 193, 111, 219, 133 }
|
||||
}, {
|
||||
32,
|
||||
{ 243, 168, 141, 254, 190, 242, 235, 113,
|
||||
{ 243, 168, 141, 254, 190, 242, 235, 113,
|
||||
255, 160, 208, 59, 117, 6, 140, 126,
|
||||
135, 120, 115, 77, 208, 190, 130, 190,
|
||||
135, 120, 115, 77, 208, 190, 130, 190,
|
||||
219, 194, 70, 65, 43, 140, 250, 48 },
|
||||
{ 127, 112, 240, 167, 84, 134, 50, 149,
|
||||
{ 127, 112, 240, 167, 84, 134, 50, 149,
|
||||
170, 91, 104, 19, 11, 230, 252, 245 },
|
||||
{ 88, 11, 25, 36, 172, 229, 202, 213,
|
||||
{ 88, 11, 25, 36, 172, 229, 202, 213,
|
||||
170, 65, 105, 153, 220, 104, 153, 138 }
|
||||
}
|
||||
};
|
||||
};
|
||||
|
||||
unsigned char tmp[2][16];
|
||||
symmetric_key skey;
|
||||
@@ -507,7 +514,8 @@ int saferp_test(void)
|
||||
saferp_ecb_decrypt(tmp[0], tmp[1], &skey);
|
||||
|
||||
/* compare */
|
||||
if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) {
|
||||
if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "Safer+ Encrypt", i) ||
|
||||
compare_testvector(tmp[1], 16, tests[i].pt, 16, "Safer+ Decrypt", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -522,11 +530,12 @@ int saferp_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void saferp_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -537,7 +546,7 @@ void saferp_done(symmetric_key *skey)
|
||||
int saferp_keysize(int *keysize)
|
||||
{
|
||||
LTC_ARGCHK(keysize != NULL);
|
||||
|
||||
|
||||
if (*keysize < 16)
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
if (*keysize < 24) {
|
||||
@@ -554,6 +563,6 @@ int saferp_keysize(int *keysize)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -28,7 +26,7 @@ const struct ltc_cipher_descriptor skipjack_desc =
|
||||
&skipjack_test,
|
||||
&skipjack_done,
|
||||
&skipjack_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
static const unsigned char sbox[256] = {
|
||||
@@ -75,7 +73,7 @@ int skipjack_setup(const unsigned char *key, int keylen, int num_rounds, symmetr
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
|
||||
if (num_rounds != 32 && num_rounds != 0) {
|
||||
if (num_rounds != 32 && num_rounds != 0) {
|
||||
return CRYPT_INVALID_ROUNDS;
|
||||
}
|
||||
|
||||
@@ -201,7 +199,7 @@ int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_k
|
||||
Decrypts a block of text with Skipjack
|
||||
@param ct The input ciphertext (8 bytes)
|
||||
@param pt The output plaintext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
@@ -223,7 +221,7 @@ int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_k
|
||||
w3 = ((unsigned)ct[4]<<8)|ct[5];
|
||||
w4 = ((unsigned)ct[6]<<8)|ct[7];
|
||||
|
||||
/* 8 rounds of RULE B^-1
|
||||
/* 8 rounds of RULE B^-1
|
||||
|
||||
Note the value "kp = 8" comes from "kp = (32 * 4) mod 10" where 32*4 is 128 which mod 10 is 8
|
||||
*/
|
||||
@@ -273,7 +271,7 @@ int skipjack_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
unsigned char key[10], pt[8], ct[8];
|
||||
} tests[] = {
|
||||
@@ -298,7 +296,8 @@ int skipjack_test(void)
|
||||
skipjack_ecb_decrypt(buf[0], buf[1], &key);
|
||||
|
||||
/* compare */
|
||||
if (XMEMCMP(buf[0], tests[x].ct, 8) != 0 || XMEMCMP(buf[1], tests[x].pt, 8) != 0) {
|
||||
if (compare_testvector(buf[0], 8, tests[x].ct, 8, "Skipjack Encrypt", x) != 0 ||
|
||||
compare_testvector(buf[1], 8, tests[x].pt, 8, "Skipjack Decrypt", x) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -313,11 +312,12 @@ int skipjack_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void skipjack_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -338,6 +338,6 @@ int skipjack_keysize(int *keysize)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -35,23 +33,13 @@ const struct ltc_cipher_descriptor twofish_desc =
|
||||
&twofish_test,
|
||||
&twofish_done,
|
||||
&twofish_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
/* the two polynomials */
|
||||
#define MDS_POLY 0x169
|
||||
#define RS_POLY 0x14D
|
||||
|
||||
/* The 4x4 MDS Linear Transform */
|
||||
#if 0
|
||||
static const unsigned char MDS[4][4] = {
|
||||
{ 0x01, 0xEF, 0x5B, 0x5B },
|
||||
{ 0x5B, 0xEF, 0xEF, 0x01 },
|
||||
{ 0xEF, 0x5B, 0x01, 0xEF },
|
||||
{ 0xEF, 0x01, 0xEF, 0x5B }
|
||||
};
|
||||
#endif
|
||||
|
||||
/* The 4x8 RS Linear Transform */
|
||||
static const unsigned char RS[4][8] = {
|
||||
{ 0x01, 0xA4, 0x55, 0x87, 0x5A, 0x58, 0xDB, 0x9E },
|
||||
@@ -60,6 +48,7 @@ static const unsigned char RS[4][8] = {
|
||||
{ 0XA4, 0X55, 0X87, 0X5A, 0X58, 0XDB, 0X9E, 0X03 }
|
||||
};
|
||||
|
||||
#ifdef LTC_TWOFISH_SMALL
|
||||
/* sbox usage orderings */
|
||||
static const unsigned char qord[4][5] = {
|
||||
{ 1, 1, 0, 0, 1 },
|
||||
@@ -67,9 +56,11 @@ static const unsigned char qord[4][5] = {
|
||||
{ 0, 0, 0, 1, 1 },
|
||||
{ 1, 0, 1, 1, 0 }
|
||||
};
|
||||
#endif /* LTC_TWOFISH_SMALL */
|
||||
|
||||
#ifdef LTC_TWOFISH_TABLES
|
||||
|
||||
#define __LTC_TWOFISH_TAB_C__
|
||||
#include "twofish_tab.c"
|
||||
|
||||
#define sbox(i, x) ((ulong32)SBOX[i][(x)&255])
|
||||
@@ -259,16 +250,19 @@ static void h_func(const unsigned char *in, unsigned char *out, unsigned char *M
|
||||
y[1] = (unsigned char)(sbox(0, (ulong32)y[1]) ^ M[4 * (6 + offset) + 1]);
|
||||
y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (6 + offset) + 2]);
|
||||
y[3] = (unsigned char)(sbox(1, (ulong32)y[3]) ^ M[4 * (6 + offset) + 3]);
|
||||
/* FALLTHROUGH */
|
||||
case 3:
|
||||
y[0] = (unsigned char)(sbox(1, (ulong32)y[0]) ^ M[4 * (4 + offset) + 0]);
|
||||
y[1] = (unsigned char)(sbox(1, (ulong32)y[1]) ^ M[4 * (4 + offset) + 1]);
|
||||
y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (4 + offset) + 2]);
|
||||
y[3] = (unsigned char)(sbox(0, (ulong32)y[3]) ^ M[4 * (4 + offset) + 3]);
|
||||
/* FALLTHROUGH */
|
||||
case 2:
|
||||
y[0] = (unsigned char)(sbox(1, sbox(0, sbox(0, (ulong32)y[0]) ^ M[4 * (2 + offset) + 0]) ^ M[4 * (0 + offset) + 0]));
|
||||
y[1] = (unsigned char)(sbox(0, sbox(0, sbox(1, (ulong32)y[1]) ^ M[4 * (2 + offset) + 1]) ^ M[4 * (0 + offset) + 1]));
|
||||
y[2] = (unsigned char)(sbox(1, sbox(1, sbox(0, (ulong32)y[2]) ^ M[4 * (2 + offset) + 2]) ^ M[4 * (0 + offset) + 2]));
|
||||
y[3] = (unsigned char)(sbox(0, sbox(1, sbox(1, (ulong32)y[3]) ^ M[4 * (2 + offset) + 3]) ^ M[4 * (0 + offset) + 3]));
|
||||
/* FALLTHROUGH */
|
||||
}
|
||||
mds_mult(y, out);
|
||||
}
|
||||
@@ -663,10 +657,8 @@ int twofish_test(void)
|
||||
}
|
||||
twofish_ecb_encrypt(tests[i].pt, tmp[0], &key);
|
||||
twofish_ecb_decrypt(tmp[0], tmp[1], &key);
|
||||
if (XMEMCMP(tmp[0], tests[i].ct, 16) != 0 || XMEMCMP(tmp[1], tests[i].pt, 16) != 0) {
|
||||
#if 0
|
||||
printf("Twofish failed test %d, %d, %d\n", i, XMEMCMP(tmp[0], tests[i].ct, 16), XMEMCMP(tmp[1], tests[i].pt, 16));
|
||||
#endif
|
||||
if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "Twofish Encrypt", i) != 0 ||
|
||||
compare_testvector(tmp[1], 16, tests[i].pt, 16, "Twofish Decrypt", i) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
@@ -684,7 +676,7 @@ int twofish_test(void)
|
||||
*/
|
||||
void twofish_done(symmetric_key *skey)
|
||||
{
|
||||
(void)skey;
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -714,6 +706,6 @@ int twofish_keysize(int *keysize)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -14,201 +12,202 @@
|
||||
Twofish tables, Tom St Denis
|
||||
*/
|
||||
#ifdef LTC_TWOFISH_TABLES
|
||||
#ifdef __LTC_TWOFISH_TAB_C__
|
||||
|
||||
/* pre generated 8x8 tables from the four 4x4s */
|
||||
static const unsigned char SBOX[2][256] = {
|
||||
{
|
||||
0xa9, 0x67, 0xb3, 0xe8, 0x04, 0xfd, 0xa3, 0x76, 0x9a, 0x92,
|
||||
0x80, 0x78, 0xe4, 0xdd, 0xd1, 0x38, 0x0d, 0xc6, 0x35, 0x98,
|
||||
0x18, 0xf7, 0xec, 0x6c, 0x43, 0x75, 0x37, 0x26, 0xfa, 0x13,
|
||||
0x94, 0x48, 0xf2, 0xd0, 0x8b, 0x30, 0x84, 0x54, 0xdf, 0x23,
|
||||
0x19, 0x5b, 0x3d, 0x59, 0xf3, 0xae, 0xa2, 0x82, 0x63, 0x01,
|
||||
0x83, 0x2e, 0xd9, 0x51, 0x9b, 0x7c, 0xa6, 0xeb, 0xa5, 0xbe,
|
||||
0x16, 0x0c, 0xe3, 0x61, 0xc0, 0x8c, 0x3a, 0xf5, 0x73, 0x2c,
|
||||
0x25, 0x0b, 0xbb, 0x4e, 0x89, 0x6b, 0x53, 0x6a, 0xb4, 0xf1,
|
||||
0xa9, 0x67, 0xb3, 0xe8, 0x04, 0xfd, 0xa3, 0x76, 0x9a, 0x92,
|
||||
0x80, 0x78, 0xe4, 0xdd, 0xd1, 0x38, 0x0d, 0xc6, 0x35, 0x98,
|
||||
0x18, 0xf7, 0xec, 0x6c, 0x43, 0x75, 0x37, 0x26, 0xfa, 0x13,
|
||||
0x94, 0x48, 0xf2, 0xd0, 0x8b, 0x30, 0x84, 0x54, 0xdf, 0x23,
|
||||
0x19, 0x5b, 0x3d, 0x59, 0xf3, 0xae, 0xa2, 0x82, 0x63, 0x01,
|
||||
0x83, 0x2e, 0xd9, 0x51, 0x9b, 0x7c, 0xa6, 0xeb, 0xa5, 0xbe,
|
||||
0x16, 0x0c, 0xe3, 0x61, 0xc0, 0x8c, 0x3a, 0xf5, 0x73, 0x2c,
|
||||
0x25, 0x0b, 0xbb, 0x4e, 0x89, 0x6b, 0x53, 0x6a, 0xb4, 0xf1,
|
||||
0xe1, 0xe6, 0xbd, 0x45, 0xe2, 0xf4, 0xb6, 0x66, 0xcc, 0x95,
|
||||
0x03, 0x56, 0xd4, 0x1c, 0x1e, 0xd7, 0xfb, 0xc3, 0x8e, 0xb5,
|
||||
0xe9, 0xcf, 0xbf, 0xba, 0xea, 0x77, 0x39, 0xaf, 0x33, 0xc9,
|
||||
0x62, 0x71, 0x81, 0x79, 0x09, 0xad, 0x24, 0xcd, 0xf9, 0xd8,
|
||||
0xe5, 0xc5, 0xb9, 0x4d, 0x44, 0x08, 0x86, 0xe7, 0xa1, 0x1d,
|
||||
0xaa, 0xed, 0x06, 0x70, 0xb2, 0xd2, 0x41, 0x7b, 0xa0, 0x11,
|
||||
0x03, 0x56, 0xd4, 0x1c, 0x1e, 0xd7, 0xfb, 0xc3, 0x8e, 0xb5,
|
||||
0xe9, 0xcf, 0xbf, 0xba, 0xea, 0x77, 0x39, 0xaf, 0x33, 0xc9,
|
||||
0x62, 0x71, 0x81, 0x79, 0x09, 0xad, 0x24, 0xcd, 0xf9, 0xd8,
|
||||
0xe5, 0xc5, 0xb9, 0x4d, 0x44, 0x08, 0x86, 0xe7, 0xa1, 0x1d,
|
||||
0xaa, 0xed, 0x06, 0x70, 0xb2, 0xd2, 0x41, 0x7b, 0xa0, 0x11,
|
||||
0x31, 0xc2, 0x27, 0x90, 0x20, 0xf6, 0x60, 0xff, 0x96, 0x5c,
|
||||
0xb1, 0xab, 0x9e, 0x9c, 0x52, 0x1b, 0x5f, 0x93, 0x0a, 0xef,
|
||||
0x91, 0x85, 0x49, 0xee, 0x2d, 0x4f, 0x8f, 0x3b, 0x47, 0x87,
|
||||
0x6d, 0x46, 0xd6, 0x3e, 0x69, 0x64, 0x2a, 0xce, 0xcb, 0x2f,
|
||||
0xfc, 0x97, 0x05, 0x7a, 0xac, 0x7f, 0xd5, 0x1a, 0x4b, 0x0e,
|
||||
0xa7, 0x5a, 0x28, 0x14, 0x3f, 0x29, 0x88, 0x3c, 0x4c, 0x02,
|
||||
0xb8, 0xda, 0xb0, 0x17, 0x55, 0x1f, 0x8a, 0x7d, 0x57, 0xc7,
|
||||
0x8d, 0x74, 0xb7, 0xc4, 0x9f, 0x72, 0x7e, 0x15, 0x22, 0x12,
|
||||
0x58, 0x07, 0x99, 0x34, 0x6e, 0x50, 0xde, 0x68, 0x65, 0xbc,
|
||||
0xdb, 0xf8, 0xc8, 0xa8, 0x2b, 0x40, 0xdc, 0xfe, 0x32, 0xa4,
|
||||
0xca, 0x10, 0x21, 0xf0, 0xd3, 0x5d, 0x0f, 0x00, 0x6f, 0x9d,
|
||||
0xb1, 0xab, 0x9e, 0x9c, 0x52, 0x1b, 0x5f, 0x93, 0x0a, 0xef,
|
||||
0x91, 0x85, 0x49, 0xee, 0x2d, 0x4f, 0x8f, 0x3b, 0x47, 0x87,
|
||||
0x6d, 0x46, 0xd6, 0x3e, 0x69, 0x64, 0x2a, 0xce, 0xcb, 0x2f,
|
||||
0xfc, 0x97, 0x05, 0x7a, 0xac, 0x7f, 0xd5, 0x1a, 0x4b, 0x0e,
|
||||
0xa7, 0x5a, 0x28, 0x14, 0x3f, 0x29, 0x88, 0x3c, 0x4c, 0x02,
|
||||
0xb8, 0xda, 0xb0, 0x17, 0x55, 0x1f, 0x8a, 0x7d, 0x57, 0xc7,
|
||||
0x8d, 0x74, 0xb7, 0xc4, 0x9f, 0x72, 0x7e, 0x15, 0x22, 0x12,
|
||||
0x58, 0x07, 0x99, 0x34, 0x6e, 0x50, 0xde, 0x68, 0x65, 0xbc,
|
||||
0xdb, 0xf8, 0xc8, 0xa8, 0x2b, 0x40, 0xdc, 0xfe, 0x32, 0xa4,
|
||||
0xca, 0x10, 0x21, 0xf0, 0xd3, 0x5d, 0x0f, 0x00, 0x6f, 0x9d,
|
||||
0x36, 0x42, 0x4a, 0x5e, 0xc1, 0xe0},
|
||||
{
|
||||
0x75, 0xf3, 0xc6, 0xf4, 0xdb, 0x7b, 0xfb, 0xc8, 0x4a, 0xd3,
|
||||
0x75, 0xf3, 0xc6, 0xf4, 0xdb, 0x7b, 0xfb, 0xc8, 0x4a, 0xd3,
|
||||
0xe6, 0x6b, 0x45, 0x7d, 0xe8, 0x4b, 0xd6, 0x32, 0xd8, 0xfd,
|
||||
0x37, 0x71, 0xf1, 0xe1, 0x30, 0x0f, 0xf8, 0x1b, 0x87, 0xfa,
|
||||
0x06, 0x3f, 0x5e, 0xba, 0xae, 0x5b, 0x8a, 0x00, 0xbc, 0x9d,
|
||||
0x6d, 0xc1, 0xb1, 0x0e, 0x80, 0x5d, 0xd2, 0xd5, 0xa0, 0x84,
|
||||
0x07, 0x14, 0xb5, 0x90, 0x2c, 0xa3, 0xb2, 0x73, 0x4c, 0x54,
|
||||
0x92, 0x74, 0x36, 0x51, 0x38, 0xb0, 0xbd, 0x5a, 0xfc, 0x60,
|
||||
0x62, 0x96, 0x6c, 0x42, 0xf7, 0x10, 0x7c, 0x28, 0x27, 0x8c,
|
||||
0x13, 0x95, 0x9c, 0xc7, 0x24, 0x46, 0x3b, 0x70, 0xca, 0xe3,
|
||||
0x6d, 0xc1, 0xb1, 0x0e, 0x80, 0x5d, 0xd2, 0xd5, 0xa0, 0x84,
|
||||
0x07, 0x14, 0xb5, 0x90, 0x2c, 0xa3, 0xb2, 0x73, 0x4c, 0x54,
|
||||
0x92, 0x74, 0x36, 0x51, 0x38, 0xb0, 0xbd, 0x5a, 0xfc, 0x60,
|
||||
0x62, 0x96, 0x6c, 0x42, 0xf7, 0x10, 0x7c, 0x28, 0x27, 0x8c,
|
||||
0x13, 0x95, 0x9c, 0xc7, 0x24, 0x46, 0x3b, 0x70, 0xca, 0xe3,
|
||||
0x85, 0xcb, 0x11, 0xd0, 0x93, 0xb8, 0xa6, 0x83, 0x20, 0xff,
|
||||
0x9f, 0x77, 0xc3, 0xcc, 0x03, 0x6f, 0x08, 0xbf, 0x40, 0xe7,
|
||||
0x2b, 0xe2, 0x79, 0x0c, 0xaa, 0x82, 0x41, 0x3a, 0xea, 0xb9,
|
||||
0xe4, 0x9a, 0xa4, 0x97, 0x7e, 0xda, 0x7a, 0x17, 0x66, 0x94,
|
||||
0xa1, 0x1d, 0x3d, 0xf0, 0xde, 0xb3, 0x0b, 0x72, 0xa7, 0x1c,
|
||||
0xef, 0xd1, 0x53, 0x3e, 0x8f, 0x33, 0x26, 0x5f, 0xec, 0x76,
|
||||
0x2a, 0x49, 0x81, 0x88, 0xee, 0x21, 0xc4, 0x1a, 0xeb, 0xd9,
|
||||
0xc5, 0x39, 0x99, 0xcd, 0xad, 0x31, 0x8b, 0x01, 0x18, 0x23,
|
||||
0xdd, 0x1f, 0x4e, 0x2d, 0xf9, 0x48, 0x4f, 0xf2, 0x65, 0x8e,
|
||||
0x78, 0x5c, 0x58, 0x19, 0x8d, 0xe5, 0x98, 0x57, 0x67, 0x7f,
|
||||
0x05, 0x64, 0xaf, 0x63, 0xb6, 0xfe, 0xf5, 0xb7, 0x3c, 0xa5,
|
||||
0xce, 0xe9, 0x68, 0x44, 0xe0, 0x4d, 0x43, 0x69, 0x29, 0x2e,
|
||||
0xac, 0x15, 0x59, 0xa8, 0x0a, 0x9e, 0x6e, 0x47, 0xdf, 0x34,
|
||||
0x35, 0x6a, 0xcf, 0xdc, 0x22, 0xc9, 0xc0, 0x9b, 0x89, 0xd4,
|
||||
0xed, 0xab, 0x12, 0xa2, 0x0d, 0x52, 0xbb, 0x02, 0x2f, 0xa9,
|
||||
0xd7, 0x61, 0x1e, 0xb4, 0x50, 0x04, 0xf6, 0xc2, 0x16, 0x25,
|
||||
0x9f, 0x77, 0xc3, 0xcc, 0x03, 0x6f, 0x08, 0xbf, 0x40, 0xe7,
|
||||
0x2b, 0xe2, 0x79, 0x0c, 0xaa, 0x82, 0x41, 0x3a, 0xea, 0xb9,
|
||||
0xe4, 0x9a, 0xa4, 0x97, 0x7e, 0xda, 0x7a, 0x17, 0x66, 0x94,
|
||||
0xa1, 0x1d, 0x3d, 0xf0, 0xde, 0xb3, 0x0b, 0x72, 0xa7, 0x1c,
|
||||
0xef, 0xd1, 0x53, 0x3e, 0x8f, 0x33, 0x26, 0x5f, 0xec, 0x76,
|
||||
0x2a, 0x49, 0x81, 0x88, 0xee, 0x21, 0xc4, 0x1a, 0xeb, 0xd9,
|
||||
0xc5, 0x39, 0x99, 0xcd, 0xad, 0x31, 0x8b, 0x01, 0x18, 0x23,
|
||||
0xdd, 0x1f, 0x4e, 0x2d, 0xf9, 0x48, 0x4f, 0xf2, 0x65, 0x8e,
|
||||
0x78, 0x5c, 0x58, 0x19, 0x8d, 0xe5, 0x98, 0x57, 0x67, 0x7f,
|
||||
0x05, 0x64, 0xaf, 0x63, 0xb6, 0xfe, 0xf5, 0xb7, 0x3c, 0xa5,
|
||||
0xce, 0xe9, 0x68, 0x44, 0xe0, 0x4d, 0x43, 0x69, 0x29, 0x2e,
|
||||
0xac, 0x15, 0x59, 0xa8, 0x0a, 0x9e, 0x6e, 0x47, 0xdf, 0x34,
|
||||
0x35, 0x6a, 0xcf, 0xdc, 0x22, 0xc9, 0xc0, 0x9b, 0x89, 0xd4,
|
||||
0xed, 0xab, 0x12, 0xa2, 0x0d, 0x52, 0xbb, 0x02, 0x2f, 0xa9,
|
||||
0xd7, 0x61, 0x1e, 0xb4, 0x50, 0x04, 0xf6, 0xc2, 0x16, 0x25,
|
||||
0x86, 0x56, 0x55, 0x09, 0xbe, 0x91}
|
||||
};
|
||||
|
||||
/* the 4x4 MDS in a nicer format */
|
||||
static const ulong32 mds_tab[4][256] = {
|
||||
{
|
||||
0x00000000UL, 0xefef5b01UL, 0xb7b7b602UL, 0x5858ed03UL, 0x07070504UL, 0xe8e85e05UL, 0xb0b0b306UL, 0x5f5fe807UL,
|
||||
0x0e0e0a08UL, 0xe1e15109UL, 0xb9b9bc0aUL, 0x5656e70bUL, 0x09090f0cUL, 0xe6e6540dUL, 0xbebeb90eUL, 0x5151e20fUL,
|
||||
0x1c1c1410UL, 0xf3f34f11UL, 0xababa212UL, 0x4444f913UL, 0x1b1b1114UL, 0xf4f44a15UL, 0xacaca716UL, 0x4343fc17UL,
|
||||
0x12121e18UL, 0xfdfd4519UL, 0xa5a5a81aUL, 0x4a4af31bUL, 0x15151b1cUL, 0xfafa401dUL, 0xa2a2ad1eUL, 0x4d4df61fUL,
|
||||
0x38382820UL, 0xd7d77321UL, 0x8f8f9e22UL, 0x6060c523UL, 0x3f3f2d24UL, 0xd0d07625UL, 0x88889b26UL, 0x6767c027UL,
|
||||
0x36362228UL, 0xd9d97929UL, 0x8181942aUL, 0x6e6ecf2bUL, 0x3131272cUL, 0xdede7c2dUL, 0x8686912eUL, 0x6969ca2fUL,
|
||||
0x24243c30UL, 0xcbcb6731UL, 0x93938a32UL, 0x7c7cd133UL, 0x23233934UL, 0xcccc6235UL, 0x94948f36UL, 0x7b7bd437UL,
|
||||
0x2a2a3638UL, 0xc5c56d39UL, 0x9d9d803aUL, 0x7272db3bUL, 0x2d2d333cUL, 0xc2c2683dUL, 0x9a9a853eUL, 0x7575de3fUL,
|
||||
0x00000000UL, 0xefef5b01UL, 0xb7b7b602UL, 0x5858ed03UL, 0x07070504UL, 0xe8e85e05UL, 0xb0b0b306UL, 0x5f5fe807UL,
|
||||
0x0e0e0a08UL, 0xe1e15109UL, 0xb9b9bc0aUL, 0x5656e70bUL, 0x09090f0cUL, 0xe6e6540dUL, 0xbebeb90eUL, 0x5151e20fUL,
|
||||
0x1c1c1410UL, 0xf3f34f11UL, 0xababa212UL, 0x4444f913UL, 0x1b1b1114UL, 0xf4f44a15UL, 0xacaca716UL, 0x4343fc17UL,
|
||||
0x12121e18UL, 0xfdfd4519UL, 0xa5a5a81aUL, 0x4a4af31bUL, 0x15151b1cUL, 0xfafa401dUL, 0xa2a2ad1eUL, 0x4d4df61fUL,
|
||||
0x38382820UL, 0xd7d77321UL, 0x8f8f9e22UL, 0x6060c523UL, 0x3f3f2d24UL, 0xd0d07625UL, 0x88889b26UL, 0x6767c027UL,
|
||||
0x36362228UL, 0xd9d97929UL, 0x8181942aUL, 0x6e6ecf2bUL, 0x3131272cUL, 0xdede7c2dUL, 0x8686912eUL, 0x6969ca2fUL,
|
||||
0x24243c30UL, 0xcbcb6731UL, 0x93938a32UL, 0x7c7cd133UL, 0x23233934UL, 0xcccc6235UL, 0x94948f36UL, 0x7b7bd437UL,
|
||||
0x2a2a3638UL, 0xc5c56d39UL, 0x9d9d803aUL, 0x7272db3bUL, 0x2d2d333cUL, 0xc2c2683dUL, 0x9a9a853eUL, 0x7575de3fUL,
|
||||
0x70705040UL, 0x9f9f0b41UL, 0xc7c7e642UL, 0x2828bd43UL, 0x77775544UL, 0x98980e45UL, 0xc0c0e346UL, 0x2f2fb847UL,
|
||||
0x7e7e5a48UL, 0x91910149UL, 0xc9c9ec4aUL, 0x2626b74bUL, 0x79795f4cUL, 0x9696044dUL, 0xcecee94eUL, 0x2121b24fUL,
|
||||
0x6c6c4450UL, 0x83831f51UL, 0xdbdbf252UL, 0x3434a953UL, 0x6b6b4154UL, 0x84841a55UL, 0xdcdcf756UL, 0x3333ac57UL,
|
||||
0x62624e58UL, 0x8d8d1559UL, 0xd5d5f85aUL, 0x3a3aa35bUL, 0x65654b5cUL, 0x8a8a105dUL, 0xd2d2fd5eUL, 0x3d3da65fUL,
|
||||
0x48487860UL, 0xa7a72361UL, 0xffffce62UL, 0x10109563UL, 0x4f4f7d64UL, 0xa0a02665UL, 0xf8f8cb66UL, 0x17179067UL,
|
||||
0x7e7e5a48UL, 0x91910149UL, 0xc9c9ec4aUL, 0x2626b74bUL, 0x79795f4cUL, 0x9696044dUL, 0xcecee94eUL, 0x2121b24fUL,
|
||||
0x6c6c4450UL, 0x83831f51UL, 0xdbdbf252UL, 0x3434a953UL, 0x6b6b4154UL, 0x84841a55UL, 0xdcdcf756UL, 0x3333ac57UL,
|
||||
0x62624e58UL, 0x8d8d1559UL, 0xd5d5f85aUL, 0x3a3aa35bUL, 0x65654b5cUL, 0x8a8a105dUL, 0xd2d2fd5eUL, 0x3d3da65fUL,
|
||||
0x48487860UL, 0xa7a72361UL, 0xffffce62UL, 0x10109563UL, 0x4f4f7d64UL, 0xa0a02665UL, 0xf8f8cb66UL, 0x17179067UL,
|
||||
0x46467268UL, 0xa9a92969UL, 0xf1f1c46aUL, 0x1e1e9f6bUL, 0x4141776cUL, 0xaeae2c6dUL, 0xf6f6c16eUL, 0x19199a6fUL,
|
||||
0x54546c70UL, 0xbbbb3771UL, 0xe3e3da72UL, 0x0c0c8173UL, 0x53536974UL, 0xbcbc3275UL, 0xe4e4df76UL, 0x0b0b8477UL,
|
||||
0x5a5a6678UL, 0xb5b53d79UL, 0xededd07aUL, 0x02028b7bUL, 0x5d5d637cUL, 0xb2b2387dUL, 0xeaead57eUL, 0x05058e7fUL,
|
||||
0xe0e0a080UL, 0x0f0ffb81UL, 0x57571682UL, 0xb8b84d83UL, 0xe7e7a584UL, 0x0808fe85UL, 0x50501386UL, 0xbfbf4887UL,
|
||||
0xeeeeaa88UL, 0x0101f189UL, 0x59591c8aUL, 0xb6b6478bUL, 0xe9e9af8cUL, 0x0606f48dUL, 0x5e5e198eUL, 0xb1b1428fUL,
|
||||
0xfcfcb490UL, 0x1313ef91UL, 0x4b4b0292UL, 0xa4a45993UL, 0xfbfbb194UL, 0x1414ea95UL, 0x4c4c0796UL, 0xa3a35c97UL,
|
||||
0xf2f2be98UL, 0x1d1de599UL, 0x4545089aUL, 0xaaaa539bUL, 0xf5f5bb9cUL, 0x1a1ae09dUL, 0x42420d9eUL, 0xadad569fUL,
|
||||
0xd8d888a0UL, 0x3737d3a1UL, 0x6f6f3ea2UL, 0x808065a3UL, 0xdfdf8da4UL, 0x3030d6a5UL, 0x68683ba6UL, 0x878760a7UL,
|
||||
0xd6d682a8UL, 0x3939d9a9UL, 0x616134aaUL, 0x8e8e6fabUL, 0xd1d187acUL, 0x3e3edcadUL, 0x666631aeUL, 0x89896aafUL,
|
||||
0xc4c49cb0UL, 0x2b2bc7b1UL, 0x73732ab2UL, 0x9c9c71b3UL, 0xc3c399b4UL, 0x2c2cc2b5UL, 0x74742fb6UL, 0x9b9b74b7UL,
|
||||
0xcaca96b8UL, 0x2525cdb9UL, 0x7d7d20baUL, 0x92927bbbUL, 0xcdcd93bcUL, 0x2222c8bdUL, 0x7a7a25beUL, 0x95957ebfUL,
|
||||
0x9090f0c0UL, 0x7f7fabc1UL, 0x272746c2UL, 0xc8c81dc3UL, 0x9797f5c4UL, 0x7878aec5UL, 0x202043c6UL, 0xcfcf18c7UL,
|
||||
0x9e9efac8UL, 0x7171a1c9UL, 0x29294ccaUL, 0xc6c617cbUL, 0x9999ffccUL, 0x7676a4cdUL, 0x2e2e49ceUL, 0xc1c112cfUL,
|
||||
0x8c8ce4d0UL, 0x6363bfd1UL, 0x3b3b52d2UL, 0xd4d409d3UL, 0x8b8be1d4UL, 0x6464bad5UL, 0x3c3c57d6UL, 0xd3d30cd7UL,
|
||||
0x8282eed8UL, 0x6d6db5d9UL, 0x353558daUL, 0xdada03dbUL, 0x8585ebdcUL, 0x6a6ab0ddUL, 0x32325ddeUL, 0xdddd06dfUL,
|
||||
0x54546c70UL, 0xbbbb3771UL, 0xe3e3da72UL, 0x0c0c8173UL, 0x53536974UL, 0xbcbc3275UL, 0xe4e4df76UL, 0x0b0b8477UL,
|
||||
0x5a5a6678UL, 0xb5b53d79UL, 0xededd07aUL, 0x02028b7bUL, 0x5d5d637cUL, 0xb2b2387dUL, 0xeaead57eUL, 0x05058e7fUL,
|
||||
0xe0e0a080UL, 0x0f0ffb81UL, 0x57571682UL, 0xb8b84d83UL, 0xe7e7a584UL, 0x0808fe85UL, 0x50501386UL, 0xbfbf4887UL,
|
||||
0xeeeeaa88UL, 0x0101f189UL, 0x59591c8aUL, 0xb6b6478bUL, 0xe9e9af8cUL, 0x0606f48dUL, 0x5e5e198eUL, 0xb1b1428fUL,
|
||||
0xfcfcb490UL, 0x1313ef91UL, 0x4b4b0292UL, 0xa4a45993UL, 0xfbfbb194UL, 0x1414ea95UL, 0x4c4c0796UL, 0xa3a35c97UL,
|
||||
0xf2f2be98UL, 0x1d1de599UL, 0x4545089aUL, 0xaaaa539bUL, 0xf5f5bb9cUL, 0x1a1ae09dUL, 0x42420d9eUL, 0xadad569fUL,
|
||||
0xd8d888a0UL, 0x3737d3a1UL, 0x6f6f3ea2UL, 0x808065a3UL, 0xdfdf8da4UL, 0x3030d6a5UL, 0x68683ba6UL, 0x878760a7UL,
|
||||
0xd6d682a8UL, 0x3939d9a9UL, 0x616134aaUL, 0x8e8e6fabUL, 0xd1d187acUL, 0x3e3edcadUL, 0x666631aeUL, 0x89896aafUL,
|
||||
0xc4c49cb0UL, 0x2b2bc7b1UL, 0x73732ab2UL, 0x9c9c71b3UL, 0xc3c399b4UL, 0x2c2cc2b5UL, 0x74742fb6UL, 0x9b9b74b7UL,
|
||||
0xcaca96b8UL, 0x2525cdb9UL, 0x7d7d20baUL, 0x92927bbbUL, 0xcdcd93bcUL, 0x2222c8bdUL, 0x7a7a25beUL, 0x95957ebfUL,
|
||||
0x9090f0c0UL, 0x7f7fabc1UL, 0x272746c2UL, 0xc8c81dc3UL, 0x9797f5c4UL, 0x7878aec5UL, 0x202043c6UL, 0xcfcf18c7UL,
|
||||
0x9e9efac8UL, 0x7171a1c9UL, 0x29294ccaUL, 0xc6c617cbUL, 0x9999ffccUL, 0x7676a4cdUL, 0x2e2e49ceUL, 0xc1c112cfUL,
|
||||
0x8c8ce4d0UL, 0x6363bfd1UL, 0x3b3b52d2UL, 0xd4d409d3UL, 0x8b8be1d4UL, 0x6464bad5UL, 0x3c3c57d6UL, 0xd3d30cd7UL,
|
||||
0x8282eed8UL, 0x6d6db5d9UL, 0x353558daUL, 0xdada03dbUL, 0x8585ebdcUL, 0x6a6ab0ddUL, 0x32325ddeUL, 0xdddd06dfUL,
|
||||
0xa8a8d8e0UL, 0x474783e1UL, 0x1f1f6ee2UL, 0xf0f035e3UL, 0xafafdde4UL, 0x404086e5UL, 0x18186be6UL, 0xf7f730e7UL,
|
||||
0xa6a6d2e8UL, 0x494989e9UL, 0x111164eaUL, 0xfefe3febUL, 0xa1a1d7ecUL, 0x4e4e8cedUL, 0x161661eeUL, 0xf9f93aefUL,
|
||||
0xb4b4ccf0UL, 0x5b5b97f1UL, 0x03037af2UL, 0xecec21f3UL, 0xb3b3c9f4UL, 0x5c5c92f5UL, 0x04047ff6UL, 0xebeb24f7UL,
|
||||
0xb4b4ccf0UL, 0x5b5b97f1UL, 0x03037af2UL, 0xecec21f3UL, 0xb3b3c9f4UL, 0x5c5c92f5UL, 0x04047ff6UL, 0xebeb24f7UL,
|
||||
0xbabac6f8UL, 0x55559df9UL, 0x0d0d70faUL, 0xe2e22bfbUL, 0xbdbdc3fcUL, 0x525298fdUL, 0x0a0a75feUL, 0xe5e52effUL
|
||||
},
|
||||
},
|
||||
{
|
||||
0x00000000UL, 0x015befefUL, 0x02b6b7b7UL, 0x03ed5858UL, 0x04050707UL, 0x055ee8e8UL, 0x06b3b0b0UL, 0x07e85f5fUL,
|
||||
0x080a0e0eUL, 0x0951e1e1UL, 0x0abcb9b9UL, 0x0be75656UL, 0x0c0f0909UL, 0x0d54e6e6UL, 0x0eb9bebeUL, 0x0fe25151UL,
|
||||
0x10141c1cUL, 0x114ff3f3UL, 0x12a2ababUL, 0x13f94444UL, 0x14111b1bUL, 0x154af4f4UL, 0x16a7acacUL, 0x17fc4343UL,
|
||||
0x181e1212UL, 0x1945fdfdUL, 0x1aa8a5a5UL, 0x1bf34a4aUL, 0x1c1b1515UL, 0x1d40fafaUL, 0x1eada2a2UL, 0x1ff64d4dUL,
|
||||
0x20283838UL, 0x2173d7d7UL, 0x229e8f8fUL, 0x23c56060UL, 0x242d3f3fUL, 0x2576d0d0UL, 0x269b8888UL, 0x27c06767UL,
|
||||
0x28223636UL, 0x2979d9d9UL, 0x2a948181UL, 0x2bcf6e6eUL, 0x2c273131UL, 0x2d7cdedeUL, 0x2e918686UL, 0x2fca6969UL,
|
||||
0x303c2424UL, 0x3167cbcbUL, 0x328a9393UL, 0x33d17c7cUL, 0x34392323UL, 0x3562ccccUL, 0x368f9494UL, 0x37d47b7bUL,
|
||||
0x38362a2aUL, 0x396dc5c5UL, 0x3a809d9dUL, 0x3bdb7272UL, 0x3c332d2dUL, 0x3d68c2c2UL, 0x3e859a9aUL, 0x3fde7575UL,
|
||||
0x40507070UL, 0x410b9f9fUL, 0x42e6c7c7UL, 0x43bd2828UL, 0x44557777UL, 0x450e9898UL, 0x46e3c0c0UL, 0x47b82f2fUL,
|
||||
0x485a7e7eUL, 0x49019191UL, 0x4aecc9c9UL, 0x4bb72626UL, 0x4c5f7979UL, 0x4d049696UL, 0x4ee9ceceUL, 0x4fb22121UL,
|
||||
0x50446c6cUL, 0x511f8383UL, 0x52f2dbdbUL, 0x53a93434UL, 0x54416b6bUL, 0x551a8484UL, 0x56f7dcdcUL, 0x57ac3333UL,
|
||||
0x00000000UL, 0x015befefUL, 0x02b6b7b7UL, 0x03ed5858UL, 0x04050707UL, 0x055ee8e8UL, 0x06b3b0b0UL, 0x07e85f5fUL,
|
||||
0x080a0e0eUL, 0x0951e1e1UL, 0x0abcb9b9UL, 0x0be75656UL, 0x0c0f0909UL, 0x0d54e6e6UL, 0x0eb9bebeUL, 0x0fe25151UL,
|
||||
0x10141c1cUL, 0x114ff3f3UL, 0x12a2ababUL, 0x13f94444UL, 0x14111b1bUL, 0x154af4f4UL, 0x16a7acacUL, 0x17fc4343UL,
|
||||
0x181e1212UL, 0x1945fdfdUL, 0x1aa8a5a5UL, 0x1bf34a4aUL, 0x1c1b1515UL, 0x1d40fafaUL, 0x1eada2a2UL, 0x1ff64d4dUL,
|
||||
0x20283838UL, 0x2173d7d7UL, 0x229e8f8fUL, 0x23c56060UL, 0x242d3f3fUL, 0x2576d0d0UL, 0x269b8888UL, 0x27c06767UL,
|
||||
0x28223636UL, 0x2979d9d9UL, 0x2a948181UL, 0x2bcf6e6eUL, 0x2c273131UL, 0x2d7cdedeUL, 0x2e918686UL, 0x2fca6969UL,
|
||||
0x303c2424UL, 0x3167cbcbUL, 0x328a9393UL, 0x33d17c7cUL, 0x34392323UL, 0x3562ccccUL, 0x368f9494UL, 0x37d47b7bUL,
|
||||
0x38362a2aUL, 0x396dc5c5UL, 0x3a809d9dUL, 0x3bdb7272UL, 0x3c332d2dUL, 0x3d68c2c2UL, 0x3e859a9aUL, 0x3fde7575UL,
|
||||
0x40507070UL, 0x410b9f9fUL, 0x42e6c7c7UL, 0x43bd2828UL, 0x44557777UL, 0x450e9898UL, 0x46e3c0c0UL, 0x47b82f2fUL,
|
||||
0x485a7e7eUL, 0x49019191UL, 0x4aecc9c9UL, 0x4bb72626UL, 0x4c5f7979UL, 0x4d049696UL, 0x4ee9ceceUL, 0x4fb22121UL,
|
||||
0x50446c6cUL, 0x511f8383UL, 0x52f2dbdbUL, 0x53a93434UL, 0x54416b6bUL, 0x551a8484UL, 0x56f7dcdcUL, 0x57ac3333UL,
|
||||
0x584e6262UL, 0x59158d8dUL, 0x5af8d5d5UL, 0x5ba33a3aUL, 0x5c4b6565UL, 0x5d108a8aUL, 0x5efdd2d2UL, 0x5fa63d3dUL,
|
||||
0x60784848UL, 0x6123a7a7UL, 0x62ceffffUL, 0x63951010UL, 0x647d4f4fUL, 0x6526a0a0UL, 0x66cbf8f8UL, 0x67901717UL,
|
||||
0x68724646UL, 0x6929a9a9UL, 0x6ac4f1f1UL, 0x6b9f1e1eUL, 0x6c774141UL, 0x6d2caeaeUL, 0x6ec1f6f6UL, 0x6f9a1919UL,
|
||||
0x706c5454UL, 0x7137bbbbUL, 0x72dae3e3UL, 0x73810c0cUL, 0x74695353UL, 0x7532bcbcUL, 0x76dfe4e4UL, 0x77840b0bUL,
|
||||
0x78665a5aUL, 0x793db5b5UL, 0x7ad0ededUL, 0x7b8b0202UL, 0x7c635d5dUL, 0x7d38b2b2UL, 0x7ed5eaeaUL, 0x7f8e0505UL,
|
||||
0x80a0e0e0UL, 0x81fb0f0fUL, 0x82165757UL, 0x834db8b8UL, 0x84a5e7e7UL, 0x85fe0808UL, 0x86135050UL, 0x8748bfbfUL,
|
||||
0x88aaeeeeUL, 0x89f10101UL, 0x8a1c5959UL, 0x8b47b6b6UL, 0x8cafe9e9UL, 0x8df40606UL, 0x8e195e5eUL, 0x8f42b1b1UL,
|
||||
0x90b4fcfcUL, 0x91ef1313UL, 0x92024b4bUL, 0x9359a4a4UL, 0x94b1fbfbUL, 0x95ea1414UL, 0x96074c4cUL, 0x975ca3a3UL,
|
||||
0x60784848UL, 0x6123a7a7UL, 0x62ceffffUL, 0x63951010UL, 0x647d4f4fUL, 0x6526a0a0UL, 0x66cbf8f8UL, 0x67901717UL,
|
||||
0x68724646UL, 0x6929a9a9UL, 0x6ac4f1f1UL, 0x6b9f1e1eUL, 0x6c774141UL, 0x6d2caeaeUL, 0x6ec1f6f6UL, 0x6f9a1919UL,
|
||||
0x706c5454UL, 0x7137bbbbUL, 0x72dae3e3UL, 0x73810c0cUL, 0x74695353UL, 0x7532bcbcUL, 0x76dfe4e4UL, 0x77840b0bUL,
|
||||
0x78665a5aUL, 0x793db5b5UL, 0x7ad0ededUL, 0x7b8b0202UL, 0x7c635d5dUL, 0x7d38b2b2UL, 0x7ed5eaeaUL, 0x7f8e0505UL,
|
||||
0x80a0e0e0UL, 0x81fb0f0fUL, 0x82165757UL, 0x834db8b8UL, 0x84a5e7e7UL, 0x85fe0808UL, 0x86135050UL, 0x8748bfbfUL,
|
||||
0x88aaeeeeUL, 0x89f10101UL, 0x8a1c5959UL, 0x8b47b6b6UL, 0x8cafe9e9UL, 0x8df40606UL, 0x8e195e5eUL, 0x8f42b1b1UL,
|
||||
0x90b4fcfcUL, 0x91ef1313UL, 0x92024b4bUL, 0x9359a4a4UL, 0x94b1fbfbUL, 0x95ea1414UL, 0x96074c4cUL, 0x975ca3a3UL,
|
||||
0x98bef2f2UL, 0x99e51d1dUL, 0x9a084545UL, 0x9b53aaaaUL, 0x9cbbf5f5UL, 0x9de01a1aUL, 0x9e0d4242UL, 0x9f56adadUL,
|
||||
0xa088d8d8UL, 0xa1d33737UL, 0xa23e6f6fUL, 0xa3658080UL, 0xa48ddfdfUL, 0xa5d63030UL, 0xa63b6868UL, 0xa7608787UL,
|
||||
0xa882d6d6UL, 0xa9d93939UL, 0xaa346161UL, 0xab6f8e8eUL, 0xac87d1d1UL, 0xaddc3e3eUL, 0xae316666UL, 0xaf6a8989UL,
|
||||
0xb09cc4c4UL, 0xb1c72b2bUL, 0xb22a7373UL, 0xb3719c9cUL, 0xb499c3c3UL, 0xb5c22c2cUL, 0xb62f7474UL, 0xb7749b9bUL,
|
||||
0xb896cacaUL, 0xb9cd2525UL, 0xba207d7dUL, 0xbb7b9292UL, 0xbc93cdcdUL, 0xbdc82222UL, 0xbe257a7aUL, 0xbf7e9595UL,
|
||||
0xc0f09090UL, 0xc1ab7f7fUL, 0xc2462727UL, 0xc31dc8c8UL, 0xc4f59797UL, 0xc5ae7878UL, 0xc6432020UL, 0xc718cfcfUL,
|
||||
0xc8fa9e9eUL, 0xc9a17171UL, 0xca4c2929UL, 0xcb17c6c6UL, 0xccff9999UL, 0xcda47676UL, 0xce492e2eUL, 0xcf12c1c1UL,
|
||||
0xd0e48c8cUL, 0xd1bf6363UL, 0xd2523b3bUL, 0xd309d4d4UL, 0xd4e18b8bUL, 0xd5ba6464UL, 0xd6573c3cUL, 0xd70cd3d3UL,
|
||||
0xd8ee8282UL, 0xd9b56d6dUL, 0xda583535UL, 0xdb03dadaUL, 0xdceb8585UL, 0xddb06a6aUL, 0xde5d3232UL, 0xdf06ddddUL,
|
||||
0xe0d8a8a8UL, 0xe1834747UL, 0xe26e1f1fUL, 0xe335f0f0UL, 0xe4ddafafUL, 0xe5864040UL, 0xe66b1818UL, 0xe730f7f7UL,
|
||||
0xe8d2a6a6UL, 0xe9894949UL, 0xea641111UL, 0xeb3ffefeUL, 0xecd7a1a1UL, 0xed8c4e4eUL, 0xee611616UL, 0xef3af9f9UL,
|
||||
0xf0ccb4b4UL, 0xf1975b5bUL, 0xf27a0303UL, 0xf321ececUL, 0xf4c9b3b3UL, 0xf5925c5cUL, 0xf67f0404UL, 0xf724ebebUL,
|
||||
0xa088d8d8UL, 0xa1d33737UL, 0xa23e6f6fUL, 0xa3658080UL, 0xa48ddfdfUL, 0xa5d63030UL, 0xa63b6868UL, 0xa7608787UL,
|
||||
0xa882d6d6UL, 0xa9d93939UL, 0xaa346161UL, 0xab6f8e8eUL, 0xac87d1d1UL, 0xaddc3e3eUL, 0xae316666UL, 0xaf6a8989UL,
|
||||
0xb09cc4c4UL, 0xb1c72b2bUL, 0xb22a7373UL, 0xb3719c9cUL, 0xb499c3c3UL, 0xb5c22c2cUL, 0xb62f7474UL, 0xb7749b9bUL,
|
||||
0xb896cacaUL, 0xb9cd2525UL, 0xba207d7dUL, 0xbb7b9292UL, 0xbc93cdcdUL, 0xbdc82222UL, 0xbe257a7aUL, 0xbf7e9595UL,
|
||||
0xc0f09090UL, 0xc1ab7f7fUL, 0xc2462727UL, 0xc31dc8c8UL, 0xc4f59797UL, 0xc5ae7878UL, 0xc6432020UL, 0xc718cfcfUL,
|
||||
0xc8fa9e9eUL, 0xc9a17171UL, 0xca4c2929UL, 0xcb17c6c6UL, 0xccff9999UL, 0xcda47676UL, 0xce492e2eUL, 0xcf12c1c1UL,
|
||||
0xd0e48c8cUL, 0xd1bf6363UL, 0xd2523b3bUL, 0xd309d4d4UL, 0xd4e18b8bUL, 0xd5ba6464UL, 0xd6573c3cUL, 0xd70cd3d3UL,
|
||||
0xd8ee8282UL, 0xd9b56d6dUL, 0xda583535UL, 0xdb03dadaUL, 0xdceb8585UL, 0xddb06a6aUL, 0xde5d3232UL, 0xdf06ddddUL,
|
||||
0xe0d8a8a8UL, 0xe1834747UL, 0xe26e1f1fUL, 0xe335f0f0UL, 0xe4ddafafUL, 0xe5864040UL, 0xe66b1818UL, 0xe730f7f7UL,
|
||||
0xe8d2a6a6UL, 0xe9894949UL, 0xea641111UL, 0xeb3ffefeUL, 0xecd7a1a1UL, 0xed8c4e4eUL, 0xee611616UL, 0xef3af9f9UL,
|
||||
0xf0ccb4b4UL, 0xf1975b5bUL, 0xf27a0303UL, 0xf321ececUL, 0xf4c9b3b3UL, 0xf5925c5cUL, 0xf67f0404UL, 0xf724ebebUL,
|
||||
0xf8c6babaUL, 0xf99d5555UL, 0xfa700d0dUL, 0xfb2be2e2UL, 0xfcc3bdbdUL, 0xfd985252UL, 0xfe750a0aUL, 0xff2ee5e5UL
|
||||
},
|
||||
},
|
||||
{
|
||||
0x00000000UL, 0xef01ef5bUL, 0xb702b7b6UL, 0x580358edUL, 0x07040705UL, 0xe805e85eUL, 0xb006b0b3UL, 0x5f075fe8UL,
|
||||
0x00000000UL, 0xef01ef5bUL, 0xb702b7b6UL, 0x580358edUL, 0x07040705UL, 0xe805e85eUL, 0xb006b0b3UL, 0x5f075fe8UL,
|
||||
0x0e080e0aUL, 0xe109e151UL, 0xb90ab9bcUL, 0x560b56e7UL, 0x090c090fUL, 0xe60de654UL, 0xbe0ebeb9UL, 0x510f51e2UL,
|
||||
0x1c101c14UL, 0xf311f34fUL, 0xab12aba2UL, 0x441344f9UL, 0x1b141b11UL, 0xf415f44aUL, 0xac16aca7UL, 0x431743fcUL,
|
||||
0x1218121eUL, 0xfd19fd45UL, 0xa51aa5a8UL, 0x4a1b4af3UL, 0x151c151bUL, 0xfa1dfa40UL, 0xa21ea2adUL, 0x4d1f4df6UL,
|
||||
0x38203828UL, 0xd721d773UL, 0x8f228f9eUL, 0x602360c5UL, 0x3f243f2dUL, 0xd025d076UL, 0x8826889bUL, 0x672767c0UL,
|
||||
0x36283622UL, 0xd929d979UL, 0x812a8194UL, 0x6e2b6ecfUL, 0x312c3127UL, 0xde2dde7cUL, 0x862e8691UL, 0x692f69caUL,
|
||||
0x2430243cUL, 0xcb31cb67UL, 0x9332938aUL, 0x7c337cd1UL, 0x23342339UL, 0xcc35cc62UL, 0x9436948fUL, 0x7b377bd4UL,
|
||||
0x1c101c14UL, 0xf311f34fUL, 0xab12aba2UL, 0x441344f9UL, 0x1b141b11UL, 0xf415f44aUL, 0xac16aca7UL, 0x431743fcUL,
|
||||
0x1218121eUL, 0xfd19fd45UL, 0xa51aa5a8UL, 0x4a1b4af3UL, 0x151c151bUL, 0xfa1dfa40UL, 0xa21ea2adUL, 0x4d1f4df6UL,
|
||||
0x38203828UL, 0xd721d773UL, 0x8f228f9eUL, 0x602360c5UL, 0x3f243f2dUL, 0xd025d076UL, 0x8826889bUL, 0x672767c0UL,
|
||||
0x36283622UL, 0xd929d979UL, 0x812a8194UL, 0x6e2b6ecfUL, 0x312c3127UL, 0xde2dde7cUL, 0x862e8691UL, 0x692f69caUL,
|
||||
0x2430243cUL, 0xcb31cb67UL, 0x9332938aUL, 0x7c337cd1UL, 0x23342339UL, 0xcc35cc62UL, 0x9436948fUL, 0x7b377bd4UL,
|
||||
0x2a382a36UL, 0xc539c56dUL, 0x9d3a9d80UL, 0x723b72dbUL, 0x2d3c2d33UL, 0xc23dc268UL, 0x9a3e9a85UL, 0x753f75deUL,
|
||||
0x70407050UL, 0x9f419f0bUL, 0xc742c7e6UL, 0x284328bdUL, 0x77447755UL, 0x9845980eUL, 0xc046c0e3UL, 0x2f472fb8UL,
|
||||
0x7e487e5aUL, 0x91499101UL, 0xc94ac9ecUL, 0x264b26b7UL, 0x794c795fUL, 0x964d9604UL, 0xce4ecee9UL, 0x214f21b2UL,
|
||||
0x70407050UL, 0x9f419f0bUL, 0xc742c7e6UL, 0x284328bdUL, 0x77447755UL, 0x9845980eUL, 0xc046c0e3UL, 0x2f472fb8UL,
|
||||
0x7e487e5aUL, 0x91499101UL, 0xc94ac9ecUL, 0x264b26b7UL, 0x794c795fUL, 0x964d9604UL, 0xce4ecee9UL, 0x214f21b2UL,
|
||||
0x6c506c44UL, 0x8351831fUL, 0xdb52dbf2UL, 0x345334a9UL, 0x6b546b41UL, 0x8455841aUL, 0xdc56dcf7UL, 0x335733acUL,
|
||||
0x6258624eUL, 0x8d598d15UL, 0xd55ad5f8UL, 0x3a5b3aa3UL, 0x655c654bUL, 0x8a5d8a10UL, 0xd25ed2fdUL, 0x3d5f3da6UL,
|
||||
0x48604878UL, 0xa761a723UL, 0xff62ffceUL, 0x10631095UL, 0x4f644f7dUL, 0xa065a026UL, 0xf866f8cbUL, 0x17671790UL,
|
||||
0x46684672UL, 0xa969a929UL, 0xf16af1c4UL, 0x1e6b1e9fUL, 0x416c4177UL, 0xae6dae2cUL, 0xf66ef6c1UL, 0x196f199aUL,
|
||||
0x6258624eUL, 0x8d598d15UL, 0xd55ad5f8UL, 0x3a5b3aa3UL, 0x655c654bUL, 0x8a5d8a10UL, 0xd25ed2fdUL, 0x3d5f3da6UL,
|
||||
0x48604878UL, 0xa761a723UL, 0xff62ffceUL, 0x10631095UL, 0x4f644f7dUL, 0xa065a026UL, 0xf866f8cbUL, 0x17671790UL,
|
||||
0x46684672UL, 0xa969a929UL, 0xf16af1c4UL, 0x1e6b1e9fUL, 0x416c4177UL, 0xae6dae2cUL, 0xf66ef6c1UL, 0x196f199aUL,
|
||||
0x5470546cUL, 0xbb71bb37UL, 0xe372e3daUL, 0x0c730c81UL, 0x53745369UL, 0xbc75bc32UL, 0xe476e4dfUL, 0x0b770b84UL,
|
||||
0x5a785a66UL, 0xb579b53dUL, 0xed7aedd0UL, 0x027b028bUL, 0x5d7c5d63UL, 0xb27db238UL, 0xea7eead5UL, 0x057f058eUL,
|
||||
0x5a785a66UL, 0xb579b53dUL, 0xed7aedd0UL, 0x027b028bUL, 0x5d7c5d63UL, 0xb27db238UL, 0xea7eead5UL, 0x057f058eUL,
|
||||
0xe080e0a0UL, 0x0f810ffbUL, 0x57825716UL, 0xb883b84dUL, 0xe784e7a5UL, 0x088508feUL, 0x50865013UL, 0xbf87bf48UL,
|
||||
0xee88eeaaUL, 0x018901f1UL, 0x598a591cUL, 0xb68bb647UL, 0xe98ce9afUL, 0x068d06f4UL, 0x5e8e5e19UL, 0xb18fb142UL,
|
||||
0xfc90fcb4UL, 0x139113efUL, 0x4b924b02UL, 0xa493a459UL, 0xfb94fbb1UL, 0x149514eaUL, 0x4c964c07UL, 0xa397a35cUL,
|
||||
0xf298f2beUL, 0x1d991de5UL, 0x459a4508UL, 0xaa9baa53UL, 0xf59cf5bbUL, 0x1a9d1ae0UL, 0x429e420dUL, 0xad9fad56UL,
|
||||
0xd8a0d888UL, 0x37a137d3UL, 0x6fa26f3eUL, 0x80a38065UL, 0xdfa4df8dUL, 0x30a530d6UL, 0x68a6683bUL, 0x87a78760UL,
|
||||
0xd6a8d682UL, 0x39a939d9UL, 0x61aa6134UL, 0x8eab8e6fUL, 0xd1acd187UL, 0x3ead3edcUL, 0x66ae6631UL, 0x89af896aUL,
|
||||
0xc4b0c49cUL, 0x2bb12bc7UL, 0x73b2732aUL, 0x9cb39c71UL, 0xc3b4c399UL, 0x2cb52cc2UL, 0x74b6742fUL, 0x9bb79b74UL,
|
||||
0xcab8ca96UL, 0x25b925cdUL, 0x7dba7d20UL, 0x92bb927bUL, 0xcdbccd93UL, 0x22bd22c8UL, 0x7abe7a25UL, 0x95bf957eUL,
|
||||
0x90c090f0UL, 0x7fc17fabUL, 0x27c22746UL, 0xc8c3c81dUL, 0x97c497f5UL, 0x78c578aeUL, 0x20c62043UL, 0xcfc7cf18UL,
|
||||
0x9ec89efaUL, 0x71c971a1UL, 0x29ca294cUL, 0xc6cbc617UL, 0x99cc99ffUL, 0x76cd76a4UL, 0x2ece2e49UL, 0xc1cfc112UL,
|
||||
0x8cd08ce4UL, 0x63d163bfUL, 0x3bd23b52UL, 0xd4d3d409UL, 0x8bd48be1UL, 0x64d564baUL, 0x3cd63c57UL, 0xd3d7d30cUL,
|
||||
0x82d882eeUL, 0x6dd96db5UL, 0x35da3558UL, 0xdadbda03UL, 0x85dc85ebUL, 0x6add6ab0UL, 0x32de325dUL, 0xdddfdd06UL,
|
||||
0xa8e0a8d8UL, 0x47e14783UL, 0x1fe21f6eUL, 0xf0e3f035UL, 0xafe4afddUL, 0x40e54086UL, 0x18e6186bUL, 0xf7e7f730UL,
|
||||
0xa6e8a6d2UL, 0x49e94989UL, 0x11ea1164UL, 0xfeebfe3fUL, 0xa1eca1d7UL, 0x4eed4e8cUL, 0x16ee1661UL, 0xf9eff93aUL,
|
||||
0xb4f0b4ccUL, 0x5bf15b97UL, 0x03f2037aUL, 0xecf3ec21UL, 0xb3f4b3c9UL, 0x5cf55c92UL, 0x04f6047fUL, 0xebf7eb24UL,
|
||||
0xfc90fcb4UL, 0x139113efUL, 0x4b924b02UL, 0xa493a459UL, 0xfb94fbb1UL, 0x149514eaUL, 0x4c964c07UL, 0xa397a35cUL,
|
||||
0xf298f2beUL, 0x1d991de5UL, 0x459a4508UL, 0xaa9baa53UL, 0xf59cf5bbUL, 0x1a9d1ae0UL, 0x429e420dUL, 0xad9fad56UL,
|
||||
0xd8a0d888UL, 0x37a137d3UL, 0x6fa26f3eUL, 0x80a38065UL, 0xdfa4df8dUL, 0x30a530d6UL, 0x68a6683bUL, 0x87a78760UL,
|
||||
0xd6a8d682UL, 0x39a939d9UL, 0x61aa6134UL, 0x8eab8e6fUL, 0xd1acd187UL, 0x3ead3edcUL, 0x66ae6631UL, 0x89af896aUL,
|
||||
0xc4b0c49cUL, 0x2bb12bc7UL, 0x73b2732aUL, 0x9cb39c71UL, 0xc3b4c399UL, 0x2cb52cc2UL, 0x74b6742fUL, 0x9bb79b74UL,
|
||||
0xcab8ca96UL, 0x25b925cdUL, 0x7dba7d20UL, 0x92bb927bUL, 0xcdbccd93UL, 0x22bd22c8UL, 0x7abe7a25UL, 0x95bf957eUL,
|
||||
0x90c090f0UL, 0x7fc17fabUL, 0x27c22746UL, 0xc8c3c81dUL, 0x97c497f5UL, 0x78c578aeUL, 0x20c62043UL, 0xcfc7cf18UL,
|
||||
0x9ec89efaUL, 0x71c971a1UL, 0x29ca294cUL, 0xc6cbc617UL, 0x99cc99ffUL, 0x76cd76a4UL, 0x2ece2e49UL, 0xc1cfc112UL,
|
||||
0x8cd08ce4UL, 0x63d163bfUL, 0x3bd23b52UL, 0xd4d3d409UL, 0x8bd48be1UL, 0x64d564baUL, 0x3cd63c57UL, 0xd3d7d30cUL,
|
||||
0x82d882eeUL, 0x6dd96db5UL, 0x35da3558UL, 0xdadbda03UL, 0x85dc85ebUL, 0x6add6ab0UL, 0x32de325dUL, 0xdddfdd06UL,
|
||||
0xa8e0a8d8UL, 0x47e14783UL, 0x1fe21f6eUL, 0xf0e3f035UL, 0xafe4afddUL, 0x40e54086UL, 0x18e6186bUL, 0xf7e7f730UL,
|
||||
0xa6e8a6d2UL, 0x49e94989UL, 0x11ea1164UL, 0xfeebfe3fUL, 0xa1eca1d7UL, 0x4eed4e8cUL, 0x16ee1661UL, 0xf9eff93aUL,
|
||||
0xb4f0b4ccUL, 0x5bf15b97UL, 0x03f2037aUL, 0xecf3ec21UL, 0xb3f4b3c9UL, 0x5cf55c92UL, 0x04f6047fUL, 0xebf7eb24UL,
|
||||
0xbaf8bac6UL, 0x55f9559dUL, 0x0dfa0d70UL, 0xe2fbe22bUL, 0xbdfcbdc3UL, 0x52fd5298UL, 0x0afe0a75UL, 0xe5ffe52eUL
|
||||
},
|
||||
},
|
||||
{
|
||||
0x00000000UL, 0x5bef015bUL, 0xb6b702b6UL, 0xed5803edUL, 0x05070405UL, 0x5ee8055eUL, 0xb3b006b3UL, 0xe85f07e8UL,
|
||||
0x0a0e080aUL, 0x51e10951UL, 0xbcb90abcUL, 0xe7560be7UL, 0x0f090c0fUL, 0x54e60d54UL, 0xb9be0eb9UL, 0xe2510fe2UL,
|
||||
0x141c1014UL, 0x4ff3114fUL, 0xa2ab12a2UL, 0xf94413f9UL, 0x111b1411UL, 0x4af4154aUL, 0xa7ac16a7UL, 0xfc4317fcUL,
|
||||
0x1e12181eUL, 0x45fd1945UL, 0xa8a51aa8UL, 0xf34a1bf3UL, 0x1b151c1bUL, 0x40fa1d40UL, 0xada21eadUL, 0xf64d1ff6UL,
|
||||
0x28382028UL, 0x73d72173UL, 0x9e8f229eUL, 0xc56023c5UL, 0x2d3f242dUL, 0x76d02576UL, 0x9b88269bUL, 0xc06727c0UL,
|
||||
0x22362822UL, 0x79d92979UL, 0x94812a94UL, 0xcf6e2bcfUL, 0x27312c27UL, 0x7cde2d7cUL, 0x91862e91UL, 0xca692fcaUL,
|
||||
0x3c24303cUL, 0x67cb3167UL, 0x8a93328aUL, 0xd17c33d1UL, 0x39233439UL, 0x62cc3562UL, 0x8f94368fUL, 0xd47b37d4UL,
|
||||
0x00000000UL, 0x5bef015bUL, 0xb6b702b6UL, 0xed5803edUL, 0x05070405UL, 0x5ee8055eUL, 0xb3b006b3UL, 0xe85f07e8UL,
|
||||
0x0a0e080aUL, 0x51e10951UL, 0xbcb90abcUL, 0xe7560be7UL, 0x0f090c0fUL, 0x54e60d54UL, 0xb9be0eb9UL, 0xe2510fe2UL,
|
||||
0x141c1014UL, 0x4ff3114fUL, 0xa2ab12a2UL, 0xf94413f9UL, 0x111b1411UL, 0x4af4154aUL, 0xa7ac16a7UL, 0xfc4317fcUL,
|
||||
0x1e12181eUL, 0x45fd1945UL, 0xa8a51aa8UL, 0xf34a1bf3UL, 0x1b151c1bUL, 0x40fa1d40UL, 0xada21eadUL, 0xf64d1ff6UL,
|
||||
0x28382028UL, 0x73d72173UL, 0x9e8f229eUL, 0xc56023c5UL, 0x2d3f242dUL, 0x76d02576UL, 0x9b88269bUL, 0xc06727c0UL,
|
||||
0x22362822UL, 0x79d92979UL, 0x94812a94UL, 0xcf6e2bcfUL, 0x27312c27UL, 0x7cde2d7cUL, 0x91862e91UL, 0xca692fcaUL,
|
||||
0x3c24303cUL, 0x67cb3167UL, 0x8a93328aUL, 0xd17c33d1UL, 0x39233439UL, 0x62cc3562UL, 0x8f94368fUL, 0xd47b37d4UL,
|
||||
0x362a3836UL, 0x6dc5396dUL, 0x809d3a80UL, 0xdb723bdbUL, 0x332d3c33UL, 0x68c23d68UL, 0x859a3e85UL, 0xde753fdeUL,
|
||||
0x50704050UL, 0x0b9f410bUL, 0xe6c742e6UL, 0xbd2843bdUL, 0x55774455UL, 0x0e98450eUL, 0xe3c046e3UL, 0xb82f47b8UL,
|
||||
0x5a7e485aUL, 0x01914901UL, 0xecc94aecUL, 0xb7264bb7UL, 0x5f794c5fUL, 0x04964d04UL, 0xe9ce4ee9UL, 0xb2214fb2UL,
|
||||
0x446c5044UL, 0x1f83511fUL, 0xf2db52f2UL, 0xa93453a9UL, 0x416b5441UL, 0x1a84551aUL, 0xf7dc56f7UL, 0xac3357acUL,
|
||||
0x4e62584eUL, 0x158d5915UL, 0xf8d55af8UL, 0xa33a5ba3UL, 0x4b655c4bUL, 0x108a5d10UL, 0xfdd25efdUL, 0xa63d5fa6UL,
|
||||
0x78486078UL, 0x23a76123UL, 0xceff62ceUL, 0x95106395UL, 0x7d4f647dUL, 0x26a06526UL, 0xcbf866cbUL, 0x90176790UL,
|
||||
0x72466872UL, 0x29a96929UL, 0xc4f16ac4UL, 0x9f1e6b9fUL, 0x77416c77UL, 0x2cae6d2cUL, 0xc1f66ec1UL, 0x9a196f9aUL,
|
||||
0x6c54706cUL, 0x37bb7137UL, 0xdae372daUL, 0x810c7381UL, 0x69537469UL, 0x32bc7532UL, 0xdfe476dfUL, 0x840b7784UL,
|
||||
0x665a7866UL, 0x3db5793dUL, 0xd0ed7ad0UL, 0x8b027b8bUL, 0x635d7c63UL, 0x38b27d38UL, 0xd5ea7ed5UL, 0x8e057f8eUL,
|
||||
0xa0e080a0UL, 0xfb0f81fbUL, 0x16578216UL, 0x4db8834dUL, 0xa5e784a5UL, 0xfe0885feUL, 0x13508613UL, 0x48bf8748UL,
|
||||
0x50704050UL, 0x0b9f410bUL, 0xe6c742e6UL, 0xbd2843bdUL, 0x55774455UL, 0x0e98450eUL, 0xe3c046e3UL, 0xb82f47b8UL,
|
||||
0x5a7e485aUL, 0x01914901UL, 0xecc94aecUL, 0xb7264bb7UL, 0x5f794c5fUL, 0x04964d04UL, 0xe9ce4ee9UL, 0xb2214fb2UL,
|
||||
0x446c5044UL, 0x1f83511fUL, 0xf2db52f2UL, 0xa93453a9UL, 0x416b5441UL, 0x1a84551aUL, 0xf7dc56f7UL, 0xac3357acUL,
|
||||
0x4e62584eUL, 0x158d5915UL, 0xf8d55af8UL, 0xa33a5ba3UL, 0x4b655c4bUL, 0x108a5d10UL, 0xfdd25efdUL, 0xa63d5fa6UL,
|
||||
0x78486078UL, 0x23a76123UL, 0xceff62ceUL, 0x95106395UL, 0x7d4f647dUL, 0x26a06526UL, 0xcbf866cbUL, 0x90176790UL,
|
||||
0x72466872UL, 0x29a96929UL, 0xc4f16ac4UL, 0x9f1e6b9fUL, 0x77416c77UL, 0x2cae6d2cUL, 0xc1f66ec1UL, 0x9a196f9aUL,
|
||||
0x6c54706cUL, 0x37bb7137UL, 0xdae372daUL, 0x810c7381UL, 0x69537469UL, 0x32bc7532UL, 0xdfe476dfUL, 0x840b7784UL,
|
||||
0x665a7866UL, 0x3db5793dUL, 0xd0ed7ad0UL, 0x8b027b8bUL, 0x635d7c63UL, 0x38b27d38UL, 0xd5ea7ed5UL, 0x8e057f8eUL,
|
||||
0xa0e080a0UL, 0xfb0f81fbUL, 0x16578216UL, 0x4db8834dUL, 0xa5e784a5UL, 0xfe0885feUL, 0x13508613UL, 0x48bf8748UL,
|
||||
0xaaee88aaUL, 0xf10189f1UL, 0x1c598a1cUL, 0x47b68b47UL, 0xafe98cafUL, 0xf4068df4UL, 0x195e8e19UL, 0x42b18f42UL,
|
||||
0xb4fc90b4UL, 0xef1391efUL, 0x024b9202UL, 0x59a49359UL, 0xb1fb94b1UL, 0xea1495eaUL, 0x074c9607UL, 0x5ca3975cUL,
|
||||
0xbef298beUL, 0xe51d99e5UL, 0x08459a08UL, 0x53aa9b53UL, 0xbbf59cbbUL, 0xe01a9de0UL, 0x0d429e0dUL, 0x56ad9f56UL,
|
||||
0x88d8a088UL, 0xd337a1d3UL, 0x3e6fa23eUL, 0x6580a365UL, 0x8ddfa48dUL, 0xd630a5d6UL, 0x3b68a63bUL, 0x6087a760UL,
|
||||
0x82d6a882UL, 0xd939a9d9UL, 0x3461aa34UL, 0x6f8eab6fUL, 0x87d1ac87UL, 0xdc3eaddcUL, 0x3166ae31UL, 0x6a89af6aUL,
|
||||
0x9cc4b09cUL, 0xc72bb1c7UL, 0x2a73b22aUL, 0x719cb371UL, 0x99c3b499UL, 0xc22cb5c2UL, 0x2f74b62fUL, 0x749bb774UL,
|
||||
0xb4fc90b4UL, 0xef1391efUL, 0x024b9202UL, 0x59a49359UL, 0xb1fb94b1UL, 0xea1495eaUL, 0x074c9607UL, 0x5ca3975cUL,
|
||||
0xbef298beUL, 0xe51d99e5UL, 0x08459a08UL, 0x53aa9b53UL, 0xbbf59cbbUL, 0xe01a9de0UL, 0x0d429e0dUL, 0x56ad9f56UL,
|
||||
0x88d8a088UL, 0xd337a1d3UL, 0x3e6fa23eUL, 0x6580a365UL, 0x8ddfa48dUL, 0xd630a5d6UL, 0x3b68a63bUL, 0x6087a760UL,
|
||||
0x82d6a882UL, 0xd939a9d9UL, 0x3461aa34UL, 0x6f8eab6fUL, 0x87d1ac87UL, 0xdc3eaddcUL, 0x3166ae31UL, 0x6a89af6aUL,
|
||||
0x9cc4b09cUL, 0xc72bb1c7UL, 0x2a73b22aUL, 0x719cb371UL, 0x99c3b499UL, 0xc22cb5c2UL, 0x2f74b62fUL, 0x749bb774UL,
|
||||
0x96cab896UL, 0xcd25b9cdUL, 0x207dba20UL, 0x7b92bb7bUL, 0x93cdbc93UL, 0xc822bdc8UL, 0x257abe25UL, 0x7e95bf7eUL,
|
||||
0xf090c0f0UL, 0xab7fc1abUL, 0x4627c246UL, 0x1dc8c31dUL, 0xf597c4f5UL, 0xae78c5aeUL, 0x4320c643UL, 0x18cfc718UL,
|
||||
0xfa9ec8faUL, 0xa171c9a1UL, 0x4c29ca4cUL, 0x17c6cb17UL, 0xff99ccffUL, 0xa476cda4UL, 0x492ece49UL, 0x12c1cf12UL,
|
||||
0xe48cd0e4UL, 0xbf63d1bfUL, 0x523bd252UL, 0x09d4d309UL, 0xe18bd4e1UL, 0xba64d5baUL, 0x573cd657UL, 0x0cd3d70cUL,
|
||||
0xee82d8eeUL, 0xb56dd9b5UL, 0x5835da58UL, 0x03dadb03UL, 0xeb85dcebUL, 0xb06addb0UL, 0x5d32de5dUL, 0x06dddf06UL,
|
||||
0xd8a8e0d8UL, 0x8347e183UL, 0x6e1fe26eUL, 0x35f0e335UL, 0xddafe4ddUL, 0x8640e586UL, 0x6b18e66bUL, 0x30f7e730UL,
|
||||
0xf090c0f0UL, 0xab7fc1abUL, 0x4627c246UL, 0x1dc8c31dUL, 0xf597c4f5UL, 0xae78c5aeUL, 0x4320c643UL, 0x18cfc718UL,
|
||||
0xfa9ec8faUL, 0xa171c9a1UL, 0x4c29ca4cUL, 0x17c6cb17UL, 0xff99ccffUL, 0xa476cda4UL, 0x492ece49UL, 0x12c1cf12UL,
|
||||
0xe48cd0e4UL, 0xbf63d1bfUL, 0x523bd252UL, 0x09d4d309UL, 0xe18bd4e1UL, 0xba64d5baUL, 0x573cd657UL, 0x0cd3d70cUL,
|
||||
0xee82d8eeUL, 0xb56dd9b5UL, 0x5835da58UL, 0x03dadb03UL, 0xeb85dcebUL, 0xb06addb0UL, 0x5d32de5dUL, 0x06dddf06UL,
|
||||
0xd8a8e0d8UL, 0x8347e183UL, 0x6e1fe26eUL, 0x35f0e335UL, 0xddafe4ddUL, 0x8640e586UL, 0x6b18e66bUL, 0x30f7e730UL,
|
||||
0xd2a6e8d2UL, 0x8949e989UL, 0x6411ea64UL, 0x3ffeeb3fUL, 0xd7a1ecd7UL, 0x8c4eed8cUL, 0x6116ee61UL, 0x3af9ef3aUL,
|
||||
0xccb4f0ccUL, 0x975bf197UL, 0x7a03f27aUL, 0x21ecf321UL, 0xc9b3f4c9UL, 0x925cf592UL, 0x7f04f67fUL, 0x24ebf724UL,
|
||||
0xccb4f0ccUL, 0x975bf197UL, 0x7a03f27aUL, 0x21ecf321UL, 0xc9b3f4c9UL, 0x925cf592UL, 0x7f04f67fUL, 0x24ebf724UL,
|
||||
0xc6baf8c6UL, 0x9d55f99dUL, 0x700dfa70UL, 0x2be2fb2bUL, 0xc3bdfcc3UL, 0x9852fd98UL, 0x750afe75UL, 0x2ee5ff2eUL
|
||||
}};
|
||||
|
||||
@@ -216,281 +215,282 @@ static const ulong32 mds_tab[4][256] = {
|
||||
|
||||
/* the 4x8 RS transform */
|
||||
static const ulong32 rs_tab0[256] = {
|
||||
0x00000000LU, 0xa402a401LU, 0x05040502LU, 0xa106a103LU, 0x0a080a04LU, 0xae0aae05LU, 0x0f0c0f06LU, 0xab0eab07LU,
|
||||
0x14101408LU, 0xb012b009LU, 0x1114110aLU, 0xb516b50bLU, 0x1e181e0cLU, 0xba1aba0dLU, 0x1b1c1b0eLU, 0xbf1ebf0fLU,
|
||||
0x28202810LU, 0x8c228c11LU, 0x2d242d12LU, 0x89268913LU, 0x22282214LU, 0x862a8615LU, 0x272c2716LU, 0x832e8317LU,
|
||||
0x3c303c18LU, 0x98329819LU, 0x3934391aLU, 0x9d369d1bLU, 0x3638361cLU, 0x923a921dLU, 0x333c331eLU, 0x973e971fLU,
|
||||
0x50405020LU, 0xf442f421LU, 0x55445522LU, 0xf146f123LU, 0x5a485a24LU, 0xfe4afe25LU, 0x5f4c5f26LU, 0xfb4efb27LU,
|
||||
0x44504428LU, 0xe052e029LU, 0x4154412aLU, 0xe556e52bLU, 0x4e584e2cLU, 0xea5aea2dLU, 0x4b5c4b2eLU, 0xef5eef2fLU,
|
||||
0x78607830LU, 0xdc62dc31LU, 0x7d647d32LU, 0xd966d933LU, 0x72687234LU, 0xd66ad635LU, 0x776c7736LU, 0xd36ed337LU,
|
||||
0x6c706c38LU, 0xc872c839LU, 0x6974693aLU, 0xcd76cd3bLU, 0x6678663cLU, 0xc27ac23dLU, 0x637c633eLU, 0xc77ec73fLU,
|
||||
0xa080a040LU, 0x04820441LU, 0xa584a542LU, 0x01860143LU, 0xaa88aa44LU, 0x0e8a0e45LU, 0xaf8caf46LU, 0x0b8e0b47LU,
|
||||
0xb490b448LU, 0x10921049LU, 0xb194b14aLU, 0x1596154bLU, 0xbe98be4cLU, 0x1a9a1a4dLU, 0xbb9cbb4eLU, 0x1f9e1f4fLU,
|
||||
0x88a08850LU, 0x2ca22c51LU, 0x8da48d52LU, 0x29a62953LU, 0x82a88254LU, 0x26aa2655LU, 0x87ac8756LU, 0x23ae2357LU,
|
||||
0x9cb09c58LU, 0x38b23859LU, 0x99b4995aLU, 0x3db63d5bLU, 0x96b8965cLU, 0x32ba325dLU, 0x93bc935eLU, 0x37be375fLU,
|
||||
0xf0c0f060LU, 0x54c25461LU, 0xf5c4f562LU, 0x51c65163LU, 0xfac8fa64LU, 0x5eca5e65LU, 0xffccff66LU, 0x5bce5b67LU,
|
||||
0xe4d0e468LU, 0x40d24069LU, 0xe1d4e16aLU, 0x45d6456bLU, 0xeed8ee6cLU, 0x4ada4a6dLU, 0xebdceb6eLU, 0x4fde4f6fLU,
|
||||
0xd8e0d870LU, 0x7ce27c71LU, 0xdde4dd72LU, 0x79e67973LU, 0xd2e8d274LU, 0x76ea7675LU, 0xd7ecd776LU, 0x73ee7377LU,
|
||||
0xccf0cc78LU, 0x68f26879LU, 0xc9f4c97aLU, 0x6df66d7bLU, 0xc6f8c67cLU, 0x62fa627dLU, 0xc3fcc37eLU, 0x67fe677fLU,
|
||||
0x0d4d0d80LU, 0xa94fa981LU, 0x08490882LU, 0xac4bac83LU, 0x07450784LU, 0xa347a385LU, 0x02410286LU, 0xa643a687LU,
|
||||
0x195d1988LU, 0xbd5fbd89LU, 0x1c591c8aLU, 0xb85bb88bLU, 0x1355138cLU, 0xb757b78dLU, 0x1651168eLU, 0xb253b28fLU,
|
||||
0x256d2590LU, 0x816f8191LU, 0x20692092LU, 0x846b8493LU, 0x2f652f94LU, 0x8b678b95LU, 0x2a612a96LU, 0x8e638e97LU,
|
||||
0x317d3198LU, 0x957f9599LU, 0x3479349aLU, 0x907b909bLU, 0x3b753b9cLU, 0x9f779f9dLU, 0x3e713e9eLU, 0x9a739a9fLU,
|
||||
0x5d0d5da0LU, 0xf90ff9a1LU, 0x580958a2LU, 0xfc0bfca3LU, 0x570557a4LU, 0xf307f3a5LU, 0x520152a6LU, 0xf603f6a7LU,
|
||||
0x491d49a8LU, 0xed1feda9LU, 0x4c194caaLU, 0xe81be8abLU, 0x431543acLU, 0xe717e7adLU, 0x461146aeLU, 0xe213e2afLU,
|
||||
0x752d75b0LU, 0xd12fd1b1LU, 0x702970b2LU, 0xd42bd4b3LU, 0x7f257fb4LU, 0xdb27dbb5LU, 0x7a217ab6LU, 0xde23deb7LU,
|
||||
0x613d61b8LU, 0xc53fc5b9LU, 0x643964baLU, 0xc03bc0bbLU, 0x6b356bbcLU, 0xcf37cfbdLU, 0x6e316ebeLU, 0xca33cabfLU,
|
||||
0xadcdadc0LU, 0x09cf09c1LU, 0xa8c9a8c2LU, 0x0ccb0cc3LU, 0xa7c5a7c4LU, 0x03c703c5LU, 0xa2c1a2c6LU, 0x06c306c7LU,
|
||||
0xb9ddb9c8LU, 0x1ddf1dc9LU, 0xbcd9bccaLU, 0x18db18cbLU, 0xb3d5b3ccLU, 0x17d717cdLU, 0xb6d1b6ceLU, 0x12d312cfLU,
|
||||
0x85ed85d0LU, 0x21ef21d1LU, 0x80e980d2LU, 0x24eb24d3LU, 0x8fe58fd4LU, 0x2be72bd5LU, 0x8ae18ad6LU, 0x2ee32ed7LU,
|
||||
0x91fd91d8LU, 0x35ff35d9LU, 0x94f994daLU, 0x30fb30dbLU, 0x9bf59bdcLU, 0x3ff73fddLU, 0x9ef19edeLU, 0x3af33adfLU,
|
||||
0xfd8dfde0LU, 0x598f59e1LU, 0xf889f8e2LU, 0x5c8b5ce3LU, 0xf785f7e4LU, 0x538753e5LU, 0xf281f2e6LU, 0x568356e7LU,
|
||||
0xe99de9e8LU, 0x4d9f4de9LU, 0xec99eceaLU, 0x489b48ebLU, 0xe395e3ecLU, 0x479747edLU, 0xe691e6eeLU, 0x429342efLU,
|
||||
0xd5add5f0LU, 0x71af71f1LU, 0xd0a9d0f2LU, 0x74ab74f3LU, 0xdfa5dff4LU, 0x7ba77bf5LU, 0xdaa1daf6LU, 0x7ea37ef7LU,
|
||||
0xc1bdc1f8LU, 0x65bf65f9LU, 0xc4b9c4faLU, 0x60bb60fbLU, 0xcbb5cbfcLU, 0x6fb76ffdLU, 0xceb1cefeLU, 0x6ab36affLU };
|
||||
0x00000000LU, 0xa402a401LU, 0x05040502LU, 0xa106a103LU, 0x0a080a04LU, 0xae0aae05LU, 0x0f0c0f06LU, 0xab0eab07LU,
|
||||
0x14101408LU, 0xb012b009LU, 0x1114110aLU, 0xb516b50bLU, 0x1e181e0cLU, 0xba1aba0dLU, 0x1b1c1b0eLU, 0xbf1ebf0fLU,
|
||||
0x28202810LU, 0x8c228c11LU, 0x2d242d12LU, 0x89268913LU, 0x22282214LU, 0x862a8615LU, 0x272c2716LU, 0x832e8317LU,
|
||||
0x3c303c18LU, 0x98329819LU, 0x3934391aLU, 0x9d369d1bLU, 0x3638361cLU, 0x923a921dLU, 0x333c331eLU, 0x973e971fLU,
|
||||
0x50405020LU, 0xf442f421LU, 0x55445522LU, 0xf146f123LU, 0x5a485a24LU, 0xfe4afe25LU, 0x5f4c5f26LU, 0xfb4efb27LU,
|
||||
0x44504428LU, 0xe052e029LU, 0x4154412aLU, 0xe556e52bLU, 0x4e584e2cLU, 0xea5aea2dLU, 0x4b5c4b2eLU, 0xef5eef2fLU,
|
||||
0x78607830LU, 0xdc62dc31LU, 0x7d647d32LU, 0xd966d933LU, 0x72687234LU, 0xd66ad635LU, 0x776c7736LU, 0xd36ed337LU,
|
||||
0x6c706c38LU, 0xc872c839LU, 0x6974693aLU, 0xcd76cd3bLU, 0x6678663cLU, 0xc27ac23dLU, 0x637c633eLU, 0xc77ec73fLU,
|
||||
0xa080a040LU, 0x04820441LU, 0xa584a542LU, 0x01860143LU, 0xaa88aa44LU, 0x0e8a0e45LU, 0xaf8caf46LU, 0x0b8e0b47LU,
|
||||
0xb490b448LU, 0x10921049LU, 0xb194b14aLU, 0x1596154bLU, 0xbe98be4cLU, 0x1a9a1a4dLU, 0xbb9cbb4eLU, 0x1f9e1f4fLU,
|
||||
0x88a08850LU, 0x2ca22c51LU, 0x8da48d52LU, 0x29a62953LU, 0x82a88254LU, 0x26aa2655LU, 0x87ac8756LU, 0x23ae2357LU,
|
||||
0x9cb09c58LU, 0x38b23859LU, 0x99b4995aLU, 0x3db63d5bLU, 0x96b8965cLU, 0x32ba325dLU, 0x93bc935eLU, 0x37be375fLU,
|
||||
0xf0c0f060LU, 0x54c25461LU, 0xf5c4f562LU, 0x51c65163LU, 0xfac8fa64LU, 0x5eca5e65LU, 0xffccff66LU, 0x5bce5b67LU,
|
||||
0xe4d0e468LU, 0x40d24069LU, 0xe1d4e16aLU, 0x45d6456bLU, 0xeed8ee6cLU, 0x4ada4a6dLU, 0xebdceb6eLU, 0x4fde4f6fLU,
|
||||
0xd8e0d870LU, 0x7ce27c71LU, 0xdde4dd72LU, 0x79e67973LU, 0xd2e8d274LU, 0x76ea7675LU, 0xd7ecd776LU, 0x73ee7377LU,
|
||||
0xccf0cc78LU, 0x68f26879LU, 0xc9f4c97aLU, 0x6df66d7bLU, 0xc6f8c67cLU, 0x62fa627dLU, 0xc3fcc37eLU, 0x67fe677fLU,
|
||||
0x0d4d0d80LU, 0xa94fa981LU, 0x08490882LU, 0xac4bac83LU, 0x07450784LU, 0xa347a385LU, 0x02410286LU, 0xa643a687LU,
|
||||
0x195d1988LU, 0xbd5fbd89LU, 0x1c591c8aLU, 0xb85bb88bLU, 0x1355138cLU, 0xb757b78dLU, 0x1651168eLU, 0xb253b28fLU,
|
||||
0x256d2590LU, 0x816f8191LU, 0x20692092LU, 0x846b8493LU, 0x2f652f94LU, 0x8b678b95LU, 0x2a612a96LU, 0x8e638e97LU,
|
||||
0x317d3198LU, 0x957f9599LU, 0x3479349aLU, 0x907b909bLU, 0x3b753b9cLU, 0x9f779f9dLU, 0x3e713e9eLU, 0x9a739a9fLU,
|
||||
0x5d0d5da0LU, 0xf90ff9a1LU, 0x580958a2LU, 0xfc0bfca3LU, 0x570557a4LU, 0xf307f3a5LU, 0x520152a6LU, 0xf603f6a7LU,
|
||||
0x491d49a8LU, 0xed1feda9LU, 0x4c194caaLU, 0xe81be8abLU, 0x431543acLU, 0xe717e7adLU, 0x461146aeLU, 0xe213e2afLU,
|
||||
0x752d75b0LU, 0xd12fd1b1LU, 0x702970b2LU, 0xd42bd4b3LU, 0x7f257fb4LU, 0xdb27dbb5LU, 0x7a217ab6LU, 0xde23deb7LU,
|
||||
0x613d61b8LU, 0xc53fc5b9LU, 0x643964baLU, 0xc03bc0bbLU, 0x6b356bbcLU, 0xcf37cfbdLU, 0x6e316ebeLU, 0xca33cabfLU,
|
||||
0xadcdadc0LU, 0x09cf09c1LU, 0xa8c9a8c2LU, 0x0ccb0cc3LU, 0xa7c5a7c4LU, 0x03c703c5LU, 0xa2c1a2c6LU, 0x06c306c7LU,
|
||||
0xb9ddb9c8LU, 0x1ddf1dc9LU, 0xbcd9bccaLU, 0x18db18cbLU, 0xb3d5b3ccLU, 0x17d717cdLU, 0xb6d1b6ceLU, 0x12d312cfLU,
|
||||
0x85ed85d0LU, 0x21ef21d1LU, 0x80e980d2LU, 0x24eb24d3LU, 0x8fe58fd4LU, 0x2be72bd5LU, 0x8ae18ad6LU, 0x2ee32ed7LU,
|
||||
0x91fd91d8LU, 0x35ff35d9LU, 0x94f994daLU, 0x30fb30dbLU, 0x9bf59bdcLU, 0x3ff73fddLU, 0x9ef19edeLU, 0x3af33adfLU,
|
||||
0xfd8dfde0LU, 0x598f59e1LU, 0xf889f8e2LU, 0x5c8b5ce3LU, 0xf785f7e4LU, 0x538753e5LU, 0xf281f2e6LU, 0x568356e7LU,
|
||||
0xe99de9e8LU, 0x4d9f4de9LU, 0xec99eceaLU, 0x489b48ebLU, 0xe395e3ecLU, 0x479747edLU, 0xe691e6eeLU, 0x429342efLU,
|
||||
0xd5add5f0LU, 0x71af71f1LU, 0xd0a9d0f2LU, 0x74ab74f3LU, 0xdfa5dff4LU, 0x7ba77bf5LU, 0xdaa1daf6LU, 0x7ea37ef7LU,
|
||||
0xc1bdc1f8LU, 0x65bf65f9LU, 0xc4b9c4faLU, 0x60bb60fbLU, 0xcbb5cbfcLU, 0x6fb76ffdLU, 0xceb1cefeLU, 0x6ab36affLU };
|
||||
|
||||
static const ulong32 rs_tab1[256] = {
|
||||
0x00000000LU, 0x55a156a4LU, 0xaa0fac05LU, 0xffaefaa1LU, 0x191e150aLU, 0x4cbf43aeLU, 0xb311b90fLU, 0xe6b0efabLU,
|
||||
0x323c2a14LU, 0x679d7cb0LU, 0x98338611LU, 0xcd92d0b5LU, 0x2b223f1eLU, 0x7e8369baLU, 0x812d931bLU, 0xd48cc5bfLU,
|
||||
0x64785428LU, 0x31d9028cLU, 0xce77f82dLU, 0x9bd6ae89LU, 0x7d664122LU, 0x28c71786LU, 0xd769ed27LU, 0x82c8bb83LU,
|
||||
0x56447e3cLU, 0x03e52898LU, 0xfc4bd239LU, 0xa9ea849dLU, 0x4f5a6b36LU, 0x1afb3d92LU, 0xe555c733LU, 0xb0f49197LU,
|
||||
0xc8f0a850LU, 0x9d51fef4LU, 0x62ff0455LU, 0x375e52f1LU, 0xd1eebd5aLU, 0x844febfeLU, 0x7be1115fLU, 0x2e4047fbLU,
|
||||
0xfacc8244LU, 0xaf6dd4e0LU, 0x50c32e41LU, 0x056278e5LU, 0xe3d2974eLU, 0xb673c1eaLU, 0x49dd3b4bLU, 0x1c7c6defLU,
|
||||
0xac88fc78LU, 0xf929aadcLU, 0x0687507dLU, 0x532606d9LU, 0xb596e972LU, 0xe037bfd6LU, 0x1f994577LU, 0x4a3813d3LU,
|
||||
0x9eb4d66cLU, 0xcb1580c8LU, 0x34bb7a69LU, 0x611a2ccdLU, 0x87aac366LU, 0xd20b95c2LU, 0x2da56f63LU, 0x780439c7LU,
|
||||
0xddad1da0LU, 0x880c4b04LU, 0x77a2b1a5LU, 0x2203e701LU, 0xc4b308aaLU, 0x91125e0eLU, 0x6ebca4afLU, 0x3b1df20bLU,
|
||||
0xef9137b4LU, 0xba306110LU, 0x459e9bb1LU, 0x103fcd15LU, 0xf68f22beLU, 0xa32e741aLU, 0x5c808ebbLU, 0x0921d81fLU,
|
||||
0xb9d54988LU, 0xec741f2cLU, 0x13dae58dLU, 0x467bb329LU, 0xa0cb5c82LU, 0xf56a0a26LU, 0x0ac4f087LU, 0x5f65a623LU,
|
||||
0x8be9639cLU, 0xde483538LU, 0x21e6cf99LU, 0x7447993dLU, 0x92f77696LU, 0xc7562032LU, 0x38f8da93LU, 0x6d598c37LU,
|
||||
0x155db5f0LU, 0x40fce354LU, 0xbf5219f5LU, 0xeaf34f51LU, 0x0c43a0faLU, 0x59e2f65eLU, 0xa64c0cffLU, 0xf3ed5a5bLU,
|
||||
0x27619fe4LU, 0x72c0c940LU, 0x8d6e33e1LU, 0xd8cf6545LU, 0x3e7f8aeeLU, 0x6bdedc4aLU, 0x947026ebLU, 0xc1d1704fLU,
|
||||
0x7125e1d8LU, 0x2484b77cLU, 0xdb2a4dddLU, 0x8e8b1b79LU, 0x683bf4d2LU, 0x3d9aa276LU, 0xc23458d7LU, 0x97950e73LU,
|
||||
0x00000000LU, 0x55a156a4LU, 0xaa0fac05LU, 0xffaefaa1LU, 0x191e150aLU, 0x4cbf43aeLU, 0xb311b90fLU, 0xe6b0efabLU,
|
||||
0x323c2a14LU, 0x679d7cb0LU, 0x98338611LU, 0xcd92d0b5LU, 0x2b223f1eLU, 0x7e8369baLU, 0x812d931bLU, 0xd48cc5bfLU,
|
||||
0x64785428LU, 0x31d9028cLU, 0xce77f82dLU, 0x9bd6ae89LU, 0x7d664122LU, 0x28c71786LU, 0xd769ed27LU, 0x82c8bb83LU,
|
||||
0x56447e3cLU, 0x03e52898LU, 0xfc4bd239LU, 0xa9ea849dLU, 0x4f5a6b36LU, 0x1afb3d92LU, 0xe555c733LU, 0xb0f49197LU,
|
||||
0xc8f0a850LU, 0x9d51fef4LU, 0x62ff0455LU, 0x375e52f1LU, 0xd1eebd5aLU, 0x844febfeLU, 0x7be1115fLU, 0x2e4047fbLU,
|
||||
0xfacc8244LU, 0xaf6dd4e0LU, 0x50c32e41LU, 0x056278e5LU, 0xe3d2974eLU, 0xb673c1eaLU, 0x49dd3b4bLU, 0x1c7c6defLU,
|
||||
0xac88fc78LU, 0xf929aadcLU, 0x0687507dLU, 0x532606d9LU, 0xb596e972LU, 0xe037bfd6LU, 0x1f994577LU, 0x4a3813d3LU,
|
||||
0x9eb4d66cLU, 0xcb1580c8LU, 0x34bb7a69LU, 0x611a2ccdLU, 0x87aac366LU, 0xd20b95c2LU, 0x2da56f63LU, 0x780439c7LU,
|
||||
0xddad1da0LU, 0x880c4b04LU, 0x77a2b1a5LU, 0x2203e701LU, 0xc4b308aaLU, 0x91125e0eLU, 0x6ebca4afLU, 0x3b1df20bLU,
|
||||
0xef9137b4LU, 0xba306110LU, 0x459e9bb1LU, 0x103fcd15LU, 0xf68f22beLU, 0xa32e741aLU, 0x5c808ebbLU, 0x0921d81fLU,
|
||||
0xb9d54988LU, 0xec741f2cLU, 0x13dae58dLU, 0x467bb329LU, 0xa0cb5c82LU, 0xf56a0a26LU, 0x0ac4f087LU, 0x5f65a623LU,
|
||||
0x8be9639cLU, 0xde483538LU, 0x21e6cf99LU, 0x7447993dLU, 0x92f77696LU, 0xc7562032LU, 0x38f8da93LU, 0x6d598c37LU,
|
||||
0x155db5f0LU, 0x40fce354LU, 0xbf5219f5LU, 0xeaf34f51LU, 0x0c43a0faLU, 0x59e2f65eLU, 0xa64c0cffLU, 0xf3ed5a5bLU,
|
||||
0x27619fe4LU, 0x72c0c940LU, 0x8d6e33e1LU, 0xd8cf6545LU, 0x3e7f8aeeLU, 0x6bdedc4aLU, 0x947026ebLU, 0xc1d1704fLU,
|
||||
0x7125e1d8LU, 0x2484b77cLU, 0xdb2a4dddLU, 0x8e8b1b79LU, 0x683bf4d2LU, 0x3d9aa276LU, 0xc23458d7LU, 0x97950e73LU,
|
||||
0x4319cbccLU, 0x16b89d68LU, 0xe91667c9LU, 0xbcb7316dLU, 0x5a07dec6LU, 0x0fa68862LU, 0xf00872c3LU, 0xa5a92467LU,
|
||||
0xf7173a0dLU, 0xa2b66ca9LU, 0x5d189608LU, 0x08b9c0acLU, 0xee092f07LU, 0xbba879a3LU, 0x44068302LU, 0x11a7d5a6LU,
|
||||
0xc52b1019LU, 0x908a46bdLU, 0x6f24bc1cLU, 0x3a85eab8LU, 0xdc350513LU, 0x899453b7LU, 0x763aa916LU, 0x239bffb2LU,
|
||||
0x936f6e25LU, 0xc6ce3881LU, 0x3960c220LU, 0x6cc19484LU, 0x8a717b2fLU, 0xdfd02d8bLU, 0x207ed72aLU, 0x75df818eLU,
|
||||
0xf7173a0dLU, 0xa2b66ca9LU, 0x5d189608LU, 0x08b9c0acLU, 0xee092f07LU, 0xbba879a3LU, 0x44068302LU, 0x11a7d5a6LU,
|
||||
0xc52b1019LU, 0x908a46bdLU, 0x6f24bc1cLU, 0x3a85eab8LU, 0xdc350513LU, 0x899453b7LU, 0x763aa916LU, 0x239bffb2LU,
|
||||
0x936f6e25LU, 0xc6ce3881LU, 0x3960c220LU, 0x6cc19484LU, 0x8a717b2fLU, 0xdfd02d8bLU, 0x207ed72aLU, 0x75df818eLU,
|
||||
0xa1534431LU, 0xf4f21295LU, 0x0b5ce834LU, 0x5efdbe90LU, 0xb84d513bLU, 0xedec079fLU, 0x1242fd3eLU, 0x47e3ab9aLU,
|
||||
0x3fe7925dLU, 0x6a46c4f9LU, 0x95e83e58LU, 0xc04968fcLU, 0x26f98757LU, 0x7358d1f3LU, 0x8cf62b52LU, 0xd9577df6LU,
|
||||
0x3fe7925dLU, 0x6a46c4f9LU, 0x95e83e58LU, 0xc04968fcLU, 0x26f98757LU, 0x7358d1f3LU, 0x8cf62b52LU, 0xd9577df6LU,
|
||||
0x0ddbb849LU, 0x587aeeedLU, 0xa7d4144cLU, 0xf27542e8LU, 0x14c5ad43LU, 0x4164fbe7LU, 0xbeca0146LU, 0xeb6b57e2LU,
|
||||
0x5b9fc675LU, 0x0e3e90d1LU, 0xf1906a70LU, 0xa4313cd4LU, 0x4281d37fLU, 0x172085dbLU, 0xe88e7f7aLU, 0xbd2f29deLU,
|
||||
0x69a3ec61LU, 0x3c02bac5LU, 0xc3ac4064LU, 0x960d16c0LU, 0x70bdf96bLU, 0x251cafcfLU, 0xdab2556eLU, 0x8f1303caLU,
|
||||
0x2aba27adLU, 0x7f1b7109LU, 0x80b58ba8LU, 0xd514dd0cLU, 0x33a432a7LU, 0x66056403LU, 0x99ab9ea2LU, 0xcc0ac806LU,
|
||||
0x18860db9LU, 0x4d275b1dLU, 0xb289a1bcLU, 0xe728f718LU, 0x019818b3LU, 0x54394e17LU, 0xab97b4b6LU, 0xfe36e212LU,
|
||||
0x4ec27385LU, 0x1b632521LU, 0xe4cddf80LU, 0xb16c8924LU, 0x57dc668fLU, 0x027d302bLU, 0xfdd3ca8aLU, 0xa8729c2eLU,
|
||||
0x7cfe5991LU, 0x295f0f35LU, 0xd6f1f594LU, 0x8350a330LU, 0x65e04c9bLU, 0x30411a3fLU, 0xcfefe09eLU, 0x9a4eb63aLU,
|
||||
0xe24a8ffdLU, 0xb7ebd959LU, 0x484523f8LU, 0x1de4755cLU, 0xfb549af7LU, 0xaef5cc53LU, 0x515b36f2LU, 0x04fa6056LU,
|
||||
0xd076a5e9LU, 0x85d7f34dLU, 0x7a7909ecLU, 0x2fd85f48LU, 0xc968b0e3LU, 0x9cc9e647LU, 0x63671ce6LU, 0x36c64a42LU,
|
||||
0x8632dbd5LU, 0xd3938d71LU, 0x2c3d77d0LU, 0x799c2174LU, 0x9f2ccedfLU, 0xca8d987bLU, 0x352362daLU, 0x6082347eLU,
|
||||
0xb40ef1c1LU, 0xe1afa765LU, 0x1e015dc4LU, 0x4ba00b60LU, 0xad10e4cbLU, 0xf8b1b26fLU, 0x071f48ceLU, 0x52be1e6aLU };
|
||||
0x5b9fc675LU, 0x0e3e90d1LU, 0xf1906a70LU, 0xa4313cd4LU, 0x4281d37fLU, 0x172085dbLU, 0xe88e7f7aLU, 0xbd2f29deLU,
|
||||
0x69a3ec61LU, 0x3c02bac5LU, 0xc3ac4064LU, 0x960d16c0LU, 0x70bdf96bLU, 0x251cafcfLU, 0xdab2556eLU, 0x8f1303caLU,
|
||||
0x2aba27adLU, 0x7f1b7109LU, 0x80b58ba8LU, 0xd514dd0cLU, 0x33a432a7LU, 0x66056403LU, 0x99ab9ea2LU, 0xcc0ac806LU,
|
||||
0x18860db9LU, 0x4d275b1dLU, 0xb289a1bcLU, 0xe728f718LU, 0x019818b3LU, 0x54394e17LU, 0xab97b4b6LU, 0xfe36e212LU,
|
||||
0x4ec27385LU, 0x1b632521LU, 0xe4cddf80LU, 0xb16c8924LU, 0x57dc668fLU, 0x027d302bLU, 0xfdd3ca8aLU, 0xa8729c2eLU,
|
||||
0x7cfe5991LU, 0x295f0f35LU, 0xd6f1f594LU, 0x8350a330LU, 0x65e04c9bLU, 0x30411a3fLU, 0xcfefe09eLU, 0x9a4eb63aLU,
|
||||
0xe24a8ffdLU, 0xb7ebd959LU, 0x484523f8LU, 0x1de4755cLU, 0xfb549af7LU, 0xaef5cc53LU, 0x515b36f2LU, 0x04fa6056LU,
|
||||
0xd076a5e9LU, 0x85d7f34dLU, 0x7a7909ecLU, 0x2fd85f48LU, 0xc968b0e3LU, 0x9cc9e647LU, 0x63671ce6LU, 0x36c64a42LU,
|
||||
0x8632dbd5LU, 0xd3938d71LU, 0x2c3d77d0LU, 0x799c2174LU, 0x9f2ccedfLU, 0xca8d987bLU, 0x352362daLU, 0x6082347eLU,
|
||||
0xb40ef1c1LU, 0xe1afa765LU, 0x1e015dc4LU, 0x4ba00b60LU, 0xad10e4cbLU, 0xf8b1b26fLU, 0x071f48ceLU, 0x52be1e6aLU };
|
||||
|
||||
static const ulong32 rs_tab2[256] = {
|
||||
0x00000000LU, 0x87fc8255LU, 0x43b549aaLU, 0xc449cbffLU, 0x86279219LU, 0x01db104cLU, 0xc592dbb3LU, 0x426e59e6LU,
|
||||
0x414e6932LU, 0xc6b2eb67LU, 0x02fb2098LU, 0x8507a2cdLU, 0xc769fb2bLU, 0x4095797eLU, 0x84dcb281LU, 0x032030d4LU,
|
||||
0x829cd264LU, 0x05605031LU, 0xc1299bceLU, 0x46d5199bLU, 0x04bb407dLU, 0x8347c228LU, 0x470e09d7LU, 0xc0f28b82LU,
|
||||
0xc3d2bb56LU, 0x442e3903LU, 0x8067f2fcLU, 0x079b70a9LU, 0x45f5294fLU, 0xc209ab1aLU, 0x064060e5LU, 0x81bce2b0LU,
|
||||
0x4975e9c8LU, 0xce896b9dLU, 0x0ac0a062LU, 0x8d3c2237LU, 0xcf527bd1LU, 0x48aef984LU, 0x8ce7327bLU, 0x0b1bb02eLU,
|
||||
0x083b80faLU, 0x8fc702afLU, 0x4b8ec950LU, 0xcc724b05LU, 0x8e1c12e3LU, 0x09e090b6LU, 0xcda95b49LU, 0x4a55d91cLU,
|
||||
0xcbe93bacLU, 0x4c15b9f9LU, 0x885c7206LU, 0x0fa0f053LU, 0x4dcea9b5LU, 0xca322be0LU, 0x0e7be01fLU, 0x8987624aLU,
|
||||
0x8aa7529eLU, 0x0d5bd0cbLU, 0xc9121b34LU, 0x4eee9961LU, 0x0c80c087LU, 0x8b7c42d2LU, 0x4f35892dLU, 0xc8c90b78LU,
|
||||
0x92ea9fddLU, 0x15161d88LU, 0xd15fd677LU, 0x56a35422LU, 0x14cd0dc4LU, 0x93318f91LU, 0x5778446eLU, 0xd084c63bLU,
|
||||
0xd3a4f6efLU, 0x545874baLU, 0x9011bf45LU, 0x17ed3d10LU, 0x558364f6LU, 0xd27fe6a3LU, 0x16362d5cLU, 0x91caaf09LU,
|
||||
0x10764db9LU, 0x978acfecLU, 0x53c30413LU, 0xd43f8646LU, 0x9651dfa0LU, 0x11ad5df5LU, 0xd5e4960aLU, 0x5218145fLU,
|
||||
0x5138248bLU, 0xd6c4a6deLU, 0x128d6d21LU, 0x9571ef74LU, 0xd71fb692LU, 0x50e334c7LU, 0x94aaff38LU, 0x13567d6dLU,
|
||||
0xdb9f7615LU, 0x5c63f440LU, 0x982a3fbfLU, 0x1fd6bdeaLU, 0x5db8e40cLU, 0xda446659LU, 0x1e0dada6LU, 0x99f12ff3LU,
|
||||
0x9ad11f27LU, 0x1d2d9d72LU, 0xd964568dLU, 0x5e98d4d8LU, 0x1cf68d3eLU, 0x9b0a0f6bLU, 0x5f43c494LU, 0xd8bf46c1LU,
|
||||
0x5903a471LU, 0xdeff2624LU, 0x1ab6eddbLU, 0x9d4a6f8eLU, 0xdf243668LU, 0x58d8b43dLU, 0x9c917fc2LU, 0x1b6dfd97LU,
|
||||
0x184dcd43LU, 0x9fb14f16LU, 0x5bf884e9LU, 0xdc0406bcLU, 0x9e6a5f5aLU, 0x1996dd0fLU, 0xdddf16f0LU, 0x5a2394a5LU,
|
||||
0x699973f7LU, 0xee65f1a2LU, 0x2a2c3a5dLU, 0xadd0b808LU, 0xefbee1eeLU, 0x684263bbLU, 0xac0ba844LU, 0x2bf72a11LU,
|
||||
0x28d71ac5LU, 0xaf2b9890LU, 0x6b62536fLU, 0xec9ed13aLU, 0xaef088dcLU, 0x290c0a89LU, 0xed45c176LU, 0x6ab94323LU,
|
||||
0xeb05a193LU, 0x6cf923c6LU, 0xa8b0e839LU, 0x2f4c6a6cLU, 0x6d22338aLU, 0xeadeb1dfLU, 0x2e977a20LU, 0xa96bf875LU,
|
||||
0xaa4bc8a1LU, 0x2db74af4LU, 0xe9fe810bLU, 0x6e02035eLU, 0x2c6c5ab8LU, 0xab90d8edLU, 0x6fd91312LU, 0xe8259147LU,
|
||||
0x20ec9a3fLU, 0xa710186aLU, 0x6359d395LU, 0xe4a551c0LU, 0xa6cb0826LU, 0x21378a73LU, 0xe57e418cLU, 0x6282c3d9LU,
|
||||
0x61a2f30dLU, 0xe65e7158LU, 0x2217baa7LU, 0xa5eb38f2LU, 0xe7856114LU, 0x6079e341LU, 0xa43028beLU, 0x23ccaaebLU,
|
||||
0xa270485bLU, 0x258cca0eLU, 0xe1c501f1LU, 0x663983a4LU, 0x2457da42LU, 0xa3ab5817LU, 0x67e293e8LU, 0xe01e11bdLU,
|
||||
0xe33e2169LU, 0x64c2a33cLU, 0xa08b68c3LU, 0x2777ea96LU, 0x6519b370LU, 0xe2e53125LU, 0x26acfadaLU, 0xa150788fLU,
|
||||
0xfb73ec2aLU, 0x7c8f6e7fLU, 0xb8c6a580LU, 0x3f3a27d5LU, 0x7d547e33LU, 0xfaa8fc66LU, 0x3ee13799LU, 0xb91db5ccLU,
|
||||
0xba3d8518LU, 0x3dc1074dLU, 0xf988ccb2LU, 0x7e744ee7LU, 0x3c1a1701LU, 0xbbe69554LU, 0x7faf5eabLU, 0xf853dcfeLU,
|
||||
0x79ef3e4eLU, 0xfe13bc1bLU, 0x3a5a77e4LU, 0xbda6f5b1LU, 0xffc8ac57LU, 0x78342e02LU, 0xbc7de5fdLU, 0x3b8167a8LU,
|
||||
0x38a1577cLU, 0xbf5dd529LU, 0x7b141ed6LU, 0xfce89c83LU, 0xbe86c565LU, 0x397a4730LU, 0xfd338ccfLU, 0x7acf0e9aLU,
|
||||
0xb20605e2LU, 0x35fa87b7LU, 0xf1b34c48LU, 0x764fce1dLU, 0x342197fbLU, 0xb3dd15aeLU, 0x7794de51LU, 0xf0685c04LU,
|
||||
0xf3486cd0LU, 0x74b4ee85LU, 0xb0fd257aLU, 0x3701a72fLU, 0x756ffec9LU, 0xf2937c9cLU, 0x36dab763LU, 0xb1263536LU,
|
||||
0x309ad786LU, 0xb76655d3LU, 0x732f9e2cLU, 0xf4d31c79LU, 0xb6bd459fLU, 0x3141c7caLU, 0xf5080c35LU, 0x72f48e60LU,
|
||||
0x71d4beb4LU, 0xf6283ce1LU, 0x3261f71eLU, 0xb59d754bLU, 0xf7f32cadLU, 0x700faef8LU, 0xb4466507LU, 0x33bae752LU };
|
||||
0x00000000LU, 0x87fc8255LU, 0x43b549aaLU, 0xc449cbffLU, 0x86279219LU, 0x01db104cLU, 0xc592dbb3LU, 0x426e59e6LU,
|
||||
0x414e6932LU, 0xc6b2eb67LU, 0x02fb2098LU, 0x8507a2cdLU, 0xc769fb2bLU, 0x4095797eLU, 0x84dcb281LU, 0x032030d4LU,
|
||||
0x829cd264LU, 0x05605031LU, 0xc1299bceLU, 0x46d5199bLU, 0x04bb407dLU, 0x8347c228LU, 0x470e09d7LU, 0xc0f28b82LU,
|
||||
0xc3d2bb56LU, 0x442e3903LU, 0x8067f2fcLU, 0x079b70a9LU, 0x45f5294fLU, 0xc209ab1aLU, 0x064060e5LU, 0x81bce2b0LU,
|
||||
0x4975e9c8LU, 0xce896b9dLU, 0x0ac0a062LU, 0x8d3c2237LU, 0xcf527bd1LU, 0x48aef984LU, 0x8ce7327bLU, 0x0b1bb02eLU,
|
||||
0x083b80faLU, 0x8fc702afLU, 0x4b8ec950LU, 0xcc724b05LU, 0x8e1c12e3LU, 0x09e090b6LU, 0xcda95b49LU, 0x4a55d91cLU,
|
||||
0xcbe93bacLU, 0x4c15b9f9LU, 0x885c7206LU, 0x0fa0f053LU, 0x4dcea9b5LU, 0xca322be0LU, 0x0e7be01fLU, 0x8987624aLU,
|
||||
0x8aa7529eLU, 0x0d5bd0cbLU, 0xc9121b34LU, 0x4eee9961LU, 0x0c80c087LU, 0x8b7c42d2LU, 0x4f35892dLU, 0xc8c90b78LU,
|
||||
0x92ea9fddLU, 0x15161d88LU, 0xd15fd677LU, 0x56a35422LU, 0x14cd0dc4LU, 0x93318f91LU, 0x5778446eLU, 0xd084c63bLU,
|
||||
0xd3a4f6efLU, 0x545874baLU, 0x9011bf45LU, 0x17ed3d10LU, 0x558364f6LU, 0xd27fe6a3LU, 0x16362d5cLU, 0x91caaf09LU,
|
||||
0x10764db9LU, 0x978acfecLU, 0x53c30413LU, 0xd43f8646LU, 0x9651dfa0LU, 0x11ad5df5LU, 0xd5e4960aLU, 0x5218145fLU,
|
||||
0x5138248bLU, 0xd6c4a6deLU, 0x128d6d21LU, 0x9571ef74LU, 0xd71fb692LU, 0x50e334c7LU, 0x94aaff38LU, 0x13567d6dLU,
|
||||
0xdb9f7615LU, 0x5c63f440LU, 0x982a3fbfLU, 0x1fd6bdeaLU, 0x5db8e40cLU, 0xda446659LU, 0x1e0dada6LU, 0x99f12ff3LU,
|
||||
0x9ad11f27LU, 0x1d2d9d72LU, 0xd964568dLU, 0x5e98d4d8LU, 0x1cf68d3eLU, 0x9b0a0f6bLU, 0x5f43c494LU, 0xd8bf46c1LU,
|
||||
0x5903a471LU, 0xdeff2624LU, 0x1ab6eddbLU, 0x9d4a6f8eLU, 0xdf243668LU, 0x58d8b43dLU, 0x9c917fc2LU, 0x1b6dfd97LU,
|
||||
0x184dcd43LU, 0x9fb14f16LU, 0x5bf884e9LU, 0xdc0406bcLU, 0x9e6a5f5aLU, 0x1996dd0fLU, 0xdddf16f0LU, 0x5a2394a5LU,
|
||||
0x699973f7LU, 0xee65f1a2LU, 0x2a2c3a5dLU, 0xadd0b808LU, 0xefbee1eeLU, 0x684263bbLU, 0xac0ba844LU, 0x2bf72a11LU,
|
||||
0x28d71ac5LU, 0xaf2b9890LU, 0x6b62536fLU, 0xec9ed13aLU, 0xaef088dcLU, 0x290c0a89LU, 0xed45c176LU, 0x6ab94323LU,
|
||||
0xeb05a193LU, 0x6cf923c6LU, 0xa8b0e839LU, 0x2f4c6a6cLU, 0x6d22338aLU, 0xeadeb1dfLU, 0x2e977a20LU, 0xa96bf875LU,
|
||||
0xaa4bc8a1LU, 0x2db74af4LU, 0xe9fe810bLU, 0x6e02035eLU, 0x2c6c5ab8LU, 0xab90d8edLU, 0x6fd91312LU, 0xe8259147LU,
|
||||
0x20ec9a3fLU, 0xa710186aLU, 0x6359d395LU, 0xe4a551c0LU, 0xa6cb0826LU, 0x21378a73LU, 0xe57e418cLU, 0x6282c3d9LU,
|
||||
0x61a2f30dLU, 0xe65e7158LU, 0x2217baa7LU, 0xa5eb38f2LU, 0xe7856114LU, 0x6079e341LU, 0xa43028beLU, 0x23ccaaebLU,
|
||||
0xa270485bLU, 0x258cca0eLU, 0xe1c501f1LU, 0x663983a4LU, 0x2457da42LU, 0xa3ab5817LU, 0x67e293e8LU, 0xe01e11bdLU,
|
||||
0xe33e2169LU, 0x64c2a33cLU, 0xa08b68c3LU, 0x2777ea96LU, 0x6519b370LU, 0xe2e53125LU, 0x26acfadaLU, 0xa150788fLU,
|
||||
0xfb73ec2aLU, 0x7c8f6e7fLU, 0xb8c6a580LU, 0x3f3a27d5LU, 0x7d547e33LU, 0xfaa8fc66LU, 0x3ee13799LU, 0xb91db5ccLU,
|
||||
0xba3d8518LU, 0x3dc1074dLU, 0xf988ccb2LU, 0x7e744ee7LU, 0x3c1a1701LU, 0xbbe69554LU, 0x7faf5eabLU, 0xf853dcfeLU,
|
||||
0x79ef3e4eLU, 0xfe13bc1bLU, 0x3a5a77e4LU, 0xbda6f5b1LU, 0xffc8ac57LU, 0x78342e02LU, 0xbc7de5fdLU, 0x3b8167a8LU,
|
||||
0x38a1577cLU, 0xbf5dd529LU, 0x7b141ed6LU, 0xfce89c83LU, 0xbe86c565LU, 0x397a4730LU, 0xfd338ccfLU, 0x7acf0e9aLU,
|
||||
0xb20605e2LU, 0x35fa87b7LU, 0xf1b34c48LU, 0x764fce1dLU, 0x342197fbLU, 0xb3dd15aeLU, 0x7794de51LU, 0xf0685c04LU,
|
||||
0xf3486cd0LU, 0x74b4ee85LU, 0xb0fd257aLU, 0x3701a72fLU, 0x756ffec9LU, 0xf2937c9cLU, 0x36dab763LU, 0xb1263536LU,
|
||||
0x309ad786LU, 0xb76655d3LU, 0x732f9e2cLU, 0xf4d31c79LU, 0xb6bd459fLU, 0x3141c7caLU, 0xf5080c35LU, 0x72f48e60LU,
|
||||
0x71d4beb4LU, 0xf6283ce1LU, 0x3261f71eLU, 0xb59d754bLU, 0xf7f32cadLU, 0x700faef8LU, 0xb4466507LU, 0x33bae752LU };
|
||||
|
||||
static const ulong32 rs_tab3[256] = {
|
||||
0x00000000LU, 0x5ac1f387LU, 0xb4cfab43LU, 0xee0e58c4LU, 0x25d31b86LU, 0x7f12e801LU, 0x911cb0c5LU, 0xcbdd4342LU,
|
||||
0x4aeb3641LU, 0x102ac5c6LU, 0xfe249d02LU, 0xa4e56e85LU, 0x6f382dc7LU, 0x35f9de40LU, 0xdbf78684LU, 0x81367503LU,
|
||||
0x949b6c82LU, 0xce5a9f05LU, 0x2054c7c1LU, 0x7a953446LU, 0xb1487704LU, 0xeb898483LU, 0x0587dc47LU, 0x5f462fc0LU,
|
||||
0x00000000LU, 0x5ac1f387LU, 0xb4cfab43LU, 0xee0e58c4LU, 0x25d31b86LU, 0x7f12e801LU, 0x911cb0c5LU, 0xcbdd4342LU,
|
||||
0x4aeb3641LU, 0x102ac5c6LU, 0xfe249d02LU, 0xa4e56e85LU, 0x6f382dc7LU, 0x35f9de40LU, 0xdbf78684LU, 0x81367503LU,
|
||||
0x949b6c82LU, 0xce5a9f05LU, 0x2054c7c1LU, 0x7a953446LU, 0xb1487704LU, 0xeb898483LU, 0x0587dc47LU, 0x5f462fc0LU,
|
||||
0xde705ac3LU, 0x84b1a944LU, 0x6abff180LU, 0x307e0207LU, 0xfba34145LU, 0xa162b2c2LU, 0x4f6cea06LU, 0x15ad1981LU,
|
||||
0x657bd849LU, 0x3fba2bceLU, 0xd1b4730aLU, 0x8b75808dLU, 0x40a8c3cfLU, 0x1a693048LU, 0xf467688cLU, 0xaea69b0bLU,
|
||||
0x2f90ee08LU, 0x75511d8fLU, 0x9b5f454bLU, 0xc19eb6ccLU, 0x0a43f58eLU, 0x50820609LU, 0xbe8c5ecdLU, 0xe44dad4aLU,
|
||||
0xf1e0b4cbLU, 0xab21474cLU, 0x452f1f88LU, 0x1feeec0fLU, 0xd433af4dLU, 0x8ef25ccaLU, 0x60fc040eLU, 0x3a3df789LU,
|
||||
0xbb0b828aLU, 0xe1ca710dLU, 0x0fc429c9LU, 0x5505da4eLU, 0x9ed8990cLU, 0xc4196a8bLU, 0x2a17324fLU, 0x70d6c1c8LU,
|
||||
0xcaf6fd92LU, 0x90370e15LU, 0x7e3956d1LU, 0x24f8a556LU, 0xef25e614LU, 0xb5e41593LU, 0x5bea4d57LU, 0x012bbed0LU,
|
||||
0x657bd849LU, 0x3fba2bceLU, 0xd1b4730aLU, 0x8b75808dLU, 0x40a8c3cfLU, 0x1a693048LU, 0xf467688cLU, 0xaea69b0bLU,
|
||||
0x2f90ee08LU, 0x75511d8fLU, 0x9b5f454bLU, 0xc19eb6ccLU, 0x0a43f58eLU, 0x50820609LU, 0xbe8c5ecdLU, 0xe44dad4aLU,
|
||||
0xf1e0b4cbLU, 0xab21474cLU, 0x452f1f88LU, 0x1feeec0fLU, 0xd433af4dLU, 0x8ef25ccaLU, 0x60fc040eLU, 0x3a3df789LU,
|
||||
0xbb0b828aLU, 0xe1ca710dLU, 0x0fc429c9LU, 0x5505da4eLU, 0x9ed8990cLU, 0xc4196a8bLU, 0x2a17324fLU, 0x70d6c1c8LU,
|
||||
0xcaf6fd92LU, 0x90370e15LU, 0x7e3956d1LU, 0x24f8a556LU, 0xef25e614LU, 0xb5e41593LU, 0x5bea4d57LU, 0x012bbed0LU,
|
||||
0x801dcbd3LU, 0xdadc3854LU, 0x34d26090LU, 0x6e139317LU, 0xa5ced055LU, 0xff0f23d2LU, 0x11017b16LU, 0x4bc08891LU,
|
||||
0x5e6d9110LU, 0x04ac6297LU, 0xeaa23a53LU, 0xb063c9d4LU, 0x7bbe8a96LU, 0x217f7911LU, 0xcf7121d5LU, 0x95b0d252LU,
|
||||
0x1486a751LU, 0x4e4754d6LU, 0xa0490c12LU, 0xfa88ff95LU, 0x3155bcd7LU, 0x6b944f50LU, 0x859a1794LU, 0xdf5be413LU,
|
||||
0x5e6d9110LU, 0x04ac6297LU, 0xeaa23a53LU, 0xb063c9d4LU, 0x7bbe8a96LU, 0x217f7911LU, 0xcf7121d5LU, 0x95b0d252LU,
|
||||
0x1486a751LU, 0x4e4754d6LU, 0xa0490c12LU, 0xfa88ff95LU, 0x3155bcd7LU, 0x6b944f50LU, 0x859a1794LU, 0xdf5be413LU,
|
||||
0xaf8d25dbLU, 0xf54cd65cLU, 0x1b428e98LU, 0x41837d1fLU, 0x8a5e3e5dLU, 0xd09fcddaLU, 0x3e91951eLU, 0x64506699LU,
|
||||
0xe566139aLU, 0xbfa7e01dLU, 0x51a9b8d9LU, 0x0b684b5eLU, 0xc0b5081cLU, 0x9a74fb9bLU, 0x747aa35fLU, 0x2ebb50d8LU,
|
||||
0x3b164959LU, 0x61d7badeLU, 0x8fd9e21aLU, 0xd518119dLU, 0x1ec552dfLU, 0x4404a158LU, 0xaa0af99cLU, 0xf0cb0a1bLU,
|
||||
0x71fd7f18LU, 0x2b3c8c9fLU, 0xc532d45bLU, 0x9ff327dcLU, 0x542e649eLU, 0x0eef9719LU, 0xe0e1cfddLU, 0xba203c5aLU,
|
||||
0xd9a1b769LU, 0x836044eeLU, 0x6d6e1c2aLU, 0x37afefadLU, 0xfc72acefLU, 0xa6b35f68LU, 0x48bd07acLU, 0x127cf42bLU,
|
||||
0x934a8128LU, 0xc98b72afLU, 0x27852a6bLU, 0x7d44d9ecLU, 0xb6999aaeLU, 0xec586929LU, 0x025631edLU, 0x5897c26aLU,
|
||||
0x4d3adbebLU, 0x17fb286cLU, 0xf9f570a8LU, 0xa334832fLU, 0x68e9c06dLU, 0x322833eaLU, 0xdc266b2eLU, 0x86e798a9LU,
|
||||
0x07d1edaaLU, 0x5d101e2dLU, 0xb31e46e9LU, 0xe9dfb56eLU, 0x2202f62cLU, 0x78c305abLU, 0x96cd5d6fLU, 0xcc0caee8LU,
|
||||
0xbcda6f20LU, 0xe61b9ca7LU, 0x0815c463LU, 0x52d437e4LU, 0x990974a6LU, 0xc3c88721LU, 0x2dc6dfe5LU, 0x77072c62LU,
|
||||
0xf6315961LU, 0xacf0aae6LU, 0x42fef222LU, 0x183f01a5LU, 0xd3e242e7LU, 0x8923b160LU, 0x672de9a4LU, 0x3dec1a23LU,
|
||||
0x284103a2LU, 0x7280f025LU, 0x9c8ea8e1LU, 0xc64f5b66LU, 0x0d921824LU, 0x5753eba3LU, 0xb95db367LU, 0xe39c40e0LU,
|
||||
0x62aa35e3LU, 0x386bc664LU, 0xd6659ea0LU, 0x8ca46d27LU, 0x47792e65LU, 0x1db8dde2LU, 0xf3b68526LU, 0xa97776a1LU,
|
||||
0x13574afbLU, 0x4996b97cLU, 0xa798e1b8LU, 0xfd59123fLU, 0x3684517dLU, 0x6c45a2faLU, 0x824bfa3eLU, 0xd88a09b9LU,
|
||||
0x59bc7cbaLU, 0x037d8f3dLU, 0xed73d7f9LU, 0xb7b2247eLU, 0x7c6f673cLU, 0x26ae94bbLU, 0xc8a0cc7fLU, 0x92613ff8LU,
|
||||
0x87cc2679LU, 0xdd0dd5feLU, 0x33038d3aLU, 0x69c27ebdLU, 0xa21f3dffLU, 0xf8dece78LU, 0x16d096bcLU, 0x4c11653bLU,
|
||||
0xcd271038LU, 0x97e6e3bfLU, 0x79e8bb7bLU, 0x232948fcLU, 0xe8f40bbeLU, 0xb235f839LU, 0x5c3ba0fdLU, 0x06fa537aLU,
|
||||
0x762c92b2LU, 0x2ced6135LU, 0xc2e339f1LU, 0x9822ca76LU, 0x53ff8934LU, 0x093e7ab3LU, 0xe7302277LU, 0xbdf1d1f0LU,
|
||||
0x3cc7a4f3LU, 0x66065774LU, 0x88080fb0LU, 0xd2c9fc37LU, 0x1914bf75LU, 0x43d54cf2LU, 0xaddb1436LU, 0xf71ae7b1LU,
|
||||
0xe2b7fe30LU, 0xb8760db7LU, 0x56785573LU, 0x0cb9a6f4LU, 0xc764e5b6LU, 0x9da51631LU, 0x73ab4ef5LU, 0x296abd72LU,
|
||||
0xa85cc871LU, 0xf29d3bf6LU, 0x1c936332LU, 0x465290b5LU, 0x8d8fd3f7LU, 0xd74e2070LU, 0x394078b4LU, 0x63818b33LU };
|
||||
0xe566139aLU, 0xbfa7e01dLU, 0x51a9b8d9LU, 0x0b684b5eLU, 0xc0b5081cLU, 0x9a74fb9bLU, 0x747aa35fLU, 0x2ebb50d8LU,
|
||||
0x3b164959LU, 0x61d7badeLU, 0x8fd9e21aLU, 0xd518119dLU, 0x1ec552dfLU, 0x4404a158LU, 0xaa0af99cLU, 0xf0cb0a1bLU,
|
||||
0x71fd7f18LU, 0x2b3c8c9fLU, 0xc532d45bLU, 0x9ff327dcLU, 0x542e649eLU, 0x0eef9719LU, 0xe0e1cfddLU, 0xba203c5aLU,
|
||||
0xd9a1b769LU, 0x836044eeLU, 0x6d6e1c2aLU, 0x37afefadLU, 0xfc72acefLU, 0xa6b35f68LU, 0x48bd07acLU, 0x127cf42bLU,
|
||||
0x934a8128LU, 0xc98b72afLU, 0x27852a6bLU, 0x7d44d9ecLU, 0xb6999aaeLU, 0xec586929LU, 0x025631edLU, 0x5897c26aLU,
|
||||
0x4d3adbebLU, 0x17fb286cLU, 0xf9f570a8LU, 0xa334832fLU, 0x68e9c06dLU, 0x322833eaLU, 0xdc266b2eLU, 0x86e798a9LU,
|
||||
0x07d1edaaLU, 0x5d101e2dLU, 0xb31e46e9LU, 0xe9dfb56eLU, 0x2202f62cLU, 0x78c305abLU, 0x96cd5d6fLU, 0xcc0caee8LU,
|
||||
0xbcda6f20LU, 0xe61b9ca7LU, 0x0815c463LU, 0x52d437e4LU, 0x990974a6LU, 0xc3c88721LU, 0x2dc6dfe5LU, 0x77072c62LU,
|
||||
0xf6315961LU, 0xacf0aae6LU, 0x42fef222LU, 0x183f01a5LU, 0xd3e242e7LU, 0x8923b160LU, 0x672de9a4LU, 0x3dec1a23LU,
|
||||
0x284103a2LU, 0x7280f025LU, 0x9c8ea8e1LU, 0xc64f5b66LU, 0x0d921824LU, 0x5753eba3LU, 0xb95db367LU, 0xe39c40e0LU,
|
||||
0x62aa35e3LU, 0x386bc664LU, 0xd6659ea0LU, 0x8ca46d27LU, 0x47792e65LU, 0x1db8dde2LU, 0xf3b68526LU, 0xa97776a1LU,
|
||||
0x13574afbLU, 0x4996b97cLU, 0xa798e1b8LU, 0xfd59123fLU, 0x3684517dLU, 0x6c45a2faLU, 0x824bfa3eLU, 0xd88a09b9LU,
|
||||
0x59bc7cbaLU, 0x037d8f3dLU, 0xed73d7f9LU, 0xb7b2247eLU, 0x7c6f673cLU, 0x26ae94bbLU, 0xc8a0cc7fLU, 0x92613ff8LU,
|
||||
0x87cc2679LU, 0xdd0dd5feLU, 0x33038d3aLU, 0x69c27ebdLU, 0xa21f3dffLU, 0xf8dece78LU, 0x16d096bcLU, 0x4c11653bLU,
|
||||
0xcd271038LU, 0x97e6e3bfLU, 0x79e8bb7bLU, 0x232948fcLU, 0xe8f40bbeLU, 0xb235f839LU, 0x5c3ba0fdLU, 0x06fa537aLU,
|
||||
0x762c92b2LU, 0x2ced6135LU, 0xc2e339f1LU, 0x9822ca76LU, 0x53ff8934LU, 0x093e7ab3LU, 0xe7302277LU, 0xbdf1d1f0LU,
|
||||
0x3cc7a4f3LU, 0x66065774LU, 0x88080fb0LU, 0xd2c9fc37LU, 0x1914bf75LU, 0x43d54cf2LU, 0xaddb1436LU, 0xf71ae7b1LU,
|
||||
0xe2b7fe30LU, 0xb8760db7LU, 0x56785573LU, 0x0cb9a6f4LU, 0xc764e5b6LU, 0x9da51631LU, 0x73ab4ef5LU, 0x296abd72LU,
|
||||
0xa85cc871LU, 0xf29d3bf6LU, 0x1c936332LU, 0x465290b5LU, 0x8d8fd3f7LU, 0xd74e2070LU, 0x394078b4LU, 0x63818b33LU };
|
||||
|
||||
static const ulong32 rs_tab4[256] = {
|
||||
0x00000000LU, 0x58471e5aLU, 0xb08e3cb4LU, 0xe8c922eeLU, 0x2d517825LU, 0x7516667fLU, 0x9ddf4491LU, 0xc5985acbLU,
|
||||
0x5aa2f04aLU, 0x02e5ee10LU, 0xea2cccfeLU, 0xb26bd2a4LU, 0x77f3886fLU, 0x2fb49635LU, 0xc77db4dbLU, 0x9f3aaa81LU,
|
||||
0xb409ad94LU, 0xec4eb3ceLU, 0x04879120LU, 0x5cc08f7aLU, 0x9958d5b1LU, 0xc11fcbebLU, 0x29d6e905LU, 0x7191f75fLU,
|
||||
0xeeab5ddeLU, 0xb6ec4384LU, 0x5e25616aLU, 0x06627f30LU, 0xc3fa25fbLU, 0x9bbd3ba1LU, 0x7374194fLU, 0x2b330715LU,
|
||||
0x25121765LU, 0x7d55093fLU, 0x959c2bd1LU, 0xcddb358bLU, 0x08436f40LU, 0x5004711aLU, 0xb8cd53f4LU, 0xe08a4daeLU,
|
||||
0x7fb0e72fLU, 0x27f7f975LU, 0xcf3edb9bLU, 0x9779c5c1LU, 0x52e19f0aLU, 0x0aa68150LU, 0xe26fa3beLU, 0xba28bde4LU,
|
||||
0x911bbaf1LU, 0xc95ca4abLU, 0x21958645LU, 0x79d2981fLU, 0xbc4ac2d4LU, 0xe40ddc8eLU, 0x0cc4fe60LU, 0x5483e03aLU,
|
||||
0xcbb94abbLU, 0x93fe54e1LU, 0x7b37760fLU, 0x23706855LU, 0xe6e8329eLU, 0xbeaf2cc4LU, 0x56660e2aLU, 0x0e211070LU,
|
||||
0x4a242ecaLU, 0x12633090LU, 0xfaaa127eLU, 0xa2ed0c24LU, 0x677556efLU, 0x3f3248b5LU, 0xd7fb6a5bLU, 0x8fbc7401LU,
|
||||
0x1086de80LU, 0x48c1c0daLU, 0xa008e234LU, 0xf84ffc6eLU, 0x3dd7a6a5LU, 0x6590b8ffLU, 0x8d599a11LU, 0xd51e844bLU,
|
||||
0xfe2d835eLU, 0xa66a9d04LU, 0x4ea3bfeaLU, 0x16e4a1b0LU, 0xd37cfb7bLU, 0x8b3be521LU, 0x63f2c7cfLU, 0x3bb5d995LU,
|
||||
0xa48f7314LU, 0xfcc86d4eLU, 0x14014fa0LU, 0x4c4651faLU, 0x89de0b31LU, 0xd199156bLU, 0x39503785LU, 0x611729dfLU,
|
||||
0x6f3639afLU, 0x377127f5LU, 0xdfb8051bLU, 0x87ff1b41LU, 0x4267418aLU, 0x1a205fd0LU, 0xf2e97d3eLU, 0xaaae6364LU,
|
||||
0x3594c9e5LU, 0x6dd3d7bfLU, 0x851af551LU, 0xdd5deb0bLU, 0x18c5b1c0LU, 0x4082af9aLU, 0xa84b8d74LU, 0xf00c932eLU,
|
||||
0xdb3f943bLU, 0x83788a61LU, 0x6bb1a88fLU, 0x33f6b6d5LU, 0xf66eec1eLU, 0xae29f244LU, 0x46e0d0aaLU, 0x1ea7cef0LU,
|
||||
0x819d6471LU, 0xd9da7a2bLU, 0x311358c5LU, 0x6954469fLU, 0xaccc1c54LU, 0xf48b020eLU, 0x1c4220e0LU, 0x44053ebaLU,
|
||||
0x94485cd9LU, 0xcc0f4283LU, 0x24c6606dLU, 0x7c817e37LU, 0xb91924fcLU, 0xe15e3aa6LU, 0x09971848LU, 0x51d00612LU,
|
||||
0xceeaac93LU, 0x96adb2c9LU, 0x7e649027LU, 0x26238e7dLU, 0xe3bbd4b6LU, 0xbbfccaecLU, 0x5335e802LU, 0x0b72f658LU,
|
||||
0x2041f14dLU, 0x7806ef17LU, 0x90cfcdf9LU, 0xc888d3a3LU, 0x0d108968LU, 0x55579732LU, 0xbd9eb5dcLU, 0xe5d9ab86LU,
|
||||
0x7ae30107LU, 0x22a41f5dLU, 0xca6d3db3LU, 0x922a23e9LU, 0x57b27922LU, 0x0ff56778LU, 0xe73c4596LU, 0xbf7b5bccLU,
|
||||
0xb15a4bbcLU, 0xe91d55e6LU, 0x01d47708LU, 0x59936952LU, 0x9c0b3399LU, 0xc44c2dc3LU, 0x2c850f2dLU, 0x74c21177LU,
|
||||
0xebf8bbf6LU, 0xb3bfa5acLU, 0x5b768742LU, 0x03319918LU, 0xc6a9c3d3LU, 0x9eeedd89LU, 0x7627ff67LU, 0x2e60e13dLU,
|
||||
0x0553e628LU, 0x5d14f872LU, 0xb5ddda9cLU, 0xed9ac4c6LU, 0x28029e0dLU, 0x70458057LU, 0x988ca2b9LU, 0xc0cbbce3LU,
|
||||
0x5ff11662LU, 0x07b60838LU, 0xef7f2ad6LU, 0xb738348cLU, 0x72a06e47LU, 0x2ae7701dLU, 0xc22e52f3LU, 0x9a694ca9LU,
|
||||
0xde6c7213LU, 0x862b6c49LU, 0x6ee24ea7LU, 0x36a550fdLU, 0xf33d0a36LU, 0xab7a146cLU, 0x43b33682LU, 0x1bf428d8LU,
|
||||
0x00000000LU, 0x58471e5aLU, 0xb08e3cb4LU, 0xe8c922eeLU, 0x2d517825LU, 0x7516667fLU, 0x9ddf4491LU, 0xc5985acbLU,
|
||||
0x5aa2f04aLU, 0x02e5ee10LU, 0xea2cccfeLU, 0xb26bd2a4LU, 0x77f3886fLU, 0x2fb49635LU, 0xc77db4dbLU, 0x9f3aaa81LU,
|
||||
0xb409ad94LU, 0xec4eb3ceLU, 0x04879120LU, 0x5cc08f7aLU, 0x9958d5b1LU, 0xc11fcbebLU, 0x29d6e905LU, 0x7191f75fLU,
|
||||
0xeeab5ddeLU, 0xb6ec4384LU, 0x5e25616aLU, 0x06627f30LU, 0xc3fa25fbLU, 0x9bbd3ba1LU, 0x7374194fLU, 0x2b330715LU,
|
||||
0x25121765LU, 0x7d55093fLU, 0x959c2bd1LU, 0xcddb358bLU, 0x08436f40LU, 0x5004711aLU, 0xb8cd53f4LU, 0xe08a4daeLU,
|
||||
0x7fb0e72fLU, 0x27f7f975LU, 0xcf3edb9bLU, 0x9779c5c1LU, 0x52e19f0aLU, 0x0aa68150LU, 0xe26fa3beLU, 0xba28bde4LU,
|
||||
0x911bbaf1LU, 0xc95ca4abLU, 0x21958645LU, 0x79d2981fLU, 0xbc4ac2d4LU, 0xe40ddc8eLU, 0x0cc4fe60LU, 0x5483e03aLU,
|
||||
0xcbb94abbLU, 0x93fe54e1LU, 0x7b37760fLU, 0x23706855LU, 0xe6e8329eLU, 0xbeaf2cc4LU, 0x56660e2aLU, 0x0e211070LU,
|
||||
0x4a242ecaLU, 0x12633090LU, 0xfaaa127eLU, 0xa2ed0c24LU, 0x677556efLU, 0x3f3248b5LU, 0xd7fb6a5bLU, 0x8fbc7401LU,
|
||||
0x1086de80LU, 0x48c1c0daLU, 0xa008e234LU, 0xf84ffc6eLU, 0x3dd7a6a5LU, 0x6590b8ffLU, 0x8d599a11LU, 0xd51e844bLU,
|
||||
0xfe2d835eLU, 0xa66a9d04LU, 0x4ea3bfeaLU, 0x16e4a1b0LU, 0xd37cfb7bLU, 0x8b3be521LU, 0x63f2c7cfLU, 0x3bb5d995LU,
|
||||
0xa48f7314LU, 0xfcc86d4eLU, 0x14014fa0LU, 0x4c4651faLU, 0x89de0b31LU, 0xd199156bLU, 0x39503785LU, 0x611729dfLU,
|
||||
0x6f3639afLU, 0x377127f5LU, 0xdfb8051bLU, 0x87ff1b41LU, 0x4267418aLU, 0x1a205fd0LU, 0xf2e97d3eLU, 0xaaae6364LU,
|
||||
0x3594c9e5LU, 0x6dd3d7bfLU, 0x851af551LU, 0xdd5deb0bLU, 0x18c5b1c0LU, 0x4082af9aLU, 0xa84b8d74LU, 0xf00c932eLU,
|
||||
0xdb3f943bLU, 0x83788a61LU, 0x6bb1a88fLU, 0x33f6b6d5LU, 0xf66eec1eLU, 0xae29f244LU, 0x46e0d0aaLU, 0x1ea7cef0LU,
|
||||
0x819d6471LU, 0xd9da7a2bLU, 0x311358c5LU, 0x6954469fLU, 0xaccc1c54LU, 0xf48b020eLU, 0x1c4220e0LU, 0x44053ebaLU,
|
||||
0x94485cd9LU, 0xcc0f4283LU, 0x24c6606dLU, 0x7c817e37LU, 0xb91924fcLU, 0xe15e3aa6LU, 0x09971848LU, 0x51d00612LU,
|
||||
0xceeaac93LU, 0x96adb2c9LU, 0x7e649027LU, 0x26238e7dLU, 0xe3bbd4b6LU, 0xbbfccaecLU, 0x5335e802LU, 0x0b72f658LU,
|
||||
0x2041f14dLU, 0x7806ef17LU, 0x90cfcdf9LU, 0xc888d3a3LU, 0x0d108968LU, 0x55579732LU, 0xbd9eb5dcLU, 0xe5d9ab86LU,
|
||||
0x7ae30107LU, 0x22a41f5dLU, 0xca6d3db3LU, 0x922a23e9LU, 0x57b27922LU, 0x0ff56778LU, 0xe73c4596LU, 0xbf7b5bccLU,
|
||||
0xb15a4bbcLU, 0xe91d55e6LU, 0x01d47708LU, 0x59936952LU, 0x9c0b3399LU, 0xc44c2dc3LU, 0x2c850f2dLU, 0x74c21177LU,
|
||||
0xebf8bbf6LU, 0xb3bfa5acLU, 0x5b768742LU, 0x03319918LU, 0xc6a9c3d3LU, 0x9eeedd89LU, 0x7627ff67LU, 0x2e60e13dLU,
|
||||
0x0553e628LU, 0x5d14f872LU, 0xb5ddda9cLU, 0xed9ac4c6LU, 0x28029e0dLU, 0x70458057LU, 0x988ca2b9LU, 0xc0cbbce3LU,
|
||||
0x5ff11662LU, 0x07b60838LU, 0xef7f2ad6LU, 0xb738348cLU, 0x72a06e47LU, 0x2ae7701dLU, 0xc22e52f3LU, 0x9a694ca9LU,
|
||||
0xde6c7213LU, 0x862b6c49LU, 0x6ee24ea7LU, 0x36a550fdLU, 0xf33d0a36LU, 0xab7a146cLU, 0x43b33682LU, 0x1bf428d8LU,
|
||||
0x84ce8259LU, 0xdc899c03LU, 0x3440beedLU, 0x6c07a0b7LU, 0xa99ffa7cLU, 0xf1d8e426LU, 0x1911c6c8LU, 0x4156d892LU,
|
||||
0x6a65df87LU, 0x3222c1ddLU, 0xdaebe333LU, 0x82acfd69LU, 0x4734a7a2LU, 0x1f73b9f8LU, 0xf7ba9b16LU, 0xaffd854cLU,
|
||||
0x30c72fcdLU, 0x68803197LU, 0x80491379LU, 0xd80e0d23LU, 0x1d9657e8LU, 0x45d149b2LU, 0xad186b5cLU, 0xf55f7506LU,
|
||||
0xfb7e6576LU, 0xa3397b2cLU, 0x4bf059c2LU, 0x13b74798LU, 0xd62f1d53LU, 0x8e680309LU, 0x66a121e7LU, 0x3ee63fbdLU,
|
||||
0xa1dc953cLU, 0xf99b8b66LU, 0x1152a988LU, 0x4915b7d2LU, 0x8c8ded19LU, 0xd4caf343LU, 0x3c03d1adLU, 0x6444cff7LU,
|
||||
0x4f77c8e2LU, 0x1730d6b8LU, 0xfff9f456LU, 0xa7beea0cLU, 0x6226b0c7LU, 0x3a61ae9dLU, 0xd2a88c73LU, 0x8aef9229LU,
|
||||
0x6a65df87LU, 0x3222c1ddLU, 0xdaebe333LU, 0x82acfd69LU, 0x4734a7a2LU, 0x1f73b9f8LU, 0xf7ba9b16LU, 0xaffd854cLU,
|
||||
0x30c72fcdLU, 0x68803197LU, 0x80491379LU, 0xd80e0d23LU, 0x1d9657e8LU, 0x45d149b2LU, 0xad186b5cLU, 0xf55f7506LU,
|
||||
0xfb7e6576LU, 0xa3397b2cLU, 0x4bf059c2LU, 0x13b74798LU, 0xd62f1d53LU, 0x8e680309LU, 0x66a121e7LU, 0x3ee63fbdLU,
|
||||
0xa1dc953cLU, 0xf99b8b66LU, 0x1152a988LU, 0x4915b7d2LU, 0x8c8ded19LU, 0xd4caf343LU, 0x3c03d1adLU, 0x6444cff7LU,
|
||||
0x4f77c8e2LU, 0x1730d6b8LU, 0xfff9f456LU, 0xa7beea0cLU, 0x6226b0c7LU, 0x3a61ae9dLU, 0xd2a88c73LU, 0x8aef9229LU,
|
||||
0x15d538a8LU, 0x4d9226f2LU, 0xa55b041cLU, 0xfd1c1a46LU, 0x3884408dLU, 0x60c35ed7LU, 0x880a7c39LU, 0xd04d6263LU };
|
||||
|
||||
static const ulong32 rs_tab5[256] = {
|
||||
0x00000000LU, 0xdbaec658LU, 0xfb11c1b0LU, 0x20bf07e8LU, 0xbb22cf2dLU, 0x608c0975LU, 0x40330e9dLU, 0x9b9dc8c5LU,
|
||||
0x3b44d35aLU, 0xe0ea1502LU, 0xc05512eaLU, 0x1bfbd4b2LU, 0x80661c77LU, 0x5bc8da2fLU, 0x7b77ddc7LU, 0xa0d91b9fLU,
|
||||
0x7688ebb4LU, 0xad262decLU, 0x8d992a04LU, 0x5637ec5cLU, 0xcdaa2499LU, 0x1604e2c1LU, 0x36bbe529LU, 0xed152371LU,
|
||||
0x4dcc38eeLU, 0x9662feb6LU, 0xb6ddf95eLU, 0x6d733f06LU, 0xf6eef7c3LU, 0x2d40319bLU, 0x0dff3673LU, 0xd651f02bLU,
|
||||
0xec5d9b25LU, 0x37f35d7dLU, 0x174c5a95LU, 0xcce29ccdLU, 0x577f5408LU, 0x8cd19250LU, 0xac6e95b8LU, 0x77c053e0LU,
|
||||
0xd719487fLU, 0x0cb78e27LU, 0x2c0889cfLU, 0xf7a64f97LU, 0x6c3b8752LU, 0xb795410aLU, 0x972a46e2LU, 0x4c8480baLU,
|
||||
0x9ad57091LU, 0x417bb6c9LU, 0x61c4b121LU, 0xba6a7779LU, 0x21f7bfbcLU, 0xfa5979e4LU, 0xdae67e0cLU, 0x0148b854LU,
|
||||
0xa191a3cbLU, 0x7a3f6593LU, 0x5a80627bLU, 0x812ea423LU, 0x1ab36ce6LU, 0xc11daabeLU, 0xe1a2ad56LU, 0x3a0c6b0eLU,
|
||||
0x95ba7b4aLU, 0x4e14bd12LU, 0x6eabbafaLU, 0xb5057ca2LU, 0x2e98b467LU, 0xf536723fLU, 0xd58975d7LU, 0x0e27b38fLU,
|
||||
0xaefea810LU, 0x75506e48LU, 0x55ef69a0LU, 0x8e41aff8LU, 0x15dc673dLU, 0xce72a165LU, 0xeecda68dLU, 0x356360d5LU,
|
||||
0xe33290feLU, 0x389c56a6LU, 0x1823514eLU, 0xc38d9716LU, 0x58105fd3LU, 0x83be998bLU, 0xa3019e63LU, 0x78af583bLU,
|
||||
0xd87643a4LU, 0x03d885fcLU, 0x23678214LU, 0xf8c9444cLU, 0x63548c89LU, 0xb8fa4ad1LU, 0x98454d39LU, 0x43eb8b61LU,
|
||||
0x79e7e06fLU, 0xa2492637LU, 0x82f621dfLU, 0x5958e787LU, 0xc2c52f42LU, 0x196be91aLU, 0x39d4eef2LU, 0xe27a28aaLU,
|
||||
0x42a33335LU, 0x990df56dLU, 0xb9b2f285LU, 0x621c34ddLU, 0xf981fc18LU, 0x222f3a40LU, 0x02903da8LU, 0xd93efbf0LU,
|
||||
0x0f6f0bdbLU, 0xd4c1cd83LU, 0xf47eca6bLU, 0x2fd00c33LU, 0xb44dc4f6LU, 0x6fe302aeLU, 0x4f5c0546LU, 0x94f2c31eLU,
|
||||
0x342bd881LU, 0xef851ed9LU, 0xcf3a1931LU, 0x1494df69LU, 0x8f0917acLU, 0x54a7d1f4LU, 0x7418d61cLU, 0xafb61044LU,
|
||||
0x6739f694LU, 0xbc9730ccLU, 0x9c283724LU, 0x4786f17cLU, 0xdc1b39b9LU, 0x07b5ffe1LU, 0x270af809LU, 0xfca43e51LU,
|
||||
0x5c7d25ceLU, 0x87d3e396LU, 0xa76ce47eLU, 0x7cc22226LU, 0xe75feae3LU, 0x3cf12cbbLU, 0x1c4e2b53LU, 0xc7e0ed0bLU,
|
||||
0x11b11d20LU, 0xca1fdb78LU, 0xeaa0dc90LU, 0x310e1ac8LU, 0xaa93d20dLU, 0x713d1455LU, 0x518213bdLU, 0x8a2cd5e5LU,
|
||||
0x2af5ce7aLU, 0xf15b0822LU, 0xd1e40fcaLU, 0x0a4ac992LU, 0x91d70157LU, 0x4a79c70fLU, 0x6ac6c0e7LU, 0xb16806bfLU,
|
||||
0x8b646db1LU, 0x50caabe9LU, 0x7075ac01LU, 0xabdb6a59LU, 0x3046a29cLU, 0xebe864c4LU, 0xcb57632cLU, 0x10f9a574LU,
|
||||
0xb020beebLU, 0x6b8e78b3LU, 0x4b317f5bLU, 0x909fb903LU, 0x0b0271c6LU, 0xd0acb79eLU, 0xf013b076LU, 0x2bbd762eLU,
|
||||
0xfdec8605LU, 0x2642405dLU, 0x06fd47b5LU, 0xdd5381edLU, 0x46ce4928LU, 0x9d608f70LU, 0xbddf8898LU, 0x66714ec0LU,
|
||||
0xc6a8555fLU, 0x1d069307LU, 0x3db994efLU, 0xe61752b7LU, 0x7d8a9a72LU, 0xa6245c2aLU, 0x869b5bc2LU, 0x5d359d9aLU,
|
||||
0xf2838ddeLU, 0x292d4b86LU, 0x09924c6eLU, 0xd23c8a36LU, 0x49a142f3LU, 0x920f84abLU, 0xb2b08343LU, 0x691e451bLU,
|
||||
0xc9c75e84LU, 0x126998dcLU, 0x32d69f34LU, 0xe978596cLU, 0x72e591a9LU, 0xa94b57f1LU, 0x89f45019LU, 0x525a9641LU,
|
||||
0x840b666aLU, 0x5fa5a032LU, 0x7f1aa7daLU, 0xa4b46182LU, 0x3f29a947LU, 0xe4876f1fLU, 0xc43868f7LU, 0x1f96aeafLU,
|
||||
0xbf4fb530LU, 0x64e17368LU, 0x445e7480LU, 0x9ff0b2d8LU, 0x046d7a1dLU, 0xdfc3bc45LU, 0xff7cbbadLU, 0x24d27df5LU,
|
||||
0x1ede16fbLU, 0xc570d0a3LU, 0xe5cfd74bLU, 0x3e611113LU, 0xa5fcd9d6LU, 0x7e521f8eLU, 0x5eed1866LU, 0x8543de3eLU,
|
||||
0x259ac5a1LU, 0xfe3403f9LU, 0xde8b0411LU, 0x0525c249LU, 0x9eb80a8cLU, 0x4516ccd4LU, 0x65a9cb3cLU, 0xbe070d64LU,
|
||||
0x6856fd4fLU, 0xb3f83b17LU, 0x93473cffLU, 0x48e9faa7LU, 0xd3743262LU, 0x08daf43aLU, 0x2865f3d2LU, 0xf3cb358aLU,
|
||||
0x53122e15LU, 0x88bce84dLU, 0xa803efa5LU, 0x73ad29fdLU, 0xe830e138LU, 0x339e2760LU, 0x13212088LU, 0xc88fe6d0LU };
|
||||
0x00000000LU, 0xdbaec658LU, 0xfb11c1b0LU, 0x20bf07e8LU, 0xbb22cf2dLU, 0x608c0975LU, 0x40330e9dLU, 0x9b9dc8c5LU,
|
||||
0x3b44d35aLU, 0xe0ea1502LU, 0xc05512eaLU, 0x1bfbd4b2LU, 0x80661c77LU, 0x5bc8da2fLU, 0x7b77ddc7LU, 0xa0d91b9fLU,
|
||||
0x7688ebb4LU, 0xad262decLU, 0x8d992a04LU, 0x5637ec5cLU, 0xcdaa2499LU, 0x1604e2c1LU, 0x36bbe529LU, 0xed152371LU,
|
||||
0x4dcc38eeLU, 0x9662feb6LU, 0xb6ddf95eLU, 0x6d733f06LU, 0xf6eef7c3LU, 0x2d40319bLU, 0x0dff3673LU, 0xd651f02bLU,
|
||||
0xec5d9b25LU, 0x37f35d7dLU, 0x174c5a95LU, 0xcce29ccdLU, 0x577f5408LU, 0x8cd19250LU, 0xac6e95b8LU, 0x77c053e0LU,
|
||||
0xd719487fLU, 0x0cb78e27LU, 0x2c0889cfLU, 0xf7a64f97LU, 0x6c3b8752LU, 0xb795410aLU, 0x972a46e2LU, 0x4c8480baLU,
|
||||
0x9ad57091LU, 0x417bb6c9LU, 0x61c4b121LU, 0xba6a7779LU, 0x21f7bfbcLU, 0xfa5979e4LU, 0xdae67e0cLU, 0x0148b854LU,
|
||||
0xa191a3cbLU, 0x7a3f6593LU, 0x5a80627bLU, 0x812ea423LU, 0x1ab36ce6LU, 0xc11daabeLU, 0xe1a2ad56LU, 0x3a0c6b0eLU,
|
||||
0x95ba7b4aLU, 0x4e14bd12LU, 0x6eabbafaLU, 0xb5057ca2LU, 0x2e98b467LU, 0xf536723fLU, 0xd58975d7LU, 0x0e27b38fLU,
|
||||
0xaefea810LU, 0x75506e48LU, 0x55ef69a0LU, 0x8e41aff8LU, 0x15dc673dLU, 0xce72a165LU, 0xeecda68dLU, 0x356360d5LU,
|
||||
0xe33290feLU, 0x389c56a6LU, 0x1823514eLU, 0xc38d9716LU, 0x58105fd3LU, 0x83be998bLU, 0xa3019e63LU, 0x78af583bLU,
|
||||
0xd87643a4LU, 0x03d885fcLU, 0x23678214LU, 0xf8c9444cLU, 0x63548c89LU, 0xb8fa4ad1LU, 0x98454d39LU, 0x43eb8b61LU,
|
||||
0x79e7e06fLU, 0xa2492637LU, 0x82f621dfLU, 0x5958e787LU, 0xc2c52f42LU, 0x196be91aLU, 0x39d4eef2LU, 0xe27a28aaLU,
|
||||
0x42a33335LU, 0x990df56dLU, 0xb9b2f285LU, 0x621c34ddLU, 0xf981fc18LU, 0x222f3a40LU, 0x02903da8LU, 0xd93efbf0LU,
|
||||
0x0f6f0bdbLU, 0xd4c1cd83LU, 0xf47eca6bLU, 0x2fd00c33LU, 0xb44dc4f6LU, 0x6fe302aeLU, 0x4f5c0546LU, 0x94f2c31eLU,
|
||||
0x342bd881LU, 0xef851ed9LU, 0xcf3a1931LU, 0x1494df69LU, 0x8f0917acLU, 0x54a7d1f4LU, 0x7418d61cLU, 0xafb61044LU,
|
||||
0x6739f694LU, 0xbc9730ccLU, 0x9c283724LU, 0x4786f17cLU, 0xdc1b39b9LU, 0x07b5ffe1LU, 0x270af809LU, 0xfca43e51LU,
|
||||
0x5c7d25ceLU, 0x87d3e396LU, 0xa76ce47eLU, 0x7cc22226LU, 0xe75feae3LU, 0x3cf12cbbLU, 0x1c4e2b53LU, 0xc7e0ed0bLU,
|
||||
0x11b11d20LU, 0xca1fdb78LU, 0xeaa0dc90LU, 0x310e1ac8LU, 0xaa93d20dLU, 0x713d1455LU, 0x518213bdLU, 0x8a2cd5e5LU,
|
||||
0x2af5ce7aLU, 0xf15b0822LU, 0xd1e40fcaLU, 0x0a4ac992LU, 0x91d70157LU, 0x4a79c70fLU, 0x6ac6c0e7LU, 0xb16806bfLU,
|
||||
0x8b646db1LU, 0x50caabe9LU, 0x7075ac01LU, 0xabdb6a59LU, 0x3046a29cLU, 0xebe864c4LU, 0xcb57632cLU, 0x10f9a574LU,
|
||||
0xb020beebLU, 0x6b8e78b3LU, 0x4b317f5bLU, 0x909fb903LU, 0x0b0271c6LU, 0xd0acb79eLU, 0xf013b076LU, 0x2bbd762eLU,
|
||||
0xfdec8605LU, 0x2642405dLU, 0x06fd47b5LU, 0xdd5381edLU, 0x46ce4928LU, 0x9d608f70LU, 0xbddf8898LU, 0x66714ec0LU,
|
||||
0xc6a8555fLU, 0x1d069307LU, 0x3db994efLU, 0xe61752b7LU, 0x7d8a9a72LU, 0xa6245c2aLU, 0x869b5bc2LU, 0x5d359d9aLU,
|
||||
0xf2838ddeLU, 0x292d4b86LU, 0x09924c6eLU, 0xd23c8a36LU, 0x49a142f3LU, 0x920f84abLU, 0xb2b08343LU, 0x691e451bLU,
|
||||
0xc9c75e84LU, 0x126998dcLU, 0x32d69f34LU, 0xe978596cLU, 0x72e591a9LU, 0xa94b57f1LU, 0x89f45019LU, 0x525a9641LU,
|
||||
0x840b666aLU, 0x5fa5a032LU, 0x7f1aa7daLU, 0xa4b46182LU, 0x3f29a947LU, 0xe4876f1fLU, 0xc43868f7LU, 0x1f96aeafLU,
|
||||
0xbf4fb530LU, 0x64e17368LU, 0x445e7480LU, 0x9ff0b2d8LU, 0x046d7a1dLU, 0xdfc3bc45LU, 0xff7cbbadLU, 0x24d27df5LU,
|
||||
0x1ede16fbLU, 0xc570d0a3LU, 0xe5cfd74bLU, 0x3e611113LU, 0xa5fcd9d6LU, 0x7e521f8eLU, 0x5eed1866LU, 0x8543de3eLU,
|
||||
0x259ac5a1LU, 0xfe3403f9LU, 0xde8b0411LU, 0x0525c249LU, 0x9eb80a8cLU, 0x4516ccd4LU, 0x65a9cb3cLU, 0xbe070d64LU,
|
||||
0x6856fd4fLU, 0xb3f83b17LU, 0x93473cffLU, 0x48e9faa7LU, 0xd3743262LU, 0x08daf43aLU, 0x2865f3d2LU, 0xf3cb358aLU,
|
||||
0x53122e15LU, 0x88bce84dLU, 0xa803efa5LU, 0x73ad29fdLU, 0xe830e138LU, 0x339e2760LU, 0x13212088LU, 0xc88fe6d0LU };
|
||||
|
||||
static const ulong32 rs_tab6[256] = {
|
||||
0x00000000LU, 0x9e3d68dbLU, 0x717ad0fbLU, 0xef47b820LU, 0xe2f4edbbLU, 0x7cc98560LU, 0x938e3d40LU, 0x0db3559bLU,
|
||||
0x89a5973bLU, 0x1798ffe0LU, 0xf8df47c0LU, 0x66e22f1bLU, 0x6b517a80LU, 0xf56c125bLU, 0x1a2baa7bLU, 0x8416c2a0LU,
|
||||
0x5f076376LU, 0xc13a0badLU, 0x2e7db38dLU, 0xb040db56LU, 0xbdf38ecdLU, 0x23cee616LU, 0xcc895e36LU, 0x52b436edLU,
|
||||
0xd6a2f44dLU, 0x489f9c96LU, 0xa7d824b6LU, 0x39e54c6dLU, 0x345619f6LU, 0xaa6b712dLU, 0x452cc90dLU, 0xdb11a1d6LU,
|
||||
0xbe0ec6ecLU, 0x2033ae37LU, 0xcf741617LU, 0x51497eccLU, 0x5cfa2b57LU, 0xc2c7438cLU, 0x2d80fbacLU, 0xb3bd9377LU,
|
||||
0x37ab51d7LU, 0xa996390cLU, 0x46d1812cLU, 0xd8ece9f7LU, 0xd55fbc6cLU, 0x4b62d4b7LU, 0xa4256c97LU, 0x3a18044cLU,
|
||||
0xe109a59aLU, 0x7f34cd41LU, 0x90737561LU, 0x0e4e1dbaLU, 0x03fd4821LU, 0x9dc020faLU, 0x728798daLU, 0xecbaf001LU,
|
||||
0x68ac32a1LU, 0xf6915a7aLU, 0x19d6e25aLU, 0x87eb8a81LU, 0x8a58df1aLU, 0x1465b7c1LU, 0xfb220fe1LU, 0x651f673aLU,
|
||||
0x311cc195LU, 0xaf21a94eLU, 0x4066116eLU, 0xde5b79b5LU, 0xd3e82c2eLU, 0x4dd544f5LU, 0xa292fcd5LU, 0x3caf940eLU,
|
||||
0xb8b956aeLU, 0x26843e75LU, 0xc9c38655LU, 0x57feee8eLU, 0x5a4dbb15LU, 0xc470d3ceLU, 0x2b376beeLU, 0xb50a0335LU,
|
||||
0x6e1ba2e3LU, 0xf026ca38LU, 0x1f617218LU, 0x815c1ac3LU, 0x8cef4f58LU, 0x12d22783LU, 0xfd959fa3LU, 0x63a8f778LU,
|
||||
0xe7be35d8LU, 0x79835d03LU, 0x96c4e523LU, 0x08f98df8LU, 0x054ad863LU, 0x9b77b0b8LU, 0x74300898LU, 0xea0d6043LU,
|
||||
0x8f120779LU, 0x112f6fa2LU, 0xfe68d782LU, 0x6055bf59LU, 0x6de6eac2LU, 0xf3db8219LU, 0x1c9c3a39LU, 0x82a152e2LU,
|
||||
0x00000000LU, 0x9e3d68dbLU, 0x717ad0fbLU, 0xef47b820LU, 0xe2f4edbbLU, 0x7cc98560LU, 0x938e3d40LU, 0x0db3559bLU,
|
||||
0x89a5973bLU, 0x1798ffe0LU, 0xf8df47c0LU, 0x66e22f1bLU, 0x6b517a80LU, 0xf56c125bLU, 0x1a2baa7bLU, 0x8416c2a0LU,
|
||||
0x5f076376LU, 0xc13a0badLU, 0x2e7db38dLU, 0xb040db56LU, 0xbdf38ecdLU, 0x23cee616LU, 0xcc895e36LU, 0x52b436edLU,
|
||||
0xd6a2f44dLU, 0x489f9c96LU, 0xa7d824b6LU, 0x39e54c6dLU, 0x345619f6LU, 0xaa6b712dLU, 0x452cc90dLU, 0xdb11a1d6LU,
|
||||
0xbe0ec6ecLU, 0x2033ae37LU, 0xcf741617LU, 0x51497eccLU, 0x5cfa2b57LU, 0xc2c7438cLU, 0x2d80fbacLU, 0xb3bd9377LU,
|
||||
0x37ab51d7LU, 0xa996390cLU, 0x46d1812cLU, 0xd8ece9f7LU, 0xd55fbc6cLU, 0x4b62d4b7LU, 0xa4256c97LU, 0x3a18044cLU,
|
||||
0xe109a59aLU, 0x7f34cd41LU, 0x90737561LU, 0x0e4e1dbaLU, 0x03fd4821LU, 0x9dc020faLU, 0x728798daLU, 0xecbaf001LU,
|
||||
0x68ac32a1LU, 0xf6915a7aLU, 0x19d6e25aLU, 0x87eb8a81LU, 0x8a58df1aLU, 0x1465b7c1LU, 0xfb220fe1LU, 0x651f673aLU,
|
||||
0x311cc195LU, 0xaf21a94eLU, 0x4066116eLU, 0xde5b79b5LU, 0xd3e82c2eLU, 0x4dd544f5LU, 0xa292fcd5LU, 0x3caf940eLU,
|
||||
0xb8b956aeLU, 0x26843e75LU, 0xc9c38655LU, 0x57feee8eLU, 0x5a4dbb15LU, 0xc470d3ceLU, 0x2b376beeLU, 0xb50a0335LU,
|
||||
0x6e1ba2e3LU, 0xf026ca38LU, 0x1f617218LU, 0x815c1ac3LU, 0x8cef4f58LU, 0x12d22783LU, 0xfd959fa3LU, 0x63a8f778LU,
|
||||
0xe7be35d8LU, 0x79835d03LU, 0x96c4e523LU, 0x08f98df8LU, 0x054ad863LU, 0x9b77b0b8LU, 0x74300898LU, 0xea0d6043LU,
|
||||
0x8f120779LU, 0x112f6fa2LU, 0xfe68d782LU, 0x6055bf59LU, 0x6de6eac2LU, 0xf3db8219LU, 0x1c9c3a39LU, 0x82a152e2LU,
|
||||
0x06b79042LU, 0x988af899LU, 0x77cd40b9LU, 0xe9f02862LU, 0xe4437df9LU, 0x7a7e1522LU, 0x9539ad02LU, 0x0b04c5d9LU,
|
||||
0xd015640fLU, 0x4e280cd4LU, 0xa16fb4f4LU, 0x3f52dc2fLU, 0x32e189b4LU, 0xacdce16fLU, 0x439b594fLU, 0xdda63194LU,
|
||||
0x59b0f334LU, 0xc78d9befLU, 0x28ca23cfLU, 0xb6f74b14LU, 0xbb441e8fLU, 0x25797654LU, 0xca3ece74LU, 0x5403a6afLU,
|
||||
0x6238cf67LU, 0xfc05a7bcLU, 0x13421f9cLU, 0x8d7f7747LU, 0x80cc22dcLU, 0x1ef14a07LU, 0xf1b6f227LU, 0x6f8b9afcLU,
|
||||
0xeb9d585cLU, 0x75a03087LU, 0x9ae788a7LU, 0x04dae07cLU, 0x0969b5e7LU, 0x9754dd3cLU, 0x7813651cLU, 0xe62e0dc7LU,
|
||||
0x3d3fac11LU, 0xa302c4caLU, 0x4c457ceaLU, 0xd2781431LU, 0xdfcb41aaLU, 0x41f62971LU, 0xaeb19151LU, 0x308cf98aLU,
|
||||
0xd015640fLU, 0x4e280cd4LU, 0xa16fb4f4LU, 0x3f52dc2fLU, 0x32e189b4LU, 0xacdce16fLU, 0x439b594fLU, 0xdda63194LU,
|
||||
0x59b0f334LU, 0xc78d9befLU, 0x28ca23cfLU, 0xb6f74b14LU, 0xbb441e8fLU, 0x25797654LU, 0xca3ece74LU, 0x5403a6afLU,
|
||||
0x6238cf67LU, 0xfc05a7bcLU, 0x13421f9cLU, 0x8d7f7747LU, 0x80cc22dcLU, 0x1ef14a07LU, 0xf1b6f227LU, 0x6f8b9afcLU,
|
||||
0xeb9d585cLU, 0x75a03087LU, 0x9ae788a7LU, 0x04dae07cLU, 0x0969b5e7LU, 0x9754dd3cLU, 0x7813651cLU, 0xe62e0dc7LU,
|
||||
0x3d3fac11LU, 0xa302c4caLU, 0x4c457ceaLU, 0xd2781431LU, 0xdfcb41aaLU, 0x41f62971LU, 0xaeb19151LU, 0x308cf98aLU,
|
||||
0xb49a3b2aLU, 0x2aa753f1LU, 0xc5e0ebd1LU, 0x5bdd830aLU, 0x566ed691LU, 0xc853be4aLU, 0x2714066aLU, 0xb9296eb1LU,
|
||||
0xdc36098bLU, 0x420b6150LU, 0xad4cd970LU, 0x3371b1abLU, 0x3ec2e430LU, 0xa0ff8cebLU, 0x4fb834cbLU, 0xd1855c10LU,
|
||||
0x55939eb0LU, 0xcbaef66bLU, 0x24e94e4bLU, 0xbad42690LU, 0xb767730bLU, 0x295a1bd0LU, 0xc61da3f0LU, 0x5820cb2bLU,
|
||||
0x83316afdLU, 0x1d0c0226LU, 0xf24bba06LU, 0x6c76d2ddLU, 0x61c58746LU, 0xfff8ef9dLU, 0x10bf57bdLU, 0x8e823f66LU,
|
||||
0x0a94fdc6LU, 0x94a9951dLU, 0x7bee2d3dLU, 0xe5d345e6LU, 0xe860107dLU, 0x765d78a6LU, 0x991ac086LU, 0x0727a85dLU,
|
||||
0x53240ef2LU, 0xcd196629LU, 0x225ede09LU, 0xbc63b6d2LU, 0xb1d0e349LU, 0x2fed8b92LU, 0xc0aa33b2LU, 0x5e975b69LU,
|
||||
0xda8199c9LU, 0x44bcf112LU, 0xabfb4932LU, 0x35c621e9LU, 0x38757472LU, 0xa6481ca9LU, 0x490fa489LU, 0xd732cc52LU,
|
||||
0x0c236d84LU, 0x921e055fLU, 0x7d59bd7fLU, 0xe364d5a4LU, 0xeed7803fLU, 0x70eae8e4LU, 0x9fad50c4LU, 0x0190381fLU,
|
||||
0x8586fabfLU, 0x1bbb9264LU, 0xf4fc2a44LU, 0x6ac1429fLU, 0x67721704LU, 0xf94f7fdfLU, 0x1608c7ffLU, 0x8835af24LU,
|
||||
0xed2ac81eLU, 0x7317a0c5LU, 0x9c5018e5LU, 0x026d703eLU, 0x0fde25a5LU, 0x91e34d7eLU, 0x7ea4f55eLU, 0xe0999d85LU,
|
||||
0x648f5f25LU, 0xfab237feLU, 0x15f58fdeLU, 0x8bc8e705LU, 0x867bb29eLU, 0x1846da45LU, 0xf7016265LU, 0x693c0abeLU,
|
||||
0xb22dab68LU, 0x2c10c3b3LU, 0xc3577b93LU, 0x5d6a1348LU, 0x50d946d3LU, 0xcee42e08LU, 0x21a39628LU, 0xbf9efef3LU,
|
||||
0x3b883c53LU, 0xa5b55488LU, 0x4af2eca8LU, 0xd4cf8473LU, 0xd97cd1e8LU, 0x4741b933LU, 0xa8060113LU, 0x363b69c8LU };
|
||||
0xdc36098bLU, 0x420b6150LU, 0xad4cd970LU, 0x3371b1abLU, 0x3ec2e430LU, 0xa0ff8cebLU, 0x4fb834cbLU, 0xd1855c10LU,
|
||||
0x55939eb0LU, 0xcbaef66bLU, 0x24e94e4bLU, 0xbad42690LU, 0xb767730bLU, 0x295a1bd0LU, 0xc61da3f0LU, 0x5820cb2bLU,
|
||||
0x83316afdLU, 0x1d0c0226LU, 0xf24bba06LU, 0x6c76d2ddLU, 0x61c58746LU, 0xfff8ef9dLU, 0x10bf57bdLU, 0x8e823f66LU,
|
||||
0x0a94fdc6LU, 0x94a9951dLU, 0x7bee2d3dLU, 0xe5d345e6LU, 0xe860107dLU, 0x765d78a6LU, 0x991ac086LU, 0x0727a85dLU,
|
||||
0x53240ef2LU, 0xcd196629LU, 0x225ede09LU, 0xbc63b6d2LU, 0xb1d0e349LU, 0x2fed8b92LU, 0xc0aa33b2LU, 0x5e975b69LU,
|
||||
0xda8199c9LU, 0x44bcf112LU, 0xabfb4932LU, 0x35c621e9LU, 0x38757472LU, 0xa6481ca9LU, 0x490fa489LU, 0xd732cc52LU,
|
||||
0x0c236d84LU, 0x921e055fLU, 0x7d59bd7fLU, 0xe364d5a4LU, 0xeed7803fLU, 0x70eae8e4LU, 0x9fad50c4LU, 0x0190381fLU,
|
||||
0x8586fabfLU, 0x1bbb9264LU, 0xf4fc2a44LU, 0x6ac1429fLU, 0x67721704LU, 0xf94f7fdfLU, 0x1608c7ffLU, 0x8835af24LU,
|
||||
0xed2ac81eLU, 0x7317a0c5LU, 0x9c5018e5LU, 0x026d703eLU, 0x0fde25a5LU, 0x91e34d7eLU, 0x7ea4f55eLU, 0xe0999d85LU,
|
||||
0x648f5f25LU, 0xfab237feLU, 0x15f58fdeLU, 0x8bc8e705LU, 0x867bb29eLU, 0x1846da45LU, 0xf7016265LU, 0x693c0abeLU,
|
||||
0xb22dab68LU, 0x2c10c3b3LU, 0xc3577b93LU, 0x5d6a1348LU, 0x50d946d3LU, 0xcee42e08LU, 0x21a39628LU, 0xbf9efef3LU,
|
||||
0x3b883c53LU, 0xa5b55488LU, 0x4af2eca8LU, 0xd4cf8473LU, 0xd97cd1e8LU, 0x4741b933LU, 0xa8060113LU, 0x363b69c8LU };
|
||||
|
||||
static const ulong32 rs_tab7[256] = {
|
||||
0x00000000LU, 0x0319e59eLU, 0x06328771LU, 0x052b62efLU, 0x0c6443e2LU, 0x0f7da67cLU, 0x0a56c493LU, 0x094f210dLU,
|
||||
0x18c88689LU, 0x1bd16317LU, 0x1efa01f8LU, 0x1de3e466LU, 0x14acc56bLU, 0x17b520f5LU, 0x129e421aLU, 0x1187a784LU,
|
||||
0x30dd415fLU, 0x33c4a4c1LU, 0x36efc62eLU, 0x35f623b0LU, 0x3cb902bdLU, 0x3fa0e723LU, 0x3a8b85ccLU, 0x39926052LU,
|
||||
0x2815c7d6LU, 0x2b0c2248LU, 0x2e2740a7LU, 0x2d3ea539LU, 0x24718434LU, 0x276861aaLU, 0x22430345LU, 0x215ae6dbLU,
|
||||
0x60f782beLU, 0x63ee6720LU, 0x66c505cfLU, 0x65dce051LU, 0x6c93c15cLU, 0x6f8a24c2LU, 0x6aa1462dLU, 0x69b8a3b3LU,
|
||||
0x783f0437LU, 0x7b26e1a9LU, 0x7e0d8346LU, 0x7d1466d8LU, 0x745b47d5LU, 0x7742a24bLU, 0x7269c0a4LU, 0x7170253aLU,
|
||||
0x502ac3e1LU, 0x5333267fLU, 0x56184490LU, 0x5501a10eLU, 0x5c4e8003LU, 0x5f57659dLU, 0x5a7c0772LU, 0x5965e2ecLU,
|
||||
0x48e24568LU, 0x4bfba0f6LU, 0x4ed0c219LU, 0x4dc92787LU, 0x4486068aLU, 0x479fe314LU, 0x42b481fbLU, 0x41ad6465LU,
|
||||
0xc0a34931LU, 0xc3baacafLU, 0xc691ce40LU, 0xc5882bdeLU, 0xccc70ad3LU, 0xcfdeef4dLU, 0xcaf58da2LU, 0xc9ec683cLU,
|
||||
0xd86bcfb8LU, 0xdb722a26LU, 0xde5948c9LU, 0xdd40ad57LU, 0xd40f8c5aLU, 0xd71669c4LU, 0xd23d0b2bLU, 0xd124eeb5LU,
|
||||
0xf07e086eLU, 0xf367edf0LU, 0xf64c8f1fLU, 0xf5556a81LU, 0xfc1a4b8cLU, 0xff03ae12LU, 0xfa28ccfdLU, 0xf9312963LU,
|
||||
0xe8b68ee7LU, 0xebaf6b79LU, 0xee840996LU, 0xed9dec08LU, 0xe4d2cd05LU, 0xe7cb289bLU, 0xe2e04a74LU, 0xe1f9afeaLU,
|
||||
0xa054cb8fLU, 0xa34d2e11LU, 0xa6664cfeLU, 0xa57fa960LU, 0xac30886dLU, 0xaf296df3LU, 0xaa020f1cLU, 0xa91bea82LU,
|
||||
0xb89c4d06LU, 0xbb85a898LU, 0xbeaeca77LU, 0xbdb72fe9LU, 0xb4f80ee4LU, 0xb7e1eb7aLU, 0xb2ca8995LU, 0xb1d36c0bLU,
|
||||
0x90898ad0LU, 0x93906f4eLU, 0x96bb0da1LU, 0x95a2e83fLU, 0x9cedc932LU, 0x9ff42cacLU, 0x9adf4e43LU, 0x99c6abddLU,
|
||||
0x88410c59LU, 0x8b58e9c7LU, 0x8e738b28LU, 0x8d6a6eb6LU, 0x84254fbbLU, 0x873caa25LU, 0x8217c8caLU, 0x810e2d54LU,
|
||||
0xcd0b9262LU, 0xce1277fcLU, 0xcb391513LU, 0xc820f08dLU, 0xc16fd180LU, 0xc276341eLU, 0xc75d56f1LU, 0xc444b36fLU,
|
||||
0xd5c314ebLU, 0xd6daf175LU, 0xd3f1939aLU, 0xd0e87604LU, 0xd9a75709LU, 0xdabeb297LU, 0xdf95d078LU, 0xdc8c35e6LU,
|
||||
0xfdd6d33dLU, 0xfecf36a3LU, 0xfbe4544cLU, 0xf8fdb1d2LU, 0xf1b290dfLU, 0xf2ab7541LU, 0xf78017aeLU, 0xf499f230LU,
|
||||
0xe51e55b4LU, 0xe607b02aLU, 0xe32cd2c5LU, 0xe035375bLU, 0xe97a1656LU, 0xea63f3c8LU, 0xef489127LU, 0xec5174b9LU,
|
||||
0xadfc10dcLU, 0xaee5f542LU, 0xabce97adLU, 0xa8d77233LU, 0xa198533eLU, 0xa281b6a0LU, 0xa7aad44fLU, 0xa4b331d1LU,
|
||||
0xb5349655LU, 0xb62d73cbLU, 0xb3061124LU, 0xb01ff4baLU, 0xb950d5b7LU, 0xba493029LU, 0xbf6252c6LU, 0xbc7bb758LU,
|
||||
0x9d215183LU, 0x9e38b41dLU, 0x9b13d6f2LU, 0x980a336cLU, 0x91451261LU, 0x925cf7ffLU, 0x97779510LU, 0x946e708eLU,
|
||||
0x85e9d70aLU, 0x86f03294LU, 0x83db507bLU, 0x80c2b5e5LU, 0x898d94e8LU, 0x8a947176LU, 0x8fbf1399LU, 0x8ca6f607LU,
|
||||
0x0da8db53LU, 0x0eb13ecdLU, 0x0b9a5c22LU, 0x0883b9bcLU, 0x01cc98b1LU, 0x02d57d2fLU, 0x07fe1fc0LU, 0x04e7fa5eLU,
|
||||
0x15605ddaLU, 0x1679b844LU, 0x1352daabLU, 0x104b3f35LU, 0x19041e38LU, 0x1a1dfba6LU, 0x1f369949LU, 0x1c2f7cd7LU,
|
||||
0x3d759a0cLU, 0x3e6c7f92LU, 0x3b471d7dLU, 0x385ef8e3LU, 0x3111d9eeLU, 0x32083c70LU, 0x37235e9fLU, 0x343abb01LU,
|
||||
0x25bd1c85LU, 0x26a4f91bLU, 0x238f9bf4LU, 0x20967e6aLU, 0x29d95f67LU, 0x2ac0baf9LU, 0x2febd816LU, 0x2cf23d88LU,
|
||||
0x6d5f59edLU, 0x6e46bc73LU, 0x6b6dde9cLU, 0x68743b02LU, 0x613b1a0fLU, 0x6222ff91LU, 0x67099d7eLU, 0x641078e0LU,
|
||||
0x7597df64LU, 0x768e3afaLU, 0x73a55815LU, 0x70bcbd8bLU, 0x79f39c86LU, 0x7aea7918LU, 0x7fc11bf7LU, 0x7cd8fe69LU,
|
||||
0x5d8218b2LU, 0x5e9bfd2cLU, 0x5bb09fc3LU, 0x58a97a5dLU, 0x51e65b50LU, 0x52ffbeceLU, 0x57d4dc21LU, 0x54cd39bfLU,
|
||||
0x00000000LU, 0x0319e59eLU, 0x06328771LU, 0x052b62efLU, 0x0c6443e2LU, 0x0f7da67cLU, 0x0a56c493LU, 0x094f210dLU,
|
||||
0x18c88689LU, 0x1bd16317LU, 0x1efa01f8LU, 0x1de3e466LU, 0x14acc56bLU, 0x17b520f5LU, 0x129e421aLU, 0x1187a784LU,
|
||||
0x30dd415fLU, 0x33c4a4c1LU, 0x36efc62eLU, 0x35f623b0LU, 0x3cb902bdLU, 0x3fa0e723LU, 0x3a8b85ccLU, 0x39926052LU,
|
||||
0x2815c7d6LU, 0x2b0c2248LU, 0x2e2740a7LU, 0x2d3ea539LU, 0x24718434LU, 0x276861aaLU, 0x22430345LU, 0x215ae6dbLU,
|
||||
0x60f782beLU, 0x63ee6720LU, 0x66c505cfLU, 0x65dce051LU, 0x6c93c15cLU, 0x6f8a24c2LU, 0x6aa1462dLU, 0x69b8a3b3LU,
|
||||
0x783f0437LU, 0x7b26e1a9LU, 0x7e0d8346LU, 0x7d1466d8LU, 0x745b47d5LU, 0x7742a24bLU, 0x7269c0a4LU, 0x7170253aLU,
|
||||
0x502ac3e1LU, 0x5333267fLU, 0x56184490LU, 0x5501a10eLU, 0x5c4e8003LU, 0x5f57659dLU, 0x5a7c0772LU, 0x5965e2ecLU,
|
||||
0x48e24568LU, 0x4bfba0f6LU, 0x4ed0c219LU, 0x4dc92787LU, 0x4486068aLU, 0x479fe314LU, 0x42b481fbLU, 0x41ad6465LU,
|
||||
0xc0a34931LU, 0xc3baacafLU, 0xc691ce40LU, 0xc5882bdeLU, 0xccc70ad3LU, 0xcfdeef4dLU, 0xcaf58da2LU, 0xc9ec683cLU,
|
||||
0xd86bcfb8LU, 0xdb722a26LU, 0xde5948c9LU, 0xdd40ad57LU, 0xd40f8c5aLU, 0xd71669c4LU, 0xd23d0b2bLU, 0xd124eeb5LU,
|
||||
0xf07e086eLU, 0xf367edf0LU, 0xf64c8f1fLU, 0xf5556a81LU, 0xfc1a4b8cLU, 0xff03ae12LU, 0xfa28ccfdLU, 0xf9312963LU,
|
||||
0xe8b68ee7LU, 0xebaf6b79LU, 0xee840996LU, 0xed9dec08LU, 0xe4d2cd05LU, 0xe7cb289bLU, 0xe2e04a74LU, 0xe1f9afeaLU,
|
||||
0xa054cb8fLU, 0xa34d2e11LU, 0xa6664cfeLU, 0xa57fa960LU, 0xac30886dLU, 0xaf296df3LU, 0xaa020f1cLU, 0xa91bea82LU,
|
||||
0xb89c4d06LU, 0xbb85a898LU, 0xbeaeca77LU, 0xbdb72fe9LU, 0xb4f80ee4LU, 0xb7e1eb7aLU, 0xb2ca8995LU, 0xb1d36c0bLU,
|
||||
0x90898ad0LU, 0x93906f4eLU, 0x96bb0da1LU, 0x95a2e83fLU, 0x9cedc932LU, 0x9ff42cacLU, 0x9adf4e43LU, 0x99c6abddLU,
|
||||
0x88410c59LU, 0x8b58e9c7LU, 0x8e738b28LU, 0x8d6a6eb6LU, 0x84254fbbLU, 0x873caa25LU, 0x8217c8caLU, 0x810e2d54LU,
|
||||
0xcd0b9262LU, 0xce1277fcLU, 0xcb391513LU, 0xc820f08dLU, 0xc16fd180LU, 0xc276341eLU, 0xc75d56f1LU, 0xc444b36fLU,
|
||||
0xd5c314ebLU, 0xd6daf175LU, 0xd3f1939aLU, 0xd0e87604LU, 0xd9a75709LU, 0xdabeb297LU, 0xdf95d078LU, 0xdc8c35e6LU,
|
||||
0xfdd6d33dLU, 0xfecf36a3LU, 0xfbe4544cLU, 0xf8fdb1d2LU, 0xf1b290dfLU, 0xf2ab7541LU, 0xf78017aeLU, 0xf499f230LU,
|
||||
0xe51e55b4LU, 0xe607b02aLU, 0xe32cd2c5LU, 0xe035375bLU, 0xe97a1656LU, 0xea63f3c8LU, 0xef489127LU, 0xec5174b9LU,
|
||||
0xadfc10dcLU, 0xaee5f542LU, 0xabce97adLU, 0xa8d77233LU, 0xa198533eLU, 0xa281b6a0LU, 0xa7aad44fLU, 0xa4b331d1LU,
|
||||
0xb5349655LU, 0xb62d73cbLU, 0xb3061124LU, 0xb01ff4baLU, 0xb950d5b7LU, 0xba493029LU, 0xbf6252c6LU, 0xbc7bb758LU,
|
||||
0x9d215183LU, 0x9e38b41dLU, 0x9b13d6f2LU, 0x980a336cLU, 0x91451261LU, 0x925cf7ffLU, 0x97779510LU, 0x946e708eLU,
|
||||
0x85e9d70aLU, 0x86f03294LU, 0x83db507bLU, 0x80c2b5e5LU, 0x898d94e8LU, 0x8a947176LU, 0x8fbf1399LU, 0x8ca6f607LU,
|
||||
0x0da8db53LU, 0x0eb13ecdLU, 0x0b9a5c22LU, 0x0883b9bcLU, 0x01cc98b1LU, 0x02d57d2fLU, 0x07fe1fc0LU, 0x04e7fa5eLU,
|
||||
0x15605ddaLU, 0x1679b844LU, 0x1352daabLU, 0x104b3f35LU, 0x19041e38LU, 0x1a1dfba6LU, 0x1f369949LU, 0x1c2f7cd7LU,
|
||||
0x3d759a0cLU, 0x3e6c7f92LU, 0x3b471d7dLU, 0x385ef8e3LU, 0x3111d9eeLU, 0x32083c70LU, 0x37235e9fLU, 0x343abb01LU,
|
||||
0x25bd1c85LU, 0x26a4f91bLU, 0x238f9bf4LU, 0x20967e6aLU, 0x29d95f67LU, 0x2ac0baf9LU, 0x2febd816LU, 0x2cf23d88LU,
|
||||
0x6d5f59edLU, 0x6e46bc73LU, 0x6b6dde9cLU, 0x68743b02LU, 0x613b1a0fLU, 0x6222ff91LU, 0x67099d7eLU, 0x641078e0LU,
|
||||
0x7597df64LU, 0x768e3afaLU, 0x73a55815LU, 0x70bcbd8bLU, 0x79f39c86LU, 0x7aea7918LU, 0x7fc11bf7LU, 0x7cd8fe69LU,
|
||||
0x5d8218b2LU, 0x5e9bfd2cLU, 0x5bb09fc3LU, 0x58a97a5dLU, 0x51e65b50LU, 0x52ffbeceLU, 0x57d4dc21LU, 0x54cd39bfLU,
|
||||
0x454a9e3bLU, 0x46537ba5LU, 0x4378194aLU, 0x4061fcd4LU, 0x492eddd9LU, 0x4a373847LU, 0x4f1c5aa8LU, 0x4c05bf36LU };
|
||||
|
||||
#endif /* LTC_TWOFISH_ALL_TABLES */
|
||||
|
||||
#endif /* __LTC_TWOFISH_TAB_C__ */
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -28,13 +26,13 @@ const struct ltc_cipher_descriptor xtea_desc =
|
||||
&xtea_test,
|
||||
&xtea_done,
|
||||
&xtea_keysize,
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
|
||||
};
|
||||
|
||||
int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
|
||||
{
|
||||
unsigned long x, sum, K[4];
|
||||
|
||||
ulong32 x, sum, K[4];
|
||||
|
||||
LTC_ARGCHK(key != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
@@ -48,21 +46,21 @@ int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k
|
||||
}
|
||||
|
||||
/* load key */
|
||||
LOAD32L(K[0], key+0);
|
||||
LOAD32L(K[1], key+4);
|
||||
LOAD32L(K[2], key+8);
|
||||
LOAD32L(K[3], key+12);
|
||||
|
||||
LOAD32H(K[0], key+0);
|
||||
LOAD32H(K[1], key+4);
|
||||
LOAD32H(K[2], key+8);
|
||||
LOAD32H(K[3], key+12);
|
||||
|
||||
for (x = sum = 0; x < 32; x++) {
|
||||
skey->xtea.A[x] = (sum + K[sum&3]) & 0xFFFFFFFFUL;
|
||||
sum = (sum + 0x9E3779B9UL) & 0xFFFFFFFFUL;
|
||||
skey->xtea.B[x] = (sum + K[(sum>>11)&3]) & 0xFFFFFFFFUL;
|
||||
}
|
||||
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(&K, sizeof(K));
|
||||
#endif
|
||||
|
||||
#endif
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
@@ -75,15 +73,15 @@ int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k
|
||||
*/
|
||||
int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
|
||||
{
|
||||
unsigned long y, z;
|
||||
ulong32 y, z;
|
||||
int r;
|
||||
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
LOAD32L(y, &pt[0]);
|
||||
LOAD32L(z, &pt[4]);
|
||||
LOAD32H(y, &pt[0]);
|
||||
LOAD32H(z, &pt[4]);
|
||||
for (r = 0; r < 32; r += 4) {
|
||||
y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r])) & 0xFFFFFFFFUL;
|
||||
z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r])) & 0xFFFFFFFFUL;
|
||||
@@ -97,8 +95,8 @@ int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *
|
||||
y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r+3])) & 0xFFFFFFFFUL;
|
||||
z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r+3])) & 0xFFFFFFFFUL;
|
||||
}
|
||||
STORE32L(y, &ct[0]);
|
||||
STORE32L(z, &ct[4]);
|
||||
STORE32H(y, &ct[0]);
|
||||
STORE32H(z, &ct[4]);
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
@@ -106,20 +104,20 @@ int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *
|
||||
Decrypts a block of text with LTC_XTEA
|
||||
@param ct The input ciphertext (8 bytes)
|
||||
@param pt The output plaintext (8 bytes)
|
||||
@param skey The key as scheduled
|
||||
@param skey The key as scheduled
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
|
||||
{
|
||||
unsigned long y, z;
|
||||
ulong32 y, z;
|
||||
int r;
|
||||
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
LTC_ARGCHK(skey != NULL);
|
||||
|
||||
LOAD32L(y, &ct[0]);
|
||||
LOAD32L(z, &ct[4]);
|
||||
LOAD32H(y, &ct[0]);
|
||||
LOAD32H(z, &ct[4]);
|
||||
for (r = 31; r >= 0; r -= 4) {
|
||||
z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r])) & 0xFFFFFFFFUL;
|
||||
y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r])) & 0xFFFFFFFFUL;
|
||||
@@ -133,8 +131,8 @@ int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *
|
||||
z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r-3])) & 0xFFFFFFFFUL;
|
||||
y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r-3])) & 0xFFFFFFFFUL;
|
||||
}
|
||||
STORE32L(y, &pt[0]);
|
||||
STORE32L(z, &pt[4]);
|
||||
STORE32H(y, &pt[0]);
|
||||
STORE32H(z, &pt[4]);
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
@@ -146,43 +144,95 @@ int xtea_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const unsigned char key[16] =
|
||||
{ 0x78, 0x56, 0x34, 0x12, 0xf0, 0xcd, 0xcb, 0x9a,
|
||||
0x48, 0x37, 0x26, 0x15, 0xc0, 0xbf, 0xae, 0x9d };
|
||||
static const unsigned char pt[8] =
|
||||
{ 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08 };
|
||||
static const unsigned char ct[8] =
|
||||
{ 0x75, 0xd7, 0xc5, 0xbf, 0xcf, 0x58, 0xc9, 0x3f };
|
||||
#else
|
||||
static const struct {
|
||||
unsigned char key[16], pt[8], ct[8];
|
||||
} tests[] = {
|
||||
{
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xde, 0xe9, 0xd4, 0xd8, 0xf7, 0x13, 0x1e, 0xd9 }
|
||||
}, {
|
||||
{ 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x02,
|
||||
0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x04 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0xa5, 0x97, 0xab, 0x41, 0x76, 0x01, 0x4d, 0x72 }
|
||||
}, {
|
||||
{ 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x04,
|
||||
0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x06 },
|
||||
{ 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x02 },
|
||||
{ 0xb1, 0xfd, 0x5d, 0xa9, 0xcc, 0x6d, 0xc9, 0xdc }
|
||||
}, {
|
||||
{ 0x78, 0x69, 0x5a, 0x4b, 0x3c, 0x2d, 0x1e, 0x0f,
|
||||
0xf0, 0xe1, 0xd2, 0xc3, 0xb4, 0xa5, 0x96, 0x87 },
|
||||
{ 0xf0, 0xe1, 0xd2, 0xc3, 0xb4, 0xa5, 0x96, 0x87 },
|
||||
{ 0x70, 0x4b, 0x31, 0x34, 0x47, 0x44, 0xdf, 0xab }
|
||||
}, {
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
{ 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, 0x48 },
|
||||
{ 0x49, 0x7d, 0xf3, 0xd0, 0x72, 0x61, 0x2c, 0xb5 }
|
||||
}, {
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
{ 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 },
|
||||
{ 0xe7, 0x8f, 0x2d, 0x13, 0x74, 0x43, 0x41, 0xd8 }
|
||||
}, {
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
{ 0x5a, 0x5b, 0x6e, 0x27, 0x89, 0x48, 0xd7, 0x7f },
|
||||
{ 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 }
|
||||
}, {
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, 0x48 },
|
||||
{ 0xa0, 0x39, 0x05, 0x89, 0xf8, 0xb8, 0xef, 0xa5 }
|
||||
}, {
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 },
|
||||
{ 0xed, 0x23, 0x37, 0x5a, 0x82, 0x1a, 0x8c, 0x2d }
|
||||
}, {
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
{ 0x70, 0xe1, 0x22, 0x5d, 0x6e, 0x4e, 0x76, 0x55 },
|
||||
{ 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 }
|
||||
}
|
||||
};
|
||||
unsigned char tmp[2][8];
|
||||
symmetric_key skey;
|
||||
int err, y;
|
||||
int i, err, y;
|
||||
for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
|
||||
zeromem(&skey, sizeof(skey));
|
||||
if ((err = xtea_setup(tests[i].key, 16, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
xtea_ecb_encrypt(tests[i].pt, tmp[0], &skey);
|
||||
xtea_ecb_decrypt(tmp[0], tmp[1], &skey);
|
||||
|
||||
if ((err = xtea_setup(key, 16, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
xtea_ecb_encrypt(pt, tmp[0], &skey);
|
||||
xtea_ecb_decrypt(tmp[0], tmp[1], &skey);
|
||||
|
||||
if (XMEMCMP(tmp[0], ct, 8) != 0 || XMEMCMP(tmp[1], pt, 8) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
if (compare_testvector(tmp[0], 8, tests[i].ct, 8, "XTEA Encrypt", i) != 0 ||
|
||||
compare_testvector(tmp[1], 8, tests[i].pt, 8, "XTEA Decrypt", i) != 0) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
/* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */
|
||||
for (y = 0; y < 8; y++) tmp[0][y] = 0;
|
||||
for (y = 0; y < 1000; y++) xtea_ecb_encrypt(tmp[0], tmp[0], &skey);
|
||||
for (y = 0; y < 1000; y++) xtea_ecb_decrypt(tmp[0], tmp[0], &skey);
|
||||
for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
} /* for */
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/** Terminate the context
|
||||
/** Terminate the context
|
||||
@param skey The scheduled key
|
||||
*/
|
||||
void xtea_done(symmetric_key *skey)
|
||||
{
|
||||
LTC_UNUSED_PARAM(skey);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -194,7 +244,7 @@ int xtea_keysize(int *keysize)
|
||||
{
|
||||
LTC_ARGCHK(keysize != NULL);
|
||||
if (*keysize < 16) {
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
return CRYPT_INVALID_KEYSIZE;
|
||||
}
|
||||
*keysize = 16;
|
||||
return CRYPT_OK;
|
||||
@@ -206,6 +256,6 @@ int xtea_keysize(int *keysize)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
63
libtomcrypt/src/encauth/ccm/ccm_add_aad.c
Normal file
63
libtomcrypt/src/encauth/ccm/ccm_add_aad.c
Normal file
@@ -0,0 +1,63 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CCM_MODE
|
||||
|
||||
/**
|
||||
Add AAD to the CCM state
|
||||
@param ccm The CCM state
|
||||
@param adata The additional authentication data to add to the CCM state
|
||||
@param adatalen The length of the AAD data.
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int ccm_add_aad(ccm_state *ccm,
|
||||
const unsigned char *adata, unsigned long adatalen)
|
||||
{
|
||||
unsigned long y;
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(ccm != NULL);
|
||||
LTC_ARGCHK(adata != NULL);
|
||||
|
||||
if (ccm->aadlen < ccm->current_aadlen + adatalen) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
ccm->current_aadlen += adatalen;
|
||||
|
||||
/* now add the data */
|
||||
for (y = 0; y < adatalen; y++) {
|
||||
if (ccm->x == 16) {
|
||||
/* full block so let's encrypt it */
|
||||
if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
ccm->x = 0;
|
||||
}
|
||||
ccm->PAD[ccm->x++] ^= adata[y];
|
||||
}
|
||||
|
||||
/* remainder? */
|
||||
if (ccm->aadlen == ccm->current_aadlen) {
|
||||
if (ccm->x != 0) {
|
||||
if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
}
|
||||
ccm->x = 0;
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
113
libtomcrypt/src/encauth/ccm/ccm_add_nonce.c
Normal file
113
libtomcrypt/src/encauth/ccm/ccm_add_nonce.c
Normal file
@@ -0,0 +1,113 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CCM_MODE
|
||||
|
||||
/**
|
||||
Add nonce data to the CCM state
|
||||
@param ccm The CCM state
|
||||
@param nonce The nonce data to add
|
||||
@param noncelen The length of the nonce
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int ccm_add_nonce(ccm_state *ccm,
|
||||
const unsigned char *nonce, unsigned long noncelen)
|
||||
{
|
||||
unsigned long x, y, len;
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(ccm != NULL);
|
||||
LTC_ARGCHK(nonce != NULL);
|
||||
|
||||
/* increase L to match the nonce len */
|
||||
ccm->noncelen = (noncelen > 13) ? 13 : noncelen;
|
||||
if ((15 - ccm->noncelen) > ccm->L) {
|
||||
ccm->L = 15 - ccm->noncelen;
|
||||
}
|
||||
|
||||
/* decrease noncelen to match L */
|
||||
if ((ccm->noncelen + ccm->L) > 15) {
|
||||
ccm->noncelen = 15 - ccm->L;
|
||||
}
|
||||
|
||||
/* form B_0 == flags | Nonce N | l(m) */
|
||||
x = 0;
|
||||
ccm->PAD[x++] = (unsigned char)(((ccm->aadlen > 0) ? (1<<6) : 0) |
|
||||
(((ccm->taglen - 2)>>1)<<3) |
|
||||
(ccm->L-1));
|
||||
|
||||
/* nonce */
|
||||
for (y = 0; y < (16 - (ccm->L + 1)); y++) {
|
||||
ccm->PAD[x++] = nonce[y];
|
||||
}
|
||||
|
||||
/* store len */
|
||||
len = ccm->ptlen;
|
||||
|
||||
/* shift len so the upper bytes of len are the contents of the length */
|
||||
for (y = ccm->L; y < 4; y++) {
|
||||
len <<= 8;
|
||||
}
|
||||
|
||||
/* store l(m) (only store 32-bits) */
|
||||
for (y = 0; ccm->L > 4 && (ccm->L-y)>4; y++) {
|
||||
ccm->PAD[x++] = 0;
|
||||
}
|
||||
for (; y < ccm->L; y++) {
|
||||
ccm->PAD[x++] = (unsigned char)((len >> 24) & 255);
|
||||
len <<= 8;
|
||||
}
|
||||
|
||||
/* encrypt PAD */
|
||||
if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
/* handle header */
|
||||
ccm->x = 0;
|
||||
if (ccm->aadlen > 0) {
|
||||
/* store length */
|
||||
if (ccm->aadlen < ((1UL<<16) - (1UL<<8))) {
|
||||
ccm->PAD[ccm->x++] ^= (ccm->aadlen>>8) & 255;
|
||||
ccm->PAD[ccm->x++] ^= ccm->aadlen & 255;
|
||||
} else {
|
||||
ccm->PAD[ccm->x++] ^= 0xFF;
|
||||
ccm->PAD[ccm->x++] ^= 0xFE;
|
||||
ccm->PAD[ccm->x++] ^= (ccm->aadlen>>24) & 255;
|
||||
ccm->PAD[ccm->x++] ^= (ccm->aadlen>>16) & 255;
|
||||
ccm->PAD[ccm->x++] ^= (ccm->aadlen>>8) & 255;
|
||||
ccm->PAD[ccm->x++] ^= ccm->aadlen & 255;
|
||||
}
|
||||
}
|
||||
|
||||
/* setup the ctr counter */
|
||||
x = 0;
|
||||
|
||||
/* flags */
|
||||
ccm->ctr[x++] = (unsigned char)ccm->L-1;
|
||||
|
||||
/* nonce */
|
||||
for (y = 0; y < (16 - (ccm->L+1)); ++y) {
|
||||
ccm->ctr[x++] = nonce[y];
|
||||
}
|
||||
/* offset */
|
||||
while (x < 16) {
|
||||
ccm->ctr[x++] = 0;
|
||||
}
|
||||
|
||||
ccm->CTRlen = 16;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
65
libtomcrypt/src/encauth/ccm/ccm_done.c
Normal file
65
libtomcrypt/src/encauth/ccm/ccm_done.c
Normal file
@@ -0,0 +1,65 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CCM_MODE
|
||||
|
||||
/**
|
||||
Terminate a CCM stream
|
||||
@param ccm The CCM state
|
||||
@param tag [out] The destination for the MAC tag
|
||||
@param taglen [in/out] The length of the MAC tag
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int ccm_done(ccm_state *ccm,
|
||||
unsigned char *tag, unsigned long *taglen)
|
||||
{
|
||||
unsigned long x, y;
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(ccm != NULL);
|
||||
|
||||
/* Check all data have been processed */
|
||||
if (ccm->ptlen != ccm->current_ptlen) {
|
||||
return CRYPT_ERROR;
|
||||
}
|
||||
|
||||
LTC_ARGCHK(tag != NULL);
|
||||
LTC_ARGCHK(taglen != NULL);
|
||||
|
||||
if (ccm->x != 0) {
|
||||
if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
}
|
||||
|
||||
/* setup CTR for the TAG (zero the count) */
|
||||
for (y = 15; y > 15 - ccm->L; y--) {
|
||||
ccm->ctr[y] = 0x00;
|
||||
}
|
||||
if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->ctr, ccm->CTRPAD, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
cipher_descriptor[ccm->cipher].done(&ccm->K);
|
||||
|
||||
/* store the TAG */
|
||||
for (x = 0; x < 16 && x < *taglen; x++) {
|
||||
tag[x] = ccm->PAD[x] ^ ccm->CTRPAD[x];
|
||||
}
|
||||
*taglen = x;
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
81
libtomcrypt/src/encauth/ccm/ccm_init.c
Normal file
81
libtomcrypt/src/encauth/ccm/ccm_init.c
Normal file
@@ -0,0 +1,81 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CCM_MODE
|
||||
|
||||
/**
|
||||
Initialize a CCM state
|
||||
@param ccm The CCM state to initialize
|
||||
@param cipher The index of the cipher to use
|
||||
@param key The secret key
|
||||
@param keylen The length of the secret key
|
||||
@param ptlen The length of the plain/cipher text that will be processed
|
||||
@param taglen The max length of the MAC tag
|
||||
@param aadlen The length of the AAD
|
||||
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int ccm_init(ccm_state *ccm, int cipher,
|
||||
const unsigned char *key, int keylen, int ptlen, int taglen, int aadlen)
|
||||
{
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(ccm != NULL);
|
||||
LTC_ARGCHK(key != NULL);
|
||||
LTC_ARGCHK(taglen != 0);
|
||||
|
||||
XMEMSET(ccm, 0, sizeof(ccm_state));
|
||||
|
||||
/* check cipher input */
|
||||
if ((err = cipher_is_valid(cipher)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if (cipher_descriptor[cipher].block_length != 16) {
|
||||
return CRYPT_INVALID_CIPHER;
|
||||
}
|
||||
|
||||
/* make sure the taglen is even and <= 16 */
|
||||
ccm->taglen = taglen;
|
||||
ccm->taglen &= ~1;
|
||||
if (ccm->taglen > 16) {
|
||||
ccm->taglen = 16;
|
||||
}
|
||||
|
||||
/* can't use < 4 */
|
||||
if (ccm->taglen < 4) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
/* schedule key */
|
||||
if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
ccm->cipher = cipher;
|
||||
|
||||
/* let's get the L value */
|
||||
ccm->ptlen = ptlen;
|
||||
ccm->L = 0;
|
||||
while (ptlen) {
|
||||
++ccm->L;
|
||||
ptlen >>= 8;
|
||||
}
|
||||
if (ccm->L <= 1) {
|
||||
ccm->L = 2;
|
||||
}
|
||||
|
||||
ccm->aadlen = aadlen;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -19,6 +17,9 @@
|
||||
|
||||
/**
|
||||
CCM encrypt/decrypt and produce an authentication tag
|
||||
|
||||
*1 'pt', 'ct' and 'tag' can both be 'in' or 'out', depending on 'direction'
|
||||
|
||||
@param cipher The index of the cipher desired
|
||||
@param key The secret key to use
|
||||
@param keylen The length of the secret key (octets)
|
||||
@@ -27,11 +28,11 @@
|
||||
@param noncelen The length of the nonce
|
||||
@param header The header for the session
|
||||
@param headerlen The length of the header (octets)
|
||||
@param pt [out] The plaintext
|
||||
@param pt [*1] The plaintext
|
||||
@param ptlen The length of the plaintext (octets)
|
||||
@param ct [out] The ciphertext
|
||||
@param tag [out] The destination tag
|
||||
@param taglen [in/out] The max size and resulting size of the authentication tag
|
||||
@param ct [*1] The ciphertext
|
||||
@param tag [*1] The destination tag
|
||||
@param taglen The max size and resulting size of the authentication tag
|
||||
@param direction Encrypt or Decrypt direction (0 or 1)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
@@ -45,10 +46,15 @@ int ccm_memory(int cipher,
|
||||
unsigned char *tag, unsigned long *taglen,
|
||||
int direction)
|
||||
{
|
||||
unsigned char PAD[16], ctr[16], CTRPAD[16], b;
|
||||
unsigned char PAD[16], ctr[16], CTRPAD[16], ptTag[16], b, *pt_real;
|
||||
unsigned char *pt_work = NULL;
|
||||
symmetric_key *skey;
|
||||
int err;
|
||||
unsigned long len, L, x, y, z, CTRlen;
|
||||
#ifdef LTC_FAST
|
||||
LTC_FAST_TYPE fastMask = ~0; /* initialize fastMask at all zeroes */
|
||||
#endif
|
||||
unsigned char mask = 0xff; /* initialize mask at all zeroes */
|
||||
|
||||
if (uskey == NULL) {
|
||||
LTC_ARGCHK(key != NULL);
|
||||
@@ -62,6 +68,8 @@ int ccm_memory(int cipher,
|
||||
LTC_ARGCHK(tag != NULL);
|
||||
LTC_ARGCHK(taglen != NULL);
|
||||
|
||||
pt_real = pt;
|
||||
|
||||
#ifdef LTC_FAST
|
||||
if (16 % sizeof(LTC_FAST_TYPE)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
@@ -95,7 +103,7 @@ int ccm_memory(int cipher,
|
||||
nonce, noncelen,
|
||||
header, headerlen,
|
||||
pt, ptlen,
|
||||
ct,
|
||||
ct,
|
||||
tag, taglen,
|
||||
direction);
|
||||
}
|
||||
@@ -117,11 +125,6 @@ int ccm_memory(int cipher,
|
||||
L = 15 - noncelen;
|
||||
}
|
||||
|
||||
/* decrease noncelen to match L */
|
||||
if ((noncelen + L) > 15) {
|
||||
noncelen = 15 - L;
|
||||
}
|
||||
|
||||
/* allocate mem for the symmetric key */
|
||||
if (uskey == NULL) {
|
||||
skey = XMALLOC(sizeof(*skey));
|
||||
@@ -138,6 +141,15 @@ int ccm_memory(int cipher,
|
||||
skey = uskey;
|
||||
}
|
||||
|
||||
/* initialize buffer for pt */
|
||||
if (direction == CCM_DECRYPT && ptlen > 0) {
|
||||
pt_work = XMALLOC(ptlen);
|
||||
if (pt_work == NULL) {
|
||||
goto error;
|
||||
}
|
||||
pt = pt_work;
|
||||
}
|
||||
|
||||
/* form B_0 == flags | Nonce N | l(m) */
|
||||
x = 0;
|
||||
PAD[x++] = (unsigned char)(((headerlen > 0) ? (1<<6) : 0) |
|
||||
@@ -174,7 +186,7 @@ int ccm_memory(int cipher,
|
||||
/* handle header */
|
||||
if (headerlen > 0) {
|
||||
x = 0;
|
||||
|
||||
|
||||
/* store length */
|
||||
if (headerlen < ((1UL<<16) - (1UL<<8))) {
|
||||
PAD[x++] ^= (headerlen>>8) & 255;
|
||||
@@ -200,11 +212,9 @@ int ccm_memory(int cipher,
|
||||
PAD[x++] ^= header[y];
|
||||
}
|
||||
|
||||
/* remainder? */
|
||||
if (x != 0) {
|
||||
if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) {
|
||||
goto error;
|
||||
}
|
||||
/* remainder */
|
||||
if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) {
|
||||
goto error;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -213,7 +223,7 @@ int ccm_memory(int cipher,
|
||||
|
||||
/* flags */
|
||||
ctr[x++] = (unsigned char)L-1;
|
||||
|
||||
|
||||
/* nonce */
|
||||
for (y = 0; y < (16 - (L+1)); ++y) {
|
||||
ctr[x++] = nonce[y];
|
||||
@@ -244,14 +254,14 @@ int ccm_memory(int cipher,
|
||||
|
||||
/* xor the PT against the pad first */
|
||||
for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) {
|
||||
*((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z]));
|
||||
*((LTC_FAST_TYPE*)(&ct[y+z])) = *((LTC_FAST_TYPE*)(&pt[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&PAD[z])) ^= *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&ct[y+z])) = *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])) ^ *(LTC_FAST_TYPE_PTR_CAST(&CTRPAD[z]));
|
||||
}
|
||||
if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) {
|
||||
goto error;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
} else { /* direction == CCM_DECRYPT */
|
||||
for (; y < (ptlen & ~15); y += 16) {
|
||||
/* increment the ctr? */
|
||||
for (z = 15; z > 15-L; z--) {
|
||||
@@ -264,15 +274,15 @@ int ccm_memory(int cipher,
|
||||
|
||||
/* xor the PT against the pad last */
|
||||
for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) {
|
||||
*((LTC_FAST_TYPE*)(&pt[y+z])) = *((LTC_FAST_TYPE*)(&ct[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z]));
|
||||
*((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])) = *(LTC_FAST_TYPE_PTR_CAST(&ct[y+z])) ^ *(LTC_FAST_TYPE_PTR_CAST(&CTRPAD[z]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&PAD[z])) ^= *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z]));
|
||||
}
|
||||
if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) {
|
||||
goto error;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
#endif
|
||||
|
||||
for (; y < ptlen; y++) {
|
||||
@@ -305,7 +315,7 @@ int ccm_memory(int cipher,
|
||||
}
|
||||
PAD[x++] ^= b;
|
||||
}
|
||||
|
||||
|
||||
if (x != 0) {
|
||||
if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) {
|
||||
goto error;
|
||||
@@ -323,20 +333,66 @@ int ccm_memory(int cipher,
|
||||
|
||||
if (skey != uskey) {
|
||||
cipher_descriptor[cipher].done(skey);
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(skey, sizeof(*skey));
|
||||
#endif
|
||||
}
|
||||
|
||||
/* store the TAG */
|
||||
for (x = 0; x < 16 && x < *taglen; x++) {
|
||||
tag[x] = PAD[x] ^ CTRPAD[x];
|
||||
if (direction == CCM_ENCRYPT) {
|
||||
/* store the TAG */
|
||||
for (x = 0; x < 16 && x < *taglen; x++) {
|
||||
tag[x] = PAD[x] ^ CTRPAD[x];
|
||||
}
|
||||
*taglen = x;
|
||||
} else { /* direction == CCM_DECRYPT */
|
||||
/* decrypt the tag */
|
||||
for (x = 0; x < 16 && x < *taglen; x++) {
|
||||
ptTag[x] = tag[x] ^ CTRPAD[x];
|
||||
}
|
||||
*taglen = x;
|
||||
|
||||
/* check validity of the decrypted tag against the computed PAD (in constant time) */
|
||||
/* HACK: the boolean value of XMEM_NEQ becomes either 0 (CRYPT_OK) or 1 (CRYPT_ERR).
|
||||
* there should be a better way of setting the correct error code in constant
|
||||
* time.
|
||||
*/
|
||||
err = XMEM_NEQ(ptTag, PAD, *taglen);
|
||||
|
||||
/* Zero the plaintext if the tag was invalid (in constant time) */
|
||||
if (ptlen > 0) {
|
||||
y = 0;
|
||||
mask *= 1 - err; /* mask = ( err ? 0 : 0xff ) */
|
||||
#ifdef LTC_FAST
|
||||
fastMask *= 1 - err;
|
||||
if (ptlen & ~15) {
|
||||
for (; y < (ptlen & ~15); y += 16) {
|
||||
for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) {
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&pt_real[y+z])) = *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])) & fastMask;
|
||||
}
|
||||
}
|
||||
}
|
||||
#endif
|
||||
for (; y < ptlen; y++) {
|
||||
pt_real[y] = pt[y] & mask;
|
||||
}
|
||||
}
|
||||
}
|
||||
*taglen = x;
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(skey, sizeof(*skey));
|
||||
#ifdef LTC_FAST
|
||||
fastMask = 0;
|
||||
#endif
|
||||
mask = 0;
|
||||
zeromem(PAD, sizeof(PAD));
|
||||
zeromem(CTRPAD, sizeof(CTRPAD));
|
||||
if (pt_work != NULL) {
|
||||
zeromem(pt_work, ptlen);
|
||||
}
|
||||
#endif
|
||||
error:
|
||||
if (pt_work) {
|
||||
XFREE(pt_work);
|
||||
}
|
||||
if (skey != uskey) {
|
||||
XFREE(skey);
|
||||
}
|
||||
@@ -346,6 +402,6 @@ error:
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
88
libtomcrypt/src/encauth/ccm/ccm_process.c
Normal file
88
libtomcrypt/src/encauth/ccm/ccm_process.c
Normal file
@@ -0,0 +1,88 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CCM_MODE
|
||||
|
||||
/**
|
||||
Process plaintext/ciphertext through CCM
|
||||
@param ccm The CCM state
|
||||
@param pt The plaintext
|
||||
@param ptlen The plaintext length (ciphertext length is the same)
|
||||
@param ct The ciphertext
|
||||
@param direction Encrypt or Decrypt mode (CCM_ENCRYPT or CCM_DECRYPT)
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int ccm_process(ccm_state *ccm,
|
||||
unsigned char *pt, unsigned long ptlen,
|
||||
unsigned char *ct,
|
||||
int direction)
|
||||
{
|
||||
unsigned char z, b;
|
||||
unsigned long y;
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(ccm != NULL);
|
||||
|
||||
/* Check aad has been correctly added */
|
||||
if (ccm->aadlen != ccm->current_aadlen) {
|
||||
return CRYPT_ERROR;
|
||||
}
|
||||
|
||||
/* Check we do not process too much data */
|
||||
if (ccm->ptlen < ccm->current_ptlen + ptlen) {
|
||||
return CRYPT_ERROR;
|
||||
}
|
||||
ccm->current_ptlen += ptlen;
|
||||
|
||||
/* now handle the PT */
|
||||
if (ptlen > 0) {
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
|
||||
for (y = 0; y < ptlen; y++) {
|
||||
/* increment the ctr? */
|
||||
if (ccm->CTRlen == 16) {
|
||||
for (z = 15; z > 15-ccm->L; z--) {
|
||||
ccm->ctr[z] = (ccm->ctr[z] + 1) & 255;
|
||||
if (ccm->ctr[z]) break;
|
||||
}
|
||||
if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->ctr, ccm->CTRPAD, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
ccm->CTRlen = 0;
|
||||
}
|
||||
|
||||
/* if we encrypt we add the bytes to the MAC first */
|
||||
if (direction == CCM_ENCRYPT) {
|
||||
b = pt[y];
|
||||
ct[y] = b ^ ccm->CTRPAD[ccm->CTRlen++];
|
||||
} else {
|
||||
b = ct[y] ^ ccm->CTRPAD[ccm->CTRlen++];
|
||||
pt[y] = b;
|
||||
}
|
||||
|
||||
if (ccm->x == 16) {
|
||||
if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
ccm->x = 0;
|
||||
}
|
||||
ccm->PAD[ccm->x++] ^= b;
|
||||
}
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
35
libtomcrypt/src/encauth/ccm/ccm_reset.c
Normal file
35
libtomcrypt/src/encauth/ccm/ccm_reset.c
Normal file
@@ -0,0 +1,35 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CCM_MODE
|
||||
|
||||
/**
|
||||
Reset a CCM state to as if you just called ccm_init(). This saves the initialization time.
|
||||
@param ccm The CCM state to reset
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int ccm_reset(ccm_state *ccm)
|
||||
{
|
||||
LTC_ARGCHK(ccm != NULL);
|
||||
zeromem(ccm->PAD, sizeof(ccm->PAD));
|
||||
zeromem(ccm->ctr, sizeof(ccm->ctr));
|
||||
zeromem(ccm->CTRPAD, sizeof(ccm->CTRPAD));
|
||||
ccm->CTRlen = 0;
|
||||
ccm->current_ptlen = 0;
|
||||
ccm->current_aadlen = 0;
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -32,14 +30,14 @@ int ccm_test(void)
|
||||
int ptlen;
|
||||
unsigned char ct[64];
|
||||
unsigned char tag[16];
|
||||
int taglen;
|
||||
unsigned long taglen;
|
||||
} tests[] = {
|
||||
|
||||
/* 13 byte nonce, 8 byte auth, 23 byte pt */
|
||||
{
|
||||
{ 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7,
|
||||
{ 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7,
|
||||
0xC8, 0xC9, 0xCA, 0xCB, 0xCC, 0xCD, 0xCE, 0xCF },
|
||||
{ 0x00, 0x00, 0x00, 0x03, 0x02, 0x01, 0x00, 0xA0,
|
||||
{ 0x00, 0x00, 0x00, 0x03, 0x02, 0x01, 0x00, 0xA0,
|
||||
0xA1, 0xA2, 0xA3, 0xA4, 0xA5 },
|
||||
13,
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07 },
|
||||
@@ -57,20 +55,20 @@ int ccm_test(void)
|
||||
|
||||
/* 13 byte nonce, 12 byte header, 19 byte pt */
|
||||
{
|
||||
{ 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7,
|
||||
{ 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7,
|
||||
0xC8, 0xC9, 0xCA, 0xCB, 0xCC, 0xCD, 0xCE, 0xCF },
|
||||
{ 0x00, 0x00, 0x00, 0x06, 0x05, 0x04, 0x03, 0xA0,
|
||||
{ 0x00, 0x00, 0x00, 0x06, 0x05, 0x04, 0x03, 0xA0,
|
||||
0xA1, 0xA2, 0xA3, 0xA4, 0xA5 },
|
||||
13,
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0A, 0x0B },
|
||||
12,
|
||||
{ 0x0C, 0x0D, 0x0E, 0x0F, 0x10, 0x11, 0x12, 0x13,
|
||||
0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B,
|
||||
{ 0x0C, 0x0D, 0x0E, 0x0F, 0x10, 0x11, 0x12, 0x13,
|
||||
0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B,
|
||||
0x1C, 0x1D, 0x1E },
|
||||
19,
|
||||
{ 0xA2, 0x8C, 0x68, 0x65, 0x93, 0x9A, 0x9A, 0x79,
|
||||
0xFA, 0xAA, 0x5C, 0x4C, 0x2A, 0x9D, 0x4A, 0x91,
|
||||
{ 0xA2, 0x8C, 0x68, 0x65, 0x93, 0x9A, 0x9A, 0x79,
|
||||
0xFA, 0xAA, 0x5C, 0x4C, 0x2A, 0x9D, 0x4A, 0x91,
|
||||
0xCD, 0xAC, 0x8C },
|
||||
{ 0x96, 0xC8, 0x61, 0xB9, 0xC9, 0xE6, 0x1E, 0xF1 },
|
||||
8
|
||||
@@ -78,7 +76,7 @@ int ccm_test(void)
|
||||
|
||||
/* supplied by Brian Gladman */
|
||||
{
|
||||
{ 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47,
|
||||
{ 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47,
|
||||
0x48, 0x49, 0x4a, 0x4b, 0x4c, 0x4d, 0x4e, 0x4f },
|
||||
{ 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16 },
|
||||
7,
|
||||
@@ -92,31 +90,34 @@ int ccm_test(void)
|
||||
},
|
||||
|
||||
{
|
||||
{ 0xc9, 0x7c, 0x1f, 0x67, 0xce, 0x37, 0x11, 0x85,
|
||||
{ 0xc9, 0x7c, 0x1f, 0x67, 0xce, 0x37, 0x11, 0x85,
|
||||
0x51, 0x4a, 0x8a, 0x19, 0xf2, 0xbd, 0xd5, 0x2f },
|
||||
{ 0x00, 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xb5,
|
||||
{ 0x00, 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xb5,
|
||||
0x03, 0x97, 0x76, 0xe7, 0x0c },
|
||||
13,
|
||||
{ 0x08, 0x40, 0x0f, 0xd2, 0xe1, 0x28, 0xa5, 0x7c,
|
||||
0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xab, 0xae,
|
||||
{ 0x08, 0x40, 0x0f, 0xd2, 0xe1, 0x28, 0xa5, 0x7c,
|
||||
0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xab, 0xae,
|
||||
0xa5, 0xb8, 0xfc, 0xba, 0x00, 0x00 },
|
||||
22,
|
||||
{ 0xf8, 0xba, 0x1a, 0x55, 0xd0, 0x2f, 0x85, 0xae,
|
||||
0x96, 0x7b, 0xb6, 0x2f, 0xb6, 0xcd, 0xa8, 0xeb,
|
||||
{ 0xf8, 0xba, 0x1a, 0x55, 0xd0, 0x2f, 0x85, 0xae,
|
||||
0x96, 0x7b, 0xb6, 0x2f, 0xb6, 0xcd, 0xa8, 0xeb,
|
||||
0x7e, 0x78, 0xa0, 0x50 },
|
||||
20,
|
||||
{ 0xf3, 0xd0, 0xa2, 0xfe, 0x9a, 0x3d, 0xbf, 0x23,
|
||||
0x42, 0xa6, 0x43, 0xe4, 0x32, 0x46, 0xe8, 0x0c,
|
||||
{ 0xf3, 0xd0, 0xa2, 0xfe, 0x9a, 0x3d, 0xbf, 0x23,
|
||||
0x42, 0xa6, 0x43, 0xe4, 0x32, 0x46, 0xe8, 0x0c,
|
||||
0x3c, 0x04, 0xd0, 0x19 },
|
||||
{ 0x78, 0x45, 0xce, 0x0b, 0x16, 0xf9, 0x76, 0x23 },
|
||||
8
|
||||
},
|
||||
|
||||
};
|
||||
unsigned long taglen, x;
|
||||
unsigned char buf[64], buf2[64], tag2[16], tag[16];
|
||||
unsigned long taglen, x, y;
|
||||
unsigned char buf[64], buf2[64], tag[16], tag2[16], tag3[16], zero[64];
|
||||
int err, idx;
|
||||
symmetric_key skey;
|
||||
ccm_state ccm;
|
||||
|
||||
zeromem(zero, 64);
|
||||
|
||||
idx = find_cipher("aes");
|
||||
if (idx == -1) {
|
||||
@@ -127,54 +128,130 @@ int ccm_test(void)
|
||||
}
|
||||
|
||||
for (x = 0; x < (sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
for (y = 0; y < 2; y++) {
|
||||
taglen = tests[x].taglen;
|
||||
if ((err = cipher_descriptor[idx].setup(tests[x].key, 16, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
if ((err = ccm_memory(idx,
|
||||
tests[x].key, 16,
|
||||
&skey,
|
||||
tests[x].nonce, tests[x].noncelen,
|
||||
tests[x].header, tests[x].headerlen,
|
||||
(unsigned char*)tests[x].pt, tests[x].ptlen,
|
||||
buf,
|
||||
tag, &taglen, 0)) != CRYPT_OK) {
|
||||
return err;
|
||||
if (y == 0) {
|
||||
if ((err = cipher_descriptor[idx].setup(tests[x].key, 16, 0, &skey)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
if ((err = ccm_memory(idx,
|
||||
tests[x].key, 16,
|
||||
&skey,
|
||||
tests[x].nonce, tests[x].noncelen,
|
||||
tests[x].header, tests[x].headerlen,
|
||||
(unsigned char*)tests[x].pt, tests[x].ptlen,
|
||||
buf,
|
||||
tag, &taglen, 0)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
/* run a second time to make sure skey is not touched */
|
||||
if ((err = ccm_memory(idx,
|
||||
tests[x].key, 16,
|
||||
&skey,
|
||||
tests[x].nonce, tests[x].noncelen,
|
||||
tests[x].header, tests[x].headerlen,
|
||||
(unsigned char*)tests[x].pt, tests[x].ptlen,
|
||||
buf,
|
||||
tag, &taglen, 0)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
} else {
|
||||
if ((err = ccm_init(&ccm, idx, tests[x].key, 16, tests[x].ptlen, tests[x].taglen, tests[x].headerlen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_add_nonce(&ccm, tests[x].nonce, tests[x].noncelen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_add_aad(&ccm, tests[x].header, tests[x].headerlen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_process(&ccm, (unsigned char*)tests[x].pt, tests[x].ptlen, buf, CCM_ENCRYPT)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_done(&ccm, tag, &taglen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
}
|
||||
|
||||
if (XMEMCMP(buf, tests[x].ct, tests[x].ptlen)) {
|
||||
if (compare_testvector(buf, tests[x].ptlen, tests[x].ct, tests[x].ptlen, "CCM encrypt data", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
if (XMEMCMP(tag, tests[x].tag, tests[x].taglen)) {
|
||||
if (compare_testvector(tag, taglen, tests[x].tag, tests[x].taglen, "CCM encrypt tag", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
if ((err = ccm_memory(idx,
|
||||
tests[x].key, 16,
|
||||
NULL,
|
||||
tests[x].nonce, tests[x].noncelen,
|
||||
tests[x].header, tests[x].headerlen,
|
||||
buf2, tests[x].ptlen,
|
||||
buf,
|
||||
tag2, &taglen, 1 )) != CRYPT_OK) {
|
||||
return err;
|
||||
if (y == 0) {
|
||||
XMEMCPY(tag3, tests[x].tag, tests[x].taglen);
|
||||
taglen = tests[x].taglen;
|
||||
if ((err = ccm_memory(idx,
|
||||
tests[x].key, 16,
|
||||
NULL,
|
||||
tests[x].nonce, tests[x].noncelen,
|
||||
tests[x].header, tests[x].headerlen,
|
||||
buf2, tests[x].ptlen,
|
||||
buf,
|
||||
tag3, &taglen, 1 )) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
} else {
|
||||
if ((err = ccm_init(&ccm, idx, tests[x].key, 16, tests[x].ptlen, tests[x].taglen, tests[x].headerlen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_add_nonce(&ccm, tests[x].nonce, tests[x].noncelen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_add_aad(&ccm, tests[x].header, tests[x].headerlen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_process(&ccm, buf2, tests[x].ptlen, buf, CCM_DECRYPT)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((err = ccm_done(&ccm, tag2, &taglen)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
}
|
||||
|
||||
if (XMEMCMP(buf2, tests[x].pt, tests[x].ptlen)) {
|
||||
|
||||
if (compare_testvector(buf2, tests[x].ptlen, tests[x].pt, tests[x].ptlen, "CCM decrypt data", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
if (XMEMCMP(tag2, tests[x].tag, tests[x].taglen)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
if (y == 0) {
|
||||
/* check if decryption with the wrong tag does not reveal the plaintext */
|
||||
XMEMCPY(tag3, tests[x].tag, tests[x].taglen);
|
||||
tag3[0] ^= 0xff; /* set the tag to the wrong value */
|
||||
taglen = tests[x].taglen;
|
||||
if ((err = ccm_memory(idx,
|
||||
tests[x].key, 16,
|
||||
NULL,
|
||||
tests[x].nonce, tests[x].noncelen,
|
||||
tests[x].header, tests[x].headerlen,
|
||||
buf2, tests[x].ptlen,
|
||||
buf,
|
||||
tag3, &taglen, 1 )) != CRYPT_ERROR) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
if (compare_testvector(buf2, tests[x].ptlen, zero, tests[x].ptlen, "CCM decrypt wrong tag", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
} else {
|
||||
if (compare_testvector(tag2, taglen, tests[x].tag, tests[x].taglen, "CCM decrypt tag", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
cipher_descriptor[idx].done(&skey);
|
||||
|
||||
if (y == 0) {
|
||||
cipher_descriptor[idx].done(&skey);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -0,0 +1,38 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Add AAD to the ChaCha20Poly1305 state
|
||||
@param st The ChaCha20Poly1305 state
|
||||
@param in The additional authentication data to add to the ChaCha20Poly1305 state
|
||||
@param inlen The length of the ChaCha20Poly1305 data.
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int chacha20poly1305_add_aad(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen)
|
||||
{
|
||||
int err;
|
||||
|
||||
if (inlen == 0) return CRYPT_OK; /* nothing to do */
|
||||
LTC_ARGCHK(st != NULL);
|
||||
|
||||
if (st->aadflg == 0) return CRYPT_ERROR;
|
||||
if ((err = poly1305_process(&st->poly, in, inlen)) != CRYPT_OK) return err;
|
||||
st->aadlen += (ulong64)inlen;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -0,0 +1,49 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Decrypt bytes of ciphertext with ChaCha20Poly1305
|
||||
@param st The ChaCha20Poly1305 state
|
||||
@param in The ciphertext
|
||||
@param inlen The length of the input (octets)
|
||||
@param out [out] The plaintext (length inlen)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int chacha20poly1305_decrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out)
|
||||
{
|
||||
unsigned char padzero[16] = { 0 };
|
||||
unsigned long padlen;
|
||||
int err;
|
||||
|
||||
if (inlen == 0) return CRYPT_OK; /* nothing to do */
|
||||
LTC_ARGCHK(st != NULL);
|
||||
|
||||
if (st->aadflg) {
|
||||
padlen = 16 - (unsigned long)(st->aadlen % 16);
|
||||
if (padlen < 16) {
|
||||
if ((err = poly1305_process(&st->poly, padzero, padlen)) != CRYPT_OK) return err;
|
||||
}
|
||||
st->aadflg = 0; /* no more AAD */
|
||||
}
|
||||
if (st->aadflg) st->aadflg = 0; /* no more AAD */
|
||||
if ((err = poly1305_process(&st->poly, in, inlen)) != CRYPT_OK) return err;
|
||||
if ((err = chacha_crypt(&st->chacha, in, inlen, out)) != CRYPT_OK) return err;
|
||||
st->ctlen += (ulong64)inlen;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
46
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_done.c
Normal file
46
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_done.c
Normal file
@@ -0,0 +1,46 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Terminate a ChaCha20Poly1305 stream
|
||||
@param st The ChaCha20Poly1305 state
|
||||
@param tag [out] The destination for the MAC tag
|
||||
@param taglen [in/out] The length of the MAC tag
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int chacha20poly1305_done(chacha20poly1305_state *st, unsigned char *tag, unsigned long *taglen)
|
||||
{
|
||||
unsigned char padzero[16] = { 0 };
|
||||
unsigned long padlen;
|
||||
unsigned char buf[16];
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(st != NULL);
|
||||
|
||||
padlen = 16 - (unsigned long)(st->ctlen % 16);
|
||||
if (padlen < 16) {
|
||||
if ((err = poly1305_process(&st->poly, padzero, padlen)) != CRYPT_OK) return err;
|
||||
}
|
||||
STORE64L(st->aadlen, buf);
|
||||
STORE64L(st->ctlen, buf + 8);
|
||||
if ((err = poly1305_process(&st->poly, buf, 16)) != CRYPT_OK) return err;
|
||||
if ((err = poly1305_done(&st->poly, tag, taglen)) != CRYPT_OK) return err;
|
||||
if ((err = chacha_done(&st->chacha)) != CRYPT_OK) return err;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -0,0 +1,48 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Encrypt bytes of ciphertext with ChaCha20Poly1305
|
||||
@param st The ChaCha20Poly1305 state
|
||||
@param in The plaintext
|
||||
@param inlen The length of the input (octets)
|
||||
@param out [out] The ciphertext (length inlen)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int chacha20poly1305_encrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out)
|
||||
{
|
||||
unsigned char padzero[16] = { 0 };
|
||||
unsigned long padlen;
|
||||
int err;
|
||||
|
||||
if (inlen == 0) return CRYPT_OK; /* nothing to do */
|
||||
LTC_ARGCHK(st != NULL);
|
||||
|
||||
if ((err = chacha_crypt(&st->chacha, in, inlen, out)) != CRYPT_OK) return err;
|
||||
if (st->aadflg) {
|
||||
padlen = 16 - (unsigned long)(st->aadlen % 16);
|
||||
if (padlen < 16) {
|
||||
if ((err = poly1305_process(&st->poly, padzero, padlen)) != CRYPT_OK) return err;
|
||||
}
|
||||
st->aadflg = 0; /* no more AAD */
|
||||
}
|
||||
if ((err = poly1305_process(&st->poly, out, inlen)) != CRYPT_OK) return err;
|
||||
st->ctlen += (ulong64)inlen;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
30
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_init.c
Normal file
30
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_init.c
Normal file
@@ -0,0 +1,30 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Initialize an ChaCha20Poly1305 context (only the key)
|
||||
@param st [out] The destination of the ChaCha20Poly1305 state
|
||||
@param key The secret key
|
||||
@param keylen The length of the secret key (octets)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int chacha20poly1305_init(chacha20poly1305_state *st, const unsigned char *key, unsigned long keylen)
|
||||
{
|
||||
return chacha_setup(&st->chacha, key, keylen, 20);
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
74
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_memory.c
Normal file
74
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_memory.c
Normal file
@@ -0,0 +1,74 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Process an entire GCM packet in one call.
|
||||
@param key The secret key
|
||||
@param keylen The length of the secret key
|
||||
@param iv The initialization vector
|
||||
@param ivlen The length of the initialization vector
|
||||
@param aad The additional authentication data (header)
|
||||
@param aadlen The length of the aad
|
||||
@param in The plaintext
|
||||
@param inlen The length of the plaintext (ciphertext length is the same)
|
||||
@param out The ciphertext
|
||||
@param tag [out] The MAC tag
|
||||
@param taglen [in/out] The MAC tag length
|
||||
@param direction Encrypt or Decrypt mode (CHACHA20POLY1305_ENCRYPT or CHACHA20POLY1305_DECRYPT)
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int chacha20poly1305_memory(const unsigned char *key, unsigned long keylen,
|
||||
const unsigned char *iv, unsigned long ivlen,
|
||||
const unsigned char *aad, unsigned long aadlen,
|
||||
const unsigned char *in, unsigned long inlen,
|
||||
unsigned char *out,
|
||||
unsigned char *tag, unsigned long *taglen,
|
||||
int direction)
|
||||
{
|
||||
chacha20poly1305_state st;
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(key != NULL);
|
||||
LTC_ARGCHK(iv != NULL);
|
||||
LTC_ARGCHK(in != NULL);
|
||||
LTC_ARGCHK(out != NULL);
|
||||
LTC_ARGCHK(tag != NULL);
|
||||
|
||||
if ((err = chacha20poly1305_init(&st, key, keylen)) != CRYPT_OK) { goto LBL_ERR; }
|
||||
if ((err = chacha20poly1305_setiv(&st, iv, ivlen)) != CRYPT_OK) { goto LBL_ERR; }
|
||||
if (aad && aadlen > 0) {
|
||||
if ((err = chacha20poly1305_add_aad(&st, aad, aadlen)) != CRYPT_OK) { goto LBL_ERR; }
|
||||
}
|
||||
if (direction == CHACHA20POLY1305_ENCRYPT) {
|
||||
if ((err = chacha20poly1305_encrypt(&st, in, inlen, out)) != CRYPT_OK) { goto LBL_ERR; }
|
||||
}
|
||||
else if (direction == CHACHA20POLY1305_DECRYPT) {
|
||||
if ((err = chacha20poly1305_decrypt(&st, in, inlen, out)) != CRYPT_OK) { goto LBL_ERR; }
|
||||
}
|
||||
else {
|
||||
err = CRYPT_INVALID_ARG;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
err = chacha20poly1305_done(&st, tag, taglen);
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(&st, sizeof(chacha20poly1305_state));
|
||||
#endif
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
68
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv.c
Normal file
68
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv.c
Normal file
@@ -0,0 +1,68 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Set IV + counter data to the ChaCha20Poly1305 state and reset the context
|
||||
@param st The ChaCha20Poly1305 state
|
||||
@param iv The IV data to add
|
||||
@param ivlen The length of the IV (must be 12 or 8)
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int chacha20poly1305_setiv(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen)
|
||||
{
|
||||
chacha_state tmp_st;
|
||||
int i, err;
|
||||
unsigned char polykey[32];
|
||||
|
||||
LTC_ARGCHK(st != NULL);
|
||||
LTC_ARGCHK(iv != NULL);
|
||||
LTC_ARGCHK(ivlen == 12 || ivlen == 8);
|
||||
|
||||
/* set IV for chacha20 */
|
||||
if (ivlen == 12) {
|
||||
/* IV 96bit */
|
||||
if ((err = chacha_ivctr32(&st->chacha, iv, ivlen, 1)) != CRYPT_OK) return err;
|
||||
}
|
||||
else {
|
||||
/* IV 64bit */
|
||||
if ((err = chacha_ivctr64(&st->chacha, iv, ivlen, 1)) != CRYPT_OK) return err;
|
||||
}
|
||||
|
||||
/* copy chacha20 key to temporary state */
|
||||
for(i = 0; i < 12; i++) tmp_st.input[i] = st->chacha.input[i];
|
||||
tmp_st.rounds = 20;
|
||||
/* set IV */
|
||||
if (ivlen == 12) {
|
||||
/* IV 32bit */
|
||||
if ((err = chacha_ivctr32(&tmp_st, iv, ivlen, 0)) != CRYPT_OK) return err;
|
||||
}
|
||||
else {
|
||||
/* IV 64bit */
|
||||
if ((err = chacha_ivctr64(&tmp_st, iv, ivlen, 0)) != CRYPT_OK) return err;
|
||||
}
|
||||
/* (re)generate new poly1305 key */
|
||||
if ((err = chacha_keystream(&tmp_st, polykey, 32)) != CRYPT_OK) return err;
|
||||
/* (re)initialise poly1305 */
|
||||
if ((err = poly1305_init(&st->poly, polykey, 32)) != CRYPT_OK) return err;
|
||||
st->ctlen = 0;
|
||||
st->aadlen = 0;
|
||||
st->aadflg = 1;
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -0,0 +1,40 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
/**
|
||||
Set IV + counter data (with RFC7905-magic) to the ChaCha20Poly1305 state and reset the context
|
||||
@param st The ChaCha20Poly1305 state
|
||||
@param iv The IV data to add
|
||||
@param ivlen The length of the IV (must be 12 or 8)
|
||||
@param sequence_number 64bit sequence number which is incorporated into IV as described in RFC7905
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int chacha20poly1305_setiv_rfc7905(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 sequence_number)
|
||||
{
|
||||
int i;
|
||||
unsigned char combined_iv[12] = { 0 };
|
||||
|
||||
LTC_ARGCHK(st != NULL);
|
||||
LTC_ARGCHK(iv != NULL);
|
||||
LTC_ARGCHK(ivlen == 12);
|
||||
|
||||
STORE64L(sequence_number, combined_iv + 4);
|
||||
for (i = 0; i < 12; i++) combined_iv[i] = iv[i] ^ combined_iv[i];
|
||||
return chacha20poly1305_setiv(st, combined_iv, 12);
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
134
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_test.c
Normal file
134
libtomcrypt/src/encauth/chachapoly/chacha20poly1305_test.c
Normal file
@@ -0,0 +1,134 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_CHACHA20POLY1305_MODE
|
||||
|
||||
int chacha20poly1305_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
chacha20poly1305_state st1, st2;
|
||||
unsigned char k[] = { 0x80, 0x81, 0x82, 0x83, 0x84, 0x85, 0x86, 0x87, 0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f, 0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97, 0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f };
|
||||
unsigned char i12[] = { 0x07, 0x00, 0x00, 0x00, 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47 };
|
||||
unsigned char i8[] = { 0x07, 0x00, 0x00, 0x00, 0x40, 0x41, 0x42, 0x43 };
|
||||
unsigned char aad[] = { 0x50, 0x51, 0x52, 0x53, 0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7 };
|
||||
unsigned char enc[] = { 0xD3, 0x1A, 0x8D, 0x34, 0x64, 0x8E, 0x60, 0xDB, 0x7B, 0x86, 0xAF, 0xBC, 0x53, 0xEF, 0x7E, 0xC2,
|
||||
0xA4, 0xAD, 0xED, 0x51, 0x29, 0x6E, 0x08, 0xFE, 0xA9, 0xE2, 0xB5, 0xA7, 0x36, 0xEE, 0x62, 0xD6,
|
||||
0x3D, 0xBE, 0xA4, 0x5E, 0x8C, 0xA9, 0x67, 0x12, 0x82, 0xFA, 0xFB, 0x69, 0xDA, 0x92, 0x72, 0x8B,
|
||||
0x1A, 0x71, 0xDE, 0x0A, 0x9E, 0x06, 0x0B, 0x29, 0x05, 0xD6, 0xA5, 0xB6, 0x7E, 0xCD, 0x3B, 0x36,
|
||||
0x92, 0xDD, 0xBD, 0x7F, 0x2D, 0x77, 0x8B, 0x8C, 0x98, 0x03, 0xAE, 0xE3, 0x28, 0x09, 0x1B, 0x58,
|
||||
0xFA, 0xB3, 0x24, 0xE4, 0xFA, 0xD6, 0x75, 0x94, 0x55, 0x85, 0x80, 0x8B, 0x48, 0x31, 0xD7, 0xBC,
|
||||
0x3F, 0xF4, 0xDE, 0xF0, 0x8E, 0x4B, 0x7A, 0x9D, 0xE5, 0x76, 0xD2, 0x65, 0x86, 0xCE, 0xC6, 0x4B,
|
||||
0x61, 0x16 };
|
||||
unsigned char tag[] = { 0x1A, 0xE1, 0x0B, 0x59, 0x4F, 0x09, 0xE2, 0x6A, 0x7E, 0x90, 0x2E, 0xCB, 0xD0, 0x60, 0x06, 0x91 };
|
||||
char m[] = "Ladies and Gentlemen of the class of '99: If I could offer you only one tip for the future, sunscreen would be it.";
|
||||
unsigned long mlen = strlen(m);
|
||||
unsigned long len;
|
||||
unsigned char rfc7905_pt[] = { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F };
|
||||
unsigned char rfc7905_enc[] = { 0xE4, 0x62, 0x85, 0xB4, 0x29, 0x95, 0x34, 0x96, 0xAB, 0xFB, 0x67, 0xCD, 0xAE, 0xAC, 0x94, 0x1E };
|
||||
unsigned char rfc7905_tag[] = { 0x16, 0x2C, 0x92, 0x48, 0x2A, 0xDB, 0xD3, 0x5D, 0x48, 0xBE, 0xC6, 0xFF, 0x10, 0x9C, 0xBA, 0xE4 };
|
||||
unsigned char ct[1000], pt[1000], emac[16], dmac[16];
|
||||
int err;
|
||||
|
||||
/* encrypt IV 96bit */
|
||||
if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_setiv(&st1, i12, sizeof(i12))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err;
|
||||
/* encrypt piece by piece */
|
||||
if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m, 25, ct)) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 25, 10, ct + 25)) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 35, 35, ct + 35)) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 70, 5, ct + 70)) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 75, 5, ct + 75)) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 80, mlen - 80, ct + 80)) != CRYPT_OK) return err;
|
||||
len = sizeof(emac);
|
||||
if ((err = chacha20poly1305_done(&st1, emac, &len)) != CRYPT_OK) return err;
|
||||
|
||||
if (compare_testvector(ct, mlen, enc, sizeof(enc), "ENC-CT", 1) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(emac, len, tag, sizeof(tag), "ENC-TAG", 2) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
/* decrypt IV 96bit */
|
||||
if ((err = chacha20poly1305_init(&st2, k, sizeof(k))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_setiv(&st2, i12, sizeof(i12))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_add_aad(&st2, aad, sizeof(aad))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_decrypt(&st2, ct, 21, pt)) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_decrypt(&st2, ct + 21, mlen - 21, pt + 21)) != CRYPT_OK) return err;
|
||||
len = sizeof(dmac);
|
||||
if ((err = chacha20poly1305_done(&st2, dmac, &len)) != CRYPT_OK) return err;
|
||||
|
||||
if (compare_testvector(pt, mlen, m, mlen, "DEC-PT", 3) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(dmac, len, tag, sizeof(tag), "DEC-TAG", 4) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
/* chacha20poly1305_memory - encrypt */
|
||||
len = sizeof(emac);
|
||||
if ((err = chacha20poly1305_memory(k, sizeof(k), i12, sizeof(i12), aad, sizeof(aad), (unsigned char *)m,
|
||||
mlen, ct, emac, &len, CHACHA20POLY1305_ENCRYPT)) != CRYPT_OK) return err;
|
||||
if (compare_testvector(ct, mlen, enc, sizeof(enc), "ENC-CT2", 1) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(emac, len, tag, sizeof(tag), "ENC-TAG2", 2) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
/* chacha20poly1305_memory - decrypt */
|
||||
len = sizeof(dmac);
|
||||
if ((err = chacha20poly1305_memory(k, sizeof(k), i12, sizeof(i12), aad, sizeof(aad),
|
||||
ct, mlen, pt, dmac, &len, CHACHA20POLY1305_DECRYPT)) != CRYPT_OK) return err;
|
||||
if (compare_testvector(pt, mlen, m, mlen, "DEC-PT2", 3) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(dmac, len, tag, sizeof(tag), "DEC-TAG2", 4) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
/* encrypt - rfc7905 */
|
||||
if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_setiv_rfc7905(&st1, i12, sizeof(i12), CONST64(0x1122334455667788))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_encrypt(&st1, rfc7905_pt, 16, ct)) != CRYPT_OK) return err;
|
||||
len = sizeof(emac);
|
||||
if ((err = chacha20poly1305_done(&st1, emac, &len)) != CRYPT_OK) return err;
|
||||
|
||||
if (compare_testvector(ct, 16, rfc7905_enc, 16, "ENC-CT3", 1) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(emac, len, rfc7905_tag, 16, "ENC-TAG3", 2) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
/* decrypt - rfc7905 */
|
||||
if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_setiv_rfc7905(&st1, i12, sizeof(i12), CONST64(0x1122334455667788))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_decrypt(&st1, ct, 16, pt)) != CRYPT_OK) return err;
|
||||
len = sizeof(dmac);
|
||||
if ((err = chacha20poly1305_done(&st1, dmac, &len)) != CRYPT_OK) return err;
|
||||
|
||||
if (compare_testvector(pt, 16, rfc7905_pt, 16, "DEC-CT3", 1) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(dmac, len, rfc7905_tag, 16, "DEC-TAG3", 2) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
/* encrypt IV 64bit */
|
||||
if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_setiv(&st1, i8, sizeof(i8))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m, mlen, ct)) != CRYPT_OK) return err;
|
||||
len = sizeof(emac);
|
||||
if ((err = chacha20poly1305_done(&st1, emac, &len)) != CRYPT_OK) return err;
|
||||
|
||||
/* decrypt IV 64bit */
|
||||
if ((err = chacha20poly1305_init(&st2, k, sizeof(k))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_setiv(&st2, i8, sizeof(i8))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_add_aad(&st2, aad, sizeof(aad))) != CRYPT_OK) return err;
|
||||
if ((err = chacha20poly1305_decrypt(&st2, ct, mlen, pt)) != CRYPT_OK) return err;
|
||||
len = sizeof(dmac);
|
||||
if ((err = chacha20poly1305_done(&st2, dmac, &len)) != CRYPT_OK) return err;
|
||||
|
||||
if (compare_testvector(pt, mlen, m, mlen, "DEC-PT4", 1) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(dmac, len, emac, len, "DEC-TAG4", 2) != 0) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -5,25 +5,23 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
/**
|
||||
/**
|
||||
@file eax_addheader.c
|
||||
EAX implementation, add meta-data, by Tom St Denis
|
||||
EAX implementation, add meta-data, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_EAX_MODE
|
||||
|
||||
/**
|
||||
add header (metadata) to the stream
|
||||
/**
|
||||
add header (metadata) to the stream
|
||||
@param eax The current EAX state
|
||||
@param header The header (meta-data) data you wish to add to the state
|
||||
@param length The length of the header data
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int eax_addheader(eax_state *eax, const unsigned char *header,
|
||||
int eax_addheader(eax_state *eax, const unsigned char *header,
|
||||
unsigned long length)
|
||||
{
|
||||
LTC_ARGCHK(eax != NULL);
|
||||
@@ -33,6 +31,6 @@ int eax_addheader(eax_state *eax, const unsigned char *header,
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file eax_decrypt.c
|
||||
EAX implementation, decrypt block, by Tom St Denis
|
||||
*/
|
||||
@@ -17,7 +15,7 @@
|
||||
|
||||
#ifdef LTC_EAX_MODE
|
||||
|
||||
/**
|
||||
/**
|
||||
Decrypt data with the EAX protocol
|
||||
@param eax The EAX state
|
||||
@param ct The ciphertext
|
||||
@@ -25,11 +23,11 @@
|
||||
@param length The length (octets) of the ciphertext
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt,
|
||||
int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt,
|
||||
unsigned long length)
|
||||
{
|
||||
int err;
|
||||
|
||||
|
||||
LTC_ARGCHK(eax != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
@@ -45,6 +43,6 @@ int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt,
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -57,6 +55,9 @@ int eax_decrypt_verify_memory(int cipher,
|
||||
/* default to zero */
|
||||
*stat = 0;
|
||||
|
||||
/* limit taglen */
|
||||
taglen = MIN(taglen, MAXBLOCKSIZE);
|
||||
|
||||
/* allocate ram */
|
||||
buf = XMALLOC(taglen);
|
||||
eax = XMALLOC(sizeof(*eax));
|
||||
@@ -77,17 +78,17 @@ int eax_decrypt_verify_memory(int cipher,
|
||||
if ((err = eax_decrypt(eax, ct, pt, ctlen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
|
||||
buflen = taglen;
|
||||
if ((err = eax_done(eax, buf, &buflen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* compare tags */
|
||||
if (buflen >= taglen && XMEMCMP(buf, tag, taglen) == 0) {
|
||||
if (buflen >= taglen && XMEM_NEQ(buf, tag, taglen) == 0) {
|
||||
*stat = 1;
|
||||
}
|
||||
|
||||
|
||||
err = CRYPT_OK;
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
@@ -103,6 +104,6 @@ LBL_ERR:
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -51,7 +49,7 @@ int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen)
|
||||
/* finish ctomac */
|
||||
len = MAXBLOCKSIZE;
|
||||
if ((err = omac_done(&eax->ctomac, ctmac, &len)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* finish headeromac */
|
||||
@@ -59,7 +57,7 @@ int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen)
|
||||
/* note we specifically don't reset len so the two lens are minimal */
|
||||
|
||||
if ((err = omac_done(&eax->headeromac, headermac, &len)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* terminate the CTR chain */
|
||||
@@ -89,6 +87,6 @@ LBL_ERR:
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,13 +5,11 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@file eax_encrypt.c
|
||||
EAX implementation, encrypt block by Tom St Denis
|
||||
EAX implementation, encrypt block by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -25,11 +23,11 @@
|
||||
@param length The length of the plaintext (octets)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct,
|
||||
int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct,
|
||||
unsigned long length)
|
||||
{
|
||||
int err;
|
||||
|
||||
|
||||
LTC_ARGCHK(eax != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
@@ -46,6 +44,6 @@ int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct,
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -53,15 +51,15 @@ int eax_encrypt_authenticate_memory(int cipher,
|
||||
eax = XMALLOC(sizeof(*eax));
|
||||
|
||||
if ((err = eax_init(eax, cipher, key, keylen, nonce, noncelen, header, headerlen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
if ((err = eax_encrypt(eax, pt, ct, ptlen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
|
||||
if ((err = eax_done(eax, tag, taglen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
err = CRYPT_OK;
|
||||
@@ -72,11 +70,11 @@ LBL_ERR:
|
||||
|
||||
XFREE(eax);
|
||||
|
||||
return err;
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,19 +5,17 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file eax_init.c
|
||||
EAX implementation, initialized EAX state, by Tom St Denis
|
||||
EAX implementation, initialized EAX state, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_EAX_MODE
|
||||
|
||||
/**
|
||||
/**
|
||||
Initialized an EAX state
|
||||
@param eax [out] The EAX state to initialize
|
||||
@param cipher The index of the desired cipher
|
||||
@@ -29,7 +27,7 @@
|
||||
@param headerlen The header length (octets)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int eax_init(eax_state *eax, int cipher,
|
||||
int eax_init(eax_state *eax, int cipher,
|
||||
const unsigned char *key, unsigned long keylen,
|
||||
const unsigned char *nonce, unsigned long noncelen,
|
||||
const unsigned char *header, unsigned long headerlen)
|
||||
@@ -69,21 +67,21 @@ int eax_init(eax_state *eax, int cipher,
|
||||
/* N = LTC_OMAC_0K(nonce) */
|
||||
zeromem(buf, MAXBLOCKSIZE);
|
||||
if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* omac the [0]_n */
|
||||
if ((err = omac_process(omac, buf, blklen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
/* omac the nonce */
|
||||
if ((err = omac_process(omac, nonce, noncelen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
/* store result */
|
||||
len = sizeof(eax->N);
|
||||
if ((err = omac_done(omac, eax->N, &len)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* H = LTC_OMAC_1K(header) */
|
||||
@@ -91,17 +89,17 @@ int eax_init(eax_state *eax, int cipher,
|
||||
buf[blklen - 1] = 1;
|
||||
|
||||
if ((err = omac_init(&eax->headeromac, cipher, key, keylen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* omac the [1]_n */
|
||||
if ((err = omac_process(&eax->headeromac, buf, blklen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
/* omac the header */
|
||||
if (headerlen != 0) {
|
||||
if ((err = omac_process(&eax->headeromac, header, headerlen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -109,19 +107,19 @@ int eax_init(eax_state *eax, int cipher,
|
||||
|
||||
/* setup the CTR mode */
|
||||
if ((err = ctr_start(cipher, eax->N, key, keylen, 0, CTR_COUNTER_BIG_ENDIAN, &eax->ctr)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* setup the LTC_OMAC for the ciphertext */
|
||||
if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* omac [2]_n */
|
||||
zeromem(buf, MAXBLOCKSIZE);
|
||||
buf[blklen-1] = 2;
|
||||
if ((err = omac_process(&eax->ctomac, buf, blklen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
err = CRYPT_OK;
|
||||
@@ -137,8 +135,8 @@ LBL_ERR:
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file eax_test.c
|
||||
EAX implementation, self-test, by Tom St Denis
|
||||
*/
|
||||
@@ -27,16 +25,16 @@ int eax_test(void)
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
int keylen,
|
||||
noncelen,
|
||||
headerlen,
|
||||
int keylen,
|
||||
noncelen,
|
||||
headerlen,
|
||||
msglen;
|
||||
|
||||
unsigned char key[MAXBLOCKSIZE],
|
||||
nonce[MAXBLOCKSIZE],
|
||||
header[MAXBLOCKSIZE],
|
||||
unsigned char key[MAXBLOCKSIZE],
|
||||
nonce[MAXBLOCKSIZE],
|
||||
header[MAXBLOCKSIZE],
|
||||
plaintext[MAXBLOCKSIZE],
|
||||
ciphertext[MAXBLOCKSIZE],
|
||||
ciphertext[MAXBLOCKSIZE],
|
||||
tag[MAXBLOCKSIZE];
|
||||
} tests[] = {
|
||||
|
||||
@@ -107,7 +105,7 @@ int eax_test(void)
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
/* nonce */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
/* header */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
@@ -134,7 +132,7 @@ int eax_test(void)
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
/* nonce */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e },
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e },
|
||||
/* header */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d },
|
||||
@@ -176,7 +174,7 @@ int eax_test(void)
|
||||
|
||||
{
|
||||
16, 16, 8, 2,
|
||||
/* key */
|
||||
/* key */
|
||||
{ 0x91, 0x94, 0x5d, 0x3f, 0x4d, 0xcb, 0xee, 0x0b,
|
||||
0xf4, 0x5e, 0xf5, 0x22, 0x55, 0xf0, 0x95, 0xa4 },
|
||||
/* nonce */
|
||||
@@ -210,14 +208,14 @@ int eax_test(void)
|
||||
/* Tag */
|
||||
{ 0x3a, 0x59, 0xf2, 0x38, 0xa2, 0x3e, 0x39, 0x19,
|
||||
0x9d, 0xc9, 0x26, 0x66, 0x26, 0xc4, 0x0f, 0x80 }
|
||||
}
|
||||
}
|
||||
|
||||
};
|
||||
int err, x, idx, res;
|
||||
unsigned long len;
|
||||
unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE];
|
||||
|
||||
/* AES can be under rijndael or aes... try to find it */
|
||||
/* AES can be under rijndael or aes... try to find it */
|
||||
if ((idx = find_cipher("aes")) == -1) {
|
||||
if ((idx = find_cipher("rijndael")) == -1) {
|
||||
return CRYPT_NOP;
|
||||
@@ -231,22 +229,8 @@ int eax_test(void)
|
||||
tests[x].plaintext, tests[x].msglen, outct, outtag, &len)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if (XMEMCMP(outct, tests[x].ciphertext, tests[x].msglen) || XMEMCMP(outtag, tests[x].tag, len)) {
|
||||
#if 0
|
||||
unsigned long y;
|
||||
printf("\n\nFailure: \nCT:\n");
|
||||
for (y = 0; y < (unsigned long)tests[x].msglen; ) {
|
||||
printf("0x%02x", outct[y]);
|
||||
if (y < (unsigned long)(tests[x].msglen-1)) printf(", ");
|
||||
if (!(++y % 8)) printf("\n");
|
||||
}
|
||||
printf("\nTAG:\n");
|
||||
for (y = 0; y < len; ) {
|
||||
printf("0x%02x", outtag[y]);
|
||||
if (y < len-1) printf(", ");
|
||||
if (!(++y % 8)) printf("\n");
|
||||
}
|
||||
#endif
|
||||
if (compare_testvector(outtag, len, tests[x].tag, len, "EAX Tag", x) ||
|
||||
compare_testvector(outct, tests[x].msglen, tests[x].ciphertext, tests[x].msglen, "EAX CT", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -256,27 +240,20 @@ int eax_test(void)
|
||||
outct, tests[x].msglen, outct, outtag, len, &res)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((res != 1) || XMEMCMP(outct, tests[x].plaintext, tests[x].msglen)) {
|
||||
#if 0
|
||||
unsigned long y;
|
||||
printf("\n\nFailure (res == %d): \nPT:\n", res);
|
||||
for (y = 0; y < (unsigned long)tests[x].msglen; ) {
|
||||
printf("0x%02x", outct[y]);
|
||||
if (y < (unsigned long)(tests[x].msglen-1)) printf(", ");
|
||||
if (!(++y % 8)) printf("\n");
|
||||
}
|
||||
printf("\n\n");
|
||||
if ((res != 1) || compare_testvector(outct, tests[x].msglen, tests[x].plaintext, tests[x].msglen, "EAX", x)) {
|
||||
#ifdef LTC_TEST_DBG
|
||||
printf("\n\nEAX: Failure-decrypt - res = %d\n", res);
|
||||
#endif
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
}
|
||||
return CRYPT_OK;
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif /* LTC_TEST */
|
||||
}
|
||||
|
||||
#endif /* LTC_EAX_MODE */
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -48,6 +46,8 @@ int gcm_add_aad(gcm_state *gcm,
|
||||
|
||||
/* in IV mode? */
|
||||
if (gcm->mode == LTC_GCM_MODE_IV) {
|
||||
/* IV length must be > 0 */
|
||||
if (gcm->buflen == 0 && gcm->totlen == 0) return CRYPT_ERROR;
|
||||
/* let's process the IV */
|
||||
if (gcm->ivmode || gcm->buflen != 12) {
|
||||
for (x = 0; x < (unsigned long)gcm->buflen; x++) {
|
||||
@@ -66,7 +66,7 @@ int gcm_add_aad(gcm_state *gcm,
|
||||
}
|
||||
gcm_mult_h(gcm, gcm->X);
|
||||
|
||||
/* copy counter out */
|
||||
/* copy counter out */
|
||||
XMEMCPY(gcm->Y, gcm->X, 16);
|
||||
zeromem(gcm->X, 16);
|
||||
} else {
|
||||
@@ -92,7 +92,7 @@ int gcm_add_aad(gcm_state *gcm,
|
||||
if (gcm->buflen == 0) {
|
||||
for (x = 0; x < (adatalen & ~15); x += 16) {
|
||||
for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) {
|
||||
*((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&adata[x + y]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&adata[x + y]));
|
||||
}
|
||||
gcm_mult_h(gcm, gcm->X);
|
||||
gcm->totlen += 128;
|
||||
@@ -104,9 +104,9 @@ int gcm_add_aad(gcm_state *gcm,
|
||||
|
||||
/* start adding AAD data to the state */
|
||||
for (; x < adatalen; x++) {
|
||||
gcm->X[gcm->buflen++] ^= *adata++;
|
||||
gcm->X[gcm->buflen++] ^= *adata++;
|
||||
|
||||
if (gcm->buflen == 16) {
|
||||
if (gcm->buflen == 16) {
|
||||
/* GF mult it */
|
||||
gcm_mult_h(gcm, gcm->X);
|
||||
gcm->buflen = 0;
|
||||
@@ -117,8 +117,8 @@ int gcm_add_aad(gcm_state *gcm,
|
||||
return CRYPT_OK;
|
||||
}
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -24,7 +22,7 @@
|
||||
@param IVlen The length of the IV
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int gcm_add_iv(gcm_state *gcm,
|
||||
int gcm_add_iv(gcm_state *gcm,
|
||||
const unsigned char *IV, unsigned long IVlen)
|
||||
{
|
||||
unsigned long x, y;
|
||||
@@ -39,7 +37,7 @@ int gcm_add_iv(gcm_state *gcm,
|
||||
if (gcm->mode != LTC_GCM_MODE_IV) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
|
||||
if (gcm->buflen >= 16 || gcm->buflen < 0) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
@@ -59,7 +57,7 @@ int gcm_add_iv(gcm_state *gcm,
|
||||
if (gcm->buflen == 0) {
|
||||
for (x = 0; x < (IVlen & ~15); x += 16) {
|
||||
for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) {
|
||||
*((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&IV[x + y]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&IV[x + y]));
|
||||
}
|
||||
gcm_mult_h(gcm, gcm->X);
|
||||
gcm->totlen += 128;
|
||||
@@ -72,7 +70,7 @@ int gcm_add_iv(gcm_state *gcm,
|
||||
for (; x < IVlen; x++) {
|
||||
gcm->buf[gcm->buflen++] = *IV++;
|
||||
|
||||
if (gcm->buflen == 16) {
|
||||
if (gcm->buflen == 16) {
|
||||
/* GF mult it */
|
||||
for (y = 0; y < 16; y++) {
|
||||
gcm->X[y] ^= gcm->buf[y];
|
||||
@@ -87,8 +85,8 @@ int gcm_add_iv(gcm_state *gcm,
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -24,7 +22,7 @@
|
||||
@param taglen [in/out] The length of the MAC tag
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int gcm_done(gcm_state *gcm,
|
||||
int gcm_done(gcm_state *gcm,
|
||||
unsigned char *tag, unsigned long *taglen)
|
||||
{
|
||||
unsigned long x;
|
||||
@@ -42,6 +40,15 @@ int gcm_done(gcm_state *gcm,
|
||||
return err;
|
||||
}
|
||||
|
||||
if (gcm->mode == LTC_GCM_MODE_IV) {
|
||||
/* let's process the IV */
|
||||
if ((err = gcm_add_aad(gcm, NULL, 0)) != CRYPT_OK) return err;
|
||||
}
|
||||
|
||||
if (gcm->mode == LTC_GCM_MODE_AAD) {
|
||||
/* let's process the AAD */
|
||||
if ((err = gcm_process(gcm, NULL, 0, NULL, 0)) != CRYPT_OK) return err;
|
||||
}
|
||||
|
||||
if (gcm->mode != LTC_GCM_MODE_TEXT) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
@@ -78,6 +85,6 @@ int gcm_done(gcm_state *gcm,
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -15,9 +13,9 @@
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#if defined(LTC_GCM_TABLES) || defined(LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST))
|
||||
#if defined(LTC_GCM_TABLES) || defined(LTC_LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST))
|
||||
|
||||
/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the
|
||||
/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the
|
||||
* lower 16 bits are not zero'ed I removed the upper 14 bytes */
|
||||
const unsigned char gcm_shift_table[256*2] = {
|
||||
0x00, 0x00, 0x01, 0xc2, 0x03, 0x84, 0x02, 0x46, 0x07, 0x08, 0x06, 0xca, 0x04, 0x8c, 0x05, 0x4e,
|
||||
@@ -60,7 +58,7 @@ const unsigned char gcm_shift_table[256*2] = {
|
||||
|
||||
#ifndef LTC_FAST
|
||||
/* right shift */
|
||||
static void gcm_rightshift(unsigned char *a)
|
||||
static void _gcm_rightshift(unsigned char *a)
|
||||
{
|
||||
int x;
|
||||
for (x = 15; x > 0; x--) {
|
||||
@@ -73,28 +71,28 @@ static void gcm_rightshift(unsigned char *a)
|
||||
static const unsigned char mask[] = { 0x80, 0x40, 0x20, 0x10, 0x08, 0x04, 0x02, 0x01 };
|
||||
static const unsigned char poly[] = { 0x00, 0xE1 };
|
||||
|
||||
|
||||
|
||||
/**
|
||||
GCM GF multiplier (internal use only) bitserial
|
||||
@param a First value
|
||||
@param b Second value
|
||||
@param c Destination for a * b
|
||||
*/
|
||||
*/
|
||||
void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c)
|
||||
{
|
||||
unsigned char Z[16], V[16];
|
||||
unsigned x, y, z;
|
||||
unsigned char x, y, z;
|
||||
|
||||
zeromem(Z, 16);
|
||||
XMEMCPY(V, a, 16);
|
||||
for (x = 0; x < 128; x++) {
|
||||
if (b[x>>3] & mask[x&7]) {
|
||||
for (y = 0; y < 16; y++) {
|
||||
Z[y] ^= V[y];
|
||||
Z[y] ^= V[y];
|
||||
}
|
||||
}
|
||||
z = V[15] & 0x01;
|
||||
gcm_rightshift(V);
|
||||
_gcm_rightshift(V);
|
||||
V[0] ^= poly[z];
|
||||
}
|
||||
XMEMCPY(c, Z, 16);
|
||||
@@ -113,7 +111,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *
|
||||
@param a First value
|
||||
@param b Second value
|
||||
@param c Destination for a * b
|
||||
*/
|
||||
*/
|
||||
void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c)
|
||||
{
|
||||
int i, j, k, u;
|
||||
@@ -129,7 +127,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *
|
||||
LOAD32H(B[M(1)][i], a + (i<<2));
|
||||
LOAD32L(pB[i], b + (i<<2));
|
||||
}
|
||||
#else
|
||||
#else
|
||||
for (i = 0; i < 2; i++) {
|
||||
LOAD64H(B[M(1)][i], a + (i<<3));
|
||||
LOAD64L(pB[i], b + (i<<3));
|
||||
@@ -154,7 +152,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *
|
||||
B[M(9)][i] = B[M(1)][i] ^ B[M(8)][i];
|
||||
B[M(10)][i] = B[M(2)][i] ^ B[M(8)][i];
|
||||
B[M(12)][i] = B[M(8)][i] ^ B[M(4)][i];
|
||||
|
||||
|
||||
/* now all 3 bit values and the only 4 bit value: 7, 11, 13, 14, 15 */
|
||||
B[M(7)][i] = B[M(3)][i] ^ B[M(4)][i];
|
||||
B[M(11)][i] = B[M(3)][i] ^ B[M(8)][i];
|
||||
@@ -193,7 +191,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *
|
||||
for (i = 0; i < 8; i++) {
|
||||
STORE32H(tmp[i], pTmp + (i<<2));
|
||||
}
|
||||
#else
|
||||
#else
|
||||
for (i = 0; i < 4; i++) {
|
||||
STORE64H(tmp[i], pTmp + (i<<3));
|
||||
}
|
||||
@@ -215,7 +213,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -25,7 +23,7 @@
|
||||
@param keylen The length of the secret key
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
int gcm_init(gcm_state *gcm, int cipher,
|
||||
int gcm_init(gcm_state *gcm, int cipher,
|
||||
const unsigned char *key, int keylen)
|
||||
{
|
||||
int err;
|
||||
@@ -92,8 +90,8 @@ int gcm_init(gcm_state *gcm, int cipher,
|
||||
}
|
||||
gcm->PC[x][y][0] = gcm_shift_table[t<<1];
|
||||
gcm->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1];
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
@@ -102,6 +100,6 @@ int gcm_init(gcm_state *gcm, int cipher,
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -22,8 +20,8 @@
|
||||
@param cipher Index of cipher to use
|
||||
@param key The secret key
|
||||
@param keylen The length of the secret key
|
||||
@param IV The initial vector
|
||||
@param IVlen The length of the initial vector
|
||||
@param IV The initialization vector
|
||||
@param IVlen The length of the initialization vector
|
||||
@param adata The additional authentication data (header)
|
||||
@param adatalen The length of the adata
|
||||
@param pt The plaintext
|
||||
@@ -39,7 +37,7 @@ int gcm_memory( int cipher,
|
||||
const unsigned char *IV, unsigned long IVlen,
|
||||
const unsigned char *adata, unsigned long adatalen,
|
||||
unsigned char *pt, unsigned long ptlen,
|
||||
unsigned char *ct,
|
||||
unsigned char *ct,
|
||||
unsigned char *tag, unsigned long *taglen,
|
||||
int direction)
|
||||
{
|
||||
@@ -50,10 +48,9 @@ int gcm_memory( int cipher,
|
||||
if ((err = cipher_is_valid(cipher)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
|
||||
if (cipher_descriptor[cipher].accel_gcm_memory != NULL) {
|
||||
return
|
||||
cipher_descriptor[cipher].accel_gcm_memory
|
||||
return cipher_descriptor[cipher].accel_gcm_memory
|
||||
(key, keylen,
|
||||
IV, IVlen,
|
||||
adata, adatalen,
|
||||
@@ -104,6 +101,6 @@ LTC_ERR:
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -25,7 +23,7 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I)
|
||||
{
|
||||
unsigned char T[16];
|
||||
#ifdef LTC_GCM_TABLES
|
||||
int x, y;
|
||||
int x;
|
||||
#ifdef LTC_GCM_TABLES_SSE2
|
||||
asm("movdqa (%0),%%xmm0"::"r"(&gcm->PC[0][I[0]][0]));
|
||||
for (x = 1; x < 16; x++) {
|
||||
@@ -33,11 +31,12 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I)
|
||||
}
|
||||
asm("movdqa %%xmm0,(%0)"::"r"(&T));
|
||||
#else
|
||||
int y;
|
||||
XMEMCPY(T, &gcm->PC[0][I[0]][0], 16);
|
||||
for (x = 1; x < 16; x++) {
|
||||
#ifdef LTC_FAST
|
||||
for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) {
|
||||
*((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&gcm->PC[x][I[x]][y]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(T + y)) ^= *(LTC_FAST_TYPE_PTR_CAST(&gcm->PC[x][I[x]][y]));
|
||||
}
|
||||
#else
|
||||
for (y = 0; y < 16; y++) {
|
||||
@@ -46,13 +45,13 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I)
|
||||
#endif /* LTC_FAST */
|
||||
}
|
||||
#endif /* LTC_GCM_TABLES_SSE2 */
|
||||
#else
|
||||
gcm_gf_mult(gcm->H, I, T);
|
||||
#else
|
||||
gcm_gf_mult(gcm->H, I, T);
|
||||
#endif
|
||||
XMEMCPY(I, T, 16);
|
||||
}
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -17,9 +15,9 @@
|
||||
|
||||
#ifdef LTC_GCM_MODE
|
||||
|
||||
/**
|
||||
/**
|
||||
Process plaintext/ciphertext through GCM
|
||||
@param gcm The GCM state
|
||||
@param gcm The GCM state
|
||||
@param pt The plaintext
|
||||
@param ptlen The plaintext length (ciphertext length is the same)
|
||||
@param ct The ciphertext
|
||||
@@ -44,11 +42,21 @@ int gcm_process(gcm_state *gcm,
|
||||
if (gcm->buflen > 16 || gcm->buflen < 0) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
|
||||
if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
/* 0xFFFFFFFE0 = ((2^39)-256)/8 */
|
||||
if (gcm->pttotlen / 8 + (ulong64)gcm->buflen + (ulong64)ptlen >= CONST64(0xFFFFFFFE0)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
if (gcm->mode == LTC_GCM_MODE_IV) {
|
||||
/* let's process the IV */
|
||||
if ((err = gcm_add_aad(gcm, NULL, 0)) != CRYPT_OK) return err;
|
||||
}
|
||||
|
||||
/* in AAD mode? */
|
||||
if (gcm->mode == LTC_GCM_MODE_AAD) {
|
||||
/* let's process the AAD */
|
||||
@@ -77,12 +85,12 @@ int gcm_process(gcm_state *gcm,
|
||||
x = 0;
|
||||
#ifdef LTC_FAST
|
||||
if (gcm->buflen == 0) {
|
||||
if (direction == GCM_ENCRYPT) {
|
||||
if (direction == GCM_ENCRYPT) {
|
||||
for (x = 0; x < (ptlen & ~15); x += 16) {
|
||||
/* ctr encrypt */
|
||||
for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) {
|
||||
*((LTC_FAST_TYPE*)(&ct[x + y])) = *((LTC_FAST_TYPE*)(&pt[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y]));
|
||||
*((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&ct[x + y])) = *(LTC_FAST_TYPE_PTR_CAST(&pt[x+y])) ^ *(LTC_FAST_TYPE_PTR_CAST(&gcm->buf[y]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&ct[x+y]));
|
||||
}
|
||||
/* GMAC it */
|
||||
gcm->pttotlen += 128;
|
||||
@@ -99,8 +107,8 @@ int gcm_process(gcm_state *gcm,
|
||||
for (x = 0; x < (ptlen & ~15); x += 16) {
|
||||
/* ctr encrypt */
|
||||
for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) {
|
||||
*((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y]));
|
||||
*((LTC_FAST_TYPE*)(&pt[x + y])) = *((LTC_FAST_TYPE*)(&ct[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&ct[x+y]));
|
||||
*(LTC_FAST_TYPE_PTR_CAST(&pt[x + y])) = *(LTC_FAST_TYPE_PTR_CAST(&ct[x+y])) ^ *(LTC_FAST_TYPE_PTR_CAST(&gcm->buf[y]));
|
||||
}
|
||||
/* GMAC it */
|
||||
gcm->pttotlen += 128;
|
||||
@@ -113,16 +121,16 @@ int gcm_process(gcm_state *gcm,
|
||||
return err;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
#endif
|
||||
#endif
|
||||
|
||||
/* process text */
|
||||
for (; x < ptlen; x++) {
|
||||
if (gcm->buflen == 16) {
|
||||
gcm->pttotlen += 128;
|
||||
gcm_mult_h(gcm, gcm->X);
|
||||
|
||||
|
||||
/* increment counter */
|
||||
for (y = 15; y >= 12; y--) {
|
||||
if (++gcm->Y[y] & 255) { break; }
|
||||
@@ -134,12 +142,12 @@ int gcm_process(gcm_state *gcm,
|
||||
}
|
||||
|
||||
if (direction == GCM_ENCRYPT) {
|
||||
b = ct[x] = pt[x] ^ gcm->buf[gcm->buflen];
|
||||
b = ct[x] = pt[x] ^ gcm->buf[gcm->buflen];
|
||||
} else {
|
||||
b = ct[x];
|
||||
pt[x] = ct[x] ^ gcm->buf[gcm->buflen];
|
||||
}
|
||||
gcm->X[gcm->buflen++] ^= b;
|
||||
gcm->X[gcm->buflen++] ^= b;
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
@@ -147,6 +155,6 @@ int gcm_process(gcm_state *gcm,
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -33,12 +31,12 @@ int gcm_reset(gcm_state *gcm)
|
||||
gcm->buflen = 0;
|
||||
gcm->totlen = 0;
|
||||
gcm->pttotlen = 0;
|
||||
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -17,7 +15,7 @@
|
||||
|
||||
#ifdef LTC_GCM_MODE
|
||||
|
||||
/**
|
||||
/**
|
||||
Test the GCM code
|
||||
@return CRYPT_OK on success
|
||||
*/
|
||||
@@ -100,18 +98,18 @@ int gcm_test(void)
|
||||
/* test case #3 */
|
||||
{
|
||||
/* key */
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, },
|
||||
16,
|
||||
|
||||
/* PT */
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
0xba, 0x63, 0x7b, 0x39, 0x1a, 0xaf, 0xd2, 0x55, },
|
||||
64,
|
||||
|
||||
@@ -120,66 +118,66 @@ int gcm_test(void)
|
||||
0,
|
||||
|
||||
/* IV */
|
||||
{ 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad,
|
||||
{ 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad,
|
||||
0xde, 0xca, 0xf8, 0x88, },
|
||||
12,
|
||||
|
||||
|
||||
/* CT */
|
||||
{ 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24,
|
||||
0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c,
|
||||
0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0,
|
||||
0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e,
|
||||
0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c,
|
||||
0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05,
|
||||
0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97,
|
||||
{ 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24,
|
||||
0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c,
|
||||
0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0,
|
||||
0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e,
|
||||
0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c,
|
||||
0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05,
|
||||
0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97,
|
||||
0x3d, 0x58, 0xe0, 0x91, 0x47, 0x3f, 0x59, 0x85, },
|
||||
|
||||
/* TAG */
|
||||
{ 0x4d, 0x5c, 0x2a, 0xf3, 0x27, 0xcd, 0x64, 0xa6,
|
||||
{ 0x4d, 0x5c, 0x2a, 0xf3, 0x27, 0xcd, 0x64, 0xa6,
|
||||
0x2c, 0xf3, 0x5a, 0xbd, 0x2b, 0xa6, 0xfa, 0xb4, }
|
||||
},
|
||||
|
||||
/* test case #4 */
|
||||
{
|
||||
/* key */
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, },
|
||||
16,
|
||||
|
||||
/* PT */
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
0xba, 0x63, 0x7b, 0x39, },
|
||||
60,
|
||||
|
||||
/* ADATA */
|
||||
{ 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
{ 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xab, 0xad, 0xda, 0xd2, },
|
||||
20,
|
||||
|
||||
/* IV */
|
||||
{ 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad,
|
||||
{ 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad,
|
||||
0xde, 0xca, 0xf8, 0x88, },
|
||||
12,
|
||||
|
||||
/* CT */
|
||||
{ 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24,
|
||||
0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c,
|
||||
0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0,
|
||||
0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e,
|
||||
0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c,
|
||||
0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05,
|
||||
0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97,
|
||||
{ 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24,
|
||||
0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c,
|
||||
0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0,
|
||||
0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e,
|
||||
0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c,
|
||||
0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05,
|
||||
0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97,
|
||||
0x3d, 0x58, 0xe0, 0x91, },
|
||||
|
||||
/* TAG */
|
||||
{ 0x5b, 0xc9, 0x4f, 0xbc, 0x32, 0x21, 0xa5, 0xdb,
|
||||
{ 0x5b, 0xc9, 0x4f, 0xbc, 0x32, 0x21, 0xa5, 0xdb,
|
||||
0x94, 0xfa, 0xe9, 0x5a, 0xe7, 0x12, 0x1a, 0x47, }
|
||||
|
||||
},
|
||||
@@ -187,24 +185,24 @@ int gcm_test(void)
|
||||
/* test case #5 */
|
||||
{
|
||||
/* key */
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, },
|
||||
16,
|
||||
|
||||
/* PT */
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
0xba, 0x63, 0x7b, 0x39, },
|
||||
60,
|
||||
|
||||
/* ADATA */
|
||||
{ 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
{ 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xab, 0xad, 0xda, 0xd2, },
|
||||
20,
|
||||
|
||||
@@ -213,112 +211,112 @@ int gcm_test(void)
|
||||
8,
|
||||
|
||||
/* CT */
|
||||
{ 0x61, 0x35, 0x3b, 0x4c, 0x28, 0x06, 0x93, 0x4a,
|
||||
0x77, 0x7f, 0xf5, 0x1f, 0xa2, 0x2a, 0x47, 0x55,
|
||||
0x69, 0x9b, 0x2a, 0x71, 0x4f, 0xcd, 0xc6, 0xf8,
|
||||
0x37, 0x66, 0xe5, 0xf9, 0x7b, 0x6c, 0x74, 0x23,
|
||||
0x73, 0x80, 0x69, 0x00, 0xe4, 0x9f, 0x24, 0xb2,
|
||||
0x2b, 0x09, 0x75, 0x44, 0xd4, 0x89, 0x6b, 0x42,
|
||||
0x49, 0x89, 0xb5, 0xe1, 0xeb, 0xac, 0x0f, 0x07,
|
||||
{ 0x61, 0x35, 0x3b, 0x4c, 0x28, 0x06, 0x93, 0x4a,
|
||||
0x77, 0x7f, 0xf5, 0x1f, 0xa2, 0x2a, 0x47, 0x55,
|
||||
0x69, 0x9b, 0x2a, 0x71, 0x4f, 0xcd, 0xc6, 0xf8,
|
||||
0x37, 0x66, 0xe5, 0xf9, 0x7b, 0x6c, 0x74, 0x23,
|
||||
0x73, 0x80, 0x69, 0x00, 0xe4, 0x9f, 0x24, 0xb2,
|
||||
0x2b, 0x09, 0x75, 0x44, 0xd4, 0x89, 0x6b, 0x42,
|
||||
0x49, 0x89, 0xb5, 0xe1, 0xeb, 0xac, 0x0f, 0x07,
|
||||
0xc2, 0x3f, 0x45, 0x98, },
|
||||
|
||||
/* TAG */
|
||||
{ 0x36, 0x12, 0xd2, 0xe7, 0x9e, 0x3b, 0x07, 0x85,
|
||||
{ 0x36, 0x12, 0xd2, 0xe7, 0x9e, 0x3b, 0x07, 0x85,
|
||||
0x56, 0x1b, 0xe1, 0x4a, 0xac, 0xa2, 0xfc, 0xcb, }
|
||||
},
|
||||
|
||||
/* test case #6 */
|
||||
{
|
||||
/* key */
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
{ 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c,
|
||||
0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, },
|
||||
16,
|
||||
|
||||
/* PT */
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
{ 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a,
|
||||
0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda,
|
||||
0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72,
|
||||
0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53,
|
||||
0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25,
|
||||
0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57,
|
||||
0xba, 0x63, 0x7b, 0x39, },
|
||||
60,
|
||||
|
||||
/* ADATA */
|
||||
{ 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
{ 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef,
|
||||
0xab, 0xad, 0xda, 0xd2, },
|
||||
20,
|
||||
|
||||
/* IV */
|
||||
{ 0x93, 0x13, 0x22, 0x5d, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0x55, 0x90, 0x9c, 0x5a, 0xff, 0x52, 0x69, 0xaa,
|
||||
0x6a, 0x7a, 0x95, 0x38, 0x53, 0x4f, 0x7d, 0xa1,
|
||||
0xe4, 0xc3, 0x03, 0xd2, 0xa3, 0x18, 0xa7, 0x28,
|
||||
0xc3, 0xc0, 0xc9, 0x51, 0x56, 0x80, 0x95, 0x39,
|
||||
0xfc, 0xf0, 0xe2, 0x42, 0x9a, 0x6b, 0x52, 0x54,
|
||||
0x16, 0xae, 0xdb, 0xf5, 0xa0, 0xde, 0x6a, 0x57,
|
||||
{ 0x93, 0x13, 0x22, 0x5d, 0xf8, 0x84, 0x06, 0xe5,
|
||||
0x55, 0x90, 0x9c, 0x5a, 0xff, 0x52, 0x69, 0xaa,
|
||||
0x6a, 0x7a, 0x95, 0x38, 0x53, 0x4f, 0x7d, 0xa1,
|
||||
0xe4, 0xc3, 0x03, 0xd2, 0xa3, 0x18, 0xa7, 0x28,
|
||||
0xc3, 0xc0, 0xc9, 0x51, 0x56, 0x80, 0x95, 0x39,
|
||||
0xfc, 0xf0, 0xe2, 0x42, 0x9a, 0x6b, 0x52, 0x54,
|
||||
0x16, 0xae, 0xdb, 0xf5, 0xa0, 0xde, 0x6a, 0x57,
|
||||
0xa6, 0x37, 0xb3, 0x9b, },
|
||||
60,
|
||||
|
||||
/* CT */
|
||||
{ 0x8c, 0xe2, 0x49, 0x98, 0x62, 0x56, 0x15, 0xb6,
|
||||
0x03, 0xa0, 0x33, 0xac, 0xa1, 0x3f, 0xb8, 0x94,
|
||||
0xbe, 0x91, 0x12, 0xa5, 0xc3, 0xa2, 0x11, 0xa8,
|
||||
0xba, 0x26, 0x2a, 0x3c, 0xca, 0x7e, 0x2c, 0xa7,
|
||||
0x01, 0xe4, 0xa9, 0xa4, 0xfb, 0xa4, 0x3c, 0x90,
|
||||
0xcc, 0xdc, 0xb2, 0x81, 0xd4, 0x8c, 0x7c, 0x6f,
|
||||
0xd6, 0x28, 0x75, 0xd2, 0xac, 0xa4, 0x17, 0x03,
|
||||
{ 0x8c, 0xe2, 0x49, 0x98, 0x62, 0x56, 0x15, 0xb6,
|
||||
0x03, 0xa0, 0x33, 0xac, 0xa1, 0x3f, 0xb8, 0x94,
|
||||
0xbe, 0x91, 0x12, 0xa5, 0xc3, 0xa2, 0x11, 0xa8,
|
||||
0xba, 0x26, 0x2a, 0x3c, 0xca, 0x7e, 0x2c, 0xa7,
|
||||
0x01, 0xe4, 0xa9, 0xa4, 0xfb, 0xa4, 0x3c, 0x90,
|
||||
0xcc, 0xdc, 0xb2, 0x81, 0xd4, 0x8c, 0x7c, 0x6f,
|
||||
0xd6, 0x28, 0x75, 0xd2, 0xac, 0xa4, 0x17, 0x03,
|
||||
0x4c, 0x34, 0xae, 0xe5, },
|
||||
|
||||
/* TAG */
|
||||
{ 0x61, 0x9c, 0xc5, 0xae, 0xff, 0xfe, 0x0b, 0xfa,
|
||||
{ 0x61, 0x9c, 0xc5, 0xae, 0xff, 0xfe, 0x0b, 0xfa,
|
||||
0x46, 0x2a, 0xf4, 0x3c, 0x16, 0x99, 0xd0, 0x50, }
|
||||
},
|
||||
|
||||
/* test case #46 from BG (catches the LTC bug of v1.15) */
|
||||
{
|
||||
/* key */
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 },
|
||||
16,
|
||||
|
||||
/* PT */
|
||||
{ 0xa2, 0xaa, 0xb3, 0xad, 0x8b, 0x17, 0xac, 0xdd,
|
||||
0xa2, 0x88, 0x42, 0x6c, 0xd7, 0xc4, 0x29, 0xb7,
|
||||
0xca, 0x86, 0xb7, 0xac, 0xa0, 0x58, 0x09, 0xc7,
|
||||
{ 0xa2, 0xaa, 0xb3, 0xad, 0x8b, 0x17, 0xac, 0xdd,
|
||||
0xa2, 0x88, 0x42, 0x6c, 0xd7, 0xc4, 0x29, 0xb7,
|
||||
0xca, 0x86, 0xb7, 0xac, 0xa0, 0x58, 0x09, 0xc7,
|
||||
0x0c, 0xe8, 0x2d, 0xb2, 0x57, 0x11, 0xcb, 0x53,
|
||||
0x02, 0xeb, 0x27, 0x43, 0xb0, 0x36, 0xf3, 0xd7,
|
||||
0x50, 0xd6, 0xcf, 0x0d, 0xc0, 0xac, 0xb9, 0x29,
|
||||
0x50, 0xd5, 0x46, 0xdb, 0x30, 0x8f, 0x93, 0xb4,
|
||||
0x02, 0xeb, 0x27, 0x43, 0xb0, 0x36, 0xf3, 0xd7,
|
||||
0x50, 0xd6, 0xcf, 0x0d, 0xc0, 0xac, 0xb9, 0x29,
|
||||
0x50, 0xd5, 0x46, 0xdb, 0x30, 0x8f, 0x93, 0xb4,
|
||||
0xff, 0x24, 0x4a, 0xfa, 0x9d, 0xc7, 0x2b, 0xcd,
|
||||
0x75, 0x8d, 0x2c },
|
||||
67,
|
||||
|
||||
/* ADATA */
|
||||
{ 0x68, 0x8e, 0x1a, 0xa9, 0x84, 0xde, 0x92, 0x6d,
|
||||
{ 0x68, 0x8e, 0x1a, 0xa9, 0x84, 0xde, 0x92, 0x6d,
|
||||
0xc7, 0xb4, 0xc4, 0x7f, 0x44 },
|
||||
13,
|
||||
13,
|
||||
|
||||
/* IV */
|
||||
{ 0xb7, 0x21, 0x38, 0xb5, 0xa0, 0x5f, 0xf5, 0x07,
|
||||
{ 0xb7, 0x21, 0x38, 0xb5, 0xa0, 0x5f, 0xf5, 0x07,
|
||||
0x0e, 0x8c, 0xd9, 0x41, 0x83, 0xf7, 0x61, 0xd8 },
|
||||
16,
|
||||
|
||||
/* CT */
|
||||
{ 0xcb, 0xc8, 0xd2, 0xf1, 0x54, 0x81, 0xa4, 0xcc,
|
||||
0x7d, 0xd1, 0xe1, 0x9a, 0xaa, 0x83, 0xde, 0x56,
|
||||
0x78, 0x48, 0x3e, 0xc3, 0x59, 0xae, 0x7d, 0xec,
|
||||
{ 0xcb, 0xc8, 0xd2, 0xf1, 0x54, 0x81, 0xa4, 0xcc,
|
||||
0x7d, 0xd1, 0xe1, 0x9a, 0xaa, 0x83, 0xde, 0x56,
|
||||
0x78, 0x48, 0x3e, 0xc3, 0x59, 0xae, 0x7d, 0xec,
|
||||
0x2a, 0xb8, 0xd5, 0x34, 0xe0, 0x90, 0x6f, 0x4b,
|
||||
0x46, 0x63, 0xfa, 0xff, 0x58, 0xa8, 0xb2, 0xd7,
|
||||
0x33, 0xb8, 0x45, 0xee, 0xf7, 0xc9, 0xb3, 0x31,
|
||||
0xe9, 0xe1, 0x0e, 0xb2, 0x61, 0x2c, 0x99, 0x5f,
|
||||
0x46, 0x63, 0xfa, 0xff, 0x58, 0xa8, 0xb2, 0xd7,
|
||||
0x33, 0xb8, 0x45, 0xee, 0xf7, 0xc9, 0xb3, 0x31,
|
||||
0xe9, 0xe1, 0x0e, 0xb2, 0x61, 0x2c, 0x99, 0x5f,
|
||||
0xeb, 0x1a, 0xc1, 0x5a, 0x62, 0x86, 0xcc, 0xe8,
|
||||
0xb2, 0x97, 0xa8 },
|
||||
|
||||
/* TAG */
|
||||
{ 0x8d, 0x2d, 0x2a, 0x93, 0x72, 0x62, 0x6f, 0x6b,
|
||||
{ 0x8d, 0x2d, 0x2a, 0x93, 0x72, 0x62, 0x6f, 0x6b,
|
||||
0xee, 0x85, 0x80, 0x27, 0x6a, 0x63, 0x66, 0xbf }
|
||||
}
|
||||
|
||||
@@ -327,6 +325,7 @@ int gcm_test(void)
|
||||
int idx, err;
|
||||
unsigned long x, y;
|
||||
unsigned char out[2][128], T[2][16];
|
||||
gcm_state gcm;
|
||||
|
||||
/* find aes */
|
||||
idx = find_cipher("aes");
|
||||
@@ -337,6 +336,14 @@ int gcm_test(void)
|
||||
}
|
||||
}
|
||||
|
||||
/* Special test case for empty AAD + empty PT */
|
||||
y = sizeof(T[0]);
|
||||
if ((err = gcm_init(&gcm, idx, tests[0].K, tests[0].keylen)) != CRYPT_OK) return err;
|
||||
if ((err = gcm_add_iv(&gcm, tests[0].IV, tests[0].IVlen)) != CRYPT_OK) return err;
|
||||
/* intentionally skip gcm_add_aad + gcm_process */
|
||||
if ((err = gcm_done(&gcm, T[0], &y)) != CRYPT_OK) return err;
|
||||
if (compare_testvector(T[0], y, tests[0].T, 16, "GCM Encrypt Tag-special", 0)) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
y = sizeof(T[0]);
|
||||
if ((err = gcm_memory(idx, tests[x].K, tests[x].keylen,
|
||||
@@ -347,25 +354,11 @@ int gcm_test(void)
|
||||
return err;
|
||||
}
|
||||
|
||||
if (XMEMCMP(out[0], tests[x].C, tests[x].ptlen)) {
|
||||
#if 0
|
||||
printf("\nCiphertext wrong %lu\n", x);
|
||||
for (y = 0; y < tests[x].ptlen; y++) {
|
||||
printf("%02x", out[0][y] & 255);
|
||||
}
|
||||
printf("\n");
|
||||
#endif
|
||||
if (compare_testvector(out[0], tests[x].ptlen, tests[x].C, tests[x].ptlen, "GCM CT", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
if (XMEMCMP(T[0], tests[x].T, 16)) {
|
||||
#if 0
|
||||
printf("\nTag on plaintext wrong %lu\n", x);
|
||||
for (y = 0; y < 16; y++) {
|
||||
printf("%02x", T[0][y] & 255);
|
||||
}
|
||||
printf("\n");
|
||||
#endif
|
||||
if (compare_testvector(T[0], y, tests[x].T, 16, "GCM Encrypt Tag", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -378,25 +371,11 @@ int gcm_test(void)
|
||||
return err;
|
||||
}
|
||||
|
||||
if (XMEMCMP(out[1], tests[x].P, tests[x].ptlen)) {
|
||||
#if 0
|
||||
printf("\nplaintext wrong %lu\n", x);
|
||||
for (y = 0; y < tests[x].ptlen; y++) {
|
||||
printf("%02x", out[0][y] & 255);
|
||||
}
|
||||
printf("\n");
|
||||
#endif
|
||||
if (compare_testvector(out[1], tests[x].ptlen, tests[x].P, tests[x].ptlen, "GCM PT", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
if (XMEMCMP(T[1], tests[x].T, 16)) {
|
||||
#if 0
|
||||
printf("\nTag on ciphertext wrong %lu\n", x);
|
||||
for (y = 0; y < 16; y++) {
|
||||
printf("%02x", T[1][y] & 255);
|
||||
}
|
||||
printf("\n");
|
||||
#endif
|
||||
if (compare_testvector(T[1], y, tests[x].T, 16, "GCM Decrypt Tag", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -408,6 +387,6 @@ int gcm_test(void)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,13 +5,11 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb_decrypt.c
|
||||
OCB implementation, decrypt data, by Tom St Denis
|
||||
OCB implementation, decrypt data, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -38,7 +36,7 @@ int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt)
|
||||
return err;
|
||||
}
|
||||
LTC_ARGCHK(cipher_descriptor[ocb->cipher].ecb_decrypt != NULL);
|
||||
|
||||
|
||||
/* check length */
|
||||
if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
@@ -74,6 +72,6 @@ int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,13 +5,11 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file ocb_decrypt_verify_memory.c
|
||||
OCB implementation, helper to decrypt block of memory, by Tom St Denis
|
||||
OCB implementation, helper to decrypt block of memory, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -33,7 +31,7 @@
|
||||
*/
|
||||
int ocb_decrypt_verify_memory(int cipher,
|
||||
const unsigned char *key, unsigned long keylen,
|
||||
const unsigned char *nonce,
|
||||
const unsigned char *nonce,
|
||||
const unsigned char *ct, unsigned long ctlen,
|
||||
unsigned char *pt,
|
||||
const unsigned char *tag, unsigned long taglen,
|
||||
@@ -56,12 +54,12 @@ int ocb_decrypt_verify_memory(int cipher,
|
||||
}
|
||||
|
||||
if ((err = ocb_init(ocb, cipher, key, keylen, nonce)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
while (ctlen > (unsigned long)ocb->block_len) {
|
||||
if ((err = ocb_decrypt(ocb, ct, pt)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
ctlen -= ocb->block_len;
|
||||
pt += ocb->block_len;
|
||||
@@ -73,7 +71,7 @@ LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(ocb, sizeof(ocb_state));
|
||||
#endif
|
||||
|
||||
|
||||
XFREE(ocb);
|
||||
|
||||
return err;
|
||||
@@ -81,6 +79,6 @@ LBL_ERR:
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file ocb_done_decrypt.c
|
||||
OCB implementation, terminate decryption, by Tom St Denis
|
||||
*/
|
||||
@@ -28,9 +26,9 @@
|
||||
@param stat [out] The result of the tag comparison
|
||||
@return CRYPT_OK if the process was successful regardless if the tag is valid
|
||||
*/
|
||||
int ocb_done_decrypt(ocb_state *ocb,
|
||||
int ocb_done_decrypt(ocb_state *ocb,
|
||||
const unsigned char *ct, unsigned long ctlen,
|
||||
unsigned char *pt,
|
||||
unsigned char *pt,
|
||||
const unsigned char *tag, unsigned long taglen, int *stat)
|
||||
{
|
||||
int err;
|
||||
@@ -57,7 +55,7 @@ int ocb_done_decrypt(ocb_state *ocb,
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
if (taglen <= tagbuflen && XMEMCMP(tagbuf, tag, taglen) == 0) {
|
||||
if (taglen <= tagbuflen && XMEM_NEQ(tagbuf, tag, taglen) == 0) {
|
||||
*stat = 1;
|
||||
}
|
||||
|
||||
@@ -75,6 +73,6 @@ LBL_ERR:
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file ocb_done_encrypt.c
|
||||
OCB implementation, terminate encryption, by Tom St Denis
|
||||
*/
|
||||
@@ -17,7 +15,7 @@
|
||||
|
||||
#ifdef LTC_OCB_MODE
|
||||
|
||||
/**
|
||||
/**
|
||||
Terminate an encryption OCB state
|
||||
@param ocb The OCB state
|
||||
@param pt Remaining plaintext (if any)
|
||||
@@ -41,6 +39,6 @@ int ocb_done_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned long ptle
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file ocb_encrypt.c
|
||||
OCB implementation, encrypt data, by Tom St Denis
|
||||
*/
|
||||
@@ -67,6 +65,6 @@ int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file ocb_encrypt_authenticate_memory.c
|
||||
OCB implementation, encrypt block of memory, by Tom St Denis
|
||||
*/
|
||||
@@ -32,7 +30,7 @@
|
||||
*/
|
||||
int ocb_encrypt_authenticate_memory(int cipher,
|
||||
const unsigned char *key, unsigned long keylen,
|
||||
const unsigned char *nonce,
|
||||
const unsigned char *nonce,
|
||||
const unsigned char *pt, unsigned long ptlen,
|
||||
unsigned char *ct,
|
||||
unsigned char *tag, unsigned long *taglen)
|
||||
@@ -79,6 +77,6 @@ LBL_ERR:
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -19,7 +17,7 @@
|
||||
|
||||
static const struct {
|
||||
int len;
|
||||
unsigned char poly_div[MAXBLOCKSIZE],
|
||||
unsigned char poly_div[MAXBLOCKSIZE],
|
||||
poly_mul[MAXBLOCKSIZE];
|
||||
} polys[] = {
|
||||
{
|
||||
@@ -27,7 +25,7 @@ static const struct {
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B }
|
||||
}, {
|
||||
16,
|
||||
16,
|
||||
{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 },
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
@@ -44,7 +42,7 @@ static const struct {
|
||||
@param nonce The session nonce (length of the block size of the cipher)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb_init(ocb_state *ocb, int cipher,
|
||||
int ocb_init(ocb_state *ocb, int cipher,
|
||||
const unsigned char *key, unsigned long keylen, const unsigned char *nonce)
|
||||
{
|
||||
int poly, x, y, m, err;
|
||||
@@ -60,20 +58,24 @@ int ocb_init(ocb_state *ocb, int cipher,
|
||||
|
||||
/* determine which polys to use */
|
||||
ocb->block_len = cipher_descriptor[cipher].block_length;
|
||||
for (poly = 0; poly < (int)(sizeof(polys)/sizeof(polys[0])); poly++) {
|
||||
if (polys[poly].len == ocb->block_len) {
|
||||
x = (int)(sizeof(polys)/sizeof(polys[0]));
|
||||
for (poly = 0; poly < x; poly++) {
|
||||
if (polys[poly].len == ocb->block_len) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
if (poly == x) {
|
||||
return CRYPT_INVALID_ARG; /* block_len not found in polys */
|
||||
}
|
||||
if (polys[poly].len != ocb->block_len) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
}
|
||||
|
||||
/* schedule the key */
|
||||
if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ocb->key)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
|
||||
/* find L = E[0] */
|
||||
zeromem(ocb->L, ocb->block_len);
|
||||
if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->L, ocb->L, &ocb->key)) != CRYPT_OK) {
|
||||
@@ -102,36 +104,36 @@ int ocb_init(ocb_state *ocb, int cipher,
|
||||
ocb->Ls[x][y] ^= polys[poly].poly_mul[y];
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/* find Lr = L / x */
|
||||
m = ocb->L[ocb->block_len-1] & 1;
|
||||
/* find Lr = L / x */
|
||||
m = ocb->L[ocb->block_len-1] & 1;
|
||||
|
||||
/* shift right */
|
||||
for (x = ocb->block_len - 1; x > 0; x--) {
|
||||
ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255;
|
||||
}
|
||||
ocb->Lr[0] = ocb->L[0] >> 1;
|
||||
/* shift right */
|
||||
for (x = ocb->block_len - 1; x > 0; x--) {
|
||||
ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255;
|
||||
}
|
||||
ocb->Lr[0] = ocb->L[0] >> 1;
|
||||
|
||||
if (m == 1) {
|
||||
for (x = 0; x < ocb->block_len; x++) {
|
||||
ocb->Lr[x] ^= polys[poly].poly_div[x];
|
||||
}
|
||||
}
|
||||
if (m == 1) {
|
||||
for (x = 0; x < ocb->block_len; x++) {
|
||||
ocb->Lr[x] ^= polys[poly].poly_div[x];
|
||||
}
|
||||
}
|
||||
|
||||
/* set Li, checksum */
|
||||
zeromem(ocb->Li, ocb->block_len);
|
||||
zeromem(ocb->checksum, ocb->block_len);
|
||||
/* set Li, checksum */
|
||||
zeromem(ocb->Li, ocb->block_len);
|
||||
zeromem(ocb->checksum, ocb->block_len);
|
||||
|
||||
/* set other params */
|
||||
ocb->block_index = 1;
|
||||
ocb->cipher = cipher;
|
||||
/* set other params */
|
||||
ocb->block_index = 1;
|
||||
ocb->cipher = cipher;
|
||||
|
||||
return CRYPT_OK;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -37,6 +35,6 @@ int ocb_ntz(unsigned long x)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file ocb_shift_xor.c
|
||||
OCB implementation, internal function, by Tom St Denis
|
||||
*/
|
||||
@@ -19,7 +17,7 @@
|
||||
|
||||
/**
|
||||
Compute the shift/xor for OCB (internal function)
|
||||
@param ocb The OCB state
|
||||
@param ocb The OCB state
|
||||
@param Z The destination of the shift
|
||||
*/
|
||||
void ocb_shift_xor(ocb_state *ocb, unsigned char *Z)
|
||||
@@ -34,6 +32,6 @@ void ocb_shift_xor(ocb_state *ocb, unsigned char *Z)
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file ocb_test.c
|
||||
OCB implementation, self-test by Tom St Denis
|
||||
*/
|
||||
@@ -17,7 +15,7 @@
|
||||
|
||||
#ifdef LTC_OCB_MODE
|
||||
|
||||
/**
|
||||
/**
|
||||
Test the OCB protocol
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
@@ -52,7 +50,7 @@ int ocb_test(void)
|
||||
|
||||
/* OCB-AES-128-3B */
|
||||
{
|
||||
3,
|
||||
3,
|
||||
/* key */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
@@ -70,7 +68,7 @@ int ocb_test(void)
|
||||
|
||||
/* OCB-AES-128-16B */
|
||||
{
|
||||
16,
|
||||
16,
|
||||
/* key */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
@@ -90,7 +88,7 @@ int ocb_test(void)
|
||||
|
||||
/* OCB-AES-128-20B */
|
||||
{
|
||||
20,
|
||||
20,
|
||||
/* key */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
@@ -99,7 +97,7 @@ int ocb_test(void)
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
|
||||
/* pt */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
|
||||
0x10, 0x11, 0x12, 0x13 },
|
||||
/* ct */
|
||||
{ 0x01, 0xa0, 0x75, 0xf0, 0xd8, 0x15, 0xb1, 0xa4,
|
||||
@@ -112,7 +110,7 @@ int ocb_test(void)
|
||||
|
||||
/* OCB-AES-128-32B */
|
||||
{
|
||||
32,
|
||||
32,
|
||||
/* key */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
@@ -121,7 +119,7 @@ int ocb_test(void)
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
|
||||
/* pt */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
|
||||
0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17,
|
||||
0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f },
|
||||
/* ct */
|
||||
@@ -137,7 +135,7 @@ int ocb_test(void)
|
||||
|
||||
/* OCB-AES-128-34B */
|
||||
{
|
||||
34,
|
||||
34,
|
||||
/* key */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f },
|
||||
@@ -146,7 +144,7 @@ int ocb_test(void)
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 },
|
||||
/* pt */
|
||||
{ 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
|
||||
0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
|
||||
0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17,
|
||||
0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f,
|
||||
0x20, 0x21 },
|
||||
@@ -168,7 +166,7 @@ int ocb_test(void)
|
||||
unsigned long len;
|
||||
unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE];
|
||||
|
||||
/* AES can be under rijndael or aes... try to find it */
|
||||
/* AES can be under rijndael or aes... try to find it */
|
||||
if ((idx = find_cipher("aes")) == -1) {
|
||||
if ((idx = find_cipher("rijndael")) == -1) {
|
||||
return CRYPT_NOP;
|
||||
@@ -181,41 +179,21 @@ int ocb_test(void)
|
||||
tests[x].nonce, tests[x].pt, tests[x].ptlen, outct, outtag, &len)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
if (XMEMCMP(outtag, tests[x].tag, len) || XMEMCMP(outct, tests[x].ct, tests[x].ptlen)) {
|
||||
#if 0
|
||||
unsigned long y;
|
||||
printf("\n\nFailure: \nCT:\n");
|
||||
for (y = 0; y < (unsigned long)tests[x].ptlen; ) {
|
||||
printf("0x%02x", outct[y]);
|
||||
if (y < (unsigned long)(tests[x].ptlen-1)) printf(", ");
|
||||
if (!(++y % 8)) printf("\n");
|
||||
}
|
||||
printf("\nTAG:\n");
|
||||
for (y = 0; y < len; ) {
|
||||
printf("0x%02x", outtag[y]);
|
||||
if (y < len-1) printf(", ");
|
||||
if (!(++y % 8)) printf("\n");
|
||||
}
|
||||
#endif
|
||||
|
||||
if (compare_testvector(outtag, len, tests[x].tag, sizeof(tests[x].tag), "OCB Tag", x) ||
|
||||
compare_testvector(outct, tests[x].ptlen, tests[x].ct, tests[x].ptlen, "OCB CT", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
|
||||
if ((err = ocb_decrypt_verify_memory(idx, tests[x].key, 16, tests[x].nonce, outct, tests[x].ptlen,
|
||||
outct, tests[x].tag, len, &res)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((res != 1) || XMEMCMP(tests[x].pt, outct, tests[x].ptlen)) {
|
||||
#if 0
|
||||
unsigned long y;
|
||||
printf("\n\nFailure-decrypt: \nPT:\n");
|
||||
for (y = 0; y < (unsigned long)tests[x].ptlen; ) {
|
||||
printf("0x%02x", outct[y]);
|
||||
if (y < (unsigned long)(tests[x].ptlen-1)) printf(", ");
|
||||
if (!(++y % 8)) printf("\n");
|
||||
}
|
||||
printf("\nres = %d\n\n", res);
|
||||
if ((res != 1) || compare_testvector(outct, tests[x].ptlen, tests[x].pt, tests[x].ptlen, "OCB", x)) {
|
||||
#ifdef LTC_TEST_DBG
|
||||
printf("\n\nOCB: Failure-decrypt - res = %d\n", res);
|
||||
#endif
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
@@ -232,6 +210,6 @@ int ocb_test(void)
|
||||
-- The setup is somewhat complicated...
|
||||
*/
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,9 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
/**
|
||||
/**
|
||||
@file s_ocb_done.c
|
||||
OCB implementation, internal helper, by Tom St Denis
|
||||
*/
|
||||
@@ -22,7 +20,7 @@
|
||||
* is we XOR the final ciphertext into the checksum so we have to xor it
|
||||
* before we CTR [decrypt] or after [encrypt]
|
||||
*
|
||||
* the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it...
|
||||
* the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it...
|
||||
*/
|
||||
|
||||
/**
|
||||
@@ -74,13 +72,13 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen,
|
||||
}
|
||||
|
||||
/* compute X[m] = len(pt[m]) XOR Lr XOR Z[m] */
|
||||
ocb_shift_xor(ocb, X);
|
||||
ocb_shift_xor(ocb, X);
|
||||
XMEMCPY(Z, X, ocb->block_len);
|
||||
|
||||
X[ocb->block_len-1] ^= (ptlen*8)&255;
|
||||
X[ocb->block_len-2] ^= ((ptlen*8)>>8)&255;
|
||||
for (x = 0; x < ocb->block_len; x++) {
|
||||
X[x] ^= ocb->Lr[x];
|
||||
X[x] ^= ocb->Lr[x];
|
||||
}
|
||||
|
||||
/* Y[m] = E(X[m])) */
|
||||
@@ -93,7 +91,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen,
|
||||
/* xor C[m] into checksum */
|
||||
for (x = 0; x < (int)ptlen; x++) {
|
||||
ocb->checksum[x] ^= ct[x];
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/* C[m] = P[m] xor Y[m] */
|
||||
@@ -102,7 +100,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen,
|
||||
}
|
||||
|
||||
if (mode == 0) {
|
||||
/* encrypt mode */
|
||||
/* encrypt mode */
|
||||
/* xor C[m] into checksum */
|
||||
for (x = 0; x < (int)ptlen; x++) {
|
||||
ocb->checksum[x] ^= ct[x];
|
||||
@@ -113,7 +111,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen,
|
||||
for (x = 0; x < ocb->block_len; x++) {
|
||||
ocb->checksum[x] ^= Y[x] ^ Z[x];
|
||||
}
|
||||
|
||||
|
||||
/* encrypt checksum, er... tag!! */
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->checksum, X, &ocb->key)) != CRYPT_OK) {
|
||||
goto error;
|
||||
@@ -132,7 +130,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen,
|
||||
zeromem(Z, MAXBLOCKSIZE);
|
||||
zeromem(ocb, sizeof(*ocb));
|
||||
#endif
|
||||
error:
|
||||
error:
|
||||
XFREE(X);
|
||||
XFREE(Y);
|
||||
XFREE(Z);
|
||||
@@ -143,6 +141,6 @@ error:
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
106
libtomcrypt/src/encauth/ocb3/ocb3_add_aad.c
Normal file
106
libtomcrypt/src/encauth/ocb3/ocb3_add_aad.c
Normal file
@@ -0,0 +1,106 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_add_aad.c
|
||||
OCB implementation, add AAD data, by Karel Miko
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Add one block of AAD data (internal function)
|
||||
@param ocb The OCB state
|
||||
@param aad_block [in] AAD data (block_len size)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
static int _ocb3_int_aad_add_block(ocb3_state *ocb, const unsigned char *aad_block)
|
||||
{
|
||||
unsigned char tmp[MAXBLOCKSIZE];
|
||||
int err;
|
||||
|
||||
/* Offset_i = Offset_{i-1} xor L_{ntz(i)} */
|
||||
ocb3_int_xor_blocks(ocb->aOffset_current, ocb->aOffset_current, ocb->L_[ocb3_int_ntz(ocb->ablock_index)], ocb->block_len);
|
||||
|
||||
/* Sum_i = Sum_{i-1} xor ENCIPHER(K, A_i xor Offset_i) */
|
||||
ocb3_int_xor_blocks(tmp, aad_block, ocb->aOffset_current, ocb->block_len);
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
ocb3_int_xor_blocks(ocb->aSum_current, ocb->aSum_current, tmp, ocb->block_len);
|
||||
|
||||
ocb->ablock_index++;
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Add AAD - additional associated data
|
||||
@param ocb The OCB state
|
||||
@param aad The AAD data
|
||||
@param aadlen The size of AAD data (octets)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_add_aad(ocb3_state *ocb, const unsigned char *aad, unsigned long aadlen)
|
||||
{
|
||||
int err, x, full_blocks, full_blocks_len, last_block_len;
|
||||
unsigned char *data;
|
||||
unsigned long datalen, l;
|
||||
|
||||
LTC_ARGCHK(ocb != NULL);
|
||||
if (aadlen == 0) return CRYPT_OK;
|
||||
LTC_ARGCHK(aad != NULL);
|
||||
|
||||
if (ocb->adata_buffer_bytes > 0) {
|
||||
l = ocb->block_len - ocb->adata_buffer_bytes;
|
||||
if (l > aadlen) l = aadlen;
|
||||
XMEMCPY(ocb->adata_buffer+ocb->adata_buffer_bytes, aad, l);
|
||||
ocb->adata_buffer_bytes += l;
|
||||
|
||||
if (ocb->adata_buffer_bytes == ocb->block_len) {
|
||||
if ((err = _ocb3_int_aad_add_block(ocb, ocb->adata_buffer)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
ocb->adata_buffer_bytes = 0;
|
||||
}
|
||||
|
||||
data = (unsigned char *)aad + l;
|
||||
datalen = aadlen - l;
|
||||
}
|
||||
else {
|
||||
data = (unsigned char *)aad;
|
||||
datalen = aadlen;
|
||||
}
|
||||
|
||||
if (datalen == 0) return CRYPT_OK;
|
||||
|
||||
full_blocks = datalen/ocb->block_len;
|
||||
full_blocks_len = full_blocks * ocb->block_len;
|
||||
last_block_len = datalen - full_blocks_len;
|
||||
|
||||
for (x=0; x<full_blocks; x++) {
|
||||
if ((err = _ocb3_int_aad_add_block(ocb, data+x*ocb->block_len)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
}
|
||||
|
||||
if (last_block_len>0) {
|
||||
XMEMCPY(ocb->adata_buffer, data+full_blocks_len, last_block_len);
|
||||
ocb->adata_buffer_bytes = last_block_len;
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
86
libtomcrypt/src/encauth/ocb3/ocb3_decrypt.c
Normal file
86
libtomcrypt/src/encauth/ocb3/ocb3_decrypt.c
Normal file
@@ -0,0 +1,86 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_decrypt.c
|
||||
OCB implementation, decrypt data, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Decrypt blocks of ciphertext with OCB
|
||||
@param ocb The OCB state
|
||||
@param ct The ciphertext (length multiple of the block size of the block cipher)
|
||||
@param ctlen The length of the input (octets)
|
||||
@param pt [out] The plaintext (length of ct)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_decrypt(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt)
|
||||
{
|
||||
unsigned char tmp[MAXBLOCKSIZE];
|
||||
int err, i, full_blocks;
|
||||
unsigned char *pt_b, *ct_b;
|
||||
|
||||
LTC_ARGCHK(ocb != NULL);
|
||||
if (ctlen == 0) return CRYPT_OK; /* no data, nothing to do */
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
|
||||
if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
if (ctlen % ocb->block_len) { /* ctlen has to bu multiple of block_len */
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
full_blocks = ctlen/ocb->block_len;
|
||||
for(i=0; i<full_blocks; i++) {
|
||||
pt_b = (unsigned char *)pt+i*ocb->block_len;
|
||||
ct_b = (unsigned char *)ct+i*ocb->block_len;
|
||||
|
||||
/* ocb->Offset_current[] = ocb->Offset_current[] ^ Offset_{ntz(block_index)} */
|
||||
ocb3_int_xor_blocks(ocb->Offset_current, ocb->Offset_current, ocb->L_[ocb3_int_ntz(ocb->block_index)], ocb->block_len);
|
||||
|
||||
/* tmp[] = ct[] XOR ocb->Offset_current[] */
|
||||
ocb3_int_xor_blocks(tmp, ct_b, ocb->Offset_current, ocb->block_len);
|
||||
|
||||
/* decrypt */
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_decrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* pt[] = tmp[] XOR ocb->Offset_current[] */
|
||||
ocb3_int_xor_blocks(pt_b, tmp, ocb->Offset_current, ocb->block_len);
|
||||
|
||||
/* ocb->checksum[] = ocb->checksum[] XOR pt[] */
|
||||
ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt_b, ocb->block_len);
|
||||
|
||||
ocb->block_index++;
|
||||
}
|
||||
|
||||
err = CRYPT_OK;
|
||||
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(tmp, sizeof(tmp));
|
||||
#endif
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
110
libtomcrypt/src/encauth/ocb3/ocb3_decrypt_last.c
Normal file
110
libtomcrypt/src/encauth/ocb3/ocb3_decrypt_last.c
Normal file
@@ -0,0 +1,110 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_decrypt_last.c
|
||||
OCB implementation, internal helper, by Karel Miko
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Finish an OCB (decryption) stream
|
||||
@param ocb The OCB state
|
||||
@param ct The remaining ciphertext
|
||||
@param ctlen The length of the ciphertext (octets)
|
||||
@param pt [out] The output buffer
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_decrypt_last(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt)
|
||||
{
|
||||
unsigned char iOffset_star[MAXBLOCKSIZE];
|
||||
unsigned char iPad[MAXBLOCKSIZE];
|
||||
int err, x, full_blocks, full_blocks_len, last_block_len;
|
||||
|
||||
LTC_ARGCHK(ocb != NULL);
|
||||
if (ct == NULL) LTC_ARGCHK(ctlen == 0);
|
||||
if (ctlen != 0) {
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
}
|
||||
|
||||
if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
full_blocks = ctlen/ocb->block_len;
|
||||
full_blocks_len = full_blocks * ocb->block_len;
|
||||
last_block_len = ctlen - full_blocks_len;
|
||||
|
||||
/* process full blocks first */
|
||||
if (full_blocks>0) {
|
||||
if ((err = ocb3_decrypt(ocb, ct, full_blocks_len, pt)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
|
||||
if (last_block_len>0) {
|
||||
/* Offset_* = Offset_m xor L_* */
|
||||
ocb3_int_xor_blocks(iOffset_star, ocb->Offset_current, ocb->L_star, ocb->block_len);
|
||||
|
||||
/* Pad = ENCIPHER(K, Offset_*) */
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(iOffset_star, iPad, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* P_* = C_* xor Pad[1..bitlen(C_*)] */
|
||||
ocb3_int_xor_blocks(pt+full_blocks_len, (unsigned char *)ct+full_blocks_len, iPad, last_block_len);
|
||||
|
||||
/* Checksum_* = Checksum_m xor (P_* || 1 || zeros(127-bitlen(P_*))) */
|
||||
ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt+full_blocks_len, last_block_len);
|
||||
for(x=last_block_len; x<ocb->block_len; x++) {
|
||||
if (x == last_block_len)
|
||||
ocb->checksum[x] ^= 0x80;
|
||||
else
|
||||
ocb->checksum[x] ^= 0x00;
|
||||
}
|
||||
|
||||
/* Tag = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) xor HASH(K,A) */
|
||||
/* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) */
|
||||
for(x=0; x<ocb->block_len; x++) {
|
||||
ocb->tag_part[x] = (ocb->checksum[x] ^ iOffset_star[x]) ^ ocb->L_dollar[x];
|
||||
}
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
else {
|
||||
/* Tag = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) xor HASH(K,A) */
|
||||
/* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) */
|
||||
for(x=0; x<ocb->block_len; x++) {
|
||||
ocb->tag_part[x] = (ocb->checksum[x] ^ ocb->Offset_current[x]) ^ ocb->L_dollar[x];
|
||||
}
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
|
||||
err = CRYPT_OK;
|
||||
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(iOffset_star, MAXBLOCKSIZE);
|
||||
zeromem(iPad, MAXBLOCKSIZE);
|
||||
#endif
|
||||
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
110
libtomcrypt/src/encauth/ocb3/ocb3_decrypt_verify_memory.c
Normal file
110
libtomcrypt/src/encauth/ocb3/ocb3_decrypt_verify_memory.c
Normal file
@@ -0,0 +1,110 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_decrypt_verify_memory.c
|
||||
OCB implementation, helper to decrypt block of memory, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Decrypt and compare the tag with OCB
|
||||
@param cipher The index of the cipher desired
|
||||
@param key The secret key
|
||||
@param keylen The length of the secret key (octets)
|
||||
@param nonce The session nonce (length of the block size of the block cipher)
|
||||
@param noncelen The length of the nonce (octets)
|
||||
@param adata The AAD - additional associated data
|
||||
@param adatalen The length of AAD (octets)
|
||||
@param ct The ciphertext
|
||||
@param ctlen The length of the ciphertext (octets)
|
||||
@param pt [out] The plaintext
|
||||
@param tag The tag to compare against
|
||||
@param taglen The length of the tag (octets)
|
||||
@param stat [out] The result of the tag comparison (1==valid, 0==invalid)
|
||||
@return CRYPT_OK if successful regardless of the tag comparison
|
||||
*/
|
||||
int ocb3_decrypt_verify_memory(int cipher,
|
||||
const unsigned char *key, unsigned long keylen,
|
||||
const unsigned char *nonce, unsigned long noncelen,
|
||||
const unsigned char *adata, unsigned long adatalen,
|
||||
const unsigned char *ct, unsigned long ctlen,
|
||||
unsigned char *pt,
|
||||
const unsigned char *tag, unsigned long taglen,
|
||||
int *stat)
|
||||
{
|
||||
int err;
|
||||
ocb3_state *ocb;
|
||||
unsigned char *buf;
|
||||
unsigned long buflen;
|
||||
|
||||
LTC_ARGCHK(stat != NULL);
|
||||
|
||||
/* default to zero */
|
||||
*stat = 0;
|
||||
|
||||
/* limit taglen */
|
||||
taglen = MIN(taglen, MAXBLOCKSIZE);
|
||||
|
||||
/* allocate memory */
|
||||
buf = XMALLOC(taglen);
|
||||
ocb = XMALLOC(sizeof(ocb3_state));
|
||||
if (ocb == NULL || buf == NULL) {
|
||||
if (ocb != NULL) {
|
||||
XFREE(ocb);
|
||||
}
|
||||
if (buf != NULL) {
|
||||
XFREE(buf);
|
||||
}
|
||||
return CRYPT_MEM;
|
||||
}
|
||||
|
||||
if ((err = ocb3_init(ocb, cipher, key, keylen, nonce, noncelen, taglen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
if (adata != NULL || adatalen != 0) {
|
||||
if ((err = ocb3_add_aad(ocb, adata, adatalen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
|
||||
if ((err = ocb3_decrypt_last(ocb, ct, ctlen, pt)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
buflen = taglen;
|
||||
if ((err = ocb3_done(ocb, buf, &buflen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* compare tags */
|
||||
if (buflen >= taglen && XMEM_NEQ(buf, tag, taglen) == 0) {
|
||||
*stat = 1;
|
||||
}
|
||||
|
||||
err = CRYPT_OK;
|
||||
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(ocb, sizeof(ocb3_state));
|
||||
#endif
|
||||
|
||||
XFREE(ocb);
|
||||
XFREE(buf);
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
92
libtomcrypt/src/encauth/ocb3/ocb3_done.c
Normal file
92
libtomcrypt/src/encauth/ocb3/ocb3_done.c
Normal file
@@ -0,0 +1,92 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_done.c
|
||||
OCB implementation, INTERNAL ONLY helper, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Finish OCB processing and compute the tag
|
||||
@param ocb The OCB state
|
||||
@param tag [out] The destination for the authentication tag
|
||||
@param taglen [in/out] The max size and resulting size of the authentication tag
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_done(ocb3_state *ocb, unsigned char *tag, unsigned long *taglen)
|
||||
{
|
||||
unsigned char tmp[MAXBLOCKSIZE];
|
||||
int err, x;
|
||||
|
||||
LTC_ARGCHK(ocb != NULL);
|
||||
LTC_ARGCHK(tag != NULL);
|
||||
LTC_ARGCHK(taglen != NULL);
|
||||
if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* check taglen */
|
||||
if ((int)*taglen < ocb->tag_len) {
|
||||
*taglen = (unsigned long)ocb->tag_len;
|
||||
return CRYPT_BUFFER_OVERFLOW;
|
||||
}
|
||||
|
||||
/* finalize AAD processing */
|
||||
|
||||
if (ocb->adata_buffer_bytes>0) {
|
||||
/* Offset_* = Offset_m xor L_* */
|
||||
ocb3_int_xor_blocks(ocb->aOffset_current, ocb->aOffset_current, ocb->L_star, ocb->block_len);
|
||||
|
||||
/* CipherInput = (A_* || 1 || zeros(127-bitlen(A_*))) xor Offset_* */
|
||||
ocb3_int_xor_blocks(tmp, ocb->adata_buffer, ocb->aOffset_current, ocb->adata_buffer_bytes);
|
||||
for(x=ocb->adata_buffer_bytes; x<ocb->block_len; x++) {
|
||||
if (x == ocb->adata_buffer_bytes) {
|
||||
tmp[x] = 0x80 ^ ocb->aOffset_current[x];
|
||||
}
|
||||
else {
|
||||
tmp[x] = 0x00 ^ ocb->aOffset_current[x];
|
||||
}
|
||||
}
|
||||
|
||||
/* Sum = Sum_m xor ENCIPHER(K, CipherInput) */
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
ocb3_int_xor_blocks(ocb->aSum_current, ocb->aSum_current, tmp, ocb->block_len);
|
||||
}
|
||||
|
||||
/* finalize TAG computing */
|
||||
|
||||
/* at this point ocb->aSum_current = HASH(K, A) */
|
||||
/* tag = tag ^ HASH(K, A) */
|
||||
ocb3_int_xor_blocks(tmp, ocb->tag_part, ocb->aSum_current, ocb->block_len);
|
||||
|
||||
/* copy tag bytes */
|
||||
for(x = 0; x < ocb->tag_len; x++) tag[x] = tmp[x];
|
||||
*taglen = (unsigned long)ocb->tag_len;
|
||||
|
||||
err = CRYPT_OK;
|
||||
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(tmp, MAXBLOCKSIZE);
|
||||
zeromem(ocb, sizeof(*ocb));
|
||||
#endif
|
||||
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
86
libtomcrypt/src/encauth/ocb3/ocb3_encrypt.c
Normal file
86
libtomcrypt/src/encauth/ocb3/ocb3_encrypt.c
Normal file
@@ -0,0 +1,86 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_encrypt.c
|
||||
OCB implementation, encrypt data, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Encrypt blocks of data with OCB
|
||||
@param ocb The OCB state
|
||||
@param pt The plaintext (length multiple of the block size of the block cipher)
|
||||
@param ptlen The length of the input (octets)
|
||||
@param ct [out] The ciphertext (same size as the pt)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_encrypt(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct)
|
||||
{
|
||||
unsigned char tmp[MAXBLOCKSIZE];
|
||||
int err, i, full_blocks;
|
||||
unsigned char *pt_b, *ct_b;
|
||||
|
||||
LTC_ARGCHK(ocb != NULL);
|
||||
if (ptlen == 0) return CRYPT_OK; /* no data, nothing to do */
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
|
||||
if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
if (ptlen % ocb->block_len) { /* ptlen has to bu multiple of block_len */
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
full_blocks = ptlen/ocb->block_len;
|
||||
for(i=0; i<full_blocks; i++) {
|
||||
pt_b = (unsigned char *)pt+i*ocb->block_len;
|
||||
ct_b = (unsigned char *)ct+i*ocb->block_len;
|
||||
|
||||
/* ocb->Offset_current[] = ocb->Offset_current[] ^ Offset_{ntz(block_index)} */
|
||||
ocb3_int_xor_blocks(ocb->Offset_current, ocb->Offset_current, ocb->L_[ocb3_int_ntz(ocb->block_index)], ocb->block_len);
|
||||
|
||||
/* tmp[] = pt[] XOR ocb->Offset_current[] */
|
||||
ocb3_int_xor_blocks(tmp, pt_b, ocb->Offset_current, ocb->block_len);
|
||||
|
||||
/* encrypt */
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* ct[] = tmp[] XOR ocb->Offset_current[] */
|
||||
ocb3_int_xor_blocks(ct_b, tmp, ocb->Offset_current, ocb->block_len);
|
||||
|
||||
/* ocb->checksum[] = ocb->checksum[] XOR pt[] */
|
||||
ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt_b, ocb->block_len);
|
||||
|
||||
ocb->block_index++;
|
||||
}
|
||||
|
||||
err = CRYPT_OK;
|
||||
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(tmp, sizeof(tmp));
|
||||
#endif
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -0,0 +1,82 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_encrypt_authenticate_memory.c
|
||||
OCB implementation, encrypt block of memory, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Encrypt and generate an authentication code for a buffer of memory
|
||||
@param cipher The index of the cipher desired
|
||||
@param key The secret key
|
||||
@param keylen The length of the secret key (octets)
|
||||
@param nonce The session nonce (length of the block ciphers block size)
|
||||
@param noncelen The length of the nonce (octets)
|
||||
@param adata The AAD - additional associated data
|
||||
@param adatalen The length of AAD (octets)
|
||||
@param pt The plaintext
|
||||
@param ptlen The length of the plaintext (octets)
|
||||
@param ct [out] The ciphertext
|
||||
@param tag [out] The authentication tag
|
||||
@param taglen [in/out] The max size and resulting size of the authentication tag
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_encrypt_authenticate_memory(int cipher,
|
||||
const unsigned char *key, unsigned long keylen,
|
||||
const unsigned char *nonce, unsigned long noncelen,
|
||||
const unsigned char *adata, unsigned long adatalen,
|
||||
const unsigned char *pt, unsigned long ptlen,
|
||||
unsigned char *ct,
|
||||
unsigned char *tag, unsigned long *taglen)
|
||||
{
|
||||
int err;
|
||||
ocb3_state *ocb;
|
||||
|
||||
LTC_ARGCHK(taglen != NULL);
|
||||
|
||||
/* allocate memory */
|
||||
ocb = XMALLOC(sizeof(ocb3_state));
|
||||
if (ocb == NULL) {
|
||||
return CRYPT_MEM;
|
||||
}
|
||||
|
||||
if ((err = ocb3_init(ocb, cipher, key, keylen, nonce, noncelen, *taglen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
if (adata != NULL || adatalen != 0) {
|
||||
if ((err = ocb3_add_aad(ocb, adata, adatalen)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
|
||||
if ((err = ocb3_encrypt_last(ocb, pt, ptlen, ct)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
err = ocb3_done(ocb, tag, taglen);
|
||||
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(ocb, sizeof(ocb3_state));
|
||||
#endif
|
||||
|
||||
XFREE(ocb);
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
112
libtomcrypt/src/encauth/ocb3/ocb3_encrypt_last.c
Normal file
112
libtomcrypt/src/encauth/ocb3/ocb3_encrypt_last.c
Normal file
@@ -0,0 +1,112 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_encrypt_last.c
|
||||
OCB implementation, internal helper, by Karel Miko
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Finish an OCB (encryption) stream
|
||||
@param ocb The OCB state
|
||||
@param pt The remaining plaintext
|
||||
@param ptlen The length of the plaintext (octets)
|
||||
@param ct [out] The output buffer
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_encrypt_last(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct)
|
||||
{
|
||||
unsigned char iOffset_star[MAXBLOCKSIZE];
|
||||
unsigned char iPad[MAXBLOCKSIZE];
|
||||
int err, x, full_blocks, full_blocks_len, last_block_len;
|
||||
|
||||
LTC_ARGCHK(ocb != NULL);
|
||||
if (pt == NULL) LTC_ARGCHK(ptlen == 0);
|
||||
if (ptlen != 0) {
|
||||
LTC_ARGCHK(pt != NULL);
|
||||
LTC_ARGCHK(ct != NULL);
|
||||
}
|
||||
|
||||
if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
full_blocks = ptlen/ocb->block_len;
|
||||
full_blocks_len = full_blocks * ocb->block_len;
|
||||
last_block_len = ptlen - full_blocks_len;
|
||||
|
||||
/* process full blocks first */
|
||||
if (full_blocks>0) {
|
||||
if ((err = ocb3_encrypt(ocb, pt, full_blocks_len, ct)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
|
||||
/* at this point: m = ocb->block_index (last block index), Offset_m = ocb->Offset_current */
|
||||
|
||||
if (last_block_len>0) {
|
||||
/* Offset_* = Offset_m xor L_* */
|
||||
ocb3_int_xor_blocks(iOffset_star, ocb->Offset_current, ocb->L_star, ocb->block_len);
|
||||
|
||||
/* Pad = ENCIPHER(K, Offset_*) */
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(iOffset_star, iPad, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
/* C_* = P_* xor Pad[1..bitlen(P_*)] */
|
||||
ocb3_int_xor_blocks(ct+full_blocks_len, pt+full_blocks_len, iPad, last_block_len);
|
||||
|
||||
/* Checksum_* = Checksum_m xor (P_* || 1 || zeros(127-bitlen(P_*))) */
|
||||
ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt+full_blocks_len, last_block_len);
|
||||
for(x=last_block_len; x<ocb->block_len; x++) {
|
||||
if (x == last_block_len)
|
||||
ocb->checksum[x] ^= 0x80;
|
||||
else
|
||||
ocb->checksum[x] ^= 0x00;
|
||||
}
|
||||
|
||||
/* Tag = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) xor HASH(K,A) */
|
||||
/* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) */
|
||||
for(x=0; x<ocb->block_len; x++) {
|
||||
ocb->tag_part[x] = (ocb->checksum[x] ^ iOffset_star[x]) ^ ocb->L_dollar[x];
|
||||
}
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
else {
|
||||
/* Tag = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) xor HASH(K,A) */
|
||||
/* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) */
|
||||
for(x=0; x<ocb->block_len; x++) {
|
||||
ocb->tag_part[x] = (ocb->checksum[x] ^ ocb->Offset_current[x]) ^ ocb->L_dollar[x];
|
||||
}
|
||||
if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) {
|
||||
goto LBL_ERR;
|
||||
}
|
||||
}
|
||||
|
||||
err = CRYPT_OK;
|
||||
|
||||
LBL_ERR:
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(iOffset_star, MAXBLOCKSIZE);
|
||||
zeromem(iPad, MAXBLOCKSIZE);
|
||||
#endif
|
||||
|
||||
return err;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
196
libtomcrypt/src/encauth/ocb3/ocb3_init.c
Normal file
196
libtomcrypt/src/encauth/ocb3/ocb3_init.c
Normal file
@@ -0,0 +1,196 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_init.c
|
||||
OCB implementation, initialize state, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
static void _ocb3_int_calc_offset_zero(ocb3_state *ocb, const unsigned char *nonce, unsigned long noncelen, unsigned long taglen)
|
||||
{
|
||||
int x, y, bottom;
|
||||
int idx, shift;
|
||||
unsigned char iNonce[MAXBLOCKSIZE];
|
||||
unsigned char iKtop[MAXBLOCKSIZE];
|
||||
unsigned char iStretch[MAXBLOCKSIZE+8];
|
||||
|
||||
/* Nonce = zeros(127-bitlen(N)) || 1 || N */
|
||||
zeromem(iNonce, sizeof(iNonce));
|
||||
for (x = ocb->block_len-1, y=0; y<(int)noncelen; x--, y++) {
|
||||
iNonce[x] = nonce[noncelen-y-1];
|
||||
}
|
||||
iNonce[x] = 0x01;
|
||||
iNonce[0] |= ((taglen*8) % 128) << 1;
|
||||
|
||||
/* bottom = str2num(Nonce[123..128]) */
|
||||
bottom = iNonce[ocb->block_len-1] & 0x3F;
|
||||
|
||||
/* Ktop = ENCIPHER(K, Nonce[1..122] || zeros(6)) */
|
||||
iNonce[ocb->block_len-1] = iNonce[ocb->block_len-1] & 0xC0;
|
||||
if ((cipher_descriptor[ocb->cipher].ecb_encrypt(iNonce, iKtop, &ocb->key)) != CRYPT_OK) {
|
||||
zeromem(ocb->Offset_current, ocb->block_len);
|
||||
return;
|
||||
}
|
||||
|
||||
/* Stretch = Ktop || (Ktop[1..64] xor Ktop[9..72]) */
|
||||
for (x = 0; x < ocb->block_len; x++) {
|
||||
iStretch[x] = iKtop[x];
|
||||
}
|
||||
for (y = 0; y < 8; y++) {
|
||||
iStretch[x+y] = iKtop[y] ^ iKtop[y+1];
|
||||
}
|
||||
|
||||
/* Offset_0 = Stretch[1+bottom..128+bottom] */
|
||||
idx = bottom / 8;
|
||||
shift = (bottom % 8);
|
||||
for (x = 0; x < ocb->block_len; x++) {
|
||||
ocb->Offset_current[x] = iStretch[idx+x] << shift;
|
||||
if (shift > 0) {
|
||||
ocb->Offset_current[x] |= iStretch[idx+x+1] >> (8-shift);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
static const struct {
|
||||
int len;
|
||||
unsigned char poly_mul[MAXBLOCKSIZE];
|
||||
} polys[] = {
|
||||
{
|
||||
8,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B }
|
||||
}, {
|
||||
16,
|
||||
{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
||||
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x87 }
|
||||
}
|
||||
};
|
||||
|
||||
/**
|
||||
Initialize an OCB context
|
||||
@param ocb [out] The destination of the OCB state
|
||||
@param cipher The index of the desired cipher
|
||||
@param key The secret key
|
||||
@param keylen The length of the secret key (octets)
|
||||
@param nonce The session nonce
|
||||
@param noncelen The length of the session nonce (octets, up to 15)
|
||||
@param taglen The length of the tag (octets, up to 16)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_init(ocb3_state *ocb, int cipher,
|
||||
const unsigned char *key, unsigned long keylen,
|
||||
const unsigned char *nonce, unsigned long noncelen,
|
||||
unsigned long taglen)
|
||||
{
|
||||
int poly, x, y, m, err;
|
||||
unsigned char *previous, *current;
|
||||
|
||||
LTC_ARGCHK(ocb != NULL);
|
||||
LTC_ARGCHK(key != NULL);
|
||||
LTC_ARGCHK(nonce != NULL);
|
||||
|
||||
/* valid cipher? */
|
||||
if ((err = cipher_is_valid(cipher)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
ocb->cipher = cipher;
|
||||
|
||||
/* Valid Nonce?
|
||||
* As of RFC7253: "string of no more than 120 bits" */
|
||||
if (noncelen > (120/8)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
/* The blockcipher must have a 128-bit blocksize */
|
||||
if (cipher_descriptor[cipher].block_length != 16) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
/* The TAGLEN may be any value up to 128 (bits) */
|
||||
if (taglen > 16) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
ocb->tag_len = taglen;
|
||||
|
||||
/* determine which polys to use */
|
||||
ocb->block_len = cipher_descriptor[cipher].block_length;
|
||||
x = (int)(sizeof(polys)/sizeof(polys[0]));
|
||||
for (poly = 0; poly < x; poly++) {
|
||||
if (polys[poly].len == ocb->block_len) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
if (poly == x) {
|
||||
return CRYPT_INVALID_ARG; /* block_len not found in polys */
|
||||
}
|
||||
if (polys[poly].len != ocb->block_len) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
/* schedule the key */
|
||||
if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ocb->key)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
/* L_* = ENCIPHER(K, zeros(128)) */
|
||||
zeromem(ocb->L_star, ocb->block_len);
|
||||
if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->L_star, ocb->L_star, &ocb->key)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
/* compute L_$, L_0, L_1, ... */
|
||||
for (x = -1; x < 32; x++) {
|
||||
if (x == -1) { /* gonna compute: L_$ = double(L_*) */
|
||||
current = ocb->L_dollar;
|
||||
previous = ocb->L_star;
|
||||
}
|
||||
else if (x == 0) { /* gonna compute: L_0 = double(L_$) */
|
||||
current = ocb->L_[0];
|
||||
previous = ocb->L_dollar;
|
||||
}
|
||||
else { /* gonna compute: L_i = double(L_{i-1}) for every integer i > 0 */
|
||||
current = ocb->L_[x];
|
||||
previous = ocb->L_[x-1];
|
||||
}
|
||||
m = previous[0] >> 7;
|
||||
for (y = 0; y < ocb->block_len-1; y++) {
|
||||
current[y] = ((previous[y] << 1) | (previous[y+1] >> 7)) & 255;
|
||||
}
|
||||
current[ocb->block_len-1] = (previous[ocb->block_len-1] << 1) & 255;
|
||||
if (m == 1) {
|
||||
/* current[] = current[] XOR polys[poly].poly_mul[]*/
|
||||
ocb3_int_xor_blocks(current, current, polys[poly].poly_mul, ocb->block_len);
|
||||
}
|
||||
}
|
||||
|
||||
/* initialize ocb->Offset_current = Offset_0 */
|
||||
_ocb3_int_calc_offset_zero(ocb, nonce, noncelen, taglen);
|
||||
|
||||
/* initialize checksum to all zeros */
|
||||
zeromem(ocb->checksum, ocb->block_len);
|
||||
|
||||
/* set block index */
|
||||
ocb->block_index = 1;
|
||||
|
||||
/* initialize AAD related stuff */
|
||||
ocb->ablock_index = 1;
|
||||
ocb->adata_buffer_bytes = 0;
|
||||
zeromem(ocb->aOffset_current, ocb->block_len);
|
||||
zeromem(ocb->aSum_current, ocb->block_len);
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
39
libtomcrypt/src/encauth/ocb3/ocb3_int_ntz.c
Normal file
39
libtomcrypt/src/encauth/ocb3/ocb3_int_ntz.c
Normal file
@@ -0,0 +1,39 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_int_ntz.c
|
||||
OCB implementation, INTERNAL ONLY helper, by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Returns the number of leading zero bits [from lsb up] (internal function)
|
||||
@param x The 32-bit value to observe
|
||||
@return The number of bits [from the lsb up] that are zero
|
||||
*/
|
||||
int ocb3_int_ntz(unsigned long x)
|
||||
{
|
||||
int c;
|
||||
x &= 0xFFFFFFFFUL;
|
||||
c = 0;
|
||||
while ((x & 1) == 0) {
|
||||
++c;
|
||||
x >>= 1;
|
||||
}
|
||||
return c;
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
40
libtomcrypt/src/encauth/ocb3/ocb3_int_xor_blocks.c
Normal file
40
libtomcrypt/src/encauth/ocb3/ocb3_int_xor_blocks.c
Normal file
@@ -0,0 +1,40 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_int_xor_blocks.c
|
||||
OCB implementation, INTERNAL ONLY helper, by Karel Miko
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Compute xor for two blocks of bytes 'out = block_a XOR block_b' (internal function)
|
||||
@param out The block of bytes (output)
|
||||
@param block_a The block of bytes (input)
|
||||
@param block_b The block of bytes (input)
|
||||
@param block_len The size of block_a, block_b, out
|
||||
*/
|
||||
void ocb3_int_xor_blocks(unsigned char *out, const unsigned char *block_a, const unsigned char *block_b, unsigned long block_len)
|
||||
{
|
||||
int x;
|
||||
if (out == block_a) {
|
||||
for (x = 0; x < (int)block_len; x++) out[x] ^= block_b[x];
|
||||
}
|
||||
else {
|
||||
for (x = 0; x < (int)block_len; x++) out[x] = block_a[x] ^ block_b[x];
|
||||
}
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
309
libtomcrypt/src/encauth/ocb3/ocb3_test.c
Normal file
309
libtomcrypt/src/encauth/ocb3/ocb3_test.c
Normal file
@@ -0,0 +1,309 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/**
|
||||
@file ocb3_test.c
|
||||
OCB implementation, self-test by Tom St Denis
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_OCB3_MODE
|
||||
|
||||
/**
|
||||
Test the OCB protocol
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int ocb3_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
/* test vectors from: http://tools.ietf.org/html/draft-krovetz-ocb-03 */
|
||||
unsigned char key[16] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F };
|
||||
unsigned char nonce[12] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B };
|
||||
const struct {
|
||||
int ptlen;
|
||||
int aadlen;
|
||||
unsigned char pt[64], aad[64], ct[64], tag[16];
|
||||
} tests[] = {
|
||||
|
||||
{ /* index:0 */
|
||||
0, /* PLAINTEXT length */
|
||||
0, /* AAD length */
|
||||
{ 0 }, /* PLAINTEXT */
|
||||
{ 0 }, /* AAD */
|
||||
{ 0 }, /* CIPHERTEXT */
|
||||
{ 0x19,0x7b,0x9c,0x3c,0x44,0x1d,0x3c,0x83,0xea,0xfb,0x2b,0xef,0x63,0x3b,0x91,0x82 }, /* TAG */
|
||||
},
|
||||
{ /* index:1 */
|
||||
8, /* PLAINTEXT length */
|
||||
8, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */
|
||||
{ 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */
|
||||
{ 0x16,0xdc,0x76,0xa4,0x6d,0x47,0xe1,0xea,0xd5,0x37,0x20,0x9e,0x8a,0x96,0xd1,0x4e }, /* TAG */
|
||||
},
|
||||
{ /* index:2 */
|
||||
0, /* PLAINTEXT length */
|
||||
8, /* AAD length */
|
||||
{ 0 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */
|
||||
{ 0 }, /* CIPHERTEXT */
|
||||
{ 0x98,0xb9,0x15,0x52,0xc8,0xc0,0x09,0x18,0x50,0x44,0xe3,0x0a,0x6e,0xb2,0xfe,0x21 }, /* TAG */
|
||||
},
|
||||
{ /* index:3 */
|
||||
8, /* PLAINTEXT length */
|
||||
0, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */
|
||||
{ 0 }, /* AAD */
|
||||
{ 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */
|
||||
{ 0x97,0x1e,0xff,0xca,0xe1,0x9a,0xd4,0x71,0x6f,0x88,0xe8,0x7b,0x87,0x1f,0xbe,0xed }, /* TAG */
|
||||
},
|
||||
{ /* index:4 */
|
||||
16, /* PLAINTEXT length */
|
||||
16, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */
|
||||
{ 0x77,0x6c,0x99,0x24,0xd6,0x72,0x3a,0x1f,0xc4,0x52,0x45,0x32,0xac,0x3e,0x5b,0xeb }, /* TAG */
|
||||
},
|
||||
{ /* index:5 */
|
||||
0, /* PLAINTEXT length */
|
||||
16, /* AAD length */
|
||||
{ 0 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */
|
||||
{ 0 }, /* CIPHERTEXT */
|
||||
{ 0x7d,0xdb,0x8e,0x6c,0xea,0x68,0x14,0x86,0x62,0x12,0x50,0x96,0x19,0xb1,0x9c,0xc6 }, /* TAG */
|
||||
},
|
||||
{ /* index:6 */
|
||||
16, /* PLAINTEXT length */
|
||||
0, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */
|
||||
{ 0 }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */
|
||||
{ 0x13,0xcc,0x8b,0x74,0x78,0x07,0x12,0x1a,0x4c,0xbb,0x3e,0x4b,0xd6,0xb4,0x56,0xaf }, /* TAG */
|
||||
},
|
||||
{ /* index:7 */
|
||||
24, /* PLAINTEXT length */
|
||||
24, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */
|
||||
{ 0x5f,0xa9,0x4f,0xc3,0xf3,0x88,0x20,0xf1,0xdc,0x3f,0x3d,0x1f,0xd4,0xe5,0x5e,0x1c }, /* TAG */
|
||||
},
|
||||
{ /* index:8 */
|
||||
0, /* PLAINTEXT length */
|
||||
24, /* AAD length */
|
||||
{ 0 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */
|
||||
{ 0 }, /* CIPHERTEXT */
|
||||
{ 0x28,0x20,0x26,0xda,0x30,0x68,0xbc,0x9f,0xa1,0x18,0x68,0x1d,0x55,0x9f,0x10,0xf6 }, /* TAG */
|
||||
},
|
||||
{ /* index:9 */
|
||||
24, /* PLAINTEXT length */
|
||||
0, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */
|
||||
{ 0 }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */
|
||||
{ 0x6e,0xf2,0xf5,0x25,0x87,0xfd,0xa0,0xed,0x97,0xdc,0x7e,0xed,0xe2,0x41,0xdf,0x68 }, /* TAG */
|
||||
},
|
||||
{ /* index:10 */
|
||||
32, /* PLAINTEXT length */
|
||||
32, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */
|
||||
{ 0xb2,0xa0,0x40,0xdd,0x3b,0xd5,0x16,0x43,0x72,0xd7,0x6d,0x7b,0xb6,0x82,0x42,0x40 }, /* TAG */
|
||||
},
|
||||
{ /* index:11 */
|
||||
0, /* PLAINTEXT length */
|
||||
32, /* AAD length */
|
||||
{ 0 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */
|
||||
{ 0 }, /* CIPHERTEXT */
|
||||
{ 0xe1,0xe0,0x72,0x63,0x3b,0xad,0xe5,0x1a,0x60,0xe8,0x59,0x51,0xd9,0xc4,0x2a,0x1b }, /* TAG */
|
||||
},
|
||||
{ /* index:12 */
|
||||
32, /* PLAINTEXT length */
|
||||
0, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */
|
||||
{ 0 }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */
|
||||
{ 0x4a,0x3b,0xae,0x82,0x44,0x65,0xcf,0xda,0xf8,0xc4,0x1f,0xc5,0x0c,0x7d,0xf9,0xd9 }, /* TAG */
|
||||
},
|
||||
{ /* index:13 */
|
||||
40, /* PLAINTEXT length */
|
||||
40, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */
|
||||
{ 0x65,0x9c,0x62,0x32,0x11,0xde,0xea,0x0d,0xe3,0x0d,0x2c,0x38,0x18,0x79,0xf4,0xc8 }, /* TAG */
|
||||
},
|
||||
{ /* index:14 */
|
||||
0, /* PLAINTEXT length */
|
||||
40, /* AAD length */
|
||||
{ 0 }, /* PLAINTEXT */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */
|
||||
{ 0 }, /* CIPHERTEXT */
|
||||
{ 0x7a,0xeb,0x7a,0x69,0xa1,0x68,0x7d,0xd0,0x82,0xca,0x27,0xb0,0xd9,0xa3,0x70,0x96 }, /* TAG */
|
||||
},
|
||||
{ /* index:15 */
|
||||
40, /* PLAINTEXT length */
|
||||
0, /* AAD length */
|
||||
{ 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */
|
||||
{ 0 }, /* AAD */
|
||||
{ 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */
|
||||
{ 0x06,0x0c,0x84,0x67,0xf4,0xab,0xab,0x5e,0x8b,0x3c,0x20,0x67,0xa2,0xe1,0x15,0xdc }, /* TAG */
|
||||
},
|
||||
|
||||
};
|
||||
/* As of RFC 7253 - 'Appendix A. Sample Results'
|
||||
* The next tuple shows a result with a tag length of 96 bits and a
|
||||
different key.
|
||||
|
||||
K: 0F0E0D0C0B0A09080706050403020100
|
||||
|
||||
N: BBAA9988776655443322110D
|
||||
A: 000102030405060708090A0B0C0D0E0F1011121314151617
|
||||
18191A1B1C1D1E1F2021222324252627
|
||||
P: 000102030405060708090A0B0C0D0E0F1011121314151617
|
||||
18191A1B1C1D1E1F2021222324252627
|
||||
C: 1792A4E31E0755FB03E31B22116E6C2DDF9EFD6E33D536F1
|
||||
A0124B0A55BAE884ED93481529C76B6AD0C515F4D1CDD4FD
|
||||
AC4F02AA
|
||||
|
||||
The C has been split up in C and T (tag)
|
||||
*/
|
||||
const unsigned char K[] = { 0x0F,0x0E,0x0D,0x0C,0x0B,0x0A,0x09,0x08,
|
||||
0x07,0x06,0x05,0x04,0x03,0x02,0x01,0x00 };
|
||||
const unsigned char N[] = { 0xBB,0xAA,0x99,0x88,0x77,0x66,0x55,0x44,
|
||||
0x33,0x22,0x11,0x0D };
|
||||
const unsigned char A[] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,
|
||||
0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F,
|
||||
0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,
|
||||
0x18,0x19,0x1A,0x1B,0x1C,0x1D,0x1E,0x1F,
|
||||
0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 };
|
||||
const unsigned char P[] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,
|
||||
0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F,
|
||||
0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,
|
||||
0x18,0x19,0x1A,0x1B,0x1C,0x1D,0x1E,0x1F,
|
||||
0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 };
|
||||
const unsigned char C[] = { 0x17,0x92,0xA4,0xE3,0x1E,0x07,0x55,0xFB,
|
||||
0x03,0xE3,0x1B,0x22,0x11,0x6E,0x6C,0x2D,
|
||||
0xDF,0x9E,0xFD,0x6E,0x33,0xD5,0x36,0xF1,
|
||||
0xA0,0x12,0x4B,0x0A,0x55,0xBA,0xE8,0x84,
|
||||
0xED,0x93,0x48,0x15,0x29,0xC7,0x6B,0x6A };
|
||||
const unsigned char T[] = { 0xD0,0xC5,0x15,0xF4,0xD1,0xCD,0xD4,0xFD,
|
||||
0xAC,0x4F,0x02,0xAA };
|
||||
|
||||
int err, x, idx, res;
|
||||
unsigned long len;
|
||||
unsigned char outct[MAXBLOCKSIZE] = { 0 };
|
||||
unsigned char outtag[MAXBLOCKSIZE] = { 0 };
|
||||
ocb3_state ocb;
|
||||
|
||||
/* AES can be under rijndael or aes... try to find it */
|
||||
if ((idx = find_cipher("aes")) == -1) {
|
||||
if ((idx = find_cipher("rijndael")) == -1) {
|
||||
return CRYPT_NOP;
|
||||
}
|
||||
}
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
len = 16; /* must be the same as the required taglen */
|
||||
if ((err = ocb3_encrypt_authenticate_memory(idx,
|
||||
key, sizeof(key),
|
||||
nonce, sizeof(nonce),
|
||||
tests[x].aadlen != 0 ? tests[x].aad : NULL, tests[x].aadlen,
|
||||
tests[x].ptlen != 0 ? tests[x].pt : NULL, tests[x].ptlen,
|
||||
tests[x].ptlen != 0 ? outct : NULL, outtag, &len)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
if (compare_testvector(outtag, len, tests[x].tag, sizeof(tests[x].tag), "OCB3 Tag", x) ||
|
||||
compare_testvector(outct, tests[x].ptlen, tests[x].ct, tests[x].ptlen, "OCB3 CT", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
if ((err = ocb3_decrypt_verify_memory(idx,
|
||||
key, sizeof(key),
|
||||
nonce, sizeof(nonce),
|
||||
tests[x].aadlen != 0 ? tests[x].aad : NULL, tests[x].aadlen,
|
||||
tests[x].ptlen != 0 ? outct : NULL, tests[x].ptlen,
|
||||
tests[x].ptlen != 0 ? outct : NULL, tests[x].tag, len, &res)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((res != 1) || compare_testvector(outct, tests[x].ptlen, tests[x].pt, tests[x].ptlen, "OCB3", x)) {
|
||||
#ifdef LTC_TEST_DBG
|
||||
printf("\n\nOCB3: Failure-decrypt - res = %d\n", res);
|
||||
#endif
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
|
||||
/* RFC 7253 - test vector with a tag length of 96 bits - part 1 */
|
||||
x = 99;
|
||||
len = 12;
|
||||
if ((err = ocb3_encrypt_authenticate_memory(idx,
|
||||
K, sizeof(K),
|
||||
N, sizeof(N),
|
||||
A, sizeof(A),
|
||||
P, sizeof(P),
|
||||
outct, outtag, &len)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
|
||||
if (compare_testvector(outtag, len, T, sizeof(T), "OCB3 Tag", x) ||
|
||||
compare_testvector(outct, sizeof(P), C, sizeof(C), "OCB3 CT", x)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
if ((err = ocb3_decrypt_verify_memory(idx,
|
||||
K, sizeof(K),
|
||||
N, sizeof(N),
|
||||
A, sizeof(A),
|
||||
C, sizeof(C),
|
||||
outct, T, sizeof(T), &res)) != CRYPT_OK) {
|
||||
return err;
|
||||
}
|
||||
if ((res != 1) || compare_testvector(outct, sizeof(C), P, sizeof(P), "OCB3", x)) {
|
||||
#ifdef LTC_TEST_DBG
|
||||
printf("\n\nOCB3: Failure-decrypt - res = %d\n", res);
|
||||
#endif
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
/* RFC 7253 - test vector with a tag length of 96 bits - part 2 */
|
||||
x = 100;
|
||||
if ((err = ocb3_init(&ocb, idx, K, sizeof(K), N, sizeof(N), 12)) != CRYPT_OK) return err;
|
||||
if ((err = ocb3_add_aad(&ocb, A, sizeof(A))) != CRYPT_OK) return err;
|
||||
if ((err = ocb3_encrypt(&ocb, P, 32, outct)) != CRYPT_OK) return err;
|
||||
if ((err = ocb3_encrypt_last(&ocb, P+32, sizeof(P)-32, outct+32)) != CRYPT_OK) return err;
|
||||
len = sizeof(outtag); /* intentionally more than 12 */
|
||||
if ((err = ocb3_done(&ocb, outtag, &len)) != CRYPT_OK) return err;
|
||||
if (compare_testvector(outct, sizeof(P), C, sizeof(C), "OCB3 CT", x)) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(outtag, len, T, sizeof(T), "OCB3 Tag.enc", x)) return CRYPT_FAIL_TESTVECTOR;
|
||||
if ((err = ocb3_init(&ocb, idx, K, sizeof(K), N, sizeof(N), 12)) != CRYPT_OK) return err;
|
||||
if ((err = ocb3_add_aad(&ocb, A, sizeof(A))) != CRYPT_OK) return err;
|
||||
if ((err = ocb3_decrypt(&ocb, C, 32, outct)) != CRYPT_OK) return err;
|
||||
if ((err = ocb3_decrypt_last(&ocb, C+32, sizeof(C)-32, outct+32)) != CRYPT_OK) return err;
|
||||
len = sizeof(outtag); /* intentionally more than 12 */
|
||||
if ((err = ocb3_done(&ocb, outtag, &len)) != CRYPT_OK) return err;
|
||||
if (compare_testvector(outct, sizeof(C), P, sizeof(P), "OCB3 PT", x)) return CRYPT_FAIL_TESTVECTOR;
|
||||
if (compare_testvector(outtag, len, T, sizeof(T), "OCB3 Tag.dec", x)) return CRYPT_FAIL_TESTVECTOR;
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif /* LTC_TEST */
|
||||
}
|
||||
|
||||
#endif /* LTC_OCB3_MODE */
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
588
libtomcrypt/src/hashes/blake2b.c
Normal file
588
libtomcrypt/src/hashes/blake2b.c
Normal file
@@ -0,0 +1,588 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/*
|
||||
BLAKE2 reference source code package - reference C implementations
|
||||
|
||||
Copyright 2012, Samuel Neves <sneves@dei.uc.pt>. You may use this under the
|
||||
terms of the CC0, the OpenSSL Licence, or the Apache Public License 2.0, at
|
||||
your option. The terms of these licenses can be found at:
|
||||
|
||||
- CC0 1.0 Universal : http://creativecommons.org/publicdomain/zero/1.0
|
||||
- OpenSSL license : https://www.openssl.org/source/license.html
|
||||
- Apache 2.0 : http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
More information about the BLAKE2 hash function can be found at
|
||||
https://blake2.net.
|
||||
*/
|
||||
/* see also https://www.ietf.org/rfc/rfc7693.txt */
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_BLAKE2B
|
||||
|
||||
enum blake2b_constant {
|
||||
BLAKE2B_BLOCKBYTES = 128,
|
||||
BLAKE2B_OUTBYTES = 64,
|
||||
BLAKE2B_KEYBYTES = 64,
|
||||
BLAKE2B_SALTBYTES = 16,
|
||||
BLAKE2B_PERSONALBYTES = 16,
|
||||
BLAKE2B_PARAM_SIZE = 64
|
||||
};
|
||||
|
||||
/* param offsets */
|
||||
enum {
|
||||
O_DIGEST_LENGTH = 0,
|
||||
O_KEY_LENGTH = 1,
|
||||
O_FANOUT = 2,
|
||||
O_DEPTH = 3,
|
||||
O_LEAF_LENGTH = 4,
|
||||
O_NODE_OFFSET = 8,
|
||||
O_XOF_LENGTH = 12,
|
||||
O_NODE_DEPTH = 16,
|
||||
O_INNER_LENGTH = 17,
|
||||
O_RESERVED = 18,
|
||||
O_SALT = 32,
|
||||
O_PERSONAL = 48
|
||||
};
|
||||
|
||||
/*
|
||||
struct blake2b_param {
|
||||
unsigned char digest_length;
|
||||
unsigned char key_length;
|
||||
unsigned char fanout;
|
||||
unsigned char depth;
|
||||
ulong32 leaf_length;
|
||||
ulong32 node_offset;
|
||||
ulong32 xof_length;
|
||||
unsigned char node_depth;
|
||||
unsigned char inner_length;
|
||||
unsigned char reserved[14];
|
||||
unsigned char salt[BLAKE2B_SALTBYTES];
|
||||
unsigned char personal[BLAKE2B_PERSONALBYTES];
|
||||
};
|
||||
*/
|
||||
|
||||
const struct ltc_hash_descriptor blake2b_160_desc =
|
||||
{
|
||||
"blake2b-160",
|
||||
25,
|
||||
20,
|
||||
128,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 5 },
|
||||
11,
|
||||
&blake2b_160_init,
|
||||
&blake2b_process,
|
||||
&blake2b_done,
|
||||
&blake2b_160_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
const struct ltc_hash_descriptor blake2b_256_desc =
|
||||
{
|
||||
"blake2b-256",
|
||||
26,
|
||||
32,
|
||||
128,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 8 },
|
||||
11,
|
||||
&blake2b_256_init,
|
||||
&blake2b_process,
|
||||
&blake2b_done,
|
||||
&blake2b_256_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
const struct ltc_hash_descriptor blake2b_384_desc =
|
||||
{
|
||||
"blake2b-384",
|
||||
27,
|
||||
48,
|
||||
128,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 12 },
|
||||
11,
|
||||
&blake2b_384_init,
|
||||
&blake2b_process,
|
||||
&blake2b_done,
|
||||
&blake2b_384_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
const struct ltc_hash_descriptor blake2b_512_desc =
|
||||
{
|
||||
"blake2b-512",
|
||||
28,
|
||||
64,
|
||||
128,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 16 },
|
||||
11,
|
||||
&blake2b_512_init,
|
||||
&blake2b_process,
|
||||
&blake2b_done,
|
||||
&blake2b_512_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
static const ulong64 blake2b_IV[8] =
|
||||
{
|
||||
CONST64(0x6a09e667f3bcc908), CONST64(0xbb67ae8584caa73b),
|
||||
CONST64(0x3c6ef372fe94f82b), CONST64(0xa54ff53a5f1d36f1),
|
||||
CONST64(0x510e527fade682d1), CONST64(0x9b05688c2b3e6c1f),
|
||||
CONST64(0x1f83d9abfb41bd6b), CONST64(0x5be0cd19137e2179)
|
||||
};
|
||||
|
||||
static const unsigned char blake2b_sigma[12][16] =
|
||||
{
|
||||
{ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 } ,
|
||||
{ 14, 10, 4, 8, 9, 15, 13, 6, 1, 12, 0, 2, 11, 7, 5, 3 } ,
|
||||
{ 11, 8, 12, 0, 5, 2, 15, 13, 10, 14, 3, 6, 7, 1, 9, 4 } ,
|
||||
{ 7, 9, 3, 1, 13, 12, 11, 14, 2, 6, 5, 10, 4, 0, 15, 8 } ,
|
||||
{ 9, 0, 5, 7, 2, 4, 10, 15, 14, 1, 11, 12, 6, 8, 3, 13 } ,
|
||||
{ 2, 12, 6, 10, 0, 11, 8, 3, 4, 13, 7, 5, 15, 14, 1, 9 } ,
|
||||
{ 12, 5, 1, 15, 14, 13, 4, 10, 0, 7, 6, 3, 9, 2, 8, 11 } ,
|
||||
{ 13, 11, 7, 14, 12, 1, 3, 9, 5, 0, 15, 4, 8, 6, 2, 10 } ,
|
||||
{ 6, 15, 14, 9, 11, 3, 0, 8, 12, 2, 13, 7, 1, 4, 10, 5 } ,
|
||||
{ 10, 2, 8, 4, 7, 6, 1, 5, 15, 11, 9, 14, 3, 12, 13 , 0 } ,
|
||||
{ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 } ,
|
||||
{ 14, 10, 4, 8, 9, 15, 13, 6, 1, 12, 0, 2, 11, 7, 5, 3 }
|
||||
};
|
||||
|
||||
static void blake2b_set_lastnode(hash_state *md) { md->blake2b.f[1] = CONST64(0xffffffffffffffff); }
|
||||
|
||||
/* Some helper functions, not necessarily useful */
|
||||
static int blake2b_is_lastblock(const hash_state *md) { return md->blake2b.f[0] != 0; }
|
||||
|
||||
static void blake2b_set_lastblock(hash_state *md)
|
||||
{
|
||||
if (md->blake2b.last_node)
|
||||
blake2b_set_lastnode(md);
|
||||
|
||||
md->blake2b.f[0] = CONST64(0xffffffffffffffff);
|
||||
}
|
||||
|
||||
static void blake2b_increment_counter(hash_state *md, ulong64 inc)
|
||||
{
|
||||
md->blake2b.t[0] += inc;
|
||||
if (md->blake2b.t[0] < inc) md->blake2b.t[1]++;
|
||||
}
|
||||
|
||||
static void blake2b_init0(hash_state *md)
|
||||
{
|
||||
unsigned long i;
|
||||
XMEMSET(&md->blake2b, 0, sizeof(md->blake2b));
|
||||
|
||||
for (i = 0; i < 8; ++i)
|
||||
md->blake2b.h[i] = blake2b_IV[i];
|
||||
}
|
||||
|
||||
/* init xors IV with input parameter block */
|
||||
static int blake2b_init_param(hash_state *md, const unsigned char *P)
|
||||
{
|
||||
unsigned long i;
|
||||
|
||||
blake2b_init0(md);
|
||||
|
||||
/* IV XOR ParamBlock */
|
||||
for (i = 0; i < 8; ++i) {
|
||||
ulong64 tmp;
|
||||
LOAD64L(tmp, P + i * 8);
|
||||
md->blake2b.h[i] ^= tmp;
|
||||
}
|
||||
|
||||
md->blake2b.outlen = P[O_DIGEST_LENGTH];
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int blake2b_init(hash_state *md, unsigned long outlen, const unsigned char *key, unsigned long keylen)
|
||||
{
|
||||
unsigned char P[BLAKE2B_PARAM_SIZE];
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(md != NULL);
|
||||
|
||||
if ((!outlen) || (outlen > BLAKE2B_OUTBYTES))
|
||||
return CRYPT_INVALID_ARG;
|
||||
|
||||
if ((key && !keylen) || (keylen && !key) || (keylen > BLAKE2B_KEYBYTES))
|
||||
return CRYPT_INVALID_ARG;
|
||||
|
||||
XMEMSET(P, 0, sizeof(P));
|
||||
|
||||
P[O_DIGEST_LENGTH] = (unsigned char)outlen;
|
||||
P[O_KEY_LENGTH] = (unsigned char)keylen;
|
||||
P[O_FANOUT] = 1;
|
||||
P[O_DEPTH] = 1;
|
||||
|
||||
err = blake2b_init_param(md, P);
|
||||
if (err != CRYPT_OK) return err;
|
||||
|
||||
if (key) {
|
||||
unsigned char block[BLAKE2B_BLOCKBYTES];
|
||||
|
||||
XMEMSET(block, 0, BLAKE2B_BLOCKBYTES);
|
||||
XMEMCPY(block, key, keylen);
|
||||
blake2b_process(md, block, BLAKE2B_BLOCKBYTES);
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(block, sizeof(block));
|
||||
#endif
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int blake2b_160_init(hash_state *md) { return blake2b_init(md, 20, NULL, 0); }
|
||||
|
||||
int blake2b_256_init(hash_state *md) { return blake2b_init(md, 32, NULL, 0); }
|
||||
|
||||
int blake2b_384_init(hash_state *md) { return blake2b_init(md, 48, NULL, 0); }
|
||||
|
||||
int blake2b_512_init(hash_state *md) { return blake2b_init(md, 64, NULL, 0); }
|
||||
|
||||
#define G(r, i, a, b, c, d) \
|
||||
do { \
|
||||
a = a + b + m[blake2b_sigma[r][2 * i + 0]]; \
|
||||
d = ROR64(d ^ a, 32); \
|
||||
c = c + d; \
|
||||
b = ROR64(b ^ c, 24); \
|
||||
a = a + b + m[blake2b_sigma[r][2 * i + 1]]; \
|
||||
d = ROR64(d ^ a, 16); \
|
||||
c = c + d; \
|
||||
b = ROR64(b ^ c, 63); \
|
||||
} while (0)
|
||||
|
||||
#define ROUND(r) \
|
||||
do { \
|
||||
G(r, 0, v[0], v[4], v[8], v[12]); \
|
||||
G(r, 1, v[1], v[5], v[9], v[13]); \
|
||||
G(r, 2, v[2], v[6], v[10], v[14]); \
|
||||
G(r, 3, v[3], v[7], v[11], v[15]); \
|
||||
G(r, 4, v[0], v[5], v[10], v[15]); \
|
||||
G(r, 5, v[1], v[6], v[11], v[12]); \
|
||||
G(r, 6, v[2], v[7], v[8], v[13]); \
|
||||
G(r, 7, v[3], v[4], v[9], v[14]); \
|
||||
} while (0)
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static int _blake2b_compress(hash_state *md, const unsigned char *buf)
|
||||
#else
|
||||
static int blake2b_compress(hash_state *md, const unsigned char *buf)
|
||||
#endif
|
||||
{
|
||||
ulong64 m[16];
|
||||
ulong64 v[16];
|
||||
unsigned long i;
|
||||
|
||||
for (i = 0; i < 16; ++i) {
|
||||
LOAD64L(m[i], buf + i * sizeof(m[i]));
|
||||
}
|
||||
|
||||
for (i = 0; i < 8; ++i) {
|
||||
v[i] = md->blake2b.h[i];
|
||||
}
|
||||
|
||||
v[8] = blake2b_IV[0];
|
||||
v[9] = blake2b_IV[1];
|
||||
v[10] = blake2b_IV[2];
|
||||
v[11] = blake2b_IV[3];
|
||||
v[12] = blake2b_IV[4] ^ md->blake2b.t[0];
|
||||
v[13] = blake2b_IV[5] ^ md->blake2b.t[1];
|
||||
v[14] = blake2b_IV[6] ^ md->blake2b.f[0];
|
||||
v[15] = blake2b_IV[7] ^ md->blake2b.f[1];
|
||||
|
||||
ROUND(0);
|
||||
ROUND(1);
|
||||
ROUND(2);
|
||||
ROUND(3);
|
||||
ROUND(4);
|
||||
ROUND(5);
|
||||
ROUND(6);
|
||||
ROUND(7);
|
||||
ROUND(8);
|
||||
ROUND(9);
|
||||
ROUND(10);
|
||||
ROUND(11);
|
||||
|
||||
for (i = 0; i < 8; ++i) {
|
||||
md->blake2b.h[i] = md->blake2b.h[i] ^ v[i] ^ v[i + 8];
|
||||
}
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
#undef G
|
||||
#undef ROUND
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static int blake2b_compress(hash_state *md, const unsigned char *buf)
|
||||
{
|
||||
int err;
|
||||
err = _blake2b_compress(md, buf);
|
||||
burn_stack(sizeof(ulong64) * 32 + sizeof(unsigned long));
|
||||
return err;
|
||||
}
|
||||
#endif
|
||||
|
||||
int blake2b_process(hash_state *md, const unsigned char *in, unsigned long inlen)
|
||||
{
|
||||
LTC_ARGCHK(md != NULL);
|
||||
LTC_ARGCHK(in != NULL);
|
||||
|
||||
if (md->blake2b.curlen > sizeof(md->blake2b.buf)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
if (inlen > 0) {
|
||||
unsigned long left = md->blake2b.curlen;
|
||||
unsigned long fill = BLAKE2B_BLOCKBYTES - left;
|
||||
if (inlen > fill) {
|
||||
md->blake2b.curlen = 0;
|
||||
XMEMCPY(md->blake2b.buf + (left % sizeof(md->blake2b.buf)), in, fill); /* Fill buffer */
|
||||
blake2b_increment_counter(md, BLAKE2B_BLOCKBYTES);
|
||||
blake2b_compress(md, md->blake2b.buf); /* Compress */
|
||||
in += fill;
|
||||
inlen -= fill;
|
||||
while (inlen > BLAKE2B_BLOCKBYTES) {
|
||||
blake2b_increment_counter(md, BLAKE2B_BLOCKBYTES);
|
||||
blake2b_compress(md, in);
|
||||
in += BLAKE2B_BLOCKBYTES;
|
||||
inlen -= BLAKE2B_BLOCKBYTES;
|
||||
}
|
||||
}
|
||||
XMEMCPY(md->blake2b.buf + md->blake2b.curlen, in, inlen);
|
||||
md->blake2b.curlen += inlen;
|
||||
}
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int blake2b_done(hash_state *md, unsigned char *out)
|
||||
{
|
||||
unsigned char buffer[BLAKE2B_OUTBYTES] = { 0 };
|
||||
unsigned long i;
|
||||
|
||||
LTC_ARGCHK(md != NULL);
|
||||
LTC_ARGCHK(out != NULL);
|
||||
|
||||
/* if(md->blakebs.outlen != outlen) return CRYPT_INVALID_ARG; */
|
||||
|
||||
if (blake2b_is_lastblock(md))
|
||||
return CRYPT_ERROR;
|
||||
|
||||
blake2b_increment_counter(md, md->blake2b.curlen);
|
||||
blake2b_set_lastblock(md);
|
||||
XMEMSET(md->blake2b.buf + md->blake2b.curlen, 0, BLAKE2B_BLOCKBYTES - md->blake2b.curlen); /* Padding */
|
||||
blake2b_compress(md, md->blake2b.buf);
|
||||
|
||||
for (i = 0; i < 8; ++i) /* Output full hash to temp buffer */
|
||||
STORE64L(md->blake2b.h[i], buffer + i * 8);
|
||||
|
||||
XMEMCPY(out, buffer, md->blake2b.outlen);
|
||||
zeromem(md, sizeof(hash_state));
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(buffer, sizeof(buffer));
|
||||
#endif
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2b_512_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[64];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x78, 0x6a, 0x02, 0xf7, 0x42, 0x01, 0x59, 0x03,
|
||||
0xc6, 0xc6, 0xfd, 0x85, 0x25, 0x52, 0xd2, 0x72,
|
||||
0x91, 0x2f, 0x47, 0x40, 0xe1, 0x58, 0x47, 0x61,
|
||||
0x8a, 0x86, 0xe2, 0x17, 0xf7, 0x1f, 0x54, 0x19,
|
||||
0xd2, 0x5e, 0x10, 0x31, 0xaf, 0xee, 0x58, 0x53,
|
||||
0x13, 0x89, 0x64, 0x44, 0x93, 0x4e, 0xb0, 0x4b,
|
||||
0x90, 0x3a, 0x68, 0x5b, 0x14, 0x48, 0xb7, 0x55,
|
||||
0xd5, 0x6f, 0x70, 0x1a, 0xfe, 0x9b, 0xe2, 0xce } },
|
||||
{ "abc",
|
||||
{ 0xba, 0x80, 0xa5, 0x3f, 0x98, 0x1c, 0x4d, 0x0d,
|
||||
0x6a, 0x27, 0x97, 0xb6, 0x9f, 0x12, 0xf6, 0xe9,
|
||||
0x4c, 0x21, 0x2f, 0x14, 0x68, 0x5a, 0xc4, 0xb7,
|
||||
0x4b, 0x12, 0xbb, 0x6f, 0xdb, 0xff, 0xa2, 0xd1,
|
||||
0x7d, 0x87, 0xc5, 0x39, 0x2a, 0xab, 0x79, 0x2d,
|
||||
0xc2, 0x52, 0xd5, 0xde, 0x45, 0x33, 0xcc, 0x95,
|
||||
0x18, 0xd3, 0x8a, 0xa8, 0xdb, 0xf1, 0x92, 0x5a,
|
||||
0xb9, 0x23, 0x86, 0xed, 0xd4, 0x00, 0x99, 0x23 } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[64];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2b_512_init(&md);
|
||||
blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2b_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_512", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2b_384_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[48];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0xb3, 0x28, 0x11, 0x42, 0x33, 0x77, 0xf5, 0x2d,
|
||||
0x78, 0x62, 0x28, 0x6e, 0xe1, 0xa7, 0x2e, 0xe5,
|
||||
0x40, 0x52, 0x43, 0x80, 0xfd, 0xa1, 0x72, 0x4a,
|
||||
0x6f, 0x25, 0xd7, 0x97, 0x8c, 0x6f, 0xd3, 0x24,
|
||||
0x4a, 0x6c, 0xaf, 0x04, 0x98, 0x81, 0x26, 0x73,
|
||||
0xc5, 0xe0, 0x5e, 0xf5, 0x83, 0x82, 0x51, 0x00 } },
|
||||
{ "abc",
|
||||
{ 0x6f, 0x56, 0xa8, 0x2c, 0x8e, 0x7e, 0xf5, 0x26,
|
||||
0xdf, 0xe1, 0x82, 0xeb, 0x52, 0x12, 0xf7, 0xdb,
|
||||
0x9d, 0xf1, 0x31, 0x7e, 0x57, 0x81, 0x5d, 0xbd,
|
||||
0xa4, 0x60, 0x83, 0xfc, 0x30, 0xf5, 0x4e, 0xe6,
|
||||
0xc6, 0x6b, 0xa8, 0x3b, 0xe6, 0x4b, 0x30, 0x2d,
|
||||
0x7c, 0xba, 0x6c, 0xe1, 0x5b, 0xb5, 0x56, 0xf4 } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[48];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2b_384_init(&md);
|
||||
blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2b_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_384", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2b_256_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[32];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x0e, 0x57, 0x51, 0xc0, 0x26, 0xe5, 0x43, 0xb2,
|
||||
0xe8, 0xab, 0x2e, 0xb0, 0x60, 0x99, 0xda, 0xa1,
|
||||
0xd1, 0xe5, 0xdf, 0x47, 0x77, 0x8f, 0x77, 0x87,
|
||||
0xfa, 0xab, 0x45, 0xcd, 0xf1, 0x2f, 0xe3, 0xa8 } },
|
||||
{ "abc",
|
||||
{ 0xbd, 0xdd, 0x81, 0x3c, 0x63, 0x42, 0x39, 0x72,
|
||||
0x31, 0x71, 0xef, 0x3f, 0xee, 0x98, 0x57, 0x9b,
|
||||
0x94, 0x96, 0x4e, 0x3b, 0xb1, 0xcb, 0x3e, 0x42,
|
||||
0x72, 0x62, 0xc8, 0xc0, 0x68, 0xd5, 0x23, 0x19 } },
|
||||
{ "12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890",
|
||||
{ 0x0f, 0x6e, 0x01, 0x8d, 0x38, 0xd6, 0x3f, 0x08,
|
||||
0x4d, 0x58, 0xe3, 0x0c, 0x90, 0xfb, 0xa2, 0x41,
|
||||
0x5f, 0xca, 0x17, 0xfa, 0x66, 0x26, 0x49, 0xf3,
|
||||
0x8a, 0x30, 0x41, 0x7c, 0x57, 0xcd, 0xa8, 0x14 } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[32];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2b_256_init(&md);
|
||||
blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2b_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_256", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2b_160_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[20];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x33, 0x45, 0x52, 0x4a, 0xbf, 0x6b, 0xbe, 0x18,
|
||||
0x09, 0x44, 0x92, 0x24, 0xb5, 0x97, 0x2c, 0x41,
|
||||
0x79, 0x0b, 0x6c, 0xf2 } },
|
||||
{ "abc",
|
||||
{ 0x38, 0x42, 0x64, 0xf6, 0x76, 0xf3, 0x95, 0x36,
|
||||
0x84, 0x05, 0x23, 0xf2, 0x84, 0x92, 0x1c, 0xdc,
|
||||
0x68, 0xb6, 0x84, 0x6b } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[20];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2b_160_init(&md);
|
||||
blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2b_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_160", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
563
libtomcrypt/src/hashes/blake2s.c
Normal file
563
libtomcrypt/src/hashes/blake2s.c
Normal file
@@ -0,0 +1,563 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
|
||||
/*
|
||||
BLAKE2 reference source code package - reference C implementations
|
||||
|
||||
Copyright 2012, Samuel Neves <sneves@dei.uc.pt>. You may use this under the
|
||||
terms of the CC0, the OpenSSL Licence, or the Apache Public License 2.0, at
|
||||
your option. The terms of these licenses can be found at:
|
||||
|
||||
- CC0 1.0 Universal : http://creativecommons.org/publicdomain/zero/1.0
|
||||
- OpenSSL license : https://www.openssl.org/source/license.html
|
||||
- Apache 2.0 : http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
More information about the BLAKE2 hash function can be found at
|
||||
https://blake2.net.
|
||||
*/
|
||||
/* see also https://www.ietf.org/rfc/rfc7693.txt */
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_BLAKE2S
|
||||
|
||||
enum blake2s_constant {
|
||||
BLAKE2S_BLOCKBYTES = 64,
|
||||
BLAKE2S_OUTBYTES = 32,
|
||||
BLAKE2S_KEYBYTES = 32,
|
||||
BLAKE2S_SALTBYTES = 8,
|
||||
BLAKE2S_PERSONALBYTES = 8,
|
||||
BLAKE2S_PARAM_SIZE = 32
|
||||
};
|
||||
|
||||
/* param offsets */
|
||||
enum {
|
||||
O_DIGEST_LENGTH = 0,
|
||||
O_KEY_LENGTH = 1,
|
||||
O_FANOUT = 2,
|
||||
O_DEPTH = 3,
|
||||
O_LEAF_LENGTH = 4,
|
||||
O_NODE_OFFSET = 8,
|
||||
O_XOF_LENGTH = 12,
|
||||
O_NODE_DEPTH = 14,
|
||||
O_INNER_LENGTH = 15,
|
||||
O_SALT = 16,
|
||||
O_PERSONAL = 24
|
||||
};
|
||||
|
||||
/*
|
||||
struct blake2s_param {
|
||||
unsigned char digest_length;
|
||||
unsigned char key_length;
|
||||
unsigned char fanout;
|
||||
unsigned char depth;
|
||||
ulong32 leaf_length;
|
||||
ulong32 node_offset;
|
||||
ushort16 xof_length;
|
||||
unsigned char node_depth;
|
||||
unsigned char inner_length;
|
||||
unsigned char salt[BLAKE2S_SALTBYTES];
|
||||
unsigned char personal[BLAKE2S_PERSONALBYTES];
|
||||
};
|
||||
*/
|
||||
|
||||
const struct ltc_hash_descriptor blake2s_128_desc =
|
||||
{
|
||||
"blake2s-128",
|
||||
21,
|
||||
16,
|
||||
64,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 4 },
|
||||
11,
|
||||
&blake2s_128_init,
|
||||
&blake2s_process,
|
||||
&blake2s_done,
|
||||
&blake2s_128_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
const struct ltc_hash_descriptor blake2s_160_desc =
|
||||
{
|
||||
"blake2s-160",
|
||||
22,
|
||||
20,
|
||||
64,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 5 },
|
||||
11,
|
||||
&blake2s_160_init,
|
||||
&blake2s_process,
|
||||
&blake2s_done,
|
||||
&blake2s_160_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
const struct ltc_hash_descriptor blake2s_224_desc =
|
||||
{
|
||||
"blake2s-224",
|
||||
23,
|
||||
28,
|
||||
64,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 7 },
|
||||
11,
|
||||
&blake2s_224_init,
|
||||
&blake2s_process,
|
||||
&blake2s_done,
|
||||
&blake2s_224_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
const struct ltc_hash_descriptor blake2s_256_desc =
|
||||
{
|
||||
"blake2s-256",
|
||||
24,
|
||||
32,
|
||||
64,
|
||||
{ 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 8 },
|
||||
11,
|
||||
&blake2s_256_init,
|
||||
&blake2s_process,
|
||||
&blake2s_done,
|
||||
&blake2s_256_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
static const ulong32 blake2s_IV[8] = {
|
||||
0x6A09E667UL, 0xBB67AE85UL, 0x3C6EF372UL, 0xA54FF53AUL,
|
||||
0x510E527FUL, 0x9B05688CUL, 0x1F83D9ABUL, 0x5BE0CD19UL
|
||||
};
|
||||
|
||||
static const unsigned char blake2s_sigma[10][16] = {
|
||||
{ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 },
|
||||
{ 14, 10, 4, 8, 9, 15, 13, 6, 1, 12, 0, 2, 11, 7, 5, 3 },
|
||||
{ 11, 8, 12, 0, 5, 2, 15, 13, 10, 14, 3, 6, 7, 1, 9, 4 },
|
||||
{ 7, 9, 3, 1, 13, 12, 11, 14, 2, 6, 5, 10, 4, 0, 15, 8 },
|
||||
{ 9, 0, 5, 7, 2, 4, 10, 15, 14, 1, 11, 12, 6, 8, 3, 13 },
|
||||
{ 2, 12, 6, 10, 0, 11, 8, 3, 4, 13, 7, 5, 15, 14, 1, 9 },
|
||||
{ 12, 5, 1, 15, 14, 13, 4, 10, 0, 7, 6, 3, 9, 2, 8, 11 },
|
||||
{ 13, 11, 7, 14, 12, 1, 3, 9, 5, 0, 15, 4, 8, 6, 2, 10 },
|
||||
{ 6, 15, 14, 9, 11, 3, 0, 8, 12, 2, 13, 7, 1, 4, 10, 5 },
|
||||
{ 10, 2, 8, 4, 7, 6, 1, 5, 15, 11, 9, 14, 3, 12, 13, 0 },
|
||||
};
|
||||
|
||||
static void blake2s_set_lastnode(hash_state *md) { md->blake2s.f[1] = 0xffffffffUL; }
|
||||
|
||||
/* Some helper functions, not necessarily useful */
|
||||
static int blake2s_is_lastblock(const hash_state *md) { return md->blake2s.f[0] != 0; }
|
||||
|
||||
static void blake2s_set_lastblock(hash_state *md)
|
||||
{
|
||||
if (md->blake2s.last_node)
|
||||
blake2s_set_lastnode(md);
|
||||
|
||||
md->blake2s.f[0] = 0xffffffffUL;
|
||||
}
|
||||
|
||||
static void blake2s_increment_counter(hash_state *md, const ulong32 inc)
|
||||
{
|
||||
md->blake2s.t[0] += inc;
|
||||
if (md->blake2s.t[0] < inc) md->blake2s.t[1]++;
|
||||
}
|
||||
|
||||
static int blake2s_init0(hash_state *md)
|
||||
{
|
||||
int i;
|
||||
XMEMSET(&md->blake2s, 0, sizeof(struct blake2s_state));
|
||||
|
||||
for (i = 0; i < 8; ++i)
|
||||
md->blake2s.h[i] = blake2s_IV[i];
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/* init2 xors IV with input parameter block */
|
||||
static int blake2s_init_param(hash_state *md, const unsigned char *P)
|
||||
{
|
||||
unsigned long i;
|
||||
|
||||
blake2s_init0(md);
|
||||
|
||||
/* IV XOR ParamBlock */
|
||||
for (i = 0; i < 8; ++i) {
|
||||
ulong32 tmp;
|
||||
LOAD32L(tmp, P + i * 4);
|
||||
md->blake2s.h[i] ^= tmp;
|
||||
}
|
||||
|
||||
md->blake2s.outlen = P[O_DIGEST_LENGTH];
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int blake2s_init(hash_state *md, unsigned long outlen, const unsigned char *key, unsigned long keylen)
|
||||
{
|
||||
unsigned char P[BLAKE2S_PARAM_SIZE];
|
||||
int err;
|
||||
|
||||
LTC_ARGCHK(md != NULL);
|
||||
|
||||
if ((!outlen) || (outlen > BLAKE2S_OUTBYTES))
|
||||
return CRYPT_INVALID_ARG;
|
||||
|
||||
if ((key && !keylen) || (keylen && !key) || (keylen > BLAKE2S_KEYBYTES))
|
||||
return CRYPT_INVALID_ARG;
|
||||
|
||||
XMEMSET(P, 0, sizeof(P));
|
||||
|
||||
P[O_DIGEST_LENGTH] = (unsigned char)outlen;
|
||||
P[O_KEY_LENGTH] = (unsigned char)keylen;
|
||||
P[O_FANOUT] = 1;
|
||||
P[O_DEPTH] = 1;
|
||||
|
||||
err = blake2s_init_param(md, P);
|
||||
if (err != CRYPT_OK) return err;
|
||||
|
||||
if (key) {
|
||||
unsigned char block[BLAKE2S_BLOCKBYTES];
|
||||
|
||||
XMEMSET(block, 0, BLAKE2S_BLOCKBYTES);
|
||||
XMEMCPY(block, key, keylen);
|
||||
blake2s_process(md, block, BLAKE2S_BLOCKBYTES);
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(block, sizeof(block));
|
||||
#endif
|
||||
}
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int blake2s_128_init(hash_state *md) { return blake2s_init(md, 16, NULL, 0); }
|
||||
|
||||
int blake2s_160_init(hash_state *md) { return blake2s_init(md, 20, NULL, 0); }
|
||||
|
||||
int blake2s_224_init(hash_state *md) { return blake2s_init(md, 28, NULL, 0); }
|
||||
|
||||
int blake2s_256_init(hash_state *md) { return blake2s_init(md, 32, NULL, 0); }
|
||||
|
||||
#define G(r, i, a, b, c, d) \
|
||||
do { \
|
||||
a = a + b + m[blake2s_sigma[r][2 * i + 0]]; \
|
||||
d = ROR(d ^ a, 16); \
|
||||
c = c + d; \
|
||||
b = ROR(b ^ c, 12); \
|
||||
a = a + b + m[blake2s_sigma[r][2 * i + 1]]; \
|
||||
d = ROR(d ^ a, 8); \
|
||||
c = c + d; \
|
||||
b = ROR(b ^ c, 7); \
|
||||
} while (0)
|
||||
#define ROUND(r) \
|
||||
do { \
|
||||
G(r, 0, v[0], v[4], v[8], v[12]); \
|
||||
G(r, 1, v[1], v[5], v[9], v[13]); \
|
||||
G(r, 2, v[2], v[6], v[10], v[14]); \
|
||||
G(r, 3, v[3], v[7], v[11], v[15]); \
|
||||
G(r, 4, v[0], v[5], v[10], v[15]); \
|
||||
G(r, 5, v[1], v[6], v[11], v[12]); \
|
||||
G(r, 6, v[2], v[7], v[8], v[13]); \
|
||||
G(r, 7, v[3], v[4], v[9], v[14]); \
|
||||
} while (0)
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static int _blake2s_compress(hash_state *md, const unsigned char *buf)
|
||||
#else
|
||||
static int blake2s_compress(hash_state *md, const unsigned char *buf)
|
||||
#endif
|
||||
{
|
||||
unsigned long i;
|
||||
ulong32 m[16];
|
||||
ulong32 v[16];
|
||||
|
||||
for (i = 0; i < 16; ++i) {
|
||||
LOAD32L(m[i], buf + i * sizeof(m[i]));
|
||||
}
|
||||
|
||||
for (i = 0; i < 8; ++i)
|
||||
v[i] = md->blake2s.h[i];
|
||||
|
||||
v[8] = blake2s_IV[0];
|
||||
v[9] = blake2s_IV[1];
|
||||
v[10] = blake2s_IV[2];
|
||||
v[11] = blake2s_IV[3];
|
||||
v[12] = md->blake2s.t[0] ^ blake2s_IV[4];
|
||||
v[13] = md->blake2s.t[1] ^ blake2s_IV[5];
|
||||
v[14] = md->blake2s.f[0] ^ blake2s_IV[6];
|
||||
v[15] = md->blake2s.f[1] ^ blake2s_IV[7];
|
||||
|
||||
ROUND(0);
|
||||
ROUND(1);
|
||||
ROUND(2);
|
||||
ROUND(3);
|
||||
ROUND(4);
|
||||
ROUND(5);
|
||||
ROUND(6);
|
||||
ROUND(7);
|
||||
ROUND(8);
|
||||
ROUND(9);
|
||||
|
||||
for (i = 0; i < 8; ++i)
|
||||
md->blake2s.h[i] = md->blake2s.h[i] ^ v[i] ^ v[i + 8];
|
||||
|
||||
return CRYPT_OK;
|
||||
}
|
||||
#undef G
|
||||
#undef ROUND
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static int blake2s_compress(hash_state *md, const unsigned char *buf)
|
||||
{
|
||||
int err;
|
||||
err = _blake2s_compress(md, buf);
|
||||
burn_stack(sizeof(ulong32) * (32) + sizeof(unsigned long));
|
||||
return err;
|
||||
}
|
||||
#endif
|
||||
|
||||
int blake2s_process(hash_state *md, const unsigned char *in, unsigned long inlen)
|
||||
{
|
||||
LTC_ARGCHK(md != NULL);
|
||||
LTC_ARGCHK(in != NULL);
|
||||
|
||||
if (md->blake2s.curlen > sizeof(md->blake2s.buf)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
if (inlen > 0) {
|
||||
unsigned long left = md->blake2s.curlen;
|
||||
unsigned long fill = BLAKE2S_BLOCKBYTES - left;
|
||||
if (inlen > fill) {
|
||||
md->blake2s.curlen = 0;
|
||||
XMEMCPY(md->blake2s.buf + (left % sizeof(md->blake2s.buf)), in, fill); /* Fill buffer */
|
||||
blake2s_increment_counter(md, BLAKE2S_BLOCKBYTES);
|
||||
blake2s_compress(md, md->blake2s.buf); /* Compress */
|
||||
in += fill;
|
||||
inlen -= fill;
|
||||
while (inlen > BLAKE2S_BLOCKBYTES) {
|
||||
blake2s_increment_counter(md, BLAKE2S_BLOCKBYTES);
|
||||
blake2s_compress(md, in);
|
||||
in += BLAKE2S_BLOCKBYTES;
|
||||
inlen -= BLAKE2S_BLOCKBYTES;
|
||||
}
|
||||
}
|
||||
XMEMCPY(md->blake2s.buf + md->blake2s.curlen, in, inlen);
|
||||
md->blake2s.curlen += inlen;
|
||||
}
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
int blake2s_done(hash_state *md, unsigned char *out)
|
||||
{
|
||||
unsigned char buffer[BLAKE2S_OUTBYTES] = { 0 };
|
||||
unsigned long i;
|
||||
|
||||
LTC_ARGCHK(md != NULL);
|
||||
LTC_ARGCHK(out != NULL);
|
||||
|
||||
/* if(md->blake2s.outlen != outlen) return CRYPT_INVALID_ARG; */
|
||||
|
||||
if (blake2s_is_lastblock(md))
|
||||
return CRYPT_ERROR;
|
||||
|
||||
blake2s_increment_counter(md, md->blake2s.curlen);
|
||||
blake2s_set_lastblock(md);
|
||||
XMEMSET(md->blake2s.buf + md->blake2s.curlen, 0, BLAKE2S_BLOCKBYTES - md->blake2s.curlen); /* Padding */
|
||||
blake2s_compress(md, md->blake2s.buf);
|
||||
|
||||
for (i = 0; i < 8; ++i) /* Output full hash to temp buffer */
|
||||
STORE32L(md->blake2s.h[i], buffer + i * 4);
|
||||
|
||||
XMEMCPY(out, buffer, md->blake2s.outlen);
|
||||
zeromem(md, sizeof(hash_state));
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(buffer, sizeof(buffer));
|
||||
#endif
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2s_256_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[32];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x69, 0x21, 0x7a, 0x30, 0x79, 0x90, 0x80, 0x94,
|
||||
0xe1, 0x11, 0x21, 0xd0, 0x42, 0x35, 0x4a, 0x7c,
|
||||
0x1f, 0x55, 0xb6, 0x48, 0x2c, 0xa1, 0xa5, 0x1e,
|
||||
0x1b, 0x25, 0x0d, 0xfd, 0x1e, 0xd0, 0xee, 0xf9 } },
|
||||
{ "abc",
|
||||
{ 0x50, 0x8c, 0x5e, 0x8c, 0x32, 0x7c, 0x14, 0xe2,
|
||||
0xe1, 0xa7, 0x2b, 0xa3, 0x4e, 0xeb, 0x45, 0x2f,
|
||||
0x37, 0x45, 0x8b, 0x20, 0x9e, 0xd6, 0x3a, 0x29,
|
||||
0x4d, 0x99, 0x9b, 0x4c, 0x86, 0x67, 0x59, 0x82 } },
|
||||
{ "12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890"
|
||||
"12345678901234567890123456789012345678901234567890",
|
||||
{ 0xa3, 0x78, 0x8b, 0x5b, 0x59, 0xee, 0xe4, 0x41,
|
||||
0x95, 0x23, 0x58, 0x00, 0xa4, 0xf9, 0xfa, 0x41,
|
||||
0x86, 0x0c, 0x7b, 0x1c, 0x35, 0xa2, 0x42, 0x70,
|
||||
0x50, 0x80, 0x79, 0x56, 0xe3, 0xbe, 0x31, 0x74 } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[32];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2s_256_init(&md);
|
||||
blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2s_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_256", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2s_224_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[28];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x1f, 0xa1, 0x29, 0x1e, 0x65, 0x24, 0x8b, 0x37,
|
||||
0xb3, 0x43, 0x34, 0x75, 0xb2, 0xa0, 0xdd, 0x63,
|
||||
0xd5, 0x4a, 0x11, 0xec, 0xc4, 0xe3, 0xe0, 0x34,
|
||||
0xe7, 0xbc, 0x1e, 0xf4 } },
|
||||
{ "abc",
|
||||
{ 0x0b, 0x03, 0x3f, 0xc2, 0x26, 0xdf, 0x7a, 0xbd,
|
||||
0xe2, 0x9f, 0x67, 0xa0, 0x5d, 0x3d, 0xc6, 0x2c,
|
||||
0xf2, 0x71, 0xef, 0x3d, 0xfe, 0xa4, 0xd3, 0x87,
|
||||
0x40, 0x7f, 0xbd, 0x55 } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[28];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2s_224_init(&md);
|
||||
blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2s_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_224", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2s_160_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[20];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x35, 0x4c, 0x9c, 0x33, 0xf7, 0x35, 0x96, 0x24,
|
||||
0x18, 0xbd, 0xac, 0xb9, 0x47, 0x98, 0x73, 0x42,
|
||||
0x9c, 0x34, 0x91, 0x6f} },
|
||||
{ "abc",
|
||||
{ 0x5a, 0xe3, 0xb9, 0x9b, 0xe2, 0x9b, 0x01, 0x83,
|
||||
0x4c, 0x3b, 0x50, 0x85, 0x21, 0xed, 0xe6, 0x04,
|
||||
0x38, 0xf8, 0xde, 0x17 } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[20];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2s_160_init(&md);
|
||||
blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2s_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_160", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int blake2s_128_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[16];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x64, 0x55, 0x0d, 0x6f, 0xfe, 0x2c, 0x0a, 0x01,
|
||||
0xa1, 0x4a, 0xba, 0x1e, 0xad, 0xe0, 0x20, 0x0c } },
|
||||
{ "abc",
|
||||
{ 0xaa, 0x49, 0x38, 0x11, 0x9b, 0x1d, 0xc7, 0xb8,
|
||||
0x7c, 0xba, 0xd0, 0xff, 0xd2, 0x00, 0xd0, 0xae } },
|
||||
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[16];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; tests[i].msg != NULL; i++) {
|
||||
blake2s_128_init(&md);
|
||||
blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
blake2s_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_128", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
@@ -35,8 +33,8 @@ const struct ltc_hash_descriptor chc_desc = {
|
||||
};
|
||||
|
||||
/**
|
||||
Initialize the CHC state with a given cipher
|
||||
@param cipher The index of the cipher you wish to bind
|
||||
Initialize the CHC state with a given cipher
|
||||
@param cipher The index of the cipher you wish to bind
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int chc_register(int cipher)
|
||||
@@ -70,7 +68,7 @@ int chc_register(int cipher)
|
||||
}
|
||||
|
||||
/* store into descriptor */
|
||||
hash_descriptor[idx].hashsize =
|
||||
hash_descriptor[idx].hashsize =
|
||||
hash_descriptor[idx].blocksize = cipher_descriptor[cipher].block_length;
|
||||
|
||||
/* store the idx and block size */
|
||||
@@ -89,7 +87,7 @@ int chc_init(hash_state *md)
|
||||
symmetric_key *key;
|
||||
unsigned char buf[MAXBLOCKSIZE];
|
||||
int err;
|
||||
|
||||
|
||||
LTC_ARGCHK(md != NULL);
|
||||
|
||||
/* is the cipher valid? */
|
||||
@@ -105,7 +103,7 @@ int chc_init(hash_state *md)
|
||||
return CRYPT_MEM;
|
||||
}
|
||||
|
||||
/* zero key and what not */
|
||||
/* zero key and what not */
|
||||
zeromem(buf, cipher_blocksize);
|
||||
if ((err = cipher_descriptor[cipher_idx].setup(buf, cipher_blocksize, 0, key)) != CRYPT_OK) {
|
||||
XFREE(key);
|
||||
@@ -123,7 +121,7 @@ int chc_init(hash_state *md)
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/*
|
||||
/*
|
||||
key <= state
|
||||
T0,T1 <= block
|
||||
T0 <= encrypt T0
|
||||
@@ -147,17 +145,23 @@ static int chc_compress(hash_state *md, unsigned char *buf)
|
||||
for (x = 0; x < cipher_blocksize; x++) {
|
||||
md->chc.state[x] ^= T[0][x] ^ T[1][x];
|
||||
}
|
||||
XFREE(key);
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(T, sizeof(T));
|
||||
zeromem(&key, sizeof(key));
|
||||
zeromem(key, sizeof(*key));
|
||||
#endif
|
||||
XFREE(key);
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/* function for processing blocks */
|
||||
int _chc_process(hash_state * md, const unsigned char *buf, unsigned long len);
|
||||
HASH_PROCESS(_chc_process, chc_compress, chc, (unsigned long)cipher_blocksize)
|
||||
/**
|
||||
Function for processing blocks
|
||||
@param md The hash state
|
||||
@param buf The data to hash
|
||||
@param len The length of the data (octets)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
static int _chc_process(hash_state * md, const unsigned char *buf, unsigned long len);
|
||||
static HASH_PROCESS(_chc_process, chc_compress, chc, (unsigned long)cipher_blocksize)
|
||||
|
||||
/**
|
||||
Process a block of memory though the hash
|
||||
@@ -248,23 +252,26 @@ int chc_done(hash_state *md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int chc_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
unsigned char *msg,
|
||||
md[MAXBLOCKSIZE];
|
||||
hash[MAXBLOCKSIZE];
|
||||
int len;
|
||||
} tests[] = {
|
||||
{
|
||||
(unsigned char *)"hello world",
|
||||
{ 0xcf, 0x57, 0x9d, 0xc3, 0x0a, 0x0e, 0xea, 0x61,
|
||||
{ 0xcf, 0x57, 0x9d, 0xc3, 0x0a, 0x0e, 0xea, 0x61,
|
||||
0x0d, 0x54, 0x47, 0xc4, 0x3c, 0x06, 0xf5, 0x4e },
|
||||
16
|
||||
}
|
||||
};
|
||||
int x, oldhashidx, idx;
|
||||
unsigned char out[MAXBLOCKSIZE];
|
||||
int i, oldhashidx, idx;
|
||||
unsigned char tmp[MAXBLOCKSIZE];
|
||||
hash_state md;
|
||||
|
||||
/* AES can be under rijndael or aes... try to find it */
|
||||
@@ -276,11 +283,11 @@ int chc_test(void)
|
||||
oldhashidx = cipher_idx;
|
||||
chc_register(idx);
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
|
||||
chc_init(&md);
|
||||
chc_process(&md, tests[x].msg, strlen((char *)tests[x].msg));
|
||||
chc_done(&md, out);
|
||||
if (XMEMCMP(out, tests[x].md, tests[x].len)) {
|
||||
chc_process(&md, tests[i].msg, strlen((char *)tests[i].msg));
|
||||
chc_done(&md, tmp);
|
||||
if (compare_testvector(tmp, tests[i].len, tests[i].hash, tests[i].len, "CHC", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -289,10 +296,11 @@ int chc_test(void)
|
||||
}
|
||||
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,10 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifndef LTC_NO_FILE
|
||||
/**
|
||||
@file hash_file.c
|
||||
Hash a file, Tom St Denis
|
||||
@@ -24,10 +23,6 @@
|
||||
*/
|
||||
int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen)
|
||||
{
|
||||
#ifdef LTC_NO_FILE
|
||||
(void)hash; (void)fname; (void)out; (void)outlen;
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
FILE *in;
|
||||
int err;
|
||||
LTC_ARGCHK(fname != NULL);
|
||||
@@ -49,10 +44,10 @@ int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *ou
|
||||
}
|
||||
|
||||
return err;
|
||||
#endif
|
||||
}
|
||||
#endif /* #ifndef LTC_NO_FILE */
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,10 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifndef LTC_NO_FILE
|
||||
/**
|
||||
@file hash_filehandle.c
|
||||
Hash open files, Tom St Denis
|
||||
@@ -25,12 +24,8 @@
|
||||
*/
|
||||
int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen)
|
||||
{
|
||||
#ifdef LTC_NO_FILE
|
||||
(void)hash; (void)in; (void)out; (void)outlen;
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
hash_state md;
|
||||
unsigned char buf[512];
|
||||
unsigned char *buf;
|
||||
size_t x;
|
||||
int err;
|
||||
|
||||
@@ -38,35 +33,42 @@ int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outle
|
||||
LTC_ARGCHK(outlen != NULL);
|
||||
LTC_ARGCHK(in != NULL);
|
||||
|
||||
if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) {
|
||||
return CRYPT_MEM;
|
||||
}
|
||||
|
||||
if ((err = hash_is_valid(hash)) != CRYPT_OK) {
|
||||
return err;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
if (*outlen < hash_descriptor[hash].hashsize) {
|
||||
*outlen = hash_descriptor[hash].hashsize;
|
||||
return CRYPT_BUFFER_OVERFLOW;
|
||||
err = CRYPT_BUFFER_OVERFLOW;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
if ((err = hash_descriptor[hash].init(&md)) != CRYPT_OK) {
|
||||
return err;
|
||||
goto LBL_ERR;
|
||||
}
|
||||
|
||||
*outlen = hash_descriptor[hash].hashsize;
|
||||
do {
|
||||
x = fread(buf, 1, sizeof(buf), in);
|
||||
if ((err = hash_descriptor[hash].process(&md, buf, x)) != CRYPT_OK) {
|
||||
return err;
|
||||
x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in);
|
||||
if ((err = hash_descriptor[hash].process(&md, buf, (unsigned long)x)) != CRYPT_OK) {
|
||||
goto LBL_CLEANBUF;
|
||||
}
|
||||
} while (x == LTC_FILE_READ_BUFSIZE);
|
||||
if ((err = hash_descriptor[hash].done(&md, out)) == CRYPT_OK) {
|
||||
*outlen = hash_descriptor[hash].hashsize;
|
||||
}
|
||||
} while (x == sizeof(buf));
|
||||
err = hash_descriptor[hash].done(&md, out);
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(buf, sizeof(buf));
|
||||
#endif
|
||||
LBL_CLEANBUF:
|
||||
zeromem(buf, LTC_FILE_READ_BUFSIZE);
|
||||
LBL_ERR:
|
||||
XFREE(buf);
|
||||
return err;
|
||||
#endif
|
||||
}
|
||||
#endif /* #ifndef LTC_NO_FILE */
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,11 +5,10 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#ifdef LTC_HASH_HELPERS
|
||||
/**
|
||||
@file hash_memory.c
|
||||
Hash memory helper, Tom St Denis
|
||||
@@ -63,7 +62,8 @@ LBL_ERR:
|
||||
|
||||
return err;
|
||||
}
|
||||
#endif /* #ifdef LTC_HASH_HELPERS */
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,18 +5,18 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
#include <stdarg.h>
|
||||
|
||||
#ifdef LTC_HASH_HELPERS
|
||||
/**
|
||||
@file hash_memory_multi.c
|
||||
Hash (multiple buffers) memory helper, Tom St Denis
|
||||
*/
|
||||
|
||||
/**
|
||||
Hash multiple (non-adjacent) blocks of memory at once.
|
||||
Hash multiple (non-adjacent) blocks of memory at once.
|
||||
@param hash The index of the hash you wish to use
|
||||
@param out [out] Where to store the digest
|
||||
@param outlen [in/out] Max size and resulting size of the digest
|
||||
@@ -24,7 +24,7 @@
|
||||
@param inlen The length of the data to hash (octets)
|
||||
@param ... tuples of (data,len) pairs to hash, terminated with a (NULL,x) (x=don't care)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
*/
|
||||
int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen,
|
||||
const unsigned char *in, unsigned long inlen, ...)
|
||||
{
|
||||
@@ -57,7 +57,7 @@ int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen,
|
||||
}
|
||||
|
||||
va_start(args, inlen);
|
||||
curptr = in;
|
||||
curptr = in;
|
||||
curlen = inlen;
|
||||
for (;;) {
|
||||
/* process buf */
|
||||
@@ -81,7 +81,8 @@ LBL_ERR:
|
||||
va_end(args);
|
||||
return err;
|
||||
}
|
||||
#endif /* #ifdef LTC_HASH_HELPERS */
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,14 +5,12 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@param md2.c
|
||||
LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis
|
||||
LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis
|
||||
*/
|
||||
|
||||
#ifdef LTC_MD2
|
||||
@@ -64,7 +62,7 @@ static void md2_update_chksum(hash_state *md)
|
||||
L = md->md2.chksum[15];
|
||||
for (j = 0; j < 16; j++) {
|
||||
|
||||
/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say
|
||||
/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say
|
||||
otherwise.
|
||||
*/
|
||||
L = (md->md2.chksum[j] ^= PI_SUBST[(int)(md->md2.buf[j] ^ L)] & 255);
|
||||
@@ -75,7 +73,7 @@ static void md2_compress(hash_state *md)
|
||||
{
|
||||
int j, k;
|
||||
unsigned char t;
|
||||
|
||||
|
||||
/* copy block */
|
||||
for (j = 0; j < 16; j++) {
|
||||
md->md2.X[16+j] = md->md2.buf[j];
|
||||
@@ -122,9 +120,9 @@ int md2_process(hash_state *md, const unsigned char *in, unsigned long inlen)
|
||||
unsigned long n;
|
||||
LTC_ARGCHK(md != NULL);
|
||||
LTC_ARGCHK(in != NULL);
|
||||
if (md-> md2 .curlen > sizeof(md-> md2 .buf)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
if (md-> md2 .curlen > sizeof(md-> md2 .buf)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
while (inlen > 0) {
|
||||
n = MIN(inlen, (16 - md->md2.curlen));
|
||||
XMEMCPY(md->md2.buf + md->md2.curlen, in, (size_t)n);
|
||||
@@ -186,15 +184,15 @@ int md2_done(hash_state * md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int md2_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
unsigned char md[16];
|
||||
const char *msg;
|
||||
unsigned char hash[16];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{0x83,0x50,0xe5,0xa3,0xe2,0x4c,0x15,0x3d,
|
||||
@@ -227,25 +225,26 @@ int md2_test(void)
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[16];
|
||||
hash_state md;
|
||||
unsigned char buf[16];
|
||||
|
||||
for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
|
||||
md2_init(&md);
|
||||
md2_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
md2_done(&md, buf);
|
||||
if (XMEMCMP(buf, tests[i].md, 16) != 0) {
|
||||
md2_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD2", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,14 +5,12 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@param md4.c
|
||||
Submitted by Dobes Vandermeer (dobes@smartt.com)
|
||||
Submitted by Dobes Vandermeer (dobes@smartt.com)
|
||||
*/
|
||||
|
||||
#ifdef LTC_MD4
|
||||
@@ -23,7 +21,7 @@ const struct ltc_hash_descriptor md4_desc =
|
||||
6,
|
||||
16,
|
||||
64,
|
||||
|
||||
|
||||
/* OID */
|
||||
{ 1, 2, 840, 113549, 2, 4, },
|
||||
6,
|
||||
@@ -56,8 +54,8 @@ const struct ltc_hash_descriptor md4_desc =
|
||||
/* ROTATE_LEFT rotates x left n bits. */
|
||||
#define ROTATE_LEFT(x, n) ROLc(x, n)
|
||||
|
||||
/* FF, GG and HH are transformations for rounds 1, 2 and 3 */
|
||||
/* Rotation is separate from addition to prevent recomputation */
|
||||
/* FF, GG and HH are transformations for rounds 1, 2 and 3 */
|
||||
/* Rotation is separate from addition to prevent recomputation */
|
||||
|
||||
#define FF(a, b, c, d, x, s) { \
|
||||
(a) += F ((b), (c), (d)) + (x); \
|
||||
@@ -91,61 +89,61 @@ static int md4_compress(hash_state *md, unsigned char *buf)
|
||||
for (i = 0; i < 16; i++) {
|
||||
LOAD32L(x[i], buf + (4*i));
|
||||
}
|
||||
|
||||
/* Round 1 */
|
||||
FF (a, b, c, d, x[ 0], S11); /* 1 */
|
||||
FF (d, a, b, c, x[ 1], S12); /* 2 */
|
||||
FF (c, d, a, b, x[ 2], S13); /* 3 */
|
||||
FF (b, c, d, a, x[ 3], S14); /* 4 */
|
||||
FF (a, b, c, d, x[ 4], S11); /* 5 */
|
||||
FF (d, a, b, c, x[ 5], S12); /* 6 */
|
||||
FF (c, d, a, b, x[ 6], S13); /* 7 */
|
||||
FF (b, c, d, a, x[ 7], S14); /* 8 */
|
||||
FF (a, b, c, d, x[ 8], S11); /* 9 */
|
||||
|
||||
/* Round 1 */
|
||||
FF (a, b, c, d, x[ 0], S11); /* 1 */
|
||||
FF (d, a, b, c, x[ 1], S12); /* 2 */
|
||||
FF (c, d, a, b, x[ 2], S13); /* 3 */
|
||||
FF (b, c, d, a, x[ 3], S14); /* 4 */
|
||||
FF (a, b, c, d, x[ 4], S11); /* 5 */
|
||||
FF (d, a, b, c, x[ 5], S12); /* 6 */
|
||||
FF (c, d, a, b, x[ 6], S13); /* 7 */
|
||||
FF (b, c, d, a, x[ 7], S14); /* 8 */
|
||||
FF (a, b, c, d, x[ 8], S11); /* 9 */
|
||||
FF (d, a, b, c, x[ 9], S12); /* 10 */
|
||||
FF (c, d, a, b, x[10], S13); /* 11 */
|
||||
FF (c, d, a, b, x[10], S13); /* 11 */
|
||||
FF (b, c, d, a, x[11], S14); /* 12 */
|
||||
FF (a, b, c, d, x[12], S11); /* 13 */
|
||||
FF (d, a, b, c, x[13], S12); /* 14 */
|
||||
FF (c, d, a, b, x[14], S13); /* 15 */
|
||||
FF (b, c, d, a, x[15], S14); /* 16 */
|
||||
|
||||
/* Round 2 */
|
||||
GG (a, b, c, d, x[ 0], S21); /* 17 */
|
||||
GG (d, a, b, c, x[ 4], S22); /* 18 */
|
||||
GG (c, d, a, b, x[ 8], S23); /* 19 */
|
||||
GG (b, c, d, a, x[12], S24); /* 20 */
|
||||
GG (a, b, c, d, x[ 1], S21); /* 21 */
|
||||
GG (d, a, b, c, x[ 5], S22); /* 22 */
|
||||
GG (c, d, a, b, x[ 9], S23); /* 23 */
|
||||
GG (b, c, d, a, x[13], S24); /* 24 */
|
||||
GG (a, b, c, d, x[ 2], S21); /* 25 */
|
||||
GG (d, a, b, c, x[ 6], S22); /* 26 */
|
||||
GG (c, d, a, b, x[10], S23); /* 27 */
|
||||
GG (b, c, d, a, x[14], S24); /* 28 */
|
||||
GG (a, b, c, d, x[ 3], S21); /* 29 */
|
||||
GG (d, a, b, c, x[ 7], S22); /* 30 */
|
||||
GG (c, d, a, b, x[11], S23); /* 31 */
|
||||
GG (b, c, d, a, x[15], S24); /* 32 */
|
||||
|
||||
FF (d, a, b, c, x[13], S12); /* 14 */
|
||||
FF (c, d, a, b, x[14], S13); /* 15 */
|
||||
FF (b, c, d, a, x[15], S14); /* 16 */
|
||||
|
||||
/* Round 2 */
|
||||
GG (a, b, c, d, x[ 0], S21); /* 17 */
|
||||
GG (d, a, b, c, x[ 4], S22); /* 18 */
|
||||
GG (c, d, a, b, x[ 8], S23); /* 19 */
|
||||
GG (b, c, d, a, x[12], S24); /* 20 */
|
||||
GG (a, b, c, d, x[ 1], S21); /* 21 */
|
||||
GG (d, a, b, c, x[ 5], S22); /* 22 */
|
||||
GG (c, d, a, b, x[ 9], S23); /* 23 */
|
||||
GG (b, c, d, a, x[13], S24); /* 24 */
|
||||
GG (a, b, c, d, x[ 2], S21); /* 25 */
|
||||
GG (d, a, b, c, x[ 6], S22); /* 26 */
|
||||
GG (c, d, a, b, x[10], S23); /* 27 */
|
||||
GG (b, c, d, a, x[14], S24); /* 28 */
|
||||
GG (a, b, c, d, x[ 3], S21); /* 29 */
|
||||
GG (d, a, b, c, x[ 7], S22); /* 30 */
|
||||
GG (c, d, a, b, x[11], S23); /* 31 */
|
||||
GG (b, c, d, a, x[15], S24); /* 32 */
|
||||
|
||||
/* Round 3 */
|
||||
HH (a, b, c, d, x[ 0], S31); /* 33 */
|
||||
HH (d, a, b, c, x[ 8], S32); /* 34 */
|
||||
HH (c, d, a, b, x[ 4], S33); /* 35 */
|
||||
HH (b, c, d, a, x[12], S34); /* 36 */
|
||||
HH (a, b, c, d, x[ 2], S31); /* 37 */
|
||||
HH (d, a, b, c, x[10], S32); /* 38 */
|
||||
HH (c, d, a, b, x[ 6], S33); /* 39 */
|
||||
HH (b, c, d, a, x[14], S34); /* 40 */
|
||||
HH (a, b, c, d, x[ 1], S31); /* 41 */
|
||||
HH (d, a, b, c, x[ 9], S32); /* 42 */
|
||||
HH (c, d, a, b, x[ 5], S33); /* 43 */
|
||||
HH (b, c, d, a, x[13], S34); /* 44 */
|
||||
HH (a, b, c, d, x[ 3], S31); /* 45 */
|
||||
HH (d, a, b, c, x[11], S32); /* 46 */
|
||||
HH (c, d, a, b, x[ 7], S33); /* 47 */
|
||||
HH (b, c, d, a, x[15], S34); /* 48 */
|
||||
|
||||
HH (a, b, c, d, x[ 0], S31); /* 33 */
|
||||
HH (d, a, b, c, x[ 8], S32); /* 34 */
|
||||
HH (c, d, a, b, x[ 4], S33); /* 35 */
|
||||
HH (b, c, d, a, x[12], S34); /* 36 */
|
||||
HH (a, b, c, d, x[ 2], S31); /* 37 */
|
||||
HH (d, a, b, c, x[10], S32); /* 38 */
|
||||
HH (c, d, a, b, x[ 6], S33); /* 39 */
|
||||
HH (b, c, d, a, x[14], S34); /* 40 */
|
||||
HH (a, b, c, d, x[ 1], S31); /* 41 */
|
||||
HH (d, a, b, c, x[ 9], S32); /* 42 */
|
||||
HH (c, d, a, b, x[ 5], S33); /* 43 */
|
||||
HH (b, c, d, a, x[13], S34); /* 44 */
|
||||
HH (a, b, c, d, x[ 3], S31); /* 45 */
|
||||
HH (d, a, b, c, x[11], S32); /* 46 */
|
||||
HH (c, d, a, b, x[ 7], S33); /* 47 */
|
||||
HH (b, c, d, a, x[15], S34); /* 48 */
|
||||
|
||||
|
||||
/* Update our state */
|
||||
md->md4.state[0] = md->md4.state[0] + a;
|
||||
@@ -242,54 +240,55 @@ int md4_done(hash_state * md, unsigned char *out)
|
||||
}
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(md, sizeof(hash_state));
|
||||
#endif
|
||||
#endif
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int md4_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct md4_test_case {
|
||||
char *input;
|
||||
unsigned char digest[16];
|
||||
} cases[] = {
|
||||
{ "",
|
||||
const char *input;
|
||||
unsigned char hash[16];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{0x31, 0xd6, 0xcf, 0xe0, 0xd1, 0x6a, 0xe9, 0x31,
|
||||
0xb7, 0x3c, 0x59, 0xd7, 0xe0, 0xc0, 0x89, 0xc0} },
|
||||
{ "a",
|
||||
{0xbd, 0xe5, 0x2c, 0xb3, 0x1d, 0xe3, 0x3e, 0x46,
|
||||
0x24, 0x5e, 0x05, 0xfb, 0xdb, 0xd6, 0xfb, 0x24} },
|
||||
{ "abc",
|
||||
{0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52,
|
||||
{0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52,
|
||||
0x5f, 0xc1, 0x0a, 0xe8, 0x7a, 0xa6, 0x72, 0x9d} },
|
||||
{ "message digest",
|
||||
{0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8,
|
||||
{ "message digest",
|
||||
{0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8,
|
||||
0x18, 0x87, 0x48, 0x06, 0xe1, 0xc7, 0x01, 0x4b} },
|
||||
{ "abcdefghijklmnopqrstuvwxyz",
|
||||
{0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd,
|
||||
{ "abcdefghijklmnopqrstuvwxyz",
|
||||
{0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd,
|
||||
0xee, 0xa8, 0xed, 0x63, 0xdf, 0x41, 0x2d, 0xa9} },
|
||||
{ "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
|
||||
{0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35,
|
||||
{ "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
|
||||
{0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35,
|
||||
0x1c, 0xe6, 0x27, 0xe1, 0x53, 0xe7, 0xf0, 0xe4} },
|
||||
{ "12345678901234567890123456789012345678901234567890123456789012345678901234567890",
|
||||
{0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19,
|
||||
{ "12345678901234567890123456789012345678901234567890123456789012345678901234567890",
|
||||
{0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19,
|
||||
0x9c, 0x3e, 0x7b, 0x16, 0x4f, 0xcc, 0x05, 0x36} },
|
||||
};
|
||||
int i;
|
||||
hash_state md;
|
||||
unsigned char digest[16];
|
||||
|
||||
for(i = 0; i < (int)(sizeof(cases) / sizeof(cases[0])); i++) {
|
||||
int i;
|
||||
unsigned char tmp[16];
|
||||
hash_state md;
|
||||
|
||||
for(i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
|
||||
md4_init(&md);
|
||||
md4_process(&md, (unsigned char *)cases[i].input, (unsigned long)strlen(cases[i].input));
|
||||
md4_done(&md, digest);
|
||||
if (XMEMCMP(digest, cases[i].digest, 16) != 0) {
|
||||
md4_process(&md, (unsigned char *)tests[i].input, (unsigned long)strlen(tests[i].input));
|
||||
md4_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD4", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
|
||||
@@ -302,6 +301,6 @@ int md4_test(void)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,15 +5,13 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
|
||||
/**
|
||||
@file md5.c
|
||||
LTC_MD5 hash function by Tom St Denis
|
||||
LTC_MD5 hash function by Tom St Denis
|
||||
*/
|
||||
|
||||
#ifdef LTC_MD5
|
||||
@@ -95,7 +93,7 @@ static const ulong32 Korder[64] = {
|
||||
a = (a + I(b,c,d) + M + t); a = ROLc(a, s) + b;
|
||||
|
||||
|
||||
#endif
|
||||
#endif
|
||||
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
static int _md5_compress(hash_state *md, unsigned char *buf)
|
||||
@@ -112,7 +110,7 @@ static int md5_compress(hash_state *md, unsigned char *buf)
|
||||
for (i = 0; i < 16; i++) {
|
||||
LOAD32L(W[i], buf + (4*i));
|
||||
}
|
||||
|
||||
|
||||
/* copy state */
|
||||
a = md->md5.state[0];
|
||||
b = md->md5.state[1];
|
||||
@@ -309,37 +307,37 @@ int md5_done(hash_state * md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int md5_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
const char *msg;
|
||||
unsigned char hash[16];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04,
|
||||
{ 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04,
|
||||
0xe9, 0x80, 0x09, 0x98, 0xec, 0xf8, 0x42, 0x7e } },
|
||||
{ "a",
|
||||
{0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8,
|
||||
{0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8,
|
||||
0x31, 0xc3, 0x99, 0xe2, 0x69, 0x77, 0x26, 0x61 } },
|
||||
{ "abc",
|
||||
{ 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0,
|
||||
{ 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0,
|
||||
0xd6, 0x96, 0x3f, 0x7d, 0x28, 0xe1, 0x7f, 0x72 } },
|
||||
{ "message digest",
|
||||
{ 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d,
|
||||
0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } },
|
||||
{ "message digest",
|
||||
{ 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d,
|
||||
0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } },
|
||||
{ "abcdefghijklmnopqrstuvwxyz",
|
||||
{ 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00,
|
||||
{ 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00,
|
||||
0x7d, 0xfb, 0x49, 0x6c, 0xca, 0x67, 0xe1, 0x3b } },
|
||||
{ "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
|
||||
{ 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5,
|
||||
{ 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5,
|
||||
0xa5, 0x61, 0x1c, 0x2c, 0x9f, 0x41, 0x9d, 0x9f } },
|
||||
{ "12345678901234567890123456789012345678901234567890123456789012345678901234567890",
|
||||
{ 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55,
|
||||
0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } },
|
||||
{ 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55,
|
||||
0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } },
|
||||
{ NULL, { 0 } }
|
||||
};
|
||||
|
||||
@@ -351,7 +349,7 @@ int md5_test(void)
|
||||
md5_init(&md);
|
||||
md5_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
md5_done(&md, tmp);
|
||||
if (XMEMCMP(tmp, tests[i].hash, 16) != 0) {
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD5", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -363,6 +361,6 @@ int md5_test(void)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,15 +5,13 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@param rmd128.c
|
||||
RMD128 Hash function
|
||||
*/
|
||||
*/
|
||||
|
||||
/* Implementation of LTC_RIPEMD-128 based on the source by Antoon Bosselaers, ESAT-COSIC
|
||||
*
|
||||
@@ -42,11 +40,11 @@ const struct ltc_hash_descriptor rmd128_desc =
|
||||
};
|
||||
|
||||
/* the four basic functions F(), G() and H() */
|
||||
#define F(x, y, z) ((x) ^ (y) ^ (z))
|
||||
#define G(x, y, z) (((x) & (y)) | (~(x) & (z)))
|
||||
#define F(x, y, z) ((x) ^ (y) ^ (z))
|
||||
#define G(x, y, z) (((x) & (y)) | (~(x) & (z)))
|
||||
#define H(x, y, z) (((x) | ~(y)) ^ (z))
|
||||
#define I(x, y, z) (((x) & (z)) | ((y) & ~(z)))
|
||||
|
||||
#define I(x, y, z) (((x) & (z)) | ((y) & ~(z)))
|
||||
|
||||
/* the eight basic operations FF() through III() */
|
||||
#define FF(a, b, c, d, x, s) \
|
||||
(a) += F((b), (c), (d)) + (x);\
|
||||
@@ -88,7 +86,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf)
|
||||
{
|
||||
ulong32 aa,bb,cc,dd,aaa,bbb,ccc,ddd,X[16];
|
||||
int i;
|
||||
|
||||
|
||||
/* load words X */
|
||||
for (i = 0; i < 16; i++){
|
||||
LOAD32L(X[i], buf + (4 * i));
|
||||
@@ -117,7 +115,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf)
|
||||
FF(dd, aa, bb, cc, X[13], 7);
|
||||
FF(cc, dd, aa, bb, X[14], 9);
|
||||
FF(bb, cc, dd, aa, X[15], 8);
|
||||
|
||||
|
||||
/* round 2 */
|
||||
GG(aa, bb, cc, dd, X[ 7], 7);
|
||||
GG(dd, aa, bb, cc, X[ 4], 6);
|
||||
@@ -173,7 +171,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf)
|
||||
II(bb, cc, dd, aa, X[ 2], 12);
|
||||
|
||||
/* parallel round 1 */
|
||||
III(aaa, bbb, ccc, ddd, X[ 5], 8);
|
||||
III(aaa, bbb, ccc, ddd, X[ 5], 8);
|
||||
III(ddd, aaa, bbb, ccc, X[14], 9);
|
||||
III(ccc, ddd, aaa, bbb, X[ 7], 9);
|
||||
III(bbb, ccc, ddd, aaa, X[ 0], 11);
|
||||
@@ -208,7 +206,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf)
|
||||
HHH(ccc, ddd, aaa, bbb, X[ 1], 13);
|
||||
HHH(bbb, ccc, ddd, aaa, X[ 2], 11);
|
||||
|
||||
/* parallel round 3 */
|
||||
/* parallel round 3 */
|
||||
GGG(aaa, bbb, ccc, ddd, X[15], 9);
|
||||
GGG(ddd, aaa, bbb, ccc, X[ 5], 7);
|
||||
GGG(ccc, ddd, aaa, bbb, X[ 1], 15);
|
||||
@@ -342,21 +340,21 @@ int rmd128_done(hash_state * md, unsigned char *out)
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(md, sizeof(hash_state));
|
||||
#endif
|
||||
return CRYPT_OK;
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int rmd128_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
unsigned char md[16];
|
||||
const char *msg;
|
||||
unsigned char hash[16];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0xcd, 0xf2, 0x62, 0x13, 0xa1, 0x50, 0xdc, 0x3e,
|
||||
@@ -383,18 +381,16 @@ int rmd128_test(void)
|
||||
0xae, 0xa4, 0x62, 0x4c, 0x60, 0xc5, 0xc7, 0x02 }
|
||||
}
|
||||
};
|
||||
int x;
|
||||
unsigned char buf[16];
|
||||
|
||||
int i;
|
||||
unsigned char tmp[16];
|
||||
hash_state md;
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
|
||||
rmd128_init(&md);
|
||||
rmd128_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg));
|
||||
rmd128_done(&md, buf);
|
||||
if (XMEMCMP(buf, tests[x].md, 16) != 0) {
|
||||
#if 0
|
||||
printf("Failed test %d\n", x);
|
||||
#endif
|
||||
rmd128_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
|
||||
rmd128_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD128", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -405,6 +401,6 @@ int rmd128_test(void)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,15 +5,13 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@file rmd160.c
|
||||
RMD160 hash function
|
||||
*/
|
||||
*/
|
||||
|
||||
/* Implementation of LTC_RIPEMD-160 based on the source by Antoon Bosselaers, ESAT-COSIC
|
||||
*
|
||||
@@ -42,12 +40,12 @@ const struct ltc_hash_descriptor rmd160_desc =
|
||||
};
|
||||
|
||||
/* the five basic functions F(), G() and H() */
|
||||
#define F(x, y, z) ((x) ^ (y) ^ (z))
|
||||
#define G(x, y, z) (((x) & (y)) | (~(x) & (z)))
|
||||
#define F(x, y, z) ((x) ^ (y) ^ (z))
|
||||
#define G(x, y, z) (((x) & (y)) | (~(x) & (z)))
|
||||
#define H(x, y, z) (((x) | ~(y)) ^ (z))
|
||||
#define I(x, y, z) (((x) & (z)) | ((y) & ~(z)))
|
||||
#define I(x, y, z) (((x) & (z)) | ((y) & ~(z)))
|
||||
#define J(x, y, z) ((x) ^ ((y) | ~(z)))
|
||||
|
||||
|
||||
/* the ten basic operations FF() through III() */
|
||||
#define FF(a, b, c, d, e, x, s) \
|
||||
(a) += F((b), (c), (d)) + (x);\
|
||||
@@ -138,7 +136,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf)
|
||||
FF(cc, dd, ee, aa, bb, X[13], 7);
|
||||
FF(bb, cc, dd, ee, aa, X[14], 9);
|
||||
FF(aa, bb, cc, dd, ee, X[15], 8);
|
||||
|
||||
|
||||
/* round 2 */
|
||||
GG(ee, aa, bb, cc, dd, X[ 7], 7);
|
||||
GG(dd, ee, aa, bb, cc, X[ 4], 6);
|
||||
@@ -230,7 +228,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf)
|
||||
JJJ(aaa, bbb, ccc, ddd, eee, X[12], 6);
|
||||
|
||||
/* parallel round 2 */
|
||||
III(eee, aaa, bbb, ccc, ddd, X[ 6], 9);
|
||||
III(eee, aaa, bbb, ccc, ddd, X[ 6], 9);
|
||||
III(ddd, eee, aaa, bbb, ccc, X[11], 13);
|
||||
III(ccc, ddd, eee, aaa, bbb, X[ 3], 15);
|
||||
III(bbb, ccc, ddd, eee, aaa, X[ 7], 7);
|
||||
@@ -265,7 +263,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf)
|
||||
HHH(eee, aaa, bbb, ccc, ddd, X[ 4], 7);
|
||||
HHH(ddd, eee, aaa, bbb, ccc, X[13], 5);
|
||||
|
||||
/* parallel round 4 */
|
||||
/* parallel round 4 */
|
||||
GGG(ccc, ddd, eee, aaa, bbb, X[ 8], 15);
|
||||
GGG(bbb, ccc, ddd, eee, aaa, X[ 6], 5);
|
||||
GGG(aaa, bbb, ccc, ddd, eee, X[ 4], 8);
|
||||
@@ -407,15 +405,15 @@ int rmd160_done(hash_state * md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int rmd160_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
unsigned char md[20];
|
||||
const char *msg;
|
||||
unsigned char hash[20];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x9c, 0x11, 0x85, 0xa5, 0xc5, 0xe9, 0xfc, 0x54, 0x61, 0x28,
|
||||
@@ -442,18 +440,16 @@ int rmd160_test(void)
|
||||
0xa0, 0x6c, 0x27, 0xdc, 0xf4, 0x9a, 0xda, 0x62, 0xeb, 0x2b }
|
||||
}
|
||||
};
|
||||
int x;
|
||||
unsigned char buf[20];
|
||||
|
||||
int i;
|
||||
unsigned char tmp[20];
|
||||
hash_state md;
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
|
||||
rmd160_init(&md);
|
||||
rmd160_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg));
|
||||
rmd160_done(&md, buf);
|
||||
if (XMEMCMP(buf, tests[x].md, 20) != 0) {
|
||||
#if 0
|
||||
printf("Failed test %d\n", x);
|
||||
#endif
|
||||
rmd160_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
|
||||
rmd160_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD160", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -464,6 +460,6 @@ int rmd160_test(void)
|
||||
#endif
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -20,7 +18,7 @@
|
||||
const struct ltc_hash_descriptor rmd256_desc =
|
||||
{
|
||||
"rmd256",
|
||||
8,
|
||||
13,
|
||||
32,
|
||||
64,
|
||||
|
||||
@@ -368,8 +366,8 @@ int rmd256_test(void)
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
unsigned char md[32];
|
||||
const char *msg;
|
||||
unsigned char hash[32];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x02, 0xba, 0x4c, 0x4e, 0x5f, 0x8e, 0xcd, 0x18,
|
||||
@@ -408,18 +406,16 @@ int rmd256_test(void)
|
||||
0xa8, 0x9f, 0x7e, 0xa6, 0xde, 0x77, 0xa0, 0xb8 }
|
||||
}
|
||||
};
|
||||
int x;
|
||||
unsigned char buf[32];
|
||||
|
||||
int i;
|
||||
unsigned char tmp[32];
|
||||
hash_state md;
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
|
||||
rmd256_init(&md);
|
||||
rmd256_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg));
|
||||
rmd256_done(&md, buf);
|
||||
if (XMEMCMP(buf, tests[x].md, 32) != 0) {
|
||||
#if 0
|
||||
printf("Failed test %d\n", x);
|
||||
#endif
|
||||
rmd256_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
|
||||
rmd256_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD256", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -429,3 +425,6 @@ int rmd256_test(void)
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,8 +5,6 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
@@ -20,11 +18,12 @@
|
||||
const struct ltc_hash_descriptor rmd320_desc =
|
||||
{
|
||||
"rmd320",
|
||||
9,
|
||||
14,
|
||||
40,
|
||||
64,
|
||||
|
||||
/* OID */
|
||||
/* OID ... does not exist
|
||||
* http://oid-info.com/get/1.3.36.3.2 */
|
||||
{ 0 },
|
||||
0,
|
||||
|
||||
@@ -432,8 +431,8 @@ int rmd320_test(void)
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
unsigned char md[40];
|
||||
const char *msg;
|
||||
unsigned char hash[40];
|
||||
} tests[] = {
|
||||
{ "",
|
||||
{ 0x22, 0xd6, 0x5d, 0x56, 0x61, 0x53, 0x6c, 0xdc, 0x75, 0xc1,
|
||||
@@ -472,18 +471,16 @@ int rmd320_test(void)
|
||||
0xbc, 0x74, 0x70, 0xa9, 0x69, 0xc9, 0xd0, 0x72, 0xa1, 0xac }
|
||||
}
|
||||
};
|
||||
int x;
|
||||
unsigned char buf[40];
|
||||
|
||||
int i;
|
||||
unsigned char tmp[40];
|
||||
hash_state md;
|
||||
|
||||
for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
|
||||
for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
|
||||
rmd320_init(&md);
|
||||
rmd320_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg));
|
||||
rmd320_done(&md, buf);
|
||||
if (XMEMCMP(buf, tests[x].md, 40) != 0) {
|
||||
#if 0
|
||||
printf("Failed test %d\n", x);
|
||||
#endif
|
||||
rmd320_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg));
|
||||
rmd320_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD320", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -493,3 +490,6 @@ int rmd320_test(void)
|
||||
|
||||
#endif
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,14 +5,12 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@file sha1.c
|
||||
LTC_SHA1 code by Tom St Denis
|
||||
LTC_SHA1 code by Tom St Denis
|
||||
*/
|
||||
|
||||
|
||||
@@ -66,7 +64,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf)
|
||||
|
||||
/* expand it */
|
||||
for (i = 16; i < 80; i++) {
|
||||
W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1);
|
||||
W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1);
|
||||
}
|
||||
|
||||
/* compress */
|
||||
@@ -75,9 +73,9 @@ static int sha1_compress(hash_state *md, unsigned char *buf)
|
||||
#define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30);
|
||||
#define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30);
|
||||
#define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30);
|
||||
|
||||
|
||||
#ifdef LTC_SMALL_CODE
|
||||
|
||||
|
||||
for (i = 0; i < 20; ) {
|
||||
FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t;
|
||||
}
|
||||
@@ -105,7 +103,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf)
|
||||
}
|
||||
|
||||
/* round two */
|
||||
for (; i < 40; ) {
|
||||
for (; i < 40; ) {
|
||||
FF1(a,b,c,d,e,i++);
|
||||
FF1(e,a,b,c,d,i++);
|
||||
FF1(d,e,a,b,c,i++);
|
||||
@@ -114,7 +112,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf)
|
||||
}
|
||||
|
||||
/* round three */
|
||||
for (; i < 60; ) {
|
||||
for (; i < 60; ) {
|
||||
FF2(a,b,c,d,e,i++);
|
||||
FF2(e,a,b,c,d,i++);
|
||||
FF2(d,e,a,b,c,i++);
|
||||
@@ -123,7 +121,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf)
|
||||
}
|
||||
|
||||
/* round four */
|
||||
for (; i < 80; ) {
|
||||
for (; i < 80; ) {
|
||||
FF3(a,b,c,d,e,i++);
|
||||
FF3(e,a,b,c,d,i++);
|
||||
FF3(d,e,a,b,c,i++);
|
||||
@@ -241,14 +239,14 @@ int sha1_done(hash_state * md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int sha1_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
const char *msg;
|
||||
unsigned char hash[20];
|
||||
} tests[] = {
|
||||
{ "abc",
|
||||
@@ -271,7 +269,7 @@ int sha1_test(void)
|
||||
sha1_init(&md);
|
||||
sha1_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
sha1_done(&md, tmp);
|
||||
if (XMEMCMP(tmp, tests[i].hash, 20) != 0) {
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA1", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -283,6 +281,6 @@ int sha1_test(void)
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,14 +5,16 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
/**
|
||||
@param sha224.c
|
||||
LTC_SHA-224 new NIST standard based off of LTC_SHA-256 truncated to 224 bits (Tom St Denis)
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#if defined(LTC_SHA224) && defined(LTC_SHA256)
|
||||
|
||||
const struct ltc_hash_descriptor sha224_desc =
|
||||
{
|
||||
"sha224",
|
||||
@@ -72,21 +74,21 @@ int sha224_done(hash_state * md, unsigned char *out)
|
||||
XMEMCPY(out, buf, 28);
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(buf, sizeof(buf));
|
||||
#endif
|
||||
#endif
|
||||
return err;
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int sha224_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
const char *msg;
|
||||
unsigned char hash[28];
|
||||
} tests[] = {
|
||||
{ "abc",
|
||||
@@ -111,7 +113,7 @@ int sha224_test(void)
|
||||
sha224_init(&md);
|
||||
sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
sha224_done(&md, tmp);
|
||||
if (XMEMCMP(tmp, tests[i].hash, 28) != 0) {
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA224", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -119,7 +121,9 @@ int sha224_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif /* defined(LTC_SHA224) && defined(LTC_SHA256) */
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,17 +5,15 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@file sha256.c
|
||||
LTC_SHA256 by Tom St Denis
|
||||
LTC_SHA256 by Tom St Denis
|
||||
*/
|
||||
|
||||
#ifdef LTC_SHA256
|
||||
#ifdef LTC_SHA256
|
||||
|
||||
const struct ltc_hash_descriptor sha256_desc =
|
||||
{
|
||||
@@ -27,7 +25,7 @@ const struct ltc_hash_descriptor sha256_desc =
|
||||
/* OID */
|
||||
{ 2, 16, 840, 1, 101, 3, 4, 2, 1, },
|
||||
9,
|
||||
|
||||
|
||||
&sha256_init,
|
||||
&sha256_process,
|
||||
&sha256_done,
|
||||
@@ -56,7 +54,7 @@ static const ulong32 K[64] = {
|
||||
|
||||
/* Various logical functions */
|
||||
#define Ch(x,y,z) (z ^ (x & (y ^ z)))
|
||||
#define Maj(x,y,z) (((x | y) & z) | (x & y))
|
||||
#define Maj(x,y,z) (((x | y) & z) | (x & y))
|
||||
#define S(x, n) RORc((x),(n))
|
||||
#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n))
|
||||
#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22))
|
||||
@@ -90,10 +88,10 @@ static int sha256_compress(hash_state * md, unsigned char *buf)
|
||||
/* fill W[16..63] */
|
||||
for (i = 16; i < 64; i++) {
|
||||
W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
|
||||
}
|
||||
}
|
||||
|
||||
/* Compress */
|
||||
#ifdef LTC_SMALL_CODE
|
||||
#ifdef LTC_SMALL_CODE
|
||||
#define RND(a,b,c,d,e,f,g,h,i) \
|
||||
t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \
|
||||
t1 = Sigma0(a) + Maj(a, b, c); \
|
||||
@@ -102,10 +100,10 @@ static int sha256_compress(hash_state * md, unsigned char *buf)
|
||||
|
||||
for (i = 0; i < 64; ++i) {
|
||||
RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i);
|
||||
t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4];
|
||||
t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4];
|
||||
S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t;
|
||||
}
|
||||
#else
|
||||
}
|
||||
#else
|
||||
#define RND(a,b,c,d,e,f,g,h,i,ki) \
|
||||
t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \
|
||||
t1 = Sigma0(a) + Maj(a, b, c); \
|
||||
@@ -177,9 +175,9 @@ static int sha256_compress(hash_state * md, unsigned char *buf)
|
||||
RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7);
|
||||
RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2);
|
||||
|
||||
#undef RND
|
||||
|
||||
#endif
|
||||
#undef RND
|
||||
|
||||
#endif
|
||||
|
||||
/* feedback */
|
||||
for (i = 0; i < 8; i++) {
|
||||
@@ -287,14 +285,14 @@ int sha256_done(hash_state * md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int sha256_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
const char *msg;
|
||||
unsigned char hash[32];
|
||||
} tests[] = {
|
||||
{ "abc",
|
||||
@@ -304,9 +302,9 @@ int sha256_test(void)
|
||||
0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad }
|
||||
},
|
||||
{ "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
|
||||
{ 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8,
|
||||
{ 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8,
|
||||
0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39,
|
||||
0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67,
|
||||
0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67,
|
||||
0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 }
|
||||
},
|
||||
};
|
||||
@@ -319,7 +317,7 @@ int sha256_test(void)
|
||||
sha256_init(&md);
|
||||
sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
sha256_done(&md, tmp);
|
||||
if (XMEMCMP(tmp, tests[i].hash, 32) != 0) {
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA256", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -327,14 +325,10 @@ int sha256_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
#ifdef LTC_SHA224
|
||||
#include "sha224.c"
|
||||
#endif
|
||||
|
||||
#endif
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,14 +5,16 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
/**
|
||||
/**
|
||||
@param sha384.c
|
||||
LTC_SHA384 hash included in sha512.c, Tom St Denis
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#if defined(LTC_SHA384) && defined(LTC_SHA512)
|
||||
|
||||
const struct ltc_hash_descriptor sha384_desc =
|
||||
{
|
||||
"sha384",
|
||||
@@ -81,14 +83,14 @@ int sha384_done(hash_state * md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int sha384_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
const char *msg;
|
||||
unsigned char hash[48];
|
||||
} tests[] = {
|
||||
{ "abc",
|
||||
@@ -117,7 +119,7 @@ int sha384_test(void)
|
||||
sha384_init(&md);
|
||||
sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
sha384_done(&md, tmp);
|
||||
if (XMEMCMP(tmp, tests[i].hash, 48) != 0) {
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA384", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -125,11 +127,8 @@ int sha384_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
@@ -5,14 +5,12 @@
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*
|
||||
* Tom St Denis, tomstdenis@gmail.com, http://libtom.org
|
||||
*/
|
||||
#include "tomcrypt.h"
|
||||
|
||||
/**
|
||||
@param sha512.c
|
||||
LTC_SHA512 by Tom St Denis
|
||||
LTC_SHA512 by Tom St Denis
|
||||
*/
|
||||
|
||||
#ifdef LTC_SHA512
|
||||
@@ -37,51 +35,51 @@ const struct ltc_hash_descriptor sha512_desc =
|
||||
|
||||
/* the K array */
|
||||
static const ulong64 K[80] = {
|
||||
CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd),
|
||||
CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd),
|
||||
CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc),
|
||||
CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019),
|
||||
CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019),
|
||||
CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118),
|
||||
CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe),
|
||||
CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe),
|
||||
CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2),
|
||||
CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1),
|
||||
CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1),
|
||||
CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694),
|
||||
CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3),
|
||||
CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3),
|
||||
CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65),
|
||||
CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483),
|
||||
CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483),
|
||||
CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5),
|
||||
CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210),
|
||||
CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210),
|
||||
CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4),
|
||||
CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725),
|
||||
CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725),
|
||||
CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70),
|
||||
CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926),
|
||||
CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926),
|
||||
CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df),
|
||||
CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8),
|
||||
CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8),
|
||||
CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b),
|
||||
CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001),
|
||||
CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30),
|
||||
CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910),
|
||||
CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910),
|
||||
CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8),
|
||||
CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53),
|
||||
CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53),
|
||||
CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8),
|
||||
CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb),
|
||||
CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb),
|
||||
CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3),
|
||||
CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60),
|
||||
CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60),
|
||||
CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec),
|
||||
CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9),
|
||||
CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9),
|
||||
CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b),
|
||||
CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207),
|
||||
CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207),
|
||||
CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178),
|
||||
CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6),
|
||||
CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6),
|
||||
CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b),
|
||||
CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493),
|
||||
CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493),
|
||||
CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c),
|
||||
CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a),
|
||||
CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a),
|
||||
CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817)
|
||||
};
|
||||
|
||||
/* Various logical functions */
|
||||
#define Ch(x,y,z) (z ^ (x & (y ^ z)))
|
||||
#define Maj(x,y,z) (((x | y) & z) | (x & y))
|
||||
#define Maj(x,y,z) (((x | y) & z) | (x & y))
|
||||
#define S(x, n) ROR64c(x, n)
|
||||
#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n))
|
||||
#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39))
|
||||
@@ -112,7 +110,7 @@ static int sha512_compress(hash_state * md, unsigned char *buf)
|
||||
/* fill W[16..79] */
|
||||
for (i = 16; i < 80; i++) {
|
||||
W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
|
||||
}
|
||||
}
|
||||
|
||||
/* Compress */
|
||||
#ifdef LTC_SMALL_CODE
|
||||
@@ -135,17 +133,17 @@ static int sha512_compress(hash_state * md, unsigned char *buf)
|
||||
d += t0; \
|
||||
h = t0 + t1;
|
||||
|
||||
for (i = 0; i < 80; i += 8) {
|
||||
RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0);
|
||||
RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1);
|
||||
RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2);
|
||||
RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3);
|
||||
RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4);
|
||||
RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5);
|
||||
RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6);
|
||||
RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7);
|
||||
}
|
||||
#endif
|
||||
for (i = 0; i < 80; i += 8) {
|
||||
RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0);
|
||||
RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1);
|
||||
RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2);
|
||||
RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3);
|
||||
RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4);
|
||||
RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5);
|
||||
RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6);
|
||||
RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7);
|
||||
}
|
||||
#endif
|
||||
|
||||
|
||||
/* feedback */
|
||||
@@ -232,7 +230,7 @@ int sha512_done(hash_state * md, unsigned char *out)
|
||||
md->sha512.curlen = 0;
|
||||
}
|
||||
|
||||
/* pad upto 120 bytes of zeroes
|
||||
/* pad upto 120 bytes of zeroes
|
||||
* note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash
|
||||
* > 2^64 bits of data... :-)
|
||||
*/
|
||||
@@ -257,14 +255,14 @@ int sha512_done(hash_state * md, unsigned char *out)
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
*/
|
||||
int sha512_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
#else
|
||||
static const struct {
|
||||
char *msg;
|
||||
const char *msg;
|
||||
unsigned char hash[64];
|
||||
} tests[] = {
|
||||
{ "abc",
|
||||
@@ -297,7 +295,7 @@ int sha512_test(void)
|
||||
sha512_init(&md);
|
||||
sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
sha512_done(&md, tmp);
|
||||
if (XMEMCMP(tmp, tests[i].hash, 64) != 0) {
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
@@ -305,15 +303,11 @@ int sha512_test(void)
|
||||
#endif
|
||||
}
|
||||
|
||||
#ifdef LTC_SHA384
|
||||
#include "sha384.c"
|
||||
#endif
|
||||
|
||||
#endif
|
||||
|
||||
|
||||
|
||||
|
||||
/* $Source$ */
|
||||
/* $Revision$ */
|
||||
/* $Date$ */
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
|
||||
130
libtomcrypt/src/hashes/sha2/sha512_224.c
Normal file
130
libtomcrypt/src/hashes/sha2/sha512_224.c
Normal file
@@ -0,0 +1,130 @@
|
||||
/* LibTomCrypt, modular cryptographic library -- Tom St Denis
|
||||
*
|
||||
* LibTomCrypt is a library that provides various cryptographic
|
||||
* algorithms in a highly modular and flexible manner.
|
||||
*
|
||||
* The library is free for all purposes without any express
|
||||
* guarantee it works.
|
||||
*/
|
||||
/**
|
||||
@param sha512_224.c
|
||||
SHA512/224 hash included in sha512.c
|
||||
*/
|
||||
|
||||
#include "tomcrypt.h"
|
||||
|
||||
#if defined(LTC_SHA512_224) && defined(LTC_SHA512)
|
||||
|
||||
const struct ltc_hash_descriptor sha512_224_desc =
|
||||
{
|
||||
"sha512-224",
|
||||
15,
|
||||
28,
|
||||
128,
|
||||
|
||||
/* OID */
|
||||
{ 2, 16, 840, 1, 101, 3, 4, 2, 5, },
|
||||
9,
|
||||
|
||||
&sha512_224_init,
|
||||
&sha512_process,
|
||||
&sha512_224_done,
|
||||
&sha512_224_test,
|
||||
NULL
|
||||
};
|
||||
|
||||
/**
|
||||
Initialize the hash state
|
||||
@param md The hash state you wish to initialize
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int sha512_224_init(hash_state * md)
|
||||
{
|
||||
LTC_ARGCHK(md != NULL);
|
||||
|
||||
md->sha512.curlen = 0;
|
||||
md->sha512.length = 0;
|
||||
md->sha512.state[0] = CONST64(0x8C3D37C819544DA2);
|
||||
md->sha512.state[1] = CONST64(0x73E1996689DCD4D6);
|
||||
md->sha512.state[2] = CONST64(0x1DFAB7AE32FF9C82);
|
||||
md->sha512.state[3] = CONST64(0x679DD514582F9FCF);
|
||||
md->sha512.state[4] = CONST64(0x0F6D2B697BD44DA8);
|
||||
md->sha512.state[5] = CONST64(0x77E36F7304C48942);
|
||||
md->sha512.state[6] = CONST64(0x3F9D85A86A1D36C8);
|
||||
md->sha512.state[7] = CONST64(0x1112E6AD91D692A1);
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Terminate the hash to get the digest
|
||||
@param md The hash state
|
||||
@param out [out] The destination of the hash (48 bytes)
|
||||
@return CRYPT_OK if successful
|
||||
*/
|
||||
int sha512_224_done(hash_state * md, unsigned char *out)
|
||||
{
|
||||
unsigned char buf[64];
|
||||
|
||||
LTC_ARGCHK(md != NULL);
|
||||
LTC_ARGCHK(out != NULL);
|
||||
|
||||
if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
|
||||
return CRYPT_INVALID_ARG;
|
||||
}
|
||||
|
||||
sha512_done(md, buf);
|
||||
XMEMCPY(out, buf, 28);
|
||||
#ifdef LTC_CLEAN_STACK
|
||||
zeromem(buf, sizeof(buf));
|
||||
#endif
|
||||
return CRYPT_OK;
|
||||
}
|
||||
|
||||
/**
|
||||
Self-test the hash
|
||||
@return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
|
||||
*/
|
||||
int sha512_224_test(void)
|
||||
{
|
||||
#ifndef LTC_TEST
|
||||
return CRYPT_NOP;
|
||||
#else
|
||||
static const struct {
|
||||
const char *msg;
|
||||
unsigned char hash[28];
|
||||
} tests[] = {
|
||||
{ "abc",
|
||||
{ 0x46, 0x34, 0x27, 0x0F, 0x70, 0x7B, 0x6A, 0x54,
|
||||
0xDA, 0xAE, 0x75, 0x30, 0x46, 0x08, 0x42, 0xE2,
|
||||
0x0E, 0x37, 0xED, 0x26, 0x5C, 0xEE, 0xE9, 0xA4,
|
||||
0x3E, 0x89, 0x24, 0xAA }
|
||||
},
|
||||
{ "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
|
||||
{ 0x23, 0xFE, 0xC5, 0xBB, 0x94, 0xD6, 0x0B, 0x23,
|
||||
0x30, 0x81, 0x92, 0x64, 0x0B, 0x0C, 0x45, 0x33,
|
||||
0x35, 0xD6, 0x64, 0x73, 0x4F, 0xE4, 0x0E, 0x72,
|
||||
0x68, 0x67, 0x4A, 0xF9 }
|
||||
},
|
||||
};
|
||||
|
||||
int i;
|
||||
unsigned char tmp[28];
|
||||
hash_state md;
|
||||
|
||||
for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
|
||||
sha512_224_init(&md);
|
||||
sha512_224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
|
||||
sha512_224_done(&md, tmp);
|
||||
if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512-224", i)) {
|
||||
return CRYPT_FAIL_TESTVECTOR;
|
||||
}
|
||||
}
|
||||
return CRYPT_OK;
|
||||
#endif
|
||||
}
|
||||
|
||||
#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */
|
||||
|
||||
/* ref: $Format:%D$ */
|
||||
/* git commit: $Format:%H$ */
|
||||
/* commit time: $Format:%ai$ */
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user